summaryrefslogtreecommitdiff
path: root/lib/scripts/jquery
diff options
context:
space:
mode:
authorKate Arzamastseva <pshns@ukr.net>2011-06-24 11:32:51 +0300
committerKate Arzamastseva <pshns@ukr.net>2011-06-24 11:32:51 +0300
commita2dc299eb0593f35454deb21a2cb5d51a235e80a (patch)
tree5b14bf906bbd13495826ebbe86d3af1c8fd88f71 /lib/scripts/jquery
parent70c3cc9a17d47d8986cba0805d943c1a68af1740 (diff)
parentc949174a2e8c324e3e463a9d10e9e6dc07b0ba9e (diff)
downloadrpg-a2dc299eb0593f35454deb21a2cb5d51a235e80a.tar.gz
rpg-a2dc299eb0593f35454deb21a2cb5d51a235e80a.tar.bz2
Merge branch 'master' of git://github.com/splitbrain/dokuwiki into media-revisions
Diffstat (limited to 'lib/scripts/jquery')
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.pngbin0 -> 180 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.pngbin0 -> 178 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.pngbin0 -> 120 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.pngbin0 -> 105 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.pngbin0 -> 111 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.pngbin0 -> 110 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.pngbin0 -> 119 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.pngbin0 -> 101 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.pngbin0 -> 4369 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.pngbin0 -> 4369 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.pngbin0 -> 4369 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.pngbin0 -> 4369 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.pngbin0 -> 4369 bytes
-rw-r--r--lib/scripts/jquery/jquery-ui-theme/smoothness.css578
-rw-r--r--lib/scripts/jquery/jquery-ui.js11631
-rw-r--r--lib/scripts/jquery/jquery-ui.min.js407
-rw-r--r--lib/scripts/jquery/jquery.js6818
-rw-r--r--lib/scripts/jquery/jquery.min.js150
-rwxr-xr-xlib/scripts/jquery/update.sh25
19 files changed, 17405 insertions, 2204 deletions
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png
new file mode 100644
index 000000000..5b5dab2ab
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png
new file mode 100644
index 000000000..ac8b229af
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png
new file mode 100644
index 000000000..ad3d6346e
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png
new file mode 100644
index 000000000..42ccba269
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png
new file mode 100644
index 000000000..5a46b47cb
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png
new file mode 100644
index 000000000..86c2baa65
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png
new file mode 100644
index 000000000..4443fdc1a
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png
new file mode 100644
index 000000000..7c9fa6c6e
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png
new file mode 100644
index 000000000..b273ff111
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png
new file mode 100644
index 000000000..09d1cdc85
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png
new file mode 100644
index 000000000..59bd45b90
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png
new file mode 100644
index 000000000..6d02426c1
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png
new file mode 100644
index 000000000..2ab019b73
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png
Binary files differ
diff --git a/lib/scripts/jquery/jquery-ui-theme/smoothness.css b/lib/scripts/jquery/jquery-ui-theme/smoothness.css
new file mode 100644
index 000000000..d3fb1c760
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui-theme/smoothness.css
@@ -0,0 +1,578 @@
+/*
+ * jQuery UI CSS Framework 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
+ * jQuery UI Resizable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;
+ /* http://bugs.jqueryui.com/ticket/7233
+ - Resizable: resizable handles fail to work in IE if transparent and content overlaps
+ */
+ background-image:url(data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs=);
+}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.13
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI Datepicker 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file
diff --git a/lib/scripts/jquery/jquery-ui.js b/lib/scripts/jquery/jquery-ui.js
new file mode 100644
index 000000000..0602653f0
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui.js
@@ -0,0 +1,11631 @@
+/*!
+ * jQuery UI 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function( $, undefined ) {
+
+// prevent duplicate loading
+// this is only a problem because we proxy existing functions
+// and we don't want to double proxy them
+$.ui = $.ui || {};
+if ( $.ui.version ) {
+ return;
+}
+
+$.extend( $.ui, {
+ version: "1.8.13",
+
+ keyCode: {
+ ALT: 18,
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ COMMAND: 91,
+ COMMAND_LEFT: 91, // COMMAND
+ COMMAND_RIGHT: 93,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ MENU: 93, // COMMAND_RIGHT
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38,
+ WINDOWS: 91 // COMMAND
+ }
+});
+
+// plugins
+$.fn.extend({
+ _focus: $.fn.focus,
+ focus: function( delay, fn ) {
+ return typeof delay === "number" ?
+ this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $( elem ).focus();
+ if ( fn ) {
+ fn.call( elem );
+ }
+ }, delay );
+ }) :
+ this._focus.apply( this, arguments );
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function( zIndex ) {
+ if ( zIndex !== undefined ) {
+ return this.css( "zIndex", zIndex );
+ }
+
+ if ( this.length ) {
+ var elem = $( this[ 0 ] ), position, value;
+ while ( elem.length && elem[ 0 ] !== document ) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css( "position" );
+ if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt( elem.css( "zIndex" ), 10 );
+ if ( !isNaN( value ) && value !== 0 ) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ },
+
+ disableSelection: function() {
+ return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+ ".ui-disableSelection", function( event ) {
+ event.preventDefault();
+ });
+ },
+
+ enableSelection: function() {
+ return this.unbind( ".ui-disableSelection" );
+ }
+});
+
+$.each( [ "Width", "Height" ], function( i, name ) {
+ var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+ type = name.toLowerCase(),
+ orig = {
+ innerWidth: $.fn.innerWidth,
+ innerHeight: $.fn.innerHeight,
+ outerWidth: $.fn.outerWidth,
+ outerHeight: $.fn.outerHeight
+ };
+
+ function reduce( elem, size, border, margin ) {
+ $.each( side, function() {
+ size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
+ if ( border ) {
+ size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
+ }
+ if ( margin ) {
+ size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
+ }
+ });
+ return size;
+ }
+
+ $.fn[ "inner" + name ] = function( size ) {
+ if ( size === undefined ) {
+ return orig[ "inner" + name ].call( this );
+ }
+
+ return this.each(function() {
+ $( this ).css( type, reduce( this, size ) + "px" );
+ });
+ };
+
+ $.fn[ "outer" + name] = function( size, margin ) {
+ if ( typeof size !== "number" ) {
+ return orig[ "outer" + name ].call( this, size );
+ }
+
+ return this.each(function() {
+ $( this).css( type, reduce( this, size, true, margin ) + "px" );
+ });
+ };
+});
+
+// selectors
+function focusable( element, isTabIndexNotNaN ) {
+ var nodeName = element.nodeName.toLowerCase();
+ if ( "area" === nodeName ) {
+ var map = element.parentNode,
+ mapName = map.name,
+ img;
+ if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+ return false;
+ }
+ img = $( "img[usemap=#" + mapName + "]" )[0];
+ return !!img && visible( img );
+ }
+ return ( /input|select|textarea|button|object/.test( nodeName )
+ ? !element.disabled
+ : "a" == nodeName
+ ? element.href || isTabIndexNotNaN
+ : isTabIndexNotNaN)
+ // the element and all of its ancestors must be visible
+ && visible( element );
+}
+
+function visible( element ) {
+ return !$( element ).parents().andSelf().filter(function() {
+ return $.curCSS( this, "visibility" ) === "hidden" ||
+ $.expr.filters.hidden( this );
+ }).length;
+}
+
+$.extend( $.expr[ ":" ], {
+ data: function( elem, i, match ) {
+ return !!$.data( elem, match[ 3 ] );
+ },
+
+ focusable: function( element ) {
+ return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
+ },
+
+ tabbable: function( element ) {
+ var tabIndex = $.attr( element, "tabindex" ),
+ isTabIndexNaN = isNaN( tabIndex );
+ return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
+ }
+});
+
+// support
+$(function() {
+ var body = document.body,
+ div = body.appendChild( div = document.createElement( "div" ) );
+
+ $.extend( div.style, {
+ minHeight: "100px",
+ height: "auto",
+ padding: 0,
+ borderWidth: 0
+ });
+
+ $.support.minHeight = div.offsetHeight === 100;
+ $.support.selectstart = "onselectstart" in div;
+
+ // set display to none to avoid a layout bug in IE
+ // http://dev.jquery.com/ticket/4014
+ body.removeChild( div ).style.display = "none";
+});
+
+
+
+
+
+// deprecated
+$.extend( $.ui, {
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function( module, option, set ) {
+ var proto = $.ui[ module ].prototype;
+ for ( var i in set ) {
+ proto.plugins[ i ] = proto.plugins[ i ] || [];
+ proto.plugins[ i ].push( [ option, set[ i ] ] );
+ }
+ },
+ call: function( instance, name, args ) {
+ var set = instance.plugins[ name ];
+ if ( !set || !instance.element[ 0 ].parentNode ) {
+ return;
+ }
+
+ for ( var i = 0; i < set.length; i++ ) {
+ if ( instance.options[ set[ i ][ 0 ] ] ) {
+ set[ i ][ 1 ].apply( instance.element, args );
+ }
+ }
+ }
+ },
+
+ // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
+ contains: function( a, b ) {
+ return document.compareDocumentPosition ?
+ a.compareDocumentPosition( b ) & 16 :
+ a !== b && a.contains( b );
+ },
+
+ // only used by resizable
+ hasScroll: function( el, a ) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ( $( el ).css( "overflow" ) === "hidden") {
+ return false;
+ }
+
+ var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+ has = false;
+
+ if ( el[ scroll ] > 0 ) {
+ return true;
+ }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[ scroll ] = 1;
+ has = ( el[ scroll ] > 0 );
+ el[ scroll ] = 0;
+ return has;
+ },
+
+ // these are odd functions, fix the API or move into individual plugins
+ isOverAxis: function( x, reference, size ) {
+ //Determines when x coordinate is over "b" element axis
+ return ( x > reference ) && ( x < ( reference + size ) );
+ },
+ isOver: function( y, x, top, left, height, width ) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
+ }
+});
+
+})( jQuery );
+/*!
+ * jQuery UI Widget 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+ var _cleanData = $.cleanData;
+ $.cleanData = function( elems ) {
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ $( elem ).triggerHandler( "remove" );
+ }
+ _cleanData( elems );
+ };
+} else {
+ var _remove = $.fn.remove;
+ $.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( [ this ] ).each(function() {
+ $( this ).triggerHandler( "remove" );
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+ };
+}
+
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( true, {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
+
+ // prevent calls to internal methods
+ if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name ),
+ methodValue = instance && $.isFunction( instance[options] ) ?
+ instance[ options ].apply( instance, args ) :
+ instance;
+ // TODO: add this back in 1.9 and use $.error() (see #5972)
+// if ( !instance ) {
+// throw "cannot call methods on " + name + " prior to initialization; " +
+// "attempted to call method '" + options + "'";
+// }
+// if ( !$.isFunction( instance[options] ) ) {
+// throw "no such method '" + options + "' for " + name + " widget instance";
+// }
+// var methodValue = instance[ options ].apply( instance, args );
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ instance.option( options || {} )._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+};
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ $.data( element, this.widgetName, this );
+ this.element = $( element );
+ this.options = $.extend( true, {},
+ this.options,
+ this._getCreateOptions(),
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._trigger( "create" );
+ this._init();
+ },
+ _getCreateOptions: function() {
+ return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+ },
+ _create: function() {},
+ _init: function() {},
+
+ destroy: function() {
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ "ui-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, this.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
+ }
+ options = {};
+ options[ key ] = value;
+ }
+
+ this._setOptions( options );
+
+ return this;
+ },
+ _setOptions: function( options ) {
+ var self = this;
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+ });
+
+ return this;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ "ui-state-disabled" )
+ .attr( "aria-disabled", value );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _trigger: function( type, event, data ) {
+ var callback = this.options[ type ];
+
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ data = data || {};
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if ( event.originalEvent ) {
+ for ( var i = $.event.props.length, prop; i; ) {
+ prop = $.event.props[ --i ];
+ event[ prop ] = event.originalEvent[ prop ];
+ }
+ }
+
+ this.element.trigger( event, data );
+
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+})( jQuery );
+/*!
+ * jQuery UI Mouse 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var mouseHandled = false;
+$(document).mousedown(function(e) {
+ mouseHandled = false;
+});
+
+$.widget("ui.mouse", {
+ options: {
+ cancel: ':input,option',
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
+ $.removeData(event.target, self.widgetName + '.preventClickEvent');
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ if(mouseHandled) {return};
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // Click event may never have fired (Gecko & Opera)
+ if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
+ $.removeData(event.target, this.widgetName + '.preventClickEvent');
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ event.preventDefault();
+
+ mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+
+ if (event.target == this._mouseDownEvent.target) {
+ $.data(event.target, this.widgetName + '.preventClickEvent', true);
+ }
+
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Draggable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ },
+ _create: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.positionAbs = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if(this._trigger('drag', event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ //if the original element is removed, don't bother to continue if helper is set to "original"
+ if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original")
+ return false;
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ if(self._trigger("stop", event) !== false) {
+ self._clear();
+ }
+ });
+ } else {
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ _mouseUp: function(event) {
+ if (this.options.iframeFix === true) {
+ $("div.ui-draggable-iframeFix").each(function() {
+ this.parentNode.removeChild(this);
+ }); //Remove frame helpers
+ }
+
+ return $.ui.mouse.prototype._mouseUp.call(this, event);
+ },
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0),
+ right: (parseInt(this.element.css("marginRight"),10) || 0),
+ bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ (o.containment == 'document' ? 0 : $(window).scrollLeft()) - this.offset.relative.left - this.offset.parent.left,
+ (o.containment == 'document' ? 0 : $(window).scrollTop()) - this.offset.relative.top - this.offset.parent.top,
+ (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var c = $(o.containment);
+ var ce = c[0]; if(!ce) return;
+ var co = c.offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
+ (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
+ (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
+ (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
+ ];
+ this.relative_container = c;
+
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+ var containment;
+ if(this.containment) {
+ if (this.relative_container){
+ var co = this.relative_container.offset();
+ containment = [ this.containment[0] + co.left,
+ this.containment[1] + co.top,
+ this.containment[2] + co.left,
+ this.containment[3] + co.top ];
+ }
+ else {
+ containment = this.containment;
+ }
+
+ if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.draggable, {
+ version: "1.8.13"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+ });
+ if (!group.length) { return; }
+
+ var min = parseInt(group[0].style.zIndex) || 0;
+ $(group).each(function(i) {
+ this.style.zIndex = min + i;
+ });
+
+ this[0].style.zIndex = min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Droppable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.droppable", {
+ widgetEventPrefix: "drop",
+ options: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ },
+ _create: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.accept = $.isFunction(accept) ? accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
+
+ (o.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+
+ if(key == 'accept') {
+ this.accept = $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ }
+ $.Widget.prototype._setOption.apply(this, arguments);
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(
+ inst.options.greedy
+ && !inst.options.disabled
+ && inst.options.scope == draggable.options.scope
+ && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+ && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.8.13"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l <= x1 && x2 <= r
+ && t <= y1 && y2 <= b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = dropped || this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ }
+};
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ if (o.disabled) return;
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (o.disabled) return;
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.after(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+ var handle = false;
+ for (var i in this.handles) {
+ if ($(this.handles[i])[0] == event.target) {
+ handle = true;
+ }
+ }
+
+ return !this.options.disabled && handle;
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+});
+
+$.extend($.ui.resizable, {
+ version: "1.8.13"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _store = function (exp) {
+ $(exp).each(function() {
+ var el = $(this);
+ el.data("resizable-alsoresize", {
+ width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+ left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10),
+ position: el.css('position') // to reset Opera on stop()
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function (exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
+ css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
+
+ $.each(css, function (i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ // Opera fixing relative position
+ if ($.browser.opera && /relative/.test(el.css('position'))) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function (event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _reset = function (exp) {
+ $(exp).each(function() {
+ var el = $(this);
+ // reset position for Opera - no need to verify it was changed
+ el.css({ position: el.data("resizable-alsoresize").position });
+ });
+ };
+
+ if (self._revertToRelativePosition) {
+ self._revertToRelativePosition = false;
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function (exp) { _reset(exp); });
+ }else{
+ _reset(o.alsoResize);
+ }
+ }
+
+ $(this).removeData("resizable-alsoresize");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+/*
+ * jQuery UI Selectable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+ options: {
+ appendTo: 'body',
+ autoRefresh: true,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ },
+ _create: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $("<div class='ui-selectable-helper'></div>");
+ },
+
+ destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected');
+ selectee.$element
+ .removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+ .addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+ selectee.unselecting = !doSelect;
+ selectee.selecting = doSelect;
+ selectee.selected = doSelect;
+ // selectable (UN)SELECTING callback
+ if (doSelect) {
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ } else {
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+});
+
+$.extend($.ui.selectable, {
+ version: "1.8.13"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Sortable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+ widgetEventPrefix: "sort",
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are being displayed horizontally
+ this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+
+ return this;
+ },
+
+ _setOption: function(key, value){
+ if ( key === "disabled" ) {
+ this.options[ key ] = value;
+
+ this.widget()
+ [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+ } else {
+ // Don't call widget base _setOption for disable as it adds ui-state-disabled class
+ $.Widget.prototype._setOption.apply(this, arguments);
+ }
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp({ target: null });
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ if (this.placeholder) {
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+ }
+
+ return this;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ if(!str.length && o.key) {
+ str.push(o.key + '=');
+ }
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
+ continue;
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ // never consider a container that's located within the item itself
+ if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ continue;
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ continue;
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else if(this.currentContainer != this.containers[innermostIndex]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ originalPosition: self.originalPosition,
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+});
+
+$.extend($.ui.sortable, {
+ version: "1.8.13"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Effects 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($, undefined) {
+
+$.effects = {};
+
+
+
+/******************************************************************************/
+/****************************** COLOR ANIMATIONS ******************************/
+/******************************************************************************/
+
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+ 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'],
+function(i, attr) {
+ $.fx.step[attr] = function(fx) {
+ if (!fx.colorInit) {
+ fx.start = getColor(fx.elem, attr);
+ fx.end = getRGB(fx.end);
+ fx.colorInit = true;
+ }
+
+ fx.elem.style[attr] = 'rgb(' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+
+var classAnimationActions = ['add', 'remove', 'toggle'],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+function getElementStyles() {
+ var style = document.defaultView
+ ? document.defaultView.getComputedStyle(this, null)
+ : this.currentStyle,
+ newStyle = {},
+ key,
+ camelCase;
+
+ // webkit enumerates style porperties
+ if (style && style.length && style[0] && style[style[0]]) {
+ var len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] == 'string') {
+ camelCase = key.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+ newStyle[camelCase] = style[key];
+ }
+ }
+ } else {
+ for (key in style) {
+ if (typeof style[key] === 'string') {
+ newStyle[key] = style[key];
+ }
+ }
+ }
+
+ return newStyle;
+}
+
+function filterStyles(styles) {
+ var name, value;
+ for (name in styles) {
+ value = styles[name];
+ if (
+ // ignore null and undefined values
+ value == null ||
+ // ignore functions (when does this occur?)
+ $.isFunction(value) ||
+ // shorthand styles that need to be expanded
+ name in shorthandStyles ||
+ // ignore scrollbars (break in IE)
+ (/scrollbar/).test(name) ||
+
+ // only colors or values that can be converted to numbers
+ (!(/color/i).test(name) && isNaN(parseFloat(value)))
+ ) {
+ delete styles[name];
+ }
+ }
+
+ return styles;
+}
+
+function styleDifference(oldStyle, newStyle) {
+ var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
+ name;
+
+ for (name in newStyle) {
+ if (oldStyle[name] != newStyle[name]) {
+ diff[name] = newStyle[name];
+ }
+ }
+
+ return diff;
+}
+
+$.effects.animateClass = function(value, duration, easing, callback) {
+ if ($.isFunction(easing)) {
+ callback = easing;
+ easing = null;
+ }
+
+ return this.queue(function() {
+ var that = $(this),
+ originalStyleAttr = that.attr('style') || ' ',
+ originalStyle = filterStyles(getElementStyles.call(this)),
+ newStyle,
+ className = that.attr('class');
+
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) {
+ that[action + 'Class'](value[action]);
+ }
+ });
+ newStyle = filterStyles(getElementStyles.call(this));
+ that.attr('class', className);
+
+ that.animate(styleDifference(originalStyle, newStyle), {
+ queue: false,
+ duration: duration,
+ easding: easing,
+ complete: function() {
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) { that[action + 'Class'](value[action]); }
+ });
+ // work around bug in IE by clearing the cssText before setting it
+ if (typeof that.attr('style') == 'object') {
+ that.attr('style').cssText = '';
+ that.attr('style').cssText = originalStyleAttr;
+ } else {
+ that.attr('style', originalStyleAttr);
+ }
+ if (callback) { callback.apply(this, arguments); }
+ $.dequeue( this );
+ }
+ });
+ });
+};
+
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function(classNames, force, speed, easing, callback) {
+ if ( typeof force == "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter;
+ return this._toggleClass(classNames, force);
+ } else {
+ return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ }
+ } else {
+ // without switch parameter;
+ return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ }
+ },
+
+ switchClass: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+$.extend($.effects, {
+ version: "1.8.13",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ // if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper')) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ 'float': element.css('float')
+ },
+ wrapper = $('<div></div>')
+ .addClass('ui-effects-wrapper')
+ .css({
+ fontSize: '100%',
+ background: 'transparent',
+ border: 'none',
+ margin: 0,
+ padding: 0
+ });
+
+ element.wrap(wrapper);
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative' });
+ } else {
+ $.extend(props, {
+ position: element.css('position'),
+ zIndex: element.css('z-index')
+ });
+ $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = 'auto';
+ }
+ });
+ element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' });
+ }
+
+ return wrapper.css(props).show();
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ }
+});
+
+
+function _normalizeArguments(effect, options, speed, callback) {
+ // shift params for method overloading
+ if (typeof effect == 'object') {
+ callback = options;
+ speed = null;
+ options = effect;
+ effect = options.effect;
+ }
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+ if (typeof options == 'number' || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+
+ options = options || {};
+
+ speed = speed || options.duration;
+ speed = $.fx.off ? 0 : typeof speed == 'number'
+ ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default;
+
+ callback = callback || options.complete;
+
+ return [effect, options, speed, callback];
+}
+
+function standardSpeed( speed ) {
+ // valid standard speeds
+ if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
+ return true;
+ }
+
+ // invalid strings - treat as "normal" speed
+ if ( typeof speed === "string" && !$.effects[ speed ] ) {
+ return true;
+ }
+
+ return false;
+}
+
+$.fn.extend({
+ effect: function(effect, options, speed, callback) {
+ var args = _normalizeArguments.apply(this, arguments),
+ // TODO: make effects take actual parameters instead of a hash
+ args2 = {
+ options: args[1],
+ duration: args[2],
+ callback: args[3]
+ },
+ mode = args2.options.mode,
+ effectMethod = $.effects[effect];
+
+ if ( $.fx.off || !effectMethod ) {
+ // delegate to the original method (e.g., .show()) if possible
+ if ( mode ) {
+ return this[ mode ]( args2.duration, args2.callback );
+ } else {
+ return this.each(function() {
+ if ( args2.callback ) {
+ args2.callback.call( this );
+ }
+ });
+ }
+ }
+
+ return effectMethod.call(this, args2);
+ },
+
+ _show: $.fn.show,
+ show: function(speed) {
+ if ( standardSpeed( speed ) ) {
+ return this._show.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'show';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ _hide: $.fn.hide,
+ hide: function(speed) {
+ if ( standardSpeed( speed ) ) {
+ return this._hide.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'hide';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // jQuery core overloads toggle and creates _toggle
+ __toggle: $.fn.toggle,
+ toggle: function(speed) {
+ if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
+ return this.__toggle.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'toggle';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
+/*
+ * jQuery UI Effects Blind 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fade 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.fade = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide');
+
+ elem.animate({ opacity: mode }, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.highlight = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ props = ['backgroundImage', 'backgroundColor', 'opacity'],
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ animation = {
+ backgroundColor: elem.css('backgroundColor')
+ };
+
+ if (mode == 'hide') {
+ animation.opacity = 0;
+ }
+
+ $.effects.save(elem, props);
+ elem
+ .show()
+ .css({
+ backgroundImage: 'none',
+ backgroundColor: o.options.color || '#ffff99'
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (mode == 'hide' && elem.hide());
+ $.effects.restore(elem, props);
+ (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.pulsate = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'show');
+ times = ((o.options.times || 5) * 2) - 1;
+ duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
+ isVisible = elem.is(':visible'),
+ animateTo = 0;
+
+ if (!isVisible) {
+ elem.css('opacity', 0).show();
+ animateTo = 1;
+ }
+
+ if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
+ times--;
+ }
+
+ for (var i = 0; i < times; i++) {
+ elem.animate({ opacity: animateTo }, duration, o.options.easing);
+ animateTo = (animateTo + 1) % 2;
+ }
+
+ elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
+ if (animateTo == 0) {
+ elem.hide();
+ }
+ (o.callback && o.callback.apply(this, arguments));
+ });
+
+ elem
+ .queue('fx', function() { elem.dequeue(); })
+ .dequeue();
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.puff = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+ percent = parseInt(o.options.percent, 10) || 150,
+ factor = percent / 100,
+ original = { height: elem.height(), width: elem.width() };
+
+ $.extend(o.options, {
+ fade: true,
+ mode: mode,
+ percent: mode == 'hide' ? percent : 100,
+ from: mode == 'hide'
+ ? original
+ : {
+ height: original.height * factor,
+ width: original.width * factor
+ }
+ });
+
+ elem.effect('scale', o.options, o.duration, o.callback);
+ elem.dequeue();
+ });
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity'];
+ var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if (el.to.opacity === 0) {
+ el.css('opacity', el.from.opacity);
+ }
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','bottom','left','right'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Transfer 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function( $, undefined ) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Accordion 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.accordion", {
+ options: {
+ active: 0,
+ animated: "slide",
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() === location.href.toLowerCase();
+ }
+ },
+
+ _create: function() {
+ var self = this,
+ options = self.options;
+
+ self.running = 0;
+
+ self.element
+ .addClass( "ui-accordion ui-widget ui-helper-reset" )
+ // in lack of child-selectors in CSS
+ // we need to mark top-LIs in a UL-accordion for some IE-fix
+ .children( "li" )
+ .addClass( "ui-accordion-li-fix" );
+
+ self.headers = self.element.find( options.header )
+ .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
+ .bind( "mouseenter.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ })
+ .bind( "mouseleave.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .bind( "focus.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-focus" );
+ })
+ .bind( "blur.accordion", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ self.headers.next()
+ .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
+
+ if ( options.navigation ) {
+ var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
+ if ( current.length ) {
+ var header = current.closest( ".ui-accordion-header" );
+ if ( header.length ) {
+ // anchor within header
+ self.active = header;
+ } else {
+ // anchor within content
+ self.active = current.closest( ".ui-accordion-content" ).prev();
+ }
+ }
+ }
+
+ self.active = self._findActive( self.active || options.active )
+ .addClass( "ui-state-default ui-state-active" )
+ .toggleClass( "ui-corner-all" )
+ .toggleClass( "ui-corner-top" );
+ self.active.next().addClass( "ui-accordion-content-active" );
+
+ self._createIcons();
+ self.resize();
+
+ // ARIA
+ self.element.attr( "role", "tablist" );
+
+ self.headers
+ .attr( "role", "tab" )
+ .bind( "keydown.accordion", function( event ) {
+ return self._keydown( event );
+ })
+ .next()
+ .attr( "role", "tabpanel" );
+
+ self.headers
+ .not( self.active || "" )
+ .attr({
+ "aria-expanded": "false",
+ "aria-selected": "false",
+ tabIndex: -1
+ })
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if ( !self.active.length ) {
+ self.headers.eq( 0 ).attr( "tabIndex", 0 );
+ } else {
+ self.active
+ .attr({
+ "aria-expanded": "true",
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ }
+
+ // only need links in tab order for Safari
+ if ( !$.browser.safari ) {
+ self.headers.find( "a" ).attr( "tabIndex", -1 );
+ }
+
+ if ( options.event ) {
+ self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
+ self._clickHandler.call( self, event, this );
+ event.preventDefault();
+ });
+ }
+ },
+
+ _createIcons: function() {
+ var options = this.options;
+ if ( options.icons ) {
+ $( "<span></span>" )
+ .addClass( "ui-icon " + options.icons.header )
+ .prependTo( this.headers );
+ this.active.children( ".ui-icon" )
+ .toggleClass(options.icons.header)
+ .toggleClass(options.icons.headerSelected);
+ this.element.addClass( "ui-accordion-icons" );
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers.children( ".ui-icon" ).remove();
+ this.element.removeClass( "ui-accordion-icons" );
+ },
+
+ destroy: function() {
+ var options = this.options;
+
+ this.element
+ .removeClass( "ui-accordion ui-widget ui-helper-reset" )
+ .removeAttr( "role" );
+
+ this.headers
+ .unbind( ".accordion" )
+ .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "aria-selected" )
+ .removeAttr( "tabIndex" );
+
+ this.headers.find( "a" ).removeAttr( "tabIndex" );
+ this._destroyIcons();
+ var contents = this.headers.next()
+ .css( "display", "" )
+ .removeAttr( "role" )
+ .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
+ if ( options.autoHeight || options.fillHeight ) {
+ contents.css( "height", "" );
+ }
+
+ return $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ if ( key == "active" ) {
+ this.activate( value );
+ }
+ if ( key == "icons" ) {
+ this._destroyIcons();
+ if ( value ) {
+ this._createIcons();
+ }
+ }
+ // #5332 - opacity doesn't cascade to positioned elements in IE
+ // so we need to add the disabled class to the headers and panels
+ if ( key == "disabled" ) {
+ this.headers.add(this.headers.next())
+ [ value ? "addClass" : "removeClass" ](
+ "ui-accordion-disabled ui-state-disabled" );
+ }
+ },
+
+ _keydown: function( event ) {
+ if ( this.options.disabled || event.altKey || event.ctrlKey ) {
+ return;
+ }
+
+ var keyCode = $.ui.keyCode,
+ length = this.headers.length,
+ currentIndex = this.headers.index( event.target ),
+ toFocus = false;
+
+ switch ( event.keyCode ) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._clickHandler( { target: event.target }, event.target );
+ event.preventDefault();
+ }
+
+ if ( toFocus ) {
+ $( event.target ).attr( "tabIndex", -1 );
+ $( toFocus ).attr( "tabIndex", 0 );
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+ },
+
+ resize: function() {
+ var options = this.options,
+ maxHeight;
+
+ if ( options.fillSpace ) {
+ if ( $.browser.msie ) {
+ var defOverflow = this.element.parent().css( "overflow" );
+ this.element.parent().css( "overflow", "hidden");
+ }
+ maxHeight = this.element.parent().height();
+ if ($.browser.msie) {
+ this.element.parent().css( "overflow", defOverflow );
+ }
+
+ this.headers.each(function() {
+ maxHeight -= $( this ).outerHeight( true );
+ });
+
+ this.headers.next()
+ .each(function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ })
+ .css( "overflow", "auto" );
+ } else if ( options.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next()
+ .each(function() {
+ maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+ })
+ .height( maxHeight );
+ }
+
+ return this;
+ },
+
+ activate: function( index ) {
+ // TODO this gets called on init, changing the option without an explicit call for that
+ this.options.active = index;
+ // call clickHandler with custom event
+ var active = this._findActive( index )[ 0 ];
+ this._clickHandler( { target: active }, active );
+
+ return this;
+ },
+
+ _findActive: function( selector ) {
+ return selector
+ ? typeof selector === "number"
+ ? this.headers.filter( ":eq(" + selector + ")" )
+ : this.headers.not( this.headers.not( selector ) )
+ : selector === false
+ ? $( [] )
+ : this.headers.filter( ":eq(0)" );
+ },
+
+ // TODO isn't event.target enough? why the separate target argument?
+ _clickHandler: function( event, target ) {
+ var options = this.options;
+ if ( options.disabled ) {
+ return;
+ }
+
+ // called only when using activate(false) to close all parts programmatically
+ if ( !event.target ) {
+ if ( !options.collapsible ) {
+ return;
+ }
+ this.active
+ .removeClass( "ui-state-active ui-corner-top" )
+ .addClass( "ui-state-default ui-corner-all" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.headerSelected )
+ .addClass( options.icons.header );
+ this.active.next().addClass( "ui-accordion-content-active" );
+ var toHide = this.active.next(),
+ data = {
+ options: options,
+ newHeader: $( [] ),
+ oldHeader: options.active,
+ newContent: $( [] ),
+ oldContent: toHide
+ },
+ toShow = ( this.active = $( [] ) );
+ this._toggle( toShow, toHide, data );
+ return;
+ }
+
+ // get the click target
+ var clicked = $( event.currentTarget || target ),
+ clickedIsActive = clicked[0] === this.active[0];
+
+ // TODO the option is changed, is that correct?
+ // TODO if it is correct, shouldn't that happen after determining that the click is valid?
+ options.active = options.collapsible && clickedIsActive ?
+ false :
+ this.headers.index( clicked );
+
+ // if animations are still active, or the active header is the target, ignore click
+ if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+ return;
+ }
+
+ // find elements to show and hide
+ var active = this.active,
+ toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: options,
+ newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
+ oldContent: toHide
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ // when the call to ._toggle() comes after the class changes
+ // it causes a very odd bug in IE 8 (see #6720)
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle( toShow, toHide, data, clickedIsActive, down );
+
+ // switch classes
+ active
+ .removeClass( "ui-state-active ui-corner-top" )
+ .addClass( "ui-state-default ui-corner-all" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.headerSelected )
+ .addClass( options.icons.header );
+ if ( !clickedIsActive ) {
+ clicked
+ .removeClass( "ui-state-default ui-corner-all" )
+ .addClass( "ui-state-active ui-corner-top" )
+ .children( ".ui-icon" )
+ .removeClass( options.icons.header )
+ .addClass( options.icons.headerSelected );
+ clicked
+ .next()
+ .addClass( "ui-accordion-content-active" );
+ }
+
+ return;
+ },
+
+ _toggle: function( toShow, toHide, data, clickedIsActive, down ) {
+ var self = this,
+ options = self.options;
+
+ self.toShow = toShow;
+ self.toHide = toHide;
+ self.data = data;
+
+ var complete = function() {
+ if ( !self ) {
+ return;
+ }
+ return self._completed.apply( self, arguments );
+ };
+
+ // trigger changestart event
+ self._trigger( "changestart", null, self.data );
+
+ // count elements to animate
+ self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if ( options.animated ) {
+ var animOptions = {};
+
+ if ( options.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $( [] ),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: options.autoHeight || options.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: options.autoHeight || options.fillSpace
+ };
+ }
+
+ if ( !options.proxied ) {
+ options.proxied = options.animated;
+ }
+
+ if ( !options.proxiedDuration ) {
+ options.proxiedDuration = options.duration;
+ }
+
+ options.animated = $.isFunction( options.proxied ) ?
+ options.proxied( animOptions ) :
+ options.proxied;
+
+ options.duration = $.isFunction( options.proxiedDuration ) ?
+ options.proxiedDuration( animOptions ) :
+ options.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = options.duration,
+ easing = options.animated;
+
+ if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
+ easing = "slide";
+ }
+ if ( !animations[ easing ] ) {
+ animations[ easing ] = function( options ) {
+ this.slide( options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[ easing ]( animOptions );
+ } else {
+ if ( options.collapsible && clickedIsActive ) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete( true );
+ }
+
+ // TODO assert that the blur and focus triggers are really necessary, remove otherwise
+ toHide.prev()
+ .attr({
+ "aria-expanded": "false",
+ "aria-selected": "false",
+ tabIndex: -1
+ })
+ .blur();
+ toShow.prev()
+ .attr({
+ "aria-expanded": "true",
+ "aria-selected": "true",
+ tabIndex: 0
+ })
+ .focus();
+ },
+
+ _completed: function( cancel ) {
+ this.running = cancel ? 0 : --this.running;
+ if ( this.running ) {
+ return;
+ }
+
+ if ( this.options.clearStyle ) {
+ this.toShow.add( this.toHide ).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ // other classes are removed before the animation; this one needs to stay until completed
+ this.toHide.removeClass( "ui-accordion-content-active" );
+ // Work around for rendering bug in IE (#5421)
+ if ( this.toHide.length ) {
+ this.toHide.parent()[0].className = this.toHide.parent()[0].className;
+ }
+
+ this._trigger( "change", null, this.data );
+ }
+});
+
+$.extend( $.ui.accordion, {
+ version: "1.8.13",
+ animations: {
+ slide: function( options, additions ) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions );
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({
+ height: "show",
+ paddingTop: "show",
+ paddingBottom: "show"
+ }, options );
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({
+ height: "hide",
+ paddingTop: "hide",
+ paddingBottom: "hide"
+ }, options );
+ return;
+ }
+ var overflow = options.toShow.css( "overflow" ),
+ percentDone = 0,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt( s.parent().width(), 10 )
+ - parseInt( s.css( "paddingLeft" ), 10 )
+ - parseInt( s.css( "paddingRight" ), 10 )
+ - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 )
+ - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) );
+
+ $.each( fxAttrs, function( i, prop ) {
+ hideProps[ prop ] = "hide";
+
+ var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
+ showProps[ prop ] = {
+ value: parts[ 1 ],
+ unit: parts[ 2 ] || "px"
+ };
+ });
+ options.toShow.css({ height: 0, overflow: "hidden" }).show();
+ options.toHide
+ .filter( ":hidden" )
+ .each( options.complete )
+ .end()
+ .filter( ":visible" )
+ .animate( hideProps, {
+ step: function( now, settings ) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if ( settings.prop == "height" ) {
+ percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+ ( settings.now - settings.start ) / ( settings.end - settings.start );
+ }
+
+ options.toShow[ 0 ].style[ settings.prop ] =
+ ( percentDone * showProps[ settings.prop ].value )
+ + showProps[ settings.prop ].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css( "height", "" );
+ }
+ options.toShow.css({
+ width: originalWidth,
+ overflow: overflow
+ });
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function( options ) {
+ this.slide( options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ }
+ }
+});
+
+})( jQuery );
+/*
+ * jQuery UI Autocomplete 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function( $, undefined ) {
+
+// used to prevent race conditions with remote data sources
+var requestIndex = 0;
+
+$.widget( "ui.autocomplete", {
+ options: {
+ appendTo: "body",
+ autoFocus: false,
+ delay: 300,
+ minLength: 1,
+ position: {
+ my: "left top",
+ at: "left bottom",
+ collision: "none"
+ },
+ source: null
+ },
+
+ pending: 0,
+
+ _create: function() {
+ var self = this,
+ doc = this.element[ 0 ].ownerDocument,
+ suppressKeyPress;
+
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" )
+ // TODO verify these actually work as intended
+ .attr({
+ role: "textbox",
+ "aria-autocomplete": "list",
+ "aria-haspopup": "true"
+ })
+ .bind( "keydown.autocomplete", function( event ) {
+ if ( self.options.disabled || self.element.attr( "readonly" ) ) {
+ return;
+ }
+
+ suppressKeyPress = false;
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ self._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ self._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ self._move( "previous", event );
+ // prevent moving cursor to beginning of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.DOWN:
+ self._move( "next", event );
+ // prevent moving cursor to end of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.ENTER:
+ case keyCode.NUMPAD_ENTER:
+ // when menu is open and has focus
+ if ( self.menu.active ) {
+ // #6055 - Opera still allows the keypress to occur
+ // which causes forms to submit
+ suppressKeyPress = true;
+ event.preventDefault();
+ }
+ //passthrough - ENTER and TAB both select the current element
+ case keyCode.TAB:
+ if ( !self.menu.active ) {
+ return;
+ }
+ self.menu.select( event );
+ break;
+ case keyCode.ESCAPE:
+ self.element.val( self.term );
+ self.close( event );
+ break;
+ default:
+ // keypress is triggered before the input value is changed
+ clearTimeout( self.searching );
+ self.searching = setTimeout(function() {
+ // only search if the value has changed
+ if ( self.term != self.element.val() ) {
+ self.selectedItem = null;
+ self.search( null, event );
+ }
+ }, self.options.delay );
+ break;
+ }
+ })
+ .bind( "keypress.autocomplete", function( event ) {
+ if ( suppressKeyPress ) {
+ suppressKeyPress = false;
+ event.preventDefault();
+ }
+ })
+ .bind( "focus.autocomplete", function() {
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ self.selectedItem = null;
+ self.previous = self.element.val();
+ })
+ .bind( "blur.autocomplete", function( event ) {
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ clearTimeout( self.searching );
+ // clicks on the menu (or a button to trigger a search) will cause a blur event
+ self.closing = setTimeout(function() {
+ self.close( event );
+ self._change( event );
+ }, 150 );
+ });
+ this._initSource();
+ this.response = function() {
+ return self._response.apply( self, arguments );
+ };
+ this.menu = $( "<ul></ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( $( this.options.appendTo || "body", doc )[0] )
+ // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
+ .mousedown(function( event ) {
+ // clicking on the scrollbar causes focus to shift to the body
+ // but we can't detect a mouseup or a click immediately afterward
+ // so we have to track the next mousedown and close the menu if
+ // the user clicks somewhere outside of the autocomplete
+ var menuElement = self.menu.element[ 0 ];
+ if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
+ setTimeout(function() {
+ $( document ).one( 'mousedown', function( event ) {
+ if ( event.target !== self.element[ 0 ] &&
+ event.target !== menuElement &&
+ !$.ui.contains( menuElement, event.target ) ) {
+ self.close();
+ }
+ });
+ }, 1 );
+ }
+
+ // use another timeout to make sure the blur-event-handler on the input was already triggered
+ setTimeout(function() {
+ clearTimeout( self.closing );
+ }, 13);
+ })
+ .menu({
+ focus: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "focus", event, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( /^key/.test(event.originalEvent.type) ) {
+ self.element.val( item.value );
+ }
+ }
+ },
+ selected: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" ),
+ previous = self.previous;
+
+ // only trigger when focus was lost (click on menu)
+ if ( self.element[0] !== doc.activeElement ) {
+ self.element.focus();
+ self.previous = previous;
+ // #6109 - IE triggers two focus events and the second
+ // is asynchronous, so we need to reset the previous
+ // term synchronously and asynchronously :-(
+ setTimeout(function() {
+ self.previous = previous;
+ self.selectedItem = item;
+ }, 1);
+ }
+
+ if ( false !== self._trigger( "select", event, { item: item } ) ) {
+ self.element.val( item.value );
+ }
+ // reset the term after the select event
+ // this allows custom select handling to work properly
+ self.term = self.element.val();
+
+ self.close( event );
+ self.selectedItem = item;
+ },
+ blur: function( event, ui ) {
+ // don't set the value of the text field if it's already correct
+ // this prevents moving the cursor unnecessarily
+ if ( self.menu.element.is(":visible") &&
+ ( self.element.val() !== self.term ) ) {
+ self.element.val( self.term );
+ }
+ }
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .hide()
+ .data( "menu" );
+ if ( $.fn.bgiframe ) {
+ this.menu.element.bgiframe();
+ }
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-autocomplete-input" )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-autocomplete" )
+ .removeAttr( "aria-haspopup" );
+ this.menu.element.remove();
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "source" ) {
+ this._initSource();
+ }
+ if ( key === "appendTo" ) {
+ this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+ }
+ if ( key === "disabled" && value && this.xhr ) {
+ this.xhr.abort();
+ }
+ },
+
+ _initSource: function() {
+ var self = this,
+ array,
+ url;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ response( $.ui.autocomplete.filter(array, request.term) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ if ( self.xhr ) {
+ self.xhr.abort();
+ }
+ self.xhr = $.ajax({
+ url: url,
+ data: request,
+ dataType: "json",
+ autocompleteRequest: ++requestIndex,
+ success: function( data, status ) {
+ if ( this.autocompleteRequest === requestIndex ) {
+ response( data );
+ }
+ },
+ error: function() {
+ if ( this.autocompleteRequest === requestIndex ) {
+ response( [] );
+ }
+ }
+ });
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ search: function( value, event ) {
+ value = value != null ? value : this.element.val();
+
+ // always save the actual value, not the one passed as an argument
+ this.term = this.element.val();
+
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ clearTimeout( this.closing );
+ if ( this._trigger( "search", event ) === false ) {
+ return;
+ }
+
+ return this._search( value );
+ },
+
+ _search: function( value ) {
+ this.pending++;
+ this.element.addClass( "ui-autocomplete-loading" );
+
+ this.source( { term: value }, this.response );
+ },
+
+ _response: function( content ) {
+ if ( !this.options.disabled && content && content.length ) {
+ content = this._normalize( content );
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ this.close();
+ }
+ this.pending--;
+ if ( !this.pending ) {
+ this.element.removeClass( "ui-autocomplete-loading" );
+ }
+ },
+
+ close: function( event ) {
+ clearTimeout( this.closing );
+ if ( this.menu.element.is(":visible") ) {
+ this.menu.element.hide();
+ this.menu.deactivate();
+ this._trigger( "close", event );
+ }
+ },
+
+ _change: function( event ) {
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event, { item: this.selectedItem } );
+ }
+ },
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function(item) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
+ },
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 );
+ this._renderMenu( ul, items );
+ // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+ this.menu.deactivate();
+ this.menu.refresh();
+
+ // size and position menu
+ ul.show();
+ this._resizeMenu();
+ ul.position( $.extend({
+ of: this.element
+ }, this.options.position ));
+
+ if ( this.options.autoFocus ) {
+ this.menu.next( new $.Event("mouseover") );
+ }
+ },
+
+ _resizeMenu: function() {
+ var ul = this.menu.element;
+ ul.outerWidth( Math.max(
+ ul.width( "" ).outerWidth(),
+ this.element.outerWidth()
+ ) );
+ },
+
+ _renderMenu: function( ul, items ) {
+ var self = this;
+ $.each( items, function( index, item ) {
+ self._renderItem( ul, item );
+ });
+ },
+
+ _renderItem: function( ul, item) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( $( "<a></a>" ).text( item.label ) )
+ .appendTo( ul );
+ },
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is(":visible") ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.first() && /^previous/.test(direction) ||
+ this.menu.last() && /^next/.test(direction) ) {
+ this.element.val( this.term );
+ this.menu.deactivate();
+ return;
+ }
+ this.menu[ direction ]( event );
+ },
+
+ widget: function() {
+ return this.menu.element;
+ }
+});
+
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+ },
+ filter: function(array, term) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+ return $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ });
+ }
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ *
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+ _create: function() {
+ var self = this;
+ this.element
+ .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ role: "listbox",
+ "aria-activedescendant": "ui-active-menuitem"
+ })
+ .click(function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+ return;
+ }
+ // temporary
+ event.preventDefault();
+ self.select( event );
+ });
+ this.refresh();
+ },
+
+ refresh: function() {
+ var self = this;
+
+ // don't refresh list items that are already adapted
+ var items = this.element.children("li:not(.ui-menu-item):has(a)")
+ .addClass("ui-menu-item")
+ .attr("role", "menuitem");
+
+ items.children("a")
+ .addClass("ui-corner-all")
+ .attr("tabindex", -1)
+ // mouseenter doesn't work with event delegation
+ .mouseenter(function( event ) {
+ self.activate( event, $(this).parent() );
+ })
+ .mouseleave(function() {
+ self.deactivate();
+ });
+ },
+
+ activate: function( event, item ) {
+ this.deactivate();
+ if (this.hasScroll()) {
+ var offset = item.offset().top - this.element.offset().top,
+ scroll = this.element.scrollTop(),
+ elementHeight = this.element.height();
+ if (offset < 0) {
+ this.element.scrollTop( scroll + offset);
+ } else if (offset >= elementHeight) {
+ this.element.scrollTop( scroll + offset - elementHeight + item.height());
+ }
+ }
+ this.active = item.eq(0)
+ .children("a")
+ .addClass("ui-state-hover")
+ .attr("id", "ui-active-menuitem")
+ .end();
+ this._trigger("focus", event, { item: item });
+ },
+
+ deactivate: function() {
+ if (!this.active) { return; }
+
+ this.active.children("a")
+ .removeClass("ui-state-hover")
+ .removeAttr("id");
+ this._trigger("blur");
+ this.active = null;
+ },
+
+ next: function(event) {
+ this.move("next", ".ui-menu-item:first", event);
+ },
+
+ previous: function(event) {
+ this.move("prev", ".ui-menu-item:last", event);
+ },
+
+ first: function() {
+ return this.active && !this.active.prevAll(".ui-menu-item").length;
+ },
+
+ last: function() {
+ return this.active && !this.active.nextAll(".ui-menu-item").length;
+ },
+
+ move: function(direction, edge, event) {
+ if (!this.active) {
+ this.activate(event, this.element.children(edge));
+ return;
+ }
+ var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+ if (next.length) {
+ this.activate(event, next);
+ } else {
+ this.activate(event, this.element.children(edge));
+ }
+ },
+
+ // TODO merge with previousPage
+ nextPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.last()) {
+ this.activate(event, this.element.children(".ui-menu-item:first"));
+ return;
+ }
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children(".ui-menu-item").filter(function() {
+ var close = $(this).offset().top - base - height + $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(".ui-menu-item:last");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(".ui-menu-item")
+ .filter(!this.active || this.last() ? ":first" : ":last"));
+ }
+ },
+
+ // TODO merge with nextPage
+ previousPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.first()) {
+ this.activate(event, this.element.children(".ui-menu-item:last"));
+ return;
+ }
+
+ var base = this.active.offset().top,
+ height = this.element.height();
+ result = this.element.children(".ui-menu-item").filter(function() {
+ var close = $(this).offset().top - base + height - $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(".ui-menu-item:first");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(".ui-menu-item")
+ .filter(!this.active || this.first() ? ":last" : ":first"));
+ }
+ },
+
+ hasScroll: function() {
+ return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
+ },
+
+ select: function( event ) {
+ this._trigger("selected", event, { item: this.active });
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Button 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var lastActive,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ stateClasses = "ui-state-hover ui-state-active ",
+ typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+ formResetHandler = function( event ) {
+ $( ":ui-button", event.target.form ).each(function() {
+ var inst = $( this ).data( "button" );
+ setTimeout(function() {
+ inst.refresh();
+ }, 1 );
+ });
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+$.widget( "ui.button", {
+ options: {
+ disabled: null,
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset.button" )
+ .bind( "reset.button", formResetHandler );
+
+ if ( typeof this.options.disabled !== "boolean" ) {
+ this.options.disabled = this.element.attr( "disabled" );
+ }
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
+
+ var self = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ focusClass = "ui-state-focus";
+
+ if ( options.label === null ) {
+ options.label = this.buttonElement.html();
+ }
+
+ if ( this.element.is( ":disabled" ) ) {
+ options.disabled = true;
+ }
+
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( hoverClass );
+ })
+ .bind( "focus.button", function() {
+ // no need to check disabled, focus won't be triggered anyway
+ $( this ).addClass( focusClass );
+ })
+ .bind( "blur.button", function() {
+ $( this ).removeClass( focusClass );
+ })
+ .bind( "click.button", function( event ) {
+ if ( options.disabled ) {
+ event.stopImmediatePropagation();
+ }
+ });
+
+ if ( toggleButton ) {
+ this.element.bind( "change.button", function() {
+ self.refresh();
+ });
+ }
+
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).toggleClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", true );
+
+ var radio = self.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ $( document ).one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown.button", function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "keyup.button", function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
+
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
+
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ },
+
+ _determineButtonType: function() {
+
+ if ( this.element.is(":checkbox") ) {
+ this.type = "checkbox";
+ } else if ( this.element.is(":radio") ) {
+ this.type = "radio";
+ } else if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ var ancestor = this.element.parents().filter(":last"),
+ labelSelector = "label[for=" + this.element.attr("id") + "]";
+ this.buttonElement = ancestor.find( labelSelector );
+ if ( !this.buttonElement.length ) {
+ ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+ this.buttonElement = ancestor.filter( labelSelector );
+ if ( !this.buttonElement.length ) {
+ this.buttonElement = ancestor.find( labelSelector );
+ }
+ }
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ var checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.attr( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function() {
+ return this.buttonElement;
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
+
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
+
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.attr( "disabled", true );
+ } else {
+ this.element.removeAttr( "disabled" );
+ }
+ }
+ this._resetButton();
+ },
+
+ refresh: function() {
+ var isDisabled = this.element.is( ":disabled" );
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ }
+ },
+
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement.removeClass( typeClasses ),
+ buttonText = $( "<span></span>" )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary,
+ buttonClasses = [];
+
+ if ( icons.primary || icons.secondary ) {
+ if ( this.options.text ) {
+ buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
+ }
+
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+
+ if ( !this.options.text ) {
+ buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", buttonText );
+ }
+ }
+ } else {
+ buttonClasses.push( "ui-button-text-only" );
+ }
+ buttonElement.addClass( buttonClasses.join( " " ) );
+ }
+});
+
+$.widget( "ui.buttonset", {
+ options: {
+ items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
+ },
+
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ },
+
+ _init: function() {
+ this.refresh();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ refresh: function() {
+ this.buttons = this.element.find( this.options.items )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( "ui-corner-left" )
+ .end()
+ .filter( ":last" )
+ .addClass( "ui-corner-right" )
+ .end()
+ .end();
+ },
+
+ destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" );
+
+ $.Widget.prototype.destroy.call( this );
+ }
+});
+
+}( jQuery ) );
+/*
+ * jQuery UI Datepicker 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+(function( $, undefined ) {
+
+$.extend($.ui, { datepicker: { version: "1.8.13" } });
+
+var PROP_NAME = 'datepicker';
+var dpuuid = new Date().getTime();
+var instActive;
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ weekHeader: 'Wk', // Column header for week of the year
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: '' // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'fadeIn', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: 'c-10:c+10', // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'fast', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false // True to size the input for the date format, false to leave as is
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'));
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id) {
+ this.uuid += 1;
+ target.id = 'dp' + this.uuid;
+ }
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append)
+ inst.append.remove();
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus', this._showDatepicker);
+ if (inst.trigger)
+ inst.trigger.remove();
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(input[0]);
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, 'autoSize') && !inst.inline) {
+ var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+ var dateFormat = this._get(inst, 'dateFormat');
+ if (dateFormat.match(/[DM]/)) {
+ var findMax = function(names) {
+ var max = 0;
+ var maxI = 0;
+ for (var i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ 'monthNames' : 'monthNamesShort'))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
+ }
+ inst.input.attr('size', this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ inst.dpDiv.show();
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param date string or Date - the initial date to display
+ @param onSelect function - the function to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ this.uuid += 1;
+ var id = 'dp' + this.uuid;
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = document.documentElement.clientWidth;
+ var browserHeight = document.documentElement.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress).
+ unbind('keyup', this._doKeyUp);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ removeAttr("disabled");
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
+ attr("disabled", "disabled");
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker();
+ }
+ var date = this._getDateDatepicker(target, true);
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ extendRemove(inst.settings, settings);
+ // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+ if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined)
+ inst.settings.minDate = this._formatDate(inst, minDate);
+ if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined)
+ inst.settings.maxDate = this._formatDate(inst, maxDate);
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDate(inst, date);
+ this._updateAlternate(inst);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @param noDefault boolean - true if no default date is to be used
+ @return Date - the current date */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst, noDefault);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' +
+ $.datepicker._currentClass + ')', inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker();
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if (inst.input.val() != inst.lastVal) {
+ try {
+ var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (event) {
+ $.datepicker.log(event);
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst != inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ }
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ //to avoid flashes on Firefox
+ inst.dpDiv.empty();
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim');
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
+ if( !! cover.length ){
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ cover.css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+ }
+ };
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ $.datepicker._datepickerShowing = true;
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ if (!showAnim || !duration)
+ postProcess();
+ if (inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var self = this;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ instActive = inst; // for delegate hover events
+ inst.dpDiv.empty().append(this._generateHTML(inst));
+ var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
+ if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6
+ cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+ }
+ inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ if (cols > 1)
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ // #6694 - don't focus the input if it's already focused
+ // this breaks the change event in IE
+ inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement)
+ inst.input.focus();
+ // deffered render of the years select (to avoid flashes on Firefox)
+ if( inst.yearshtml ){
+ var origyearshtml = inst.yearshtml;
+ setTimeout(function(){
+ //assure that inst.yearshtml didn't change.
+ if( origyearshtml === inst.yearshtml && inst.yearshtml ){
+ inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml);
+ }
+ origyearshtml = inst.yearshtml = null;
+ }, 0);
+ }
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker */
+ _hideDatepicker: function(input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (this._datepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ if (!showAnim)
+ postProcess();
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if ($target[0].id != $.datepicker._mainDivId &&
+ $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker();
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear) {
+ setTimeout(function() {
+ inst.input.focus();
+ }, 0);
+ }
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input.focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getTime());
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+ var time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ var isDoubled = lookAhead(match);
+ var size = (match == '@' ? 14 : (match == '!' ? 20 :
+ (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2))));
+ var digits = new RegExp('^\\d{1,' + size + '}');
+ var num = value.substring(iValue).match(digits);
+ if (!num)
+ throw 'Missing number at position ' + iValue;
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
+ return [ [k, v] ];
+ }).sort(function (a, b) {
+ return -(a[1].length - b[1].length);
+ });
+ var index = -1;
+ $.each(names, function (i, pair) {
+ var name = pair[1];
+ if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) {
+ index = pair[0];
+ iValue += name.length;
+ return false;
+ }
+ });
+ if (index != -1)
+ return index + 1;
+ else
+ throw 'Unknown name at position ' + iValue;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case '!':
+ var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/00
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TICKS: '!',
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ ! - Windows ticks (100ns since 01/01/0001)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ output += formatNumber('o',
+ (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case '!':
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() == inst.lastVal) {
+ return;
+ }
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.lastVal = inst.input ? inst.input.val() : null;
+ var date, defaultDate;
+ date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ dates = (noDefault ? '' : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
+ newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate);
+ if (newDate) {
+ newDate.setHours(0);
+ newDate.setMinutes(0);
+ newDate.setSeconds(0);
+ newDate.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(newDate);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !date;
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+ inst.selectedDay = inst.currentDay = newDate.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+ if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var showWeek = this._get(inst, 'showWeek');
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group';
+ if (numMonths[1] > 1)
+ switch (col) {
+ case 0: calender += ' ui-datepicker-group-first';
+ cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += ' ui-datepicker-group-last';
+ cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+ this._get(inst, 'calculateWeek')(printDate) + '</td>');
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
+ inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+ (otherMonth && !showOtherMonths ? '&#xa0;' : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+ (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? '&#xa0;' : '');
+ // year selection
+ if ( !inst.yearshtml ) {
+ inst.yearshtml = '';
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var thisYear = new Date().getFullYear();
+ var determineYear = function(value) {
+ var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ var year = determineYear(years[0]);
+ var endYear = Math.max(year, determineYear(years[1] || ''));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ inst.yearshtml += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ inst.yearshtml += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ inst.yearshtml += '</select>';
+
+ html += inst.yearshtml;
+ inst.yearshtml = null;
+ }
+ }
+ html += this._get(inst, 'yearSuffix');
+ if (showMonthAfterYear)
+ html += (secondary || !(changeMonth && changeYear) ? '&#xa0;' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._restrictMinMax(inst,
+ this._daylightSavingAdjust(new Date(year, month, day)));
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var newDate = (minDate && date < minDate ? minDate : date);
+ newDate = (maxDate && newDate > maxDate ? maxDate : newDate);
+ return newDate;
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+function bindHover(dpDiv) {
+ var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a';
+ return dpDiv.delegate(selector, 'mouseout', function() {
+ $(this).removeClass('ui-state-hover');
+ if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if (this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .delegate(selector, 'mouseover', function(){
+ if (!$.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if (this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ });
+}
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Verify an empty collection wasn't passed - Fixes #6976 */
+ if ( !this.length ) {
+ return this;
+ }
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.8.13";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window['DP_jQuery_' + dpuuid] = $;
+
+})(jQuery);
+/*
+ * jQuery UI Dialog 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function( $, undefined ) {
+
+var uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ',
+ sizeRelatedOptions = {
+ buttons: true,
+ height: true,
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true,
+ width: true
+ },
+ resizableRelatedOptions = {
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true
+ },
+ // support for jQuery 1.3.2 - handle common attrFn methods for dialog
+ attrFn = $.attrFn || {
+ val: true,
+ css: true,
+ html: true,
+ text: true,
+ data: true,
+ width: true,
+ height: true,
+ offset: true,
+ click: true
+ };
+
+$.widget("ui.dialog", {
+ options: {
+ autoOpen: true,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: {
+ my: 'center',
+ at: 'center',
+ collision: 'fit',
+ // ensure that the titlebar is never outside the document
+ using: function(pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css('top', pos.top - topOffset);
+ }
+ }
+ },
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ _create: function() {
+ this.originalTitle = this.element.attr('title');
+ // #5742 - .attr() might return a DOMElement
+ if ( typeof this.originalTitle !== "string" ) {
+ this.originalTitle = "";
+ }
+
+ this.options.title = this.options.title || this.originalTitle;
+ var self = this,
+ options = self.options,
+
+ title = options.title || '&#160;',
+ titleId = $.ui.dialog.getTitleId(self.element),
+
+ uiDialog = (self.uiDialog = $('<div></div>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ if (options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ self.close(event);
+ event.preventDefault();
+ }
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = self.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"></a>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span></span>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+ options.beforeClose = options.beforeclose;
+ }
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ if (options.draggable && $.fn.draggable) {
+ self._makeDraggable();
+ }
+ if (options.resizable && $.fn.resizable) {
+ self._makeResizable();
+ }
+
+ self._createButtons(options.buttons);
+ self._isOpen = false;
+
+ if ($.fn.bgiframe) {
+ uiDialog.bgiframe();
+ }
+ },
+
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ destroy: function() {
+ var self = this;
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.hide();
+ self.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ self.uiDialog.remove();
+
+ if (self.originalTitle) {
+ self.element.attr('title', self.originalTitle);
+ }
+
+ return self;
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ close: function(event) {
+ var self = this,
+ maxZ, thisZ;
+
+ if (false === self._trigger('beforeClose', event)) {
+ return;
+ }
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ self._isOpen = false;
+
+ if (self.options.hide) {
+ self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ });
+ } else {
+ self.uiDialog.hide();
+ self._trigger('close', event);
+ }
+
+ $.ui.dialog.overlay.resize();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this !== self.uiDialog[0]) {
+ thisZ = $(this).css('z-index');
+ if(!isNaN(thisZ)) {
+ maxZ = Math.max(maxZ, thisZ);
+ }
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
+
+ return self;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+ var self = this,
+ options = self.options,
+ saveScroll;
+
+ if ((options.modal && !force) ||
+ (!options.stack && !options.modal)) {
+ return self._trigger('focus', event);
+ }
+
+ if (options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = options.zIndex;
+ }
+ if (self.overlay) {
+ $.ui.dialog.maxZ += 1;
+ self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+ }
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+ $.ui.dialog.maxZ += 1;
+ self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+ self.element.attr(saveScroll);
+ self._trigger('focus', event);
+
+ return self;
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var self = this,
+ options = self.options,
+ uiDialog = self.uiDialog;
+
+ self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+ self._size();
+ self._position(options.position);
+ uiDialog.show(options.show);
+ self.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ if (options.modal) {
+ uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode !== $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first'),
+ last = tabbables.filter(':last');
+
+ if (event.target === last[0] && !event.shiftKey) {
+ first.focus(1);
+ return false;
+ } else if (event.target === first[0] && event.shiftKey) {
+ last.focus(1);
+ return false;
+ }
+ });
+ }
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $(self.element.find(':tabbable').get().concat(
+ uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
+ uiDialog.get()))).eq(0).focus();
+
+ self._isOpen = true;
+ self._trigger('open');
+
+ return self;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ ),
+ uiButtonSet = $( "<div></div>" )
+ .addClass( "ui-dialog-buttonset" )
+ .appendTo( uiDialogButtonPane );
+
+ // if we already have a button pane, remove it
+ self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ if (typeof buttons === 'object' && buttons !== null) {
+ $.each(buttons, function() {
+ return !(hasButtons = true);
+ });
+ }
+ if (hasButtons) {
+ $.each(buttons, function(name, props) {
+ props = $.isFunction( props ) ?
+ { click: props, text: name } :
+ props;
+ var button = $('<button type="button"></button>')
+ .click(function() {
+ props.click.apply(self.element[0], arguments);
+ })
+ .appendTo(uiButtonSet);
+ // can't use .attr( props, true ) with jQuery 1.3.2.
+ $.each( props, function( key, value ) {
+ if ( key === "click" ) {
+ return;
+ }
+ if ( key in attrFn ) {
+ button[ key ]( value );
+ } else {
+ button.attr( key, value );
+ }
+ });
+ if ($.fn.button) {
+ button.button();
+ }
+ });
+ uiDialogButtonPane.appendTo(self.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = self.options,
+ doc = $(document),
+ heightBeforeDrag;
+
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ self.uiDialog.draggable({
+ cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function(event, ui) {
+ heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ self._trigger('dragStart', event, filteredUi(ui));
+ },
+ drag: function(event, ui) {
+ self._trigger('drag', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ options.position = [ui.position.left - doc.scrollLeft(),
+ ui.position.top - doc.scrollTop()];
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ self._trigger('dragStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = self.options,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = self.uiDialog.css('position'),
+ resizeHandles = (typeof handles === 'string' ?
+ handles :
+ 'n,e,s,w,se,sw,ne,nw'
+ );
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ self.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ containment: 'document',
+ alsoResize: self.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: self._minHeight(),
+ handles: resizeHandles,
+ start: function(event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ self._trigger('resizeStart', event, filteredUi(ui));
+ },
+ resize: function(event, ui) {
+ self._trigger('resize', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ self._trigger('resizeStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .css('position', position)
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ if (options.height === 'auto') {
+ return options.minHeight;
+ } else {
+ return Math.min(options.minHeight, options.height);
+ }
+ },
+
+ _position: function(position) {
+ var myAt = [],
+ offset = [0, 0],
+ isVisible;
+
+ if (position) {
+ // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+ // if (typeof position == 'string' || $.isArray(position)) {
+ // myAt = $.isArray(position) ? position : position.split(' ');
+
+ if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+ myAt = position.split ? position.split(' ') : [position[0], position[1]];
+ if (myAt.length === 1) {
+ myAt[1] = myAt[0];
+ }
+
+ $.each(['left', 'top'], function(i, offsetPosition) {
+ if (+myAt[i] === myAt[i]) {
+ offset[i] = myAt[i];
+ myAt[i] = offsetPosition;
+ }
+ });
+
+ position = {
+ my: myAt.join(" "),
+ at: myAt.join(" "),
+ offset: offset.join(" ")
+ };
+ }
+
+ position = $.extend({}, $.ui.dialog.prototype.options.position, position);
+ } else {
+ position = $.ui.dialog.prototype.options.position;
+ }
+
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(':visible');
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .position($.extend({ of: window }, position));
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOptions: function( options ) {
+ var self = this,
+ resizableOptions = {},
+ resize = false;
+
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+
+ if ( key in sizeRelatedOptions ) {
+ resize = true;
+ }
+ if ( key in resizableRelatedOptions ) {
+ resizableOptions[ key ] = value;
+ }
+ });
+
+ if ( resize ) {
+ this._size();
+ }
+ if ( this.uiDialog.is( ":data(resizable)" ) ) {
+ this.uiDialog.resizable( "option", resizableOptions );
+ }
+ },
+
+ _setOption: function(key, value){
+ var self = this,
+ uiDialog = self.uiDialog;
+
+ switch (key) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ case "beforeclose":
+ key = "beforeClose";
+ break;
+ case "buttons":
+ self._createButtons(value);
+ break;
+ case "closeText":
+ // ensure that we always pass a string
+ self.uiDialogTitlebarCloseText.text("" + value);
+ break;
+ case "dialogClass":
+ uiDialog
+ .removeClass(self.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "disabled":
+ if (value) {
+ uiDialog.addClass('ui-dialog-disabled');
+ } else {
+ uiDialog.removeClass('ui-dialog-disabled');
+ }
+ break;
+ case "draggable":
+ var isDraggable = uiDialog.is( ":data(draggable)" );
+ if ( isDraggable && !value ) {
+ uiDialog.draggable( "destroy" );
+ }
+
+ if ( !isDraggable && value ) {
+ self._makeDraggable();
+ }
+ break;
+ case "position":
+ self._position(value);
+ break;
+ case "resizable":
+ // currently resizable, becoming non-resizable
+ var isResizable = uiDialog.is( ":data(resizable)" );
+ if (isResizable && !value) {
+ uiDialog.resizable('destroy');
+ }
+
+ // currently resizable, changing handles
+ if (isResizable && typeof value === 'string') {
+ uiDialog.resizable('option', 'handles', value);
+ }
+
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ self._makeResizable(value);
+ }
+ break;
+ case "title":
+ // convert whatever was passed in o a string, for html() to not throw up
+ $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || '&#160;'));
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply(self, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options,
+ nonContentHeight,
+ minContentHeight,
+ isVisible = this.uiDialog.is( ":visible" );
+
+ // reset content sizing
+ this.element.show().css({
+ width: 'auto',
+ minHeight: 0,
+ height: 0
+ });
+
+ if (options.minWidth > options.width) {
+ options.width = options.minWidth;
+ }
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+ minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+
+ if ( options.height === "auto" ) {
+ // only needed for IE6 support
+ if ( $.support.minHeight ) {
+ this.element.css({
+ minHeight: minContentHeight,
+ height: "auto"
+ });
+ } else {
+ this.uiDialog.show();
+ var autoHeight = this.element.css( "height", "auto" ).height();
+ if ( !isVisible ) {
+ this.uiDialog.hide();
+ }
+ this.element.height( Math.max( autoHeight, minContentHeight ) );
+ }
+ } else {
+ this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+ }
+
+ if (this.uiDialog.is(':data(resizable)')) {
+ this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ }
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.8.13",
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ var id = $el.attr('id');
+ if (!id) {
+ this.uuid += 1;
+ id = this.uuid;
+ }
+ return 'ui-dialog-title-' + id;
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ // reuse old instances due to IE memory leak with alpha transparency (see #5185)
+ oldInstances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ // stop events if the z-index of the target is < the z-index of the overlay
+ // we cannot return true when we don't want to cancel the event (#3523)
+ if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
+ return false;
+ }
+ });
+ }
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ if (dialog.options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ dialog.close(event);
+ event.preventDefault();
+ }
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+ .appendTo(document.body)
+ .css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ if ($.fn.bgiframe) {
+ $el.bgiframe();
+ }
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ var indexOf = $.inArray($el, this.instances);
+ if (indexOf != -1){
+ this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+ }
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
+
+ height: function() {
+ var scrollHeight,
+ offsetHeight;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ var scrollWidth,
+ offsetWidth;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Position 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $, undefined ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+ verticalPositions = /top|center|bottom/,
+ center = "center",
+ _position = $.fn.position,
+ _offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var target = $( options.of ),
+ targetElem = target[0],
+ collision = ( options.collision || "flip" ).split( " " ),
+ offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+ targetWidth,
+ targetHeight,
+ basePosition;
+
+ if ( targetElem.nodeType === 9 ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: 0, left: 0 };
+ // TODO: use $.isWindow() in 1.9
+ } else if ( targetElem.setTimeout ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ } else if ( targetElem.preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ targetWidth = targetHeight = 0;
+ basePosition = { top: options.of.pageY, left: options.of.pageX };
+ } else {
+ targetWidth = target.outerWidth();
+ targetHeight = target.outerHeight();
+ basePosition = target.offset();
+ }
+
+ // force my and at to have valid horizontal and veritcal positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[this] || "" ).split( " " );
+ if ( pos.length === 1) {
+ pos = horizontalPositions.test( pos[0] ) ?
+ pos.concat( [center] ) :
+ verticalPositions.test( pos[0] ) ?
+ [ center ].concat( pos ) :
+ [ center, center ];
+ }
+ pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
+ pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
+ options[ this ] = pos;
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ // normalize offset option
+ offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+ if ( options.at[0] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if ( options.at[0] === center ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[1] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[1] === center ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ basePosition.left += offset[ 0 ];
+ basePosition.top += offset[ 1 ];
+
+ return this.each(function() {
+ var elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
+ marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
+ collisionWidth = elemWidth + marginLeft +
+ ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
+ collisionHeight = elemHeight + marginTop +
+ ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+ position = $.extend( {}, basePosition ),
+ collisionPosition;
+
+ if ( options.my[0] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[0] === center ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[1] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[1] === center ) {
+ position.top -= elemHeight / 2;
+ }
+
+ // prevent fractions (see #5280)
+ position.left = Math.round( position.left );
+ position.top = Math.round( position.top );
+
+ collisionPosition = {
+ left: position.left - marginLeft,
+ top: position.top - marginTop
+ };
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[i] ] ) {
+ $.ui.position[ collision[i] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ collisionPosition: collisionPosition,
+ collisionWidth: collisionWidth,
+ collisionHeight: collisionHeight,
+ offset: offset,
+ my: options.my,
+ at: options.at
+ });
+ }
+ });
+
+ if ( $.fn.bgiframe ) {
+ elem.bgiframe();
+ }
+ elem.offset( $.extend( position, { using: options.using } ) );
+ });
+};
+
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var win = $( window ),
+ over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
+ position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+ },
+ top: function( position, data ) {
+ var win = $( window ),
+ over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
+ position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+ }
+ },
+
+ flip: {
+ left: function( position, data ) {
+ if ( data.at[0] === center ) {
+ return;
+ }
+ var win = $( window ),
+ over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ atOffset = data.at[ 0 ] === "left" ?
+ data.targetWidth :
+ -data.targetWidth,
+ offset = -2 * data.offset[ 0 ];
+ position.left += data.collisionPosition.left < 0 ?
+ myOffset + atOffset + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ },
+ top: function( position, data ) {
+ if ( data.at[1] === center ) {
+ return;
+ }
+ var win = $( window ),
+ over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
+ myOffset = data.my[ 1 ] === "top" ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ -data.targetHeight,
+ offset = -2 * data.offset[ 1 ];
+ position.top += data.collisionPosition.top < 0 ?
+ myOffset + atOffset + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ }
+ }
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+ $.offset.setOffset = function( elem, options ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = $( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
+ props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( 'using' in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ };
+
+ $.fn.offset = function( options ) {
+ var elem = this[ 0 ];
+ if ( !elem || !elem.ownerDocument ) { return null; }
+ if ( options ) {
+ return this.each(function() {
+ $.offset.setOffset( this, options );
+ });
+ }
+ return _offset.call( this );
+ };
+}
+
+}( jQuery ));
+/*
+ * jQuery UI Progressbar 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.progressbar", {
+ options: {
+ value: 0,
+ max: 100
+ },
+
+ min: 0,
+
+ _create: function() {
+ this.element
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this.min,
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
+
+ this.oldValue = this._value();
+ this._refreshValue();
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+
+ this.valueDiv.remove();
+
+ $.Widget.prototype.destroy.apply( this, arguments );
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this._value();
+ }
+
+ this._setOption( "value", newValue );
+ return this;
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "value" ) {
+ this.options.value = value;
+ this._refreshValue();
+ if ( this._value() === this.options.max ) {
+ this._trigger( "complete" );
+ }
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ _value: function() {
+ var val = this.options.value;
+ // normalize invalid value
+ if ( typeof val !== "number" ) {
+ val = 0;
+ }
+ return Math.min( this.options.max, Math.max( this.min, val ) );
+ },
+
+ _percentage: function() {
+ return 100 * this._value() / this.options.max;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ var percentage = this._percentage();
+
+ if ( this.oldValue !== value ) {
+ this.oldValue = value;
+ this._trigger( "change" );
+ }
+
+ this.valueDiv
+ .toggle( value > this.min )
+ .toggleClass( "ui-corner-right", value === this.options.max )
+ .width( percentage.toFixed(0) + "%" );
+ this.element.attr( "aria-valuenow", value );
+ }
+});
+
+$.extend( $.ui.progressbar, {
+ version: "1.8.13"
+});
+
+})( jQuery );
+/*
+ * jQuery UI Slider 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget( "ui.slider", $.ui.mouse, {
+
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ },
+
+ _create: function() {
+ var self = this,
+ o = this.options,
+ existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
+ handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
+ handleCount = ( o.values && o.values.length ) || 1,
+ handles = [];
+
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass( "ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" +
+ ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
+
+ this.range = $([]);
+
+ if ( o.range ) {
+ if ( o.range === true ) {
+ if ( !o.values ) {
+ o.values = [ this._valueMin(), this._valueMin() ];
+ }
+ if ( o.values.length && o.values.length !== 2 ) {
+ o.values = [ o.values[0], o.values[0] ];
+ }
+ }
+
+ this.range = $( "<div></div>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-range" +
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ " ui-widget-header" +
+ ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
+ }
+
+ for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
+ handles.push( handle );
+ }
+
+ this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
+
+ this.handle = this.handles.eq( 0 );
+
+ this.handles.add( this.range ).filter( "a" )
+ .click(function( event ) {
+ event.preventDefault();
+ })
+ .hover(function() {
+ if ( !o.disabled ) {
+ $( this ).addClass( "ui-state-hover" );
+ }
+ }, function() {
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .focus(function() {
+ if ( !o.disabled ) {
+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+ $( this ).addClass( "ui-state-focus" );
+ } else {
+ $( this ).blur();
+ }
+ })
+ .blur(function() {
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ this.handles.each(function( i ) {
+ $( this ).data( "index.ui-slider-handle", i );
+ });
+
+ this.handles
+ .keydown(function( event ) {
+ var ret = true,
+ index = $( this ).data( "index.ui-slider-handle" ),
+ allowed,
+ curVal,
+ newVal,
+ step;
+
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if ( !self._keySliding ) {
+ self._keySliding = true;
+ $( this ).addClass( "ui-state-active" );
+ allowed = self._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = self.options.step;
+ if ( self.options.values && self.options.values.length ) {
+ curVal = newVal = self.values( index );
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === self._valueMax() ) {
+ return;
+ }
+ newVal = self._trimAlignValue( curVal + step );
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === self._valueMin() ) {
+ return;
+ }
+ newVal = self._trimAlignValue( curVal - step );
+ break;
+ }
+
+ self._slide( event, index, newVal );
+
+ return ret;
+
+ })
+ .keyup(function( event ) {
+ var index = $( this ).data( "index.ui-slider-handle" );
+
+ if ( self._keySliding ) {
+ self._keySliding = false;
+ self._stop( event, index );
+ self._change( event, index );
+ $( this ).removeClass( "ui-state-active" );
+ }
+
+ });
+
+ this._refreshValue();
+
+ this._animateOff = false;
+ },
+
+ destroy: function() {
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass( "ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-slider-disabled" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" )
+ .removeData( "slider" )
+ .unbind( ".slider" );
+
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function( event ) {
+ var o = this.options,
+ position,
+ normValue,
+ distance,
+ closestHandle,
+ self,
+ index,
+ allowed,
+ offset,
+ mouseOverHandle;
+
+ if ( o.disabled ) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ self = this;
+ this.handles.each(function( i ) {
+ var thisDistance = Math.abs( normValue - self.values(i) );
+ if ( distance > thisDistance ) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if( o.range === true && this.values(1) === o.min ) {
+ index += 1;
+ closestHandle = $( this.handles[index] );
+ }
+
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass( "ui-state-active" )
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+ ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ };
+
+ if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+ this._slide( event, index, normValue );
+ }
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function( event ) {
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ this.handles.removeClass( "ui-state-active" );
+ this._mouseSliding = false;
+
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
+ }
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue( valueMouse );
+ },
+
+ _start: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+ return this._trigger( "start", event, uiHash );
+ },
+
+ _slide: function( event, index, newVal ) {
+ var otherVal,
+ newValues,
+ allowed;
+
+ if ( this.options.values && this.options.values.length ) {
+ otherVal = this.values( index ? 0 : 1 );
+
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+
+ if ( newVal !== this.values( index ) ) {
+ newValues = this.values();
+ newValues[ index ] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal,
+ values: newValues
+ } );
+ otherVal = this.values( index ? 0 : 1 );
+ if ( allowed !== false ) {
+ this.values( index, newVal, true );
+ }
+ }
+ } else {
+ if ( newVal !== this.value() ) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal
+ } );
+ if ( allowed !== false ) {
+ this.value( newVal );
+ }
+ }
+ }
+ },
+
+ _stop: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "stop", event, uiHash );
+ },
+
+ _change: function( event, index ) {
+ if ( !this._keySliding && !this._mouseSliding ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "change", event, uiHash );
+ }
+ },
+
+ value: function( newValue ) {
+ if ( arguments.length ) {
+ this.options.value = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, 0 );
+ return;
+ }
+
+ return this._value();
+ },
+
+ values: function( index, newValue ) {
+ var vals,
+ newValues,
+ i;
+
+ if ( arguments.length > 1 ) {
+ this.options.values[ index ] = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, index );
+ return;
+ }
+
+ if ( arguments.length ) {
+ if ( $.isArray( arguments[ 0 ] ) ) {
+ vals = this.options.values;
+ newValues = arguments[ 0 ];
+ for ( i = 0; i < vals.length; i += 1 ) {
+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
+ this._change( null, i );
+ }
+ this._refreshValue();
+ } else {
+ if ( this.options.values && this.options.values.length ) {
+ return this._values( index );
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var i,
+ valsLength = 0;
+
+ if ( $.isArray( this.options.values ) ) {
+ valsLength = this.options.values.length;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ switch ( key ) {
+ case "disabled":
+ if ( value ) {
+ this.handles.filter( ".ui-state-focus" ).blur();
+ this.handles.removeClass( "ui-state-hover" );
+ this.handles.attr( "disabled", "disabled" );
+ this.element.addClass( "ui-disabled" );
+ } else {
+ this.handles.removeAttr( "disabled" );
+ this.element.removeClass( "ui-disabled" );
+ }
+ break;
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ .addClass( "ui-slider-" + this.orientation );
+ this._refreshValue();
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change( null, 0 );
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for ( i = 0; i < valsLength; i += 1 ) {
+ this._change( null, i );
+ }
+ this._animateOff = false;
+ break;
+ }
+ },
+
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function() {
+ var val = this.options.value;
+ val = this._trimAlignValue( val );
+
+ return val;
+ },
+
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function( index ) {
+ var val,
+ vals,
+ i;
+
+ if ( arguments.length ) {
+ val = this.options.values[ index ];
+ val = this._trimAlignValue( val );
+
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for ( i = 0; i < vals.length; i+= 1) {
+ vals[ i ] = this._trimAlignValue( vals[ i ] );
+ }
+
+ return vals;
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val <= this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val >= this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = ( this.options.step > 0 ) ? this.options.step : 1,
+ valModStep = (val - this._valueMin()) % step;
+ alignValue = val - valModStep;
+
+ if ( Math.abs(valModStep) * 2 >= step ) {
+ alignValue += ( valModStep > 0 ) ? step : ( -step );
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed(5) );
+ },
+
+ _valueMin: function() {
+ return this.options.min;
+ },
+
+ _valueMax: function() {
+ return this.options.max;
+ },
+
+ _refreshValue: function() {
+ var oRange = this.options.range,
+ o = this.options,
+ self = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ valPercent,
+ _set = {},
+ lastValPercent,
+ value,
+ valueMin,
+ valueMax;
+
+ if ( this.options.values && this.options.values.length ) {
+ this.handles.each(function( i, j ) {
+ valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( self.options.range === true ) {
+ if ( self.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ } else {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+
+});
+
+$.extend( $.ui.slider, {
+ version: "1.8.13"
+});
+
+}(jQuery));
+/*
+ * jQuery UI Tabs 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var tabId = 0,
+ listId = 0;
+
+function getNextTabId() {
+ return ++tabId;
+}
+
+function getNextListId() {
+ return ++listId;
+}
+
+$.widget( "ui.tabs", {
+ options: {
+ add: null,
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disable: null,
+ disabled: [],
+ enable: null,
+ event: "click",
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: "ui-tabs-",
+ load: null,
+ panelTemplate: "<div></div>",
+ remove: null,
+ select: null,
+ show: null,
+ spinner: "<em>Loading&#8230;</em>",
+ tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
+ },
+
+ _create: function() {
+ this._tabify( true );
+ },
+
+ _setOption: function( key, value ) {
+ if ( key == "selected" ) {
+ if (this.options.collapsible && value == this.options.selected ) {
+ return;
+ }
+ this.select( value );
+ } else {
+ this.options[ key ] = value;
+ this._tabify();
+ }
+ },
+
+ _tabId: function( a ) {
+ return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
+ this.options.idPrefix + getNextTabId();
+ },
+
+ _sanitizeSelector: function( hash ) {
+ // we need this because an id may contain a ":"
+ return hash.replace( /:/g, "\\:" );
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie ||
+ ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
+ return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
+ },
+
+ _ui: function( tab, panel ) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index( tab )
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter( ".ui-state-processing" )
+ .removeClass( "ui-state-processing" )
+ .find( "span:data(label.tabs)" )
+ .each(function() {
+ var el = $( this );
+ el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
+ });
+ },
+
+ _tabify: function( init ) {
+ var self = this,
+ o = this.options,
+ fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+
+ this.list = this.element.find( "ol,ul" ).eq( 0 );
+ this.lis = $( " > li:has(a[href])", this.list );
+ this.anchors = this.lis.map(function() {
+ return $( "a", this )[ 0 ];
+ });
+ this.panels = $( [] );
+
+ this.anchors.each(function( i, a ) {
+ var href = $( a ).attr( "href" );
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split( "#" )[ 0 ],
+ baseEl;
+ if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
+ ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if ( fragmentId.test( href ) ) {
+ self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
+ // remote tab
+ // prevent loading the page itself if href is just "#"
+ } else if ( href && href !== "#" ) {
+ // required for restore on destroy
+ $.data( a, "href.tabs", href );
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
+
+ var id = self._tabId( a );
+ a.href = "#" + id;
+ var $panel = self.element.find( "#" + id );
+ if ( !$panel.length ) {
+ $panel = $( o.panelTemplate )
+ .attr( "id", id )
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .insertAfter( self.panels[ i - 1 ] || self.list );
+ $panel.data( "destroy.tabs", true );
+ }
+ self.panels = self.panels.add( $panel );
+ // invalid tab href
+ } else {
+ o.disabled.push( i );
+ }
+ });
+
+ // initialization from scratch
+ if ( init ) {
+ // attach necessary classes for styling
+ this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
+ this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+ this.lis.addClass( "ui-state-default ui-corner-top" );
+ this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if ( o.selected === undefined ) {
+ if ( location.hash ) {
+ this.anchors.each(function( i, a ) {
+ if ( a.hash == location.hash ) {
+ o.selected = i;
+ return false;
+ }
+ });
+ }
+ if ( typeof o.selected !== "number" && o.cookie ) {
+ o.selected = parseInt( self._cookie(), 10 );
+ }
+ if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
+ o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ }
+ o.selected = o.selected || ( this.lis.length ? 0 : -1 );
+ } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
+ ? o.selected
+ : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique( o.disabled.concat(
+ $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
+ return self.lis.index( n );
+ })
+ ) ).sort();
+
+ if ( $.inArray( o.selected, o.disabled ) != -1 ) {
+ o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
+ }
+
+ // highlight selected tab
+ this.panels.addClass( "ui-tabs-hide" );
+ this.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ // check for length avoids error when initializing empty list
+ if ( o.selected >= 0 && this.anchors.length ) {
+ self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
+ this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue( "tabs", function() {
+ self._trigger( "show", null,
+ self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
+ });
+
+ this.load( o.selected );
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ // TODO: namespace this event
+ $( window ).bind( "unload", function() {
+ self.lis.add( self.anchors ).unbind( ".tabs" );
+ self.lis = self.anchors = self.panels = null;
+ });
+ // update selected after add/remove
+ } else {
+ o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ }
+
+ // update collapsible
+ // TODO: use .toggleClass()
+ this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
+
+ // set or update cookie after init and add/remove respectively
+ if ( o.cookie ) {
+ this._cookie( o.selected, o.cookie );
+ }
+
+ // disable tabs
+ for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
+ $( li )[ $.inArray( i, o.disabled ) != -1 &&
+ // TODO: use .toggleClass()
+ !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
+ }
+
+ // reset cache if switching from cached to not cached
+ if ( o.cache === false ) {
+ this.anchors.removeData( "cache.tabs" );
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add( this.anchors ).unbind( ".tabs" );
+
+ if ( o.event !== "mouseover" ) {
+ var addState = function( state, el ) {
+ if ( el.is( ":not(.ui-state-disabled)" ) ) {
+ el.addClass( "ui-state-" + state );
+ }
+ };
+ var removeState = function( state, el ) {
+ el.removeClass( "ui-state-" + state );
+ };
+ this.lis.bind( "mouseover.tabs" , function() {
+ addState( "hover", $( this ) );
+ });
+ this.lis.bind( "mouseout.tabs", function() {
+ removeState( "hover", $( this ) );
+ });
+ this.anchors.bind( "focus.tabs", function() {
+ addState( "focus", $( this ).closest( "li" ) );
+ });
+ this.anchors.bind( "blur.tabs", function() {
+ removeState( "focus", $( this ).closest( "li" ) );
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if ( o.fx ) {
+ if ( $.isArray( o.fx ) ) {
+ hideFx = o.fx[ 0 ];
+ showFx = o.fx[ 1 ];
+ } else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle( $el, fx ) {
+ $el.css( "display", "" );
+ if ( !$.support.opacity && fx.opacity ) {
+ $el[ 0 ].style.removeAttribute( "filter" );
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx
+ ? function( clicked, $show ) {
+ $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+ $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
+ .animate( showFx, showFx.duration || "normal", function() {
+ resetStyle( $show, showFx );
+ self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+ });
+ }
+ : function( clicked, $show ) {
+ $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+ $show.removeClass( "ui-tabs-hide" );
+ self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx
+ ? function( clicked, $hide ) {
+ $hide.animate( hideFx, hideFx.duration || "normal", function() {
+ self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ $hide.addClass( "ui-tabs-hide" );
+ resetStyle( $hide, hideFx );
+ self.element.dequeue( "tabs" );
+ });
+ }
+ : function( clicked, $hide, $show ) {
+ self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+ $hide.addClass( "ui-tabs-hide" );
+ self.element.dequeue( "tabs" );
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind( o.event + ".tabs", function() {
+ var el = this,
+ $li = $(el).closest( "li" ),
+ $hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
+ $show = self.element.find( self._sanitizeSelector( el.hash ) );
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
+ $li.hasClass( "ui-state-disabled" ) ||
+ $li.hasClass( "ui-state-processing" ) ||
+ self.panels.filter( ":animated" ).length ||
+ self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index( this );
+
+ self.abort();
+
+ // if tab may be closed
+ if ( o.collapsible ) {
+ if ( $li.hasClass( "ui-tabs-selected" ) ) {
+ o.selected = -1;
+
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ self.element.queue( "tabs", function() {
+ hideTab( el, $hide );
+ }).dequeue( "tabs" );
+
+ this.blur();
+ return false;
+ } else if ( !$hide.length ) {
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ self.element.queue( "tabs", function() {
+ showTab( el, $show );
+ });
+
+ // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+ self.load( self.anchors.index( this ) );
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if ( o.cookie ) {
+ self._cookie( o.selected, o.cookie );
+ }
+
+ // show new tab
+ if ( $show.length ) {
+ if ( $hide.length ) {
+ self.element.queue( "tabs", function() {
+ hideTab( el, $hide );
+ });
+ }
+ self.element.queue( "tabs", function() {
+ showTab( el, $show );
+ });
+
+ self.load( self.anchors.index( this ) );
+ } else {
+ throw "jQuery UI Tabs: Mismatching fragment identifier.";
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ( $.browser.msie ) {
+ this.blur();
+ }
+ });
+
+ // disable click in any case
+ this.anchors.bind( "click.tabs", function(){
+ return false;
+ });
+ },
+
+ _getIndex: function( index ) {
+ // meta-function to give users option to provide a href string instead of a numerical index.
+ // also sanitizes numerical indexes to valid values.
+ if ( typeof index == "string" ) {
+ index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) );
+ }
+
+ return index;
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element
+ .unbind( ".tabs" )
+ .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
+ .removeData( "tabs" );
+
+ this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+
+ this.anchors.each(function() {
+ var href = $.data( this, "href.tabs" );
+ if ( href ) {
+ this.href = href;
+ }
+ var $this = $( this ).unbind( ".tabs" );
+ $.each( [ "href", "load", "cache" ], function( i, prefix ) {
+ $this.removeData( prefix + ".tabs" );
+ });
+ });
+
+ this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
+ if ( $.data( this, "destroy.tabs" ) ) {
+ $( this ).remove();
+ } else {
+ $( this ).removeClass([
+ "ui-state-default",
+ "ui-corner-top",
+ "ui-tabs-selected",
+ "ui-state-active",
+ "ui-state-hover",
+ "ui-state-focus",
+ "ui-state-disabled",
+ "ui-tabs-panel",
+ "ui-widget-content",
+ "ui-corner-bottom",
+ "ui-tabs-hide"
+ ].join( " " ) );
+ }
+ });
+
+ if ( o.cookie ) {
+ this._cookie( null, o.cookie );
+ }
+
+ return this;
+ },
+
+ add: function( url, label, index ) {
+ if ( index === undefined ) {
+ index = this.anchors.length;
+ }
+
+ var self = this,
+ o = this.options,
+ $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
+ id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
+
+ $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
+
+ // try to find an existing element before creating a new one
+ var $panel = self.element.find( "#" + id );
+ if ( !$panel.length ) {
+ $panel = $( o.panelTemplate )
+ .attr( "id", id )
+ .data( "destroy.tabs", true );
+ }
+ $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
+
+ if ( index >= this.lis.length ) {
+ $li.appendTo( this.list );
+ $panel.appendTo( this.list[ 0 ].parentNode );
+ } else {
+ $li.insertBefore( this.lis[ index ] );
+ $panel.insertBefore( this.panels[ index ] );
+ }
+
+ o.disabled = $.map( o.disabled, function( n, i ) {
+ return n >= index ? ++n : n;
+ });
+
+ this._tabify();
+
+ if ( this.anchors.length == 1 ) {
+ o.selected = 0;
+ $li.addClass( "ui-tabs-selected ui-state-active" );
+ $panel.removeClass( "ui-tabs-hide" );
+ this.element.queue( "tabs", function() {
+ self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
+ });
+
+ this.load( 0 );
+ }
+
+ this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ return this;
+ },
+
+ remove: function( index ) {
+ index = this._getIndex( index );
+ var o = this.options,
+ $li = this.lis.eq( index ).remove(),
+ $panel = this.panels.eq( index ).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
+ this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
+ }
+
+ o.disabled = $.map(
+ $.grep( o.disabled, function(n, i) {
+ return n != index;
+ }),
+ function( n, i ) {
+ return n >= index ? --n : n;
+ });
+
+ this._tabify();
+
+ this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
+ return this;
+ },
+
+ enable: function( index ) {
+ index = this._getIndex( index );
+ var o = this.options;
+ if ( $.inArray( index, o.disabled ) == -1 ) {
+ return;
+ }
+
+ this.lis.eq( index ).removeClass( "ui-state-disabled" );
+ o.disabled = $.grep( o.disabled, function( n, i ) {
+ return n != index;
+ });
+
+ this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ return this;
+ },
+
+ disable: function( index ) {
+ index = this._getIndex( index );
+ var self = this, o = this.options;
+ // cannot disable already selected tab
+ if ( index != o.selected ) {
+ this.lis.eq( index ).addClass( "ui-state-disabled" );
+
+ o.disabled.push( index );
+ o.disabled.sort();
+
+ this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ }
+
+ return this;
+ },
+
+ select: function( index ) {
+ index = this._getIndex( index );
+ if ( index == -1 ) {
+ if ( this.options.collapsible && this.options.selected != -1 ) {
+ index = this.options.selected;
+ } else {
+ return this;
+ }
+ }
+ this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
+ return this;
+ },
+
+ load: function( index ) {
+ index = this._getIndex( index );
+ var self = this,
+ o = this.options,
+ a = this.anchors.eq( index )[ 0 ],
+ url = $.data( a, "load.tabs" );
+
+ this.abort();
+
+ // not remote or from cache
+ if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
+ this.element.dequeue( "tabs" );
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq( index ).addClass( "ui-state-processing" );
+
+ if ( o.spinner ) {
+ var span = $( "span", a );
+ span.data( "label.tabs", span.html() ).html( o.spinner );
+ }
+
+ this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
+ url: url,
+ success: function( r, s ) {
+ self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
+
+ // take care of tab labels
+ self._cleanup();
+
+ if ( o.cache ) {
+ $.data( a, "cache.tabs", true );
+ }
+
+ self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+ try {
+ o.ajaxOptions.success( r, s );
+ }
+ catch ( e ) {}
+ },
+ error: function( xhr, s, e ) {
+ // take care of tab labels
+ self._cleanup();
+
+ self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ o.ajaxOptions.error( xhr, s, index, a );
+ }
+ catch ( e ) {}
+ }
+ } ) );
+
+ // last, so that load event is fired before show...
+ self.element.dequeue( "tabs" );
+
+ return this;
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue( [] );
+ this.panels.stop( false, true );
+
+ // "tabs" queue must not contain more than two elements,
+ // which are the callbacks for the latest clicked tab...
+ this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
+
+ // terminate pending requests from other tabs
+ if ( this.xhr ) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+ return this;
+ },
+
+ url: function( index, url ) {
+ this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
+ return this;
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+});
+
+$.extend( $.ui.tabs, {
+ version: "1.8.13"
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend( $.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function( ms, continuing ) {
+ var self = this,
+ o = this.options;
+
+ var rotate = self._rotate || ( self._rotate = function( e ) {
+ clearTimeout( self.rotation );
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms );
+
+ if ( e ) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || ( self._unrotate = !continuing
+ ? function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ }
+ : function( e ) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if ( ms ) {
+ this.element.bind( "tabsshow", rotate );
+ this.anchors.bind( o.event + ".tabs", stop );
+ rotate();
+ // stop rotation
+ } else {
+ clearTimeout( self.rotation );
+ this.element.unbind( "tabsshow", rotate );
+ this.anchors.unbind( o.event + ".tabs", stop );
+ delete this._rotate;
+ delete this._unrotate;
+ }
+
+ return this;
+ }
+});
+
+})( jQuery );
diff --git a/lib/scripts/jquery/jquery-ui.min.js b/lib/scripts/jquery/jquery-ui.min.js
new file mode 100644
index 000000000..8a2a208ec
--- /dev/null
+++ b/lib/scripts/jquery/jquery-ui.min.js
@@ -0,0 +1,407 @@
+/*!
+ * jQuery UI 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(a,d){function c(g,e){var i=g.nodeName.toLowerCase();if("area"===i){e=g.parentNode;i=e.name;if(!g.href||!i||e.nodeName.toLowerCase()!=="map")return false;g=a("img[usemap=#"+i+"]")[0];return!!g&&f(g)}return(/input|select|textarea|button|object/.test(i)?!g.disabled:"a"==i?g.href||e:e)&&f(g)}function f(g){return!a(g).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(!a.ui.version){a.extend(a.ui,{version:"1.8.13",
+keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({_focus:a.fn.focus,focus:function(g,e){return typeof g==="number"?this.each(function(){var i=this;setTimeout(function(){a(i).focus();
+e&&e.call(i)},g)}):this._focus.apply(this,arguments)},scrollParent:function(){var g;g=a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,
+"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!g.length?a(document):g},zIndex:function(g){if(g!==d)return this.css("zIndex",g);if(this.length){g=a(this[0]);for(var e;g.length&&g[0]!==document;){e=g.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){e=parseInt(g.css("zIndex"),10);if(!isNaN(e)&&e!==0)return e}g=g.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",
+function(g){g.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){function i(l,o,n,k){a.each(b,function(){o-=parseFloat(a.curCSS(l,"padding"+this,true))||0;if(n)o-=parseFloat(a.curCSS(l,"border"+this+"Width",true))||0;if(k)o-=parseFloat(a.curCSS(l,"margin"+this,true))||0});return o}var b=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),j={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,
+outerHeight:a.fn.outerHeight};a.fn["inner"+e]=function(l){if(l===d)return j["inner"+e].call(this);return this.each(function(){a(this).css(h,i(this,l)+"px")})};a.fn["outer"+e]=function(l,o){if(typeof l!=="number")return j["outer"+e].call(this,l);return this.each(function(){a(this).css(h,i(this,l,true,o)+"px")})}});a.extend(a.expr[":"],{data:function(g,e,i){return!!a.data(g,i[3])},focusable:function(g){return c(g,!isNaN(a.attr(g,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),i=isNaN(e);
+return(i||e>=0)&&c(g,!i)}});a(function(){var g=document.body,e=g.appendChild(e=document.createElement("div"));a.extend(e.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=e.offsetHeight===100;a.support.selectstart="onselectstart"in e;g.removeChild(e).style.display="none"});a.extend(a.ui,{plugin:{add:function(g,e,i){g=a.ui[g].prototype;for(var b in i){g.plugins[b]=g.plugins[b]||[];g.plugins[b].push([e,i[b]])}},call:function(g,e,i){if((e=g.plugins[e])&&g.element[0].parentNode)for(var b=
+0;b<e.length;b++)g.options[e[b][0]]&&e[b][1].apply(g.element,i)}},contains:function(g,e){return document.compareDocumentPosition?g.compareDocumentPosition(e)&16:g!==e&&g.contains(e)},hasScroll:function(g,e){if(a(g).css("overflow")==="hidden")return false;e=e&&e==="left"?"scrollLeft":"scrollTop";var i=false;if(g[e]>0)return true;g[e]=1;i=g[e]>0;g[e]=0;return i},isOverAxis:function(g,e,i){return g>e&&g<e+i},isOver:function(g,e,i,b,h,j){return a.ui.isOverAxis(g,i,h)&&a.ui.isOverAxis(e,b,j)}})}})(jQuery);
+(function(a,d){if(a.cleanData){var c=a.cleanData;a.cleanData=function(g){for(var e=0,i;(i=g[e])!=null;e++)a(i).triggerHandler("remove");c(g)}}else{var f=a.fn.remove;a.fn.remove=function(g,e){return this.each(function(){if(!e)if(!g||a.filter(g,[this]).length)a("*",this).add([this]).each(function(){a(this).triggerHandler("remove")});return f.call(a(this),g,e)})}}a.widget=function(g,e,i){var b=g.split(".")[0],h;g=g.split(".")[1];h=b+"-"+g;if(!i){i=e;e=a.Widget}a.expr[":"][h]=function(j){return!!a.data(j,
+g)};a[b]=a[b]||{};a[b][g]=function(j,l){arguments.length&&this._createWidget(j,l)};e=new e;e.options=a.extend(true,{},e.options);a[b][g].prototype=a.extend(true,e,{namespace:b,widgetName:g,widgetEventPrefix:a[b][g].prototype.widgetEventPrefix||g,widgetBaseClass:h},i);a.widget.bridge(g,a[b][g])};a.widget.bridge=function(g,e){a.fn[g]=function(i){var b=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!b&&h.length?a.extend.apply(null,[true,i].concat(h)):i;if(b&&i.charAt(0)==="_")return j;
+b?this.each(function(){var l=a.data(this,g),o=l&&a.isFunction(l[i])?l[i].apply(l,h):l;if(o!==l&&o!==d){j=o;return false}}):this.each(function(){var l=a.data(this,g);l?l.option(i||{})._init():a.data(this,g,new e(i,this))});return j}};a.Widget=function(g,e){arguments.length&&this._createWidget(g,e)};a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(g,e){a.data(e,this.widgetName,this);this.element=a(e);this.options=a.extend(true,{},this.options,
+this._getCreateOptions(),g);var i=this;this.element.bind("remove."+this.widgetName,function(){i.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return a.metadata&&a.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(g,e){var i=g;if(arguments.length===0)return a.extend({},this.options);if(typeof g==="string"){if(e===d)return this.options[g];i={};i[g]=e}this._setOptions(i);return this},_setOptions:function(g){var e=this;a.each(g,function(i,b){e._setOption(i,b)});return this},_setOption:function(g,e){this.options[g]=e;if(g==="disabled")this.widget()[e?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",e);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(g,e,i){var b=this.options[g];e=a.Event(e);e.type=(g===this.widgetEventPrefix?g:this.widgetEventPrefix+g).toLowerCase();i=i||{};if(e.originalEvent){g=a.event.props.length;for(var h;g;){h=a.event.props[--g];e[h]=e.originalEvent[h]}}this.element.trigger(e,i);return!(a.isFunction(b)&&b.call(this.element[0],e,i)===false||e.isDefaultPrevented())}}})(jQuery);
+(function(a){var d=false;a(document).mousedown(function(){d=false});a.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var c=this;this.element.bind("mousedown."+this.widgetName,function(f){return c._mouseDown(f)}).bind("click."+this.widgetName,function(f){if(true===a.data(f.target,c.widgetName+".preventClickEvent")){a.removeData(f.target,c.widgetName+".preventClickEvent");f.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+
+this.widgetName)},_mouseDown:function(c){if(!d){this._mouseStarted&&this._mouseUp(c);this._mouseDownEvent=c;var f=this,g=c.which==1,e=typeof this.options.cancel=="string"?a(c.target).parents().add(c.target).filter(this.options.cancel).length:false;if(!g||e||!this._mouseCapture(c))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){f.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c)){this._mouseStarted=
+this._mouseStart(c)!==false;if(!this._mouseStarted){c.preventDefault();return true}}true===a.data(c.target,this.widgetName+".preventClickEvent")&&a.removeData(c.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(i){return f._mouseMove(i)};this._mouseUpDelegate=function(i){return f._mouseUp(i)};a(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.preventDefault();return d=true}},_mouseMove:function(c){if(a.browser.msie&&
+!(document.documentMode>=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c);return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
+false;c.target==this._mouseDownEvent.target&&a.data(c.target,this.widgetName+".preventClickEvent",true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+(function(a){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(d){var c=
+this.options;if(this.helper||c.disabled||a(d.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(d);if(!this.handle)return false;a(c.iframeFix===true?"iframe":c.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(a(this).offset()).appendTo("body")});return true},_mouseStart:function(d){var c=this.options;this.helper=
+this._createHelper(d);this._cacheHelperProportions();if(a.ui.ddmanager)a.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});
+this.originalPosition=this.position=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);c.containment&&this._setContainment();if(this._trigger("start",d)===false){this._clear();return false}this._cacheHelperProportions();a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(d,true);return true},_mouseDrag:function(d,c){this.position=this._generatePosition(d);
+this.positionAbs=this._convertPositionTo("absolute");if(!c){c=this._uiHash();if(this._trigger("drag",d,c)===false){this._mouseUp({});return false}this.position=c.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);return false},_mouseStop:function(d){var c=false;if(a.ui.ddmanager&&!this.options.dropBehaviour)c=
+a.ui.ddmanager.drop(this,d);if(this.dropped){c=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===true||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var f=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){f._trigger("stop",d)!==false&&f._clear()})}else this._trigger("stop",
+d)!==false&&this._clear();return false},_mouseUp:function(d){this.options.iframeFix===true&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});return a.ui.mouse.prototype._mouseUp.call(this,d)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(d){var c=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+d.target)c=true});return c},_createHelper:function(d){var c=this.options;d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[d])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo);d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&&d.css("position","absolute");return d},_adjustOffsetFromHelper:function(d){if(typeof d=="string")d=d.split(" ");if(a.isArray(d))d=
+{left:+d[0],top:+d[1]||0};if("left"in d)this.offset.click.left=d.left+this.margins.left;if("right"in d)this.offset.click.left=this.helperProportions.width-d.right+this.margins.left;if("top"in d)this.offset.click.top=d.top+this.margins.top;if("bottom"in d)this.offset.click.top=this.helperProportions.height-d.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var d=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&
+a.ui.contains(this.scrollParent[0],this.offsetParent[0])){d.left+=this.scrollParent.scrollLeft();d.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)d={top:0,left:0};return{top:d.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:d.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var d=
+this.element.position();return{top:d.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:d.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
+{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var d=this.options;if(d.containment=="parent")d.containment=this.helper[0].parentNode;if(d.containment=="document"||d.containment=="window")this.containment=[(d.containment=="document"?0:a(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(d.containment=="document"?0:a(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(d.containment=="document"?0:a(window).scrollLeft())+
+a(d.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d.containment=="document"?0:a(window).scrollTop())+(a(d.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(d.containment)&&d.containment.constructor!=Array){d=a(d.containment);var c=d[0];if(c){d.offset();var f=a(c).css("overflow")!="hidden";this.containment=[(parseInt(a(c).css("borderLeftWidth"),
+10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0),(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0),(f?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(f?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-
+this.margins.top-this.margins.bottom];this.relative_container=d}}else if(d.containment.constructor==Array)this.containment=d.containment},_convertPositionTo:function(d,c){if(!c)c=this.position;d=d=="absolute"?1:-1;var f=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&
+a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(d){var c=this.options,f=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName),e=d.pageX,i=d.pageY;if(this.originalPosition){var b;if(this.containment){if(this.relative_container){b=this.relative_container.offset();b=[this.containment[0]+b.left,this.containment[1]+b.top,this.containment[2]+b.left,this.containment[3]+b.top]}else b=this.containment;if(d.pageX-this.offset.click.left<b[0])e=b[0]+this.offset.click.left;if(d.pageY-this.offset.click.top<b[1])i=b[1]+this.offset.click.top;
+if(d.pageX-this.offset.click.left>b[2])e=b[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>b[3])i=b[3]+this.offset.click.top}if(c.grid){i=this.originalPageY+Math.round((i-this.originalPageY)/c.grid[1])*c.grid[1];i=b?!(i-this.offset.click.top<b[1]||i-this.offset.click.top>b[3])?i:!(i-this.offset.click.top<b[1])?i-c.grid[1]:i+c.grid[1]:i;e=this.originalPageX+Math.round((e-this.originalPageX)/c.grid[0])*c.grid[0];e=b?!(e-this.offset.click.left<b[0]||e-this.offset.click.left>b[2])?e:!(e-this.offset.click.left<
+b[0])?e-c.grid[0]:e+c.grid[0]:e}}return{top:i-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");
+this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(d,c,f){f=f||this._uiHash();a.ui.plugin.call(this,d,[c,f]);if(d=="drag")this.positionAbs=this._convertPositionTo("absolute");return a.Widget.prototype._trigger.call(this,d,c,f)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});a.extend(a.ui.draggable,{version:"1.8.13"});
+a.ui.plugin.add("draggable","connectToSortable",{start:function(d,c){var f=a(this).data("draggable"),g=f.options,e=a.extend({},c,{item:f.element});f.sortables=[];a(g.connectToSortable).each(function(){var i=a.data(this,"sortable");if(i&&!i.options.disabled){f.sortables.push({instance:i,shouldRevert:i.options.revert});i.refreshPositions();i._trigger("activate",d,e)}})},stop:function(d,c){var f=a(this).data("draggable"),g=a.extend({},c,{item:f.element});a.each(f.sortables,function(){if(this.instance.isOver){this.instance.isOver=
+0;f.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(d);this.instance.options.helper=this.instance.options._helper;f.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",d,g)}})},drag:function(d,c){var f=a(this).data("draggable"),g=this;a.each(f.sortables,function(){this.instance.positionAbs=
+f.positionAbs;this.instance.helperProportions=f.helperProportions;this.instance.offset.click=f.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(g).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return c.helper[0]};d.target=this.instance.currentItem[0];this.instance._mouseCapture(d,
+true);this.instance._mouseStart(d,true,true);this.instance.offset.click.top=f.offset.click.top;this.instance.offset.click.left=f.offset.click.left;this.instance.offset.parent.left-=f.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=f.offset.parent.top-this.instance.offset.parent.top;f._trigger("toSortable",d);f.dropped=this.instance.element;f.currentItem=f.element;this.instance.fromOutside=f}this.instance.currentItem&&this.instance._mouseDrag(d)}else if(this.instance.isOver){this.instance.isOver=
+0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",d,this.instance._uiHash(this.instance));this.instance._mouseStop(d,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();f._trigger("fromSortable",d);f.dropped=false}})}});a.ui.plugin.add("draggable","cursor",{start:function(){var d=a("body"),c=a(this).data("draggable").options;if(d.css("cursor"))c._cursor=
+d.css("cursor");d.css("cursor",c.cursor)},stop:function(){var d=a(this).data("draggable").options;d._cursor&&a("body").css("cursor",d._cursor)}});a.ui.plugin.add("draggable","opacity",{start:function(d,c){d=a(c.helper);c=a(this).data("draggable").options;if(d.css("opacity"))c._opacity=d.css("opacity");d.css("opacity",c.opacity)},stop:function(d,c){d=a(this).data("draggable").options;d._opacity&&a(c.helper).css("opacity",d._opacity)}});a.ui.plugin.add("draggable","scroll",{start:function(){var d=a(this).data("draggable");
+if(d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML")d.overflowOffset=d.scrollParent.offset()},drag:function(d){var c=a(this).data("draggable"),f=c.options,g=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x")if(c.overflowOffset.top+c.scrollParent[0].offsetHeight-d.pageY<f.scrollSensitivity)c.scrollParent[0].scrollTop=g=c.scrollParent[0].scrollTop+f.scrollSpeed;else if(d.pageY-c.overflowOffset.top<f.scrollSensitivity)c.scrollParent[0].scrollTop=
+g=c.scrollParent[0].scrollTop-f.scrollSpeed;if(!f.axis||f.axis!="y")if(c.overflowOffset.left+c.scrollParent[0].offsetWidth-d.pageX<f.scrollSensitivity)c.scrollParent[0].scrollLeft=g=c.scrollParent[0].scrollLeft+f.scrollSpeed;else if(d.pageX-c.overflowOffset.left<f.scrollSensitivity)c.scrollParent[0].scrollLeft=g=c.scrollParent[0].scrollLeft-f.scrollSpeed}else{if(!f.axis||f.axis!="x")if(d.pageY-a(document).scrollTop()<f.scrollSensitivity)g=a(document).scrollTop(a(document).scrollTop()-f.scrollSpeed);
+else if(a(window).height()-(d.pageY-a(document).scrollTop())<f.scrollSensitivity)g=a(document).scrollTop(a(document).scrollTop()+f.scrollSpeed);if(!f.axis||f.axis!="y")if(d.pageX-a(document).scrollLeft()<f.scrollSensitivity)g=a(document).scrollLeft(a(document).scrollLeft()-f.scrollSpeed);else if(a(window).width()-(d.pageX-a(document).scrollLeft())<f.scrollSensitivity)g=a(document).scrollLeft(a(document).scrollLeft()+f.scrollSpeed)}g!==false&&a.ui.ddmanager&&!f.dropBehaviour&&a.ui.ddmanager.prepareOffsets(c,
+d)}});a.ui.plugin.add("draggable","snap",{start:function(){var d=a(this).data("draggable"),c=d.options;d.snapElements=[];a(c.snap.constructor!=String?c.snap.items||":data(draggable)":c.snap).each(function(){var f=a(this),g=f.offset();this!=d.element[0]&&d.snapElements.push({item:this,width:f.outerWidth(),height:f.outerHeight(),top:g.top,left:g.left})})},drag:function(d,c){for(var f=a(this).data("draggable"),g=f.options,e=g.snapTolerance,i=c.offset.left,b=i+f.helperProportions.width,h=c.offset.top,
+j=h+f.helperProportions.height,l=f.snapElements.length-1;l>=0;l--){var o=f.snapElements[l].left,n=o+f.snapElements[l].width,k=f.snapElements[l].top,m=k+f.snapElements[l].height;if(o-e<i&&i<n+e&&k-e<h&&h<m+e||o-e<i&&i<n+e&&k-e<j&&j<m+e||o-e<b&&b<n+e&&k-e<h&&h<m+e||o-e<b&&b<n+e&&k-e<j&&j<m+e){if(g.snapMode!="inner"){var p=Math.abs(k-j)<=e,q=Math.abs(m-h)<=e,s=Math.abs(o-b)<=e,r=Math.abs(n-i)<=e;if(p)c.position.top=f._convertPositionTo("relative",{top:k-f.helperProportions.height,left:0}).top-f.margins.top;
+if(q)c.position.top=f._convertPositionTo("relative",{top:m,left:0}).top-f.margins.top;if(s)c.position.left=f._convertPositionTo("relative",{top:0,left:o-f.helperProportions.width}).left-f.margins.left;if(r)c.position.left=f._convertPositionTo("relative",{top:0,left:n}).left-f.margins.left}var u=p||q||s||r;if(g.snapMode!="outer"){p=Math.abs(k-h)<=e;q=Math.abs(m-j)<=e;s=Math.abs(o-i)<=e;r=Math.abs(n-b)<=e;if(p)c.position.top=f._convertPositionTo("relative",{top:k,left:0}).top-f.margins.top;if(q)c.position.top=
+f._convertPositionTo("relative",{top:m-f.helperProportions.height,left:0}).top-f.margins.top;if(s)c.position.left=f._convertPositionTo("relative",{top:0,left:o}).left-f.margins.left;if(r)c.position.left=f._convertPositionTo("relative",{top:0,left:n-f.helperProportions.width}).left-f.margins.left}if(!f.snapElements[l].snapping&&(p||q||s||r||u))f.options.snap.snap&&f.options.snap.snap.call(f.element,d,a.extend(f._uiHash(),{snapItem:f.snapElements[l].item}));f.snapElements[l].snapping=p||q||s||r||u}else{f.snapElements[l].snapping&&
+f.options.snap.release&&f.options.snap.release.call(f.element,d,a.extend(f._uiHash(),{snapItem:f.snapElements[l].item}));f.snapElements[l].snapping=false}}}});a.ui.plugin.add("draggable","stack",{start:function(){var d=a(this).data("draggable").options;d=a.makeArray(a(d.stack)).sort(function(f,g){return(parseInt(a(f).css("zIndex"),10)||0)-(parseInt(a(g).css("zIndex"),10)||0)});if(d.length){var c=parseInt(d[0].style.zIndex)||0;a(d).each(function(f){this.style.zIndex=c+f});this[0].style.zIndex=c+d.length}}});
+a.ui.plugin.add("draggable","zIndex",{start:function(d,c){d=a(c.helper);c=a(this).data("draggable").options;if(d.css("zIndex"))c._zIndex=d.css("zIndex");d.css("zIndex",c.zIndex)},stop:function(d,c){d=a(this).data("draggable").options;d._zIndex&&a(c.helper).css("zIndex",d._zIndex)}})})(jQuery);
+(function(a){a.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var d=this.options,c=d.accept;this.isover=0;this.isout=1;this.accept=a.isFunction(c)?c:function(f){return f.is(c)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};a.ui.ddmanager.droppables[d.scope]=a.ui.ddmanager.droppables[d.scope]||[];a.ui.ddmanager.droppables[d.scope].push(this);
+d.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var d=a.ui.ddmanager.droppables[this.options.scope],c=0;c<d.length;c++)d[c]==this&&d.splice(c,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(d,c){if(d=="accept")this.accept=a.isFunction(c)?c:function(f){return f.is(c)};a.Widget.prototype._setOption.apply(this,arguments)},_activate:function(d){var c=a.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);c&&this._trigger("activate",d,this.ui(c))},_deactivate:function(d){var c=a.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);c&&this._trigger("deactivate",d,this.ui(c))},_over:function(d){var c=a.ui.ddmanager.current;if(!(!c||(c.currentItem||c.element)[0]==this.element[0]))if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",d,this.ui(c))}},_out:function(d){var c=a.ui.ddmanager.current;if(!(!c||(c.currentItem||c.element)[0]==this.element[0]))if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",d,this.ui(c))}},_drop:function(d,c){var f=c||a.ui.ddmanager.current;if(!f||(f.currentItem||f.element)[0]==this.element[0])return false;var g=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var e=
+a.data(this,"droppable");if(e.options.greedy&&!e.options.disabled&&e.options.scope==f.options.scope&&e.accept.call(e.element[0],f.currentItem||f.element)&&a.ui.intersect(f,a.extend(e,{offset:e.element.offset()}),e.options.tolerance)){g=true;return false}});if(g)return false;if(this.accept.call(this.element[0],f.currentItem||f.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+d,this.ui(f));return this.element}return false},ui:function(d){return{draggable:d.currentItem||d.element,helper:d.helper,position:d.position,offset:d.positionAbs}}});a.extend(a.ui.droppable,{version:"1.8.13"});a.ui.intersect=function(d,c,f){if(!c.offset)return false;var g=(d.positionAbs||d.position.absolute).left,e=g+d.helperProportions.width,i=(d.positionAbs||d.position.absolute).top,b=i+d.helperProportions.height,h=c.offset.left,j=h+c.proportions.width,l=c.offset.top,o=l+c.proportions.height;
+switch(f){case "fit":return h<=g&&e<=j&&l<=i&&b<=o;case "intersect":return h<g+d.helperProportions.width/2&&e-d.helperProportions.width/2<j&&l<i+d.helperProportions.height/2&&b-d.helperProportions.height/2<o;case "pointer":return a.ui.isOver((d.positionAbs||d.position.absolute).top+(d.clickOffset||d.offset.click).top,(d.positionAbs||d.position.absolute).left+(d.clickOffset||d.offset.click).left,l,h,c.proportions.height,c.proportions.width);case "touch":return(i>=l&&i<=o||b>=l&&b<=o||i<l&&b>o)&&(g>=
+h&&g<=j||e>=h&&e<=j||g<h&&e>j);default:return false}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(d,c){var f=a.ui.ddmanager.droppables[d.options.scope]||[],g=c?c.type:null,e=(d.currentItem||d.element).find(":data(droppable)").andSelf(),i=0;a:for(;i<f.length;i++)if(!(f[i].options.disabled||d&&!f[i].accept.call(f[i].element[0],d.currentItem||d.element))){for(var b=0;b<e.length;b++)if(e[b]==f[i].element[0]){f[i].proportions.height=0;continue a}f[i].visible=f[i].element.css("display")!=
+"none";if(f[i].visible){g=="mousedown"&&f[i]._activate.call(f[i],c);f[i].offset=f[i].element.offset();f[i].proportions={width:f[i].element[0].offsetWidth,height:f[i].element[0].offsetHeight}}}},drop:function(d,c){var f=false;a.each(a.ui.ddmanager.droppables[d.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&a.ui.intersect(d,this,this.options.tolerance))f=f||this._drop.call(this,c);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],d.currentItem||
+d.element)){this.isout=1;this.isover=0;this._deactivate.call(this,c)}}});return f},drag:function(d,c){d.options.refreshPositions&&a.ui.ddmanager.prepareOffsets(d,c);a.each(a.ui.ddmanager.droppables[d.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var f=a.ui.intersect(d,this,this.options.tolerance);if(f=!f&&this.isover==1?"isout":f&&this.isover==0?"isover":null){var g;if(this.options.greedy){var e=this.element.parents(":data(droppable):eq(0)");if(e.length){g=
+a.data(e[0],"droppable");g.greedyChild=f=="isover"?1:0}}if(g&&f=="isover"){g.isover=0;g.isout=1;g._out.call(g,c)}this[f]=1;this[f=="isout"?"isover":"isout"]=0;this[f=="isover"?"_over":"_out"].call(this,c);if(g&&f=="isout"){g.isout=0;g.isover=1;g._over.call(g,c)}}}})}}})(jQuery);
+(function(a){a.widget("ui.resizable",a.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var f=this,g=this.options;this.element.addClass("ui-resizable");a.extend(this,{_aspectRatio:!!g.aspectRatio,aspectRatio:g.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:g.helper||g.ghost||g.animate?g.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&a.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(a('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=g.handles||(!a(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var e=this.handles.split(",");this.handles={};for(var i=0;i<e.length;i++){var b=a.trim(e[i]),h=a('<div class="ui-resizable-handle '+("ui-resizable-"+b)+'"></div>');/sw|se|ne|nw/.test(b)&&h.css({zIndex:++g.zIndex});"se"==b&&h.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[b]=".ui-resizable-"+b;this.element.append(h)}}this._renderAxis=function(j){j=j||this.element;for(var l in this.handles){if(this.handles[l].constructor==
+String)this.handles[l]=a(this.handles[l],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=a(this.handles[l],this.element),n=0;n=/sw|ne|nw|se|n|s/.test(l)?o.outerHeight():o.outerWidth();o=["padding",/ne|nw|n/.test(l)?"Top":/se|sw|s/.test(l)?"Bottom":/^e$/.test(l)?"Right":"Left"].join("");j.css(o,n);this._proportionallyResize()}a(this.handles[l])}};this._renderAxis(this.element);this._handles=a(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!f.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);f.axis=j&&j[1]?j[1]:"se"}});if(g.autoHide){this._handles.hide();a(this.element).addClass("ui-resizable-autohide").hover(function(){if(!g.disabled){a(this).removeClass("ui-resizable-autohide");f._handles.show()}},function(){if(!g.disabled)if(!f.resizing){a(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();
+var f=function(e){a(e).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){f(this.element);var g=this.element;g.after(this.originalElement.css({position:g.css("position"),width:g.outerWidth(),height:g.outerHeight(),top:g.css("top"),left:g.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);f(this.originalElement);return this},_mouseCapture:function(f){var g=
+false;for(var e in this.handles)if(a(this.handles[e])[0]==f.target)g=true;return!this.options.disabled&&g},_mouseStart:function(f){var g=this.options,e=this.element.position(),i=this.element;this.resizing=true;this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()};if(i.is(".ui-draggable")||/absolute/.test(i.css("position")))i.css({position:"absolute",top:e.top,left:e.left});a.browser.opera&&/relative/.test(i.css("position"))&&i.css({position:"relative",top:"auto",left:"auto"});
+this._renderProxy();e=d(this.helper.css("left"));var b=d(this.helper.css("top"));if(g.containment){e+=a(g.containment).scrollLeft()||0;b+=a(g.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:e,top:b};this.size=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalSize=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalPosition={left:e,top:b};this.sizeDiff=
+{width:i.outerWidth()-i.width(),height:i.outerHeight()-i.height()};this.originalMousePosition={left:f.pageX,top:f.pageY};this.aspectRatio=typeof g.aspectRatio=="number"?g.aspectRatio:this.originalSize.width/this.originalSize.height||1;g=a(".ui-resizable-"+this.axis).css("cursor");a("body").css("cursor",g=="auto"?this.axis+"-resize":g);i.addClass("ui-resizable-resizing");this._propagate("start",f);return true},_mouseDrag:function(f){var g=this.helper,e=this.originalMousePosition,i=this._change[this.axis];
+if(!i)return false;e=i.apply(this,[f,f.pageX-e.left||0,f.pageY-e.top||0]);if(this._aspectRatio||f.shiftKey)e=this._updateRatio(e,f);e=this._respectSize(e,f);this._propagate("resize",f);g.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(e);this._trigger("resize",f,this.ui());return false},_mouseStop:function(f){this.resizing=
+false;var g=this.options,e=this;if(this._helper){var i=this._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName);i=b&&a.ui.hasScroll(i[0],"left")?0:e.sizeDiff.height;b=b?0:e.sizeDiff.width;b={width:e.helper.width()-b,height:e.helper.height()-i};i=parseInt(e.element.css("left"),10)+(e.position.left-e.originalPosition.left)||null;var h=parseInt(e.element.css("top"),10)+(e.position.top-e.originalPosition.top)||null;g.animate||this.element.css(a.extend(b,{top:h,left:i}));e.helper.height(e.size.height);
+e.helper.width(e.size.width);this._helper&&!g.animate&&this._proportionallyResize()}a("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",f);this._helper&&this.helper.remove();return false},_updateCache:function(f){this.offset=this.helper.offset();if(c(f.left))this.position.left=f.left;if(c(f.top))this.position.top=f.top;if(c(f.height))this.size.height=f.height;if(c(f.width))this.size.width=f.width},_updateRatio:function(f){var g=this.position,e=this.size,
+i=this.axis;if(f.height)f.width=e.height*this.aspectRatio;else if(f.width)f.height=e.width/this.aspectRatio;if(i=="sw"){f.left=g.left+(e.width-f.width);f.top=null}if(i=="nw"){f.top=g.top+(e.height-f.height);f.left=g.left+(e.width-f.width)}return f},_respectSize:function(f){var g=this.options,e=this.axis,i=c(f.width)&&g.maxWidth&&g.maxWidth<f.width,b=c(f.height)&&g.maxHeight&&g.maxHeight<f.height,h=c(f.width)&&g.minWidth&&g.minWidth>f.width,j=c(f.height)&&g.minHeight&&g.minHeight>f.height;if(h)f.width=
+g.minWidth;if(j)f.height=g.minHeight;if(i)f.width=g.maxWidth;if(b)f.height=g.maxHeight;var l=this.originalPosition.left+this.originalSize.width,o=this.position.top+this.size.height,n=/sw|nw|w/.test(e);e=/nw|ne|n/.test(e);if(h&&n)f.left=l-g.minWidth;if(i&&n)f.left=l-g.maxWidth;if(j&&e)f.top=o-g.minHeight;if(b&&e)f.top=o-g.maxHeight;if((g=!f.width&&!f.height)&&!f.left&&f.top)f.top=null;else if(g&&!f.top&&f.left)f.left=null;return f},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var f=
+this.helper||this.element,g=0;g<this._proportionallyResizeElements.length;g++){var e=this._proportionallyResizeElements[g];if(!this.borderDif){var i=[e.css("borderTopWidth"),e.css("borderRightWidth"),e.css("borderBottomWidth"),e.css("borderLeftWidth")],b=[e.css("paddingTop"),e.css("paddingRight"),e.css("paddingBottom"),e.css("paddingLeft")];this.borderDif=a.map(i,function(h,j){h=parseInt(h,10)||0;j=parseInt(b[j],10)||0;return h+j})}a.browser.msie&&(a(f).is(":hidden")||a(f).parents(":hidden").length)||
+e.css({height:f.height()-this.borderDif[0]-this.borderDif[2]||0,width:f.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var f=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||a('<div style="overflow:hidden;"></div>');var g=a.browser.msie&&a.browser.version<7,e=g?1:0;g=g?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+g,height:this.element.outerHeight()+g,position:"absolute",left:this.elementOffset.left-
+e+"px",top:this.elementOffset.top-e+"px",zIndex:++f.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(f,g){return{width:this.originalSize.width+g}},w:function(f,g){return{left:this.originalPosition.left+g,width:this.originalSize.width-g}},n:function(f,g,e){return{top:this.originalPosition.top+e,height:this.originalSize.height-e}},s:function(f,g,e){return{height:this.originalSize.height+e}},se:function(f,g,e){return a.extend(this._change.s.apply(this,
+arguments),this._change.e.apply(this,[f,g,e]))},sw:function(f,g,e){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[f,g,e]))},ne:function(f,g,e){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[f,g,e]))},nw:function(f,g,e){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[f,g,e]))}},_propagate:function(f,g){a.ui.plugin.call(this,f,[g,this.ui()]);f!="resize"&&this._trigger(f,g,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,
+element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});a.extend(a.ui.resizable,{version:"1.8.13"});a.ui.plugin.add("resizable","alsoResize",{start:function(){var f=a(this).data("resizable").options,g=function(e){a(e).each(function(){var i=a(this);i.data("resizable-alsoresize",{width:parseInt(i.width(),10),height:parseInt(i.height(),10),left:parseInt(i.css("left"),10),top:parseInt(i.css("top"),10),position:i.css("position")})})};
+if(typeof f.alsoResize=="object"&&!f.alsoResize.parentNode)if(f.alsoResize.length){f.alsoResize=f.alsoResize[0];g(f.alsoResize)}else a.each(f.alsoResize,function(e){g(e)});else g(f.alsoResize)},resize:function(f,g){var e=a(this).data("resizable");f=e.options;var i=e.originalSize,b=e.originalPosition,h={height:e.size.height-i.height||0,width:e.size.width-i.width||0,top:e.position.top-b.top||0,left:e.position.left-b.left||0},j=function(l,o){a(l).each(function(){var n=a(this),k=a(this).data("resizable-alsoresize"),
+m={},p=o&&o.length?o:n.parents(g.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(p,function(q,s){if((q=(k[s]||0)+(h[s]||0))&&q>=0)m[s]=q||null});if(a.browser.opera&&/relative/.test(n.css("position"))){e._revertToRelativePosition=true;n.css({position:"absolute",top:"auto",left:"auto"})}n.css(m)})};typeof f.alsoResize=="object"&&!f.alsoResize.nodeType?a.each(f.alsoResize,function(l,o){j(l,o)}):j(f.alsoResize)},stop:function(){var f=a(this).data("resizable"),g=f.options,
+e=function(i){a(i).each(function(){var b=a(this);b.css({position:b.data("resizable-alsoresize").position})})};if(f._revertToRelativePosition){f._revertToRelativePosition=false;typeof g.alsoResize=="object"&&!g.alsoResize.nodeType?a.each(g.alsoResize,function(i){e(i)}):e(g.alsoResize)}a(this).removeData("resizable-alsoresize")}});a.ui.plugin.add("resizable","animate",{stop:function(f){var g=a(this).data("resizable"),e=g.options,i=g._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName),
+h=b&&a.ui.hasScroll(i[0],"left")?0:g.sizeDiff.height;b={width:g.size.width-(b?0:g.sizeDiff.width),height:g.size.height-h};h=parseInt(g.element.css("left"),10)+(g.position.left-g.originalPosition.left)||null;var j=parseInt(g.element.css("top"),10)+(g.position.top-g.originalPosition.top)||null;g.element.animate(a.extend(b,j&&h?{top:j,left:h}:{}),{duration:e.animateDuration,easing:e.animateEasing,step:function(){var l={width:parseInt(g.element.css("width"),10),height:parseInt(g.element.css("height"),
+10),top:parseInt(g.element.css("top"),10),left:parseInt(g.element.css("left"),10)};i&&i.length&&a(i[0]).css({width:l.width,height:l.height});g._updateCache(l);g._propagate("resize",f)}})}});a.ui.plugin.add("resizable","containment",{start:function(){var f=a(this).data("resizable"),g=f.element,e=f.options.containment;if(g=e instanceof a?e.get(0):/parent/.test(e)?g.parent().get(0):e){f.containerElement=a(g);if(/document/.test(e)||e==document){f.containerOffset={left:0,top:0};f.containerPosition={left:0,
+top:0};f.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight}}else{var i=a(g),b=[];a(["Top","Right","Left","Bottom"]).each(function(l,o){b[l]=d(i.css("padding"+o))});f.containerOffset=i.offset();f.containerPosition=i.position();f.containerSize={height:i.innerHeight()-b[3],width:i.innerWidth()-b[1]};e=f.containerOffset;var h=f.containerSize.height,j=f.containerSize.width;j=a.ui.hasScroll(g,"left")?g.scrollWidth:j;
+h=a.ui.hasScroll(g)?g.scrollHeight:h;f.parentData={element:g,left:e.left,top:e.top,width:j,height:h}}}},resize:function(f){var g=a(this).data("resizable"),e=g.options,i=g.containerOffset,b=g.position;f=g._aspectRatio||f.shiftKey;var h={top:0,left:0},j=g.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))h=i;if(b.left<(g._helper?i.left:0)){g.size.width+=g._helper?g.position.left-i.left:g.position.left-h.left;if(f)g.size.height=g.size.width/e.aspectRatio;g.position.left=e.helper?i.left:
+0}if(b.top<(g._helper?i.top:0)){g.size.height+=g._helper?g.position.top-i.top:g.position.top;if(f)g.size.width=g.size.height*e.aspectRatio;g.position.top=g._helper?i.top:0}g.offset.left=g.parentData.left+g.position.left;g.offset.top=g.parentData.top+g.position.top;e=Math.abs((g._helper?g.offset.left-h.left:g.offset.left-h.left)+g.sizeDiff.width);i=Math.abs((g._helper?g.offset.top-h.top:g.offset.top-i.top)+g.sizeDiff.height);b=g.containerElement.get(0)==g.element.parent().get(0);h=/relative|absolute/.test(g.containerElement.css("position"));
+if(b&&h)e-=g.parentData.left;if(e+g.size.width>=g.parentData.width){g.size.width=g.parentData.width-e;if(f)g.size.height=g.size.width/g.aspectRatio}if(i+g.size.height>=g.parentData.height){g.size.height=g.parentData.height-i;if(f)g.size.width=g.size.height*g.aspectRatio}},stop:function(){var f=a(this).data("resizable"),g=f.options,e=f.containerOffset,i=f.containerPosition,b=f.containerElement,h=a(f.helper),j=h.offset(),l=h.outerWidth()-f.sizeDiff.width;h=h.outerHeight()-f.sizeDiff.height;f._helper&&
+!g.animate&&/relative/.test(b.css("position"))&&a(this).css({left:j.left-i.left-e.left,width:l,height:h});f._helper&&!g.animate&&/static/.test(b.css("position"))&&a(this).css({left:j.left-i.left-e.left,width:l,height:h})}});a.ui.plugin.add("resizable","ghost",{start:function(){var f=a(this).data("resizable"),g=f.options,e=f.size;f.ghost=f.originalElement.clone();f.ghost.css({opacity:0.25,display:"block",position:"relative",height:e.height,width:e.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof g.ghost==
+"string"?g.ghost:"");f.ghost.appendTo(f.helper)},resize:function(){var f=a(this).data("resizable");f.ghost&&f.ghost.css({position:"relative",height:f.size.height,width:f.size.width})},stop:function(){var f=a(this).data("resizable");f.ghost&&f.helper&&f.helper.get(0).removeChild(f.ghost.get(0))}});a.ui.plugin.add("resizable","grid",{resize:function(){var f=a(this).data("resizable"),g=f.options,e=f.size,i=f.originalSize,b=f.originalPosition,h=f.axis;g.grid=typeof g.grid=="number"?[g.grid,g.grid]:g.grid;
+var j=Math.round((e.width-i.width)/(g.grid[0]||1))*(g.grid[0]||1);g=Math.round((e.height-i.height)/(g.grid[1]||1))*(g.grid[1]||1);if(/^(se|s|e)$/.test(h)){f.size.width=i.width+j;f.size.height=i.height+g}else if(/^(ne)$/.test(h)){f.size.width=i.width+j;f.size.height=i.height+g;f.position.top=b.top-g}else{if(/^(sw)$/.test(h)){f.size.width=i.width+j;f.size.height=i.height+g}else{f.size.width=i.width+j;f.size.height=i.height+g;f.position.top=b.top-g}f.position.left=b.left-j}}});var d=function(f){return parseInt(f,
+10)||0},c=function(f){return!isNaN(parseInt(f,10))}})(jQuery);
+(function(a){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var d=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(d.options.filter,d.element[0]);c.each(function(){var f=a(this),g=f.offset();a.data(this,"selectable-item",{element:this,$element:f,left:g.left,top:g.top,right:g.left+f.outerWidth(),bottom:g.top+f.outerHeight(),startselected:false,selected:f.hasClass("ui-selected"),
+selecting:f.hasClass("ui-selecting"),unselecting:f.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(d){var c=this;this.opos=[d.pageX,
+d.pageY];if(!this.options.disabled){var f=this.options;this.selectees=a(f.filter,this.element[0]);this._trigger("start",d);a(f.appendTo).append(this.helper);this.helper.css({left:d.clientX,top:d.clientY,width:0,height:0});f.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var g=a.data(this,"selectable-item");g.startselected=true;if(!d.metaKey){g.$element.removeClass("ui-selected");g.selected=false;g.$element.addClass("ui-unselecting");g.unselecting=true;c._trigger("unselecting",
+d,{unselecting:g.element})}});a(d.target).parents().andSelf().each(function(){var g=a.data(this,"selectable-item");if(g){var e=!d.metaKey||!g.$element.hasClass("ui-selected");g.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting");g.unselecting=!e;g.selecting=e;(g.selected=e)?c._trigger("selecting",d,{selecting:g.element}):c._trigger("unselecting",d,{unselecting:g.element});return false}})}},_mouseDrag:function(d){var c=this;this.dragged=true;if(!this.options.disabled){var f=
+this.options,g=this.opos[0],e=this.opos[1],i=d.pageX,b=d.pageY;if(g>i){var h=i;i=g;g=h}if(e>b){h=b;b=e;e=h}this.helper.css({left:g,top:e,width:i-g,height:b-e});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!(!j||j.element==c.element[0])){var l=false;if(f.tolerance=="touch")l=!(j.left>i||j.right<g||j.top>b||j.bottom<e);else if(f.tolerance=="fit")l=j.left>g&&j.right<i&&j.top>e&&j.bottom<b;if(l){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting");
+j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;c._trigger("selecting",d,{selecting:j.element})}}else{if(j.selecting)if(d.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}c._trigger("unselecting",d,{unselecting:j.element})}if(j.selected)if(!d.metaKey&&
+!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;c._trigger("unselecting",d,{unselecting:j.element})}}}});return false}},_mouseStop:function(d){var c=this;this.dragged=false;a(".ui-unselecting",this.element[0]).each(function(){var f=a.data(this,"selectable-item");f.$element.removeClass("ui-unselecting");f.unselecting=false;f.startselected=false;c._trigger("unselected",d,{unselected:f.element})});a(".ui-selecting",this.element[0]).each(function(){var f=
+a.data(this,"selectable-item");f.$element.removeClass("ui-selecting").addClass("ui-selected");f.selecting=false;f.selected=true;f.startselected=true;c._trigger("selected",d,{selected:f.element})});this._trigger("stop",d);this.helper.remove();return false}});a.extend(a.ui.selectable,{version:"1.8.13"})})(jQuery);
+(function(a){a.widget("ui.sortable",a.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var d=this.options;this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?d.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var d=this.items.length-1;d>=0;d--)this.items[d].item.removeData("sortable-item");return this},_setOption:function(d,c){if(d===
+"disabled"){this.options[d]=c;this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")}else a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(d,c){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(d);var f=null,g=this;a(d.target).parents().each(function(){if(a.data(this,"sortable-item")==g){f=a(this);return false}});if(a.data(d.target,"sortable-item")==g)f=a(d.target);if(!f)return false;if(this.options.handle&&
+!c){var e=false;a(this.options.handle,f).find("*").andSelf().each(function(){if(this==d.target)e=true});if(!e)return false}this.currentItem=f;this._removeCurrentsFromItems();return true},_mouseStart:function(d,c,f){c=this.options;var g=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(d);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,
+left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();c.containment&&this._setContainment();if(c.cursor){if(a("body").css("cursor"))this._storedCursor=a("body").css("cursor");a("body").css("cursor",c.cursor)}if(c.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",c.opacity)}if(c.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",c.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",d,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!f)for(f=this.containers.length-1;f>=0;f--)this.containers[f]._trigger("activate",d,g._uiHash(this));if(a.ui.ddmanager)a.ui.ddmanager.current=this;a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(d);
+return true},_mouseDrag:function(d){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var c=this.options,f=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-d.pageY<c.scrollSensitivity)this.scrollParent[0].scrollTop=f=this.scrollParent[0].scrollTop+c.scrollSpeed;else if(d.pageY-this.overflowOffset.top<
+c.scrollSensitivity)this.scrollParent[0].scrollTop=f=this.scrollParent[0].scrollTop-c.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-d.pageX<c.scrollSensitivity)this.scrollParent[0].scrollLeft=f=this.scrollParent[0].scrollLeft+c.scrollSpeed;else if(d.pageX-this.overflowOffset.left<c.scrollSensitivity)this.scrollParent[0].scrollLeft=f=this.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(d.pageY-a(document).scrollTop()<c.scrollSensitivity)f=a(document).scrollTop(a(document).scrollTop()-
+c.scrollSpeed);else if(a(window).height()-(d.pageY-a(document).scrollTop())<c.scrollSensitivity)f=a(document).scrollTop(a(document).scrollTop()+c.scrollSpeed);if(d.pageX-a(document).scrollLeft()<c.scrollSensitivity)f=a(document).scrollLeft(a(document).scrollLeft()-c.scrollSpeed);else if(a(window).width()-(d.pageX-a(document).scrollLeft())<c.scrollSensitivity)f=a(document).scrollLeft(a(document).scrollLeft()+c.scrollSpeed)}f!==false&&a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,
+d)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(c=this.items.length-1;c>=0;c--){f=this.items[c];var g=f.item[0],e=this._intersectsWithPointer(f);if(e)if(g!=this.currentItem[0]&&this.placeholder[e==1?"next":"prev"]()[0]!=g&&!a.ui.contains(this.placeholder[0],g)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],
+g):true)){this.direction=e==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(f))this._rearrange(d,f);else break;this._trigger("change",d,this._uiHash());break}}this._contactContainers(d);a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);this._trigger("sort",d,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(d,c){if(d){a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,d);if(this.options.revert){var f=this;c=f.placeholder.offset();
+f.reverting=true;a(this.helper).animate({left:c.left-this.offset.parent.left-f.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:c.top-this.offset.parent.top-f.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){f._clear(d)})}else this._clear(d,c);return false}},cancel:function(){var d=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,d._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,d._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();a.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(d){var c=this._getItemsAsjQuery(d&&d.connected),f=[];d=d||{};a(c).each(function(){var g=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||/(.+)[-=_](.+)/);if(g)f.push((d.key||g[1]+"[]")+"="+(d.key&&d.expression?g[1]:g[2]))});!f.length&&d.key&&f.push(d.key+"=");return f.join("&")},
+toArray:function(d){var c=this._getItemsAsjQuery(d&&d.connected),f=[];d=d||{};c.each(function(){f.push(a(d.item||this).attr(d.attribute||"id")||"")});return f},_intersectsWith:function(d){var c=this.positionAbs.left,f=c+this.helperProportions.width,g=this.positionAbs.top,e=g+this.helperProportions.height,i=d.left,b=i+d.width,h=d.top,j=h+d.height,l=this.offset.click.top,o=this.offset.click.left;l=g+l>h&&g+l<j&&c+o>i&&c+o<b;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||
+this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>d[this.floating?"width":"height"]?l:i<c+this.helperProportions.width/2&&f-this.helperProportions.width/2<b&&h<g+this.helperProportions.height/2&&e-this.helperProportions.height/2<j},_intersectsWithPointer:function(d){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,d.top,d.height);d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,d.left,d.width);c=c&&d;d=this._getDragVerticalDirection();
+var f=this._getDragHorizontalDirection();if(!c)return false;return this.floating?f&&f=="right"||d=="down"?2:1:d&&(d=="down"?2:1)},_intersectsWithSides:function(d){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,d.top+d.height/2,d.height);d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,d.left+d.width/2,d.width);var f=this._getDragVerticalDirection(),g=this._getDragHorizontalDirection();return this.floating&&g?g=="right"&&d||g=="left"&&!d:f&&(f=="down"&&c||f=="up"&&!c)},
+_getDragVerticalDirection:function(){var d=this.positionAbs.top-this.lastPositionAbs.top;return d!=0&&(d>0?"down":"up")},_getDragHorizontalDirection:function(){var d=this.positionAbs.left-this.lastPositionAbs.left;return d!=0&&(d>0?"right":"left")},refresh:function(d){this._refreshItems(d);this.refreshPositions();return this},_connectWith:function(){var d=this.options;return d.connectWith.constructor==String?[d.connectWith]:d.connectWith},_getItemsAsjQuery:function(d){var c=[],f=[],g=this._connectWith();
+if(g&&d)for(d=g.length-1;d>=0;d--)for(var e=a(g[d]),i=e.length-1;i>=0;i--){var b=a.data(e[i],"sortable");if(b&&b!=this&&!b.options.disabled)f.push([a.isFunction(b.options.items)?b.options.items.call(b.element):a(b.options.items,b.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),b])}f.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(d=f.length-1;d>=0;d--)f[d][0].each(function(){c.push(this)});return a(c)},_removeCurrentsFromItems:function(){for(var d=this.currentItem.find(":data(sortable-item)"),c=0;c<this.items.length;c++)for(var f=0;f<d.length;f++)d[f]==this.items[c].item[0]&&this.items.splice(c,1)},_refreshItems:function(d){this.items=[];this.containers=[this];var c=this.items,f=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],d,{item:this.currentItem}):a(this.options.items,this.element),
+this]],g=this._connectWith();if(g)for(var e=g.length-1;e>=0;e--)for(var i=a(g[e]),b=i.length-1;b>=0;b--){var h=a.data(i[b],"sortable");if(h&&h!=this&&!h.options.disabled){f.push([a.isFunction(h.options.items)?h.options.items.call(h.element[0],d,{item:this.currentItem}):a(h.options.items,h.element),h]);this.containers.push(h)}}for(e=f.length-1;e>=0;e--){d=f[e][1];g=f[e][0];b=0;for(i=g.length;b<i;b++){h=a(g[b]);h.data("sortable-item",d);c.push({item:h,instance:d,width:0,height:0,left:0,top:0})}}},refreshPositions:function(d){if(this.offsetParent&&
+this.helper)this.offset.parent=this._getParentOffset();for(var c=this.items.length-1;c>=0;c--){var f=this.items[c];if(!(f.instance!=this.currentContainer&&this.currentContainer&&f.item[0]!=this.currentItem[0])){var g=this.options.toleranceElement?a(this.options.toleranceElement,f.item):f.item;if(!d){f.width=g.outerWidth();f.height=g.outerHeight()}g=g.offset();f.left=g.left;f.top=g.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(c=
+this.containers.length-1;c>=0;c--){g=this.containers[c].element.offset();this.containers[c].containerCache.left=g.left;this.containers[c].containerCache.top=g.top;this.containers[c].containerCache.width=this.containers[c].element.outerWidth();this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(d){var c=d||this,f=c.options;if(!f.placeholder||f.placeholder.constructor==String){var g=f.placeholder;f.placeholder={element:function(){var e=
+a(document.createElement(c.currentItem[0].nodeName)).addClass(g||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!g)e.style.visibility="hidden";return e},update:function(e,i){if(!(g&&!f.forcePlaceholderSize)){i.height()||i.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10));i.width()||i.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")||
+0,10))}}}}c.placeholder=a(f.placeholder.element.call(c.element,c.currentItem));c.currentItem.after(c.placeholder);f.placeholder.update(c,c.placeholder)},_contactContainers:function(d){for(var c=null,f=null,g=this.containers.length-1;g>=0;g--)if(!a.ui.contains(this.currentItem[0],this.containers[g].element[0]))if(this._intersectsWith(this.containers[g].containerCache)){if(!(c&&a.ui.contains(this.containers[g].element[0],c.element[0]))){c=this.containers[g];f=g}}else if(this.containers[g].containerCache.over){this.containers[g]._trigger("out",
+d,this._uiHash(this));this.containers[g].containerCache.over=0}if(c)if(this.containers.length===1){this.containers[f]._trigger("over",d,this._uiHash(this));this.containers[f].containerCache.over=1}else if(this.currentContainer!=this.containers[f]){c=1E4;g=null;for(var e=this.positionAbs[this.containers[f].floating?"left":"top"],i=this.items.length-1;i>=0;i--)if(a.ui.contains(this.containers[f].element[0],this.items[i].item[0])){var b=this.items[i][this.containers[f].floating?"left":"top"];if(Math.abs(b-
+e)<c){c=Math.abs(b-e);g=this.items[i]}}if(g||this.options.dropOnEmpty){this.currentContainer=this.containers[f];g?this._rearrange(d,g,null,true):this._rearrange(d,null,this.containers[f].element,true);this._trigger("change",d,this._uiHash());this.containers[f]._trigger("change",d,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[f]._trigger("over",d,this._uiHash(this));this.containers[f].containerCache.over=1}}},_createHelper:function(d){var c=
+this.options;d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[d,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]);if(d[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(d[0].style.width==
+""||c.forceHelperSize)d.width(this.currentItem.width());if(d[0].style.height==""||c.forceHelperSize)d.height(this.currentItem.height());return d},_adjustOffsetFromHelper:function(d){if(typeof d=="string")d=d.split(" ");if(a.isArray(d))d={left:+d[0],top:+d[1]||0};if("left"in d)this.offset.click.left=d.left+this.margins.left;if("right"in d)this.offset.click.left=this.helperProportions.width-d.right+this.margins.left;if("top"in d)this.offset.click.top=d.top+this.margins.top;if("bottom"in d)this.offset.click.top=
+this.helperProportions.height-d.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var d=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){d.left+=this.scrollParent.scrollLeft();d.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)d=
+{top:0,left:0};return{top:d.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:d.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var d=this.currentItem.position();return{top:d.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:d.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),
+10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var d=this.options;if(d.containment=="parent")d.containment=this.helper[0].parentNode;if(d.containment=="document"||d.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(d.containment=="document"?
+document:window).width()-this.helperProportions.width-this.margins.left,(a(d.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(d.containment)){var c=a(d.containment)[0];d=a(d.containment).offset();var f=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),
+10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(f?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(f?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(d,c){if(!c)c=
+this.position;d=d=="absolute"?1:-1;var f=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&
+this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())*d)}},_generatePosition:function(d){var c=this.options,f=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=/(html|body)/i.test(f[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();
+var e=d.pageX,i=d.pageY;if(this.originalPosition){if(this.containment){if(d.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(d.pageY-this.offset.click.top<this.containment[1])i=this.containment[1]+this.offset.click.top;if(d.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>this.containment[3])i=this.containment[3]+this.offset.click.top}if(c.grid){i=this.originalPageY+Math.round((i-
+this.originalPageY)/c.grid[1])*c.grid[1];i=this.containment?!(i-this.offset.click.top<this.containment[1]||i-this.offset.click.top>this.containment[3])?i:!(i-this.offset.click.top<this.containment[1])?i-c.grid[1]:i+c.grid[1]:i;e=this.originalPageX+Math.round((e-this.originalPageX)/c.grid[0])*c.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-c.grid[0]:e+c.grid[0]:e}}return{top:i-
+this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():g?0:f.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:f.scrollLeft())}},_rearrange:function(d,c,f,g){f?f[0].appendChild(this.placeholder[0]):c.item[0].parentNode.insertBefore(this.placeholder[0],
+this.direction=="down"?c.item[0]:c.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var e=this,i=this.counter;window.setTimeout(function(){i==e.counter&&e.refreshPositions(!g)},0)},_clear:function(d,c){this.reverting=false;var f=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var g in this._storedCSS)if(this._storedCSS[g]=="auto"||this._storedCSS[g]=="static")this._storedCSS[g]=
+"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!c&&f.push(function(e){this._trigger("receive",e,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!c)f.push(function(e){this._trigger("update",e,this._uiHash())});if(!a.ui.contains(this.element[0],this.currentItem[0])){c||f.push(function(e){this._trigger("remove",
+e,this._uiHash())});for(g=this.containers.length-1;g>=0;g--)if(a.ui.contains(this.containers[g].element[0],this.currentItem[0])&&!c){f.push(function(e){return function(i){e._trigger("receive",i,this._uiHash(this))}}.call(this,this.containers[g]));f.push(function(e){return function(i){e._trigger("update",i,this._uiHash(this))}}.call(this,this.containers[g]))}}for(g=this.containers.length-1;g>=0;g--){c||f.push(function(e){return function(i){e._trigger("deactivate",i,this._uiHash(this))}}.call(this,
+this.containers[g]));if(this.containers[g].containerCache.over){f.push(function(e){return function(i){e._trigger("out",i,this._uiHash(this))}}.call(this,this.containers[g]));this.containers[g].containerCache.over=0}}this._storedCursor&&a("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop",
+d,this._uiHash());for(g=0;g<f.length;g++)f[g].call(this,d);this._trigger("stop",d,this._uiHash())}return false}c||this._trigger("beforeStop",d,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!c){for(g=0;g<f.length;g++)f[g].call(this,d);this._trigger("stop",d,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){a.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},
+_uiHash:function(d){var c=d||this;return{helper:c.helper,placeholder:c.placeholder||a([]),position:c.position,originalPosition:c.originalPosition,offset:c.positionAbs,item:c.currentItem,sender:d?d.element:null}}});a.extend(a.ui.sortable,{version:"1.8.13"})})(jQuery);
+jQuery.effects||function(a,d){function c(n){var k;if(n&&n.constructor==Array&&n.length==3)return n;if(k=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(n))return[parseInt(k[1],10),parseInt(k[2],10),parseInt(k[3],10)];if(k=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(n))return[parseFloat(k[1])*2.55,parseFloat(k[2])*2.55,parseFloat(k[3])*2.55];if(k=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(n))return[parseInt(k[1],
+16),parseInt(k[2],16),parseInt(k[3],16)];if(k=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(n))return[parseInt(k[1]+k[1],16),parseInt(k[2]+k[2],16),parseInt(k[3]+k[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(n))return j.transparent;return j[a.trim(n).toLowerCase()]}function f(n,k){var m;do{m=a.curCSS(n,k);if(m!=""&&m!="transparent"||a.nodeName(n,"body"))break;k="backgroundColor"}while(n=n.parentNode);return c(m)}function g(){var n=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+k={},m,p;if(n&&n.length&&n[0]&&n[n[0]])for(var q=n.length;q--;){m=n[q];if(typeof n[m]=="string"){p=m.replace(/\-(\w)/g,function(s,r){return r.toUpperCase()});k[p]=n[m]}}else for(m in n)if(typeof n[m]==="string")k[m]=n[m];return k}function e(n){var k,m;for(k in n){m=n[k];if(m==null||a.isFunction(m)||k in o||/scrollbar/.test(k)||!/color/i.test(k)&&isNaN(parseFloat(m)))delete n[k]}return n}function i(n,k){var m={_:0},p;for(p in k)if(n[p]!=k[p])m[p]=k[p];return m}function b(n,k,m,p){if(typeof n=="object"){p=
+k;m=null;k=n;n=k.effect}if(a.isFunction(k)){p=k;m=null;k={}}if(typeof k=="number"||a.fx.speeds[k]){p=m;m=k;k={}}if(a.isFunction(m)){p=m;m=null}k=k||{};m=m||k.duration;m=a.fx.off?0:typeof m=="number"?m:m in a.fx.speeds?a.fx.speeds[m]:a.fx.speeds._default;p=p||k.complete;return[n,k,m,p]}function h(n){if(!n||typeof n==="number"||a.fx.speeds[n])return true;if(typeof n==="string"&&!a.effects[n])return true;return false}a.effects={};a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor",
+"borderTopColor","borderColor","color","outlineColor"],function(n,k){a.fx.step[k]=function(m){if(!m.colorInit){m.start=f(m.elem,k);m.end=c(m.end);m.colorInit=true}m.elem.style[k]="rgb("+Math.max(Math.min(parseInt(m.pos*(m.end[0]-m.start[0])+m.start[0],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[1]-m.start[1])+m.start[1],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[2]-m.start[2])+m.start[2],10),255),0)+")"}});var j={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,
+0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,
+211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},l=["add","remove","toggle"],o={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(n,k,m,
+p){if(a.isFunction(m)){p=m;m=null}return this.queue(function(){var q=a(this),s=q.attr("style")||" ",r=e(g.call(this)),u,v=q.attr("class");a.each(l,function(w,x){n[x]&&q[x+"Class"](n[x])});u=e(g.call(this));q.attr("class",v);q.animate(i(r,u),{queue:false,duration:k,easding:m,complete:function(){a.each(l,function(w,x){n[x]&&q[x+"Class"](n[x])});if(typeof q.attr("style")=="object"){q.attr("style").cssText="";q.attr("style").cssText=s}else q.attr("style",s);p&&p.apply(this,arguments);a.dequeue(this)}})})};
+a.fn.extend({_addClass:a.fn.addClass,addClass:function(n,k,m,p){return k?a.effects.animateClass.apply(this,[{add:n},k,m,p]):this._addClass(n)},_removeClass:a.fn.removeClass,removeClass:function(n,k,m,p){return k?a.effects.animateClass.apply(this,[{remove:n},k,m,p]):this._removeClass(n)},_toggleClass:a.fn.toggleClass,toggleClass:function(n,k,m,p,q){return typeof k=="boolean"||k===d?m?a.effects.animateClass.apply(this,[k?{add:n}:{remove:n},m,p,q]):this._toggleClass(n,k):a.effects.animateClass.apply(this,
+[{toggle:n},k,m,p])},switchClass:function(n,k,m,p,q){return a.effects.animateClass.apply(this,[{add:k,remove:n},m,p,q])}});a.extend(a.effects,{version:"1.8.13",save:function(n,k){for(var m=0;m<k.length;m++)k[m]!==null&&n.data("ec.storage."+k[m],n[0].style[k[m]])},restore:function(n,k){for(var m=0;m<k.length;m++)k[m]!==null&&n.css(k[m],n.data("ec.storage."+k[m]))},setMode:function(n,k){if(k=="toggle")k=n.is(":hidden")?"show":"hide";return k},getBaseline:function(n,k){var m;switch(n[0]){case "top":m=
+0;break;case "middle":m=0.5;break;case "bottom":m=1;break;default:m=n[0]/k.height}switch(n[1]){case "left":n=0;break;case "center":n=0.5;break;case "right":n=1;break;default:n=n[1]/k.width}return{x:n,y:m}},createWrapper:function(n){if(n.parent().is(".ui-effects-wrapper"))return n.parent();var k={width:n.outerWidth(true),height:n.outerHeight(true),"float":n.css("float")},m=a("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});
+n.wrap(m);m=n.parent();if(n.css("position")=="static"){m.css({position:"relative"});n.css({position:"relative"})}else{a.extend(k,{position:n.css("position"),zIndex:n.css("z-index")});a.each(["top","left","bottom","right"],function(p,q){k[q]=n.css(q);if(isNaN(parseInt(k[q],10)))k[q]="auto"});n.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return m.css(k).show()},removeWrapper:function(n){if(n.parent().is(".ui-effects-wrapper"))return n.parent().replaceWith(n);return n},setTransition:function(n,
+k,m,p){p=p||{};a.each(k,function(q,s){unit=n.cssUnit(s);if(unit[0]>0)p[s]=unit[0]*m+unit[1]});return p}});a.fn.extend({effect:function(n){var k=b.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var p=a.effects[n];if(a.fx.off||!p)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)});return p.call(this,m)},_show:a.fn.show,show:function(n){if(h(n))return this._show.apply(this,arguments);else{var k=b.apply(this,arguments);
+k[1].mode="show";return this.effect.apply(this,k)}},_hide:a.fn.hide,hide:function(n){if(h(n))return this._hide.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:a.fn.toggle,toggle:function(n){if(h(n)||typeof n==="boolean"||a.isFunction(n))return this.__toggle.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(n){var k=this.css(n),m=[];a.each(["em","px","%",
+"pt"],function(p,q){if(k.indexOf(q)>0)m=[parseFloat(k),q]});return m}});a.easing.jswing=a.easing.swing;a.extend(a.easing,{def:"easeOutQuad",swing:function(n,k,m,p,q){return a.easing[a.easing.def](n,k,m,p,q)},easeInQuad:function(n,k,m,p,q){return p*(k/=q)*k+m},easeOutQuad:function(n,k,m,p,q){return-p*(k/=q)*(k-2)+m},easeInOutQuad:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k+m;return-p/2*(--k*(k-2)-1)+m},easeInCubic:function(n,k,m,p,q){return p*(k/=q)*k*k+m},easeOutCubic:function(n,k,m,p,q){return p*
+((k=k/q-1)*k*k+1)+m},easeInOutCubic:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k+m;return p/2*((k-=2)*k*k+2)+m},easeInQuart:function(n,k,m,p,q){return p*(k/=q)*k*k*k+m},easeOutQuart:function(n,k,m,p,q){return-p*((k=k/q-1)*k*k*k-1)+m},easeInOutQuart:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k+m;return-p/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(n,k,m,p,q){return p*(k/=q)*k*k*k*k+m},easeOutQuint:function(n,k,m,p,q){return p*((k=k/q-1)*k*k*k*k+1)+m},easeInOutQuint:function(n,k,m,p,q){if((k/=
+q/2)<1)return p/2*k*k*k*k*k+m;return p/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(n,k,m,p,q){return-p*Math.cos(k/q*(Math.PI/2))+p+m},easeOutSine:function(n,k,m,p,q){return p*Math.sin(k/q*(Math.PI/2))+m},easeInOutSine:function(n,k,m,p,q){return-p/2*(Math.cos(Math.PI*k/q)-1)+m},easeInExpo:function(n,k,m,p,q){return k==0?m:p*Math.pow(2,10*(k/q-1))+m},easeOutExpo:function(n,k,m,p,q){return k==q?m+p:p*(-Math.pow(2,-10*k/q)+1)+m},easeInOutExpo:function(n,k,m,p,q){if(k==0)return m;if(k==q)return m+p;if((k/=
+q/2)<1)return p/2*Math.pow(2,10*(k-1))+m;return p/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(n,k,m,p,q){return-p*(Math.sqrt(1-(k/=q)*k)-1)+m},easeOutCirc:function(n,k,m,p,q){return p*Math.sqrt(1-(k=k/q-1)*k)+m},easeInOutCirc:function(n,k,m,p,q){if((k/=q/2)<1)return-p/2*(Math.sqrt(1-k*k)-1)+m;return p/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(n,k,m,p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q)==1)return m+p;s||(s=q*0.3);if(r<Math.abs(p)){r=p;n=s/4}else n=s/(2*Math.PI)*Math.asin(p/
+r);return-(r*Math.pow(2,10*(k-=1))*Math.sin((k*q-n)*2*Math.PI/s))+m},easeOutElastic:function(n,k,m,p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q)==1)return m+p;s||(s=q*0.3);if(r<Math.abs(p)){r=p;n=s/4}else n=s/(2*Math.PI)*Math.asin(p/r);return r*Math.pow(2,-10*k)*Math.sin((k*q-n)*2*Math.PI/s)+p+m},easeInOutElastic:function(n,k,m,p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q/2)==2)return m+p;s||(s=q*0.3*1.5);if(r<Math.abs(p)){r=p;n=s/4}else n=s/(2*Math.PI)*Math.asin(p/r);if(k<1)return-0.5*
+r*Math.pow(2,10*(k-=1))*Math.sin((k*q-n)*2*Math.PI/s)+m;return r*Math.pow(2,-10*(k-=1))*Math.sin((k*q-n)*2*Math.PI/s)*0.5+p+m},easeInBack:function(n,k,m,p,q,s){if(s==d)s=1.70158;return p*(k/=q)*k*((s+1)*k-s)+m},easeOutBack:function(n,k,m,p,q,s){if(s==d)s=1.70158;return p*((k=k/q-1)*k*((s+1)*k+s)+1)+m},easeInOutBack:function(n,k,m,p,q,s){if(s==d)s=1.70158;if((k/=q/2)<1)return p/2*k*k*(((s*=1.525)+1)*k-s)+m;return p/2*((k-=2)*k*(((s*=1.525)+1)*k+s)+2)+m},easeInBounce:function(n,k,m,p,q){return p-a.easing.easeOutBounce(n,
+q-k,0,p,q)+m},easeOutBounce:function(n,k,m,p,q){return(k/=q)<1/2.75?p*7.5625*k*k+m:k<2/2.75?p*(7.5625*(k-=1.5/2.75)*k+0.75)+m:k<2.5/2.75?p*(7.5625*(k-=2.25/2.75)*k+0.9375)+m:p*(7.5625*(k-=2.625/2.75)*k+0.984375)+m},easeInOutBounce:function(n,k,m,p,q){if(k<q/2)return a.easing.easeInBounce(n,k*2,0,p,q)*0.5+m;return a.easing.easeOutBounce(n,k*2-q,0,p,q)*0.5+p*0.5+m}})}(jQuery);
+(function(a){a.effects.blind=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right"],g=a.effects.setMode(c,d.options.mode||"hide"),e=d.options.direction||"vertical";a.effects.save(c,f);c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),b=e=="vertical"?"height":"width";e=e=="vertical"?i.height():i.width();g=="show"&&i.css(b,0);var h={};h[b]=g=="show"?e:0;i.animate(h,d.duration,d.options.easing,function(){g=="hide"&&c.hide();a.effects.restore(c,
+f);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()})})}})(jQuery);
+(function(a){a.effects.bounce=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right"],g=a.effects.setMode(c,d.options.mode||"effect"),e=d.options.direction||"up",i=d.options.distance||20,b=d.options.times||5,h=d.duration||250;/show|hide/.test(g)&&f.push("opacity");a.effects.save(c,f);c.show();a.effects.createWrapper(c);var j=e=="up"||e=="down"?"top":"left";e=e=="up"||e=="left"?"pos":"neg";i=d.options.distance||(j=="top"?c.outerHeight({margin:true})/3:c.outerWidth({margin:true})/
+3);if(g=="show")c.css("opacity",0).css(j,e=="pos"?-i:i);if(g=="hide")i/=b*2;g!="hide"&&b--;if(g=="show"){var l={opacity:1};l[j]=(e=="pos"?"+=":"-=")+i;c.animate(l,h/2,d.options.easing);i/=2;b--}for(l=0;l<b;l++){var o={},n={};o[j]=(e=="pos"?"-=":"+=")+i;n[j]=(e=="pos"?"+=":"-=")+i;c.animate(o,h/2,d.options.easing).animate(n,h/2,d.options.easing);i=g=="hide"?i*2:i/2}if(g=="hide"){l={opacity:0};l[j]=(e=="pos"?"-=":"+=")+i;c.animate(l,h/2,d.options.easing,function(){c.hide();a.effects.restore(c,f);a.effects.removeWrapper(c);
+d.callback&&d.callback.apply(this,arguments)})}else{o={};n={};o[j]=(e=="pos"?"-=":"+=")+i;n[j]=(e=="pos"?"+=":"-=")+i;c.animate(o,h/2,d.options.easing).animate(n,h/2,d.options.easing,function(){a.effects.restore(c,f);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments)})}c.queue("fx",function(){c.dequeue()});c.dequeue()})}})(jQuery);
+(function(a){a.effects.clip=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right","height","width"],g=a.effects.setMode(c,d.options.mode||"hide"),e=d.options.direction||"vertical";a.effects.save(c,f);c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"});i=c[0].tagName=="IMG"?i:c;var b={size:e=="vertical"?"height":"width",position:e=="vertical"?"top":"left"};e=e=="vertical"?i.height():i.width();if(g=="show"){i.css(b.size,0);i.css(b.position,
+e/2)}var h={};h[b.size]=g=="show"?e:0;h[b.position]=g=="show"?0:e/2;i.animate(h,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){g=="hide"&&c.hide();a.effects.restore(c,f);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()}})})}})(jQuery);
+(function(a){a.effects.drop=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right","opacity"],g=a.effects.setMode(c,d.options.mode||"hide"),e=d.options.direction||"left";a.effects.save(c,f);c.show();a.effects.createWrapper(c);var i=e=="up"||e=="down"?"top":"left";e=e=="up"||e=="left"?"pos":"neg";var b=d.options.distance||(i=="top"?c.outerHeight({margin:true})/2:c.outerWidth({margin:true})/2);if(g=="show")c.css("opacity",0).css(i,e=="pos"?-b:b);var h={opacity:g==
+"show"?1:0};h[i]=(g=="show"?e=="pos"?"+=":"-=":e=="pos"?"-=":"+=")+b;c.animate(h,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){g=="hide"&&c.hide();a.effects.restore(c,f);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+(function(a){a.effects.explode=function(d){return this.queue(function(){var c=d.options.pieces?Math.round(Math.sqrt(d.options.pieces)):3,f=d.options.pieces?Math.round(Math.sqrt(d.options.pieces)):3;d.options.mode=d.options.mode=="toggle"?a(this).is(":visible")?"hide":"show":d.options.mode;var g=a(this).show().css("visibility","hidden"),e=g.offset();e.top-=parseInt(g.css("marginTop"),10)||0;e.left-=parseInt(g.css("marginLeft"),10)||0;for(var i=g.outerWidth(true),b=g.outerHeight(true),h=0;h<c;h++)for(var j=
+0;j<f;j++)g.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(i/f),top:-h*(b/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:i/f,height:b/c,left:e.left+j*(i/f)+(d.options.mode=="show"?(j-Math.floor(f/2))*(i/f):0),top:e.top+h*(b/c)+(d.options.mode=="show"?(h-Math.floor(c/2))*(b/c):0),opacity:d.options.mode=="show"?0:1}).animate({left:e.left+j*(i/f)+(d.options.mode=="show"?0:(j-Math.floor(f/2))*(i/f)),top:e.top+
+h*(b/c)+(d.options.mode=="show"?0:(h-Math.floor(c/2))*(b/c)),opacity:d.options.mode=="show"?1:0},d.duration||500);setTimeout(function(){d.options.mode=="show"?g.css({visibility:"visible"}):g.css({visibility:"visible"}).hide();d.callback&&d.callback.apply(g[0]);g.dequeue();a("div.ui-effects-explode").remove()},d.duration||500)})}})(jQuery);
+(function(a){a.effects.fade=function(d){return this.queue(function(){var c=a(this),f=a.effects.setMode(c,d.options.mode||"hide");c.animate({opacity:f},{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+(function(a){a.effects.fold=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right"],g=a.effects.setMode(c,d.options.mode||"hide"),e=d.options.size||15,i=!!d.options.horizFirst,b=d.duration?d.duration/2:a.fx.speeds._default/2;a.effects.save(c,f);c.show();var h=a.effects.createWrapper(c).css({overflow:"hidden"}),j=g=="show"!=i,l=j?["width","height"]:["height","width"];j=j?[h.width(),h.height()]:[h.height(),h.width()];var o=/([0-9]+)%/.exec(e);if(o)e=parseInt(o[1],
+10)/100*j[g=="hide"?0:1];if(g=="show")h.css(i?{height:0,width:e}:{height:e,width:0});i={};o={};i[l[0]]=g=="show"?j[0]:e;o[l[1]]=g=="show"?j[1]:0;h.animate(i,b,d.options.easing).animate(o,b,d.options.easing,function(){g=="hide"&&c.hide();a.effects.restore(c,f);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()})})}})(jQuery);
+(function(a){a.effects.highlight=function(d){return this.queue(function(){var c=a(this),f=["backgroundImage","backgroundColor","opacity"],g=a.effects.setMode(c,d.options.mode||"show"),e={backgroundColor:c.css("backgroundColor")};if(g=="hide")e.opacity=0;a.effects.save(c,f);c.show().css({backgroundImage:"none",backgroundColor:d.options.color||"#ffff99"}).animate(e,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){g=="hide"&&c.hide();a.effects.restore(c,f);g=="show"&&!a.support.opacity&&
+this.style.removeAttribute("filter");d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+(function(a){a.effects.pulsate=function(d){return this.queue(function(){var c=a(this),f=a.effects.setMode(c,d.options.mode||"show");times=(d.options.times||5)*2-1;duration=d.duration?d.duration/2:a.fx.speeds._default/2;isVisible=c.is(":visible");animateTo=0;if(!isVisible){c.css("opacity",0).show();animateTo=1}if(f=="hide"&&isVisible||f=="show"&&!isVisible)times--;for(f=0;f<times;f++){c.animate({opacity:animateTo},duration,d.options.easing);animateTo=(animateTo+1)%2}c.animate({opacity:animateTo},duration,
+d.options.easing,function(){animateTo==0&&c.hide();d.callback&&d.callback.apply(this,arguments)});c.queue("fx",function(){c.dequeue()}).dequeue()})}})(jQuery);
+(function(a){a.effects.puff=function(d){return this.queue(function(){var c=a(this),f=a.effects.setMode(c,d.options.mode||"hide"),g=parseInt(d.options.percent,10)||150,e=g/100,i={height:c.height(),width:c.width()};a.extend(d.options,{fade:true,mode:f,percent:f=="hide"?g:100,from:f=="hide"?i:{height:i.height*e,width:i.width*e}});c.effect("scale",d.options,d.duration,d.callback);c.dequeue()})};a.effects.scale=function(d){return this.queue(function(){var c=a(this),f=a.extend(true,{},d.options),g=a.effects.setMode(c,
+d.options.mode||"effect"),e=parseInt(d.options.percent,10)||(parseInt(d.options.percent,10)==0?0:g=="hide"?0:100),i=d.options.direction||"both",b=d.options.origin;if(g!="effect"){f.origin=b||["middle","center"];f.restore=true}b={height:c.height(),width:c.width()};c.from=d.options.from||(g=="show"?{height:0,width:0}:b);e={y:i!="horizontal"?e/100:1,x:i!="vertical"?e/100:1};c.to={height:b.height*e.y,width:b.width*e.x};if(d.options.fade){if(g=="show"){c.from.opacity=0;c.to.opacity=1}if(g=="hide"){c.from.opacity=
+1;c.to.opacity=0}}f.from=c.from;f.to=c.to;f.mode=g;c.effect("size",f,d.duration,d.callback);c.dequeue()})};a.effects.size=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],e=["width","height","overflow"],i=["fontSize"],b=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],h=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],
+j=a.effects.setMode(c,d.options.mode||"effect"),l=d.options.restore||false,o=d.options.scale||"both",n=d.options.origin,k={height:c.height(),width:c.width()};c.from=d.options.from||k;c.to=d.options.to||k;if(n){n=a.effects.getBaseline(n,k);c.from.top=(k.height-c.from.height)*n.y;c.from.left=(k.width-c.from.width)*n.x;c.to.top=(k.height-c.to.height)*n.y;c.to.left=(k.width-c.to.width)*n.x}var m={from:{y:c.from.height/k.height,x:c.from.width/k.width},to:{y:c.to.height/k.height,x:c.to.width/k.width}};
+if(o=="box"||o=="both"){if(m.from.y!=m.to.y){f=f.concat(b);c.from=a.effects.setTransition(c,b,m.from.y,c.from);c.to=a.effects.setTransition(c,b,m.to.y,c.to)}if(m.from.x!=m.to.x){f=f.concat(h);c.from=a.effects.setTransition(c,h,m.from.x,c.from);c.to=a.effects.setTransition(c,h,m.to.x,c.to)}}if(o=="content"||o=="both")if(m.from.y!=m.to.y){f=f.concat(i);c.from=a.effects.setTransition(c,i,m.from.y,c.from);c.to=a.effects.setTransition(c,i,m.to.y,c.to)}a.effects.save(c,l?f:g);c.show();a.effects.createWrapper(c);
+c.css("overflow","hidden").css(c.from);if(o=="content"||o=="both"){b=b.concat(["marginTop","marginBottom"]).concat(i);h=h.concat(["marginLeft","marginRight"]);e=f.concat(b).concat(h);c.find("*[width]").each(function(){child=a(this);l&&a.effects.save(child,e);var p={height:child.height(),width:child.width()};child.from={height:p.height*m.from.y,width:p.width*m.from.x};child.to={height:p.height*m.to.y,width:p.width*m.to.x};if(m.from.y!=m.to.y){child.from=a.effects.setTransition(child,b,m.from.y,child.from);
+child.to=a.effects.setTransition(child,b,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=a.effects.setTransition(child,h,m.from.x,child.from);child.to=a.effects.setTransition(child,h,m.to.x,child.to)}child.css(child.from);child.animate(child.to,d.duration,d.options.easing,function(){l&&a.effects.restore(child,e)})})}c.animate(c.to,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){c.to.opacity===0&&c.css("opacity",c.from.opacity);j=="hide"&&c.hide();a.effects.restore(c,
+l?f:g);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+(function(a){a.effects.shake=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right"];a.effects.setMode(c,d.options.mode||"effect");var g=d.options.direction||"left",e=d.options.distance||20,i=d.options.times||3,b=d.duration||d.options.duration||140;a.effects.save(c,f);c.show();a.effects.createWrapper(c);var h=g=="up"||g=="down"?"top":"left",j=g=="up"||g=="left"?"pos":"neg";g={};var l={},o={};g[h]=(j=="pos"?"-=":"+=")+e;l[h]=(j=="pos"?"+=":"-=")+e*2;o[h]=
+(j=="pos"?"-=":"+=")+e*2;c.animate(g,b,d.options.easing);for(e=1;e<i;e++)c.animate(l,b,d.options.easing).animate(o,b,d.options.easing);c.animate(l,b,d.options.easing).animate(g,b/2,d.options.easing,function(){a.effects.restore(c,f);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments)});c.queue("fx",function(){c.dequeue()});c.dequeue()})}})(jQuery);
+(function(a){a.effects.slide=function(d){return this.queue(function(){var c=a(this),f=["position","top","bottom","left","right"],g=a.effects.setMode(c,d.options.mode||"show"),e=d.options.direction||"left";a.effects.save(c,f);c.show();a.effects.createWrapper(c).css({overflow:"hidden"});var i=e=="up"||e=="down"?"top":"left";e=e=="up"||e=="left"?"pos":"neg";var b=d.options.distance||(i=="top"?c.outerHeight({margin:true}):c.outerWidth({margin:true}));if(g=="show")c.css(i,e=="pos"?isNaN(b)?"-"+b:-b:b);
+var h={};h[i]=(g=="show"?e=="pos"?"+=":"-=":e=="pos"?"-=":"+=")+b;c.animate(h,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){g=="hide"&&c.hide();a.effects.restore(c,f);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+(function(a){a.effects.transfer=function(d){return this.queue(function(){var c=a(this),f=a(d.options.to),g=f.offset();f={top:g.top,left:g.left,height:f.innerHeight(),width:f.innerWidth()};g=c.offset();var e=a('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(d.options.className).css({top:g.top,left:g.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(f,d.duration,d.options.easing,function(){e.remove();d.callback&&d.callback.apply(c[0],arguments);
+c.dequeue()})})}})(jQuery);
+(function(a){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var d=this,c=d.options;d.running=0;d.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");d.headers=
+d.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){c.disabled||a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){c.disabled||a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){c.disabled||a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){c.disabled||a(this).removeClass("ui-state-focus")});d.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(c.navigation){var f=d.element.find("a").filter(c.navigationFilter).eq(0);if(f.length){var g=f.closest(".ui-accordion-header");d.active=g.length?g:f.closest(".ui-accordion-content").prev()}}d.active=d._findActive(d.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");d.active.next().addClass("ui-accordion-content-active");d._createIcons();d.resize();d.element.attr("role","tablist");d.headers.attr("role","tab").bind("keydown.accordion",
+function(e){return d._keydown(e)}).next().attr("role","tabpanel");d.headers.not(d.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();d.active.length?d.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):d.headers.eq(0).attr("tabIndex",0);a.browser.safari||d.headers.find("a").attr("tabIndex",-1);c.event&&d.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(e){d._clickHandler.call(d,e,this);e.preventDefault()})},_createIcons:function(){var d=
+this.options;if(d.icons){a("<span></span>").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var d=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(d.autoHeight||d.fillHeight)c.css("height","");return a.Widget.prototype.destroy.call(this)},_setOption:function(d,c){a.Widget.prototype._setOption.apply(this,arguments);d=="active"&&this.activate(c);if(d=="icons"){this._destroyIcons();
+c&&this._createIcons()}if(d=="disabled")this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(d){if(!(this.options.disabled||d.altKey||d.ctrlKey)){var c=a.ui.keyCode,f=this.headers.length,g=this.headers.index(d.target),e=false;switch(d.keyCode){case c.RIGHT:case c.DOWN:e=this.headers[(g+1)%f];break;case c.LEFT:case c.UP:e=this.headers[(g-1+f)%f];break;case c.SPACE:case c.ENTER:this._clickHandler({target:d.target},d.target);
+d.preventDefault()}if(e){a(d.target).attr("tabIndex",-1);a(e).attr("tabIndex",0);e.focus();return false}return true}},resize:function(){var d=this.options,c;if(d.fillSpace){if(a.browser.msie){var f=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height();a.browser.msie&&this.element.parent().css("overflow",f);this.headers.each(function(){c-=a(this).outerHeight(true)});this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+
+a(this).height()))}).css("overflow","auto")}else if(d.autoHeight){c=0;this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c)}return this},activate:function(d){this.options.active=d;d=this._findActive(d)[0];this._clickHandler({target:d},d);return this},_findActive:function(d){return d?typeof d==="number"?this.headers.filter(":eq("+d+")"):this.headers.not(this.headers.not(d)):d===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(d,c){var f=this.options;
+if(!f.disabled)if(d.target){d=a(d.currentTarget||c);c=d[0]===this.active[0];f.active=f.collapsible&&c?false:this.headers.index(d);if(!(this.running||!f.collapsible&&c)){var g=this.active;h=d.next();i=this.active.next();b={options:f,newHeader:c&&f.collapsible?a([]):d,oldHeader:this.active,newContent:c&&f.collapsible?a([]):h,oldContent:i};var e=this.headers.index(this.active[0])>this.headers.index(d[0]);this.active=c?a([]):d;this._toggle(h,i,b,c,e);g.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(f.icons.headerSelected).addClass(f.icons.header);
+if(!c){d.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(f.icons.header).addClass(f.icons.headerSelected);d.next().addClass("ui-accordion-content-active")}}}else if(f.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(f.icons.headerSelected).addClass(f.icons.header);this.active.next().addClass("ui-accordion-content-active");var i=this.active.next(),
+b={options:f,newHeader:a([]),oldHeader:f.active,newContent:a([]),oldContent:i},h=this.active=a([]);this._toggle(h,i,b)}},_toggle:function(d,c,f,g,e){var i=this,b=i.options;i.toShow=d;i.toHide=c;i.data=f;var h=function(){if(i)return i._completed.apply(i,arguments)};i._trigger("changestart",null,i.data);i.running=c.size()===0?d.size():c.size();if(b.animated){f={};f=b.collapsible&&g?{toShow:a([]),toHide:c,complete:h,down:e,autoHeight:b.autoHeight||b.fillSpace}:{toShow:d,toHide:c,complete:h,down:e,autoHeight:b.autoHeight||
+b.fillSpace};if(!b.proxied)b.proxied=b.animated;if(!b.proxiedDuration)b.proxiedDuration=b.duration;b.animated=a.isFunction(b.proxied)?b.proxied(f):b.proxied;b.duration=a.isFunction(b.proxiedDuration)?b.proxiedDuration(f):b.proxiedDuration;g=a.ui.accordion.animations;var j=b.duration,l=b.animated;if(l&&!g[l]&&!a.easing[l])l="slide";g[l]||(g[l]=function(o){this.slide(o,{easing:l,duration:j||700})});g[l](f)}else{if(b.collapsible&&g)d.toggle();else{c.hide();d.show()}h(true)}c.prev().attr({"aria-expanded":"false",
+"aria-selected":"false",tabIndex:-1}).blur();d.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(d){this.running=d?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});a.extend(a.ui.accordion,{version:"1.8.13",
+animations:{slide:function(d,c){d=a.extend({easing:"swing",duration:300},d,c);if(d.toHide.size())if(d.toShow.size()){var f=d.toShow.css("overflow"),g=0,e={},i={},b;c=d.toShow;b=c[0].style.width;c.width(parseInt(c.parent().width(),10)-parseInt(c.css("paddingLeft"),10)-parseInt(c.css("paddingRight"),10)-(parseInt(c.css("borderLeftWidth"),10)||0)-(parseInt(c.css("borderRightWidth"),10)||0));a.each(["height","paddingTop","paddingBottom"],function(h,j){i[j]="hide";h=(""+a.css(d.toShow[0],j)).match(/^([\d+-.]+)(.*)$/);
+e[j]={value:h[1],unit:h[2]||"px"}});d.toShow.css({height:0,overflow:"hidden"}).show();d.toHide.filter(":hidden").each(d.complete).end().filter(":visible").animate(i,{step:function(h,j){if(j.prop=="height")g=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);d.toShow[0].style[j.prop]=g*e[j.prop].value+e[j.prop].unit},duration:d.duration,easing:d.easing,complete:function(){d.autoHeight||d.toShow.css("height","");d.toShow.css({width:b,overflow:f});d.complete()}})}else d.toHide.animate({height:"hide",
+paddingTop:"hide",paddingBottom:"hide"},d);else d.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},d)},bounceslide:function(d){this.slide(d,{easing:d.down?"easeOutBounce":"swing",duration:d.down?1E3:200})}}})})(jQuery);
+(function(a){var d=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var c=this,f=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(e){if(!(c.options.disabled||c.element.attr("readonly"))){g=
+false;var i=a.ui.keyCode;switch(e.keyCode){case i.PAGE_UP:c._move("previousPage",e);break;case i.PAGE_DOWN:c._move("nextPage",e);break;case i.UP:c._move("previous",e);e.preventDefault();break;case i.DOWN:c._move("next",e);e.preventDefault();break;case i.ENTER:case i.NUMPAD_ENTER:if(c.menu.active){g=true;e.preventDefault()}case i.TAB:if(!c.menu.active)return;c.menu.select(e);break;case i.ESCAPE:c.element.val(c.term);c.close(e);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!=
+c.element.val()){c.selectedItem=null;c.search(null,e)}},c.options.delay);break}}}).bind("keypress.autocomplete",function(e){if(g){g=false;e.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(e){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(e);c._change(e)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)};
+this.menu=a("<ul></ul>").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",f)[0]).mousedown(function(e){var i=c.menu.element[0];a(e.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(b){b.target!==c.element[0]&&b.target!==i&&!a.ui.contains(i,b.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(e,i){i=i.item.data("item.autocomplete");false!==c._trigger("focus",e,{item:i})&&/^key/.test(e.originalEvent.type)&&
+c.element.val(i.value)},selected:function(e,i){var b=i.item.data("item.autocomplete"),h=c.previous;if(c.element[0]!==f.activeElement){c.element.focus();c.previous=h;setTimeout(function(){c.previous=h;c.selectedItem=b},1)}false!==c._trigger("select",e,{item:b})&&c.element.val(b.value);c.term=c.element.val();c.close(e);c.selectedItem=b},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+a.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();a.Widget.prototype.destroy.call(this)},_setOption:function(c,f){a.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(a(f||"body",this.element[0].ownerDocument)[0]);c==="disabled"&&
+f&&this.xhr&&this.xhr.abort()},_initSource:function(){var c=this,f,g;if(a.isArray(this.options.source)){f=this.options.source;this.source=function(e,i){i(a.ui.autocomplete.filter(f,e.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(e,i){c.xhr&&c.xhr.abort();c.xhr=a.ajax({url:g,data:e,dataType:"json",autocompleteRequest:++d,success:function(b){this.autocompleteRequest===d&&i(b)},error:function(){this.autocompleteRequest===d&&i([])}})}}else this.source=
+this.options.source},search:function(c,f){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length<this.options.minLength)return this.close(f);clearTimeout(this.closing);if(this._trigger("search",f)!==false)return this._search(c)},_search:function(c){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:c},this.response)},_response:function(c){if(!this.options.disabled&&c&&c.length){c=this._normalize(c);this._suggest(c);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(c){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",c)}},_change:function(c){this.previous!==this.element.val()&&this._trigger("change",c,{item:this.selectedItem})},_normalize:function(c){if(c.length&&c[0].label&&c[0].value)return c;return a.map(c,function(f){if(typeof f==="string")return{label:f,value:f};return a.extend({label:f.label||
+f.value,value:f.value||f.label},f)})},_suggest:function(c){var f=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(f,c);this.menu.deactivate();this.menu.refresh();f.show();this._resizeMenu();f.position(a.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new a.Event("mouseover"))},_resizeMenu:function(){var c=this.menu.element;c.outerWidth(Math.max(c.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(c,f){var g=this;
+a.each(f,function(e,i){g._renderItem(c,i)})},_renderItem:function(c,f){return a("<li></li>").data("item.autocomplete",f).append(a("<a></a>").text(f.label)).appendTo(c)},_move:function(c,f){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](f);else this.search(null,f)},widget:function(){return this.menu.element}});a.extend(a.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(c,f){var g=new RegExp(a.ui.autocomplete.escapeRegex(f),"i");return a.grep(c,function(e){return g.test(e.label||e.value||e)})}})})(jQuery);
+(function(a){a.widget("ui.menu",{_create:function(){var d=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(a(c.target).closest(".ui-menu-item a").length){c.preventDefault();d.select(c)}});this.refresh()},refresh:function(){var d=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(c){d.activate(c,a(this).parent())}).mouseleave(function(){d.deactivate()})},activate:function(d,c){this.deactivate();if(this.hasScroll()){var f=c.offset().top-this.element.offset().top,g=this.element.scrollTop(),e=this.element.height();if(f<0)this.element.scrollTop(g+f);else f>=e&&this.element.scrollTop(g+f-e+c.height())}this.active=c.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",d,{item:c})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
+this._trigger("blur");this.active=null}},next:function(d){this.move("next",".ui-menu-item:first",d)},previous:function(d){this.move("prev",".ui-menu-item:last",d)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(d,c,f){if(this.active){d=this.active[d+"All"](".ui-menu-item").eq(0);d.length?this.activate(f,d):this.activate(f,this.element.children(c))}else this.activate(f,
+this.element.children(c))},nextPage:function(d){if(this.hasScroll())if(!this.active||this.last())this.activate(d,this.element.children(".ui-menu-item:first"));else{var c=this.active.offset().top,f=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var e=a(this).offset().top-c-f+a(this).height();return e<10&&e>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(d,g)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active||
+this.last()?":first":":last"))},previousPage:function(d){if(this.hasScroll())if(!this.active||this.first())this.activate(d,this.element.children(".ui-menu-item:last"));else{var c=this.active.offset().top,f=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=a(this).offset().top-c+f-a(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(d,result)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active||
+this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[a.fn.prop?"prop":"attr"]("scrollHeight")},select:function(d){this._trigger("selected",d,{item:this.active})}})})(jQuery);
+(function(a){var d,c=function(g){a(":ui-button",g.target.form).each(function(){var e=a(this).data("button");setTimeout(function(){e.refresh()},1)})},f=function(g){var e=g.name,i=g.form,b=a([]);if(e)b=i?a(i).find("[name='"+e+"']"):a("[name='"+e+"']",g.ownerDocument).filter(function(){return!this.form});return b};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
+c);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var g=this,e=this.options,i=this.type==="checkbox"||this.type==="radio",b="ui-state-hover"+(!i?" ui-state-active":"");if(e.label===null)e.label=this.buttonElement.html();if(this.element.is(":disabled"))e.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
+function(){if(!e.disabled){a(this).addClass("ui-state-hover");this===d&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){e.disabled||a(this).removeClass(b)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")}).bind("click.button",function(h){e.disabled&&h.stopImmediatePropagation()});i&&this.element.bind("change.button",function(){g.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",
+function(){if(e.disabled)return false;a(this).toggleClass("ui-state-active");g.buttonElement.attr("aria-pressed",g.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(e.disabled)return false;a(this).addClass("ui-state-active");g.buttonElement.attr("aria-pressed",true);var h=g.element[0];f(h).not(h).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",
+function(){if(e.disabled)return false;a(this).addClass("ui-state-active");d=this;a(document).one("mouseup",function(){d=null})}).bind("mouseup.button",function(){if(e.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(h){if(e.disabled)return false;if(h.keyCode==a.ui.keyCode.SPACE||h.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(h){h.keyCode===
+a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",e.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){var g=this.element.parents().filter(":last"),e="label[for="+this.element.attr("id")+"]";this.buttonElement=g.find(e);if(!this.buttonElement.length){g=g.length?g.siblings():this.element.siblings();this.buttonElement=g.filter(e);
+if(!this.buttonElement.length)this.buttonElement=g.find(e)}this.element.addClass("ui-helper-hidden-accessible");(g=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",g)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());
+this.hasTitle||this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(g,e){a.Widget.prototype._setOption.apply(this,arguments);if(g==="disabled")e?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var g=this.element.is(":disabled");g!==this.options.disabled&&this._setOption("disabled",g);if(this.type==="radio")f(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var g=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
+e=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(g.empty()).text(),i=this.options.icons,b=i.primary&&i.secondary,h=[];if(i.primary||i.secondary){if(this.options.text)h.push("ui-button-text-icon"+(b?"s":i.primary?"-primary":"-secondary"));i.primary&&g.prepend("<span class='ui-button-icon-primary ui-icon "+i.primary+"'></span>");i.secondary&&g.append("<span class='ui-button-icon-secondary ui-icon "+i.secondary+"'></span>");if(!this.options.text){h.push(b?"ui-button-icons-only":
+"ui-button-icon-only");this.hasTitle||g.attr("title",e)}}else h.push("ui-button-text-only");g.addClass(h.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(g,e){g==="disabled"&&this.buttons.button("option",g,e);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
+(function(a,d){function c(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
+"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
+"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
+minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};a.extend(this._defaults,this.regional[""]);this.dpDiv=f(a('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function f(b){return b.delegate("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a",
+"mouseout",function(){a(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&a(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&a(this).removeClass("ui-datepicker-next-hover")}).delegate("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a","mouseover",function(){if(!a.datepicker._isDisabledDatepicker(i.inline?b.parent()[0]:i.input[0])){a(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
+a(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&a(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&a(this).addClass("ui-datepicker-next-hover")}})}function g(b,h){a.extend(b,h);for(var j in h)if(h[j]==null||h[j]==d)b[j]=h[j];return b}a.extend(a.ui,{datepicker:{version:"1.8.13"}});var e=(new Date).getTime(),i;a.extend(c.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},
+_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(b){g(this._defaults,b||{});return this},_attachDatepicker:function(b,h){var j=null;for(var l in this._defaults){var o=b.getAttribute("date:"+l);if(o){j=j||{};try{j[l]=eval(o)}catch(n){j[l]=o}}}l=b.nodeName.toLowerCase();o=l=="div"||l=="span";if(!b.id){this.uuid+=1;b.id="dp"+this.uuid}var k=this._newInst(a(b),o);k.settings=a.extend({},h||{},j||{});if(l=="input")this._connectDatepicker(b,k);else o&&this._inlineDatepicker(b,k)},_newInst:function(b,
+h){return{id:b[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:b,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:h,dpDiv:!h?this.dpDiv:f(a('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(b,h){var j=a(b);h.append=a([]);h.trigger=a([]);if(!j.hasClass(this.markerClassName)){this._attachments(j,h);j.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",
+function(l,o,n){h.settings[o]=n}).bind("getData.datepicker",function(l,o){return this._get(h,o)});this._autoSize(h);a.data(b,"datepicker",h)}},_attachments:function(b,h){var j=this._get(h,"appendText"),l=this._get(h,"isRTL");h.append&&h.append.remove();if(j){h.append=a('<span class="'+this._appendClass+'">'+j+"</span>");b[l?"before":"after"](h.append)}b.unbind("focus",this._showDatepicker);h.trigger&&h.trigger.remove();j=this._get(h,"showOn");if(j=="focus"||j=="both")b.focus(this._showDatepicker);
+if(j=="button"||j=="both"){j=this._get(h,"buttonText");var o=this._get(h,"buttonImage");h.trigger=a(this._get(h,"buttonImageOnly")?a("<img/>").addClass(this._triggerClass).attr({src:o,alt:j,title:j}):a('<button type="button"></button>').addClass(this._triggerClass).html(o==""?j:a("<img/>").attr({src:o,alt:j,title:j})));b[l?"before":"after"](h.trigger);h.trigger.click(function(){a.datepicker._datepickerShowing&&a.datepicker._lastInput==b[0]?a.datepicker._hideDatepicker():a.datepicker._showDatepicker(b[0]);
+return false})}},_autoSize:function(b){if(this._get(b,"autoSize")&&!b.inline){var h=new Date(2009,11,20),j=this._get(b,"dateFormat");if(j.match(/[DM]/)){var l=function(o){for(var n=0,k=0,m=0;m<o.length;m++)if(o[m].length>n){n=o[m].length;k=m}return k};h.setMonth(l(this._get(b,j.match(/MM/)?"monthNames":"monthNamesShort")));h.setDate(l(this._get(b,j.match(/DD/)?"dayNames":"dayNamesShort"))+20-h.getDay())}b.input.attr("size",this._formatDate(b,h).length)}},_inlineDatepicker:function(b,h){var j=a(b);
+if(!j.hasClass(this.markerClassName)){j.addClass(this.markerClassName).append(h.dpDiv).bind("setData.datepicker",function(l,o,n){h.settings[o]=n}).bind("getData.datepicker",function(l,o){return this._get(h,o)});a.data(b,"datepicker",h);this._setDate(h,this._getDefaultDate(h),true);this._updateDatepicker(h);this._updateAlternate(h);h.dpDiv.show()}},_dialogDatepicker:function(b,h,j,l,o){b=this._dialogInst;if(!b){this.uuid+=1;this._dialogInput=a('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+this._dialogInput.keydown(this._doKeyDown);a("body").append(this._dialogInput);b=this._dialogInst=this._newInst(this._dialogInput,false);b.settings={};a.data(this._dialogInput[0],"datepicker",b)}g(b.settings,l||{});h=h&&h.constructor==Date?this._formatDate(b,h):h;this._dialogInput.val(h);this._pos=o?o.length?o:[o.pageX,o.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/
+2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");b.settings.onSelect=j;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);a.blockUI&&a.blockUI(this.dpDiv);a.data(this._dialogInput[0],"datepicker",b);return this},_destroyDatepicker:function(b){var h=a(b),j=a.data(b,"datepicker");if(h.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();a.removeData(b,
+"datepicker");if(l=="input"){j.append.remove();j.trigger.remove();h.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(l=="div"||l=="span")h.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(b){var h=a(b),j=a.data(b,"datepicker");if(h.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();if(l=="input"){b.disabled=false;j.trigger.filter("button").each(function(){this.disabled=
+false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(l=="div"||l=="span"){h=h.children("."+this._inlineClass);h.children().removeClass("ui-state-disabled");h.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o==b?null:o})}},_disableDatepicker:function(b){var h=a(b),j=a.data(b,"datepicker");if(h.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();if(l=="input"){b.disabled=
+true;j.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(l=="div"||l=="span"){h=h.children("."+this._inlineClass);h.children().addClass("ui-state-disabled");h.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o==b?null:o});this._disabledInputs[this._disabledInputs.length]=b}},_isDisabledDatepicker:function(b){if(!b)return false;
+for(var h=0;h<this._disabledInputs.length;h++)if(this._disabledInputs[h]==b)return true;return false},_getInst:function(b){try{return a.data(b,"datepicker")}catch(h){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(b,h,j){var l=this._getInst(b);if(arguments.length==2&&typeof h=="string")return h=="defaults"?a.extend({},a.datepicker._defaults):l?h=="all"?a.extend({},l.settings):this._get(l,h):null;var o=h||{};if(typeof h=="string"){o={};o[h]=j}if(l){this._curInst==l&&
+this._hideDatepicker();var n=this._getDateDatepicker(b,true),k=this._getMinMaxDate(l,"min"),m=this._getMinMaxDate(l,"max");g(l.settings,o);if(k!==null&&o.dateFormat!==d&&o.minDate===d)l.settings.minDate=this._formatDate(l,k);if(m!==null&&o.dateFormat!==d&&o.maxDate===d)l.settings.maxDate=this._formatDate(l,m);this._attachments(a(b),l);this._autoSize(l);this._setDate(l,n);this._updateAlternate(l);this._updateDatepicker(l)}},_changeDatepicker:function(b,h,j){this._optionDatepicker(b,h,j)},_refreshDatepicker:function(b){(b=
+this._getInst(b))&&this._updateDatepicker(b)},_setDateDatepicker:function(b,h){if(b=this._getInst(b)){this._setDate(b,h);this._updateDatepicker(b);this._updateAlternate(b)}},_getDateDatepicker:function(b,h){(b=this._getInst(b))&&!b.inline&&this._setDateFromField(b,h);return b?this._getDate(b):null},_doKeyDown:function(b){var h=a.datepicker._getInst(b.target),j=true,l=h.dpDiv.is(".ui-datepicker-rtl");h._keyEvent=true;if(a.datepicker._datepickerShowing)switch(b.keyCode){case 9:a.datepicker._hideDatepicker();
+j=false;break;case 13:j=a("td."+a.datepicker._dayOverClass+":not(."+a.datepicker._currentClass+")",h.dpDiv);j[0]?a.datepicker._selectDay(b.target,h.selectedMonth,h.selectedYear,j[0]):a.datepicker._hideDatepicker();return false;case 27:a.datepicker._hideDatepicker();break;case 33:a.datepicker._adjustDate(b.target,b.ctrlKey?-a.datepicker._get(h,"stepBigMonths"):-a.datepicker._get(h,"stepMonths"),"M");break;case 34:a.datepicker._adjustDate(b.target,b.ctrlKey?+a.datepicker._get(h,"stepBigMonths"):+a.datepicker._get(h,
+"stepMonths"),"M");break;case 35:if(b.ctrlKey||b.metaKey)a.datepicker._clearDate(b.target);j=b.ctrlKey||b.metaKey;break;case 36:if(b.ctrlKey||b.metaKey)a.datepicker._gotoToday(b.target);j=b.ctrlKey||b.metaKey;break;case 37:if(b.ctrlKey||b.metaKey)a.datepicker._adjustDate(b.target,l?+1:-1,"D");j=b.ctrlKey||b.metaKey;if(b.originalEvent.altKey)a.datepicker._adjustDate(b.target,b.ctrlKey?-a.datepicker._get(h,"stepBigMonths"):-a.datepicker._get(h,"stepMonths"),"M");break;case 38:if(b.ctrlKey||b.metaKey)a.datepicker._adjustDate(b.target,
+-7,"D");j=b.ctrlKey||b.metaKey;break;case 39:if(b.ctrlKey||b.metaKey)a.datepicker._adjustDate(b.target,l?-1:+1,"D");j=b.ctrlKey||b.metaKey;if(b.originalEvent.altKey)a.datepicker._adjustDate(b.target,b.ctrlKey?+a.datepicker._get(h,"stepBigMonths"):+a.datepicker._get(h,"stepMonths"),"M");break;case 40:if(b.ctrlKey||b.metaKey)a.datepicker._adjustDate(b.target,+7,"D");j=b.ctrlKey||b.metaKey;break;default:j=false}else if(b.keyCode==36&&b.ctrlKey)a.datepicker._showDatepicker(this);else j=false;if(j){b.preventDefault();
+b.stopPropagation()}},_doKeyPress:function(b){var h=a.datepicker._getInst(b.target);if(a.datepicker._get(h,"constrainInput")){h=a.datepicker._possibleChars(a.datepicker._get(h,"dateFormat"));var j=String.fromCharCode(b.charCode==d?b.keyCode:b.charCode);return b.ctrlKey||b.metaKey||j<" "||!h||h.indexOf(j)>-1}},_doKeyUp:function(b){b=a.datepicker._getInst(b.target);if(b.input.val()!=b.lastVal)try{if(a.datepicker.parseDate(a.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,a.datepicker._getFormatConfig(b))){a.datepicker._setDateFromField(b);
+a.datepicker._updateAlternate(b);a.datepicker._updateDatepicker(b)}}catch(h){a.datepicker.log(h)}return true},_showDatepicker:function(b){b=b.target||b;if(b.nodeName.toLowerCase()!="input")b=a("input",b.parentNode)[0];if(!(a.datepicker._isDisabledDatepicker(b)||a.datepicker._lastInput==b)){var h=a.datepicker._getInst(b);a.datepicker._curInst&&a.datepicker._curInst!=h&&a.datepicker._curInst.dpDiv.stop(true,true);var j=a.datepicker._get(h,"beforeShow");g(h.settings,j?j.apply(b,[b,h]):{});h.lastVal=
+null;a.datepicker._lastInput=b;a.datepicker._setDateFromField(h);if(a.datepicker._inDialog)b.value="";if(!a.datepicker._pos){a.datepicker._pos=a.datepicker._findPos(b);a.datepicker._pos[1]+=b.offsetHeight}var l=false;a(b).parents().each(function(){l|=a(this).css("position")=="fixed";return!l});if(l&&a.browser.opera){a.datepicker._pos[0]-=document.documentElement.scrollLeft;a.datepicker._pos[1]-=document.documentElement.scrollTop}j={left:a.datepicker._pos[0],top:a.datepicker._pos[1]};a.datepicker._pos=
+null;h.dpDiv.empty();h.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});a.datepicker._updateDatepicker(h);j=a.datepicker._checkOffset(h,j,l);h.dpDiv.css({position:a.datepicker._inDialog&&a.blockUI?"static":l?"fixed":"absolute",display:"none",left:j.left+"px",top:j.top+"px"});if(!h.inline){j=a.datepicker._get(h,"showAnim");var o=a.datepicker._get(h,"duration"),n=function(){var k=h.dpDiv.find("iframe.ui-datepicker-cover");if(k.length){var m=a.datepicker._getBorders(h.dpDiv);k.css({left:-m[0],
+top:-m[1],width:h.dpDiv.outerWidth(),height:h.dpDiv.outerHeight()})}};h.dpDiv.zIndex(a(b).zIndex()+1);a.datepicker._datepickerShowing=true;a.effects&&a.effects[j]?h.dpDiv.show(j,a.datepicker._get(h,"showOptions"),o,n):h.dpDiv[j||"show"](j?o:null,n);if(!j||!o)n();h.input.is(":visible")&&!h.input.is(":disabled")&&h.input.focus();a.datepicker._curInst=h}}},_updateDatepicker:function(b){var h=a.datepicker._getBorders(b.dpDiv);i=b;b.dpDiv.empty().append(this._generateHTML(b));var j=b.dpDiv.find("iframe.ui-datepicker-cover");
+j.length&&j.css({left:-h[0],top:-h[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()});b.dpDiv.find("."+this._dayOverClass+" a").mouseover();h=this._getNumberOfMonths(b);j=h[1];b.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");j>1&&b.dpDiv.addClass("ui-datepicker-multi-"+j).css("width",17*j+"em");b.dpDiv[(h[0]!=1||h[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");b.dpDiv[(this._get(b,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");
+b==a.datepicker._curInst&&a.datepicker._datepickerShowing&&b.input&&b.input.is(":visible")&&!b.input.is(":disabled")&&b.input[0]!=document.activeElement&&b.input.focus();if(b.yearshtml){var l=b.yearshtml;setTimeout(function(){l===b.yearshtml&&b.yearshtml&&b.dpDiv.find("select.ui-datepicker-year:first").replaceWith(b.yearshtml);l=b.yearshtml=null},0)}},_getBorders:function(b){var h=function(j){return{thin:1,medium:2,thick:3}[j]||j};return[parseFloat(h(b.css("border-left-width"))),parseFloat(h(b.css("border-top-width")))]},
+_checkOffset:function(b,h,j){var l=b.dpDiv.outerWidth(),o=b.dpDiv.outerHeight(),n=b.input?b.input.outerWidth():0,k=b.input?b.input.outerHeight():0,m=document.documentElement.clientWidth+a(document).scrollLeft(),p=document.documentElement.clientHeight+a(document).scrollTop();h.left-=this._get(b,"isRTL")?l-n:0;h.left-=j&&h.left==b.input.offset().left?a(document).scrollLeft():0;h.top-=j&&h.top==b.input.offset().top+k?a(document).scrollTop():0;h.left-=Math.min(h.left,h.left+l>m&&m>l?Math.abs(h.left+l-
+m):0);h.top-=Math.min(h.top,h.top+o>p&&p>o?Math.abs(o+k):0);return h},_findPos:function(b){for(var h=this._get(this._getInst(b),"isRTL");b&&(b.type=="hidden"||b.nodeType!=1||a.expr.filters.hidden(b));)b=b[h?"previousSibling":"nextSibling"];b=a(b).offset();return[b.left,b.top]},_hideDatepicker:function(b){var h=this._curInst;if(!(!h||b&&h!=a.data(b,"datepicker")))if(this._datepickerShowing){b=this._get(h,"showAnim");var j=this._get(h,"duration"),l=function(){a.datepicker._tidyDialog(h);this._curInst=
+null};a.effects&&a.effects[b]?h.dpDiv.hide(b,a.datepicker._get(h,"showOptions"),j,l):h.dpDiv[b=="slideDown"?"slideUp":b=="fadeIn"?"fadeOut":"hide"](b?j:null,l);b||l();if(b=this._get(h,"onClose"))b.apply(h.input?h.input[0]:null,[h.input?h.input.val():"",h]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(a.blockUI){a.unblockUI();a("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(b){b.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},
+_checkExternalClick:function(b){if(a.datepicker._curInst){b=a(b.target);b[0].id!=a.datepicker._mainDivId&&b.parents("#"+a.datepicker._mainDivId).length==0&&!b.hasClass(a.datepicker.markerClassName)&&!b.hasClass(a.datepicker._triggerClass)&&a.datepicker._datepickerShowing&&!(a.datepicker._inDialog&&a.blockUI)&&a.datepicker._hideDatepicker()}},_adjustDate:function(b,h,j){b=a(b);var l=this._getInst(b[0]);if(!this._isDisabledDatepicker(b[0])){this._adjustInstDate(l,h+(j=="M"?this._get(l,"showCurrentAtPos"):
+0),j);this._updateDatepicker(l)}},_gotoToday:function(b){b=a(b);var h=this._getInst(b[0]);if(this._get(h,"gotoCurrent")&&h.currentDay){h.selectedDay=h.currentDay;h.drawMonth=h.selectedMonth=h.currentMonth;h.drawYear=h.selectedYear=h.currentYear}else{var j=new Date;h.selectedDay=j.getDate();h.drawMonth=h.selectedMonth=j.getMonth();h.drawYear=h.selectedYear=j.getFullYear()}this._notifyChange(h);this._adjustDate(b)},_selectMonthYear:function(b,h,j){b=a(b);var l=this._getInst(b[0]);l._selectingMonthYear=
+false;l["selected"+(j=="M"?"Month":"Year")]=l["draw"+(j=="M"?"Month":"Year")]=parseInt(h.options[h.selectedIndex].value,10);this._notifyChange(l);this._adjustDate(b)},_clickMonthYear:function(b){var h=this._getInst(a(b)[0]);h.input&&h._selectingMonthYear&&setTimeout(function(){h.input.focus()},0);h._selectingMonthYear=!h._selectingMonthYear},_selectDay:function(b,h,j,l){var o=a(b);if(!(a(l).hasClass(this._unselectableClass)||this._isDisabledDatepicker(o[0]))){o=this._getInst(o[0]);o.selectedDay=o.currentDay=
+a("a",l).html();o.selectedMonth=o.currentMonth=h;o.selectedYear=o.currentYear=j;this._selectDate(b,this._formatDate(o,o.currentDay,o.currentMonth,o.currentYear))}},_clearDate:function(b){b=a(b);this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(b,h){b=this._getInst(a(b)[0]);h=h!=null?h:this._formatDate(b);b.input&&b.input.val(h);this._updateAlternate(b);var j=this._get(b,"onSelect");if(j)j.apply(b.input?b.input[0]:null,[h,b]);else b.input&&b.input.trigger("change");if(b.inline)this._updateDatepicker(b);
+else{this._hideDatepicker();this._lastInput=b.input[0];typeof b.input[0]!="object"&&b.input.focus();this._lastInput=null}},_updateAlternate:function(b){var h=this._get(b,"altField");if(h){var j=this._get(b,"altFormat")||this._get(b,"dateFormat"),l=this._getDate(b),o=this.formatDate(j,l,this._getFormatConfig(b));a(h).each(function(){a(this).val(o)})}},noWeekends:function(b){b=b.getDay();return[b>0&&b<6,""]},iso8601Week:function(b){b=new Date(b.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var h=
+b.getTime();b.setMonth(0);b.setDate(1);return Math.floor(Math.round((h-b)/864E5)/7)+1},parseDate:function(b,h,j){if(b==null||h==null)throw"Invalid arguments";h=typeof h=="object"?h.toString():h+"";if(h=="")return null;var l=(j?j.shortYearCutoff:null)||this._defaults.shortYearCutoff;l=typeof l!="string"?l:(new Date).getFullYear()%100+parseInt(l,10);for(var o=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,n=(j?j.dayNames:null)||this._defaults.dayNames,k=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort,
+m=(j?j.monthNames:null)||this._defaults.monthNames,p=j=-1,q=-1,s=-1,r=false,u=function(y){(y=G+1<b.length&&b.charAt(G+1)==y)&&G++;return y},v=function(y){var H=u(y);y=new RegExp("^\\d{1,"+(y=="@"?14:y=="!"?20:y=="y"&&H?4:y=="o"?3:2)+"}");y=h.substring(z).match(y);if(!y)throw"Missing number at position "+z;z+=y[0].length;return parseInt(y[0],10)},w=function(y,H,N){y=a.map(u(y)?N:H,function(D,E){return[[E,D]]}).sort(function(D,E){return-(D[1].length-E[1].length)});var J=-1;a.each(y,function(D,E){D=
+E[1];if(h.substr(z,D.length).toLowerCase()==D.toLowerCase()){J=E[0];z+=D.length;return false}});if(J!=-1)return J+1;else throw"Unknown name at position "+z;},x=function(){if(h.charAt(z)!=b.charAt(G))throw"Unexpected literal at position "+z;z++},z=0,G=0;G<b.length;G++)if(r)if(b.charAt(G)=="'"&&!u("'"))r=false;else x();else switch(b.charAt(G)){case "d":q=v("d");break;case "D":w("D",o,n);break;case "o":s=v("o");break;case "m":p=v("m");break;case "M":p=w("M",k,m);break;case "y":j=v("y");break;case "@":var C=
+new Date(v("@"));j=C.getFullYear();p=C.getMonth()+1;q=C.getDate();break;case "!":C=new Date((v("!")-this._ticksTo1970)/1E4);j=C.getFullYear();p=C.getMonth()+1;q=C.getDate();break;case "'":if(u("'"))x();else r=true;break;default:x()}if(j==-1)j=(new Date).getFullYear();else if(j<100)j+=(new Date).getFullYear()-(new Date).getFullYear()%100+(j<=l?0:-100);if(s>-1){p=1;q=s;do{l=this._getDaysInMonth(j,p-1);if(q<=l)break;p++;q-=l}while(1)}C=this._daylightSavingAdjust(new Date(j,p-1,q));if(C.getFullYear()!=
+j||C.getMonth()+1!=p||C.getDate()!=q)throw"Invalid date";return C},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(b,h,j){if(!h)return"";var l=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,o=(j?j.dayNames:null)||this._defaults.dayNames,
+n=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort;j=(j?j.monthNames:null)||this._defaults.monthNames;var k=function(u){(u=r+1<b.length&&b.charAt(r+1)==u)&&r++;return u},m=function(u,v,w){v=""+v;if(k(u))for(;v.length<w;)v="0"+v;return v},p=function(u,v,w,x){return k(u)?x[v]:w[v]},q="",s=false;if(h)for(var r=0;r<b.length;r++)if(s)if(b.charAt(r)=="'"&&!k("'"))s=false;else q+=b.charAt(r);else switch(b.charAt(r)){case "d":q+=m("d",h.getDate(),2);break;case "D":q+=p("D",h.getDay(),l,o);break;
+case "o":q+=m("o",(h.getTime()-(new Date(h.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":q+=m("m",h.getMonth()+1,2);break;case "M":q+=p("M",h.getMonth(),n,j);break;case "y":q+=k("y")?h.getFullYear():(h.getYear()%100<10?"0":"")+h.getYear()%100;break;case "@":q+=h.getTime();break;case "!":q+=h.getTime()*1E4+this._ticksTo1970;break;case "'":if(k("'"))q+="'";else s=true;break;default:q+=b.charAt(r)}return q},_possibleChars:function(b){for(var h="",j=false,l=function(n){(n=o+1<b.length&&b.charAt(o+
+1)==n)&&o++;return n},o=0;o<b.length;o++)if(j)if(b.charAt(o)=="'"&&!l("'"))j=false;else h+=b.charAt(o);else switch(b.charAt(o)){case "d":case "m":case "y":case "@":h+="0123456789";break;case "D":case "M":return null;case "'":if(l("'"))h+="'";else j=true;break;default:h+=b.charAt(o)}return h},_get:function(b,h){return b.settings[h]!==d?b.settings[h]:this._defaults[h]},_setDateFromField:function(b,h){if(b.input.val()!=b.lastVal){var j=this._get(b,"dateFormat"),l=b.lastVal=b.input?b.input.val():null,
+o,n;o=n=this._getDefaultDate(b);var k=this._getFormatConfig(b);try{o=this.parseDate(j,l,k)||n}catch(m){this.log(m);l=h?"":l}b.selectedDay=o.getDate();b.drawMonth=b.selectedMonth=o.getMonth();b.drawYear=b.selectedYear=o.getFullYear();b.currentDay=l?o.getDate():0;b.currentMonth=l?o.getMonth():0;b.currentYear=l?o.getFullYear():0;this._adjustInstDate(b)}},_getDefaultDate:function(b){return this._restrictMinMax(b,this._determineDate(b,this._get(b,"defaultDate"),new Date))},_determineDate:function(b,h,
+j){var l=function(n){var k=new Date;k.setDate(k.getDate()+n);return k},o=function(n){try{return a.datepicker.parseDate(a.datepicker._get(b,"dateFormat"),n,a.datepicker._getFormatConfig(b))}catch(k){}var m=(n.toLowerCase().match(/^c/)?a.datepicker._getDate(b):null)||new Date,p=m.getFullYear(),q=m.getMonth();m=m.getDate();for(var s=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,r=s.exec(n);r;){switch(r[2]||"d"){case "d":case "D":m+=parseInt(r[1],10);break;case "w":case "W":m+=parseInt(r[1],10)*7;break;case "m":case "M":q+=
+parseInt(r[1],10);m=Math.min(m,a.datepicker._getDaysInMonth(p,q));break;case "y":case "Y":p+=parseInt(r[1],10);m=Math.min(m,a.datepicker._getDaysInMonth(p,q));break}r=s.exec(n)}return new Date(p,q,m)};if(h=(h=h==null||h===""?j:typeof h=="string"?o(h):typeof h=="number"?isNaN(h)?j:l(h):new Date(h.getTime()))&&h.toString()=="Invalid Date"?j:h){h.setHours(0);h.setMinutes(0);h.setSeconds(0);h.setMilliseconds(0)}return this._daylightSavingAdjust(h)},_daylightSavingAdjust:function(b){if(!b)return null;
+b.setHours(b.getHours()>12?b.getHours()+2:0);return b},_setDate:function(b,h,j){var l=!h,o=b.selectedMonth,n=b.selectedYear;h=this._restrictMinMax(b,this._determineDate(b,h,new Date));b.selectedDay=b.currentDay=h.getDate();b.drawMonth=b.selectedMonth=b.currentMonth=h.getMonth();b.drawYear=b.selectedYear=b.currentYear=h.getFullYear();if((o!=b.selectedMonth||n!=b.selectedYear)&&!j)this._notifyChange(b);this._adjustInstDate(b);if(b.input)b.input.val(l?"":this._formatDate(b))},_getDate:function(b){return!b.currentYear||
+b.input&&b.input.val()==""?null:this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay))},_generateHTML:function(b){var h=new Date;h=this._daylightSavingAdjust(new Date(h.getFullYear(),h.getMonth(),h.getDate()));var j=this._get(b,"isRTL"),l=this._get(b,"showButtonPanel"),o=this._get(b,"hideIfNoPrevNext"),n=this._get(b,"navigationAsDateFormat"),k=this._getNumberOfMonths(b),m=this._get(b,"showCurrentAtPos"),p=this._get(b,"stepMonths"),q=k[0]!=1||k[1]!=1,s=this._daylightSavingAdjust(!b.currentDay?
+new Date(9999,9,9):new Date(b.currentYear,b.currentMonth,b.currentDay)),r=this._getMinMaxDate(b,"min"),u=this._getMinMaxDate(b,"max");m=b.drawMonth-m;var v=b.drawYear;if(m<0){m+=12;v--}if(u){var w=this._daylightSavingAdjust(new Date(u.getFullYear(),u.getMonth()-k[0]*k[1]+1,u.getDate()));for(w=r&&w<r?r:w;this._daylightSavingAdjust(new Date(v,m,1))>w;){m--;if(m<0){m=11;v--}}}b.drawMonth=m;b.drawYear=v;w=this._get(b,"prevText");w=!n?w:this.formatDate(w,this._daylightSavingAdjust(new Date(v,m-p,1)),this._getFormatConfig(b));
+w=this._canAdjustMonth(b,-1,v,m)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+b.id+"', -"+p+", 'M');\" title=\""+w+'"><span class="ui-icon ui-icon-circle-triangle-'+(j?"e":"w")+'">'+w+"</span></a>":o?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+w+'"><span class="ui-icon ui-icon-circle-triangle-'+(j?"e":"w")+'">'+w+"</span></a>";var x=this._get(b,"nextText");x=!n?x:this.formatDate(x,this._daylightSavingAdjust(new Date(v,
+m+p,1)),this._getFormatConfig(b));o=this._canAdjustMonth(b,+1,v,m)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+e+".datepicker._adjustDate('#"+b.id+"', +"+p+", 'M');\" title=\""+x+'"><span class="ui-icon ui-icon-circle-triangle-'+(j?"w":"e")+'">'+x+"</span></a>":o?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+x+'"><span class="ui-icon ui-icon-circle-triangle-'+(j?"w":"e")+'">'+x+"</span></a>";p=this._get(b,"currentText");x=this._get(b,"gotoCurrent")&&
+b.currentDay?s:h;p=!n?p:this.formatDate(p,x,this._getFormatConfig(b));n=!b.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+e+'.datepicker._hideDatepicker();">'+this._get(b,"closeText")+"</button>":"";l=l?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(j?n:"")+(this._isInRange(b,x)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+
+e+".datepicker._gotoToday('#"+b.id+"');\">"+p+"</button>":"")+(j?"":n)+"</div>":"";n=parseInt(this._get(b,"firstDay"),10);n=isNaN(n)?0:n;p=this._get(b,"showWeek");x=this._get(b,"dayNames");this._get(b,"dayNamesShort");var z=this._get(b,"dayNamesMin"),G=this._get(b,"monthNames"),C=this._get(b,"monthNamesShort"),y=this._get(b,"beforeShowDay"),H=this._get(b,"showOtherMonths"),N=this._get(b,"selectOtherMonths");this._get(b,"calculateWeek");for(var J=this._getDefaultDate(b),D="",E=0;E<k[0];E++){for(var P=
+"",L=0;L<k[1];L++){var Q=this._daylightSavingAdjust(new Date(v,m,b.selectedDay)),B=" ui-corner-all",F="";if(q){F+='<div class="ui-datepicker-group';if(k[1]>1)switch(L){case 0:F+=" ui-datepicker-group-first";B=" ui-corner-"+(j?"right":"left");break;case k[1]-1:F+=" ui-datepicker-group-last";B=" ui-corner-"+(j?"left":"right");break;default:F+=" ui-datepicker-group-middle";B="";break}F+='">'}F+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+B+'">'+(/all|left/.test(B)&&E==0?j?
+o:w:"")+(/all|right/.test(B)&&E==0?j?w:o:"")+this._generateMonthYearHeader(b,m,v,r,u,E>0||L>0,G,C)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var I=p?'<th class="ui-datepicker-week-col">'+this._get(b,"weekHeader")+"</th>":"";for(B=0;B<7;B++){var A=(B+n)%7;I+="<th"+((B+n+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+x[A]+'">'+z[A]+"</span></th>"}F+=I+"</tr></thead><tbody>";I=this._getDaysInMonth(v,m);if(v==b.selectedYear&&m==b.selectedMonth)b.selectedDay=Math.min(b.selectedDay,
+I);B=(this._getFirstDayOfMonth(v,m)-n+7)%7;I=q?6:Math.ceil((B+I)/7);A=this._daylightSavingAdjust(new Date(v,m,1-B));for(var R=0;R<I;R++){F+="<tr>";var S=!p?"":'<td class="ui-datepicker-week-col">'+this._get(b,"calculateWeek")(A)+"</td>";for(B=0;B<7;B++){var M=y?y.apply(b.input?b.input[0]:null,[A]):[true,""],K=A.getMonth()!=m,O=K&&!N||!M[0]||r&&A<r||u&&A>u;S+='<td class="'+((B+n+6)%7>=5?" ui-datepicker-week-end":"")+(K?" ui-datepicker-other-month":"")+(A.getTime()==Q.getTime()&&m==b.selectedMonth&&
+b._keyEvent||J.getTime()==A.getTime()&&J.getTime()==Q.getTime()?" "+this._dayOverClass:"")+(O?" "+this._unselectableClass+" ui-state-disabled":"")+(K&&!H?"":" "+M[1]+(A.getTime()==s.getTime()?" "+this._currentClass:"")+(A.getTime()==h.getTime()?" ui-datepicker-today":""))+'"'+((!K||H)&&M[2]?' title="'+M[2]+'"':"")+(O?"":' onclick="DP_jQuery_'+e+".datepicker._selectDay('#"+b.id+"',"+A.getMonth()+","+A.getFullYear()+', this);return false;"')+">"+(K&&!H?"&#xa0;":O?'<span class="ui-state-default">'+A.getDate()+
+"</span>":'<a class="ui-state-default'+(A.getTime()==h.getTime()?" ui-state-highlight":"")+(A.getTime()==s.getTime()?" ui-state-active":"")+(K?" ui-priority-secondary":"")+'" href="#">'+A.getDate()+"</a>")+"</td>";A.setDate(A.getDate()+1);A=this._daylightSavingAdjust(A)}F+=S+"</tr>"}m++;if(m>11){m=0;v++}F+="</tbody></table>"+(q?"</div>"+(k[0]>0&&L==k[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");P+=F}D+=P}D+=l+(a.browser.msie&&parseInt(a.browser.version,10)<7&&!b.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':
+"");b._keyEvent=false;return D},_generateMonthYearHeader:function(b,h,j,l,o,n,k,m){var p=this._get(b,"changeMonth"),q=this._get(b,"changeYear"),s=this._get(b,"showMonthAfterYear"),r='<div class="ui-datepicker-title">',u="";if(n||!p)u+='<span class="ui-datepicker-month">'+k[h]+"</span>";else{k=l&&l.getFullYear()==j;var v=o&&o.getFullYear()==j;u+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+b.id+"', this, 'M');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+
+b.id+"');\">";for(var w=0;w<12;w++)if((!k||w>=l.getMonth())&&(!v||w<=o.getMonth()))u+='<option value="'+w+'"'+(w==h?' selected="selected"':"")+">"+m[w]+"</option>";u+="</select>"}s||(r+=u+(n||!(p&&q)?"&#xa0;":""));if(!b.yearshtml){b.yearshtml="";if(n||!q)r+='<span class="ui-datepicker-year">'+j+"</span>";else{m=this._get(b,"yearRange").split(":");var x=(new Date).getFullYear();k=function(z){z=z.match(/c[+-].*/)?j+parseInt(z.substring(1),10):z.match(/[+-].*/)?x+parseInt(z,10):parseInt(z,10);return isNaN(z)?
+x:z};h=k(m[0]);m=Math.max(h,k(m[1]||""));h=l?Math.max(h,l.getFullYear()):h;m=o?Math.min(m,o.getFullYear()):m;for(b.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+e+".datepicker._selectMonthYear('#"+b.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+e+".datepicker._clickMonthYear('#"+b.id+"');\">";h<=m;h++)b.yearshtml+='<option value="'+h+'"'+(h==j?' selected="selected"':"")+">"+h+"</option>";b.yearshtml+="</select>";r+=b.yearshtml;b.yearshtml=null}}r+=this._get(b,"yearSuffix");if(s)r+=
+(n||!(p&&q)?"&#xa0;":"")+u;r+="</div>";return r},_adjustInstDate:function(b,h,j){var l=b.drawYear+(j=="Y"?h:0),o=b.drawMonth+(j=="M"?h:0);h=Math.min(b.selectedDay,this._getDaysInMonth(l,o))+(j=="D"?h:0);l=this._restrictMinMax(b,this._daylightSavingAdjust(new Date(l,o,h)));b.selectedDay=l.getDate();b.drawMonth=b.selectedMonth=l.getMonth();b.drawYear=b.selectedYear=l.getFullYear();if(j=="M"||j=="Y")this._notifyChange(b)},_restrictMinMax:function(b,h){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,
+"max");h=j&&h<j?j:h;return h=b&&h>b?b:h},_notifyChange:function(b){var h=this._get(b,"onChangeMonthYear");if(h)h.apply(b.input?b.input[0]:null,[b.selectedYear,b.selectedMonth+1,b])},_getNumberOfMonths:function(b){b=this._get(b,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(b,h){return this._determineDate(b,this._get(b,h+"Date"),null)},_getDaysInMonth:function(b,h){return 32-this._daylightSavingAdjust(new Date(b,h,32)).getDate()},_getFirstDayOfMonth:function(b,
+h){return(new Date(b,h,1)).getDay()},_canAdjustMonth:function(b,h,j,l){var o=this._getNumberOfMonths(b);j=this._daylightSavingAdjust(new Date(j,l+(h<0?h:o[0]*o[1]),1));h<0&&j.setDate(this._getDaysInMonth(j.getFullYear(),j.getMonth()));return this._isInRange(b,j)},_isInRange:function(b,h){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");return(!j||h.getTime()>=j.getTime())&&(!b||h.getTime()<=b.getTime())},_getFormatConfig:function(b){var h=this._get(b,"shortYearCutoff");h=typeof h!=
+"string"?h:(new Date).getFullYear()%100+parseInt(h,10);return{shortYearCutoff:h,dayNamesShort:this._get(b,"dayNamesShort"),dayNames:this._get(b,"dayNames"),monthNamesShort:this._get(b,"monthNamesShort"),monthNames:this._get(b,"monthNames")}},_formatDate:function(b,h,j,l){if(!h){b.currentDay=b.selectedDay;b.currentMonth=b.selectedMonth;b.currentYear=b.selectedYear}h=h?typeof h=="object"?h:this._daylightSavingAdjust(new Date(l,j,h)):this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay));
+return this.formatDate(this._get(b,"dateFormat"),h,this._getFormatConfig(b))}});a.fn.datepicker=function(b){if(!this.length)return this;if(!a.datepicker.initialized){a(document).mousedown(a.datepicker._checkExternalClick).find("body").append(a.datepicker.dpDiv);a.datepicker.initialized=true}var h=Array.prototype.slice.call(arguments,1);if(typeof b=="string"&&(b=="isDisabled"||b=="getDate"||b=="widget"))return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(h));if(b=="option"&&
+arguments.length==2&&typeof arguments[1]=="string")return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(h));return this.each(function(){typeof b=="string"?a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this].concat(h)):a.datepicker._attachDatepicker(this,b)})};a.datepicker=new c;a.datepicker.initialized=false;a.datepicker.uuid=(new Date).getTime();a.datepicker.version="1.8.13";window["DP_jQuery_"+e]=a})(jQuery);
+(function(a,d){var c={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},f={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},g=a.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};a.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,
+position:{my:"center",at:"center",collision:"fit",using:function(e){var i=a(this).css(e).offset().top;i<0&&a(this).css("top",e.top-i)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var e=this,i=e.options,b=i.title||"&#160;",h=a.ui.dialog.getTitleId(e.element),j=(e.uiDialog=a("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
+i.dialogClass).css({zIndex:i.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){if(i.closeOnEscape&&n.keyCode&&n.keyCode===a.ui.keyCode.ESCAPE){e.close(n);n.preventDefault()}}).attr({role:"dialog","aria-labelledby":h}).mousedown(function(n){e.moveToTop(false,n)});e.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j);var l=(e.uiDialogTitlebar=a("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j),
+o=a('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){o.addClass("ui-state-hover")},function(){o.removeClass("ui-state-hover")}).focus(function(){o.addClass("ui-state-focus")}).blur(function(){o.removeClass("ui-state-focus")}).click(function(n){e.close(n);return false}).appendTo(l);(e.uiDialogTitlebarCloseText=a("<span></span>")).addClass("ui-icon ui-icon-closethick").text(i.closeText).appendTo(o);a("<span></span>").addClass("ui-dialog-title").attr("id",
+h).html(b).prependTo(l);if(a.isFunction(i.beforeclose)&&!a.isFunction(i.beforeClose))i.beforeClose=i.beforeclose;l.find("*").add(l).disableSelection();i.draggable&&a.fn.draggable&&e._makeDraggable();i.resizable&&a.fn.resizable&&e._makeResizable();e._createButtons(i.buttons);e._isOpen=false;a.fn.bgiframe&&j.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var e=this;e.overlay&&e.overlay.destroy();e.uiDialog.hide();e.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
+e.uiDialog.remove();e.originalTitle&&e.element.attr("title",e.originalTitle);return e},widget:function(){return this.uiDialog},close:function(e){var i=this,b,h;if(false!==i._trigger("beforeClose",e)){i.overlay&&i.overlay.destroy();i.uiDialog.unbind("keypress.ui-dialog");i._isOpen=false;if(i.options.hide)i.uiDialog.hide(i.options.hide,function(){i._trigger("close",e)});else{i.uiDialog.hide();i._trigger("close",e)}a.ui.dialog.overlay.resize();if(i.options.modal){b=0;a(".ui-dialog").each(function(){if(this!==
+i.uiDialog[0]){h=a(this).css("z-index");isNaN(h)||(b=Math.max(b,h))}});a.ui.dialog.maxZ=b}return i}},isOpen:function(){return this._isOpen},moveToTop:function(e,i){var b=this,h=b.options;if(h.modal&&!e||!h.stack&&!h.modal)return b._trigger("focus",i);if(h.zIndex>a.ui.dialog.maxZ)a.ui.dialog.maxZ=h.zIndex;if(b.overlay){a.ui.dialog.maxZ+=1;b.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)}e={scrollTop:b.element.attr("scrollTop"),scrollLeft:b.element.attr("scrollLeft")};a.ui.dialog.maxZ+=
+1;b.uiDialog.css("z-index",a.ui.dialog.maxZ);b.element.attr(e);b._trigger("focus",i);return b},open:function(){if(!this._isOpen){var e=this,i=e.options,b=e.uiDialog;e.overlay=i.modal?new a.ui.dialog.overlay(e):null;e._size();e._position(i.position);b.show(i.show);e.moveToTop(true);i.modal&&b.bind("keypress.ui-dialog",function(h){if(h.keyCode===a.ui.keyCode.TAB){var j=a(":tabbable",this),l=j.filter(":first");j=j.filter(":last");if(h.target===j[0]&&!h.shiftKey){l.focus(1);return false}else if(h.target===
+l[0]&&h.shiftKey){j.focus(1);return false}}});a(e.element.find(":tabbable").get().concat(b.find(".ui-dialog-buttonpane :tabbable").get().concat(b.get()))).eq(0).focus();e._isOpen=true;e._trigger("open");return e}},_createButtons:function(e){var i=this,b=false,h=a("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),j=a("<div></div>").addClass("ui-dialog-buttonset").appendTo(h);i.uiDialog.find(".ui-dialog-buttonpane").remove();typeof e==="object"&&e!==null&&a.each(e,
+function(){return!(b=true)});if(b){a.each(e,function(l,o){o=a.isFunction(o)?{click:o,text:l}:o;var n=a('<button type="button"></button>').click(function(){o.click.apply(i.element[0],arguments)}).appendTo(j);a.each(o,function(k,m){if(k!=="click")k in g?n[k](m):n.attr(k,m)});a.fn.button&&n.button()});h.appendTo(i.uiDialog)}},_makeDraggable:function(){function e(l){return{position:l.position,offset:l.offset}}var i=this,b=i.options,h=a(document),j;i.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",
+handle:".ui-dialog-titlebar",containment:"document",start:function(l,o){j=b.height==="auto"?"auto":a(this).height();a(this).height(a(this).height()).addClass("ui-dialog-dragging");i._trigger("dragStart",l,e(o))},drag:function(l,o){i._trigger("drag",l,e(o))},stop:function(l,o){b.position=[o.position.left-h.scrollLeft(),o.position.top-h.scrollTop()];a(this).removeClass("ui-dialog-dragging").height(j);i._trigger("dragStop",l,e(o));a.ui.dialog.overlay.resize()}})},_makeResizable:function(e){function i(l){return{originalPosition:l.originalPosition,
+originalSize:l.originalSize,position:l.position,size:l.size}}e=e===d?this.options.resizable:e;var b=this,h=b.options,j=b.uiDialog.css("position");e=typeof e==="string"?e:"n,e,s,w,se,sw,ne,nw";b.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:b.element,maxWidth:h.maxWidth,maxHeight:h.maxHeight,minWidth:h.minWidth,minHeight:b._minHeight(),handles:e,start:function(l,o){a(this).addClass("ui-dialog-resizing");b._trigger("resizeStart",l,i(o))},resize:function(l,o){b._trigger("resize",
+l,i(o))},stop:function(l,o){a(this).removeClass("ui-dialog-resizing");h.height=a(this).height();h.width=a(this).width();b._trigger("resizeStop",l,i(o));a.ui.dialog.overlay.resize()}}).css("position",j).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var e=this.options;return e.height==="auto"?e.minHeight:Math.min(e.minHeight,e.height)},_position:function(e){var i=[],b=[0,0],h;if(e){if(typeof e==="string"||typeof e==="object"&&"0"in e){i=e.split?e.split(" "):
+[e[0],e[1]];if(i.length===1)i[1]=i[0];a.each(["left","top"],function(j,l){if(+i[j]===i[j]){b[j]=i[j];i[j]=l}});e={my:i.join(" "),at:i.join(" "),offset:b.join(" ")}}e=a.extend({},a.ui.dialog.prototype.options.position,e)}else e=a.ui.dialog.prototype.options.position;(h=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},e));h||this.uiDialog.hide()},_setOptions:function(e){var i=this,b={},h=false;a.each(e,function(j,l){i._setOption(j,l);
+if(j in c)h=true;if(j in f)b[j]=l});h&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",b)},_setOption:function(e,i){var b=this,h=b.uiDialog;switch(e){case "beforeclose":e="beforeClose";break;case "buttons":b._createButtons(i);break;case "closeText":b.uiDialogTitlebarCloseText.text(""+i);break;case "dialogClass":h.removeClass(b.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+i);break;case "disabled":i?h.addClass("ui-dialog-disabled"):
+h.removeClass("ui-dialog-disabled");break;case "draggable":var j=h.is(":data(draggable)");j&&!i&&h.draggable("destroy");!j&&i&&b._makeDraggable();break;case "position":b._position(i);break;case "resizable":(j=h.is(":data(resizable)"))&&!i&&h.resizable("destroy");j&&typeof i==="string"&&h.resizable("option","handles",i);!j&&i!==false&&b._makeResizable(i);break;case "title":a(".ui-dialog-title",b.uiDialogTitlebar).html(""+(i||"&#160;"));break}a.Widget.prototype._setOption.apply(b,arguments)},_size:function(){var e=
+this.options,i,b,h=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(e.minWidth>e.width)e.width=e.minWidth;i=this.uiDialog.css({height:"auto",width:e.width}).height();b=Math.max(0,e.minHeight-i);if(e.height==="auto")if(a.support.minHeight)this.element.css({minHeight:b,height:"auto"});else{this.uiDialog.show();e=this.element.css("height","auto").height();h||this.uiDialog.hide();this.element.height(Math.max(e,b))}else this.element.height(Math.max(e.height-
+i,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});a.extend(a.ui.dialog,{version:"1.8.13",uuid:0,maxZ:0,getTitleId:function(e){e=e.attr("id");if(!e){this.uuid+=1;e=this.uuid}return"ui-dialog-title-"+e},overlay:function(e){this.$el=a.ui.dialog.overlay.create(e)}});a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(e){return e+".dialog-overlay"}).join(" "),
+create:function(e){if(this.instances.length===0){setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()<a.ui.dialog.overlay.maxZ)return false})},1);a(document).bind("keydown.dialog-overlay",function(b){if(e.options.closeOnEscape&&b.keyCode&&b.keyCode===a.ui.keyCode.ESCAPE){e.close(b);b.preventDefault()}});a(window).bind("resize.dialog-overlay",a.ui.dialog.overlay.resize)}var i=(this.oldInstances.pop()||a("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});a.fn.bgiframe&&i.bgiframe();this.instances.push(i);return i},destroy:function(e){var i=a.inArray(e,this.instances);i!=-1&&this.oldInstances.push(this.instances.splice(i,1)[0]);this.instances.length===0&&a([document,window]).unbind(".dialog-overlay");e.remove();var b=0;a.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var e,i;if(a.browser.msie&&a.browser.version<7){e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+i=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return e<i?a(window).height()+"px":e+"px"}else return a(document).height()+"px"},width:function(){var e,i;if(a.browser.msie&&a.browser.version<7){e=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);i=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return e<i?a(window).width()+"px":e+"px"}else return a(document).width()+"px"},resize:function(){var e=a([]);a.each(a.ui.dialog.overlay.instances,
+function(){e=e.add(this)});e.css({width:0,height:0}).css({width:a.ui.dialog.overlay.width(),height:a.ui.dialog.overlay.height()})}});a.extend(a.ui.dialog.overlay.prototype,{destroy:function(){a.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
+(function(a){a.ui=a.ui||{};var d=/left|center|right/,c=/top|center|bottom/,f=a.fn.position,g=a.fn.offset;a.fn.position=function(e){if(!e||!e.of)return f.apply(this,arguments);e=a.extend({},e);var i=a(e.of),b=i[0],h=(e.collision||"flip").split(" "),j=e.offset?e.offset.split(" "):[0,0],l,o,n;if(b.nodeType===9){l=i.width();o=i.height();n={top:0,left:0}}else if(b.setTimeout){l=i.width();o=i.height();n={top:i.scrollTop(),left:i.scrollLeft()}}else if(b.preventDefault){e.at="left top";l=o=0;n={top:e.of.pageY,
+left:e.of.pageX}}else{l=i.outerWidth();o=i.outerHeight();n=i.offset()}a.each(["my","at"],function(){var k=(e[this]||"").split(" ");if(k.length===1)k=d.test(k[0])?k.concat(["center"]):c.test(k[0])?["center"].concat(k):["center","center"];k[0]=d.test(k[0])?k[0]:"center";k[1]=c.test(k[1])?k[1]:"center";e[this]=k});if(h.length===1)h[1]=h[0];j[0]=parseInt(j[0],10)||0;if(j.length===1)j[1]=j[0];j[1]=parseInt(j[1],10)||0;if(e.at[0]==="right")n.left+=l;else if(e.at[0]==="center")n.left+=l/2;if(e.at[1]==="bottom")n.top+=
+o;else if(e.at[1]==="center")n.top+=o/2;n.left+=j[0];n.top+=j[1];return this.each(function(){var k=a(this),m=k.outerWidth(),p=k.outerHeight(),q=parseInt(a.curCSS(this,"marginLeft",true))||0,s=parseInt(a.curCSS(this,"marginTop",true))||0,r=m+q+(parseInt(a.curCSS(this,"marginRight",true))||0),u=p+s+(parseInt(a.curCSS(this,"marginBottom",true))||0),v=a.extend({},n),w;if(e.my[0]==="right")v.left-=m;else if(e.my[0]==="center")v.left-=m/2;if(e.my[1]==="bottom")v.top-=p;else if(e.my[1]==="center")v.top-=
+p/2;v.left=Math.round(v.left);v.top=Math.round(v.top);w={left:v.left-q,top:v.top-s};a.each(["left","top"],function(x,z){a.ui.position[h[x]]&&a.ui.position[h[x]][z](v,{targetWidth:l,targetHeight:o,elemWidth:m,elemHeight:p,collisionPosition:w,collisionWidth:r,collisionHeight:u,offset:j,my:e.my,at:e.at})});a.fn.bgiframe&&k.bgiframe();k.offset(a.extend(v,{using:e.using}))})};a.ui.position={fit:{left:function(e,i){var b=a(window);b=i.collisionPosition.left+i.collisionWidth-b.width()-b.scrollLeft();e.left=
+b>0?e.left-b:Math.max(e.left-i.collisionPosition.left,e.left)},top:function(e,i){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();e.top=b>0?e.top-b:Math.max(e.top-i.collisionPosition.top,e.top)}},flip:{left:function(e,i){if(i.at[0]!=="center"){var b=a(window);b=i.collisionPosition.left+i.collisionWidth-b.width()-b.scrollLeft();var h=i.my[0]==="left"?-i.elemWidth:i.my[0]==="right"?i.elemWidth:0,j=i.at[0]==="left"?i.targetWidth:-i.targetWidth,l=-2*i.offset[0];e.left+=
+i.collisionPosition.left<0?h+j+l:b>0?h+j+l:0}},top:function(e,i){if(i.at[1]!=="center"){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();var h=i.my[1]==="top"?-i.elemHeight:i.my[1]==="bottom"?i.elemHeight:0,j=i.at[1]==="top"?i.targetHeight:-i.targetHeight,l=-2*i.offset[1];e.top+=i.collisionPosition.top<0?h+j+l:b>0?h+j+l:0}}}};if(!a.offset.setOffset){a.offset.setOffset=function(e,i){if(/static/.test(a.curCSS(e,"position")))e.style.position="relative";var b=a(e),
+h=b.offset(),j=parseInt(a.curCSS(e,"top",true),10)||0,l=parseInt(a.curCSS(e,"left",true),10)||0;h={top:i.top-h.top+j,left:i.left-h.left+l};"using"in i?i.using.call(e,h):b.css(h)};a.fn.offset=function(e){var i=this[0];if(!i||!i.ownerDocument)return null;if(e)return this.each(function(){a.offset.setOffset(this,e)});return g.call(this)}}})(jQuery);
+(function(a,d){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=a("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();a.Widget.prototype.destroy.apply(this,arguments)},value:function(c){if(c===d)return this._value();this._setOption("value",c);return this},_setOption:function(c,f){if(c==="value"){this.options.value=f;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var c=this.options.value;if(typeof c!=="number")c=0;return Math.min(this.options.max,Math.max(this.min,c))},_percentage:function(){return 100*
+this._value()/this.options.max},_refreshValue:function(){var c=this.value(),f=this._percentage();if(this.oldValue!==c){this.oldValue=c;this._trigger("change")}this.valueDiv.toggle(c>this.min).toggleClass("ui-corner-right",c===this.options.max).width(f.toFixed(0)+"%");this.element.attr("aria-valuenow",c)}});a.extend(a.ui.progressbar,{version:"1.8.13"})})(jQuery);
+(function(a){a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var d=this,c=this.options,f=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),g=c.values&&c.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+
+this.orientation+" ui-widget ui-widget-content ui-corner-all"+(c.disabled?" ui-slider-disabled ui-disabled":""));this.range=a([]);if(c.range){if(c.range===true){if(!c.values)c.values=[this._valueMin(),this._valueMin()];if(c.values.length&&c.values.length!==2)c.values=[c.values[0],c.values[0]]}this.range=a("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(c.range==="min"||c.range==="max"?" ui-slider-range-"+c.range:""))}for(var i=f.length;i<g;i+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>");
+this.handles=f.add(a(e.join("")).appendTo(d.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(b){b.preventDefault()}).hover(function(){c.disabled||a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){if(c.disabled)a(this).blur();else{a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(b){a(this).data("index.ui-slider-handle",
+b)});this.handles.keydown(function(b){var h=true,j=a(this).data("index.ui-slider-handle"),l,o,n;if(!d.options.disabled){switch(b.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.PAGE_UP:case a.ui.keyCode.PAGE_DOWN:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:h=false;if(!d._keySliding){d._keySliding=true;a(this).addClass("ui-state-active");l=d._start(b,j);if(l===false)return}break}n=d.options.step;l=d.options.values&&d.options.values.length?
+(o=d.values(j)):(o=d.value());switch(b.keyCode){case a.ui.keyCode.HOME:o=d._valueMin();break;case a.ui.keyCode.END:o=d._valueMax();break;case a.ui.keyCode.PAGE_UP:o=d._trimAlignValue(l+(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.PAGE_DOWN:o=d._trimAlignValue(l-(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(l===d._valueMax())return;o=d._trimAlignValue(l+n);break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(l===d._valueMin())return;o=d._trimAlignValue(l-
+n);break}d._slide(b,j,o);return h}}).keyup(function(b){var h=a(this).data("index.ui-slider-handle");if(d._keySliding){d._keySliding=false;d._stop(b,h);d._change(b,h);a(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();
+return this},_mouseCapture:function(d){var c=this.options,f,g,e,i,b;if(c.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();f=this._normValueFromMouse({x:d.pageX,y:d.pageY});g=this._valueMax()-this._valueMin()+1;i=this;this.handles.each(function(h){var j=Math.abs(f-i.values(h));if(g>j){g=j;e=a(this);b=h}});if(c.range===true&&this.values(1)===c.min){b+=1;e=a(this.handles[b])}if(this._start(d,b)===false)return false;
+this._mouseSliding=true;i._handleIndex=b;e.addClass("ui-state-active").focus();c=e.offset();this._clickOffset=!a(d.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:d.pageX-c.left-e.width()/2,top:d.pageY-c.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(d,b,f);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(d){var c=
+this._normValueFromMouse({x:d.pageX,y:d.pageY});this._slide(d,this._handleIndex,c);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c;if(this.orientation==="horizontal"){c=
+this.elementSize.width;d=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;d=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}c=d/c;if(c>1)c=1;if(c<0)c=0;if(this.orientation==="vertical")c=1-c;d=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+c*d)},_start:function(d,c){var f={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){f.value=this.values(c);
+f.values=this.values()}return this._trigger("start",d,f)},_slide:function(d,c,f){var g;if(this.options.values&&this.options.values.length){g=this.values(c?0:1);if(this.options.values.length===2&&this.options.range===true&&(c===0&&f>g||c===1&&f<g))f=g;if(f!==this.values(c)){g=this.values();g[c]=f;d=this._trigger("slide",d,{handle:this.handles[c],value:f,values:g});this.values(c?0:1);d!==false&&this.values(c,f,true)}}else if(f!==this.value()){d=this._trigger("slide",d,{handle:this.handles[c],value:f});
+d!==false&&this.value(f)}},_stop:function(d,c){var f={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){f.value=this.values(c);f.values=this.values()}this._trigger("stop",d,f)},_change:function(d,c){if(!this._keySliding&&!this._mouseSliding){var f={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){f.value=this.values(c);f.values=this.values()}this._trigger("change",d,f)}},value:function(d){if(arguments.length){this.options.value=
+this._trimAlignValue(d);this._refreshValue();this._change(null,0)}else return this._value()},values:function(d,c){var f,g,e;if(arguments.length>1){this.options.values[d]=this._trimAlignValue(c);this._refreshValue();this._change(null,d)}else if(arguments.length)if(a.isArray(arguments[0])){f=this.options.values;g=arguments[0];for(e=0;e<f.length;e+=1){f[e]=this._trimAlignValue(g[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(d):
+this.value();else return this._values()},_setOption:function(d,c){var f,g=0;if(a.isArray(this.options.values))g=this.options.values.length;a.Widget.prototype._setOption.apply(this,arguments);switch(d){case "disabled":if(c){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
+this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(f=0;f<g;f+=1)this._change(null,f);this._animateOff=false;break}},_value:function(){var d=this.options.value;return d=this._trimAlignValue(d)},_values:function(d){var c,f;if(arguments.length){c=this.options.values[d];
+return c=this._trimAlignValue(c)}else{c=this.options.values.slice();for(f=0;f<c.length;f+=1)c[f]=this._trimAlignValue(c[f]);return c}},_trimAlignValue:function(d){if(d<=this._valueMin())return this._valueMin();if(d>=this._valueMax())return this._valueMax();var c=this.options.step>0?this.options.step:1,f=(d-this._valueMin())%c;alignValue=d-f;if(Math.abs(f)*2>=c)alignValue+=f>0?c:-c;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
+_refreshValue:function(){var d=this.options.range,c=this.options,f=this,g=!this._animateOff?c.animate:false,e,i={},b,h,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(o){e=(f.values(o)-f._valueMin())/(f._valueMax()-f._valueMin())*100;i[f.orientation==="horizontal"?"left":"bottom"]=e+"%";a(this).stop(1,1)[g?"animate":"css"](i,c.animate);if(f.options.range===true)if(f.orientation==="horizontal"){if(o===0)f.range.stop(1,1)[g?"animate":"css"]({left:e+"%"},c.animate);
+if(o===1)f.range[g?"animate":"css"]({width:e-b+"%"},{queue:false,duration:c.animate})}else{if(o===0)f.range.stop(1,1)[g?"animate":"css"]({bottom:e+"%"},c.animate);if(o===1)f.range[g?"animate":"css"]({height:e-b+"%"},{queue:false,duration:c.animate})}b=e});else{h=this.value();j=this._valueMin();l=this._valueMax();e=l!==j?(h-j)/(l-j)*100:0;i[f.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[g?"animate":"css"](i,c.animate);if(d==="min"&&this.orientation==="horizontal")this.range.stop(1,
+1)[g?"animate":"css"]({width:e+"%"},c.animate);if(d==="max"&&this.orientation==="horizontal")this.range[g?"animate":"css"]({width:100-e+"%"},{queue:false,duration:c.animate});if(d==="min"&&this.orientation==="vertical")this.range.stop(1,1)[g?"animate":"css"]({height:e+"%"},c.animate);if(d==="max"&&this.orientation==="vertical")this.range[g?"animate":"css"]({height:100-e+"%"},{queue:false,duration:c.animate})}}});a.extend(a.ui.slider,{version:"1.8.13"})})(jQuery);
+(function(a,d){function c(){return++g}function f(){return++e}var g=0,e=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading&#8230;</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(i,b){if(i=="selected")this.options.collapsible&&
+b==this.options.selected||this.select(b);else{this.options[i]=b;this._tabify()}},_tabId:function(i){return i.title&&i.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+c()},_sanitizeSelector:function(i){return i.replace(/:/g,"\\:")},_cookie:function(){var i=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+f());return a.cookie.apply(null,[i].concat(a.makeArray(arguments)))},_ui:function(i,b){return{tab:i,panel:b,index:this.anchors.index(i)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var i=
+a(this);i.html(i.data("label.tabs")).removeData("label.tabs")})},_tabify:function(i){function b(r,u){r.css("display","");!a.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var h=this,j=this.options,l=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=a(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);this.anchors.each(function(r,u){var v=a(u).attr("href"),w=v.split("#")[0],x;if(w&&(w===location.toString().split("#")[0]||
+(x=a("base")[0])&&w===x.href)){v=u.hash;u.href=v}if(l.test(v))h.panels=h.panels.add(h.element.find(h._sanitizeSelector(v)));else if(v&&v!=="#"){a.data(u,"href.tabs",v);a.data(u,"load.tabs",v.replace(/#.*$/,""));v=h._tabId(u);u.href="#"+v;u=h.element.find("#"+v);if(!u.length){u=a(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(h.panels[r-1]||h.list);u.data("destroy.tabs",true)}h.panels=h.panels.add(u)}else j.disabled.push(r)});if(i){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===d){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(h._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=a.unique(j.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(r){return h.lis.index(r)}))).sort();a.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(a.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(j.selected>=0&&this.anchors.length){h.element.find(h._sanitizeSelector(h.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");h.element.queue("tabs",function(){h._trigger("show",null,h._ui(h.anchors[j.selected],h.element.find(h._sanitizeSelector(h.anchors[j.selected].hash))[0]))});this.load(j.selected)}a(window).bind("unload",function(){h.lis.add(h.anchors).unbind(".tabs");h.lis=h.anchors=h.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
+this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);i=0;for(var o;o=this.lis[i];i++)a(o)[a.inArray(i,j.disabled)!=-1&&!a(o).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var n=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+
+r)};this.lis.bind("mouseover.tabs",function(){n("hover",a(this))});this.lis.bind("mouseout.tabs",function(){k("hover",a(this))});this.anchors.bind("focus.tabs",function(){n("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",a(this).closest("li"))})}var m,p;if(j.fx)if(a.isArray(j.fx)){m=j.fx[0];p=j.fx[1]}else m=p=j.fx;var q=p?function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(p,p.duration||"normal",
+function(){b(u,p);h._trigger("show",null,h._ui(r,u[0]))})}:function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");h._trigger("show",null,h._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){h.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");b(u,m);h.element.dequeue("tabs")})}:function(r,u){h.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");h.element.dequeue("tabs")};
+this.anchors.bind(j.event+".tabs",function(){var r=this,u=a(r).closest("li"),v=h.panels.filter(":not(.ui-tabs-hide)"),w=h.element.find(h._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||h.panels.filter(":animated").length||h._trigger("select",null,h._ui(this,w[0]))===false){this.blur();return false}j.selected=h.anchors.index(this);h.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected=
+-1;j.cookie&&h._cookie(j.selected,j.cookie);h.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&h._cookie(j.selected,j.cookie);h.element.queue("tabs",function(){q(r,w)});h.load(h.anchors.index(this));this.blur();return false}j.cookie&&h._cookie(j.selected,j.cookie);if(w.length){v.length&&h.element.queue("tabs",function(){s(r,v)});h.element.queue("tabs",function(){q(r,w)});h.load(h.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
+a.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(i){if(typeof i=="string")i=this.anchors.index(this.anchors.filter("[href$="+i+"]"));return i},destroy:function(){var i=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var b=
+a.data(this,"href.tabs");if(b)this.href=b;var h=a(this).unbind(".tabs");a.each(["href","load","cache"],function(j,l){h.removeData(l+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});i.cookie&&this._cookie(null,i.cookie);return this},add:function(i,
+b,h){if(h===d)h=this.anchors.length;var j=this,l=this.options;b=a(l.tabTemplate.replace(/#\{href\}/g,i).replace(/#\{label\}/g,b));i=!i.indexOf("#")?i.replace("#",""):this._tabId(a("a",b)[0]);b.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var o=j.element.find("#"+i);o.length||(o=a(l.panelTemplate).attr("id",i).data("destroy.tabs",true));o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(h>=this.lis.length){b.appendTo(this.list);o.appendTo(this.list[0].parentNode)}else{b.insertBefore(this.lis[h]);
+o.insertBefore(this.panels[h])}l.disabled=a.map(l.disabled,function(n){return n>=h?++n:n});this._tabify();if(this.anchors.length==1){l.selected=0;b.addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[h],this.panels[h]));return this},remove:function(i){i=this._getIndex(i);var b=this.options,h=this.lis.eq(i).remove(),j=this.panels.eq(i).remove();
+if(h.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(i+(i+1<this.anchors.length?1:-1));b.disabled=a.map(a.grep(b.disabled,function(l){return l!=i}),function(l){return l>=i?--l:l});this._tabify();this._trigger("remove",null,this._ui(h.find("a")[0],j[0]));return this},enable:function(i){i=this._getIndex(i);var b=this.options;if(a.inArray(i,b.disabled)!=-1){this.lis.eq(i).removeClass("ui-state-disabled");b.disabled=a.grep(b.disabled,function(h){return h!=i});this._trigger("enable",null,
+this._ui(this.anchors[i],this.panels[i]));return this}},disable:function(i){i=this._getIndex(i);var b=this.options;if(i!=b.selected){this.lis.eq(i).addClass("ui-state-disabled");b.disabled.push(i);b.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[i],this.panels[i]))}return this},select:function(i){i=this._getIndex(i);if(i==-1)if(this.options.collapsible&&this.options.selected!=-1)i=this.options.selected;else return this;this.anchors.eq(i).trigger(this.options.event+".tabs");return this},
+load:function(i){i=this._getIndex(i);var b=this,h=this.options,j=this.anchors.eq(i)[0],l=a.data(j,"load.tabs");this.abort();if(!l||this.element.queue("tabs").length!==0&&a.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(i).addClass("ui-state-processing");if(h.spinner){var o=a("span",j);o.data("label.tabs",o.html()).html(h.spinner)}this.xhr=a.ajax(a.extend({},h.ajaxOptions,{url:l,success:function(n,k){b.element.find(b._sanitizeSelector(j.hash)).html(n);b._cleanup();h.cache&&a.data(j,
+"cache.tabs",true);b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{h.ajaxOptions.success(n,k)}catch(m){}},error:function(n,k){b._cleanup();b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{h.ajaxOptions.error(n,k,i,j)}catch(m){}}}));b.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
+url:function(i,b){this.anchors.eq(i).removeData("cache.tabs").data("load.tabs",b);return this},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.8.13"});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(i,b){var h=this,j=this.options,l=h._rotate||(h._rotate=function(o){clearTimeout(h.rotation);h.rotation=setTimeout(function(){var n=j.selected;h.select(++n<h.anchors.length?n:0)},i);o&&o.stopPropagation()});b=h._unrotate||(h._unrotate=!b?function(o){o.clientX&&
+h.rotate(null)}:function(){t=j.selected;l()});if(i){this.element.bind("tabsshow",l);this.anchors.bind(j.event+".tabs",b);l()}else{clearTimeout(h.rotation);this.element.unbind("tabsshow",l);this.anchors.unbind(j.event+".tabs",b);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
diff --git a/lib/scripts/jquery/jquery.js b/lib/scripts/jquery/jquery.js
index fff677643..5d5a1d58e 100644
--- a/lib/scripts/jquery/jquery.js
+++ b/lib/scripts/jquery/jquery.js
@@ -1,24 +1,30 @@
/*!
- * jQuery JavaScript Library v1.4.2
+ * jQuery JavaScript Library v1.6.1
* http://jquery.com/
*
- * Copyright 2010, John Resig
+ * Copyright 2011, John Resig
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* Includes Sizzle.js
* http://sizzlejs.com/
- * Copyright 2010, The Dojo Foundation
+ * Copyright 2011, The Dojo Foundation
* Released under the MIT, BSD, and GPL Licenses.
*
- * Date: Sat Feb 13 22:33:48 2010 -0500
+ * Date: Thu May 12 15:04:36 2011 -0400
*/
(function( window, undefined ) {
+// Use the correct document accordingly with window argument (sandbox)
+var document = window.document,
+ navigator = window.navigator,
+ location = window.location;
+var jQuery = (function() {
+
// Define a local copy of jQuery
var jQuery = function( selector, context ) {
// The jQuery object is actually just the init constructor 'enhanced'
- return new jQuery.fn.init( selector, context );
+ return new jQuery.fn.init( selector, context, rootjQuery );
},
// Map over jQuery in case of overwrite
@@ -27,52 +33,64 @@ var jQuery = function( selector, context ) {
// Map over the $ in case of overwrite
_$ = window.$,
- // Use the correct document accordingly with window argument (sandbox)
- document = window.document,
-
// A central reference to the root jQuery(document)
rootjQuery,
// A simple way to check for HTML strings or ID strings
// (both of which we optimize for)
- quickExpr = /^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,
-
- // Is it a simple selector
- isSimple = /^.[^:#\[\.,]*$/,
+ quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,
// Check if a string has a non-whitespace character in it
rnotwhite = /\S/,
// Used for trimming whitespace
- rtrim = /^(\s|\u00A0)+|(\s|\u00A0)+$/g,
+ trimLeft = /^\s+/,
+ trimRight = /\s+$/,
+
+ // Check for digits
+ rdigit = /\d/,
// Match a standalone tag
rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
+ // JSON RegExp
+ rvalidchars = /^[\],:{}\s]*$/,
+ rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,
+ rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,
+ rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g,
+
+ // Useragent RegExp
+ rwebkit = /(webkit)[ \/]([\w.]+)/,
+ ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/,
+ rmsie = /(msie) ([\w.]+)/,
+ rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/,
+
// Keep a UserAgent string for use with jQuery.browser
userAgent = navigator.userAgent,
// For matching the engine and version of the browser
browserMatch,
-
- // Has the ready events already been bound?
- readyBound = false,
-
- // The functions to execute on DOM ready
- readyList = [],
+
+ // The deferred used on DOM ready
+ readyList,
// The ready event handler
DOMContentLoaded,
// Save a reference to some core methods
toString = Object.prototype.toString,
- hasOwnProperty = Object.prototype.hasOwnProperty,
+ hasOwn = Object.prototype.hasOwnProperty,
push = Array.prototype.push,
slice = Array.prototype.slice,
- indexOf = Array.prototype.indexOf;
+ trim = String.prototype.trim,
+ indexOf = Array.prototype.indexOf,
+
+ // [[Class]] -> type pairs
+ class2type = {};
jQuery.fn = jQuery.prototype = {
- init: function( selector, context ) {
+ constructor: jQuery,
+ init: function( selector, context, rootjQuery ) {
var match, elem, ret, doc;
// Handle $(""), $(null), or $(undefined)
@@ -86,12 +104,12 @@ jQuery.fn = jQuery.prototype = {
this.length = 1;
return this;
}
-
+
// The body element only exists once, optimize finding it
- if ( selector === "body" && !context ) {
+ if ( selector === "body" && !context && document.body ) {
this.context = document;
this[0] = document.body;
- this.selector = "body";
+ this.selector = selector;
this.length = 1;
return this;
}
@@ -99,13 +117,20 @@ jQuery.fn = jQuery.prototype = {
// Handle HTML strings
if ( typeof selector === "string" ) {
// Are we dealing with HTML string or an ID?
- match = quickExpr.exec( selector );
+ if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) {
+ // Assume that strings that start and end with <> are HTML and skip the regex check
+ match = [ null, selector, null ];
+
+ } else {
+ match = quickExpr.exec( selector );
+ }
// Verify a match, and that no context was specified for #id
if ( match && (match[1] || !context) ) {
// HANDLE: $(html) -> $(array)
if ( match[1] ) {
+ context = context instanceof jQuery ? context[0] : context;
doc = (context ? context.ownerDocument || context : document);
// If a single string is passed in and it's a single tag
@@ -122,17 +147,19 @@ jQuery.fn = jQuery.prototype = {
}
} else {
- ret = buildFragment( [ match[1] ], [ doc ] );
- selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes;
+ ret = jQuery.buildFragment( [ match[1] ], [ doc ] );
+ selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes;
}
-
+
return jQuery.merge( this, selector );
-
+
// HANDLE: $("#id")
} else {
elem = document.getElementById( match[2] );
- if ( elem ) {
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
// Handle the case where IE and Opera return items
// by name instead of ID
if ( elem.id !== match[2] ) {
@@ -149,13 +176,6 @@ jQuery.fn = jQuery.prototype = {
return this;
}
- // HANDLE: $("TAG")
- } else if ( !context && /^\w+$/.test( selector ) ) {
- this.selector = selector;
- this.context = document;
- selector = document.getElementsByTagName( selector );
- return jQuery.merge( this, selector );
-
// HANDLE: $(expr, $(...))
} else if ( !context || context.jquery ) {
return (context || rootjQuery).find( selector );
@@ -163,7 +183,7 @@ jQuery.fn = jQuery.prototype = {
// HANDLE: $(expr, context)
// (which is just equivalent to: $(context).find(expr)
} else {
- return jQuery( context ).find( selector );
+ return this.constructor( context ).find( selector );
}
// HANDLE: $(function)
@@ -184,7 +204,7 @@ jQuery.fn = jQuery.prototype = {
selector: "",
// The current version of jQuery being used
- jquery: "1.4.2",
+ jquery: "1.6.1",
// The default length of a jQuery object is 0
length: 0,
@@ -207,18 +227,18 @@ jQuery.fn = jQuery.prototype = {
this.toArray() :
// Return just the object
- ( num < 0 ? this.slice(num)[ 0 ] : this[ num ] );
+ ( num < 0 ? this[ this.length + num ] : this[ num ] );
},
// Take an array of elements and push it onto the stack
// (returning the new matched element set)
pushStack: function( elems, name, selector ) {
// Build a new jQuery matched element set
- var ret = jQuery();
+ var ret = this.constructor();
if ( jQuery.isArray( elems ) ) {
push.apply( ret, elems );
-
+
} else {
jQuery.merge( ret, elems );
}
@@ -244,25 +264,17 @@ jQuery.fn = jQuery.prototype = {
each: function( callback, args ) {
return jQuery.each( this, callback, args );
},
-
+
ready: function( fn ) {
// Attach the listeners
jQuery.bindReady();
- // If the DOM is already ready
- if ( jQuery.isReady ) {
- // Execute the function immediately
- fn.call( document, jQuery );
-
- // Otherwise, remember the function for later
- } else if ( readyList ) {
- // Add the function to the wait list
- readyList.push( fn );
- }
+ // Add the callback
+ readyList.done( fn );
return this;
},
-
+
eq: function( i ) {
return i === -1 ?
this.slice( i ) :
@@ -287,9 +299,9 @@ jQuery.fn = jQuery.prototype = {
return callback.call( elem, i, elem );
}));
},
-
+
end: function() {
- return this.prevObject || jQuery(null);
+ return this.prevObject || this.constructor(null);
},
// For internal use only.
@@ -303,8 +315,11 @@ jQuery.fn = jQuery.prototype = {
jQuery.fn.init.prototype = jQuery.fn;
jQuery.extend = jQuery.fn.extend = function() {
- // copy reference to target object
- var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options, name, src, copy;
+ var options, name, src, copy, copyIsArray, clone,
+ target = arguments[0] || {},
+ i = 1,
+ length = arguments.length,
+ deep = false;
// Handle a deep copy situation
if ( typeof target === "boolean" ) {
@@ -338,10 +353,15 @@ jQuery.extend = jQuery.fn.extend = function() {
continue;
}
- // Recurse if we're merging object literal values or arrays
- if ( deep && copy && ( jQuery.isPlainObject(copy) || jQuery.isArray(copy) ) ) {
- var clone = src && ( jQuery.isPlainObject(src) || jQuery.isArray(src) ) ? src
- : jQuery.isArray(copy) ? [] : {};
+ // Recurse if we're merging plain objects or arrays
+ if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) {
+ if ( copyIsArray ) {
+ copyIsArray = false;
+ clone = src && jQuery.isArray(src) ? src : [];
+
+ } else {
+ clone = src && jQuery.isPlainObject(src) ? src : {};
+ }
// Never move original objects, clone them
target[ name ] = jQuery.extend( deep, clone, copy );
@@ -360,67 +380,79 @@ jQuery.extend = jQuery.fn.extend = function() {
jQuery.extend({
noConflict: function( deep ) {
- window.$ = _$;
+ if ( window.$ === jQuery ) {
+ window.$ = _$;
+ }
- if ( deep ) {
+ if ( deep && window.jQuery === jQuery ) {
window.jQuery = _jQuery;
}
return jQuery;
},
-
+
// Is the DOM ready to be used? Set to true once it occurs.
isReady: false,
-
+
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+
+ // Hold (or release) the ready event
+ holdReady: function( hold ) {
+ if ( hold ) {
+ jQuery.readyWait++;
+ } else {
+ jQuery.ready( true );
+ }
+ },
+
// Handle when the DOM is ready
- ready: function() {
- // Make sure that the DOM is not already loaded
- if ( !jQuery.isReady ) {
+ ready: function( wait ) {
+ // Either a released hold or an DOMready/load event and not yet ready
+ if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) {
// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
if ( !document.body ) {
- return setTimeout( jQuery.ready, 13 );
+ return setTimeout( jQuery.ready, 1 );
}
// Remember that the DOM is ready
jQuery.isReady = true;
- // If there are functions bound, to execute
- if ( readyList ) {
- // Execute all of them
- var fn, i = 0;
- while ( (fn = readyList[ i++ ]) ) {
- fn.call( document, jQuery );
- }
-
- // Reset the list of functions
- readyList = null;
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --jQuery.readyWait > 0 ) {
+ return;
}
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ jQuery ] );
+
// Trigger any bound ready events
- if ( jQuery.fn.triggerHandler ) {
- jQuery( document ).triggerHandler( "ready" );
+ if ( jQuery.fn.trigger ) {
+ jQuery( document ).trigger( "ready" ).unbind( "ready" );
}
}
},
-
+
bindReady: function() {
- if ( readyBound ) {
+ if ( readyList ) {
return;
}
- readyBound = true;
+ readyList = jQuery._Deferred();
// Catch cases where $(document).ready() is called after the
// browser event has already occurred.
if ( document.readyState === "complete" ) {
- return jQuery.ready();
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ return setTimeout( jQuery.ready, 1 );
}
// Mozilla, Opera and webkit nightlies currently support this event
if ( document.addEventListener ) {
// Use the handy event callback
document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
-
+
// A fallback to window.onload, that will always work
window.addEventListener( "load", jQuery.ready, false );
@@ -428,8 +460,8 @@ jQuery.extend({
} else if ( document.attachEvent ) {
// ensure firing before onload,
// maybe late but safe also for iframes
- document.attachEvent("onreadystatechange", DOMContentLoaded);
-
+ document.attachEvent( "onreadystatechange", DOMContentLoaded );
+
// A fallback to window.onload, that will always work
window.attachEvent( "onload", jQuery.ready );
@@ -451,35 +483,50 @@ jQuery.extend({
// Since version 1.3, DOM methods and functions like alert
// aren't supported. They return false on IE (#2968).
isFunction: function( obj ) {
- return toString.call(obj) === "[object Function]";
+ return jQuery.type(obj) === "function";
+ },
+
+ isArray: Array.isArray || function( obj ) {
+ return jQuery.type(obj) === "array";
},
- isArray: function( obj ) {
- return toString.call(obj) === "[object Array]";
+ // A crude way of determining if an object is a window
+ isWindow: function( obj ) {
+ return obj && typeof obj === "object" && "setInterval" in obj;
+ },
+
+ isNaN: function( obj ) {
+ return obj == null || !rdigit.test( obj ) || isNaN( obj );
+ },
+
+ type: function( obj ) {
+ return obj == null ?
+ String( obj ) :
+ class2type[ toString.call(obj) ] || "object";
},
isPlainObject: function( obj ) {
// Must be an Object.
// Because of IE, we also have to check the presence of the constructor property.
// Make sure that DOM nodes and window objects don't pass through, as well
- if ( !obj || toString.call(obj) !== "[object Object]" || obj.nodeType || obj.setInterval ) {
+ if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) {
return false;
}
-
+
// Not own constructor property must be Object
- if ( obj.constructor
- && !hasOwnProperty.call(obj, "constructor")
- && !hasOwnProperty.call(obj.constructor.prototype, "isPrototypeOf") ) {
+ if ( obj.constructor &&
+ !hasOwn.call(obj, "constructor") &&
+ !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) {
return false;
}
-
+
// Own properties are enumerated firstly, so to speed up,
// if last one is own, then all properties are own.
-
+
var key;
for ( key in obj ) {}
-
- return key === undefined || hasOwnProperty.call( obj, key );
+
+ return key === undefined || hasOwn.call( obj, key );
},
isEmptyObject: function( obj ) {
@@ -488,11 +535,11 @@ jQuery.extend({
}
return true;
},
-
+
error: function( msg ) {
throw msg;
},
-
+
parseJSON: function( data ) {
if ( typeof data !== "string" || !data ) {
return null;
@@ -500,45 +547,59 @@ jQuery.extend({
// Make sure leading/trailing whitespace is removed (IE can't handle it)
data = jQuery.trim( data );
-
+
+ // Attempt to parse using the native JSON parser first
+ if ( window.JSON && window.JSON.parse ) {
+ return window.JSON.parse( data );
+ }
+
// Make sure the incoming data is actual JSON
// Logic borrowed from http://json.org/json2.js
- if ( /^[\],:{}\s]*$/.test(data.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, "@")
- .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, "]")
- .replace(/(?:^|:|,)(?:\s*\[)+/g, "")) ) {
+ if ( rvalidchars.test( data.replace( rvalidescape, "@" )
+ .replace( rvalidtokens, "]" )
+ .replace( rvalidbraces, "")) ) {
- // Try to use the native JSON parser first
- return window.JSON && window.JSON.parse ?
- window.JSON.parse( data ) :
- (new Function("return " + data))();
+ return (new Function( "return " + data ))();
- } else {
- jQuery.error( "Invalid JSON: " + data );
}
+ jQuery.error( "Invalid JSON: " + data );
},
- noop: function() {},
+ // Cross-browser xml parsing
+ // (xml & tmp used internally)
+ parseXML: function( data , xml , tmp ) {
- // Evalulates a script in a global context
- globalEval: function( data ) {
- if ( data && rnotwhite.test(data) ) {
- // Inspired by code by Andrea Giammarchi
- // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
- var head = document.getElementsByTagName("head")[0] || document.documentElement,
- script = document.createElement("script");
+ if ( window.DOMParser ) { // Standard
+ tmp = new DOMParser();
+ xml = tmp.parseFromString( data , "text/xml" );
+ } else { // IE
+ xml = new ActiveXObject( "Microsoft.XMLDOM" );
+ xml.async = "false";
+ xml.loadXML( data );
+ }
- script.type = "text/javascript";
+ tmp = xml.documentElement;
- if ( jQuery.support.scriptEval ) {
- script.appendChild( document.createTextNode( data ) );
- } else {
- script.text = data;
- }
+ if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) {
+ jQuery.error( "Invalid XML: " + data );
+ }
+
+ return xml;
+ },
- // Use insertBefore instead of appendChild to circumvent an IE6 bug.
- // This arises when a base node is used (#2709).
- head.insertBefore( script, head.firstChild );
- head.removeChild( script );
+ noop: function() {},
+
+ // Evaluates a script in a global context
+ // Workarounds based on findings by Jim Driscoll
+ // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context
+ globalEval: function( data ) {
+ if ( data && rnotwhite.test( data ) ) {
+ // We use execScript on Internet Explorer
+ // We use an anonymous function so that context is window
+ // rather than jQuery in Firefox
+ ( window.execScript || function( data ) {
+ window[ "eval" ].call( window, data );
+ } )( data );
}
},
@@ -550,7 +611,7 @@ jQuery.extend({
each: function( object, callback, args ) {
var name, i = 0,
length = object.length,
- isObj = length === undefined || jQuery.isFunction(object);
+ isObj = length === undefined || jQuery.isFunction( object );
if ( args ) {
if ( isObj ) {
@@ -576,17 +637,31 @@ jQuery.extend({
}
}
} else {
- for ( var value = object[0];
- i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {}
+ for ( ; i < length; ) {
+ if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) {
+ break;
+ }
+ }
}
}
return object;
},
- trim: function( text ) {
- return (text || "").replace( rtrim, "" );
- },
+ // Use native String.trim function wherever possible
+ trim: trim ?
+ function( text ) {
+ return text == null ?
+ "" :
+ trim.call( text );
+ } :
+
+ // Otherwise use our own trimming functionality
+ function( text ) {
+ return text == null ?
+ "" :
+ text.toString().replace( trimLeft, "" ).replace( trimRight, "" );
+ },
// results is for internal usage only
makeArray: function( array, results ) {
@@ -596,7 +671,10 @@ jQuery.extend({
// The window, strings (and functions) also have 'length'
// The extra typeof function check is to prevent crashes
// in Safari 2 (See: #3039)
- if ( array.length == null || typeof array === "string" || jQuery.isFunction(array) || (typeof array !== "function" && array.setInterval) ) {
+ // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930
+ var type = jQuery.type( array );
+
+ if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) {
push.call( ret, array );
} else {
jQuery.merge( ret, array );
@@ -607,8 +685,9 @@ jQuery.extend({
},
inArray: function( elem, array ) {
- if ( array.indexOf ) {
- return array.indexOf( elem );
+
+ if ( indexOf ) {
+ return indexOf.call( array, elem );
}
for ( var i = 0, length = array.length; i < length; i++ ) {
@@ -621,13 +700,14 @@ jQuery.extend({
},
merge: function( first, second ) {
- var i = first.length, j = 0;
+ var i = first.length,
+ j = 0;
if ( typeof second.length === "number" ) {
for ( var l = second.length; j < l; j++ ) {
first[ i++ ] = second[ j ];
}
-
+
} else {
while ( second[j] !== undefined ) {
first[ i++ ] = second[ j++ ];
@@ -640,12 +720,14 @@ jQuery.extend({
},
grep: function( elems, callback, inv ) {
- var ret = [];
+ var ret = [], retVal;
+ inv = !!inv;
// Go through the array, only saving the items
// that pass the validator function
for ( var i = 0, length = elems.length; i < length; i++ ) {
- if ( !inv !== !callback( elems[ i ], i ) ) {
+ retVal = !!callback( elems[ i ], i );
+ if ( inv !== retVal ) {
ret.push( elems[ i ] );
}
}
@@ -655,69 +737,143 @@ jQuery.extend({
// arg is for internal usage only
map: function( elems, callback, arg ) {
- var ret = [], value;
+ var value, key, ret = [],
+ i = 0,
+ length = elems.length,
+ // jquery objects are treated as arrays
+ isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ;
// Go through the array, translating each of the items to their
- // new value (or values).
- for ( var i = 0, length = elems.length; i < length; i++ ) {
- value = callback( elems[ i ], i, arg );
+ if ( isArray ) {
+ for ( ; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
- if ( value != null ) {
- ret[ ret.length ] = value;
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
+ }
+
+ // Go through every key on the object,
+ } else {
+ for ( key in elems ) {
+ value = callback( elems[ key ], key, arg );
+
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
}
}
+ // Flatten any nested arrays
return ret.concat.apply( [], ret );
},
// A global GUID counter for objects
guid: 1,
- proxy: function( fn, proxy, thisObject ) {
- if ( arguments.length === 2 ) {
- if ( typeof proxy === "string" ) {
- thisObject = fn;
- fn = thisObject[ proxy ];
- proxy = undefined;
+ // Bind a function to a context, optionally partially applying any
+ // arguments.
+ proxy: function( fn, context ) {
+ if ( typeof context === "string" ) {
+ var tmp = fn[ context ];
+ context = fn;
+ fn = tmp;
+ }
- } else if ( proxy && !jQuery.isFunction( proxy ) ) {
- thisObject = proxy;
- proxy = undefined;
- }
+ // Quick check to determine if target is callable, in the spec
+ // this throws a TypeError, but we will just return undefined.
+ if ( !jQuery.isFunction( fn ) ) {
+ return undefined;
}
- if ( !proxy && fn ) {
+ // Simulated bind
+ var args = slice.call( arguments, 2 ),
proxy = function() {
- return fn.apply( thisObject || this, arguments );
+ return fn.apply( context, args.concat( slice.call( arguments ) ) );
};
- }
// Set the guid of unique handler to the same of original handler, so it can be removed
- if ( fn ) {
- proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
- }
+ proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
- // So proxy can be declared as an argument
return proxy;
},
+ // Mutifunctional method to get and set values to a collection
+ // The value/s can be optionally by executed if its a function
+ access: function( elems, key, value, exec, fn, pass ) {
+ var length = elems.length;
+
+ // Setting many attributes
+ if ( typeof key === "object" ) {
+ for ( var k in key ) {
+ jQuery.access( elems, k, key[k], exec, fn, value );
+ }
+ return elems;
+ }
+
+ // Setting one attribute
+ if ( value !== undefined ) {
+ // Optionally, function values get executed if exec is true
+ exec = !pass && exec && jQuery.isFunction(value);
+
+ for ( var i = 0; i < length; i++ ) {
+ fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+ }
+
+ return elems;
+ }
+
+ // Getting an attribute
+ return length ? fn( elems[0], key ) : undefined;
+ },
+
+ now: function() {
+ return (new Date()).getTime();
+ },
+
// Use of jQuery.browser is frowned upon.
// More details: http://docs.jquery.com/Utilities/jQuery.browser
uaMatch: function( ua ) {
ua = ua.toLowerCase();
- var match = /(webkit)[ \/]([\w.]+)/.exec( ua ) ||
- /(opera)(?:.*version)?[ \/]([\w.]+)/.exec( ua ) ||
- /(msie) ([\w.]+)/.exec( ua ) ||
- !/compatible/.test( ua ) && /(mozilla)(?:.*? rv:([\w.]+))?/.exec( ua ) ||
- [];
+ var match = rwebkit.exec( ua ) ||
+ ropera.exec( ua ) ||
+ rmsie.exec( ua ) ||
+ ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) ||
+ [];
return { browser: match[1] || "", version: match[2] || "0" };
},
+ sub: function() {
+ function jQuerySub( selector, context ) {
+ return new jQuerySub.fn.init( selector, context );
+ }
+ jQuery.extend( true, jQuerySub, this );
+ jQuerySub.superclass = this;
+ jQuerySub.fn = jQuerySub.prototype = this();
+ jQuerySub.fn.constructor = jQuerySub;
+ jQuerySub.sub = this.sub;
+ jQuerySub.fn.init = function init( selector, context ) {
+ if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) {
+ context = jQuerySub( context );
+ }
+
+ return jQuery.fn.init.call( this, selector, context, rootjQuerySub );
+ };
+ jQuerySub.fn.init.prototype = jQuerySub.fn;
+ var rootjQuerySub = jQuerySub(document);
+ return jQuerySub;
+ },
+
browser: {}
});
+// Populate the class2type map
+jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) {
+ class2type[ "[object " + name + "]" ] = name.toLowerCase();
+});
+
browserMatch = jQuery.uaMatch( userAgent );
if ( browserMatch.browser ) {
jQuery.browser[ browserMatch.browser ] = true;
@@ -729,10 +885,10 @@ if ( jQuery.browser.webkit ) {
jQuery.browser.safari = true;
}
-if ( indexOf ) {
- jQuery.inArray = function( elem, array ) {
- return indexOf.call( array, elem );
- };
+// IE doesn't match non-breaking spaces with \s
+if ( rnotwhite.test( "\xA0" ) ) {
+ trimLeft = /^[\s\xA0]+/;
+ trimRight = /[\s\xA0]+$/;
}
// All jQuery objects should point back to these
@@ -765,7 +921,7 @@ function doScrollCheck() {
// If IE is used, use the trick by Diego Perini
// http://javascript.nwbox.com/IEContentLoaded/
document.documentElement.doScroll("left");
- } catch( error ) {
+ } catch(e) {
setTimeout( doScrollCheck, 1 );
return;
}
@@ -774,93 +930,266 @@ function doScrollCheck() {
jQuery.ready();
}
-function evalScript( i, elem ) {
- if ( elem.src ) {
- jQuery.ajax({
- url: elem.src,
- async: false,
- dataType: "script"
- });
- } else {
- jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
- }
+// Expose jQuery to the global object
+return jQuery;
- if ( elem.parentNode ) {
- elem.parentNode.removeChild( elem );
- }
-}
+})();
-// Mutifunctional method to get and set values to a collection
-// The value/s can be optionally by executed if its a function
-function access( elems, key, value, exec, fn, pass ) {
- var length = elems.length;
-
- // Setting many attributes
- if ( typeof key === "object" ) {
- for ( var k in key ) {
- access( elems, k, key[k], exec, fn, value );
+
+var // Promise methods
+ promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ),
+ // Static reference to slice
+ sliceDeferred = [].slice;
+
+jQuery.extend({
+ // Create a simple deferred (one callbacks list)
+ _Deferred: function() {
+ var // callbacks list
+ callbacks = [],
+ // stored [ context , args ]
+ fired,
+ // to avoid firing when already doing so
+ firing,
+ // flag to know if the deferred has been cancelled
+ cancelled,
+ // the deferred itself
+ deferred = {
+
+ // done( f1, f2, ...)
+ done: function() {
+ if ( !cancelled ) {
+ var args = arguments,
+ i,
+ length,
+ elem,
+ type,
+ _fired;
+ if ( fired ) {
+ _fired = fired;
+ fired = 0;
+ }
+ for ( i = 0, length = args.length; i < length; i++ ) {
+ elem = args[ i ];
+ type = jQuery.type( elem );
+ if ( type === "array" ) {
+ deferred.done.apply( deferred, elem );
+ } else if ( type === "function" ) {
+ callbacks.push( elem );
+ }
+ }
+ if ( _fired ) {
+ deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] );
+ }
+ }
+ return this;
+ },
+
+ // resolve with given context and args
+ resolveWith: function( context, args ) {
+ if ( !cancelled && !fired && !firing ) {
+ // make sure args are available (#8421)
+ args = args || [];
+ firing = 1;
+ try {
+ while( callbacks[ 0 ] ) {
+ callbacks.shift().apply( context, args );
+ }
+ }
+ finally {
+ fired = [ context, args ];
+ firing = 0;
+ }
+ }
+ return this;
+ },
+
+ // resolve with this as context and given arguments
+ resolve: function() {
+ deferred.resolveWith( this, arguments );
+ return this;
+ },
+
+ // Has this deferred been resolved?
+ isResolved: function() {
+ return !!( firing || fired );
+ },
+
+ // Cancel
+ cancel: function() {
+ cancelled = 1;
+ callbacks = [];
+ return this;
+ }
+ };
+
+ return deferred;
+ },
+
+ // Full fledged deferred (two callbacks list)
+ Deferred: function( func ) {
+ var deferred = jQuery._Deferred(),
+ failDeferred = jQuery._Deferred(),
+ promise;
+ // Add errorDeferred methods, then and promise
+ jQuery.extend( deferred, {
+ then: function( doneCallbacks, failCallbacks ) {
+ deferred.done( doneCallbacks ).fail( failCallbacks );
+ return this;
+ },
+ always: function() {
+ return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments );
+ },
+ fail: failDeferred.done,
+ rejectWith: failDeferred.resolveWith,
+ reject: failDeferred.resolve,
+ isRejected: failDeferred.isResolved,
+ pipe: function( fnDone, fnFail ) {
+ return jQuery.Deferred(function( newDefer ) {
+ jQuery.each( {
+ done: [ fnDone, "resolve" ],
+ fail: [ fnFail, "reject" ]
+ }, function( handler, data ) {
+ var fn = data[ 0 ],
+ action = data[ 1 ],
+ returned;
+ if ( jQuery.isFunction( fn ) ) {
+ deferred[ handler ](function() {
+ returned = fn.apply( this, arguments );
+ if ( returned && jQuery.isFunction( returned.promise ) ) {
+ returned.promise().then( newDefer.resolve, newDefer.reject );
+ } else {
+ newDefer[ action ]( returned );
+ }
+ });
+ } else {
+ deferred[ handler ]( newDefer[ action ] );
+ }
+ });
+ }).promise();
+ },
+ // Get a promise for this deferred
+ // If obj is provided, the promise aspect is added to the object
+ promise: function( obj ) {
+ if ( obj == null ) {
+ if ( promise ) {
+ return promise;
+ }
+ promise = obj = {};
+ }
+ var i = promiseMethods.length;
+ while( i-- ) {
+ obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ];
+ }
+ return obj;
+ }
+ });
+ // Make sure only one callback list will be used
+ deferred.done( failDeferred.cancel ).fail( deferred.cancel );
+ // Unexpose cancel
+ delete deferred.cancel;
+ // Call given func if any
+ if ( func ) {
+ func.call( deferred, deferred );
+ }
+ return deferred;
+ },
+
+ // Deferred helper
+ when: function( firstParam ) {
+ var args = arguments,
+ i = 0,
+ length = args.length,
+ count = length,
+ deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ?
+ firstParam :
+ jQuery.Deferred();
+ function resolveFunc( i ) {
+ return function( value ) {
+ args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value;
+ if ( !( --count ) ) {
+ // Strange bug in FF4:
+ // Values changed onto the arguments object sometimes end up as undefined values
+ // outside the $.when method. Cloning the object into a fresh array solves the issue
+ deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) );
+ }
+ };
}
- return elems;
- }
-
- // Setting one attribute
- if ( value !== undefined ) {
- // Optionally, function values get executed if exec is true
- exec = !pass && exec && jQuery.isFunction(value);
-
- for ( var i = 0; i < length; i++ ) {
- fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+ if ( length > 1 ) {
+ for( ; i < length; i++ ) {
+ if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) {
+ args[ i ].promise().then( resolveFunc(i), deferred.reject );
+ } else {
+ --count;
+ }
+ }
+ if ( !count ) {
+ deferred.resolveWith( deferred, args );
+ }
+ } else if ( deferred !== firstParam ) {
+ deferred.resolveWith( deferred, length ? [ firstParam ] : [] );
}
-
- return elems;
+ return deferred.promise();
}
-
- // Getting an attribute
- return length ? fn( elems[0], key ) : undefined;
-}
+});
-function now() {
- return (new Date).getTime();
-}
-(function() {
- jQuery.support = {};
- var root = document.documentElement,
- script = document.createElement("script"),
- div = document.createElement("div"),
- id = "script" + now();
+jQuery.support = (function() {
- div.style.display = "none";
- div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+ var div = document.createElement( "div" ),
+ documentElement = document.documentElement,
+ all,
+ a,
+ select,
+ opt,
+ input,
+ marginDiv,
+ support,
+ fragment,
+ body,
+ bodyStyle,
+ tds,
+ events,
+ eventName,
+ i,
+ isSupported;
- var all = div.getElementsByTagName("*"),
- a = div.getElementsByTagName("a")[0];
+ // Preliminary tests
+ div.setAttribute("className", "t");
+ div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+
+ all = div.getElementsByTagName( "*" );
+ a = div.getElementsByTagName( "a" )[ 0 ];
// Can't get basic test support
if ( !all || !all.length || !a ) {
- return;
+ return {};
}
- jQuery.support = {
+ // First batch of supports tests
+ select = document.createElement( "select" );
+ opt = select.appendChild( document.createElement("option") );
+ input = div.getElementsByTagName( "input" )[ 0 ];
+
+ support = {
// IE strips leading whitespace when .innerHTML is used
- leadingWhitespace: div.firstChild.nodeType === 3,
+ leadingWhitespace: ( div.firstChild.nodeType === 3 ),
// Make sure that tbody elements aren't automatically inserted
// IE will insert them into empty tables
- tbody: !div.getElementsByTagName("tbody").length,
+ tbody: !div.getElementsByTagName( "tbody" ).length,
// Make sure that link elements get serialized correctly by innerHTML
// This requires a wrapper element in IE
- htmlSerialize: !!div.getElementsByTagName("link").length,
+ htmlSerialize: !!div.getElementsByTagName( "link" ).length,
// Get the style information from getAttribute
- // (IE uses .cssText insted)
- style: /red/.test( a.getAttribute("style") ),
+ // (IE uses .cssText instead)
+ style: /top/.test( a.getAttribute("style") ),
// Make sure that URLs aren't manipulated
// (IE normalizes it by default)
- hrefNormalized: a.getAttribute("href") === "/a",
+ hrefNormalized: ( a.getAttribute( "href" ) === "/a" ),
// Make sure that element opacity exists
// (IE uses filter instead)
@@ -874,213 +1203,419 @@ function now() {
// Make sure that if no value is specified for a checkbox
// that it defaults to "on".
// (WebKit defaults to "" instead)
- checkOn: div.getElementsByTagName("input")[0].value === "on",
+ checkOn: ( input.value === "on" ),
// Make sure that a selected-by-default option has a working selected property.
// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
- optSelected: document.createElement("select").appendChild( document.createElement("option") ).selected,
+ optSelected: opt.selected,
- parentNode: div.removeChild( div.appendChild( document.createElement("div") ) ).parentNode === null,
+ // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7)
+ getSetAttribute: div.className !== "t",
// Will be defined later
+ submitBubbles: true,
+ changeBubbles: true,
+ focusinBubbles: false,
deleteExpando: true,
- checkClone: false,
- scriptEval: false,
noCloneEvent: true,
- boxModel: null
+ inlineBlockNeedsLayout: false,
+ shrinkWrapBlocks: false,
+ reliableMarginRight: true
};
- script.type = "text/javascript";
- try {
- script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
- } catch(e) {}
-
- root.insertBefore( script, root.firstChild );
+ // Make sure checked status is properly cloned
+ input.checked = true;
+ support.noCloneChecked = input.cloneNode( true ).checked;
- // Make sure that the execution of code works by injecting a script
- // tag with appendChild/createTextNode
- // (IE doesn't support this, fails, and uses .text instead)
- if ( window[ id ] ) {
- jQuery.support.scriptEval = true;
- delete window[ id ];
- }
+ // Make sure that the options inside disabled selects aren't marked as disabled
+ // (WebKit marks them as disabled)
+ select.disabled = true;
+ support.optDisabled = !opt.disabled;
// Test to see if it's possible to delete an expando from an element
// Fails in Internet Explorer
try {
- delete script.test;
-
- } catch(e) {
- jQuery.support.deleteExpando = false;
+ delete div.test;
+ } catch( e ) {
+ support.deleteExpando = false;
}
- root.removeChild( script );
-
- if ( div.attachEvent && div.fireEvent ) {
- div.attachEvent("onclick", function click() {
+ if ( !div.addEventListener && div.attachEvent && div.fireEvent ) {
+ div.attachEvent( "onclick", function click() {
// Cloning a node shouldn't copy over any
// bound event handlers (IE does this)
- jQuery.support.noCloneEvent = false;
- div.detachEvent("onclick", click);
+ support.noCloneEvent = false;
+ div.detachEvent( "onclick", click );
});
- div.cloneNode(true).fireEvent("onclick");
+ div.cloneNode( true ).fireEvent( "onclick" );
}
- div = document.createElement("div");
- div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>";
+ // Check if a radio maintains it's value
+ // after being appended to the DOM
+ input = document.createElement("input");
+ input.value = "t";
+ input.setAttribute("type", "radio");
+ support.radioValue = input.value === "t";
- var fragment = document.createDocumentFragment();
+ input.setAttribute("checked", "checked");
+ div.appendChild( input );
+ fragment = document.createDocumentFragment();
fragment.appendChild( div.firstChild );
// WebKit doesn't clone checked state correctly in fragments
- jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
+ support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+ div.innerHTML = "";
// Figure out if the W3C box model works as expected
- // document.body must exist before we can do this
- jQuery(function() {
- var div = document.createElement("div");
- div.style.width = div.style.paddingLeft = "1px";
+ div.style.width = div.style.paddingLeft = "1px";
+
+ // We use our own, invisible, body
+ body = document.createElement( "body" );
+ bodyStyle = {
+ visibility: "hidden",
+ width: 0,
+ height: 0,
+ border: 0,
+ margin: 0,
+ // Set background to avoid IE crashes when removing (#9028)
+ background: "none"
+ };
+ for ( i in bodyStyle ) {
+ body.style[ i ] = bodyStyle[ i ];
+ }
+ body.appendChild( div );
+ documentElement.insertBefore( body, documentElement.firstChild );
+
+ // Check if a disconnected checkbox will retain its checked
+ // value of true after appended to the DOM (IE6/7)
+ support.appendChecked = input.checked;
+
+ support.boxModel = div.offsetWidth === 2;
+
+ if ( "zoom" in div.style ) {
+ // Check if natively block-level elements act like inline-block
+ // elements when setting their display to 'inline' and giving
+ // them layout
+ // (IE < 8 does this)
+ div.style.display = "inline";
+ div.style.zoom = 1;
+ support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 );
+
+ // Check if elements with layout shrink-wrap their children
+ // (IE 6 does this)
+ div.style.display = "";
+ div.innerHTML = "<div style='width:4px;'></div>";
+ support.shrinkWrapBlocks = ( div.offsetWidth !== 2 );
+ }
- document.body.appendChild( div );
- jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
- document.body.removeChild( div ).style.display = 'none';
+ div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";
+ tds = div.getElementsByTagName( "td" );
+
+ // Check if table cells still have offsetWidth/Height when they are set
+ // to display:none and there are still other visible table cells in a
+ // table row; if so, offsetWidth/Height are not reliable for use when
+ // determining if an element has been hidden directly using
+ // display:none (it is still safe to use offsets if a parent element is
+ // hidden; don safety goggles and see bug #4512 for more information).
+ // (only IE 8 fails this test)
+ isSupported = ( tds[ 0 ].offsetHeight === 0 );
+
+ tds[ 0 ].style.display = "";
+ tds[ 1 ].style.display = "none";
+
+ // Check if empty table cells still have offsetWidth/Height
+ // (IE < 8 fail this test)
+ support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 );
+ div.innerHTML = "";
+
+ // Check if div with explicit width and no margin-right incorrectly
+ // gets computed margin-right based on width of container. For more
+ // info see bug #3333
+ // Fails in WebKit before Feb 2011 nightlies
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ if ( document.defaultView && document.defaultView.getComputedStyle ) {
+ marginDiv = document.createElement( "div" );
+ marginDiv.style.width = "0";
+ marginDiv.style.marginRight = "0";
+ div.appendChild( marginDiv );
+ support.reliableMarginRight =
+ ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0;
+ }
- div = null;
- });
+ // Remove the body element we added
+ body.innerHTML = "";
+ documentElement.removeChild( body );
// Technique from Juriy Zaytsev
// http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
- var eventSupported = function( eventName ) {
- var el = document.createElement("div");
- eventName = "on" + eventName;
-
- var isSupported = (eventName in el);
- if ( !isSupported ) {
- el.setAttribute(eventName, "return;");
- isSupported = typeof el[eventName] === "function";
- }
- el = null;
-
- return isSupported;
- };
-
- jQuery.support.submitBubbles = eventSupported("submit");
- jQuery.support.changeBubbles = eventSupported("change");
+ // We only care about the case where non-standard event systems
+ // are used, namely in IE. Short-circuiting here helps us to
+ // avoid an eval call (in setAttribute) which can cause CSP
+ // to go haywire. See: https://developer.mozilla.org/en/Security/CSP
+ if ( div.attachEvent ) {
+ for( i in {
+ submit: 1,
+ change: 1,
+ focusin: 1
+ } ) {
+ eventName = "on" + i;
+ isSupported = ( eventName in div );
+ if ( !isSupported ) {
+ div.setAttribute( eventName, "return;" );
+ isSupported = ( typeof div[ eventName ] === "function" );
+ }
+ support[ i + "Bubbles" ] = isSupported;
+ }
+ }
- // release memory in IE
- root = script = div = all = a = null;
+ return support;
})();
-jQuery.props = {
- "for": "htmlFor",
- "class": "className",
- readonly: "readOnly",
- maxlength: "maxLength",
- cellspacing: "cellSpacing",
- rowspan: "rowSpan",
- colspan: "colSpan",
- tabindex: "tabIndex",
- usemap: "useMap",
- frameborder: "frameBorder"
-};
-var expando = "jQuery" + now(), uuid = 0, windowData = {};
+// Keep track of boxModel
+jQuery.boxModel = jQuery.support.boxModel;
+
+
+
+
+var rbrace = /^(?:\{.*\}|\[.*\])$/,
+ rmultiDash = /([a-z])([A-Z])/g;
jQuery.extend({
cache: {},
-
- expando:expando,
+
+ // Please use with caution
+ uuid: 0,
+
+ // Unique for each copy of jQuery on the page
+ // Non-digits removed to match rinlinejQuery
+ expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ),
// The following elements throw uncatchable exceptions if you
// attempt to add expando properties to them.
noData: {
"embed": true,
- "object": true,
+ // Ban all objects except for Flash (which handle expandos)
+ "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",
"applet": true
},
- data: function( elem, name, data ) {
- if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+ hasData: function( elem ) {
+ elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ];
+
+ return !!elem && !isEmptyDataObject( elem );
+ },
+
+ data: function( elem, name, data, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
return;
}
- elem = elem == window ?
- windowData :
- elem;
+ var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache,
- var id = elem[ expando ], cache = jQuery.cache, thisCache;
+ // We have to handle DOM nodes and JS objects differently because IE6-7
+ // can't GC object references properly across the DOM-JS boundary
+ isNode = elem.nodeType,
- if ( !id && typeof name === "string" && data === undefined ) {
- return null;
- }
+ // Only DOM nodes need the global jQuery cache; JS object data is
+ // attached directly to the object so GC can occur automatically
+ cache = isNode ? jQuery.cache : elem,
+
+ // Only defining an ID for JS objects if its cache already exists allows
+ // the code to shortcut on the same path as a DOM node with no cache
+ id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando;
- // Compute a unique ID for the element
- if ( !id ) {
- id = ++uuid;
+ // Avoid doing any more work than we need to when trying to get data on an
+ // object that has no data at all
+ if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) {
+ return;
}
- // Avoid generating a new cache unless none exists and we
- // want to manipulate it.
- if ( typeof name === "object" ) {
- elem[ expando ] = id;
- thisCache = cache[ id ] = jQuery.extend(true, {}, name);
+ if ( !id ) {
+ // Only DOM nodes need a new unique ID for each element since their data
+ // ends up in the global cache
+ if ( isNode ) {
+ elem[ jQuery.expando ] = id = ++jQuery.uuid;
+ } else {
+ id = jQuery.expando;
+ }
+ }
- } else if ( !cache[ id ] ) {
- elem[ expando ] = id;
+ if ( !cache[ id ] ) {
cache[ id ] = {};
+
+ // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery
+ // metadata on plain JS objects when the object is serialized using
+ // JSON.stringify
+ if ( !isNode ) {
+ cache[ id ].toJSON = jQuery.noop;
+ }
+ }
+
+ // An object can be passed to jQuery.data instead of a key/value pair; this gets
+ // shallow copied over onto the existing cache
+ if ( typeof name === "object" || typeof name === "function" ) {
+ if ( pvt ) {
+ cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name);
+ } else {
+ cache[ id ] = jQuery.extend(cache[ id ], name);
+ }
}
thisCache = cache[ id ];
- // Prevent overriding the named cache with undefined values
+ // Internal jQuery data is stored in a separate object inside the object's data
+ // cache in order to avoid key collisions between internal data and user-defined
+ // data
+ if ( pvt ) {
+ if ( !thisCache[ internalKey ] ) {
+ thisCache[ internalKey ] = {};
+ }
+
+ thisCache = thisCache[ internalKey ];
+ }
+
if ( data !== undefined ) {
- thisCache[ name ] = data;
+ thisCache[ jQuery.camelCase( name ) ] = data;
+ }
+
+ // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should
+ // not attempt to inspect the internal events object using jQuery.data, as this
+ // internal data object is undocumented and subject to change.
+ if ( name === "events" && !thisCache[name] ) {
+ return thisCache[ internalKey ] && thisCache[ internalKey ].events;
}
- return typeof name === "string" ? thisCache[ name ] : thisCache;
+ return getByName ? thisCache[ jQuery.camelCase( name ) ] : thisCache;
},
- removeData: function( elem, name ) {
- if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+ removeData: function( elem, name, pvt /* Internal Use Only */ ) {
+ if ( !jQuery.acceptData( elem ) ) {
return;
}
- elem = elem == window ?
- windowData :
- elem;
+ var internalKey = jQuery.expando, isNode = elem.nodeType,
+
+ // See jQuery.data for more information
+ cache = isNode ? jQuery.cache : elem,
- var id = elem[ expando ], cache = jQuery.cache, thisCache = cache[ id ];
+ // See jQuery.data for more information
+ id = isNode ? elem[ jQuery.expando ] : jQuery.expando;
+
+ // If there is already no cache entry for this object, there is no
+ // purpose in continuing
+ if ( !cache[ id ] ) {
+ return;
+ }
- // If we want to remove a specific section of the element's data
if ( name ) {
+ var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ];
+
if ( thisCache ) {
- // Remove the section of cache data
delete thisCache[ name ];
- // If we've removed all the data, remove the element's cache
- if ( jQuery.isEmptyObject(thisCache) ) {
- jQuery.removeData( elem );
+ // If there is no data left in the cache, we want to continue
+ // and let the cache object itself get destroyed
+ if ( !isEmptyDataObject(thisCache) ) {
+ return;
}
}
+ }
+
+ // See jQuery.data for more information
+ if ( pvt ) {
+ delete cache[ id ][ internalKey ];
- // Otherwise, we want to remove all of the element's data
+ // Don't destroy the parent cache unless the internal data object
+ // had been the only thing left in it
+ if ( !isEmptyDataObject(cache[ id ]) ) {
+ return;
+ }
+ }
+
+ var internalCache = cache[ id ][ internalKey ];
+
+ // Browsers that fail expando deletion also refuse to delete expandos on
+ // the window, but it will allow it on all other JS objects; other browsers
+ // don't care
+ if ( jQuery.support.deleteExpando || cache != window ) {
+ delete cache[ id ];
} else {
+ cache[ id ] = null;
+ }
+
+ // We destroyed the entire user cache at once because it's faster than
+ // iterating through each key, but we need to continue to persist internal
+ // data if it existed
+ if ( internalCache ) {
+ cache[ id ] = {};
+ // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery
+ // metadata on plain JS objects when the object is serialized using
+ // JSON.stringify
+ if ( !isNode ) {
+ cache[ id ].toJSON = jQuery.noop;
+ }
+
+ cache[ id ][ internalKey ] = internalCache;
+
+ // Otherwise, we need to eliminate the expando on the node to avoid
+ // false lookups in the cache for entries that no longer exist
+ } else if ( isNode ) {
+ // IE does not allow us to delete expando properties from nodes,
+ // nor does it have a removeAttribute function on Document nodes;
+ // we must handle all of these cases
if ( jQuery.support.deleteExpando ) {
delete elem[ jQuery.expando ];
-
} else if ( elem.removeAttribute ) {
elem.removeAttribute( jQuery.expando );
+ } else {
+ elem[ jQuery.expando ] = null;
}
+ }
+ },
- // Completely remove the data cache
- delete cache[ id ];
+ // For internal use only.
+ _data: function( elem, name, data ) {
+ return jQuery.data( elem, name, data, true );
+ },
+
+ // A method for determining if a DOM node can handle the data expando
+ acceptData: function( elem ) {
+ if ( elem.nodeName ) {
+ var match = jQuery.noData[ elem.nodeName.toLowerCase() ];
+
+ if ( match ) {
+ return !(match === true || elem.getAttribute("classid") !== match);
+ }
}
+
+ return true;
}
});
jQuery.fn.extend({
data: function( key, value ) {
- if ( typeof key === "undefined" && this.length ) {
- return jQuery.data( this[0] );
+ var data = null;
+
+ if ( typeof key === "undefined" ) {
+ if ( this.length ) {
+ data = jQuery.data( this[0] );
+
+ if ( this[0].nodeType === 1 ) {
+ var attr = this[0].attributes, name;
+ for ( var i = 0, l = attr.length; i < l; i++ ) {
+ name = attr[i].name;
+
+ if ( name.indexOf( "data-" ) === 0 ) {
+ name = jQuery.camelCase( name.substring(5) );
+
+ dataAttr( this[0], name, data[ name ] );
+ }
+ }
+ }
+ }
+
+ return data;
} else if ( typeof key === "object" ) {
return this.each(function() {
@@ -1092,17 +1627,26 @@ jQuery.fn.extend({
parts[1] = parts[1] ? "." + parts[1] : "";
if ( value === undefined ) {
- var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+ data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+ // Try to fetch any internally stored data first
if ( data === undefined && this.length ) {
data = jQuery.data( this[0], key );
+ data = dataAttr( this[0], key, data );
}
+
return data === undefined && parts[1] ?
this.data( parts[0] ) :
data;
+
} else {
- return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function() {
+ return this.each(function() {
+ var $this = jQuery( this ),
+ args = [ parts[0], value ];
+
+ $this.triggerHandler( "setData" + parts[1] + "!", args );
jQuery.data( this, key, value );
+ $this.triggerHandler( "changeData" + parts[1] + "!", args );
});
}
},
@@ -1113,34 +1657,122 @@ jQuery.fn.extend({
});
}
});
-jQuery.extend({
- queue: function( elem, type, data ) {
- if ( !elem ) {
- return;
+
+function dataAttr( elem, key, data ) {
+ // If nothing was found internally, try to fetch any
+ // data from the HTML5 data-* attribute
+ if ( data === undefined && elem.nodeType === 1 ) {
+ var name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase();
+
+ data = elem.getAttribute( name );
+
+ if ( typeof data === "string" ) {
+ try {
+ data = data === "true" ? true :
+ data === "false" ? false :
+ data === "null" ? null :
+ !jQuery.isNaN( data ) ? parseFloat( data ) :
+ rbrace.test( data ) ? jQuery.parseJSON( data ) :
+ data;
+ } catch( e ) {}
+
+ // Make sure we set the data so it isn't changed later
+ jQuery.data( elem, key, data );
+
+ } else {
+ data = undefined;
}
+ }
- type = (type || "fx") + "queue";
- var q = jQuery.data( elem, type );
+ return data;
+}
- // Speed up dequeue by getting out quickly if this is just a lookup
- if ( !data ) {
- return q || [];
+// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON
+// property to be considered empty objects; this property always exists in
+// order to make sure JSON.stringify does not expose internal metadata
+function isEmptyDataObject( obj ) {
+ for ( var name in obj ) {
+ if ( name !== "toJSON" ) {
+ return false;
}
+ }
- if ( !q || jQuery.isArray(data) ) {
- q = jQuery.data( elem, type, jQuery.makeArray(data) );
+ return true;
+}
- } else {
- q.push( data );
+
+
+
+function handleQueueMarkDefer( elem, type, src ) {
+ var deferDataKey = type + "defer",
+ queueDataKey = type + "queue",
+ markDataKey = type + "mark",
+ defer = jQuery.data( elem, deferDataKey, undefined, true );
+ if ( defer &&
+ ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) &&
+ ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) {
+ // Give room for hard-coded callbacks to fire first
+ // and eventually mark/queue something else on the element
+ setTimeout( function() {
+ if ( !jQuery.data( elem, queueDataKey, undefined, true ) &&
+ !jQuery.data( elem, markDataKey, undefined, true ) ) {
+ jQuery.removeData( elem, deferDataKey, true );
+ defer.resolve();
+ }
+ }, 0 );
+ }
+}
+
+jQuery.extend({
+
+ _mark: function( elem, type ) {
+ if ( elem ) {
+ type = (type || "fx") + "mark";
+ jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true );
}
+ },
- return q;
+ _unmark: function( force, elem, type ) {
+ if ( force !== true ) {
+ type = elem;
+ elem = force;
+ force = false;
+ }
+ if ( elem ) {
+ type = type || "fx";
+ var key = type + "mark",
+ count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 );
+ if ( count ) {
+ jQuery.data( elem, key, count, true );
+ } else {
+ jQuery.removeData( elem, key, true );
+ handleQueueMarkDefer( elem, type, "mark" );
+ }
+ }
+ },
+
+ queue: function( elem, type, data ) {
+ if ( elem ) {
+ type = (type || "fx") + "queue";
+ var q = jQuery.data( elem, type, undefined, true );
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( data ) {
+ if ( !q || jQuery.isArray(data) ) {
+ q = jQuery.data( elem, type, jQuery.makeArray(data), true );
+ } else {
+ q.push( data );
+ }
+ }
+ return q || [];
+ }
},
dequeue: function( elem, type ) {
type = type || "fx";
- var queue = jQuery.queue( elem, type ), fn = queue.shift();
+ var queue = jQuery.queue( elem, type ),
+ fn = queue.shift(),
+ defer;
// If the fx queue is dequeued, always remove the progress sentinel
if ( fn === "inprogress" ) {
@@ -1158,6 +1790,11 @@ jQuery.extend({
jQuery.dequeue(elem, type);
});
}
+
+ if ( !queue.length ) {
+ jQuery.removeData( elem, type + "queue", true );
+ handleQueueMarkDefer( elem, type, "queue" );
+ }
}
});
@@ -1171,7 +1808,7 @@ jQuery.fn.extend({
if ( data === undefined ) {
return jQuery.queue( this[0], type );
}
- return this.each(function( i, elem ) {
+ return this.each(function() {
var queue = jQuery.queue( this, type, data );
if ( type === "fx" && queue[0] !== "inprogress" ) {
@@ -1184,7 +1821,6 @@ jQuery.fn.extend({
jQuery.dequeue( this, type );
});
},
-
// Based off of the plugin by Clint Helfers, with permission.
// http://blindsignals.com/index.php/2009/07/jquery-delay/
delay: function( time, type ) {
@@ -1198,39 +1834,88 @@ jQuery.fn.extend({
}, time );
});
},
-
clearQueue: function( type ) {
return this.queue( type || "fx", [] );
+ },
+ // Get a promise resolved when queues of a certain type
+ // are emptied (fx is the type by default)
+ promise: function( type, object ) {
+ if ( typeof type !== "string" ) {
+ object = type;
+ type = undefined;
+ }
+ type = type || "fx";
+ var defer = jQuery.Deferred(),
+ elements = this,
+ i = elements.length,
+ count = 1,
+ deferDataKey = type + "defer",
+ queueDataKey = type + "queue",
+ markDataKey = type + "mark",
+ tmp;
+ function resolve() {
+ if ( !( --count ) ) {
+ defer.resolveWith( elements, [ elements ] );
+ }
+ }
+ while( i-- ) {
+ if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) ||
+ ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) ||
+ jQuery.data( elements[ i ], markDataKey, undefined, true ) ) &&
+ jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) {
+ count++;
+ tmp.done( resolve );
+ }
+ }
+ resolve();
+ return defer.promise();
}
});
-var rclass = /[\n\t]/g,
+
+
+
+
+var rclass = /[\n\t\r]/g,
rspace = /\s+/,
rreturn = /\r/g,
- rspecialurl = /href|src|style/,
- rtype = /(button|input)/i,
- rfocusable = /(button|input|object|select|textarea)/i,
- rclickable = /^(a|area)$/i,
- rradiocheck = /radio|checkbox/;
+ rtype = /^(?:button|input)$/i,
+ rfocusable = /^(?:button|input|object|select|textarea)$/i,
+ rclickable = /^a(?:rea)?$/i,
+ rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,
+ rinvalidChar = /\:/,
+ formHook, boolHook;
jQuery.fn.extend({
attr: function( name, value ) {
- return access( this, name, value, true, jQuery.attr );
+ return jQuery.access( this, name, value, true, jQuery.attr );
},
- removeAttr: function( name, fn ) {
- return this.each(function(){
- jQuery.attr( this, name, "" );
- if ( this.nodeType === 1 ) {
- this.removeAttribute( name );
- }
+ removeAttr: function( name ) {
+ return this.each(function() {
+ jQuery.removeAttr( this, name );
+ });
+ },
+
+ prop: function( name, value ) {
+ return jQuery.access( this, name, value, true, jQuery.prop );
+ },
+
+ removeProp: function( name ) {
+ name = jQuery.propFix[ name ] || name;
+ return this.each(function() {
+ // try/catch handles cases where IE balks (such as removing a property on window)
+ try {
+ this[ name ] = undefined;
+ delete this[ name ];
+ } catch( e ) {}
});
},
addClass: function( value ) {
- if ( jQuery.isFunction(value) ) {
+ if ( jQuery.isFunction( value ) ) {
return this.each(function(i) {
var self = jQuery(this);
- self.addClass( value.call(this, i, self.attr("class")) );
+ self.addClass( value.call(this, i, self.attr("class") || "") );
});
}
@@ -1245,7 +1930,9 @@ jQuery.fn.extend({
elem.className = value;
} else {
- var className = " " + elem.className + " ", setClass = elem.className;
+ var className = " " + elem.className + " ",
+ setClass = elem.className;
+
for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) {
setClass += " " + classNames[c];
@@ -1269,7 +1956,7 @@ jQuery.fn.extend({
}
if ( (value && typeof value === "string") || value === undefined ) {
- var classNames = (value || "").split(rspace);
+ var classNames = (value || "").split( rspace );
for ( var i = 0, l = this.length; i < l; i++ ) {
var elem = this[i];
@@ -1293,7 +1980,8 @@ jQuery.fn.extend({
},
toggleClass: function( value, stateVal ) {
- var type = typeof value, isBool = typeof stateVal === "boolean";
+ var type = typeof value,
+ isBool = typeof stateVal === "boolean";
if ( jQuery.isFunction( value ) ) {
return this.each(function(i) {
@@ -1305,7 +1993,9 @@ jQuery.fn.extend({
return this.each(function() {
if ( type === "string" ) {
// toggle individual class names
- var className, i = 0, self = jQuery(this),
+ var className,
+ i = 0,
+ self = jQuery( this ),
state = stateVal,
classNames = value.split( rspace );
@@ -1318,11 +2008,11 @@ jQuery.fn.extend({
} else if ( type === "undefined" || type === "boolean" ) {
if ( this.className ) {
// store className if set
- jQuery.data( this, "__className__", this.className );
+ jQuery._data( this, "__className__", this.className );
}
// toggle whole className
- this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || "";
+ this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || "";
}
});
},
@@ -1339,102 +2029,126 @@ jQuery.fn.extend({
},
val: function( value ) {
- if ( value === undefined ) {
- var elem = this[0];
-
+ var hooks, ret,
+ elem = this[0];
+
+ if ( !arguments.length ) {
if ( elem ) {
- if ( jQuery.nodeName( elem, "option" ) ) {
- return (elem.attributes.value || {}).specified ? elem.value : elem.text;
- }
-
- // We need to handle select boxes special
- if ( jQuery.nodeName( elem, "select" ) ) {
- var index = elem.selectedIndex,
- values = [],
- options = elem.options,
- one = elem.type === "select-one";
-
- // Nothing was selected
- if ( index < 0 ) {
- return null;
- }
-
- // Loop through all the selected options
- for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
- var option = options[ i ];
-
- if ( option.selected ) {
- // Get the specifc value for the option
- value = jQuery(option).val();
-
- // We don't need an array for one selects
- if ( one ) {
- return value;
- }
-
- // Multi-Selects return an array
- values.push( value );
- }
- }
+ hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ];
- return values;
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) {
+ return ret;
}
- // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
- if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) {
- return elem.getAttribute("value") === null ? "on" : elem.value;
- }
-
-
- // Everything else, we just grab the value
return (elem.value || "").replace(rreturn, "");
-
}
return undefined;
}
- var isFunction = jQuery.isFunction(value);
+ var isFunction = jQuery.isFunction( value );
- return this.each(function(i) {
- var self = jQuery(this), val = value;
+ return this.each(function( i ) {
+ var self = jQuery(this), val;
if ( this.nodeType !== 1 ) {
return;
}
if ( isFunction ) {
- val = value.call(this, i, self.val());
+ val = value.call( this, i, self.val() );
+ } else {
+ val = value;
}
- // Typecast each time if the value is a Function and the appended
- // value is therefore different each time.
- if ( typeof val === "number" ) {
+ // Treat null/undefined as ""; convert numbers to string
+ if ( val == null ) {
+ val = "";
+ } else if ( typeof val === "number" ) {
val += "";
+ } else if ( jQuery.isArray( val ) ) {
+ val = jQuery.map(val, function ( value ) {
+ return value == null ? "" : value + "";
+ });
}
- if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) {
- this.checked = jQuery.inArray( self.val(), val ) >= 0;
+ hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ];
+
+ // If set returns undefined, fall back to normal setting
+ if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) {
+ this.value = val;
+ }
+ });
+ }
+});
+
+jQuery.extend({
+ valHooks: {
+ option: {
+ get: function( elem ) {
+ // attributes.value is undefined in Blackberry 4.7 but
+ // uses .value. See #6932
+ var val = elem.attributes.value;
+ return !val || val.specified ? elem.value : elem.text;
+ }
+ },
+ select: {
+ get: function( elem ) {
+ var value,
+ index = elem.selectedIndex,
+ values = [],
+ options = elem.options,
+ one = elem.type === "select-one";
+
+ // Nothing was selected
+ if ( index < 0 ) {
+ return null;
+ }
+
+ // Loop through all the selected options
+ for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+ var option = options[ i ];
+
+ // Don't return options that are disabled or in a disabled optgroup
+ if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) &&
+ (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) {
+
+ // Get the specific value for the option
+ value = jQuery( option ).val();
- } else if ( jQuery.nodeName( this, "select" ) ) {
- var values = jQuery.makeArray(val);
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
+
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
+
+ // Fixes Bug #2551 -- select.val() broken in IE after form.reset()
+ if ( one && !values.length && options.length ) {
+ return jQuery( options[ index ] ).val();
+ }
+
+ return values;
+ },
- jQuery( "option", this ).each(function() {
+ set: function( elem, value ) {
+ var values = jQuery.makeArray( value );
+
+ jQuery(elem).find("option").each(function() {
this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
});
if ( !values.length ) {
- this.selectedIndex = -1;
+ elem.selectedIndex = -1;
}
-
- } else {
- this.value = val;
+ return values;
}
- });
- }
-});
+ }
+ },
-jQuery.extend({
attrFn: {
val: true,
css: true,
@@ -1445,106 +2159,348 @@ jQuery.extend({
height: true,
offset: true
},
-
+
+ attrFix: {
+ // Always normalize to ensure hook usage
+ tabindex: "tabIndex"
+ },
+
attr: function( elem, name, value, pass ) {
- // don't set attributes on text and comment nodes
- if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+ var nType = elem.nodeType;
+
+ // don't get/set attributes on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
return undefined;
}
if ( pass && name in jQuery.attrFn ) {
- return jQuery(elem)[name](value);
+ return jQuery( elem )[ name ]( value );
+ }
+
+ // Fallback to prop when attributes are not supported
+ if ( !("getAttribute" in elem) ) {
+ return jQuery.prop( elem, name, value );
}
- var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ),
- // Whether we are setting (or getting)
- set = value !== undefined;
+ var ret, hooks,
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
- // Try to normalize/fix the name
- name = notxml && jQuery.props[ name ] || name;
+ // Normalize the name if needed
+ name = notxml && jQuery.attrFix[ name ] || name;
+
+ hooks = jQuery.attrHooks[ name ];
+
+ if ( !hooks ) {
+ // Use boolHook for boolean attributes
+ if ( rboolean.test( name ) &&
+ (typeof value === "boolean" || value === undefined || value.toLowerCase() === name.toLowerCase()) ) {
+
+ hooks = boolHook;
- // Only do all the following if this is a node (faster for style)
+ // Use formHook for forms and if the name contains certain characters
+ } else if ( formHook && (jQuery.nodeName( elem, "form" ) || rinvalidChar.test( name )) ) {
+ hooks = formHook;
+ }
+ }
+
+ if ( value !== undefined ) {
+
+ if ( value === null ) {
+ jQuery.removeAttr( elem, name );
+ return undefined;
+
+ } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ elem.setAttribute( name, "" + value );
+ return value;
+ }
+
+ } else if ( hooks && "get" in hooks && notxml ) {
+ return hooks.get( elem, name );
+
+ } else {
+
+ ret = elem.getAttribute( name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return ret === null ?
+ undefined :
+ ret;
+ }
+ },
+
+ removeAttr: function( elem, name ) {
+ var propName;
if ( elem.nodeType === 1 ) {
- // These attributes require special treatment
- var special = rspecialurl.test( name );
-
- // Safari mis-reports the default selected property of an option
- // Accessing the parent's selectedIndex property fixes it
- if ( name === "selected" && !jQuery.support.optSelected ) {
- var parent = elem.parentNode;
- if ( parent ) {
- parent.selectedIndex;
-
- // Make sure that it also works with optgroups, see #5701
- if ( parent.parentNode ) {
- parent.parentNode.selectedIndex;
+ name = jQuery.attrFix[ name ] || name;
+
+ if ( jQuery.support.getSetAttribute ) {
+ // Use removeAttribute in browsers that support it
+ elem.removeAttribute( name );
+ } else {
+ jQuery.attr( elem, name, "" );
+ elem.removeAttributeNode( elem.getAttributeNode( name ) );
+ }
+
+ // Set corresponding property to false for boolean attributes
+ if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) {
+ elem[ propName ] = false;
+ }
+ }
+ },
+
+ attrHooks: {
+ type: {
+ set: function( elem, value ) {
+ // We can't allow the type property to be changed (since it causes problems in IE)
+ if ( rtype.test( elem.nodeName ) && elem.parentNode ) {
+ jQuery.error( "type property can't be changed" );
+ } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) {
+ // Setting the type on a radio button after the value resets the value in IE6-9
+ // Reset value to it's default in case type is set after value
+ // This is for element creation
+ var val = elem.value;
+ elem.setAttribute( "type", value );
+ if ( val ) {
+ elem.value = val;
}
+ return value;
}
}
+ },
+ tabIndex: {
+ get: function( elem ) {
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ var attributeNode = elem.getAttributeNode("tabIndex");
- // If applicable, access the attribute via the DOM 0 way
- if ( name in elem && notxml && !special ) {
- if ( set ) {
- // We can't allow the type property to be changed (since it causes problems in IE)
- if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) {
- jQuery.error( "type property can't be changed" );
- }
+ return attributeNode && attributeNode.specified ?
+ parseInt( attributeNode.value, 10 ) :
+ rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+ 0 :
+ undefined;
+ }
+ }
+ },
- elem[ name ] = value;
- }
+ propFix: {
+ tabindex: "tabIndex",
+ readonly: "readOnly",
+ "for": "htmlFor",
+ "class": "className",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ cellpadding: "cellPadding",
+ rowspan: "rowSpan",
+ colspan: "colSpan",
+ usemap: "useMap",
+ frameborder: "frameBorder",
+ contenteditable: "contentEditable"
+ },
+
+ prop: function( elem, name, value ) {
+ var nType = elem.nodeType;
- // browsers index elements by id/name on forms, give priority to attributes.
- if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) {
- return elem.getAttributeNode( name ).nodeValue;
- }
+ // don't get/set properties on text, comment and attribute nodes
+ if ( !elem || nType === 3 || nType === 8 || nType === 2 ) {
+ return undefined;
+ }
- // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
- // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
- if ( name === "tabIndex" ) {
- var attributeNode = elem.getAttributeNode( "tabIndex" );
+ var ret, hooks,
+ notxml = nType !== 1 || !jQuery.isXMLDoc( elem );
- return attributeNode && attributeNode.specified ?
- attributeNode.value :
- rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
- 0 :
- undefined;
- }
+ // Try to normalize/fix the name
+ name = notxml && jQuery.propFix[ name ] || name;
+
+ hooks = jQuery.propHooks[ name ];
+
+ if ( value !== undefined ) {
+ if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) {
+ return ret;
+
+ } else {
+ return (elem[ name ] = value);
+ }
+ } else {
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== undefined ) {
+ return ret;
+
+ } else {
return elem[ name ];
}
+ }
+ },
+
+ propHooks: {}
+});
- if ( !jQuery.support.style && notxml && name === "style" ) {
- if ( set ) {
- elem.style.cssText = "" + value;
- }
+// Hook for boolean attributes
+boolHook = {
+ get: function( elem, name ) {
+ // Align boolean attributes with corresponding properties
+ return elem[ jQuery.propFix[ name ] || name ] ?
+ name.toLowerCase() :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ var propName;
+ if ( value === false ) {
+ // Remove boolean attributes when set to false
+ jQuery.removeAttr( elem, name );
+ } else {
+ // value is true since we know at this point it's type boolean and not false
+ // Set boolean attributes to the same name and set the DOM property
+ propName = jQuery.propFix[ name ] || name;
+ if ( propName in elem ) {
+ // Only set the IDL specifically if it already exists on the element
+ elem[ propName ] = value;
+ }
+
+ elem.setAttribute( name, name.toLowerCase() );
+ }
+ return name;
+ }
+};
- return elem.style.cssText;
+// Use the value property for back compat
+// Use the formHook for button elements in IE6/7 (#1954)
+jQuery.attrHooks.value = {
+ get: function( elem, name ) {
+ if ( formHook && jQuery.nodeName( elem, "button" ) ) {
+ return formHook.get( elem, name );
+ }
+ return elem.value;
+ },
+ set: function( elem, value, name ) {
+ if ( formHook && jQuery.nodeName( elem, "button" ) ) {
+ return formHook.set( elem, value, name );
+ }
+ // Does not return so that setAttribute is also used
+ elem.value = value;
+ }
+};
+
+// IE6/7 do not support getting/setting some attributes with get/setAttribute
+if ( !jQuery.support.getSetAttribute ) {
+
+ // propFix is more comprehensive and contains all fixes
+ jQuery.attrFix = jQuery.propFix;
+
+ // Use this for any attribute on a form in IE6/7
+ formHook = jQuery.attrHooks.name = jQuery.valHooks.button = {
+ get: function( elem, name ) {
+ var ret;
+ ret = elem.getAttributeNode( name );
+ // Return undefined if nodeValue is empty string
+ return ret && ret.nodeValue !== "" ?
+ ret.nodeValue :
+ undefined;
+ },
+ set: function( elem, value, name ) {
+ // Check form objects in IE (multiple bugs related)
+ // Only use nodeValue if the attribute node exists on the form
+ var ret = elem.getAttributeNode( name );
+ if ( ret ) {
+ ret.nodeValue = value;
+ return value;
}
+ }
+ };
- if ( set ) {
- // convert the value to a string (all browsers do this but IE) see #1070
- elem.setAttribute( name, "" + value );
+ // Set width and height to auto instead of 0 on empty string( Bug #8150 )
+ // This is for removals
+ jQuery.each([ "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ set: function( elem, value ) {
+ if ( value === "" ) {
+ elem.setAttribute( name, "auto" );
+ return value;
+ }
}
+ });
+ });
+}
- var attr = !jQuery.support.hrefNormalized && notxml && special ?
- // Some attributes require a special call on IE
- elem.getAttribute( name, 2 ) :
- elem.getAttribute( name );
- // Non-existent attributes return null, we normalize to undefined
- return attr === null ? undefined : attr;
+// Some attributes require a special call on IE
+if ( !jQuery.support.hrefNormalized ) {
+ jQuery.each([ "href", "src", "width", "height" ], function( i, name ) {
+ jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], {
+ get: function( elem ) {
+ var ret = elem.getAttribute( name, 2 );
+ return ret === null ? undefined : ret;
+ }
+ });
+ });
+}
+
+if ( !jQuery.support.style ) {
+ jQuery.attrHooks.style = {
+ get: function( elem ) {
+ // Return undefined in the case of empty string
+ // Normalize to lowercase since IE uppercases css property names
+ return elem.style.cssText.toLowerCase() || undefined;
+ },
+ set: function( elem, value ) {
+ return (elem.style.cssText = "" + value);
}
+ };
+}
- // elem is actually elem.style ... set the style
- // Using attr for specific style information is now deprecated. Use style instead.
- return jQuery.style( elem, name, value );
- }
+// Safari mis-reports the default selected property of an option
+// Accessing the parent's selectedIndex property fixes it
+if ( !jQuery.support.optSelected ) {
+ jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, {
+ get: function( elem ) {
+ var parent = elem.parentNode;
+
+ if ( parent ) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ }
+ });
+}
+
+// Radios and checkboxes getter/setter
+if ( !jQuery.support.checkOn ) {
+ jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = {
+ get: function( elem ) {
+ // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ }
+ };
+ });
+}
+jQuery.each([ "radio", "checkbox" ], function() {
+ jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], {
+ set: function( elem, value ) {
+ if ( jQuery.isArray( value ) ) {
+ return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0);
+ }
+ }
+ });
});
-var rnamespaces = /\.(.*)$/,
+
+
+
+
+var hasOwn = Object.prototype.hasOwnProperty,
+ rnamespaces = /\.(.*)$/,
+ rformElems = /^(?:textarea|input|select)$/i,
+ rperiod = /\./g,
+ rspaces = / /g,
+ rescape = /[^\w\s.|`]/g,
fcleanup = function( nm ) {
- return nm.replace(/[^\w\s\.\|`]/g, function( ch ) {
- return "\\" + ch;
- });
+ return nm.replace(rescape, "\\$&");
};
/*
@@ -1561,10 +2517,11 @@ jQuery.event = {
return;
}
- // For whatever reason, IE has trouble passing the window object
- // around, causing it to be cloned in the process
- if ( elem.setInterval && ( elem !== window && !elem.frameElement ) ) {
- elem = window;
+ if ( handler === false ) {
+ handler = returnFalse;
+ } else if ( !handler ) {
+ // Fixes bug #7229. Fix recommended by jdalton
+ return;
}
var handleObjIn, handleObj;
@@ -1580,7 +2537,7 @@ jQuery.event = {
}
// Init the element's event structure
- var elemData = jQuery.data( elem );
+ var elemData = jQuery._data( elem );
// If no elemData is found then we must be trying to bind to one of the
// banned noData elements
@@ -1588,14 +2545,18 @@ jQuery.event = {
return;
}
- var events = elemData.events = elemData.events || {},
- eventHandle = elemData.handle, eventHandle;
+ var events = elemData.events,
+ eventHandle = elemData.handle;
+
+ if ( !events ) {
+ elemData.events = events = {};
+ }
if ( !eventHandle ) {
- elemData.handle = eventHandle = function() {
- // Handle the second event of a trigger and when
- // an event is called after a page has unloaded
- return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
+ elemData.handle = eventHandle = function( e ) {
+ // Discard the second event of a jQuery.event.trigger() and
+ // when an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ?
jQuery.event.handle.apply( eventHandle.elem, arguments ) :
undefined;
};
@@ -1628,7 +2589,9 @@ jQuery.event = {
}
handleObj.type = type;
- handleObj.guid = handler.guid;
+ if ( !handleObj.guid ) {
+ handleObj.guid = handler.guid;
+ }
// Get the current list of functions bound to this event
var handlers = events[ type ],
@@ -1651,9 +2614,9 @@ jQuery.event = {
}
}
}
-
- if ( special.add ) {
- special.add.call( elem, handleObj );
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
if ( !handleObj.handler.guid ) {
handleObj.handler.guid = handler.guid;
@@ -1663,7 +2626,7 @@ jQuery.event = {
// Add the function to the element's handler list
handlers.push( handleObj );
- // Keep track of which events have been used, for global triggering
+ // Keep track of which events have been used, for event optimization
jQuery.event.global[ type ] = true;
}
@@ -1680,8 +2643,12 @@ jQuery.event = {
return;
}
- var ret, type, fn, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
- elemData = jQuery.data( elem ),
+ if ( handler === false ) {
+ handler = returnFalse;
+ }
+
+ var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
+ elemData = jQuery.hasData( elem ) && jQuery._data( elem ),
events = elemData && elemData.events;
if ( !elemData || !events ) {
@@ -1720,8 +2687,8 @@ jQuery.event = {
namespaces = type.split(".");
type = namespaces.shift();
- namespace = new RegExp("(^|\\.)" +
- jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)")
+ namespace = new RegExp("(^|\\.)" +
+ jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)");
}
eventType = events[ type ];
@@ -1731,7 +2698,7 @@ jQuery.event = {
}
if ( !handler ) {
- for ( var j = 0; j < eventType.length; j++ ) {
+ for ( j = 0; j < eventType.length; j++ ) {
handleObj = eventType[ j ];
if ( all || namespace.test( handleObj.namespace ) ) {
@@ -1745,7 +2712,7 @@ jQuery.event = {
special = jQuery.event.special[ type ] || {};
- for ( var j = pos || 0; j < eventType.length; j++ ) {
+ for ( j = pos || 0; j < eventType.length; j++ ) {
handleObj = eventType[ j ];
if ( handler.guid === handleObj.guid ) {
@@ -1769,7 +2736,7 @@ jQuery.event = {
// remove generic event handler if no more handlers exist
if ( eventType.length === 0 || pos != null && eventType.length === 1 ) {
if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
- removeEvent( elem, type, elemData.handle );
+ jQuery.removeEvent( elem, type, elemData.handle );
}
ret = null;
@@ -1788,175 +2755,196 @@ jQuery.event = {
delete elemData.handle;
if ( jQuery.isEmptyObject( elemData ) ) {
- jQuery.removeData( elem );
+ jQuery.removeData( elem, undefined, true );
}
}
},
+
+ // Events that are safe to short-circuit if no handlers are attached.
+ // Native DOM events should not be added, they may have inline handlers.
+ customEvent: {
+ "getData": true,
+ "setData": true,
+ "changeData": true
+ },
- // bubbling is internal
- trigger: function( event, data, elem /*, bubbling */ ) {
+ trigger: function( event, data, elem, onlyHandlers ) {
// Event object or event type
var type = event.type || event,
- bubbling = arguments[3];
+ namespaces = [],
+ exclusive;
- if ( !bubbling ) {
- event = typeof event === "object" ?
- // jQuery.Event object
- event[expando] ? event :
- // Object literal
- jQuery.extend( jQuery.Event(type), event ) :
- // Just the event type (string)
- jQuery.Event(type);
+ if ( type.indexOf("!") >= 0 ) {
+ // Exclusive events trigger only for the exact event (no namespaces)
+ type = type.slice(0, -1);
+ exclusive = true;
+ }
- if ( type.indexOf("!") >= 0 ) {
- event.type = type = type.slice(0, -1);
- event.exclusive = true;
- }
+ if ( type.indexOf(".") >= 0 ) {
+ // Namespaced trigger; create a regexp to match event type in handle()
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ namespaces.sort();
+ }
- // Handle a global trigger
- if ( !elem ) {
- // Don't bubble custom events when global (to avoid too much overhead)
- event.stopPropagation();
-
- // Only trigger if we've ever bound an event for it
- if ( jQuery.event.global[ type ] ) {
- jQuery.each( jQuery.cache, function() {
- if ( this.events && this.events[type] ) {
- jQuery.event.trigger( event, data, this.handle.elem );
- }
- });
- }
- }
+ if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) {
+ // No jQuery handlers for this event type, and it can't have inline handlers
+ return;
+ }
- // Handle triggering a single element
+ // Caller can pass in an Event, Object, or just an event type string
+ event = typeof event === "object" ?
+ // jQuery.Event object
+ event[ jQuery.expando ] ? event :
+ // Object literal
+ new jQuery.Event( type, event ) :
+ // Just the event type (string)
+ new jQuery.Event( type );
- // don't do events on text and comment nodes
- if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
- return undefined;
- }
+ event.type = type;
+ event.exclusive = exclusive;
+ event.namespace = namespaces.join(".");
+ event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)");
+
+ // triggerHandler() and global events don't bubble or run the default action
+ if ( onlyHandlers || !elem ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
- // Clean up in case it is reused
- event.result = undefined;
- event.target = elem;
+ // Handle a global trigger
+ if ( !elem ) {
+ // TODO: Stop taunting the data cache; remove global events and always attach to document
+ jQuery.each( jQuery.cache, function() {
+ // internalKey variable is just used to make it easier to find
+ // and potentially change this stuff later; currently it just
+ // points to jQuery.expando
+ var internalKey = jQuery.expando,
+ internalCache = this[ internalKey ];
+ if ( internalCache && internalCache.events && internalCache.events[ type ] ) {
+ jQuery.event.trigger( event, data, internalCache.handle.elem );
+ }
+ });
+ return;
+ }
- // Clone the incoming data, if any
- data = jQuery.makeArray( data );
- data.unshift( event );
+ // Don't do events on text and comment nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
}
- event.currentTarget = elem;
+ // Clean up the event in case it is being reused
+ event.result = undefined;
+ event.target = elem;
- // Trigger the event, it is assumed that "handle" is a function
- var handle = jQuery.data( elem, "handle" );
- if ( handle ) {
- handle.apply( elem, data );
- }
+ // Clone any incoming data and prepend the event, creating the handler arg list
+ data = data ? jQuery.makeArray( data ) : [];
+ data.unshift( event );
- var parent = elem.parentNode || elem.ownerDocument;
+ var cur = elem,
+ // IE doesn't like method names with a colon (#3533, #8272)
+ ontype = type.indexOf(":") < 0 ? "on" + type : "";
- // Trigger an inline bound script
- try {
- if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) {
- if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) {
- event.result = false;
- }
+ // Fire event on the current element, then bubble up the DOM tree
+ do {
+ var handle = jQuery._data( cur, "handle" );
+
+ event.currentTarget = cur;
+ if ( handle ) {
+ handle.apply( cur, data );
}
- // prevent IE from throwing an error for some elements with some event types, see #3533
- } catch (e) {}
+ // Trigger an inline bound script
+ if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) {
+ event.result = false;
+ event.preventDefault();
+ }
- if ( !event.isPropagationStopped() && parent ) {
- jQuery.event.trigger( event, data, parent, true );
+ // Bubble up to document, then to window
+ cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window;
+ } while ( cur && !event.isPropagationStopped() );
- } else if ( !event.isDefaultPrevented() ) {
- var target = event.target, old,
- isClick = jQuery.nodeName(target, "a") && type === "click",
+ // If nobody prevented the default action, do it now
+ if ( !event.isDefaultPrevented() ) {
+ var old,
special = jQuery.event.special[ type ] || {};
- if ( (!special._default || special._default.call( elem, event ) === false) &&
- !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) {
+ if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) &&
+ !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) {
+ // Call a native DOM method on the target with the same name name as the event.
+ // Can't use an .isFunction)() check here because IE6/7 fails that test.
+ // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch.
try {
- if ( target[ type ] ) {
- // Make sure that we don't accidentally re-trigger the onFOO events
- old = target[ "on" + type ];
+ if ( ontype && elem[ type ] ) {
+ // Don't re-trigger an onFOO event when we call its FOO() method
+ old = elem[ ontype ];
if ( old ) {
- target[ "on" + type ] = null;
+ elem[ ontype ] = null;
}
- jQuery.event.triggered = true;
- target[ type ]();
+ jQuery.event.triggered = type;
+ elem[ type ]();
}
-
- // prevent IE from throwing an error for some elements with some event types, see #3533
- } catch (e) {}
+ } catch ( ieError ) {}
if ( old ) {
- target[ "on" + type ] = old;
+ elem[ ontype ] = old;
}
- jQuery.event.triggered = false;
+ jQuery.event.triggered = undefined;
}
}
+
+ return event.result;
},
handle: function( event ) {
- var all, handlers, namespaces, namespace, events;
-
- event = arguments[0] = jQuery.event.fix( event || window.event );
+ event = jQuery.event.fix( event || window.event );
+ // Snapshot the handlers list since a called handler may add/remove events.
+ var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0),
+ run_all = !event.exclusive && !event.namespace,
+ args = Array.prototype.slice.call( arguments, 0 );
+
+ // Use the fix-ed Event rather than the (read-only) native event
+ args[0] = event;
event.currentTarget = this;
- // Namespaced event handlers
- all = event.type.indexOf(".") < 0 && !event.exclusive;
-
- if ( !all ) {
- namespaces = event.type.split(".");
- event.type = namespaces.shift();
- namespace = new RegExp("(^|\\.)" + namespaces.slice(0).sort().join("\\.(?:.*\\.)?") + "(\\.|$)");
- }
-
- var events = jQuery.data(this, "events"), handlers = events[ event.type ];
-
- if ( events && handlers ) {
- // Clone the handlers to prevent manipulation
- handlers = handlers.slice(0);
-
- for ( var j = 0, l = handlers.length; j < l; j++ ) {
- var handleObj = handlers[ j ];
-
- // Filter the functions by class
- if ( all || namespace.test( handleObj.namespace ) ) {
- // Pass in a reference to the handler function itself
- // So that we can later remove it
- event.handler = handleObj.handler;
- event.data = handleObj.data;
- event.handleObj = handleObj;
-
- var ret = handleObj.handler.apply( this, arguments );
-
- if ( ret !== undefined ) {
- event.result = ret;
- if ( ret === false ) {
- event.preventDefault();
- event.stopPropagation();
- }
+ for ( var j = 0, l = handlers.length; j < l; j++ ) {
+ var handleObj = handlers[ j ];
+
+ // Triggered event must 1) be non-exclusive and have no namespace, or
+ // 2) have namespace(s) a subset or equal to those in the bound event.
+ if ( run_all || event.namespace_re.test( handleObj.namespace ) ) {
+ // Pass in a reference to the handler function itself
+ // So that we can later remove it
+ event.handler = handleObj.handler;
+ event.data = handleObj.data;
+ event.handleObj = handleObj;
+
+ var ret = handleObj.handler.apply( this, args );
+
+ if ( ret !== undefined ) {
+ event.result = ret;
+ if ( ret === false ) {
+ event.preventDefault();
+ event.stopPropagation();
}
+ }
- if ( event.isImmediatePropagationStopped() ) {
- break;
- }
+ if ( event.isImmediatePropagationStopped() ) {
+ break;
}
}
}
-
return event.result;
},
- props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+ props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
fix: function( event ) {
- if ( event[ expando ] ) {
+ if ( event[ jQuery.expando ] ) {
return event;
}
@@ -1972,7 +2960,8 @@ jQuery.event = {
// Fix target property, if necessary
if ( !event.target ) {
- event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+ // Fixes #1925 where srcElement might not be defined either
+ event.target = event.srcElement || document;
}
// check if target is a textnode (safari)
@@ -1987,14 +2976,17 @@ jQuery.event = {
// Calculate pageX/Y if missing and clientX/Y available
if ( event.pageX == null && event.clientX != null ) {
- var doc = document.documentElement, body = document.body;
+ var eventDocument = event.target.ownerDocument || document,
+ doc = eventDocument.documentElement,
+ body = eventDocument.body;
+
event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0);
}
// Add which for key events
- if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) {
- event.which = event.charCode || event.keyCode;
+ if ( event.which == null && (event.charCode != null || event.keyCode != null) ) {
+ event.which = event.charCode != null ? event.charCode : event.keyCode;
}
// Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
@@ -2026,36 +3018,24 @@ jQuery.event = {
live: {
add: function( handleObj ) {
- jQuery.event.add( this, handleObj.origType, jQuery.extend({}, handleObj, {handler: liveHandler}) );
+ jQuery.event.add( this,
+ liveConvert( handleObj.origType, handleObj.selector ),
+ jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) );
},
remove: function( handleObj ) {
- var remove = true,
- type = handleObj.origType.replace(rnamespaces, "");
-
- jQuery.each( jQuery.data(this, "events").live || [], function() {
- if ( type === this.origType.replace(rnamespaces, "") ) {
- remove = false;
- return false;
- }
- });
-
- if ( remove ) {
- jQuery.event.remove( this, handleObj.origType, liveHandler );
- }
+ jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj );
}
-
},
beforeunload: {
setup: function( data, namespaces, eventHandle ) {
// We only want to do this special case on windows
- if ( this.setInterval ) {
+ if ( jQuery.isWindow( this ) ) {
this.onbeforeunload = eventHandle;
}
-
- return false;
},
+
teardown: function( namespaces, eventHandle ) {
if ( this.onbeforeunload === eventHandle ) {
this.onbeforeunload = null;
@@ -2065,35 +3045,50 @@ jQuery.event = {
}
};
-var removeEvent = document.removeEventListener ?
+jQuery.removeEvent = document.removeEventListener ?
function( elem, type, handle ) {
- elem.removeEventListener( type, handle, false );
- } :
+ if ( elem.removeEventListener ) {
+ elem.removeEventListener( type, handle, false );
+ }
+ } :
function( elem, type, handle ) {
- elem.detachEvent( "on" + type, handle );
+ if ( elem.detachEvent ) {
+ elem.detachEvent( "on" + type, handle );
+ }
};
-jQuery.Event = function( src ) {
+jQuery.Event = function( src, props ) {
// Allow instantiation without the 'new' keyword
if ( !this.preventDefault ) {
- return new jQuery.Event( src );
+ return new jQuery.Event( src, props );
}
// Event object
if ( src && src.type ) {
this.originalEvent = src;
this.type = src.type;
+
+ // Events bubbling up the document may have been marked as prevented
+ // by a handler lower down the tree; reflect the correct value.
+ this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false ||
+ src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse;
+
// Event type
} else {
this.type = src;
}
+ // Put explicitly provided properties onto the event object
+ if ( props ) {
+ jQuery.extend( this, props );
+ }
+
// timeStamp is buggy for some events on Firefox(#3843)
// So we won't rely on the native value
- this.timeStamp = now();
+ this.timeStamp = jQuery.now();
// Mark it as fixed
- this[ expando ] = true;
+ this[ jQuery.expando ] = true;
};
function returnFalse() {
@@ -2113,13 +3108,15 @@ jQuery.Event.prototype = {
if ( !e ) {
return;
}
-
+
// if preventDefault exists run it on the original event
if ( e.preventDefault ) {
e.preventDefault();
- }
+
// otherwise set the returnValue property of the original event to false (IE)
- e.returnValue = false;
+ } else {
+ e.returnValue = false;
+ }
},
stopPropagation: function() {
this.isPropagationStopped = returnTrue;
@@ -2150,18 +3147,25 @@ var withinElement = function( event ) {
// Check if mouse(over|out) are still within the same parent element
var parent = event.relatedTarget;
+ // set the correct event type
+ event.type = event.data;
+
// Firefox sometimes assigns relatedTarget a XUL element
// which we cannot access the parentNode property of
try {
+
+ // Chrome does something similar, the parentNode property
+ // can be accessed but is null.
+ if ( parent && parent !== document && !parent.parentNode ) {
+ return;
+ }
+
// Traverse up the tree
while ( parent && parent !== this ) {
parent = parent.parentNode;
}
if ( parent !== this ) {
- // set the correct event type
- event.type = event.data;
-
// handle event if we actually just moused on to a non sub-element
jQuery.event.handle.apply( this, arguments );
}
@@ -2197,20 +3201,22 @@ if ( !jQuery.support.submitBubbles ) {
jQuery.event.special.submit = {
setup: function( data, namespaces ) {
- if ( this.nodeName.toLowerCase() !== "form" ) {
+ if ( !jQuery.nodeName( this, "form" ) ) {
jQuery.event.add(this, "click.specialSubmit", function( e ) {
- var elem = e.target, type = elem.type;
+ var elem = e.target,
+ type = elem.type;
if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) {
- return trigger( "submit", this, arguments );
+ trigger( "submit", this, arguments );
}
});
-
+
jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
- var elem = e.target, type = elem.type;
+ var elem = e.target,
+ type = elem.type;
if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
- return trigger( "submit", this, arguments );
+ trigger( "submit", this, arguments );
}
});
@@ -2229,9 +3235,7 @@ if ( !jQuery.support.submitBubbles ) {
// change delegation, happens here so we have bind.
if ( !jQuery.support.changeBubbles ) {
- var formElems = /textarea|input|select/i,
-
- changeFilters,
+ var changeFilters,
getVal = function( elem ) {
var type = elem.type, val = elem.value;
@@ -2246,7 +3250,7 @@ if ( !jQuery.support.changeBubbles ) {
}).join("-") :
"";
- } else if ( elem.nodeName.toLowerCase() === "select" ) {
+ } else if ( jQuery.nodeName( elem, "select" ) ) {
val = elem.selectedIndex;
}
@@ -2256,58 +3260,61 @@ if ( !jQuery.support.changeBubbles ) {
testChange = function testChange( e ) {
var elem = e.target, data, val;
- if ( !formElems.test( elem.nodeName ) || elem.readOnly ) {
+ if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) {
return;
}
- data = jQuery.data( elem, "_change_data" );
+ data = jQuery._data( elem, "_change_data" );
val = getVal(elem);
// the current data will be also retrieved by beforeactivate
if ( e.type !== "focusout" || elem.type !== "radio" ) {
- jQuery.data( elem, "_change_data", val );
+ jQuery._data( elem, "_change_data", val );
}
-
+
if ( data === undefined || val === data ) {
return;
}
if ( data != null || val ) {
e.type = "change";
- return jQuery.event.trigger( e, arguments[1], elem );
+ e.liveFired = undefined;
+ jQuery.event.trigger( e, arguments[1], elem );
}
};
jQuery.event.special.change = {
filters: {
- focusout: testChange,
+ focusout: testChange,
+
+ beforedeactivate: testChange,
click: function( e ) {
- var elem = e.target, type = elem.type;
+ var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : "";
- if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) {
- return testChange.call( this, e );
+ if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) {
+ testChange.call( this, e );
}
},
// Change has to be called before submit
// Keydown will be called before keypress, which is used in submit-event delegation
keydown: function( e ) {
- var elem = e.target, type = elem.type;
+ var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : "";
- if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") ||
+ if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) ||
(e.keyCode === 32 && (type === "checkbox" || type === "radio")) ||
type === "select-multiple" ) {
- return testChange.call( this, e );
+ testChange.call( this, e );
}
},
// Beforeactivate happens also before the previous element is blurred
// with this event you can't trigger a change event, but you can store
- // information/focus[in] is not needed anymore
+ // information
beforeactivate: function( e ) {
var elem = e.target;
- jQuery.data( elem, "_change_data", getVal(elem) );
+ jQuery._data( elem, "_change_data", getVal(elem) );
}
},
@@ -2320,46 +3327,75 @@ if ( !jQuery.support.changeBubbles ) {
jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
}
- return formElems.test( this.nodeName );
+ return rformElems.test( this.nodeName );
},
teardown: function( namespaces ) {
jQuery.event.remove( this, ".specialChange" );
- return formElems.test( this.nodeName );
+ return rformElems.test( this.nodeName );
}
};
changeFilters = jQuery.event.special.change.filters;
+
+ // Handle when the input is .focus()'d
+ changeFilters.focus = changeFilters.beforeactivate;
}
function trigger( type, elem, args ) {
- args[0].type = type;
- return jQuery.event.handle.apply( elem, args );
+ // Piggyback on a donor event to simulate a different one.
+ // Fake originalEvent to avoid donor's stopPropagation, but if the
+ // simulated event prevents default then we do the same on the donor.
+ // Don't pass args or remember liveFired; they apply to the donor event.
+ var event = jQuery.extend( {}, args[ 0 ] );
+ event.type = type;
+ event.originalEvent = {};
+ event.liveFired = undefined;
+ jQuery.event.handle.call( elem, event );
+ if ( event.isDefaultPrevented() ) {
+ args[ 0 ].preventDefault();
+ }
}
// Create "bubbling" focus and blur events
-if ( document.addEventListener ) {
+if ( !jQuery.support.focusinBubbles ) {
jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+ // Attach a single capturing handler while someone wants focusin/focusout
+ var attaches = 0;
+
jQuery.event.special[ fix ] = {
setup: function() {
- this.addEventListener( orig, handler, true );
- },
- teardown: function() {
- this.removeEventListener( orig, handler, true );
+ if ( attaches++ === 0 ) {
+ document.addEventListener( orig, handler, true );
+ }
+ },
+ teardown: function() {
+ if ( --attaches === 0 ) {
+ document.removeEventListener( orig, handler, true );
+ }
}
};
- function handler( e ) {
- e = jQuery.event.fix( e );
+ function handler( donor ) {
+ // Donor event is always a native one; fix it and switch its type.
+ // Let focusin/out handler cancel the donor focus/blur event.
+ var e = jQuery.event.fix( donor );
e.type = fix;
- return jQuery.event.handle.call( this, e );
+ e.originalEvent = {};
+ jQuery.event.trigger( e, null, e.target );
+ if ( e.isDefaultPrevented() ) {
+ donor.preventDefault();
+ }
}
});
}
jQuery.each(["bind", "one"], function( i, name ) {
jQuery.fn[ name ] = function( type, data, fn ) {
+ var handler;
+
// Handle object literals
if ( typeof type === "object" ) {
for ( var key in type ) {
@@ -2367,16 +3403,21 @@ jQuery.each(["bind", "one"], function( i, name ) {
}
return this;
}
-
- if ( jQuery.isFunction( data ) ) {
+
+ if ( arguments.length === 2 || data === false ) {
fn = data;
data = undefined;
}
- var handler = name === "one" ? jQuery.proxy( fn, function( event ) {
- jQuery( this ).unbind( event, handler );
- return fn.apply( this, arguments );
- }) : fn;
+ if ( name === "one" ) {
+ handler = function( event ) {
+ jQuery( this ).unbind( event, handler );
+ return fn.apply( this, arguments );
+ };
+ handler.guid = fn.guid || jQuery.guid++;
+ } else {
+ handler = fn;
+ }
if ( type === "unload" && name !== "one" ) {
this.one( type, data, fn );
@@ -2407,20 +3448,20 @@ jQuery.fn.extend({
return this;
},
-
+
delegate: function( selector, types, data, fn ) {
return this.live( types, data, fn, selector );
},
-
+
undelegate: function( selector, types, fn ) {
if ( arguments.length === 0 ) {
- return this.unbind( "live" );
-
+ return this.unbind( "live" );
+
} else {
return this.die( types, null, fn, selector );
}
},
-
+
trigger: function( type, data ) {
return this.each(function() {
jQuery.event.trigger( type, data, this );
@@ -2429,34 +3470,34 @@ jQuery.fn.extend({
triggerHandler: function( type, data ) {
if ( this[0] ) {
- var event = jQuery.Event( type );
- event.preventDefault();
- event.stopPropagation();
- jQuery.event.trigger( event, data, this[0] );
- return event.result;
+ return jQuery.event.trigger( type, data, this[0], true );
}
},
toggle: function( fn ) {
// Save reference to arguments for access in closure
- var args = arguments, i = 1;
+ var args = arguments,
+ guid = fn.guid || jQuery.guid++,
+ i = 0,
+ toggler = function( event ) {
+ // Figure out which function to execute
+ var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+ jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+ // Make sure that clicks stop
+ event.preventDefault();
+
+ // and execute the function
+ return args[ lastToggle ].apply( this, arguments ) || false;
+ };
// link all the functions, so any of them can unbind this click handler
+ toggler.guid = guid;
while ( i < args.length ) {
- jQuery.proxy( fn, args[ i++ ] );
+ args[ i++ ].guid = guid;
}
- return this.click( jQuery.proxy( fn, function( event ) {
- // Figure out which function to execute
- var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i;
- jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 );
-
- // Make sure that clicks stop
- event.preventDefault();
-
- // and execute the function
- return args[ lastToggle ].apply( this, arguments ) || false;
- }));
+ return this.click( toggler );
},
hover: function( fnOver, fnOut ) {
@@ -2477,8 +3518,24 @@ jQuery.each(["live", "die"], function( i, name ) {
selector = origSelector || this.selector,
context = origSelector ? this : jQuery( this.context );
- if ( jQuery.isFunction( data ) ) {
- fn = data;
+ if ( typeof types === "object" && !types.preventDefault ) {
+ for ( var key in types ) {
+ context[ name ]( key, data, types[key], selector );
+ }
+
+ return this;
+ }
+
+ if ( name === "die" && !types &&
+ origSelector && origSelector.charAt(0) === "." ) {
+
+ context.unbind( origSelector );
+
+ return this;
+ }
+
+ if ( data === false || jQuery.isFunction( data ) ) {
+ fn = data || returnFalse;
data = undefined;
}
@@ -2500,7 +3557,7 @@ jQuery.each(["live", "die"], function( i, name ) {
preType = type;
- if ( type === "focus" || type === "blur" ) {
+ if ( liveMap[ type ] ) {
types.push( liveMap[ type ] + namespaces );
type = type + namespaces;
@@ -2510,31 +3567,36 @@ jQuery.each(["live", "die"], function( i, name ) {
if ( name === "live" ) {
// bind live handler
- context.each(function(){
- jQuery.event.add( this, liveConvert( type, selector ),
+ for ( var j = 0, l = context.length; j < l; j++ ) {
+ jQuery.event.add( context[j], "live." + liveConvert( type, selector ),
{ data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
- });
+ }
} else {
// unbind live handler
- context.unbind( liveConvert( type, selector ), fn );
+ context.unbind( "live." + liveConvert( type, selector ), fn );
}
}
-
+
return this;
- }
+ };
});
function liveHandler( event ) {
- var stop, elems = [], selectors = [], args = arguments,
- related, match, handleObj, elem, j, i, l, data,
- events = jQuery.data( this, "events" );
+ var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret,
+ elems = [],
+ selectors = [],
+ events = jQuery._data( this, "events" );
- // Make sure we avoid non-left-click bubbling in Firefox (#3861)
- if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) {
+ // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911)
+ if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) {
return;
}
+ if ( event.namespace ) {
+ namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)");
+ }
+
event.liveFired = this;
var live = events.live.slice(0);
@@ -2553,20 +3615,28 @@ function liveHandler( event ) {
match = jQuery( event.target ).closest( selectors, event.currentTarget );
for ( i = 0, l = match.length; i < l; i++ ) {
+ close = match[i];
+
for ( j = 0; j < live.length; j++ ) {
handleObj = live[j];
- if ( match[i].selector === handleObj.selector ) {
- elem = match[i].elem;
+ if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) {
+ elem = close.elem;
related = null;
// Those two events require additional checking
if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) {
+ event.type = handleObj.preType;
related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
+
+ // Make sure not to accidentally match a child element with the same selector
+ if ( related && jQuery.contains( elem, related ) ) {
+ related = elem;
+ }
}
if ( !related || related !== elem ) {
- elems.push({ elem: elem, handleObj: handleObj });
+ elems.push({ elem: elem, handleObj: handleObj, level: close.level });
}
}
}
@@ -2574,13 +3644,26 @@ function liveHandler( event ) {
for ( i = 0, l = elems.length; i < l; i++ ) {
match = elems[i];
+
+ if ( maxLevel && match.level > maxLevel ) {
+ break;
+ }
+
event.currentTarget = match.elem;
event.data = match.handleObj.data;
event.handleObj = match.handleObj;
- if ( match.handleObj.origHandler.apply( match.elem, args ) === false ) {
- stop = false;
- break;
+ ret = match.handleObj.origHandler.apply( match.elem, arguments );
+
+ if ( ret === false || event.isPropagationStopped() ) {
+ maxLevel = match.level;
+
+ if ( ret === false ) {
+ stop = false;
+ }
+ if ( event.isImmediatePropagationStopped() ) {
+ break;
+ }
}
}
@@ -2588,7 +3671,7 @@ function liveHandler( event ) {
}
function liveConvert( type, selector ) {
- return "live." + (type && type !== "*" ? type + "." : "") + selector.replace(/\./g, "`").replace(/ /g, "&");
+ return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&");
}
jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
@@ -2596,8 +3679,15 @@ jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblcl
"change select submit keydown keypress keyup error").split(" "), function( i, name ) {
// Handle event binding
- jQuery.fn[ name ] = function( fn ) {
- return fn ? this.bind( name, fn ) : this.trigger( name );
+ jQuery.fn[ name ] = function( data, fn ) {
+ if ( fn == null ) {
+ fn = data;
+ data = null;
+ }
+
+ return arguments.length > 0 ?
+ this.bind( name, data, fn ) :
+ this.trigger( name );
};
if ( jQuery.attrFn ) {
@@ -2605,48 +3695,38 @@ jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblcl
}
});
-// Prevent memory leaks in IE
-// Window isn't included so as not to unbind existing unload events
-// More info:
-// - http://isaacschlueter.com/2006/10/msie-memory-leaks/
-if ( window.attachEvent && !window.addEventListener ) {
- window.attachEvent("onunload", function() {
- for ( var id in jQuery.cache ) {
- if ( jQuery.cache[ id ].handle ) {
- // Try/Catch is to handle iframes being unloaded, see #4280
- try {
- jQuery.event.remove( jQuery.cache[ id ].handle.elem );
- } catch(e) {}
- }
- }
- });
-}
+
+
/*!
- * Sizzle CSS Selector Engine - v1.0
- * Copyright 2009, The Dojo Foundation
+ * Sizzle CSS Selector Engine
+ * Copyright 2011, The Dojo Foundation
* Released under the MIT, BSD, and GPL Licenses.
* More information: http://sizzlejs.com/
*/
(function(){
-var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
done = 0,
toString = Object.prototype.toString,
hasDuplicate = false,
- baseHasDuplicate = true;
+ baseHasDuplicate = true,
+ rBackslash = /\\/g,
+ rNonWord = /\W/;
// Here we check if the JavaScript engine is using some sort of
// optimization where it does not always call our comparision
// function. If that is the case, discard the hasDuplicate value.
// Thus far that includes Google Chrome.
-[0, 0].sort(function(){
+[0, 0].sort(function() {
baseHasDuplicate = false;
return 0;
});
-var Sizzle = function(selector, context, results, seed) {
+var Sizzle = function( selector, context, results, seed ) {
results = results || [];
- var origContext = context = context || document;
+ context = context || document;
+
+ var origContext = context;
if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
return [];
@@ -2656,24 +3736,34 @@ var Sizzle = function(selector, context, results, seed) {
return results;
}
- var parts = [], m, set, checkSet, extra, prune = true, contextXML = isXML(context),
+ var m, set, checkSet, extra, ret, cur, pop, i,
+ prune = true,
+ contextXML = Sizzle.isXML( context ),
+ parts = [],
soFar = selector;
// Reset the position of the chunker regexp (start from head)
- while ( (chunker.exec(""), m = chunker.exec(soFar)) !== null ) {
- soFar = m[3];
+ do {
+ chunker.exec( "" );
+ m = chunker.exec( soFar );
+
+ if ( m ) {
+ soFar = m[3];
- parts.push( m[1] );
+ parts.push( m[1] );
- if ( m[2] ) {
- extra = m[3];
- break;
+ if ( m[2] ) {
+ extra = m[3];
+ break;
+ }
}
- }
+ } while ( m );
if ( parts.length > 1 && origPOS.exec( selector ) ) {
+
if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
set = posProcess( parts[0] + parts[1], context );
+
} else {
set = Expr.relative[ parts[0] ] ?
[ context ] :
@@ -2689,29 +3779,38 @@ var Sizzle = function(selector, context, results, seed) {
set = posProcess( selector, set );
}
}
+
} else {
// Take a shortcut and set the context if the root selector is an ID
// (but not if it'll be faster if the inner selector is an ID)
if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
- var ret = Sizzle.find( parts.shift(), context, contextXML );
- context = ret.expr ? Sizzle.filter( ret.expr, ret.set )[0] : ret.set[0];
+
+ ret = Sizzle.find( parts.shift(), context, contextXML );
+ context = ret.expr ?
+ Sizzle.filter( ret.expr, ret.set )[0] :
+ ret.set[0];
}
if ( context ) {
- var ret = seed ?
+ ret = seed ?
{ expr: parts.pop(), set: makeArray(seed) } :
Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
- set = ret.expr ? Sizzle.filter( ret.expr, ret.set ) : ret.set;
+
+ set = ret.expr ?
+ Sizzle.filter( ret.expr, ret.set ) :
+ ret.set;
if ( parts.length > 0 ) {
- checkSet = makeArray(set);
+ checkSet = makeArray( set );
+
} else {
prune = false;
}
while ( parts.length ) {
- var cur = parts.pop(), pop = cur;
+ cur = parts.pop();
+ pop = cur;
if ( !Expr.relative[ cur ] ) {
cur = "";
@@ -2725,6 +3824,7 @@ var Sizzle = function(selector, context, results, seed) {
Expr.relative[ cur ]( checkSet, pop, contextXML );
}
+
} else {
checkSet = parts = [];
}
@@ -2741,19 +3841,22 @@ var Sizzle = function(selector, context, results, seed) {
if ( toString.call(checkSet) === "[object Array]" ) {
if ( !prune ) {
results.push.apply( results, checkSet );
+
} else if ( context && context.nodeType === 1 ) {
- for ( var i = 0; checkSet[i] != null; i++ ) {
- if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+ for ( i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) {
results.push( set[i] );
}
}
+
} else {
- for ( var i = 0; checkSet[i] != null; i++ ) {
+ for ( i = 0; checkSet[i] != null; i++ ) {
if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
results.push( set[i] );
}
}
}
+
} else {
makeArray( checkSet, results );
}
@@ -2766,15 +3869,15 @@ var Sizzle = function(selector, context, results, seed) {
return results;
};
-Sizzle.uniqueSort = function(results){
+Sizzle.uniqueSort = function( results ) {
if ( sortOrder ) {
hasDuplicate = baseHasDuplicate;
- results.sort(sortOrder);
+ results.sort( sortOrder );
if ( hasDuplicate ) {
for ( var i = 1; i < results.length; i++ ) {
- if ( results[i] === results[i-1] ) {
- results.splice(i--, 1);
+ if ( results[i] === results[ i - 1 ] ) {
+ results.splice( i--, 1 );
}
}
}
@@ -2783,27 +3886,33 @@ Sizzle.uniqueSort = function(results){
return results;
};
-Sizzle.matches = function(expr, set){
- return Sizzle(expr, null, null, set);
+Sizzle.matches = function( expr, set ) {
+ return Sizzle( expr, null, null, set );
};
-Sizzle.find = function(expr, context, isXML){
- var set, match;
+Sizzle.matchesSelector = function( node, expr ) {
+ return Sizzle( expr, null, null, [node] ).length > 0;
+};
+
+Sizzle.find = function( expr, context, isXML ) {
+ var set;
if ( !expr ) {
return [];
}
for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
- var type = Expr.order[i], match;
+ var match,
+ type = Expr.order[i];
if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
var left = match[1];
- match.splice(1,1);
+ match.splice( 1, 1 );
if ( left.substr( left.length - 1 ) !== "\\" ) {
- match[1] = (match[1] || "").replace(/\\/g, "");
+ match[1] = (match[1] || "").replace( rBackslash, "" );
set = Expr.find[ type ]( match, context, isXML );
+
if ( set != null ) {
expr = expr.replace( Expr.match[ type ], "" );
break;
@@ -2813,20 +3922,28 @@ Sizzle.find = function(expr, context, isXML){
}
if ( !set ) {
- set = context.getElementsByTagName("*");
+ set = typeof context.getElementsByTagName !== "undefined" ?
+ context.getElementsByTagName( "*" ) :
+ [];
}
- return {set: set, expr: expr};
+ return { set: set, expr: expr };
};
-Sizzle.filter = function(expr, set, inplace, not){
- var old = expr, result = [], curLoop = set, match, anyFound,
- isXMLFilter = set && set[0] && isXML(set[0]);
+Sizzle.filter = function( expr, set, inplace, not ) {
+ var match, anyFound,
+ old = expr,
+ result = [],
+ curLoop = set,
+ isXMLFilter = set && set[0] && Sizzle.isXML( set[0] );
while ( expr && set.length ) {
for ( var type in Expr.filter ) {
if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
- var filter = Expr.filter[ type ], found, item, left = match[1];
+ var found, item,
+ filter = Expr.filter[ type ],
+ left = match[1];
+
anyFound = false;
match.splice(1,1);
@@ -2844,6 +3961,7 @@ Sizzle.filter = function(expr, set, inplace, not){
if ( !match ) {
anyFound = found = true;
+
} else if ( match === true ) {
continue;
}
@@ -2858,9 +3976,11 @@ Sizzle.filter = function(expr, set, inplace, not){
if ( inplace && found != null ) {
if ( pass ) {
anyFound = true;
+
} else {
curLoop[i] = false;
}
+
} else if ( pass ) {
result.push( item );
anyFound = true;
@@ -2889,6 +4009,7 @@ Sizzle.filter = function(expr, set, inplace, not){
if ( expr === old ) {
if ( anyFound == null ) {
Sizzle.error( expr );
+
} else {
break;
}
@@ -2906,30 +4027,38 @@ Sizzle.error = function( msg ) {
var Expr = Sizzle.selectors = {
order: [ "ID", "NAME", "TAG" ],
+
match: {
- ID: /#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
- CLASS: /\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
- NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,
- ATTR: /\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
- TAG: /^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,
- CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,
- POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,
- PSEUDO: /:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
+ ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+ CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,
+ NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,
+ ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,
+ TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,
+ CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,
+ POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,
+ PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
},
+
leftMatch: {},
+
attrMap: {
"class": "className",
"for": "htmlFor"
},
+
attrHandle: {
- href: function(elem){
- return elem.getAttribute("href");
+ href: function( elem ) {
+ return elem.getAttribute( "href" );
+ },
+ type: function( elem ) {
+ return elem.getAttribute( "type" );
}
},
+
relative: {
"+": function(checkSet, part){
var isPartStr = typeof part === "string",
- isTag = isPartStr && !/\W/.test(part),
+ isTag = isPartStr && !rNonWord.test( part ),
isPartStrNotTag = isPartStr && !isTag;
if ( isTag ) {
@@ -2950,22 +4079,29 @@ var Expr = Sizzle.selectors = {
Sizzle.filter( part, checkSet, true );
}
},
- ">": function(checkSet, part){
- var isPartStr = typeof part === "string";
- if ( isPartStr && !/\W/.test(part) ) {
+ ">": function( checkSet, part ) {
+ var elem,
+ isPartStr = typeof part === "string",
+ i = 0,
+ l = checkSet.length;
+
+ if ( isPartStr && !rNonWord.test( part ) ) {
part = part.toLowerCase();
- for ( var i = 0, l = checkSet.length; i < l; i++ ) {
- var elem = checkSet[i];
+ for ( ; i < l; i++ ) {
+ elem = checkSet[i];
+
if ( elem ) {
var parent = elem.parentNode;
checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
}
}
+
} else {
- for ( var i = 0, l = checkSet.length; i < l; i++ ) {
- var elem = checkSet[i];
+ for ( ; i < l; i++ ) {
+ elem = checkSet[i];
+
if ( elem ) {
checkSet[i] = isPartStr ?
elem.parentNode :
@@ -2978,37 +4114,50 @@ var Expr = Sizzle.selectors = {
}
}
},
+
"": function(checkSet, part, isXML){
- var doneName = done++, checkFn = dirCheck;
+ var nodeCheck,
+ doneName = done++,
+ checkFn = dirCheck;
- if ( typeof part === "string" && !/\W/.test(part) ) {
- var nodeCheck = part = part.toLowerCase();
+ if ( typeof part === "string" && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+ nodeCheck = part;
checkFn = dirNodeCheck;
}
- checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML);
+ checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML );
},
- "~": function(checkSet, part, isXML){
- var doneName = done++, checkFn = dirCheck;
- if ( typeof part === "string" && !/\W/.test(part) ) {
- var nodeCheck = part = part.toLowerCase();
+ "~": function( checkSet, part, isXML ) {
+ var nodeCheck,
+ doneName = done++,
+ checkFn = dirCheck;
+
+ if ( typeof part === "string" && !rNonWord.test( part ) ) {
+ part = part.toLowerCase();
+ nodeCheck = part;
checkFn = dirNodeCheck;
}
- checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML);
+ checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML );
}
},
+
find: {
- ID: function(match, context, isXML){
+ ID: function( match, context, isXML ) {
if ( typeof context.getElementById !== "undefined" && !isXML ) {
var m = context.getElementById(match[1]);
- return m ? [m] : [];
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
}
},
- NAME: function(match, context){
+
+ NAME: function( match, context ) {
if ( typeof context.getElementsByName !== "undefined" ) {
- var ret = [], results = context.getElementsByName(match[1]);
+ var ret = [],
+ results = context.getElementsByName( match[1] );
for ( var i = 0, l = results.length; i < l; i++ ) {
if ( results[i].getAttribute("name") === match[1] ) {
@@ -3019,13 +4168,16 @@ var Expr = Sizzle.selectors = {
return ret.length === 0 ? null : ret;
}
},
- TAG: function(match, context){
- return context.getElementsByTagName(match[1]);
+
+ TAG: function( match, context ) {
+ if ( typeof context.getElementsByTagName !== "undefined" ) {
+ return context.getElementsByTagName( match[1] );
+ }
}
},
preFilter: {
- CLASS: function(match, curLoop, inplace, result, not, isXML){
- match = " " + match[1].replace(/\\/g, "") + " ";
+ CLASS: function( match, curLoop, inplace, result, not, isXML ) {
+ match = " " + match[1].replace( rBackslash, "" ) + " ";
if ( isXML ) {
return match;
@@ -3033,10 +4185,11 @@ var Expr = Sizzle.selectors = {
for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
if ( elem ) {
- if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) {
+ if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) {
if ( !inplace ) {
result.push( elem );
}
+
} else if ( inplace ) {
curLoop[i] = false;
}
@@ -3045,16 +4198,25 @@ var Expr = Sizzle.selectors = {
return false;
},
- ID: function(match){
- return match[1].replace(/\\/g, "");
+
+ ID: function( match ) {
+ return match[1].replace( rBackslash, "" );
},
- TAG: function(match, curLoop){
- return match[1].toLowerCase();
+
+ TAG: function( match, curLoop ) {
+ return match[1].replace( rBackslash, "" ).toLowerCase();
},
- CHILD: function(match){
+
+ CHILD: function( match ) {
if ( match[1] === "nth" ) {
+ if ( !match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ match[2] = match[2].replace(/^\+|\s*/g, '');
+
// parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
- var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
+ var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec(
match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
!/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
@@ -3062,178 +4224,243 @@ var Expr = Sizzle.selectors = {
match[2] = (test[1] + (test[2] || 1)) - 0;
match[3] = test[3] - 0;
}
+ else if ( match[2] ) {
+ Sizzle.error( match[0] );
+ }
// TODO: Move to normal caching system
match[0] = done++;
return match;
},
- ATTR: function(match, curLoop, inplace, result, not, isXML){
- var name = match[1].replace(/\\/g, "");
+
+ ATTR: function( match, curLoop, inplace, result, not, isXML ) {
+ var name = match[1] = match[1].replace( rBackslash, "" );
if ( !isXML && Expr.attrMap[name] ) {
match[1] = Expr.attrMap[name];
}
+ // Handle if an un-quoted value was used
+ match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" );
+
if ( match[2] === "~=" ) {
match[4] = " " + match[4] + " ";
}
return match;
},
- PSEUDO: function(match, curLoop, inplace, result, not){
+
+ PSEUDO: function( match, curLoop, inplace, result, not ) {
if ( match[1] === "not" ) {
// If we're dealing with a complex expression, or a simple one
if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
match[3] = Sizzle(match[3], null, null, curLoop);
+
} else {
var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+
if ( !inplace ) {
result.push.apply( result, ret );
}
+
return false;
}
+
} else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
return true;
}
return match;
},
- POS: function(match){
+
+ POS: function( match ) {
match.unshift( true );
+
return match;
}
},
+
filters: {
- enabled: function(elem){
+ enabled: function( elem ) {
return elem.disabled === false && elem.type !== "hidden";
},
- disabled: function(elem){
+
+ disabled: function( elem ) {
return elem.disabled === true;
},
- checked: function(elem){
+
+ checked: function( elem ) {
return elem.checked === true;
},
- selected: function(elem){
+
+ selected: function( elem ) {
// Accessing this property makes selected-by-default
// options in Safari work properly
- elem.parentNode.selectedIndex;
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
return elem.selected === true;
},
- parent: function(elem){
+
+ parent: function( elem ) {
return !!elem.firstChild;
},
- empty: function(elem){
+
+ empty: function( elem ) {
return !elem.firstChild;
},
- has: function(elem, i, match){
+
+ has: function( elem, i, match ) {
return !!Sizzle( match[3], elem ).length;
},
- header: function(elem){
- return /h\d/i.test( elem.nodeName );
+
+ header: function( elem ) {
+ return (/h\d/i).test( elem.nodeName );
+ },
+
+ text: function( elem ) {
+ var attr = elem.getAttribute( "type" ), type = elem.type;
+ // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
+ // use getAttribute instead to test this case
+ return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null );
},
- text: function(elem){
- return "text" === elem.type;
+
+ radio: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type;
},
- radio: function(elem){
- return "radio" === elem.type;
+
+ checkbox: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type;
},
- checkbox: function(elem){
- return "checkbox" === elem.type;
+
+ file: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "file" === elem.type;
},
- file: function(elem){
- return "file" === elem.type;
+
+ password: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "password" === elem.type;
},
- password: function(elem){
- return "password" === elem.type;
+
+ submit: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && "submit" === elem.type;
},
- submit: function(elem){
- return "submit" === elem.type;
+
+ image: function( elem ) {
+ return elem.nodeName.toLowerCase() === "input" && "image" === elem.type;
},
- image: function(elem){
- return "image" === elem.type;
+
+ reset: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && "reset" === elem.type;
},
- reset: function(elem){
- return "reset" === elem.type;
+
+ button: function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && "button" === elem.type || name === "button";
},
- button: function(elem){
- return "button" === elem.type || elem.nodeName.toLowerCase() === "button";
+
+ input: function( elem ) {
+ return (/input|select|textarea|button/i).test( elem.nodeName );
},
- input: function(elem){
- return /input|select|textarea|button/i.test(elem.nodeName);
+
+ focus: function( elem ) {
+ return elem === elem.ownerDocument.activeElement;
}
},
setFilters: {
- first: function(elem, i){
+ first: function( elem, i ) {
return i === 0;
},
- last: function(elem, i, match, array){
+
+ last: function( elem, i, match, array ) {
return i === array.length - 1;
},
- even: function(elem, i){
+
+ even: function( elem, i ) {
return i % 2 === 0;
},
- odd: function(elem, i){
+
+ odd: function( elem, i ) {
return i % 2 === 1;
},
- lt: function(elem, i, match){
+
+ lt: function( elem, i, match ) {
return i < match[3] - 0;
},
- gt: function(elem, i, match){
+
+ gt: function( elem, i, match ) {
return i > match[3] - 0;
},
- nth: function(elem, i, match){
+
+ nth: function( elem, i, match ) {
return match[3] - 0 === i;
},
- eq: function(elem, i, match){
+
+ eq: function( elem, i, match ) {
return match[3] - 0 === i;
}
},
filter: {
- PSEUDO: function(elem, match, i, array){
- var name = match[1], filter = Expr.filters[ name ];
+ PSEUDO: function( elem, match, i, array ) {
+ var name = match[1],
+ filter = Expr.filters[ name ];
if ( filter ) {
return filter( elem, i, match, array );
+
} else if ( name === "contains" ) {
- return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0;
+ return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0;
+
} else if ( name === "not" ) {
var not = match[3];
- for ( var i = 0, l = not.length; i < l; i++ ) {
- if ( not[i] === elem ) {
+ for ( var j = 0, l = not.length; j < l; j++ ) {
+ if ( not[j] === elem ) {
return false;
}
}
return true;
+
} else {
- Sizzle.error( "Syntax error, unrecognized expression: " + name );
+ Sizzle.error( name );
}
},
- CHILD: function(elem, match){
- var type = match[1], node = elem;
- switch (type) {
- case 'only':
- case 'first':
+
+ CHILD: function( elem, match ) {
+ var type = match[1],
+ node = elem;
+
+ switch ( type ) {
+ case "only":
+ case "first":
while ( (node = node.previousSibling) ) {
if ( node.nodeType === 1 ) {
return false;
}
}
+
if ( type === "first" ) {
return true;
}
+
node = elem;
- case 'last':
+
+ case "last":
while ( (node = node.nextSibling) ) {
if ( node.nodeType === 1 ) {
return false;
}
}
+
return true;
- case 'nth':
- var first = match[2], last = match[3];
+
+ case "nth":
+ var first = match[2],
+ last = match[3];
if ( first === 1 && last === 0 ) {
return true;
@@ -3244,33 +4471,41 @@ var Expr = Sizzle.selectors = {
if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
var count = 0;
+
for ( node = parent.firstChild; node; node = node.nextSibling ) {
if ( node.nodeType === 1 ) {
node.nodeIndex = ++count;
}
}
+
parent.sizcache = doneName;
}
var diff = elem.nodeIndex - last;
+
if ( first === 0 ) {
return diff === 0;
+
} else {
return ( diff % first === 0 && diff / first >= 0 );
}
}
},
- ID: function(elem, match){
+
+ ID: function( elem, match ) {
return elem.nodeType === 1 && elem.getAttribute("id") === match;
},
- TAG: function(elem, match){
+
+ TAG: function( elem, match ) {
return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match;
},
- CLASS: function(elem, match){
+
+ CLASS: function( elem, match ) {
return (" " + (elem.className || elem.getAttribute("class")) + " ")
.indexOf( match ) > -1;
},
- ATTR: function(elem, match){
+
+ ATTR: function( elem, match ) {
var name = match[1],
result = Expr.attrHandle[ name ] ?
Expr.attrHandle[ name ]( elem ) :
@@ -3301,8 +4536,10 @@ var Expr = Sizzle.selectors = {
value === check || value.substr(0, check.length + 1) === check + "-" :
false;
},
- POS: function(elem, match, i, array){
- var name = match[2], filter = Expr.setFilters[ name ];
+
+ POS: function( elem, match, i, array ) {
+ var name = match[2],
+ filter = Expr.setFilters[ name ];
if ( filter ) {
return filter( elem, i, match, array );
@@ -3311,16 +4548,17 @@ var Expr = Sizzle.selectors = {
}
};
-var origPOS = Expr.match.POS;
+var origPOS = Expr.match.POS,
+ fescape = function(all, num){
+ return "\\" + (num - 0 + 1);
+ };
for ( var type in Expr.match ) {
- Expr.match[ type ] = new RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
- Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, function(all, num){
- return "\\" + (num - 0 + 1);
- }));
+ Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) );
+ Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) );
}
-var makeArray = function(array, results) {
+var makeArray = function( array, results ) {
array = Array.prototype.slice.call( array, 0 );
if ( results ) {
@@ -3339,19 +4577,22 @@ try {
Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
// Provide a fallback method if it does not work
-} catch(e){
- makeArray = function(array, results) {
- var ret = results || [];
+} catch( e ) {
+ makeArray = function( array, results ) {
+ var i = 0,
+ ret = results || [];
if ( toString.call(array) === "[object Array]" ) {
Array.prototype.push.apply( ret, array );
+
} else {
if ( typeof array.length === "number" ) {
- for ( var i = 0, l = array.length; i < l; i++ ) {
+ for ( var l = array.length; i < l; i++ ) {
ret.push( array[i] );
}
+
} else {
- for ( var i = 0; array[i]; i++ ) {
+ for ( ; array[i]; i++ ) {
ret.push( array[i] );
}
}
@@ -3361,62 +4602,104 @@ try {
};
}
-var sortOrder;
+var sortOrder, siblingCheck;
if ( document.documentElement.compareDocumentPosition ) {
sortOrder = function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
- if ( a == b ) {
- hasDuplicate = true;
- }
return a.compareDocumentPosition ? -1 : 1;
}
- var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1;
- if ( ret === 0 ) {
- hasDuplicate = true;
- }
- return ret;
+ return a.compareDocumentPosition(b) & 4 ? -1 : 1;
};
-} else if ( "sourceIndex" in document.documentElement ) {
+
+} else {
sortOrder = function( a, b ) {
- if ( !a.sourceIndex || !b.sourceIndex ) {
- if ( a == b ) {
- hasDuplicate = true;
- }
- return a.sourceIndex ? -1 : 1;
+ // The nodes are identical, we can exit early
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+
+ // Fallback to using sourceIndex (in IE) if it's available on both nodes
+ } else if ( a.sourceIndex && b.sourceIndex ) {
+ return a.sourceIndex - b.sourceIndex;
}
- var ret = a.sourceIndex - b.sourceIndex;
- if ( ret === 0 ) {
- hasDuplicate = true;
+ var al, bl,
+ ap = [],
+ bp = [],
+ aup = a.parentNode,
+ bup = b.parentNode,
+ cur = aup;
+
+ // If the nodes are siblings (or identical) we can do a quick check
+ if ( aup === bup ) {
+ return siblingCheck( a, b );
+
+ // If no parents were found then the nodes are disconnected
+ } else if ( !aup ) {
+ return -1;
+
+ } else if ( !bup ) {
+ return 1;
}
- return ret;
- };
-} else if ( document.createRange ) {
- sortOrder = function( a, b ) {
- if ( !a.ownerDocument || !b.ownerDocument ) {
- if ( a == b ) {
- hasDuplicate = true;
+
+ // Otherwise they're somewhere else in the tree so we need
+ // to build up a full list of the parentNodes for comparison
+ while ( cur ) {
+ ap.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ cur = bup;
+
+ while ( cur ) {
+ bp.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ al = ap.length;
+ bl = bp.length;
+
+ // Start walking down the tree looking for a discrepancy
+ for ( var i = 0; i < al && i < bl; i++ ) {
+ if ( ap[i] !== bp[i] ) {
+ return siblingCheck( ap[i], bp[i] );
}
- return a.ownerDocument ? -1 : 1;
}
- var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange();
- aRange.setStart(a, 0);
- aRange.setEnd(a, 0);
- bRange.setStart(b, 0);
- bRange.setEnd(b, 0);
- var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange);
- if ( ret === 0 ) {
- hasDuplicate = true;
+ // We ended someplace up the tree so do a sibling check
+ return i === al ?
+ siblingCheck( a, bp[i], -1 ) :
+ siblingCheck( ap[i], b, 1 );
+ };
+
+ siblingCheck = function( a, b, ret ) {
+ if ( a === b ) {
+ return ret;
}
- return ret;
+
+ var cur = a.nextSibling;
+
+ while ( cur ) {
+ if ( cur === b ) {
+ return -1;
+ }
+
+ cur = cur.nextSibling;
+ }
+
+ return 1;
};
}
// Utility function for retreiving the text value of an array of DOM nodes
-function getText( elems ) {
+Sizzle.getText = function( elems ) {
var ret = "", elem;
for ( var i = 0; elems[i]; i++ ) {
@@ -3428,43 +4711,52 @@ function getText( elems ) {
// Traverse everything else, except comment nodes
} else if ( elem.nodeType !== 8 ) {
- ret += getText( elem.childNodes );
+ ret += Sizzle.getText( elem.childNodes );
}
}
return ret;
-}
+};
// Check to see if the browser returns elements by name when
// querying by getElementById (and provide a workaround)
(function(){
// We're going to inject a fake input element with a specified name
var form = document.createElement("div"),
- id = "script" + (new Date).getTime();
+ id = "script" + (new Date()).getTime(),
+ root = document.documentElement;
+
form.innerHTML = "<a name='" + id + "'/>";
// Inject it into the root element, check its status, and remove it quickly
- var root = document.documentElement;
root.insertBefore( form, root.firstChild );
// The workaround has to do additional checks after a getElementById
// Which slows things down for other browsers (hence the branching)
if ( document.getElementById( id ) ) {
- Expr.find.ID = function(match, context, isXML){
+ Expr.find.ID = function( match, context, isXML ) {
if ( typeof context.getElementById !== "undefined" && !isXML ) {
var m = context.getElementById(match[1]);
- return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : [];
+
+ return m ?
+ m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ?
+ [m] :
+ undefined :
+ [];
}
};
- Expr.filter.ID = function(elem, match){
+ Expr.filter.ID = function( elem, match ) {
var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+
return elem.nodeType === 1 && node && node.nodeValue === match;
};
}
root.removeChild( form );
- root = form = null; // release memory in IE
+
+ // release memory in IE
+ root = form = null;
})();
(function(){
@@ -3477,8 +4769,8 @@ function getText( elems ) {
// Make sure no comments are found
if ( div.getElementsByTagName("*").length > 0 ) {
- Expr.find.TAG = function(match, context){
- var results = context.getElementsByTagName(match[1]);
+ Expr.find.TAG = function( match, context ) {
+ var results = context.getElementsByTagName( match[1] );
// Filter out possible comments
if ( match[1] === "*" ) {
@@ -3499,19 +4791,25 @@ function getText( elems ) {
// Check to see if an attribute returns normalized href attributes
div.innerHTML = "<a href='#'></a>";
+
if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
div.firstChild.getAttribute("href") !== "#" ) {
- Expr.attrHandle.href = function(elem){
- return elem.getAttribute("href", 2);
+
+ Expr.attrHandle.href = function( elem ) {
+ return elem.getAttribute( "href", 2 );
};
}
- div = null; // release memory in IE
+ // release memory in IE
+ div = null;
})();
if ( document.querySelectorAll ) {
(function(){
- var oldSizzle = Sizzle, div = document.createElement("div");
+ var oldSizzle = Sizzle,
+ div = document.createElement("div"),
+ id = "__sizzle__";
+
div.innerHTML = "<p class='TEST'></p>";
// Safari can't handle uppercase or unicode characters when
@@ -3520,15 +4818,86 @@ if ( document.querySelectorAll ) {
return;
}
- Sizzle = function(query, context, extra, seed){
+ Sizzle = function( query, context, extra, seed ) {
context = context || document;
// Only use querySelectorAll on non-XML documents
// (ID selectors don't work in non-HTML documents)
- if ( !seed && context.nodeType === 9 && !isXML(context) ) {
- try {
- return makeArray( context.querySelectorAll(query), extra );
- } catch(e){}
+ if ( !seed && !Sizzle.isXML(context) ) {
+ // See if we find a selector to speed up
+ var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query );
+
+ if ( match && (context.nodeType === 1 || context.nodeType === 9) ) {
+ // Speed-up: Sizzle("TAG")
+ if ( match[1] ) {
+ return makeArray( context.getElementsByTagName( query ), extra );
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) {
+ return makeArray( context.getElementsByClassName( match[2] ), extra );
+ }
+ }
+
+ if ( context.nodeType === 9 ) {
+ // Speed-up: Sizzle("body")
+ // The body element only exists once, optimize finding it
+ if ( query === "body" && context.body ) {
+ return makeArray( [ context.body ], extra );
+
+ // Speed-up: Sizzle("#ID")
+ } else if ( match && match[3] ) {
+ var elem = context.getElementById( match[3] );
+
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id === match[3] ) {
+ return makeArray( [ elem ], extra );
+ }
+
+ } else {
+ return makeArray( [], extra );
+ }
+ }
+
+ try {
+ return makeArray( context.querySelectorAll(query), extra );
+ } catch(qsaError) {}
+
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+ var oldContext = context,
+ old = context.getAttribute( "id" ),
+ nid = old || id,
+ hasParent = context.parentNode,
+ relativeHierarchySelector = /^\s*[+~]/.test( query );
+
+ if ( !old ) {
+ context.setAttribute( "id", nid );
+ } else {
+ nid = nid.replace( /'/g, "\\$&" );
+ }
+ if ( relativeHierarchySelector && hasParent ) {
+ context = context.parentNode;
+ }
+
+ try {
+ if ( !relativeHierarchySelector || hasParent ) {
+ return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra );
+ }
+
+ } catch(pseudoError) {
+ } finally {
+ if ( !old ) {
+ oldContext.removeAttribute( "id" );
+ }
+ }
+ }
}
return oldSizzle(query, context, extra, seed);
@@ -3538,11 +4907,56 @@ if ( document.querySelectorAll ) {
Sizzle[ prop ] = oldSizzle[ prop ];
}
- div = null; // release memory in IE
+ // release memory in IE
+ div = null;
})();
}
(function(){
+ var html = document.documentElement,
+ matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector;
+
+ if ( matches ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9 fails this)
+ var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ),
+ pseudoWorks = false;
+
+ try {
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ matches.call( document.documentElement, "[test!='']:sizzle" );
+
+ } catch( pseudoError ) {
+ pseudoWorks = true;
+ }
+
+ Sizzle.matchesSelector = function( node, expr ) {
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']");
+
+ if ( !Sizzle.isXML( node ) ) {
+ try {
+ if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) {
+ var ret = matches.call( node, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || !disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9, so check for that
+ node.document && node.document.nodeType !== 11 ) {
+ return ret;
+ }
+ }
+ } catch(e) {}
+ }
+
+ return Sizzle(expr, null, null, [node]).length > 0;
+ };
+ }
+})();
+
+(function(){
var div = document.createElement("div");
div.innerHTML = "<div class='test e'></div><div class='test'></div>";
@@ -3561,22 +4975,25 @@ if ( document.querySelectorAll ) {
}
Expr.order.splice(1, 0, "CLASS");
- Expr.find.CLASS = function(match, context, isXML) {
+ Expr.find.CLASS = function( match, context, isXML ) {
if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
return context.getElementsByClassName(match[1]);
}
};
- div = null; // release memory in IE
+ // release memory in IE
+ div = null;
})();
function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
for ( var i = 0, l = checkSet.length; i < l; i++ ) {
var elem = checkSet[i];
+
if ( elem ) {
- elem = elem[dir];
var match = false;
+ elem = elem[dir];
+
while ( elem ) {
if ( elem.sizcache === doneName ) {
match = checkSet[elem.sizset];
@@ -3604,9 +5021,11 @@ function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
for ( var i = 0, l = checkSet.length; i < l; i++ ) {
var elem = checkSet[i];
+
if ( elem ) {
- elem = elem[dir];
var match = false;
+
+ elem = elem[dir];
while ( elem ) {
if ( elem.sizcache === doneName ) {
@@ -3619,6 +5038,7 @@ function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
elem.sizcache = doneName;
elem.sizset = i;
}
+
if ( typeof cur !== "string" ) {
if ( elem === cur ) {
match = true;
@@ -3639,21 +5059,34 @@ function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
}
}
-var contains = document.compareDocumentPosition ? function(a, b){
- return !!(a.compareDocumentPosition(b) & 16);
-} : function(a, b){
- return a !== b && (a.contains ? a.contains(b) : true);
-};
+if ( document.documentElement.contains ) {
+ Sizzle.contains = function( a, b ) {
+ return a !== b && (a.contains ? a.contains(b) : true);
+ };
-var isXML = function(elem){
+} else if ( document.documentElement.compareDocumentPosition ) {
+ Sizzle.contains = function( a, b ) {
+ return !!(a.compareDocumentPosition(b) & 16);
+ };
+
+} else {
+ Sizzle.contains = function() {
+ return false;
+ };
+}
+
+Sizzle.isXML = function( elem ) {
// documentElement is verified for cases where it doesn't yet exist
// (such as loading iframes in IE - #4833)
var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+
return documentElement ? documentElement.nodeName !== "HTML" : false;
};
-var posProcess = function(selector, context){
- var tmpSet = [], later = "", match,
+var posProcess = function( selector, context ) {
+ var match,
+ tmpSet = [],
+ later = "",
root = context.nodeType ? [context] : context;
// Position selectors must be done after the filter
@@ -3677,62 +5110,55 @@ jQuery.find = Sizzle;
jQuery.expr = Sizzle.selectors;
jQuery.expr[":"] = jQuery.expr.filters;
jQuery.unique = Sizzle.uniqueSort;
-jQuery.text = getText;
-jQuery.isXMLDoc = isXML;
-jQuery.contains = contains;
-
-return;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
-window.Sizzle = Sizzle;
})();
+
+
var runtil = /Until$/,
rparentsprev = /^(?:parents|prevUntil|prevAll)/,
// Note: This RegExp should be improved, or likely pulled from Sizzle
rmultiselector = /,/,
- slice = Array.prototype.slice;
-
-// Implement the identical functionality for filter and not
-var winnow = function( elements, qualifier, keep ) {
- if ( jQuery.isFunction( qualifier ) ) {
- return jQuery.grep(elements, function( elem, i ) {
- return !!qualifier.call( elem, i, elem ) === keep;
- });
-
- } else if ( qualifier.nodeType ) {
- return jQuery.grep(elements, function( elem, i ) {
- return (elem === qualifier) === keep;
- });
+ isSimple = /^.[^:#\[\.,]*$/,
+ slice = Array.prototype.slice,
+ POS = jQuery.expr.match.POS,
+ // methods guaranteed to produce a unique set when starting from a unique set
+ guaranteedUnique = {
+ children: true,
+ contents: true,
+ next: true,
+ prev: true
+ };
- } else if ( typeof qualifier === "string" ) {
- var filtered = jQuery.grep(elements, function( elem ) {
- return elem.nodeType === 1;
- });
+jQuery.fn.extend({
+ find: function( selector ) {
+ var self = this,
+ i, l;
- if ( isSimple.test( qualifier ) ) {
- return jQuery.filter(qualifier, filtered, !keep);
- } else {
- qualifier = jQuery.filter( qualifier, filtered );
+ if ( typeof selector !== "string" ) {
+ return jQuery( selector ).filter(function() {
+ for ( i = 0, l = self.length; i < l; i++ ) {
+ if ( jQuery.contains( self[ i ], this ) ) {
+ return true;
+ }
+ }
+ });
}
- }
- return jQuery.grep(elements, function( elem, i ) {
- return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
- });
-};
-
-jQuery.fn.extend({
- find: function( selector ) {
- var ret = this.pushStack( "", "find", selector ), length = 0;
+ var ret = this.pushStack( "", "find", selector ),
+ length, n, r;
- for ( var i = 0, l = this.length; i < l; i++ ) {
+ for ( i = 0, l = this.length; i < l; i++ ) {
length = ret.length;
jQuery.find( selector, this[i], ret );
if ( i > 0 ) {
// Make sure that the results are unique
- for ( var n = length; n < ret.length; n++ ) {
- for ( var r = 0; r < length; r++ ) {
+ for ( n = length; n < ret.length; n++ ) {
+ for ( r = 0; r < length; r++ ) {
if ( ret[r] === ret[n] ) {
ret.splice(n--, 1);
break;
@@ -3763,21 +5189,28 @@ jQuery.fn.extend({
filter: function( selector ) {
return this.pushStack( winnow(this, selector, true), "filter", selector );
},
-
+
is: function( selector ) {
- return !!selector && jQuery.filter( selector, this ).length > 0;
+ return !!selector && ( typeof selector === "string" ?
+ jQuery.filter( selector, this ).length > 0 :
+ this.filter( selector ).length > 0 );
},
closest: function( selectors, context ) {
+ var ret = [], i, l, cur = this[0];
+
+ // Array
if ( jQuery.isArray( selectors ) ) {
- var ret = [], cur = this[0], match, matches = {}, selector;
+ var match, selector,
+ matches = {},
+ level = 1;
if ( cur && selectors.length ) {
- for ( var i = 0, l = selectors.length; i < l; i++ ) {
+ for ( i = 0, l = selectors.length; i < l; i++ ) {
selector = selectors[i];
- if ( !matches[selector] ) {
- matches[selector] = jQuery.expr.match.POS.test( selector ) ?
+ if ( !matches[ selector ] ) {
+ matches[ selector ] = POS.test( selector ) ?
jQuery( selector, context || this.context ) :
selector;
}
@@ -3785,34 +5218,48 @@ jQuery.fn.extend({
while ( cur && cur.ownerDocument && cur !== context ) {
for ( selector in matches ) {
- match = matches[selector];
+ match = matches[ selector ];
- if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) {
- ret.push({ selector: selector, elem: cur });
- delete matches[selector];
+ if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) {
+ ret.push({ selector: selector, elem: cur, level: level });
}
}
+
cur = cur.parentNode;
+ level++;
}
}
return ret;
}
- var pos = jQuery.expr.match.POS.test( selectors ) ?
- jQuery( selectors, context || this.context ) : null;
+ // String
+ var pos = POS.test( selectors ) || typeof selectors !== "string" ?
+ jQuery( selectors, context || this.context ) :
+ 0;
+
+ for ( i = 0, l = this.length; i < l; i++ ) {
+ cur = this[i];
+
+ while ( cur ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) {
+ ret.push( cur );
+ break;
- return this.map(function( i, cur ) {
- while ( cur && cur.ownerDocument && cur !== context ) {
- if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selectors) ) {
- return cur;
+ } else {
+ cur = cur.parentNode;
+ if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) {
+ break;
+ }
}
- cur = cur.parentNode;
}
- return null;
- });
+ }
+
+ ret = ret.length > 1 ? jQuery.unique( ret ) : ret;
+
+ return this.pushStack( ret, "closest", selectors );
},
-
+
// Determine the position of an element within
// the matched set of elements
index: function( elem ) {
@@ -3830,8 +5277,8 @@ jQuery.fn.extend({
add: function( selector, context ) {
var set = typeof selector === "string" ?
- jQuery( selector, context || this.context ) :
- jQuery.makeArray( selector ),
+ jQuery( selector, context ) :
+ jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ),
all = jQuery.merge( this.get(), set );
return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
@@ -3892,8 +5339,13 @@ jQuery.each({
}
}, function( name, fn ) {
jQuery.fn[ name ] = function( until, selector ) {
- var ret = jQuery.map( this, fn, until );
-
+ var ret = jQuery.map( this, fn, until ),
+ // The variable 'args' was introduced in
+ // https://github.com/jquery/jquery/commit/52a0238
+ // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed.
+ // http://code.google.com/p/v8/issues/detail?id=1050
+ args = slice.call(arguments);
+
if ( !runtil.test( name ) ) {
selector = until;
}
@@ -3902,13 +5354,13 @@ jQuery.each({
ret = jQuery.filter( selector, ret );
}
- ret = this.length > 1 ? jQuery.unique( ret ) : ret;
+ ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret;
if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
ret = ret.reverse();
}
- return this.pushStack( ret, name, slice.call(arguments).join(",") );
+ return this.pushStack( ret, name, args.join(",") );
};
});
@@ -3918,11 +5370,15 @@ jQuery.extend({
expr = ":not(" + expr + ")";
}
- return jQuery.find.matches(expr, elems);
+ return elems.length === 1 ?
+ jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] :
+ jQuery.find.matches(expr, elems);
},
-
+
dir: function( elem, dir, until ) {
- var matched = [], cur = elem[dir];
+ var matched = [],
+ cur = elem[ dir ];
+
while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
if ( cur.nodeType === 1 ) {
matched.push( cur );
@@ -3957,20 +5413,56 @@ jQuery.extend({
return r;
}
});
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, keep ) {
+
+ // Can't pass null or undefined to indexOf in Firefox 4
+ // Set to 0 to skip string check
+ qualifier = qualifier || 0;
+
+ if ( jQuery.isFunction( qualifier ) ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ var retVal = !!qualifier.call( elem, i, elem );
+ return retVal === keep;
+ });
+
+ } else if ( qualifier.nodeType ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ return (elem === qualifier) === keep;
+ });
+
+ } else if ( typeof qualifier === "string" ) {
+ var filtered = jQuery.grep(elements, function( elem ) {
+ return elem.nodeType === 1;
+ });
+
+ if ( isSimple.test( qualifier ) ) {
+ return jQuery.filter(qualifier, filtered, !keep);
+ } else {
+ qualifier = jQuery.filter( qualifier, filtered );
+ }
+ }
+
+ return jQuery.grep(elements, function( elem, i ) {
+ return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
+ });
+}
+
+
+
+
var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
rleadingWhitespace = /^\s+/,
- rxhtmlTag = /(<([\w:]+)[^>]*?)\/>/g,
- rselfClosing = /^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,
+ rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,
rtagName = /<([\w:]+)/,
rtbody = /<tbody/i,
rhtml = /<|&#?\w+;/,
- rnocache = /<script|<object|<embed|<option|<style/i,
- rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, // checked="checked" or checked (html5)
- fcloseTag = function( all, front, tag ) {
- return rselfClosing.test( tag ) ?
- all :
- front + "></" + tag + ">";
- },
+ rnocache = /<(?:script|object|embed|option|style)/i,
+ // checked="checked" or checked
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+ rscriptType = /\/(java|ecma)script/i,
+ rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/,
wrapMap = {
option: [ 1, "<select multiple='multiple'>", "</select>" ],
legend: [ 1, "<fieldset>", "</fieldset>" ],
@@ -3995,7 +5487,8 @@ jQuery.fn.extend({
text: function( text ) {
if ( jQuery.isFunction(text) ) {
return this.each(function(i) {
- var self = jQuery(this);
+ var self = jQuery( this );
+
self.text( text.call(this, i, self.text()) );
});
}
@@ -4030,7 +5523,7 @@ jQuery.fn.extend({
}
return elem;
- }).append(this);
+ }).append( this );
}
return this;
@@ -4044,7 +5537,8 @@ jQuery.fn.extend({
}
return this.each(function() {
- var self = jQuery( this ), contents = self.contents();
+ var self = jQuery( this ),
+ contents = self.contents();
if ( contents.length ) {
contents.wrapAll( html );
@@ -4108,7 +5602,7 @@ jQuery.fn.extend({
return set;
}
},
-
+
// keepData is for internal use only--do not document
remove: function( selector, keepData ) {
for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
@@ -4119,11 +5613,11 @@ jQuery.fn.extend({
}
if ( elem.parentNode ) {
- elem.parentNode.removeChild( elem );
+ elem.parentNode.removeChild( elem );
}
}
}
-
+
return this;
},
@@ -4139,46 +5633,17 @@ jQuery.fn.extend({
elem.removeChild( elem.firstChild );
}
}
-
+
return this;
},
- clone: function( events ) {
- // Do the clone
- var ret = this.map(function() {
- if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
- // IE copies events bound via attachEvent when
- // using cloneNode. Calling detachEvent on the
- // clone will also remove the events from the orignal
- // In order to get around this, we use innerHTML.
- // Unfortunately, this means some modifications to
- // attributes in IE that are actually only stored
- // as properties will not be copied (such as the
- // the name attribute on an input).
- var html = this.outerHTML, ownerDocument = this.ownerDocument;
- if ( !html ) {
- var div = ownerDocument.createElement("div");
- div.appendChild( this.cloneNode(true) );
- html = div.innerHTML;
- }
-
- return jQuery.clean([html.replace(rinlinejQuery, "")
- // Handle the case in IE 8 where action=/test/> self-closes a tag
- .replace(/=([^="'>\s]+\/)>/g, '="$1">')
- .replace(rleadingWhitespace, "")], ownerDocument)[0];
- } else {
- return this.cloneNode(true);
- }
- });
-
- // Copy the events from the original to the clone
- if ( events === true ) {
- cloneCopyEvent( this, ret );
- cloneCopyEvent( this.find("*"), ret.find("*") );
- }
+ clone: function( dataAndEvents, deepDataAndEvents ) {
+ dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+ deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
- // Return the cloned set
- return ret;
+ return this.map( function () {
+ return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+ });
},
html: function( value ) {
@@ -4192,7 +5657,7 @@ jQuery.fn.extend({
(jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
!wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
- value = value.replace(rxhtmlTag, fcloseTag);
+ value = value.replace(rxhtmlTag, "<$1></$2>");
try {
for ( var i = 0, l = this.length; i < l; i++ ) {
@@ -4210,10 +5675,9 @@ jQuery.fn.extend({
} else if ( jQuery.isFunction( value ) ) {
this.each(function(i){
- var self = jQuery(this), old = self.html();
- self.empty().append(function(){
- return value.call( this, i, old );
- });
+ var self = jQuery( this );
+
+ self.html( value.call(this, i, self.html()) );
});
} else {
@@ -4235,13 +5699,14 @@ jQuery.fn.extend({
}
if ( typeof value !== "string" ) {
- value = jQuery(value).detach();
+ value = jQuery( value ).detach();
}
return this.each(function() {
- var next = this.nextSibling, parent = this.parentNode;
+ var next = this.nextSibling,
+ parent = this.parentNode;
- jQuery(this).remove();
+ jQuery( this ).remove();
if ( next ) {
jQuery(next).before( value );
@@ -4250,7 +5715,9 @@ jQuery.fn.extend({
}
});
} else {
- return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value );
+ return this.length ?
+ this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) :
+ this;
}
},
@@ -4259,7 +5726,9 @@ jQuery.fn.extend({
},
domManip: function( args, table, callback ) {
- var results, first, value = args[0], scripts = [], fragment, parent;
+ var results, first, fragment, parent,
+ value = args[0],
+ scripts = [];
// We can't cloneNode fragments that contain checked, in WebKit
if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
@@ -4284,11 +5753,11 @@ jQuery.fn.extend({
results = { fragment: parent };
} else {
- results = buildFragment( args, this, scripts );
+ results = jQuery.buildFragment( args, this, scripts );
}
-
+
fragment = results.fragment;
-
+
if ( fragment.childNodes.length === 1 ) {
first = fragment = fragment.firstChild;
} else {
@@ -4298,13 +5767,20 @@ jQuery.fn.extend({
if ( first ) {
table = table && jQuery.nodeName( first, "tr" );
- for ( var i = 0, l = this.length; i < l; i++ ) {
+ for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) {
callback.call(
table ?
root(this[i], first) :
this[i],
- i > 0 || results.cacheable || this.length > 1 ?
- fragment.cloneNode(true) :
+ // Make sure that we do not leak memory by inadvertently discarding
+ // the original fragment (which might have attached data) instead of
+ // using it; in addition, use the original fragment object for the last
+ // item instead of first because it can end up being emptied incorrectly
+ // in certain situations (Bug #8070).
+ // Fragments from the fragment cache must always be cloned and never used
+ // in place.
+ results.cacheable || (l > 1 && i < lastIndex) ?
+ jQuery.clone( fragment, true, true ) :
fragment
);
}
@@ -4316,56 +5792,119 @@ jQuery.fn.extend({
}
return this;
-
- function root( elem, cur ) {
- return jQuery.nodeName(elem, "table") ?
- (elem.getElementsByTagName("tbody")[0] ||
- elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
- elem;
- }
}
});
-function cloneCopyEvent(orig, ret) {
- var i = 0;
+function root( elem, cur ) {
+ return jQuery.nodeName(elem, "table") ?
+ (elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+ elem;
+}
- ret.each(function() {
- if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) {
- return;
- }
+function cloneCopyEvent( src, dest ) {
+
+ if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) {
+ return;
+ }
- var oldData = jQuery.data( orig[i++] ), curData = jQuery.data( this, oldData ), events = oldData && oldData.events;
+ var internalKey = jQuery.expando,
+ oldData = jQuery.data( src ),
+ curData = jQuery.data( dest, oldData );
+
+ // Switch to use the internal data object, if it exists, for the next
+ // stage of data copying
+ if ( (oldData = oldData[ internalKey ]) ) {
+ var events = oldData.events;
+ curData = curData[ internalKey ] = jQuery.extend({}, oldData);
if ( events ) {
delete curData.handle;
curData.events = {};
for ( var type in events ) {
- for ( var handler in events[ type ] ) {
- jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data );
+ for ( var i = 0, l = events[ type ].length; i < l; i++ ) {
+ jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data );
}
}
}
- });
+ }
}
-function buildFragment( args, nodes, scripts ) {
+function cloneFixAttributes( src, dest ) {
+ var nodeName;
+
+ // We do not need to do anything for non-Elements
+ if ( dest.nodeType !== 1 ) {
+ return;
+ }
+
+ // clearAttributes removes the attributes, which we don't want,
+ // but also removes the attachEvent events, which we *do* want
+ if ( dest.clearAttributes ) {
+ dest.clearAttributes();
+ }
+
+ // mergeAttributes, in contrast, only merges back on the
+ // original attributes, not the events
+ if ( dest.mergeAttributes ) {
+ dest.mergeAttributes( src );
+ }
+
+ nodeName = dest.nodeName.toLowerCase();
+
+ // IE6-8 fail to clone children inside object elements that use
+ // the proprietary classid attribute value (rather than the type
+ // attribute) to identify the type of content to display
+ if ( nodeName === "object" ) {
+ dest.outerHTML = src.outerHTML;
+
+ } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) {
+ // IE6-8 fails to persist the checked state of a cloned checkbox
+ // or radio button. Worse, IE6-7 fail to give the cloned element
+ // a checked appearance if the defaultChecked value isn't also set
+ if ( src.checked ) {
+ dest.defaultChecked = dest.checked = src.checked;
+ }
+
+ // IE6-7 get confused and end up setting the value of a cloned
+ // checkbox/radio button to an empty string instead of "on"
+ if ( dest.value !== src.value ) {
+ dest.value = src.value;
+ }
+
+ // IE6-8 fails to return the selected option to the default selected
+ // state when cloning options
+ } else if ( nodeName === "option" ) {
+ dest.selected = src.defaultSelected;
+
+ // IE6-8 fails to set the defaultValue to the correct value when
+ // cloning other types of input fields
+ } else if ( nodeName === "input" || nodeName === "textarea" ) {
+ dest.defaultValue = src.defaultValue;
+ }
+
+ // Event data gets referenced instead of copied if the expando
+ // gets copied too
+ dest.removeAttribute( jQuery.expando );
+}
+
+jQuery.buildFragment = function( args, nodes, scripts ) {
var fragment, cacheable, cacheresults,
doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document);
- // Only cache "small" (1/2 KB) strings that are associated with the main document
+ // Only cache "small" (1/2 KB) HTML strings that are associated with the main document
// Cloning options loses the selected state, so don't cache them
// IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
// Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
- !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
+ args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
cacheable = true;
+
cacheresults = jQuery.fragments[ args[0] ];
- if ( cacheresults ) {
- if ( cacheresults !== 1 ) {
- fragment = cacheresults;
- }
+ if ( cacheresults && cacheresults !== 1 ) {
+ fragment = cacheresults;
}
}
@@ -4379,7 +5918,7 @@ function buildFragment( args, nodes, scripts ) {
}
return { fragment: fragment, cacheable: cacheable };
-}
+};
jQuery.fragments = {};
@@ -4391,27 +5930,104 @@ jQuery.each({
replaceAll: "replaceWith"
}, function( name, original ) {
jQuery.fn[ name ] = function( selector ) {
- var ret = [], insert = jQuery( selector ),
+ var ret = [],
+ insert = jQuery( selector ),
parent = this.length === 1 && this[0].parentNode;
-
+
if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
insert[ original ]( this[0] );
return this;
-
+
} else {
for ( var i = 0, l = insert.length; i < l; i++ ) {
var elems = (i > 0 ? this.clone(true) : this).get();
- jQuery.fn[ original ].apply( jQuery(insert[i]), elems );
+ jQuery( insert[i] )[ original ]( elems );
ret = ret.concat( elems );
}
-
+
return this.pushStack( ret, name, insert.selector );
}
};
});
+function getAll( elem ) {
+ if ( "getElementsByTagName" in elem ) {
+ return elem.getElementsByTagName( "*" );
+
+ } else if ( "querySelectorAll" in elem ) {
+ return elem.querySelectorAll( "*" );
+
+ } else {
+ return [];
+ }
+}
+
+// Used in clean, fixes the defaultChecked property
+function fixDefaultChecked( elem ) {
+ if ( elem.type === "checkbox" || elem.type === "radio" ) {
+ elem.defaultChecked = elem.checked;
+ }
+}
+// Finds all inputs and passes them to fixDefaultChecked
+function findInputs( elem ) {
+ if ( jQuery.nodeName( elem, "input" ) ) {
+ fixDefaultChecked( elem );
+ } else if ( elem.getElementsByTagName ) {
+ jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked );
+ }
+}
+
jQuery.extend({
+ clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+ var clone = elem.cloneNode(true),
+ srcElements,
+ destElements,
+ i;
+
+ if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) &&
+ (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) {
+ // IE copies events bound via attachEvent when using cloneNode.
+ // Calling detachEvent on the clone will also remove the events
+ // from the original. In order to get around this, we use some
+ // proprietary methods to clear the events. Thanks to MooTools
+ // guys for this hotness.
+
+ cloneFixAttributes( elem, clone );
+
+ // Using Sizzle here is crazy slow, so we use getElementsByTagName
+ // instead
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ // Weird iteration because IE will replace the length property
+ // with an element if you are cloning the body and one of the
+ // elements on the page has a name or id of "length"
+ for ( i = 0; srcElements[i]; ++i ) {
+ cloneFixAttributes( srcElements[i], destElements[i] );
+ }
+ }
+
+ // Copy the events from the original to the clone
+ if ( dataAndEvents ) {
+ cloneCopyEvent( elem, clone );
+
+ if ( deepDataAndEvents ) {
+ srcElements = getAll( elem );
+ destElements = getAll( clone );
+
+ for ( i = 0; srcElements[i]; ++i ) {
+ cloneCopyEvent( srcElements[i], destElements[i] );
+ }
+ }
+ }
+
+ // Return the cloned set
+ return clone;
+ },
+
clean: function( elems, context, fragment, scripts ) {
+ var checkScriptType;
+
context = context || document;
// !context.createElement fails in IE with an error but returns typeof 'object'
@@ -4419,7 +6035,7 @@ jQuery.extend({
context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
}
- var ret = [];
+ var ret = [], j;
for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
if ( typeof elem === "number" ) {
@@ -4431,54 +6047,67 @@ jQuery.extend({
}
// Convert html string into DOM nodes
- if ( typeof elem === "string" && !rhtml.test( elem ) ) {
- elem = context.createTextNode( elem );
-
- } else if ( typeof elem === "string" ) {
- // Fix "XHTML"-style tags in all browsers
- elem = elem.replace(rxhtmlTag, fcloseTag);
+ if ( typeof elem === "string" ) {
+ if ( !rhtml.test( elem ) ) {
+ elem = context.createTextNode( elem );
+ } else {
+ // Fix "XHTML"-style tags in all browsers
+ elem = elem.replace(rxhtmlTag, "<$1></$2>");
- // Trim whitespace, otherwise indexOf won't work as expected
- var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
- wrap = wrapMap[ tag ] || wrapMap._default,
- depth = wrap[0],
- div = context.createElement("div");
+ // Trim whitespace, otherwise indexOf won't work as expected
+ var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
+ wrap = wrapMap[ tag ] || wrapMap._default,
+ depth = wrap[0],
+ div = context.createElement("div");
- // Go to html and back, then peel off extra wrappers
- div.innerHTML = wrap[1] + elem + wrap[2];
+ // Go to html and back, then peel off extra wrappers
+ div.innerHTML = wrap[1] + elem + wrap[2];
- // Move to the right depth
- while ( depth-- ) {
- div = div.lastChild;
- }
+ // Move to the right depth
+ while ( depth-- ) {
+ div = div.lastChild;
+ }
- // Remove IE's autoinserted <tbody> from table fragments
- if ( !jQuery.support.tbody ) {
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
- // String was a <table>, *may* have spurious <tbody>
- var hasBody = rtbody.test(elem),
- tbody = tag === "table" && !hasBody ?
- div.firstChild && div.firstChild.childNodes :
+ // String was a <table>, *may* have spurious <tbody>
+ var hasBody = rtbody.test(elem),
+ tbody = tag === "table" && !hasBody ?
+ div.firstChild && div.firstChild.childNodes :
- // String was a bare <thead> or <tfoot>
- wrap[1] === "<table>" && !hasBody ?
- div.childNodes :
- [];
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !hasBody ?
+ div.childNodes :
+ [];
- for ( var j = tbody.length - 1; j >= 0 ; --j ) {
- if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
- tbody[ j ].parentNode.removeChild( tbody[ j ] );
+ for ( j = tbody.length - 1; j >= 0 ; --j ) {
+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
+ }
}
}
- }
+ // IE completely kills leading whitespace when innerHTML is used
+ if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+ div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+ }
- // IE completely kills leading whitespace when innerHTML is used
- if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
- div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+ elem = div.childNodes;
}
+ }
- elem = div.childNodes;
+ // Resets defaultChecked for any radios and checkboxes
+ // about to be appended to the DOM in IE 6/7 (#8060)
+ var len;
+ if ( !jQuery.support.appendChecked ) {
+ if ( elem[0] && typeof (len = elem.length) === "number" ) {
+ for ( j = 0; j < len; j++ ) {
+ findInputs( elem[j] );
+ }
+ } else {
+ findInputs( elem );
+ }
}
if ( elem.nodeType ) {
@@ -4489,13 +6118,18 @@ jQuery.extend({
}
if ( fragment ) {
- for ( var i = 0; ret[i]; i++ ) {
+ checkScriptType = function( elem ) {
+ return !elem.type || rscriptType.test( elem.type );
+ };
+ for ( i = 0; ret[i]; i++ ) {
if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
-
+
} else {
if ( ret[i].nodeType === 1 ) {
- ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
+ var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType );
+
+ ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) );
}
fragment.appendChild( ret[i] );
}
@@ -4504,297 +6138,597 @@ jQuery.extend({
return ret;
},
-
+
cleanData: function( elems ) {
- var data, id, cache = jQuery.cache,
- special = jQuery.event.special,
+ var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special,
deleteExpando = jQuery.support.deleteExpando;
-
+
for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+ continue;
+ }
+
id = elem[ jQuery.expando ];
-
+
if ( id ) {
- data = cache[ id ];
-
- if ( data.events ) {
+ data = cache[ id ] && cache[ id ][ internalKey ];
+
+ if ( data && data.events ) {
for ( var type in data.events ) {
if ( special[ type ] ) {
jQuery.event.remove( elem, type );
+ // This is a shortcut to avoid jQuery.event.remove's overhead
} else {
- removeEvent( elem, type, data.handle );
+ jQuery.removeEvent( elem, type, data.handle );
}
}
+
+ // Null the DOM reference to avoid IE6/7/8 leak (#7054)
+ if ( data.handle ) {
+ data.handle.elem = null;
+ }
}
-
+
if ( deleteExpando ) {
delete elem[ jQuery.expando ];
} else if ( elem.removeAttribute ) {
elem.removeAttribute( jQuery.expando );
}
-
+
delete cache[ id ];
}
}
}
});
-// exclude the following css properties to add px
-var rexclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
- ralpha = /alpha\([^)]*\)/,
+
+function evalScript( i, elem ) {
+ if ( elem.src ) {
+ jQuery.ajax({
+ url: elem.src,
+ async: false,
+ dataType: "script"
+ });
+ } else {
+ jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) );
+ }
+
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+}
+
+
+
+
+var ralpha = /alpha\([^)]*\)/i,
ropacity = /opacity=([^)]*)/,
- rfloat = /float/i,
rdashAlpha = /-([a-z])/ig,
- rupper = /([A-Z])/g,
+ // fixed for IE9, see #8346
+ rupper = /([A-Z]|^ms)/g,
rnumpx = /^-?\d+(?:px)?$/i,
rnum = /^-?\d/,
+ rrelNum = /^[+\-]=/,
+ rrelNumFilter = /[^+\-\.\de]+/g,
- cssShow = { position: "absolute", visibility: "hidden", display:"block" },
+ cssShow = { position: "absolute", visibility: "hidden", display: "block" },
cssWidth = [ "Left", "Right" ],
cssHeight = [ "Top", "Bottom" ],
+ curCSS,
+
+ getComputedStyle,
+ currentStyle,
- // cache check for defaultView.getComputedStyle
- getComputedStyle = document.defaultView && document.defaultView.getComputedStyle,
- // normalize float css property
- styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat",
fcamelCase = function( all, letter ) {
return letter.toUpperCase();
};
jQuery.fn.css = function( name, value ) {
- return access( this, name, value, true, function( elem, name, value ) {
- if ( value === undefined ) {
- return jQuery.curCSS( elem, name );
- }
-
- if ( typeof value === "number" && !rexclude.test(name) ) {
- value += "px";
- }
+ // Setting 'undefined' is a no-op
+ if ( arguments.length === 2 && value === undefined ) {
+ return this;
+ }
- jQuery.style( elem, name, value );
+ return jQuery.access( this, name, value, true, function( elem, name, value ) {
+ return value !== undefined ?
+ jQuery.style( elem, name, value ) :
+ jQuery.css( elem, name );
});
};
jQuery.extend({
- style: function( elem, name, value ) {
- // don't set styles on text and comment nodes
- if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
- return undefined;
+ // Add in style property hooks for overriding the default
+ // behavior of getting and setting a style property
+ cssHooks: {
+ opacity: {
+ get: function( elem, computed ) {
+ if ( computed ) {
+ // We should always get a number back from opacity
+ var ret = curCSS( elem, "opacity", "opacity" );
+ return ret === "" ? "1" : ret;
+
+ } else {
+ return elem.style.opacity;
+ }
+ }
}
+ },
- // ignore negative width and height values #1599
- if ( (name === "width" || name === "height") && parseFloat(value) < 0 ) {
- value = undefined;
+ // Exclude the following css properties to add px
+ cssNumber: {
+ "zIndex": true,
+ "fontWeight": true,
+ "opacity": true,
+ "zoom": true,
+ "lineHeight": true,
+ "widows": true,
+ "orphans": true
+ },
+
+ // Add in properties whose names you wish to fix before
+ // setting or getting the value
+ cssProps: {
+ // normalize float css property
+ "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat"
+ },
+
+ // Get and set the style property on a DOM Node
+ style: function( elem, name, value, extra ) {
+ // Don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+ return;
}
- var style = elem.style || elem, set = value !== undefined;
+ // Make sure that we're working with the right name
+ var ret, type, origName = jQuery.camelCase( name ),
+ style = elem.style, hooks = jQuery.cssHooks[ origName ];
+
+ name = jQuery.cssProps[ origName ] || origName;
- // IE uses filters for opacity
- if ( !jQuery.support.opacity && name === "opacity" ) {
- if ( set ) {
- // IE has trouble with opacity if it does not have layout
- // Force it by setting the zoom level
- style.zoom = 1;
+ // Check if we're setting a value
+ if ( value !== undefined ) {
+ type = typeof value;
- // Set the alpha filter to set the opacity
- var opacity = parseInt( value, 10 ) + "" === "NaN" ? "" : "alpha(opacity=" + value * 100 + ")";
- var filter = style.filter || jQuery.curCSS( elem, "filter" ) || "";
- style.filter = ralpha.test(filter) ? filter.replace(ralpha, opacity) : opacity;
+ // Make sure that NaN and null values aren't set. See: #7116
+ if ( type === "number" && isNaN( value ) || value == null ) {
+ return;
}
- return style.filter && style.filter.indexOf("opacity=") >= 0 ?
- (parseFloat( ropacity.exec(style.filter)[1] ) / 100) + "":
- "";
+ // convert relative number strings (+= or -=) to relative numbers. #7345
+ if ( type === "string" && rrelNum.test( value ) ) {
+ value = +value.replace( rrelNumFilter, "" ) + parseFloat( jQuery.css( elem, name ) );
+ }
+
+ // If a number was passed in, add 'px' to the (except for certain CSS properties)
+ if ( type === "number" && !jQuery.cssNumber[ origName ] ) {
+ value += "px";
+ }
+
+ // If a hook was provided, use that value, otherwise just set the specified value
+ if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) {
+ // Wrapped to prevent IE from throwing errors when 'invalid' values are provided
+ // Fixes bug #5509
+ try {
+ style[ name ] = value;
+ } catch(e) {}
+ }
+
+ } else {
+ // If a hook was provided get the non-computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) {
+ return ret;
+ }
+
+ // Otherwise just get the value from the style object
+ return style[ name ];
}
+ },
+
+ css: function( elem, name, extra ) {
+ var ret, hooks;
+
+ // Make sure that we're working with the right name
+ name = jQuery.camelCase( name );
+ hooks = jQuery.cssHooks[ name ];
+ name = jQuery.cssProps[ name ] || name;
- // Make sure we're using the right name for getting the float value
- if ( rfloat.test( name ) ) {
- name = styleFloat;
+ // cssFloat needs a special treatment
+ if ( name === "cssFloat" ) {
+ name = "float";
}
- name = name.replace(rdashAlpha, fcamelCase);
+ // If a hook was provided get the computed value from there
+ if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) {
+ return ret;
- if ( set ) {
- style[ name ] = value;
+ // Otherwise, if a way to get the computed value exists, use that
+ } else if ( curCSS ) {
+ return curCSS( elem, name );
}
+ },
- return style[ name ];
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback ) {
+ var old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( var name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ callback.call( elem );
+
+ // Revert the old values
+ for ( name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
},
- css: function( elem, name, force, extra ) {
- if ( name === "width" || name === "height" ) {
- var val, props = cssShow, which = name === "width" ? cssWidth : cssHeight;
+ camelCase: function( string ) {
+ return string.replace( rdashAlpha, fcamelCase );
+ }
+});
- function getWH() {
- val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
+// DEPRECATED, Use jQuery.css() instead
+jQuery.curCSS = jQuery.css;
- if ( extra === "border" ) {
- return;
+jQuery.each(["height", "width"], function( i, name ) {
+ jQuery.cssHooks[ name ] = {
+ get: function( elem, computed, extra ) {
+ var val;
+
+ if ( computed ) {
+ if ( elem.offsetWidth !== 0 ) {
+ val = getWH( elem, name, extra );
+
+ } else {
+ jQuery.swap( elem, cssShow, function() {
+ val = getWH( elem, name, extra );
+ });
}
- jQuery.each( which, function() {
- if ( !extra ) {
- val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
- }
+ if ( val <= 0 ) {
+ val = curCSS( elem, name, name );
- if ( extra === "margin" ) {
- val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0;
- } else {
- val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
+ if ( val === "0px" && currentStyle ) {
+ val = currentStyle( elem, name, name );
}
- });
- }
- if ( elem.offsetWidth !== 0 ) {
- getWH();
- } else {
- jQuery.swap( elem, props, getWH );
- }
+ if ( val != null ) {
+ // Should return "auto" instead of 0, use 0 for
+ // temporary backwards-compat
+ return val === "" || val === "auto" ? "0px" : val;
+ }
+ }
- return Math.max(0, Math.round(val));
- }
+ if ( val < 0 || val == null ) {
+ val = elem.style[ name ];
- return jQuery.curCSS( elem, name, force );
- },
+ // Should return "auto" instead of 0, use 0 for
+ // temporary backwards-compat
+ return val === "" || val === "auto" ? "0px" : val;
+ }
- curCSS: function( elem, name, force ) {
- var ret, style = elem.style, filter;
+ return typeof val === "string" ? val : val + "px";
+ }
+ },
- // IE uses filters for opacity
- if ( !jQuery.support.opacity && name === "opacity" && elem.currentStyle ) {
- ret = ropacity.test(elem.currentStyle.filter || "") ?
- (parseFloat(RegExp.$1) / 100) + "" :
- "";
+ set: function( elem, value ) {
+ if ( rnumpx.test( value ) ) {
+ // ignore negative width and height values #1599
+ value = parseFloat(value);
- return ret === "" ?
- "1" :
- ret;
- }
+ if ( value >= 0 ) {
+ return value + "px";
+ }
- // Make sure we're using the right name for getting the float value
- if ( rfloat.test( name ) ) {
- name = styleFloat;
+ } else {
+ return value;
+ }
}
+ };
+});
- if ( !force && style && style[ name ] ) {
- ret = style[ name ];
+if ( !jQuery.support.opacity ) {
+ jQuery.cssHooks.opacity = {
+ get: function( elem, computed ) {
+ // IE uses filters for opacity
+ return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ?
+ ( parseFloat( RegExp.$1 ) / 100 ) + "" :
+ computed ? "1" : "";
+ },
- } else if ( getComputedStyle ) {
+ set: function( elem, value ) {
+ var style = elem.style,
+ currentStyle = elem.currentStyle;
- // Only "float" is needed here
- if ( rfloat.test( name ) ) {
- name = "float";
- }
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
- name = name.replace( rupper, "-$1" ).toLowerCase();
+ // Set the alpha filter to set the opacity
+ var opacity = jQuery.isNaN( value ) ?
+ "" :
+ "alpha(opacity=" + value * 100 + ")",
+ filter = currentStyle && currentStyle.filter || style.filter || "";
- var defaultView = elem.ownerDocument.defaultView;
+ style.filter = ralpha.test( filter ) ?
+ filter.replace( ralpha, opacity ) :
+ filter + " " + opacity;
+ }
+ };
+}
- if ( !defaultView ) {
- return null;
+jQuery(function() {
+ // This hook cannot be added until DOM ready because the support test
+ // for it is not run until after DOM ready
+ if ( !jQuery.support.reliableMarginRight ) {
+ jQuery.cssHooks.marginRight = {
+ get: function( elem, computed ) {
+ // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right
+ // Work around by temporarily setting element display to inline-block
+ var ret;
+ jQuery.swap( elem, { "display": "inline-block" }, function() {
+ if ( computed ) {
+ ret = curCSS( elem, "margin-right", "marginRight" );
+ } else {
+ ret = elem.style.marginRight;
+ }
+ });
+ return ret;
}
+ };
+ }
+});
- var computedStyle = defaultView.getComputedStyle( elem, null );
+if ( document.defaultView && document.defaultView.getComputedStyle ) {
+ getComputedStyle = function( elem, name ) {
+ var ret, defaultView, computedStyle;
- if ( computedStyle ) {
- ret = computedStyle.getPropertyValue( name );
- }
+ name = name.replace( rupper, "-$1" ).toLowerCase();
- // We should always get a number back from opacity
- if ( name === "opacity" && ret === "" ) {
- ret = "1";
+ if ( !(defaultView = elem.ownerDocument.defaultView) ) {
+ return undefined;
+ }
+
+ if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) {
+ ret = computedStyle.getPropertyValue( name );
+ if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) {
+ ret = jQuery.style( elem, name );
}
+ }
- } else if ( elem.currentStyle ) {
- var camelCase = name.replace(rdashAlpha, fcamelCase);
+ return ret;
+ };
+}
- ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
+if ( document.documentElement.currentStyle ) {
+ currentStyle = function( elem, name ) {
+ var left,
+ ret = elem.currentStyle && elem.currentStyle[ name ],
+ rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ],
+ style = elem.style;
- // From the awesome hack by Dean Edwards
- // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
- // If we're not dealing with a regular pixel number
- // but a number that has a weird ending, we need to convert it to pixels
- if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
- // Remember the original values
- var left = style.left, rsLeft = elem.runtimeStyle.left;
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
+ // Remember the original values
+ left = style.left;
- // Put in the new values to get a computed value out
+ // Put in the new values to get a computed value out
+ if ( rsLeft ) {
elem.runtimeStyle.left = elem.currentStyle.left;
- style.left = camelCase === "fontSize" ? "1em" : (ret || 0);
- ret = style.pixelLeft + "px";
+ }
+ style.left = name === "fontSize" ? "1em" : (ret || 0);
+ ret = style.pixelLeft + "px";
- // Revert the changed values
- style.left = left;
+ // Revert the changed values
+ style.left = left;
+ if ( rsLeft ) {
elem.runtimeStyle.left = rsLeft;
}
}
- return ret;
- },
+ return ret === "" ? "auto" : ret;
+ };
+}
- // A method for quickly swapping in/out CSS properties to get correct calculations
- swap: function( elem, options, callback ) {
- var old = {};
+curCSS = getComputedStyle || currentStyle;
- // Remember the old values, and insert the new ones
- for ( var name in options ) {
- old[ name ] = elem.style[ name ];
- elem.style[ name ] = options[ name ];
+function getWH( elem, name, extra ) {
+ var which = name === "width" ? cssWidth : cssHeight,
+ val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
+
+ if ( extra === "border" ) {
+ return val;
+ }
+
+ jQuery.each( which, function() {
+ if ( !extra ) {
+ val -= parseFloat(jQuery.css( elem, "padding" + this )) || 0;
}
- callback.call( elem );
+ if ( extra === "margin" ) {
+ val += parseFloat(jQuery.css( elem, "margin" + this )) || 0;
- // Revert the old values
- for ( var name in options ) {
- elem.style[ name ] = old[ name ];
+ } else {
+ val -= parseFloat(jQuery.css( elem, "border" + this + "Width" )) || 0;
}
- }
-});
+ });
+
+ return val;
+}
if ( jQuery.expr && jQuery.expr.filters ) {
jQuery.expr.filters.hidden = function( elem ) {
- var width = elem.offsetWidth, height = elem.offsetHeight,
- skip = elem.nodeName.toLowerCase() === "tr";
-
- return width === 0 && height === 0 && !skip ?
- true :
- width > 0 && height > 0 && !skip ?
- false :
- jQuery.curCSS(elem, "display") === "none";
+ var width = elem.offsetWidth,
+ height = elem.offsetHeight;
+
+ return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none");
};
jQuery.expr.filters.visible = function( elem ) {
return !jQuery.expr.filters.hidden( elem );
};
}
-var jsc = now(),
- rscript = /<script(.|\s)*?\/script>/gi,
- rselectTextarea = /select|textarea/i,
- rinput = /color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,
- jsre = /=\?(&|$)/,
+
+
+
+
+var r20 = /%20/g,
+ rbracket = /\[\]$/,
+ rCRLF = /\r?\n/g,
+ rhash = /#.*$/,
+ rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL
+ rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,
+ // #7653, #8125, #8152: local protocol detection
+ rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|widget):$/,
+ rnoContent = /^(?:GET|HEAD)$/,
+ rprotocol = /^\/\//,
rquery = /\?/,
- rts = /(\?|&)_=.*?(&|$)/,
- rurl = /^(\w+:)?\/\/([^\/?#]+)/,
- r20 = /%20/g,
+ rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,
+ rselectTextarea = /^(?:select|textarea)/i,
+ rspacesAjax = /\s+/,
+ rts = /([?&])_=[^&]*/,
+ rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,
// Keep a copy of the old load method
- _load = jQuery.fn.load;
+ _load = jQuery.fn.load,
+
+ /* Prefilters
+ * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+ * 2) These are called:
+ * - BEFORE asking for a transport
+ * - AFTER param serialization (s.data is a string if s.processData is true)
+ * 3) key is the dataType
+ * 4) the catchall symbol "*" can be used
+ * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+ */
+ prefilters = {},
+
+ /* Transports bindings
+ * 1) key is the dataType
+ * 2) the catchall symbol "*" can be used
+ * 3) selection will start with transport dataType and THEN go to "*" if needed
+ */
+ transports = {},
+
+ // Document location
+ ajaxLocation,
+
+ // Document location segments
+ ajaxLocParts;
+
+// #8138, IE may throw an exception when accessing
+// a field from window.location if document.domain has been set
+try {
+ ajaxLocation = location.href;
+} catch( e ) {
+ // Use the href attribute of an A element
+ // since IE will modify it given document.location
+ ajaxLocation = document.createElement( "a" );
+ ajaxLocation.href = "";
+ ajaxLocation = ajaxLocation.href;
+}
+
+// Segment location into parts
+ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || [];
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+ // dataTypeExpression is optional and defaults to "*"
+ return function( dataTypeExpression, func ) {
+
+ if ( typeof dataTypeExpression !== "string" ) {
+ func = dataTypeExpression;
+ dataTypeExpression = "*";
+ }
+
+ if ( jQuery.isFunction( func ) ) {
+ var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ),
+ i = 0,
+ length = dataTypes.length,
+ dataType,
+ list,
+ placeBefore;
+
+ // For each dataType in the dataTypeExpression
+ for(; i < length; i++ ) {
+ dataType = dataTypes[ i ];
+ // We control if we're asked to add before
+ // any existing element
+ placeBefore = /^\+/.test( dataType );
+ if ( placeBefore ) {
+ dataType = dataType.substr( 1 ) || "*";
+ }
+ list = structure[ dataType ] = structure[ dataType ] || [];
+ // then we add to the structure accordingly
+ list[ placeBefore ? "unshift" : "push" ]( func );
+ }
+ }
+ };
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR,
+ dataType /* internal */, inspected /* internal */ ) {
+
+ dataType = dataType || options.dataTypes[ 0 ];
+ inspected = inspected || {};
+
+ inspected[ dataType ] = true;
+
+ var list = structure[ dataType ],
+ i = 0,
+ length = list ? list.length : 0,
+ executeOnly = ( structure === prefilters ),
+ selection;
+
+ for(; i < length && ( executeOnly || !selection ); i++ ) {
+ selection = list[ i ]( options, originalOptions, jqXHR );
+ // If we got redirected to another dataType
+ // we try there if executing only and not done already
+ if ( typeof selection === "string" ) {
+ if ( !executeOnly || inspected[ selection ] ) {
+ selection = undefined;
+ } else {
+ options.dataTypes.unshift( selection );
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, selection, inspected );
+ }
+ }
+ }
+ // If we're only executing or nothing was selected
+ // we try the catchall dataType if not done already
+ if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) {
+ selection = inspectPrefiltersOrTransports(
+ structure, options, originalOptions, jqXHR, "*", inspected );
+ }
+ // unnecessary when only executing (prefilters)
+ // but it'll be ignored by the caller in that case
+ return selection;
+}
jQuery.fn.extend({
load: function( url, params, callback ) {
- if ( typeof url !== "string" ) {
- return _load.call( this, url );
+ if ( typeof url !== "string" && _load ) {
+ return _load.apply( this, arguments );
// Don't do a request if no elements are being requested
} else if ( !this.length ) {
return this;
}
- var off = url.indexOf(" ");
+ var off = url.indexOf( " " );
if ( off >= 0 ) {
- var selector = url.slice(off, url.length);
- url = url.slice(0, off);
+ var selector = url.slice( off, url.length );
+ url = url.slice( 0, off );
}
// Default to a GET request
@@ -4806,7 +6740,7 @@ jQuery.fn.extend({
if ( jQuery.isFunction( params ) ) {
// We assume that it's the callback
callback = params;
- params = null;
+ params = undefined;
// Otherwise, build a param string
} else if ( typeof params === "object" ) {
@@ -4823,26 +6757,34 @@ jQuery.fn.extend({
type: type,
dataType: "html",
data: params,
- complete: function( res, status ) {
+ // Complete callback (responseText is used internally)
+ complete: function( jqXHR, status, responseText ) {
+ // Store the response as specified by the jqXHR object
+ responseText = jqXHR.responseText;
// If successful, inject the HTML into all the matched elements
- if ( status === "success" || status === "notmodified" ) {
+ if ( jqXHR.isResolved() ) {
+ // #4825: Get the actual response in case
+ // a dataFilter is present in ajaxSettings
+ jqXHR.done(function( r ) {
+ responseText = r;
+ });
// See if a selector was specified
self.html( selector ?
// Create a dummy div to hold the results
- jQuery("<div />")
+ jQuery("<div>")
// inject the contents of the document in, removing the scripts
// to avoid any 'Permission Denied' errors in IE
- .append(res.responseText.replace(rscript, ""))
+ .append(responseText.replace(rscript, ""))
// Locate the specified elements
.find(selector) :
// If not, just inject the full result
- res.responseText );
+ responseText );
}
if ( callback ) {
- self.each( callback, [res.responseText, status, res] );
+ self.each( callback, [ responseText, status, jqXHR ] );
}
}
});
@@ -4851,88 +6793,94 @@ jQuery.fn.extend({
},
serialize: function() {
- return jQuery.param(this.serializeArray());
+ return jQuery.param( this.serializeArray() );
},
+
serializeArray: function() {
- return this.map(function() {
- return this.elements ? jQuery.makeArray(this.elements) : this;
+ return this.map(function(){
+ return this.elements ? jQuery.makeArray( this.elements ) : this;
})
- .filter(function() {
+ .filter(function(){
return this.name && !this.disabled &&
- (this.checked || rselectTextarea.test(this.nodeName) ||
- rinput.test(this.type));
+ ( this.checked || rselectTextarea.test( this.nodeName ) ||
+ rinput.test( this.type ) );
})
- .map(function( i, elem ) {
- var val = jQuery(this).val();
+ .map(function( i, elem ){
+ var val = jQuery( this ).val();
return val == null ?
null :
- jQuery.isArray(val) ?
- jQuery.map( val, function( val, i ) {
- return { name: elem.name, value: val };
+ jQuery.isArray( val ) ?
+ jQuery.map( val, function( val, i ){
+ return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
}) :
- { name: elem.name, value: val };
+ { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
}).get();
}
});
// Attach a bunch of functions for handling common AJAX events
-jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) {
- jQuery.fn[o] = function( f ) {
- return this.bind(o, f);
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){
+ jQuery.fn[ o ] = function( f ){
+ return this.bind( o, f );
};
});
-jQuery.extend({
-
- get: function( url, data, callback, type ) {
- // shift arguments if data argument was omited
+jQuery.each( [ "get", "post" ], function( i, method ) {
+ jQuery[ method ] = function( url, data, callback, type ) {
+ // shift arguments if data argument was omitted
if ( jQuery.isFunction( data ) ) {
type = type || callback;
callback = data;
- data = null;
+ data = undefined;
}
return jQuery.ajax({
- type: "GET",
+ type: method,
url: url,
data: data,
success: callback,
dataType: type
});
- },
+ };
+});
+
+jQuery.extend({
getScript: function( url, callback ) {
- return jQuery.get(url, null, callback, "script");
+ return jQuery.get( url, undefined, callback, "script" );
},
getJSON: function( url, data, callback ) {
- return jQuery.get(url, data, callback, "json");
+ return jQuery.get( url, data, callback, "json" );
},
- post: function( url, data, callback, type ) {
- // shift arguments if data argument was omited
- if ( jQuery.isFunction( data ) ) {
- type = type || callback;
- callback = data;
- data = {};
+ // Creates a full fledged settings object into target
+ // with both ajaxSettings and settings fields.
+ // If target is omitted, writes into ajaxSettings.
+ ajaxSetup: function ( target, settings ) {
+ if ( !settings ) {
+ // Only one parameter, we extend ajaxSettings
+ settings = target;
+ target = jQuery.extend( true, jQuery.ajaxSettings, settings );
+ } else {
+ // target was provided, we extend into it
+ jQuery.extend( true, target, jQuery.ajaxSettings, settings );
}
-
- return jQuery.ajax({
- type: "POST",
- url: url,
- data: data,
- success: callback,
- dataType: type
- });
- },
-
- ajaxSetup: function( settings ) {
- jQuery.extend( jQuery.ajaxSettings, settings );
+ // Flatten fields we don't want deep extended
+ for( var field in { context: 1, url: 1 } ) {
+ if ( field in settings ) {
+ target[ field ] = settings[ field ];
+ } else if( field in jQuery.ajaxSettings ) {
+ target[ field ] = jQuery.ajaxSettings[ field ];
+ }
+ }
+ return target;
},
ajaxSettings: {
- url: location.href,
+ url: ajaxLocation,
+ isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ),
global: true,
type: "GET",
contentType: "application/x-www-form-urlencoded",
@@ -4941,507 +6889,1063 @@ jQuery.extend({
/*
timeout: 0,
data: null,
+ dataType: null,
username: null,
password: null,
+ cache: null,
traditional: false,
+ headers: {},
*/
- // Create the request object; Microsoft failed to properly
- // implement the XMLHttpRequest in IE7 (can't request local files),
- // so we use the ActiveXObject when it is available
- // This function can be overriden by calling jQuery.ajaxSetup
- xhr: window.XMLHttpRequest && (window.location.protocol !== "file:" || !window.ActiveXObject) ?
- function() {
- return new window.XMLHttpRequest();
- } :
- function() {
- try {
- return new window.ActiveXObject("Microsoft.XMLHTTP");
- } catch(e) {}
- },
+
accepts: {
xml: "application/xml, text/xml",
html: "text/html",
- script: "text/javascript, application/javascript",
- json: "application/json, text/javascript",
text: "text/plain",
- _default: "*/*"
- }
- },
+ json: "application/json, text/javascript",
+ "*": "*/*"
+ },
- // Last-Modified header cache for next request
- lastModified: {},
- etag: {},
+ contents: {
+ xml: /xml/,
+ html: /html/,
+ json: /json/
+ },
- ajax: function( origSettings ) {
- var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings);
-
- var jsonp, status, data,
- callbackContext = origSettings && origSettings.context || s,
- type = s.type.toUpperCase();
+ responseFields: {
+ xml: "responseXML",
+ text: "responseText"
+ },
- // convert data if not already a string
- if ( s.data && s.processData && typeof s.data !== "string" ) {
- s.data = jQuery.param( s.data, s.traditional );
- }
+ // List of data converters
+ // 1) key format is "source_type destination_type" (a single space in-between)
+ // 2) the catchall symbol "*" can be used for source_type
+ converters: {
+
+ // Convert anything to text
+ "* text": window.String,
+
+ // Text to html (true = no transformation)
+ "text html": true,
+
+ // Evaluate text as a json expression
+ "text json": jQuery.parseJSON,
+
+ // Parse text as xml
+ "text xml": jQuery.parseXML
+ }
+ },
+
+ ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+ ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+ // Main method
+ ajax: function( url, options ) {
+
+ // If url is an object, simulate pre-1.5 signature
+ if ( typeof url === "object" ) {
+ options = url;
+ url = undefined;
+ }
+
+ // Force options to be an object
+ options = options || {};
+
+ var // Create the final options object
+ s = jQuery.ajaxSetup( {}, options ),
+ // Callbacks context
+ callbackContext = s.context || s,
+ // Context for global events
+ // It's the callbackContext if one was provided in the options
+ // and if it's a DOM node or a jQuery collection
+ globalEventContext = callbackContext !== s &&
+ ( callbackContext.nodeType || callbackContext instanceof jQuery ) ?
+ jQuery( callbackContext ) : jQuery.event,
+ // Deferreds
+ deferred = jQuery.Deferred(),
+ completeDeferred = jQuery._Deferred(),
+ // Status-dependent callbacks
+ statusCode = s.statusCode || {},
+ // ifModified key
+ ifModifiedKey,
+ // Headers (they are sent all at once)
+ requestHeaders = {},
+ requestHeadersNames = {},
+ // Response headers
+ responseHeadersString,
+ responseHeaders,
+ // transport
+ transport,
+ // timeout handle
+ timeoutTimer,
+ // Cross-domain detection vars
+ parts,
+ // The jqXHR state
+ state = 0,
+ // To know if global events are to be dispatched
+ fireGlobals,
+ // Loop variable
+ i,
+ // Fake xhr
+ jqXHR = {
+
+ readyState: 0,
+
+ // Caches the header
+ setRequestHeader: function( name, value ) {
+ if ( !state ) {
+ var lname = name.toLowerCase();
+ name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name;
+ requestHeaders[ name ] = value;
+ }
+ return this;
+ },
+
+ // Raw string
+ getAllResponseHeaders: function() {
+ return state === 2 ? responseHeadersString : null;
+ },
+
+ // Builds headers hashtable if needed
+ getResponseHeader: function( key ) {
+ var match;
+ if ( state === 2 ) {
+ if ( !responseHeaders ) {
+ responseHeaders = {};
+ while( ( match = rheaders.exec( responseHeadersString ) ) ) {
+ responseHeaders[ match[1].toLowerCase() ] = match[ 2 ];
+ }
+ }
+ match = responseHeaders[ key.toLowerCase() ];
+ }
+ return match === undefined ? null : match;
+ },
- // Handle JSONP Parameter Callbacks
- if ( s.dataType === "jsonp" ) {
- if ( type === "GET" ) {
- if ( !jsre.test( s.url ) ) {
- s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?";
+ // Overrides response content-type header
+ overrideMimeType: function( type ) {
+ if ( !state ) {
+ s.mimeType = type;
+ }
+ return this;
+ },
+
+ // Cancel the request
+ abort: function( statusText ) {
+ statusText = statusText || "abort";
+ if ( transport ) {
+ transport.abort( statusText );
+ }
+ done( 0, statusText );
+ return this;
}
- } else if ( !s.data || !jsre.test(s.data) ) {
- s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?";
+ };
+
+ // Callback for when everything is done
+ // It is defined here because jslint complains if it is declared
+ // at the end of the function (which would be more logical and readable)
+ function done( status, statusText, responses, headers ) {
+
+ // Called once
+ if ( state === 2 ) {
+ return;
}
- s.dataType = "json";
- }
- // Build temporary JSONP function
- if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) {
- jsonp = s.jsonpCallback || ("jsonp" + jsc++);
+ // State is "done" now
+ state = 2;
- // Replace the =? sequence both in the query string and the data
- if ( s.data ) {
- s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
+ // Clear timeout if it exists
+ if ( timeoutTimer ) {
+ clearTimeout( timeoutTimer );
}
- s.url = s.url.replace(jsre, "=" + jsonp + "$1");
+ // Dereference transport for early garbage collection
+ // (no matter how long the jqXHR object will be used)
+ transport = undefined;
- // We need to make sure
- // that a JSONP style response is executed properly
- s.dataType = "script";
+ // Cache response headers
+ responseHeadersString = headers || "";
- // Handle JSONP-style loading
- window[ jsonp ] = window[ jsonp ] || function( tmp ) {
- data = tmp;
- success();
- complete();
- // Garbage collect
- window[ jsonp ] = undefined;
+ // Set readyState
+ jqXHR.readyState = status ? 4 : 0;
- try {
- delete window[ jsonp ];
- } catch(e) {}
+ var isSuccess,
+ success,
+ error,
+ response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined,
+ lastModified,
+ etag;
+
+ // If successful, handle type chaining
+ if ( status >= 200 && status < 300 || status === 304 ) {
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
- if ( head ) {
- head.removeChild( script );
+ if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) {
+ jQuery.lastModified[ ifModifiedKey ] = lastModified;
+ }
+ if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) {
+ jQuery.etag[ ifModifiedKey ] = etag;
+ }
}
- };
- }
- if ( s.dataType === "script" && s.cache === null ) {
- s.cache = false;
+ // If not modified
+ if ( status === 304 ) {
+
+ statusText = "notmodified";
+ isSuccess = true;
+
+ // If we have data
+ } else {
+
+ try {
+ success = ajaxConvert( s, response );
+ statusText = "success";
+ isSuccess = true;
+ } catch(e) {
+ // We have a parsererror
+ statusText = "parsererror";
+ error = e;
+ }
+ }
+ } else {
+ // We extract error from statusText
+ // then normalize statusText and status for non-aborts
+ error = statusText;
+ if( !statusText || status ) {
+ statusText = "error";
+ if ( status < 0 ) {
+ status = 0;
+ }
+ }
+ }
+
+ // Set data for the fake xhr object
+ jqXHR.status = status;
+ jqXHR.statusText = statusText;
+
+ // Success/Error
+ if ( isSuccess ) {
+ deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+ } else {
+ deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+ }
+
+ // Status-dependent callbacks
+ jqXHR.statusCode( statusCode );
+ statusCode = undefined;
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ),
+ [ jqXHR, s, isSuccess ? success : error ] );
+ }
+
+ // Complete
+ completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] );
+
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxComplete", [ jqXHR, s] );
+ // Handle the global AJAX counter
+ if ( !( --jQuery.active ) ) {
+ jQuery.event.trigger( "ajaxStop" );
+ }
+ }
}
- if ( s.cache === false && type === "GET" ) {
- var ts = now();
+ // Attach deferreds
+ deferred.promise( jqXHR );
+ jqXHR.success = jqXHR.done;
+ jqXHR.error = jqXHR.fail;
+ jqXHR.complete = completeDeferred.done;
- // try replacing _= if it is there
- var ret = s.url.replace(rts, "$1_=" + ts + "$2");
+ // Status-dependent callbacks
+ jqXHR.statusCode = function( map ) {
+ if ( map ) {
+ var tmp;
+ if ( state < 2 ) {
+ for( tmp in map ) {
+ statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ];
+ }
+ } else {
+ tmp = map[ jqXHR.status ];
+ jqXHR.then( tmp, tmp );
+ }
+ }
+ return this;
+ };
+
+ // Remove hash character (#7531: and string promotion)
+ // Add protocol if not provided (#5866: IE7 issue with protocol-less urls)
+ // We also use the url parameter if available
+ s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" );
+
+ // Extract dataTypes list
+ s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax );
- // if nothing was replaced, add timestamp to the end
- s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : "");
+ // Determine if a cross-domain request is in order
+ if ( s.crossDomain == null ) {
+ parts = rurl.exec( s.url.toLowerCase() );
+ s.crossDomain = !!( parts &&
+ ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] ||
+ ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) !=
+ ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) )
+ );
}
- // If data is available, append data to url for get requests
- if ( s.data && type === "GET" ) {
- s.url += (rquery.test(s.url) ? "&" : "?") + s.data;
+ // Convert data if not already a string
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
}
+ // Apply prefilters
+ inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+ // If request was aborted inside a prefiler, stop there
+ if ( state === 2 ) {
+ return false;
+ }
+
+ // We can fire global events as of now if asked to
+ fireGlobals = s.global;
+
+ // Uppercase the type
+ s.type = s.type.toUpperCase();
+
+ // Determine if request has content
+ s.hasContent = !rnoContent.test( s.type );
+
// Watch for a new set of requests
- if ( s.global && ! jQuery.active++ ) {
+ if ( fireGlobals && jQuery.active++ === 0 ) {
jQuery.event.trigger( "ajaxStart" );
}
- // Matches an absolute URL, and saves the domain
- var parts = rurl.exec( s.url ),
- remote = parts && (parts[1] && parts[1] !== location.protocol || parts[2] !== location.host);
+ // More options handling for requests with no content
+ if ( !s.hasContent ) {
- // If we're requesting a remote document
- // and trying to load JSON or Script with a GET
- if ( s.dataType === "script" && type === "GET" && remote ) {
- var head = document.getElementsByTagName("head")[0] || document.documentElement;
- var script = document.createElement("script");
- script.src = s.url;
- if ( s.scriptCharset ) {
- script.charset = s.scriptCharset;
+ // If data is available, append data to url
+ if ( s.data ) {
+ s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data;
}
- // Handle Script loading
- if ( !jsonp ) {
- var done = false;
+ // Get ifModifiedKey before adding the anti-cache parameter
+ ifModifiedKey = s.url;
- // Attach handlers for all browsers
- script.onload = script.onreadystatechange = function() {
- if ( !done && (!this.readyState ||
- this.readyState === "loaded" || this.readyState === "complete") ) {
- done = true;
- success();
- complete();
+ // Add anti-cache in url if needed
+ if ( s.cache === false ) {
- // Handle memory leak in IE
- script.onload = script.onreadystatechange = null;
- if ( head && script.parentNode ) {
- head.removeChild( script );
- }
- }
- };
+ var ts = jQuery.now(),
+ // try replacing _= if it is there
+ ret = s.url.replace( rts, "$1_=" + ts );
+
+ // if nothing was replaced, add timestamp to the end
+ s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" );
}
+ }
- // Use insertBefore instead of appendChild to circumvent an IE6 bug.
- // This arises when a base node is used (#2709 and #4378).
- head.insertBefore( script, head.firstChild );
+ // Set the correct header, if data is being sent
+ if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+ jqXHR.setRequestHeader( "Content-Type", s.contentType );
+ }
- // We handle everything using the script element injection
- return undefined;
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ ifModifiedKey = ifModifiedKey || s.url;
+ if ( jQuery.lastModified[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] );
+ }
+ if ( jQuery.etag[ ifModifiedKey ] ) {
+ jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] );
+ }
}
- var requestDone = false;
+ // Set the Accepts header for the server, depending on the dataType
+ jqXHR.setRequestHeader(
+ "Accept",
+ s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ?
+ s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) :
+ s.accepts[ "*" ]
+ );
+
+ // Check for headers option
+ for ( i in s.headers ) {
+ jqXHR.setRequestHeader( i, s.headers[ i ] );
+ }
- // Create the request object
- var xhr = s.xhr();
+ // Allow custom headers/mimetypes and early abort
+ if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) {
+ // Abort if not done already
+ jqXHR.abort();
+ return false;
- if ( !xhr ) {
- return;
}
- // Open the socket
- // Passing null username, generates a login popup on Opera (#2865)
- if ( s.username ) {
- xhr.open(type, s.url, s.async, s.username, s.password);
- } else {
- xhr.open(type, s.url, s.async);
+ // Install callbacks on deferreds
+ for ( i in { success: 1, error: 1, complete: 1 } ) {
+ jqXHR[ i ]( s[ i ] );
}
- // Need an extra try/catch for cross domain requests in Firefox 3
- try {
- // Set the correct header, if data is being sent
- if ( s.data || origSettings && origSettings.contentType ) {
- xhr.setRequestHeader("Content-Type", s.contentType);
- }
+ // Get transport
+ transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
- // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
- if ( s.ifModified ) {
- if ( jQuery.lastModified[s.url] ) {
- xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]);
- }
+ // If no transport, we auto-abort
+ if ( !transport ) {
+ done( -1, "No Transport" );
+ } else {
+ jqXHR.readyState = 1;
+ // Send global event
+ if ( fireGlobals ) {
+ globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+ }
+ // Timeout
+ if ( s.async && s.timeout > 0 ) {
+ timeoutTimer = setTimeout( function(){
+ jqXHR.abort( "timeout" );
+ }, s.timeout );
+ }
- if ( jQuery.etag[s.url] ) {
- xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]);
+ try {
+ state = 1;
+ transport.send( requestHeaders, done );
+ } catch (e) {
+ // Propagate exception as error if not done
+ if ( status < 2 ) {
+ done( -1, e );
+ // Simply rethrow otherwise
+ } else {
+ jQuery.error( e );
}
}
+ }
+
+ return jqXHR;
+ },
+
+ // Serialize an array of form elements or a set of
+ // key/values into a query string
+ param: function( a, traditional ) {
+ var s = [],
+ add = function( key, value ) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction( value ) ? value() : value;
+ s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value );
+ };
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if ( traditional === undefined ) {
+ traditional = jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+ // Serialize the form elements
+ jQuery.each( a, function() {
+ add( this.name, this.value );
+ });
- // Set header so the called script knows that it's an XMLHttpRequest
- // Only send the header if it's not a remote XHR
- if ( !remote ) {
- xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( var prefix in a ) {
+ buildParams( prefix, a[ prefix ], traditional, add );
}
+ }
- // Set the Accepts header for the server, depending on the dataType
- xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
- s.accepts[ s.dataType ] + ", */*" :
- s.accepts._default );
- } catch(e) {}
+ // Return the resulting serialization
+ return s.join( "&" ).replace( r20, "+" );
+ }
+});
- // Allow custom headers/mimetypes and early abort
- if ( s.beforeSend && s.beforeSend.call(callbackContext, xhr, s) === false ) {
- // Handle the global AJAX counter
- if ( s.global && ! --jQuery.active ) {
- jQuery.event.trigger( "ajaxStop" );
+function buildParams( prefix, obj, traditional, add ) {
+ if ( jQuery.isArray( obj ) ) {
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || rbracket.test( prefix ) ) {
+ // Treat each array item as a scalar.
+ add( prefix, v );
+
+ } else {
+ // If array item is non-scalar (array or object), encode its
+ // numeric index to resolve deserialization ambiguity issues.
+ // Note that rack (as of 1.0.0) can't currently deserialize
+ // nested arrays properly, and attempting to do so may cause
+ // a server error. Possible fixes are to modify rack's
+ // deserialization algorithm or to provide an option or flag
+ // to force array serialization to be shallow.
+ buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add );
}
+ });
- // close opended socket
- xhr.abort();
- return false;
+ } else if ( !traditional && obj != null && typeof obj === "object" ) {
+ // Serialize object item.
+ for ( var name in obj ) {
+ buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
}
- if ( s.global ) {
- trigger("ajaxSend", [xhr, s]);
- }
+ } else {
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+}
- // Wait for a response to come back
- var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) {
- // The request was aborted
- if ( !xhr || xhr.readyState === 0 || isTimeout === "abort" ) {
- // Opera doesn't call onreadystatechange before this point
- // so we simulate the call
- if ( !requestDone ) {
- complete();
- }
+// This is still on the jQuery object... for now
+// Want to move this to jQuery.ajax some day
+jQuery.extend({
- requestDone = true;
- if ( xhr ) {
- xhr.onreadystatechange = jQuery.noop;
- }
+ // Counter for holding the number of active queries
+ active: 0,
- // The transfer is complete and the data is available, or the request timed out
- } else if ( !requestDone && xhr && (xhr.readyState === 4 || isTimeout === "timeout") ) {
- requestDone = true;
- xhr.onreadystatechange = jQuery.noop;
+ // Last-Modified header cache for next request
+ lastModified: {},
+ etag: {}
- status = isTimeout === "timeout" ?
- "timeout" :
- !jQuery.httpSuccess( xhr ) ?
- "error" :
- s.ifModified && jQuery.httpNotModified( xhr, s.url ) ?
- "notmodified" :
- "success";
+});
- var errMsg;
+/* Handles responses to an ajax request:
+ * - sets all responseXXX fields accordingly
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
- if ( status === "success" ) {
- // Watch for, and catch, XML document parse errors
- try {
- // process the data (runs the xml through httpData regardless of callback)
- data = jQuery.httpData( xhr, s.dataType, s );
- } catch(err) {
- status = "parsererror";
- errMsg = err;
- }
- }
+ var contents = s.contents,
+ dataTypes = s.dataTypes,
+ responseFields = s.responseFields,
+ ct,
+ type,
+ finalDataType,
+ firstDataType;
- // Make sure that the request was successful or notmodified
- if ( status === "success" || status === "notmodified" ) {
- // JSONP handles its own success callback
- if ( !jsonp ) {
- success();
- }
- } else {
- jQuery.handleError(s, xhr, status, errMsg);
- }
+ // Fill responseXXX fields
+ for( type in responseFields ) {
+ if ( type in responses ) {
+ jqXHR[ responseFields[type] ] = responses[ type ];
+ }
+ }
- // Fire the complete handlers
- complete();
+ // Remove auto dataType and get content-type in the process
+ while( dataTypes[ 0 ] === "*" ) {
+ dataTypes.shift();
+ if ( ct === undefined ) {
+ ct = s.mimeType || jqXHR.getResponseHeader( "content-type" );
+ }
+ }
- if ( isTimeout === "timeout" ) {
- xhr.abort();
- }
+ // Check if we're dealing with a known content-type
+ if ( ct ) {
+ for ( type in contents ) {
+ if ( contents[ type ] && contents[ type ].test( ct ) ) {
+ dataTypes.unshift( type );
+ break;
+ }
+ }
+ }
- // Stop memory leaks
- if ( s.async ) {
- xhr = null;
- }
+ // Check to see if we have a response for the expected dataType
+ if ( dataTypes[ 0 ] in responses ) {
+ finalDataType = dataTypes[ 0 ];
+ } else {
+ // Try convertible dataTypes
+ for ( type in responses ) {
+ if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) {
+ finalDataType = type;
+ break;
}
- };
+ if ( !firstDataType ) {
+ firstDataType = type;
+ }
+ }
+ // Or just use first one
+ finalDataType = finalDataType || firstDataType;
+ }
- // Override the abort handler, if we can (IE doesn't allow it, but that's OK)
- // Opera doesn't fire onreadystatechange at all on abort
- try {
- var oldAbort = xhr.abort;
- xhr.abort = function() {
- if ( xhr ) {
- oldAbort.call( xhr );
- }
+ // If we found a dataType
+ // We add the dataType to the list if needed
+ // and return the corresponding response
+ if ( finalDataType ) {
+ if ( finalDataType !== dataTypes[ 0 ] ) {
+ dataTypes.unshift( finalDataType );
+ }
+ return responses[ finalDataType ];
+ }
+}
- onreadystatechange( "abort" );
- };
- } catch(e) { }
+// Chain conversions given the request and the original response
+function ajaxConvert( s, response ) {
- // Timeout checker
- if ( s.async && s.timeout > 0 ) {
- setTimeout(function() {
- // Check to see if the request is still happening
- if ( xhr && !requestDone ) {
- onreadystatechange( "timeout" );
+ // Apply the dataFilter if provided
+ if ( s.dataFilter ) {
+ response = s.dataFilter( response, s.dataType );
+ }
+
+ var dataTypes = s.dataTypes,
+ converters = {},
+ i,
+ key,
+ length = dataTypes.length,
+ tmp,
+ // Current and previous dataTypes
+ current = dataTypes[ 0 ],
+ prev,
+ // Conversion expression
+ conversion,
+ // Conversion function
+ conv,
+ // Conversion functions (transitive conversion)
+ conv1,
+ conv2;
+
+ // For each dataType in the chain
+ for( i = 1; i < length; i++ ) {
+
+ // Create converters map
+ // with lowercased keys
+ if ( i === 1 ) {
+ for( key in s.converters ) {
+ if( typeof key === "string" ) {
+ converters[ key.toLowerCase() ] = s.converters[ key ];
}
- }, s.timeout);
+ }
}
- // Send the data
- try {
- xhr.send( type === "POST" || type === "PUT" || type === "DELETE" ? s.data : null );
- } catch(e) {
- jQuery.handleError(s, xhr, null, e);
- // Fire the complete handlers
- complete();
+ // Get the dataTypes
+ prev = current;
+ current = dataTypes[ i ];
+
+ // If current is auto dataType, update it to prev
+ if( current === "*" ) {
+ current = prev;
+ // If no auto and dataTypes are actually different
+ } else if ( prev !== "*" && prev !== current ) {
+
+ // Get the converter
+ conversion = prev + " " + current;
+ conv = converters[ conversion ] || converters[ "* " + current ];
+
+ // If there is no direct converter, search transitively
+ if ( !conv ) {
+ conv2 = undefined;
+ for( conv1 in converters ) {
+ tmp = conv1.split( " " );
+ if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) {
+ conv2 = converters[ tmp[1] + " " + current ];
+ if ( conv2 ) {
+ conv1 = converters[ conv1 ];
+ if ( conv1 === true ) {
+ conv = conv2;
+ } else if ( conv2 === true ) {
+ conv = conv1;
+ }
+ break;
+ }
+ }
+ }
+ }
+ // If we found no converter, dispatch an error
+ if ( !( conv || conv2 ) ) {
+ jQuery.error( "No conversion from " + conversion.replace(" "," to ") );
+ }
+ // If found converter is not an equivalence
+ if ( conv !== true ) {
+ // Convert with 1 or 2 converters accordingly
+ response = conv ? conv( response ) : conv2( conv1(response) );
+ }
}
+ }
+ return response;
+}
- // firefox 1.5 doesn't fire statechange for sync requests
- if ( !s.async ) {
- onreadystatechange();
- }
- function success() {
- // If a local callback was specified, fire it and pass it the data
- if ( s.success ) {
- s.success.call( callbackContext, data, status, xhr );
- }
- // Fire the global callback
- if ( s.global ) {
- trigger( "ajaxSuccess", [xhr, s] );
+
+var jsc = jQuery.now(),
+ jsre = /(\=)\?(&|$)|\?\?/i;
+
+// Default jsonp settings
+jQuery.ajaxSetup({
+ jsonp: "callback",
+ jsonpCallback: function() {
+ return jQuery.expando + "_" + ( jsc++ );
+ }
+});
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+ var inspectData = s.contentType === "application/x-www-form-urlencoded" &&
+ ( typeof s.data === "string" );
+
+ if ( s.dataTypes[ 0 ] === "jsonp" ||
+ s.jsonp !== false && ( jsre.test( s.url ) ||
+ inspectData && jsre.test( s.data ) ) ) {
+
+ var responseContainer,
+ jsonpCallback = s.jsonpCallback =
+ jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback,
+ previous = window[ jsonpCallback ],
+ url = s.url,
+ data = s.data,
+ replace = "$1" + jsonpCallback + "$2";
+
+ if ( s.jsonp !== false ) {
+ url = url.replace( jsre, replace );
+ if ( s.url === url ) {
+ if ( inspectData ) {
+ data = data.replace( jsre, replace );
+ }
+ if ( s.data === data ) {
+ // Add callback manually
+ url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback;
+ }
}
}
- function complete() {
- // Process result
- if ( s.complete ) {
- s.complete.call( callbackContext, xhr, status);
- }
+ s.url = url;
+ s.data = data;
+
+ // Install callback
+ window[ jsonpCallback ] = function( response ) {
+ responseContainer = [ response ];
+ };
- // The request was completed
- if ( s.global ) {
- trigger( "ajaxComplete", [xhr, s] );
+ // Clean-up function
+ jqXHR.always(function() {
+ // Set callback back to previous value
+ window[ jsonpCallback ] = previous;
+ // Call if it was a function and we have a response
+ if ( responseContainer && jQuery.isFunction( previous ) ) {
+ window[ jsonpCallback ]( responseContainer[ 0 ] );
}
+ });
- // Handle the global AJAX counter
- if ( s.global && ! --jQuery.active ) {
- jQuery.event.trigger( "ajaxStop" );
+ // Use data converter to retrieve json after script execution
+ s.converters["script json"] = function() {
+ if ( !responseContainer ) {
+ jQuery.error( jsonpCallback + " was not called" );
}
- }
-
- function trigger(type, args) {
- (s.context ? jQuery(s.context) : jQuery.event).trigger(type, args);
- }
+ return responseContainer[ 0 ];
+ };
- // return XMLHttpRequest to allow aborting the request etc.
- return xhr;
- },
+ // force json dataType
+ s.dataTypes[ 0 ] = "json";
- handleError: function( s, xhr, status, e ) {
- // If a local callback was specified, fire it
- if ( s.error ) {
- s.error.call( s.context || s, xhr, status, e );
- }
+ // Delegate to script
+ return "script";
+ }
+});
- // Fire the global callback
- if ( s.global ) {
- (s.context ? jQuery(s.context) : jQuery.event).trigger( "ajaxError", [xhr, s, e] );
- }
- },
- // Counter for holding the number of active queries
- active: 0,
- // Determines if an XMLHttpRequest was successful or not
- httpSuccess: function( xhr ) {
- try {
- // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
- return !xhr.status && location.protocol === "file:" ||
- // Opera returns 0 when status is 304
- ( xhr.status >= 200 && xhr.status < 300 ) ||
- xhr.status === 304 || xhr.status === 1223 || xhr.status === 0;
- } catch(e) {}
- return false;
+// Install script dataType
+jQuery.ajaxSetup({
+ accepts: {
+ script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"
},
+ contents: {
+ script: /javascript|ecmascript/
+ },
+ converters: {
+ "text script": function( text ) {
+ jQuery.globalEval( text );
+ return text;
+ }
+ }
+});
- // Determines if an XMLHttpRequest returns NotModified
- httpNotModified: function( xhr, url ) {
- var lastModified = xhr.getResponseHeader("Last-Modified"),
- etag = xhr.getResponseHeader("Etag");
+// Handle cache's special case and global
+jQuery.ajaxPrefilter( "script", function( s ) {
+ if ( s.cache === undefined ) {
+ s.cache = false;
+ }
+ if ( s.crossDomain ) {
+ s.type = "GET";
+ s.global = false;
+ }
+});
- if ( lastModified ) {
- jQuery.lastModified[url] = lastModified;
- }
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function(s) {
- if ( etag ) {
- jQuery.etag[url] = etag;
- }
+ // This transport only deals with cross domain requests
+ if ( s.crossDomain ) {
- // Opera returns 0 when status is 304
- return xhr.status === 304 || xhr.status === 0;
- },
+ var script,
+ head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement;
- httpData: function( xhr, type, s ) {
- var ct = xhr.getResponseHeader("content-type") || "",
- xml = type === "xml" || !type && ct.indexOf("xml") >= 0,
- data = xml ? xhr.responseXML : xhr.responseText;
+ return {
- if ( xml && data.documentElement.nodeName === "parsererror" ) {
- jQuery.error( "parsererror" );
- }
+ send: function( _, callback ) {
- // Allow a pre-filtering function to sanitize the response
- // s is checked to keep backwards compatibility
- if ( s && s.dataFilter ) {
- data = s.dataFilter( data, type );
- }
+ script = document.createElement( "script" );
- // The filter can actually parse the response
- if ( typeof data === "string" ) {
- // Get the JavaScript object, if JSON is used.
- if ( type === "json" || !type && ct.indexOf("json") >= 0 ) {
- data = jQuery.parseJSON( data );
+ script.async = "async";
- // If the type is "script", eval it in global context
- } else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) {
- jQuery.globalEval( data );
- }
- }
+ if ( s.scriptCharset ) {
+ script.charset = s.scriptCharset;
+ }
- return data;
- },
+ script.src = s.url;
- // Serialize an array of form elements or a set of
- // key/values into a query string
- param: function( a, traditional ) {
- var s = [];
-
- // Set traditional to true for jQuery <= 1.3.2 behavior.
- if ( traditional === undefined ) {
- traditional = jQuery.ajaxSettings.traditional;
- }
-
- // If an array was passed in, assume that it is an array of form elements.
- if ( jQuery.isArray(a) || a.jquery ) {
- // Serialize the form elements
- jQuery.each( a, function() {
- add( this.name, this.value );
- });
-
- } else {
- // If traditional, encode the "old" way (the way 1.3.2 or older
- // did it), otherwise encode params recursively.
- for ( var prefix in a ) {
- buildParams( prefix, a[prefix] );
+ // Attach handlers for all browsers
+ script.onload = script.onreadystatechange = function( _, isAbort ) {
+
+ if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) {
+
+ // Handle memory leak in IE
+ script.onload = script.onreadystatechange = null;
+
+ // Remove the script
+ if ( head && script.parentNode ) {
+ head.removeChild( script );
+ }
+
+ // Dereference the script
+ script = undefined;
+
+ // Callback if not abort
+ if ( !isAbort ) {
+ callback( 200, "success" );
+ }
+ }
+ };
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // This arises when a base node is used (#2709 and #4378).
+ head.insertBefore( script, head.firstChild );
+ },
+
+ abort: function() {
+ if ( script ) {
+ script.onload( 0, 1 );
+ }
}
+ };
+ }
+});
+
+
+
+
+var // #5280: Internet Explorer will keep connections alive if we don't abort on unload
+ xhrOnUnloadAbort = window.ActiveXObject ? function() {
+ // Abort all pending requests
+ for ( var key in xhrCallbacks ) {
+ xhrCallbacks[ key ]( 0, 1 );
}
+ } : false,
+ xhrId = 0,
+ xhrCallbacks;
- // Return the resulting serialization
- return s.join("&").replace(r20, "+");
-
- function buildParams( prefix, obj ) {
- if ( jQuery.isArray(obj) ) {
- // Serialize array item.
- jQuery.each( obj, function( i, v ) {
- if ( traditional || /\[\]$/.test( prefix ) ) {
- // Treat each array item as a scalar.
- add( prefix, v );
+// Functions to create xhrs
+function createStandardXHR() {
+ try {
+ return new window.XMLHttpRequest();
+ } catch( e ) {}
+}
+
+function createActiveXHR() {
+ try {
+ return new window.ActiveXObject( "Microsoft.XMLHTTP" );
+ } catch( e ) {}
+}
+
+// Create the request object
+// (This is still attached to ajaxSettings for backward compatibility)
+jQuery.ajaxSettings.xhr = window.ActiveXObject ?
+ /* Microsoft failed to properly
+ * implement the XMLHttpRequest in IE7 (can't request local files),
+ * so we use the ActiveXObject when it is available
+ * Additionally XMLHttpRequest can be disabled in IE7/IE8 so
+ * we need a fallback.
+ */
+ function() {
+ return !this.isLocal && createStandardXHR() || createActiveXHR();
+ } :
+ // For all other browsers, use the standard XMLHttpRequest object
+ createStandardXHR;
+
+// Determine support properties
+(function( xhr ) {
+ jQuery.extend( jQuery.support, {
+ ajax: !!xhr,
+ cors: !!xhr && ( "withCredentials" in xhr )
+ });
+})( jQuery.ajaxSettings.xhr() );
+
+// Create transport if the browser can provide an xhr
+if ( jQuery.support.ajax ) {
+
+ jQuery.ajaxTransport(function( s ) {
+ // Cross domain only allowed if supported through XMLHttpRequest
+ if ( !s.crossDomain || jQuery.support.cors ) {
+
+ var callback;
+
+ return {
+ send: function( headers, complete ) {
+
+ // Get a new xhr
+ var xhr = s.xhr(),
+ handle,
+ i;
+
+ // Open the socket
+ // Passing null username, generates a login popup on Opera (#2865)
+ if ( s.username ) {
+ xhr.open( s.type, s.url, s.async, s.username, s.password );
} else {
- // If array item is non-scalar (array or object), encode its
- // numeric index to resolve deserialization ambiguity issues.
- // Note that rack (as of 1.0.0) can't currently deserialize
- // nested arrays properly, and attempting to do so may cause
- // a server error. Possible fixes are to modify rack's
- // deserialization algorithm or to provide an option or flag
- // to force array serialization to be shallow.
- buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v );
+ xhr.open( s.type, s.url, s.async );
}
- });
-
- } else if ( !traditional && obj != null && typeof obj === "object" ) {
- // Serialize object item.
- jQuery.each( obj, function( k, v ) {
- buildParams( prefix + "[" + k + "]", v );
- });
-
- } else {
- // Serialize scalar item.
- add( prefix, obj );
- }
- }
- function add( key, value ) {
- // If value is a function, invoke it and return its value
- value = jQuery.isFunction(value) ? value() : value;
- s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
+ // Apply custom fields if provided
+ if ( s.xhrFields ) {
+ for ( i in s.xhrFields ) {
+ xhr[ i ] = s.xhrFields[ i ];
+ }
+ }
+
+ // Override mime type if needed
+ if ( s.mimeType && xhr.overrideMimeType ) {
+ xhr.overrideMimeType( s.mimeType );
+ }
+
+ // X-Requested-With header
+ // For cross-domain requests, seeing as conditions for a preflight are
+ // akin to a jigsaw puzzle, we simply never set it to be sure.
+ // (it can always be set on a per-request basis or even using ajaxSetup)
+ // For same-domain requests, won't change header if already provided.
+ if ( !s.crossDomain && !headers["X-Requested-With"] ) {
+ headers[ "X-Requested-With" ] = "XMLHttpRequest";
+ }
+
+ // Need an extra try/catch for cross domain requests in Firefox 3
+ try {
+ for ( i in headers ) {
+ xhr.setRequestHeader( i, headers[ i ] );
+ }
+ } catch( _ ) {}
+
+ // Do send the request
+ // This may raise an exception which is actually
+ // handled in jQuery.ajax (so no try/catch here)
+ xhr.send( ( s.hasContent && s.data ) || null );
+
+ // Listener
+ callback = function( _, isAbort ) {
+
+ var status,
+ statusText,
+ responseHeaders,
+ responses,
+ xml;
+
+ // Firefox throws exceptions when accessing properties
+ // of an xhr when a network error occured
+ // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE)
+ try {
+
+ // Was never called and is aborted or complete
+ if ( callback && ( isAbort || xhr.readyState === 4 ) ) {
+
+ // Only called once
+ callback = undefined;
+
+ // Do not keep as active anymore
+ if ( handle ) {
+ xhr.onreadystatechange = jQuery.noop;
+ if ( xhrOnUnloadAbort ) {
+ delete xhrCallbacks[ handle ];
+ }
+ }
+
+ // If it's an abort
+ if ( isAbort ) {
+ // Abort it manually if needed
+ if ( xhr.readyState !== 4 ) {
+ xhr.abort();
+ }
+ } else {
+ status = xhr.status;
+ responseHeaders = xhr.getAllResponseHeaders();
+ responses = {};
+ xml = xhr.responseXML;
+
+ // Construct response list
+ if ( xml && xml.documentElement /* #4958 */ ) {
+ responses.xml = xml;
+ }
+ responses.text = xhr.responseText;
+
+ // Firefox throws an exception when accessing
+ // statusText for faulty cross-domain requests
+ try {
+ statusText = xhr.statusText;
+ } catch( e ) {
+ // We normalize with Webkit giving an empty statusText
+ statusText = "";
+ }
+
+ // Filter status for non standard behaviors
+
+ // If the request is local and we have data: assume a success
+ // (success with no data won't get notified, that's the best we
+ // can do given current implementations)
+ if ( !status && s.isLocal && !s.crossDomain ) {
+ status = responses.text ? 200 : 404;
+ // IE - #1450: sometimes returns 1223 when it should be 204
+ } else if ( status === 1223 ) {
+ status = 204;
+ }
+ }
+ }
+ } catch( firefoxAccessException ) {
+ if ( !isAbort ) {
+ complete( -1, firefoxAccessException );
+ }
+ }
+
+ // Call complete if needed
+ if ( responses ) {
+ complete( status, statusText, responses, responseHeaders );
+ }
+ };
+
+ // if we're in sync mode or it's in cache
+ // and has been retrieved directly (IE6 & IE7)
+ // we need to manually fire the callback
+ if ( !s.async || xhr.readyState === 4 ) {
+ callback();
+ } else {
+ handle = ++xhrId;
+ if ( xhrOnUnloadAbort ) {
+ // Create the active xhrs callbacks list if needed
+ // and attach the unload handler
+ if ( !xhrCallbacks ) {
+ xhrCallbacks = {};
+ jQuery( window ).unload( xhrOnUnloadAbort );
+ }
+ // Add to list of active xhrs callbacks
+ xhrCallbacks[ handle ] = callback;
+ }
+ xhr.onreadystatechange = callback;
+ }
+ },
+
+ abort: function() {
+ if ( callback ) {
+ callback(0,1);
+ }
+ }
+ };
}
- }
-});
+ });
+}
+
+
+
+
var elemdisplay = {},
- rfxtypes = /toggle|show|hide/,
- rfxnum = /^([+-]=)?([\d+-.]+)(.*)$/,
+ iframe, iframeDoc,
+ rfxtypes = /^(?:toggle|show|hide)$/,
+ rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,
timerId,
fxAttrs = [
// height animations
@@ -5450,69 +7954,80 @@ var elemdisplay = {},
[ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
// opacity animations
[ "opacity" ]
- ];
+ ],
+ fxNow,
+ requestAnimationFrame = window.webkitRequestAnimationFrame ||
+ window.mozRequestAnimationFrame ||
+ window.oRequestAnimationFrame;
jQuery.fn.extend({
- show: function( speed, callback ) {
- if ( speed || speed === 0) {
- return this.animate( genFx("show", 3), speed, callback);
-
- } else {
- for ( var i = 0, l = this.length; i < l; i++ ) {
- var old = jQuery.data(this[i], "olddisplay");
+ show: function( speed, easing, callback ) {
+ var elem, display;
- this[i].style.display = old || "";
-
- if ( jQuery.css(this[i], "display") === "none" ) {
- var nodeName = this[i].nodeName, display;
-
- if ( elemdisplay[ nodeName ] ) {
- display = elemdisplay[ nodeName ];
-
- } else {
- var elem = jQuery("<" + nodeName + " />").appendTo("body");
-
- display = elem.css("display");
+ if ( speed || speed === 0 ) {
+ return this.animate( genFx("show", 3), speed, easing, callback);
- if ( display === "none" ) {
- display = "block";
- }
+ } else {
+ for ( var i = 0, j = this.length; i < j; i++ ) {
+ elem = this[i];
- elem.remove();
+ if ( elem.style ) {
+ display = elem.style.display;
- elemdisplay[ nodeName ] = display;
+ // Reset the inline display of this element to learn if it is
+ // being hidden by cascaded rules or not
+ if ( !jQuery._data(elem, "olddisplay") && display === "none" ) {
+ display = elem.style.display = "";
}
- jQuery.data(this[i], "olddisplay", display);
+ // Set elements which have been overridden with display: none
+ // in a stylesheet to whatever the default browser style is
+ // for such an element
+ if ( display === "" && jQuery.css( elem, "display" ) === "none" ) {
+ jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName));
+ }
}
}
- // Set the display of the elements in a second loop
+ // Set the display of most of the elements in a second loop
// to avoid the constant reflow
- for ( var j = 0, k = this.length; j < k; j++ ) {
- this[j].style.display = jQuery.data(this[j], "olddisplay") || "";
+ for ( i = 0; i < j; i++ ) {
+ elem = this[i];
+
+ if ( elem.style ) {
+ display = elem.style.display;
+
+ if ( display === "" || display === "none" ) {
+ elem.style.display = jQuery._data(elem, "olddisplay") || "";
+ }
+ }
}
return this;
}
},
- hide: function( speed, callback ) {
+ hide: function( speed, easing, callback ) {
if ( speed || speed === 0 ) {
- return this.animate( genFx("hide", 3), speed, callback);
+ return this.animate( genFx("hide", 3), speed, easing, callback);
} else {
- for ( var i = 0, l = this.length; i < l; i++ ) {
- var old = jQuery.data(this[i], "olddisplay");
- if ( !old && old !== "none" ) {
- jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display"));
+ for ( var i = 0, j = this.length; i < j; i++ ) {
+ if ( this[i].style ) {
+ var display = jQuery.css( this[i], "display" );
+
+ if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) {
+ jQuery._data( this[i], "olddisplay", display );
+ }
}
}
// Set the display of the elements in a second loop
// to avoid the constant reflow
- for ( var j = 0, k = this.length; j < k; j++ ) {
- this[j].style.display = "none";
+ for ( i = 0; i < j; i++ ) {
+ if ( this[i].style ) {
+ this[i].style.display = "none";
+ }
}
return this;
@@ -5522,7 +8037,7 @@ jQuery.fn.extend({
// Save the old toggle function
_toggle: jQuery.fn.toggle,
- toggle: function( fn, fn2 ) {
+ toggle: function( fn, fn2, callback ) {
var bool = typeof fn === "boolean";
if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
@@ -5535,54 +8050,97 @@ jQuery.fn.extend({
});
} else {
- this.animate(genFx("toggle", 3), fn, fn2);
+ this.animate(genFx("toggle", 3), fn, fn2, callback);
}
return this;
},
- fadeTo: function( speed, to, callback ) {
+ fadeTo: function( speed, to, easing, callback ) {
return this.filter(":hidden").css("opacity", 0).show().end()
- .animate({opacity: to}, speed, callback);
+ .animate({opacity: to}, speed, easing, callback);
},
animate: function( prop, speed, easing, callback ) {
var optall = jQuery.speed(speed, easing, callback);
if ( jQuery.isEmptyObject( prop ) ) {
- return this.each( optall.complete );
+ return this.each( optall.complete, [ false ] );
}
+ // Do not change referenced properties as per-property easing will be lost
+ prop = jQuery.extend( {}, prop );
+
return this[ optall.queue === false ? "each" : "queue" ](function() {
- var opt = jQuery.extend({}, optall), p,
- hidden = this.nodeType === 1 && jQuery(this).is(":hidden"),
- self = this;
+ // XXX 'this' does not always have a nodeName when running the
+ // test suite
+
+ if ( optall.queue === false ) {
+ jQuery._mark( this );
+ }
+
+ var opt = jQuery.extend( {}, optall ),
+ isElement = this.nodeType === 1,
+ hidden = isElement && jQuery(this).is(":hidden"),
+ name, val, p,
+ display, e,
+ parts, start, end, unit;
+
+ // will store per property easing and be used to determine when an animation is complete
+ opt.animatedProperties = {};
for ( p in prop ) {
- var name = p.replace(rdashAlpha, fcamelCase);
+ // property name normalization
+ name = jQuery.camelCase( p );
if ( p !== name ) {
prop[ name ] = prop[ p ];
delete prop[ p ];
- p = name;
}
- if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) {
- return opt.complete.call(this);
+ val = prop[ name ];
+
+ // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default)
+ if ( jQuery.isArray( val ) ) {
+ opt.animatedProperties[ name ] = val[ 1 ];
+ val = prop[ name ] = val[ 0 ];
+ } else {
+ opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing';
}
- if ( ( p === "height" || p === "width" ) && this.style ) {
- // Store display property
- opt.display = jQuery.css(this, "display");
+ if ( val === "hide" && hidden || val === "show" && !hidden ) {
+ return opt.complete.call( this );
+ }
+ if ( isElement && ( name === "height" || name === "width" ) ) {
// Make sure that nothing sneaks out
- opt.overflow = this.style.overflow;
- }
+ // Record all 3 overflow attributes because IE does not
+ // change the overflow attribute when overflowX and
+ // overflowY are set to the same value
+ opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ];
+
+ // Set display property to inline-block for height/width
+ // animations on inline elements that are having width/height
+ // animated
+ if ( jQuery.css( this, "display" ) === "inline" &&
+ jQuery.css( this, "float" ) === "none" ) {
+ if ( !jQuery.support.inlineBlockNeedsLayout ) {
+ this.style.display = "inline-block";
+
+ } else {
+ display = defaultDisplay( this.nodeName );
- if ( jQuery.isArray( prop[p] ) ) {
- // Create (if needed) and add to specialEasing
- (opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1];
- prop[p] = prop[p][0];
+ // inline-level elements accept inline-block;
+ // block-level elements need to be inline with layout
+ if ( display === "inline" ) {
+ this.style.display = "inline-block";
+
+ } else {
+ this.style.display = "inline";
+ this.style.zoom = 1;
+ }
+ }
+ }
}
}
@@ -5590,32 +8148,31 @@ jQuery.fn.extend({
this.style.overflow = "hidden";
}
- opt.curAnim = jQuery.extend({}, prop);
-
- jQuery.each( prop, function( name, val ) {
- var e = new jQuery.fx( self, opt, name );
+ for ( p in prop ) {
+ e = new jQuery.fx( this, opt, p );
+ val = prop[ p ];
if ( rfxtypes.test(val) ) {
- e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+ e[ val === "toggle" ? hidden ? "show" : "hide" : val ]();
} else {
- var parts = rfxnum.exec(val),
- start = e.cur(true) || 0;
+ parts = rfxnum.exec( val );
+ start = e.cur();
if ( parts ) {
- var end = parseFloat( parts[2] ),
- unit = parts[3] || "px";
+ end = parseFloat( parts[2] );
+ unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" );
// We need to compute starting value
if ( unit !== "px" ) {
- self.style[ name ] = (end || 1) + unit;
- start = ((end || 1) / e.cur(true)) * start;
- self.style[ name ] = start + unit;
+ jQuery.style( this, p, (end || 1) + unit);
+ start = ((end || 1) / e.cur()) * start;
+ jQuery.style( this, p, start + unit);
}
// If a +=/-= token was provided, we're doing a relative animation
if ( parts[1] ) {
- end = ((parts[1] === "-=" ? -1 : 1) * end) + start;
+ end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start;
}
e.custom( start, end, unit );
@@ -5624,7 +8181,7 @@ jQuery.fn.extend({
e.custom( start, val, "" );
}
}
- });
+ }
// For JS strict compliance
return true;
@@ -5632,15 +8189,18 @@ jQuery.fn.extend({
},
stop: function( clearQueue, gotoEnd ) {
- var timers = jQuery.timers;
-
if ( clearQueue ) {
this.queue([]);
}
this.each(function() {
- // go in reverse order so anything added to the queue during the loop is ignored
- for ( var i = timers.length - 1; i >= 0; i-- ) {
+ var timers = jQuery.timers,
+ i = timers.length;
+ // clear marker counters if we know they won't be
+ if ( !gotoEnd ) {
+ jQuery._unmark( true, this );
+ }
+ while ( i-- ) {
if ( timers[i].elem === this ) {
if (gotoEnd) {
// force the next step to be the last
@@ -5662,22 +8222,44 @@ jQuery.fn.extend({
});
+// Animations created synchronously will run synchronously
+function createFxNow() {
+ setTimeout( clearFxNow, 0 );
+ return ( fxNow = jQuery.now() );
+}
+
+function clearFxNow() {
+ fxNow = undefined;
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, num ) {
+ var obj = {};
+
+ jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
+ obj[ this ] = type;
+ });
+
+ return obj;
+}
+
// Generate shortcuts for custom animations
jQuery.each({
slideDown: genFx("show", 1),
slideUp: genFx("hide", 1),
slideToggle: genFx("toggle", 1),
fadeIn: { opacity: "show" },
- fadeOut: { opacity: "hide" }
+ fadeOut: { opacity: "hide" },
+ fadeToggle: { opacity: "toggle" }
}, function( name, props ) {
- jQuery.fn[ name ] = function( speed, callback ) {
- return this.animate( props, speed, callback );
+ jQuery.fn[ name ] = function( speed, easing, callback ) {
+ return this.animate( props, speed, easing, callback );
};
});
jQuery.extend({
speed: function( speed, easing, fn ) {
- var opt = speed && typeof speed === "object" ? speed : {
+ var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : {
complete: fn || !fn && easing ||
jQuery.isFunction( speed ) && speed,
duration: speed,
@@ -5685,14 +8267,17 @@ jQuery.extend({
};
opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
- jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default;
+ opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default;
// Queueing
opt.old = opt.complete;
- opt.complete = function() {
+ opt.complete = function( noUnmark ) {
if ( opt.queue !== false ) {
- jQuery(this).dequeue();
+ jQuery.dequeue( this );
+ } else if ( noUnmark !== false ) {
+ jQuery._unmark( this );
}
+
if ( jQuery.isFunction( opt.old ) ) {
opt.old.call( this );
}
@@ -5717,9 +8302,7 @@ jQuery.extend({
this.elem = elem;
this.prop = prop;
- if ( !options.orig ) {
- options.orig = {};
- }
+ options.orig = options.orig || {};
}
});
@@ -5732,33 +8315,35 @@ jQuery.fx.prototype = {
}
(jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
-
- // Set display property to block for height/width animations
- if ( ( this.prop === "height" || this.prop === "width" ) && this.elem.style ) {
- this.elem.style.display = "block";
- }
},
// Get the current size
- cur: function( force ) {
+ cur: function() {
if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) {
return this.elem[ this.prop ];
}
- var r = parseFloat(jQuery.css(this.elem, this.prop, force));
- return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0;
+ var parsed,
+ r = jQuery.css( this.elem, this.prop );
+ // Empty strings, null, undefined and "auto" are converted to 0,
+ // complex values such as "rotate(1rad)" are returned as is,
+ // simple values such as "10px" are parsed to Float.
+ return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed;
},
// Start an animation from one number to another
custom: function( from, to, unit ) {
- this.startTime = now();
+ var self = this,
+ fx = jQuery.fx,
+ raf;
+
+ this.startTime = fxNow || createFxNow();
this.start = from;
this.end = to;
- this.unit = unit || this.unit || "px";
+ this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" );
this.now = this.start;
this.pos = this.state = 0;
- var self = this;
function t( gotoEnd ) {
return self.step(gotoEnd);
}
@@ -5766,7 +8351,20 @@ jQuery.fx.prototype = {
t.elem = this.elem;
if ( t() && jQuery.timers.push(t) && !timerId ) {
- timerId = setInterval(jQuery.fx.tick, 13);
+ // Use requestAnimationFrame instead of setInterval if available
+ if ( requestAnimationFrame ) {
+ timerId = 1;
+ raf = function() {
+ // When timerId gets set to null at any point, this stops
+ if ( timerId ) {
+ requestAnimationFrame( raf );
+ fx.tick();
+ }
+ };
+ requestAnimationFrame( raf );
+ } else {
+ timerId = setInterval( fx.tick, fx.interval );
+ }
}
},
@@ -5797,63 +8395,64 @@ jQuery.fx.prototype = {
// Each step of an animation
step: function( gotoEnd ) {
- var t = now(), done = true;
+ var t = fxNow || createFxNow(),
+ done = true,
+ elem = this.elem,
+ options = this.options,
+ i, n;
- if ( gotoEnd || t >= this.options.duration + this.startTime ) {
+ if ( gotoEnd || t >= options.duration + this.startTime ) {
this.now = this.end;
this.pos = this.state = 1;
this.update();
- this.options.curAnim[ this.prop ] = true;
+ options.animatedProperties[ this.prop ] = true;
- for ( var i in this.options.curAnim ) {
- if ( this.options.curAnim[i] !== true ) {
+ for ( i in options.animatedProperties ) {
+ if ( options.animatedProperties[i] !== true ) {
done = false;
}
}
if ( done ) {
- if ( this.options.display != null ) {
- // Reset the overflow
- this.elem.style.overflow = this.options.overflow;
-
- // Reset the display
- var old = jQuery.data(this.elem, "olddisplay");
- this.elem.style.display = old ? old : this.options.display;
+ // Reset the overflow
+ if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) {
- if ( jQuery.css(this.elem, "display") === "none" ) {
- this.elem.style.display = "block";
- }
+ jQuery.each( [ "", "X", "Y" ], function (index, value) {
+ elem.style[ "overflow" + value ] = options.overflow[index];
+ });
}
// Hide the element if the "hide" operation was done
- if ( this.options.hide ) {
- jQuery(this.elem).hide();
+ if ( options.hide ) {
+ jQuery(elem).hide();
}
// Reset the properties, if the item has been hidden or shown
- if ( this.options.hide || this.options.show ) {
- for ( var p in this.options.curAnim ) {
- jQuery.style(this.elem, p, this.options.orig[p]);
+ if ( options.hide || options.show ) {
+ for ( var p in options.animatedProperties ) {
+ jQuery.style( elem, p, options.orig[p] );
}
}
// Execute the complete function
- this.options.complete.call( this.elem );
+ options.complete.call( elem );
}
return false;
} else {
- var n = t - this.startTime;
- this.state = n / this.options.duration;
-
- // Perform the easing function, defaults to swing
- var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop];
- var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear");
- this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration);
- this.now = this.start + ((this.end - this.start) * this.pos);
+ // classical easing cannot be used with an Infinity duration
+ if ( options.duration == Infinity ) {
+ this.now = t;
+ } else {
+ n = t - this.startTime;
+ this.state = n / options.duration;
+ // Perform the easing function, defaults to swing
+ this.pos = jQuery.easing[ options.animatedProperties[ this.prop ] ]( this.state, n, 0, 1, options.duration );
+ this.now = this.start + ((this.end - this.start) * this.pos);
+ }
// Perform the next step of the animation
this.update();
}
@@ -5864,9 +8463,7 @@ jQuery.fx.prototype = {
jQuery.extend( jQuery.fx, {
tick: function() {
- var timers = jQuery.timers;
-
- for ( var i = 0; i < timers.length; i++ ) {
+ for ( var timers = jQuery.timers, i = 0 ; i < timers.length ; ++i ) {
if ( !timers[i]() ) {
timers.splice(i--, 1);
}
@@ -5876,22 +8473,24 @@ jQuery.extend( jQuery.fx, {
jQuery.fx.stop();
}
},
-
+
+ interval: 13,
+
stop: function() {
clearInterval( timerId );
timerId = null;
},
-
+
speeds: {
slow: 600,
- fast: 200,
- // Default speed
- _default: 400
+ fast: 200,
+ // Default speed
+ _default: 400
},
step: {
opacity: function( fx ) {
- jQuery.style(fx.elem, "opacity", fx.now);
+ jQuery.style( fx.elem, "opacity", fx.now );
},
_default: function( fx ) {
@@ -5912,20 +8511,62 @@ if ( jQuery.expr && jQuery.expr.filters ) {
};
}
-function genFx( type, num ) {
- var obj = {};
+// Try to restore the default display value of an element
+function defaultDisplay( nodeName ) {
- jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
- obj[ this ] = type;
- });
+ if ( !elemdisplay[ nodeName ] ) {
- return obj;
+ var elem = jQuery( "<" + nodeName + ">" ).appendTo( "body" ),
+ display = elem.css( "display" );
+
+ elem.remove();
+
+ // If the simple way fails,
+ // get element's real default display by attaching it to a temp iframe
+ if ( display === "none" || display === "" ) {
+ // No iframe to use yet, so create it
+ if ( !iframe ) {
+ iframe = document.createElement( "iframe" );
+ iframe.frameBorder = iframe.width = iframe.height = 0;
+ }
+
+ document.body.appendChild( iframe );
+
+ // Create a cacheable copy of the iframe document on first call.
+ // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake html
+ // document to it, Webkit & Firefox won't allow reusing the iframe document
+ if ( !iframeDoc || !iframe.createElement ) {
+ iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document;
+ iframeDoc.write( "<!doctype><html><body></body></html>" );
+ }
+
+ elem = iframeDoc.createElement( nodeName );
+
+ iframeDoc.body.appendChild( elem );
+
+ display = jQuery.css( elem, "display" );
+
+ document.body.removeChild( iframe );
+ }
+
+ // Store the correct default display
+ elemdisplay[ nodeName ] = display;
+ }
+
+ return elemdisplay[ nodeName ];
}
+
+
+
+
+var rtable = /^t(?:able|d|h)$/i,
+ rroot = /^(?:body|html)$/i;
+
if ( "getBoundingClientRect" in document.documentElement ) {
jQuery.fn.offset = function( options ) {
- var elem = this[0];
+ var elem = this[0], box;
- if ( options ) {
+ if ( options ) {
return this.each(function( i ) {
jQuery.offset.setOffset( this, options, i );
});
@@ -5939,10 +8580,26 @@ if ( "getBoundingClientRect" in document.documentElement ) {
return jQuery.offset.bodyOffset( elem );
}
- var box = elem.getBoundingClientRect(), doc = elem.ownerDocument, body = doc.body, docElem = doc.documentElement,
- clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0,
- top = box.top + (self.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop,
- left = box.left + (self.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft;
+ try {
+ box = elem.getBoundingClientRect();
+ } catch(e) {}
+
+ var doc = elem.ownerDocument,
+ docElem = doc.documentElement;
+
+ // Make sure we're not dealing with a disconnected DOM node
+ if ( !box || !jQuery.contains( docElem, elem ) ) {
+ return box ? { top: box.top, left: box.left } : { top: 0, left: 0 };
+ }
+
+ var body = doc.body,
+ win = getWindow(doc),
+ clientTop = docElem.clientTop || body.clientTop || 0,
+ clientLeft = docElem.clientLeft || body.clientLeft || 0,
+ scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop,
+ scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft,
+ top = box.top + scrollTop - clientTop,
+ left = box.left + scrollLeft - clientLeft;
return { top: top, left: left };
};
@@ -5951,7 +8608,7 @@ if ( "getBoundingClientRect" in document.documentElement ) {
jQuery.fn.offset = function( options ) {
var elem = this[0];
- if ( options ) {
+ if ( options ) {
return this.each(function( i ) {
jQuery.offset.setOffset( this, options, i );
});
@@ -5967,11 +8624,16 @@ if ( "getBoundingClientRect" in document.documentElement ) {
jQuery.offset.initialize();
- var offsetParent = elem.offsetParent, prevOffsetParent = elem,
- doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement,
- body = doc.body, defaultView = doc.defaultView,
+ var computedStyle,
+ offsetParent = elem.offsetParent,
+ prevOffsetParent = elem,
+ doc = elem.ownerDocument,
+ docElem = doc.documentElement,
+ body = doc.body,
+ defaultView = doc.defaultView,
prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
- top = elem.offsetTop, left = elem.offsetLeft;
+ top = elem.offsetTop,
+ left = elem.offsetLeft;
while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
@@ -5986,12 +8648,13 @@ if ( "getBoundingClientRect" in document.documentElement ) {
top += elem.offsetTop;
left += elem.offsetLeft;
- if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.nodeName)) ) {
+ if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) {
top += parseFloat( computedStyle.borderTopWidth ) || 0;
left += parseFloat( computedStyle.borderLeftWidth ) || 0;
}
- prevOffsetParent = offsetParent, offsetParent = elem.offsetParent;
+ prevOffsetParent = offsetParent;
+ offsetParent = elem.offsetParent;
}
if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
@@ -6018,7 +8681,7 @@ if ( "getBoundingClientRect" in document.documentElement ) {
jQuery.offset = {
initialize: function() {
- var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.curCSS(body, "marginTop", true) ) || 0,
+ var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0,
html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
@@ -6032,53 +8695,74 @@ jQuery.offset = {
this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
- checkDiv.style.position = "fixed", checkDiv.style.top = "20px";
+ checkDiv.style.position = "fixed";
+ checkDiv.style.top = "20px";
+
// safari subtracts parent border width here which is 5px
this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15);
checkDiv.style.position = checkDiv.style.top = "";
- innerDiv.style.overflow = "hidden", innerDiv.style.position = "relative";
+ innerDiv.style.overflow = "hidden";
+ innerDiv.style.position = "relative";
+
this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
body.removeChild( container );
- body = container = innerDiv = checkDiv = table = td = null;
jQuery.offset.initialize = jQuery.noop;
},
bodyOffset: function( body ) {
- var top = body.offsetTop, left = body.offsetLeft;
+ var top = body.offsetTop,
+ left = body.offsetLeft;
jQuery.offset.initialize();
if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
- top += parseFloat( jQuery.curCSS(body, "marginTop", true) ) || 0;
- left += parseFloat( jQuery.curCSS(body, "marginLeft", true) ) || 0;
+ top += parseFloat( jQuery.css(body, "marginTop") ) || 0;
+ left += parseFloat( jQuery.css(body, "marginLeft") ) || 0;
}
return { top: top, left: left };
},
-
+
setOffset: function( elem, options, i ) {
+ var position = jQuery.css( elem, "position" );
+
// set position first, in-case top/left are set even on static elem
- if ( /static/.test( jQuery.curCSS( elem, "position" ) ) ) {
+ if ( position === "static" ) {
elem.style.position = "relative";
}
- var curElem = jQuery( elem ),
+
+ var curElem = jQuery( elem ),
curOffset = curElem.offset(),
- curTop = parseInt( jQuery.curCSS( elem, "top", true ), 10 ) || 0,
- curLeft = parseInt( jQuery.curCSS( elem, "left", true ), 10 ) || 0;
+ curCSSTop = jQuery.css( elem, "top" ),
+ curCSSLeft = jQuery.css( elem, "left" ),
+ calculatePosition = (position === "absolute" || position === "fixed") && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1,
+ props = {}, curPosition = {}, curTop, curLeft;
+
+ // need to be able to calculate position if either top or left is auto and position is either absolute or fixed
+ if ( calculatePosition ) {
+ curPosition = curElem.position();
+ curTop = curPosition.top;
+ curLeft = curPosition.left;
+ } else {
+ curTop = parseFloat( curCSSTop ) || 0;
+ curLeft = parseFloat( curCSSLeft ) || 0;
+ }
if ( jQuery.isFunction( options ) ) {
options = options.call( elem, i, curOffset );
}
- var props = {
- top: (options.top - curOffset.top) + curTop,
- left: (options.left - curOffset.left) + curLeft
- };
-
+ if (options.top != null) {
+ props.top = (options.top - curOffset.top) + curTop;
+ }
+ if (options.left != null) {
+ props.left = (options.left - curOffset.left) + curLeft;
+ }
+
if ( "using" in options ) {
options.using.call( elem, props );
} else {
@@ -6101,17 +8785,17 @@ jQuery.fn.extend({
// Get correct offsets
offset = this.offset(),
- parentOffset = /^body|html$/i.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+ parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
// Subtract element margins
// note: when an element has margin: auto the offsetLeft and marginLeft
// are the same in Safari causing offset.left to incorrectly be 0
- offset.top -= parseFloat( jQuery.curCSS(elem, "marginTop", true) ) || 0;
- offset.left -= parseFloat( jQuery.curCSS(elem, "marginLeft", true) ) || 0;
+ offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0;
+ offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0;
// Add offsetParent borders
- parentOffset.top += parseFloat( jQuery.curCSS(offsetParent[0], "borderTopWidth", true) ) || 0;
- parentOffset.left += parseFloat( jQuery.curCSS(offsetParent[0], "borderLeftWidth", true) ) || 0;
+ parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0;
+ parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0;
// Subtract the two offsets
return {
@@ -6123,7 +8807,7 @@ jQuery.fn.extend({
offsetParent: function() {
return this.map(function() {
var offsetParent = this.offsetParent || document.body;
- while ( offsetParent && (!/^body|html$/i.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+ while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
offsetParent = offsetParent.offsetParent;
}
return offsetParent;
@@ -6136,29 +8820,16 @@ jQuery.fn.extend({
jQuery.each( ["Left", "Top"], function( i, name ) {
var method = "scroll" + name;
- jQuery.fn[ method ] = function(val) {
- var elem = this[0], win;
-
- if ( !elem ) {
- return null;
- }
+ jQuery.fn[ method ] = function( val ) {
+ var elem, win;
- if ( val !== undefined ) {
- // Set the scroll offset
- return this.each(function() {
- win = getWindow( this );
+ if ( val === undefined ) {
+ elem = this[ 0 ];
- if ( win ) {
- win.scrollTo(
- !i ? val : jQuery(win).scrollLeft(),
- i ? val : jQuery(win).scrollTop()
- );
+ if ( !elem ) {
+ return null;
+ }
- } else {
- this[ method ] = val;
- }
- });
- } else {
win = getWindow( elem );
// Return the scroll offset
@@ -6167,16 +8838,35 @@ jQuery.each( ["Left", "Top"], function( i, name ) {
win.document.body[ method ] :
elem[ method ];
}
+
+ // Set the scroll offset
+ return this.each(function() {
+ win = getWindow( this );
+
+ if ( win ) {
+ win.scrollTo(
+ !i ? val : jQuery( win ).scrollLeft(),
+ i ? val : jQuery( win ).scrollTop()
+ );
+
+ } else {
+ this[ method ] = val;
+ }
+ });
};
});
function getWindow( elem ) {
- return ("scrollTo" in elem && elem.document) ?
+ return jQuery.isWindow( elem ) ?
elem :
elem.nodeType === 9 ?
elem.defaultView || elem.parentWindow :
false;
}
+
+
+
+
// Create innerHeight, innerWidth, outerHeight and outerWidth methods
jQuery.each([ "Height", "Width" ], function( i, name ) {
@@ -6185,14 +8875,14 @@ jQuery.each([ "Height", "Width" ], function( i, name ) {
// innerHeight and innerWidth
jQuery.fn["inner" + name] = function() {
return this[0] ?
- jQuery.css( this[0], type, false, "padding" ) :
+ parseFloat( jQuery.css( this[0], type, "padding" ) ) :
null;
};
// outerHeight and outerWidth
jQuery.fn["outer" + name] = function( margin ) {
return this[0] ?
- jQuery.css( this[0], type, false, margin ? "margin" : "border" ) :
+ parseFloat( jQuery.css( this[0], type, margin ? "margin" : "border" ) ) :
null;
};
@@ -6202,7 +8892,7 @@ jQuery.each([ "Height", "Width" ], function( i, name ) {
if ( !elem ) {
return size == null ? null : this;
}
-
+
if ( jQuery.isFunction( size ) ) {
return this.each(function( i ) {
var self = jQuery( this );
@@ -6210,31 +8900,37 @@ jQuery.each([ "Height", "Width" ], function( i, name ) {
});
}
- return ("scrollTo" in elem && elem.document) ? // does it walk and quack like a window?
+ if ( jQuery.isWindow( elem ) ) {
// Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
- elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] ||
- elem.document.body[ "client" + name ] :
-
- // Get document width or height
- (elem.nodeType === 9) ? // is it a document
- // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
- Math.max(
- elem.documentElement["client" + name],
- elem.body["scroll" + name], elem.documentElement["scroll" + name],
- elem.body["offset" + name], elem.documentElement["offset" + name]
- ) :
-
- // Get or set width or height on the element
- size === undefined ?
- // Get width or height on the element
- jQuery.css( elem, type ) :
-
- // Set the width or height on the element (default to pixels if value is unitless)
- this.css( type, typeof size === "string" ? size : size + "px" );
+ // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat
+ var docElemProp = elem.document.documentElement[ "client" + name ];
+ return elem.document.compatMode === "CSS1Compat" && docElemProp ||
+ elem.document.body[ "client" + name ] || docElemProp;
+
+ // Get document width or height
+ } else if ( elem.nodeType === 9 ) {
+ // Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+ return Math.max(
+ elem.documentElement["client" + name],
+ elem.body["scroll" + name], elem.documentElement["scroll" + name],
+ elem.body["offset" + name], elem.documentElement["offset" + name]
+ );
+
+ // Get or set width or height on the element
+ } else if ( size === undefined ) {
+ var orig = jQuery.css( elem, type ),
+ ret = parseFloat( orig );
+
+ return jQuery.isNaN( ret ) ? orig : ret;
+
+ // Set the width or height on the element (default to pixels if value is unitless)
+ } else {
+ return this.css( type, typeof size === "string" ? size : size + "px" );
+ }
};
});
-// Expose jQuery to the global object
-window.jQuery = window.$ = jQuery;
+
+window.jQuery = window.$ = jQuery;
})(window);
diff --git a/lib/scripts/jquery/jquery.min.js b/lib/scripts/jquery/jquery.min.js
index 7c2430802..b2ac1747f 100644
--- a/lib/scripts/jquery/jquery.min.js
+++ b/lib/scripts/jquery/jquery.min.js
@@ -1,154 +1,18 @@
/*!
- * jQuery JavaScript Library v1.4.2
+ * jQuery JavaScript Library v1.6.1
* http://jquery.com/
*
- * Copyright 2010, John Resig
+ * Copyright 2011, John Resig
* Dual licensed under the MIT or GPL Version 2 licenses.
* http://jquery.org/license
*
* Includes Sizzle.js
* http://sizzlejs.com/
- * Copyright 2010, The Dojo Foundation
+ * Copyright 2011, The Dojo Foundation
* Released under the MIT, BSD, and GPL Licenses.
*
- * Date: Sat Feb 13 22:33:48 2010 -0500
+ * Date: Thu May 12 15:04:36 2011 -0400
*/
-(function(A,w){function ma(){if(!c.isReady){try{s.documentElement.doScroll("left")}catch(a){setTimeout(ma,1);return}c.ready()}}function Qa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function X(a,b,d,f,e,j){var i=a.length;if(typeof b==="object"){for(var o in b)X(a,o,b[o],f,e,d);return a}if(d!==w){f=!j&&f&&c.isFunction(d);for(o=0;o<i;o++)e(a[o],b,f?d.call(a[o],o,e(a[o],b)):d,j);return a}return i?
-e(a[0],b):w}function J(){return(new Date).getTime()}function Y(){return false}function Z(){return true}function na(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function oa(a){var b,d=[],f=[],e=arguments,j,i,o,k,n,r;i=c.data(this,"events");if(!(a.liveFired===this||!i||!i.live||a.button&&a.type==="click")){a.liveFired=this;var u=i.live.slice(0);for(k=0;k<u.length;k++){i=u[k];i.origType.replace(O,"")===a.type?f.push(i.selector):u.splice(k--,1)}j=c(a.target).closest(f,a.currentTarget);n=0;for(r=
-j.length;n<r;n++)for(k=0;k<u.length;k++){i=u[k];if(j[n].selector===i.selector){o=j[n].elem;f=null;if(i.preType==="mouseenter"||i.preType==="mouseleave")f=c(a.relatedTarget).closest(i.selector)[0];if(!f||f!==o)d.push({elem:o,handleObj:i})}}n=0;for(r=d.length;n<r;n++){j=d[n];a.currentTarget=j.elem;a.data=j.handleObj.data;a.handleObj=j.handleObj;if(j.handleObj.origHandler.apply(j.elem,e)===false){b=false;break}}return b}}function pa(a,b){return"live."+(a&&a!=="*"?a+".":"")+b.replace(/\./g,"`").replace(/ /g,
-"&")}function qa(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function ra(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var f=c.data(a[d++]),e=c.data(this,f);if(f=f&&f.events){delete e.handle;e.events={};for(var j in f)for(var i in f[j])c.event.add(this,j,f[j][i],f[j][i].data)}}})}function sa(a,b,d){var f,e,j;b=b&&b[0]?b[0].ownerDocument||b[0]:s;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&b===s&&!ta.test(a[0])&&(c.support.checkClone||!ua.test(a[0]))){e=
-true;if(j=c.fragments[a[0]])if(j!==1)f=j}if(!f){f=b.createDocumentFragment();c.clean(a,b,f,d)}if(e)c.fragments[a[0]]=j?f:1;return{fragment:f,cacheable:e}}function K(a,b){var d={};c.each(va.concat.apply([],va.slice(0,b)),function(){d[this]=a});return d}function wa(a){return"scrollTo"in a&&a.document?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var c=function(a,b){return new c.fn.init(a,b)},Ra=A.jQuery,Sa=A.$,s=A.document,T,Ta=/^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,Ua=/^.[^:#\[\.,]*$/,Va=/\S/,
-Wa=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,Xa=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,P=navigator.userAgent,xa=false,Q=[],L,$=Object.prototype.toString,aa=Object.prototype.hasOwnProperty,ba=Array.prototype.push,R=Array.prototype.slice,ya=Array.prototype.indexOf;c.fn=c.prototype={init:function(a,b){var d,f;if(!a)return this;if(a.nodeType){this.context=this[0]=a;this.length=1;return this}if(a==="body"&&!b){this.context=s;this[0]=s.body;this.selector="body";this.length=1;return this}if(typeof a==="string")if((d=Ta.exec(a))&&
-(d[1]||!b))if(d[1]){f=b?b.ownerDocument||b:s;if(a=Xa.exec(a))if(c.isPlainObject(b)){a=[s.createElement(a[1])];c.fn.attr.call(a,b,true)}else a=[f.createElement(a[1])];else{a=sa([d[1]],[f]);a=(a.cacheable?a.fragment.cloneNode(true):a.fragment).childNodes}return c.merge(this,a)}else{if(b=s.getElementById(d[2])){if(b.id!==d[2])return T.find(a);this.length=1;this[0]=b}this.context=s;this.selector=a;return this}else if(!b&&/^\w+$/.test(a)){this.selector=a;this.context=s;a=s.getElementsByTagName(a);return c.merge(this,
-a)}else return!b||b.jquery?(b||T).find(a):c(b).find(a);else if(c.isFunction(a))return T.ready(a);if(a.selector!==w){this.selector=a.selector;this.context=a.context}return c.makeArray(a,this)},selector:"",jquery:"1.4.2",length:0,size:function(){return this.length},toArray:function(){return R.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this.slice(a)[0]:this[a]},pushStack:function(a,b,d){var f=c();c.isArray(a)?ba.apply(f,a):c.merge(f,a);f.prevObject=this;f.context=this.context;if(b===
-"find")f.selector=this.selector+(this.selector?" ":"")+d;else if(b)f.selector=this.selector+"."+b+"("+d+")";return f},each:function(a,b){return c.each(this,a,b)},ready:function(a){c.bindReady();if(c.isReady)a.call(s,c);else Q&&Q.push(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(R.apply(this,arguments),"slice",R.call(arguments).join(","))},map:function(a){return this.pushStack(c.map(this,
-function(b,d){return a.call(b,d,b)}))},end:function(){return this.prevObject||c(null)},push:ba,sort:[].sort,splice:[].splice};c.fn.init.prototype=c.fn;c.extend=c.fn.extend=function(){var a=arguments[0]||{},b=1,d=arguments.length,f=false,e,j,i,o;if(typeof a==="boolean"){f=a;a=arguments[1]||{};b=2}if(typeof a!=="object"&&!c.isFunction(a))a={};if(d===b){a=this;--b}for(;b<d;b++)if((e=arguments[b])!=null)for(j in e){i=a[j];o=e[j];if(a!==o)if(f&&o&&(c.isPlainObject(o)||c.isArray(o))){i=i&&(c.isPlainObject(i)||
-c.isArray(i))?i:c.isArray(o)?[]:{};a[j]=c.extend(f,i,o)}else if(o!==w)a[j]=o}return a};c.extend({noConflict:function(a){A.$=Sa;if(a)A.jQuery=Ra;return c},isReady:false,ready:function(){if(!c.isReady){if(!s.body)return setTimeout(c.ready,13);c.isReady=true;if(Q){for(var a,b=0;a=Q[b++];)a.call(s,c);Q=null}c.fn.triggerHandler&&c(s).triggerHandler("ready")}},bindReady:function(){if(!xa){xa=true;if(s.readyState==="complete")return c.ready();if(s.addEventListener){s.addEventListener("DOMContentLoaded",
-L,false);A.addEventListener("load",c.ready,false)}else if(s.attachEvent){s.attachEvent("onreadystatechange",L);A.attachEvent("onload",c.ready);var a=false;try{a=A.frameElement==null}catch(b){}s.documentElement.doScroll&&a&&ma()}}},isFunction:function(a){return $.call(a)==="[object Function]"},isArray:function(a){return $.call(a)==="[object Array]"},isPlainObject:function(a){if(!a||$.call(a)!=="[object Object]"||a.nodeType||a.setInterval)return false;if(a.constructor&&!aa.call(a,"constructor")&&!aa.call(a.constructor.prototype,
-"isPrototypeOf"))return false;var b;for(b in a);return b===w||aa.call(a,b)},isEmptyObject:function(a){for(var b in a)return false;return true},error:function(a){throw a;},parseJSON:function(a){if(typeof a!=="string"||!a)return null;a=c.trim(a);if(/^[\],:{}\s]*$/.test(a.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"")))return A.JSON&&A.JSON.parse?A.JSON.parse(a):(new Function("return "+
-a))();else c.error("Invalid JSON: "+a)},noop:function(){},globalEval:function(a){if(a&&Va.test(a)){var b=s.getElementsByTagName("head")[0]||s.documentElement,d=s.createElement("script");d.type="text/javascript";if(c.support.scriptEval)d.appendChild(s.createTextNode(a));else d.text=a;b.insertBefore(d,b.firstChild);b.removeChild(d)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,b,d){var f,e=0,j=a.length,i=j===w||c.isFunction(a);if(d)if(i)for(f in a){if(b.apply(a[f],
-d)===false)break}else for(;e<j;){if(b.apply(a[e++],d)===false)break}else if(i)for(f in a){if(b.call(a[f],f,a[f])===false)break}else for(d=a[0];e<j&&b.call(d,e,d)!==false;d=a[++e]);return a},trim:function(a){return(a||"").replace(Wa,"")},makeArray:function(a,b){b=b||[];if(a!=null)a.length==null||typeof a==="string"||c.isFunction(a)||typeof a!=="function"&&a.setInterval?ba.call(b,a):c.merge(b,a);return b},inArray:function(a,b){if(b.indexOf)return b.indexOf(a);for(var d=0,f=b.length;d<f;d++)if(b[d]===
-a)return d;return-1},merge:function(a,b){var d=a.length,f=0;if(typeof b.length==="number")for(var e=b.length;f<e;f++)a[d++]=b[f];else for(;b[f]!==w;)a[d++]=b[f++];a.length=d;return a},grep:function(a,b,d){for(var f=[],e=0,j=a.length;e<j;e++)!d!==!b(a[e],e)&&f.push(a[e]);return f},map:function(a,b,d){for(var f=[],e,j=0,i=a.length;j<i;j++){e=b(a[j],j,d);if(e!=null)f[f.length]=e}return f.concat.apply([],f)},guid:1,proxy:function(a,b,d){if(arguments.length===2)if(typeof b==="string"){d=a;a=d[b];b=w}else if(b&&
-!c.isFunction(b)){d=b;b=w}if(!b&&a)b=function(){return a.apply(d||this,arguments)};if(a)b.guid=a.guid=a.guid||b.guid||c.guid++;return b},uaMatch:function(a){a=a.toLowerCase();a=/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version)?[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||!/compatible/.test(a)&&/(mozilla)(?:.*? rv:([\w.]+))?/.exec(a)||[];return{browser:a[1]||"",version:a[2]||"0"}},browser:{}});P=c.uaMatch(P);if(P.browser){c.browser[P.browser]=true;c.browser.version=P.version}if(c.browser.webkit)c.browser.safari=
-true;if(ya)c.inArray=function(a,b){return ya.call(b,a)};T=c(s);if(s.addEventListener)L=function(){s.removeEventListener("DOMContentLoaded",L,false);c.ready()};else if(s.attachEvent)L=function(){if(s.readyState==="complete"){s.detachEvent("onreadystatechange",L);c.ready()}};(function(){c.support={};var a=s.documentElement,b=s.createElement("script"),d=s.createElement("div"),f="script"+J();d.style.display="none";d.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
-var e=d.getElementsByTagName("*"),j=d.getElementsByTagName("a")[0];if(!(!e||!e.length||!j)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(j.getAttribute("style")),hrefNormalized:j.getAttribute("href")==="/a",opacity:/^0.55$/.test(j.style.opacity),cssFloat:!!j.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:s.createElement("select").appendChild(s.createElement("option")).selected,
-parentNode:d.removeChild(d.appendChild(s.createElement("div"))).parentNode===null,deleteExpando:true,checkClone:false,scriptEval:false,noCloneEvent:true,boxModel:null};b.type="text/javascript";try{b.appendChild(s.createTextNode("window."+f+"=1;"))}catch(i){}a.insertBefore(b,a.firstChild);if(A[f]){c.support.scriptEval=true;delete A[f]}try{delete b.test}catch(o){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function k(){c.support.noCloneEvent=
-false;d.detachEvent("onclick",k)});d.cloneNode(true).fireEvent("onclick")}d=s.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=s.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var k=s.createElement("div");k.style.width=k.style.paddingLeft="1px";s.body.appendChild(k);c.boxModel=c.support.boxModel=k.offsetWidth===2;s.body.removeChild(k).style.display="none"});a=function(k){var n=
-s.createElement("div");k="on"+k;var r=k in n;if(!r){n.setAttribute(k,"return;");r=typeof n[k]==="function"}return r};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=e=j=null}})();c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};var G="jQuery"+J(),Ya=0,za={};c.extend({cache:{},expando:G,noData:{embed:true,object:true,
-applet:true},data:function(a,b,d){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var f=a[G],e=c.cache;if(!f&&typeof b==="string"&&d===w)return null;f||(f=++Ya);if(typeof b==="object"){a[G]=f;e[f]=c.extend(true,{},b)}else if(!e[f]){a[G]=f;e[f]={}}a=e[f];if(d!==w)a[b]=d;return typeof b==="string"?a[b]:a}},removeData:function(a,b){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var d=a[G],f=c.cache,e=f[d];if(b){if(e){delete e[b];c.isEmptyObject(e)&&c.removeData(a)}}else{if(c.support.deleteExpando)delete a[c.expando];
-else a.removeAttribute&&a.removeAttribute(c.expando);delete f[d]}}}});c.fn.extend({data:function(a,b){if(typeof a==="undefined"&&this.length)return c.data(this[0]);else if(typeof a==="object")return this.each(function(){c.data(this,a)});var d=a.split(".");d[1]=d[1]?"."+d[1]:"";if(b===w){var f=this.triggerHandler("getData"+d[1]+"!",[d[0]]);if(f===w&&this.length)f=c.data(this[0],a);return f===w&&d[1]?this.data(d[0]):f}else return this.trigger("setData"+d[1]+"!",[d[0],b]).each(function(){c.data(this,
-a,b)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var f=c.data(a,b);if(!d)return f||[];if(!f||c.isArray(d))f=c.data(a,b,c.makeArray(d));else f.push(d);return f}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),f=d.shift();if(f==="inprogress")f=d.shift();if(f){b==="fx"&&d.unshift("inprogress");f.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===
-w)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this,a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var Aa=/[\n\t]/g,ca=/\s+/,Za=/\r/g,$a=/href|src|style/,ab=/(button|input)/i,bb=/(button|input|object|select|textarea)/i,
-cb=/^(a|area)$/i,Ba=/radio|checkbox/;c.fn.extend({attr:function(a,b){return X(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(n){var r=c(this);r.addClass(a.call(this,n,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1)if(e.className){for(var j=" "+e.className+" ",
-i=e.className,o=0,k=b.length;o<k;o++)if(j.indexOf(" "+b[o]+" ")<0)i+=" "+b[o];e.className=c.trim(i)}else e.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(k){var n=c(this);n.removeClass(a.call(this,k,n.attr("class")))});if(a&&typeof a==="string"||a===w)for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1&&e.className)if(a){for(var j=(" "+e.className+" ").replace(Aa," "),i=0,o=b.length;i<o;i++)j=j.replace(" "+b[i]+" ",
-" ");e.className=c.trim(j)}else e.className=""}return this},toggleClass:function(a,b){var d=typeof a,f=typeof b==="boolean";if(c.isFunction(a))return this.each(function(e){var j=c(this);j.toggleClass(a.call(this,e,j.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var e,j=0,i=c(this),o=b,k=a.split(ca);e=k[j++];){o=f?o:!i.hasClass(e);i[o?"addClass":"removeClass"](e)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this,"__className__",this.className);this.className=
-this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(Aa," ").indexOf(a)>-1)return true;return false},val:function(a){if(a===w){var b=this[0];if(b){if(c.nodeName(b,"option"))return(b.attributes.value||{}).specified?b.value:b.text;if(c.nodeName(b,"select")){var d=b.selectedIndex,f=[],e=b.options;b=b.type==="select-one";if(d<0)return null;var j=b?d:0;for(d=b?d+1:e.length;j<d;j++){var i=
-e[j];if(i.selected){a=c(i).val();if(b)return a;f.push(a)}}return f}if(Ba.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Za,"")}return w}var o=c.isFunction(a);return this.each(function(k){var n=c(this),r=a;if(this.nodeType===1){if(o)r=a.call(this,k,n.val());if(typeof r==="number")r+="";if(c.isArray(r)&&Ba.test(this.type))this.checked=c.inArray(n.val(),r)>=0;else if(c.nodeName(this,"select")){var u=c.makeArray(r);c("option",this).each(function(){this.selected=
-c.inArray(c(this).val(),u)>=0});if(!u.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(a,b,d,f){if(!a||a.nodeType===3||a.nodeType===8)return w;if(f&&b in c.attrFn)return c(a)[b](d);f=a.nodeType!==1||!c.isXMLDoc(a);var e=d!==w;b=f&&c.props[b]||b;if(a.nodeType===1){var j=$a.test(b);if(b in a&&f&&!j){if(e){b==="type"&&ab.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");
-a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&&b.specified?b.value:bb.test(a.nodeName)||cb.test(a.nodeName)&&a.href?0:w;return a[b]}if(!c.support.style&&f&&b==="style"){if(e)a.style.cssText=""+d;return a.style.cssText}e&&a.setAttribute(b,""+d);a=!c.support.hrefNormalized&&f&&j?a.getAttribute(b,2):a.getAttribute(b);return a===null?w:a}return c.style(a,b,d)}});var O=/\.(.*)$/,db=function(a){return a.replace(/[^\w\s\.\|`]/g,
-function(b){return"\\"+b})};c.event={add:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){if(a.setInterval&&a!==A&&!a.frameElement)a=A;var e,j;if(d.handler){e=d;d=e.handler}if(!d.guid)d.guid=c.guid++;if(j=c.data(a)){var i=j.events=j.events||{},o=j.handle;if(!o)j.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem,arguments):w};o.elem=a;b=b.split(" ");for(var k,n=0,r;k=b[n++];){j=e?c.extend({},e):{handler:d,data:f};if(k.indexOf(".")>-1){r=k.split(".");
-k=r.shift();j.namespace=r.slice(0).sort().join(".")}else{r=[];j.namespace=""}j.type=k;j.guid=d.guid;var u=i[k],z=c.event.special[k]||{};if(!u){u=i[k]=[];if(!z.setup||z.setup.call(a,f,r,o)===false)if(a.addEventListener)a.addEventListener(k,o,false);else a.attachEvent&&a.attachEvent("on"+k,o)}if(z.add){z.add.call(a,j);if(!j.handler.guid)j.handler.guid=d.guid}u.push(j);c.event.global[k]=true}a=null}}},global:{},remove:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){var e,j=0,i,o,k,n,r,u,z=c.data(a),
-C=z&&z.events;if(z&&C){if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(e in C)c.event.remove(a,e+b)}else{for(b=b.split(" ");e=b[j++];){n=e;i=e.indexOf(".")<0;o=[];if(!i){o=e.split(".");e=o.shift();k=new RegExp("(^|\\.)"+c.map(o.slice(0).sort(),db).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(r=C[e])if(d){n=c.event.special[e]||{};for(B=f||0;B<r.length;B++){u=r[B];if(d.guid===u.guid){if(i||k.test(u.namespace)){f==null&&r.splice(B--,1);n.remove&&n.remove.call(a,u)}if(f!=
-null)break}}if(r.length===0||f!=null&&r.length===1){if(!n.teardown||n.teardown.call(a,o)===false)Ca(a,e,z.handle);delete C[e]}}else for(var B=0;B<r.length;B++){u=r[B];if(i||k.test(u.namespace)){c.event.remove(a,n,u.handler,B);r.splice(B--,1)}}}if(c.isEmptyObject(C)){if(b=z.handle)b.elem=null;delete z.events;delete z.handle;c.isEmptyObject(z)&&c.removeData(a)}}}}},trigger:function(a,b,d,f){var e=a.type||a;if(!f){a=typeof a==="object"?a[G]?a:c.extend(c.Event(e),a):c.Event(e);if(e.indexOf("!")>=0){a.type=
-e=e.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[e]&&c.each(c.cache,function(){this.events&&this.events[e]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType===8)return w;a.result=w;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(f=c.data(d,"handle"))&&f.apply(d,b);f=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+e]&&d["on"+e].apply(d,b)===false)a.result=false}catch(j){}if(!a.isPropagationStopped()&&
-f)c.event.trigger(a,b,f,true);else if(!a.isDefaultPrevented()){f=a.target;var i,o=c.nodeName(f,"a")&&e==="click",k=c.event.special[e]||{};if((!k._default||k._default.call(d,a)===false)&&!o&&!(f&&f.nodeName&&c.noData[f.nodeName.toLowerCase()])){try{if(f[e]){if(i=f["on"+e])f["on"+e]=null;c.event.triggered=true;f[e]()}}catch(n){}if(i)f["on"+e]=i;c.event.triggered=false}}},handle:function(a){var b,d,f,e;a=arguments[0]=c.event.fix(a||A.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive;
-if(!b){d=a.type.split(".");a.type=d.shift();f=new RegExp("(^|\\.)"+d.slice(0).sort().join("\\.(?:.*\\.)?")+"(\\.|$)")}e=c.data(this,"events");d=e[a.type];if(e&&d){d=d.slice(0);e=0;for(var j=d.length;e<j;e++){var i=d[e];if(b||f.test(i.namespace)){a.handler=i.handler;a.data=i.data;a.handleObj=i;i=i.handler.apply(this,arguments);if(i!==w){a.result=i;if(i===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
-fix:function(a){if(a[G])return a;var b=a;a=c.Event(b);for(var d=this.props.length,f;d;){f=this.props[--d];a[f]=b[f]}if(!a.target)a.target=a.srcElement||s;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=s.documentElement;d=s.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop||
-d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(!a.which&&(a.charCode||a.charCode===0?a.charCode:a.keyCode))a.which=a.charCode||a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==w)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a){c.event.add(this,a.origType,c.extend({},a,{handler:oa}))},remove:function(a){var b=true,d=a.origType.replace(O,"");c.each(c.data(this,
-"events").live||[],function(){if(d===this.origType.replace(O,""))return b=false});b&&c.event.remove(this,a.origType,oa)}},beforeunload:{setup:function(a,b,d){if(this.setInterval)this.onbeforeunload=d;return false},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};var Ca=s.removeEventListener?function(a,b,d){a.removeEventListener(b,d,false)}:function(a,b,d){a.detachEvent("on"+b,d)};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=
-a;this.type=a.type}else this.type=a;this.timeStamp=J();this[G]=true};c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=Z;var a=this.originalEvent;if(a){a.preventDefault&&a.preventDefault();a.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=Z;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=Z;this.stopPropagation()},isDefaultPrevented:Y,isPropagationStopped:Y,
-isImmediatePropagationStopped:Y};var Da=function(a){var b=a.relatedTarget;try{for(;b&&b!==this;)b=b.parentNode;if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}}catch(d){}},Ea=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?Ea:Da,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?Ea:Da)}}});if(!c.support.submitBubbles)c.event.special.submit=
-{setup:function(){if(this.nodeName.toLowerCase()!=="form"){c.event.add(this,"click.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="submit"||d==="image")&&c(b).closest("form").length)return na("submit",this,arguments)});c.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="text"||d==="password")&&c(b).closest("form").length&&a.keyCode===13)return na("submit",this,arguments)})}else return false},teardown:function(){c.event.remove(this,".specialSubmit")}};
-if(!c.support.changeBubbles){var da=/textarea|input|select/i,ea,Fa=function(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(f){return f.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},fa=function(a,b){var d=a.target,f,e;if(!(!da.test(d.nodeName)||d.readOnly)){f=c.data(d,"_change_data");e=Fa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data",
-e);if(!(f===w||e===f))if(f!=null||e){a.type="change";return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:fa,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return fa.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return fa.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a,
-"_change_data",Fa(a))}},setup:function(){if(this.type==="file")return false;for(var a in ea)c.event.add(this,a+".specialChange",ea[a]);return da.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return da.test(this.nodeName)}};ea=c.event.special.change.filters}s.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(f){f=c.event.fix(f);f.type=b;return c.event.handle.call(this,f)}c.event.special[b]={setup:function(){this.addEventListener(a,
-d,true)},teardown:function(){this.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,f,e){if(typeof d==="object"){for(var j in d)this[b](j,f,d[j],e);return this}if(c.isFunction(f)){e=f;f=w}var i=b==="one"?c.proxy(e,function(k){c(this).unbind(k,i);return e.apply(this,arguments)}):e;if(d==="unload"&&b!=="one")this.one(d,f,e);else{j=0;for(var o=this.length;j<o;j++)c.event.add(this[j],d,i,f)}return this}});c.fn.extend({unbind:function(a,b){if(typeof a==="object"&&
-!a.preventDefault)for(var d in a)this.unbind(d,a[d]);else{d=0;for(var f=this.length;d<f;d++)c.event.remove(this[d],a,b)}return this},delegate:function(a,b,d,f){return this.live(b,d,f,a)},undelegate:function(a,b,d){return arguments.length===0?this.unbind("live"):this.die(b,null,d,a)},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){a=c.Event(a);a.preventDefault();a.stopPropagation();c.event.trigger(a,b,this[0]);return a.result}},
-toggle:function(a){for(var b=arguments,d=1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(f){var e=(c.data(this,"lastToggle"+a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,e+1);f.preventDefault();return b[e].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var Ga={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};c.each(["live","die"],function(a,b){c.fn[b]=function(d,f,e,j){var i,o=0,k,n,r=j||this.selector,
-u=j?this:c(this.context);if(c.isFunction(f)){e=f;f=w}for(d=(d||"").split(" ");(i=d[o++])!=null;){j=O.exec(i);k="";if(j){k=j[0];i=i.replace(O,"")}if(i==="hover")d.push("mouseenter"+k,"mouseleave"+k);else{n=i;if(i==="focus"||i==="blur"){d.push(Ga[i]+k);i+=k}else i=(Ga[i]||i)+k;b==="live"?u.each(function(){c.event.add(this,pa(i,r),{data:f,selector:r,handler:e,origType:i,origHandler:e,preType:n})}):u.unbind(pa(i,r),e)}}return this}});c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),
-function(a,b){c.fn[b]=function(d){return d?this.bind(b,d):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});A.attachEvent&&!A.addEventListener&&A.attachEvent("onunload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}});(function(){function a(g){for(var h="",l,m=0;g[m];m++){l=g[m];if(l.nodeType===3||l.nodeType===4)h+=l.nodeValue;else if(l.nodeType!==8)h+=a(l.childNodes)}return h}function b(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];
-if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1&&!p){t.sizcache=l;t.sizset=q}if(t.nodeName.toLowerCase()===h){y=t;break}t=t[g]}m[q]=y}}}function d(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1){if(!p){t.sizcache=l;t.sizset=q}if(typeof h!=="string"){if(t===h){y=true;break}}else if(k.filter(h,[t]).length>0){y=t;break}}t=t[g]}m[q]=y}}}var f=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
-e=0,j=Object.prototype.toString,i=false,o=true;[0,0].sort(function(){o=false;return 0});var k=function(g,h,l,m){l=l||[];var q=h=h||s;if(h.nodeType!==1&&h.nodeType!==9)return[];if(!g||typeof g!=="string")return l;for(var p=[],v,t,y,S,H=true,M=x(h),I=g;(f.exec(""),v=f.exec(I))!==null;){I=v[3];p.push(v[1]);if(v[2]){S=v[3];break}}if(p.length>1&&r.exec(g))if(p.length===2&&n.relative[p[0]])t=ga(p[0]+p[1],h);else for(t=n.relative[p[0]]?[h]:k(p.shift(),h);p.length;){g=p.shift();if(n.relative[g])g+=p.shift();
-t=ga(g,t)}else{if(!m&&p.length>1&&h.nodeType===9&&!M&&n.match.ID.test(p[0])&&!n.match.ID.test(p[p.length-1])){v=k.find(p.shift(),h,M);h=v.expr?k.filter(v.expr,v.set)[0]:v.set[0]}if(h){v=m?{expr:p.pop(),set:z(m)}:k.find(p.pop(),p.length===1&&(p[0]==="~"||p[0]==="+")&&h.parentNode?h.parentNode:h,M);t=v.expr?k.filter(v.expr,v.set):v.set;if(p.length>0)y=z(t);else H=false;for(;p.length;){var D=p.pop();v=D;if(n.relative[D])v=p.pop();else D="";if(v==null)v=h;n.relative[D](y,v,M)}}else y=[]}y||(y=t);y||k.error(D||
-g);if(j.call(y)==="[object Array]")if(H)if(h&&h.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&E(h,y[g])))l.push(t[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&l.push(t[g]);else l.push.apply(l,y);else z(y,l);if(S){k(S,q,l,m);k.uniqueSort(l)}return l};k.uniqueSort=function(g){if(B){i=o;g.sort(B);if(i)for(var h=1;h<g.length;h++)g[h]===g[h-1]&&g.splice(h--,1)}return g};k.matches=function(g,h){return k(g,null,null,h)};k.find=function(g,h,l){var m,q;if(!g)return[];
-for(var p=0,v=n.order.length;p<v;p++){var t=n.order[p];if(q=n.leftMatch[t].exec(g)){var y=q[1];q.splice(1,1);if(y.substr(y.length-1)!=="\\"){q[1]=(q[1]||"").replace(/\\/g,"");m=n.find[t](q,h,l);if(m!=null){g=g.replace(n.match[t],"");break}}}}m||(m=h.getElementsByTagName("*"));return{set:m,expr:g}};k.filter=function(g,h,l,m){for(var q=g,p=[],v=h,t,y,S=h&&h[0]&&x(h[0]);g&&h.length;){for(var H in n.filter)if((t=n.leftMatch[H].exec(g))!=null&&t[2]){var M=n.filter[H],I,D;D=t[1];y=false;t.splice(1,1);if(D.substr(D.length-
-1)!=="\\"){if(v===p)p=[];if(n.preFilter[H])if(t=n.preFilter[H](t,v,l,p,m,S)){if(t===true)continue}else y=I=true;if(t)for(var U=0;(D=v[U])!=null;U++)if(D){I=M(D,t,U,v);var Ha=m^!!I;if(l&&I!=null)if(Ha)y=true;else v[U]=false;else if(Ha){p.push(D);y=true}}if(I!==w){l||(v=p);g=g.replace(n.match[H],"");if(!y)return[];break}}}if(g===q)if(y==null)k.error(g);else break;q=g}return v};k.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var n=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
-CLASS:/\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},
-relative:{"+":function(g,h){var l=typeof h==="string",m=l&&!/\W/.test(h);l=l&&!m;if(m)h=h.toLowerCase();m=0;for(var q=g.length,p;m<q;m++)if(p=g[m]){for(;(p=p.previousSibling)&&p.nodeType!==1;);g[m]=l||p&&p.nodeName.toLowerCase()===h?p||false:p===h}l&&k.filter(h,g,true)},">":function(g,h){var l=typeof h==="string";if(l&&!/\W/.test(h)){h=h.toLowerCase();for(var m=0,q=g.length;m<q;m++){var p=g[m];if(p){l=p.parentNode;g[m]=l.nodeName.toLowerCase()===h?l:false}}}else{m=0;for(q=g.length;m<q;m++)if(p=g[m])g[m]=
-l?p.parentNode:p.parentNode===h;l&&k.filter(h,g,true)}},"":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("parentNode",h,m,g,p,l)},"~":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("previousSibling",h,m,g,p,l)}},find:{ID:function(g,h,l){if(typeof h.getElementById!=="undefined"&&!l)return(g=h.getElementById(g[1]))?[g]:[]},NAME:function(g,h){if(typeof h.getElementsByName!=="undefined"){var l=[];
-h=h.getElementsByName(g[1]);for(var m=0,q=h.length;m<q;m++)h[m].getAttribute("name")===g[1]&&l.push(h[m]);return l.length===0?null:l}},TAG:function(g,h){return h.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,h,l,m,q,p){g=" "+g[1].replace(/\\/g,"")+" ";if(p)return g;p=0;for(var v;(v=h[p])!=null;p++)if(v)if(q^(v.className&&(" "+v.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))l||m.push(v);else if(l)h[p]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},
-CHILD:function(g){if(g[1]==="nth"){var h=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=h[1]+(h[2]||1)-0;g[3]=h[3]-0}g[0]=e++;return g},ATTR:function(g,h,l,m,q,p){h=g[1].replace(/\\/g,"");if(!p&&n.attrMap[h])g[1]=n.attrMap[h];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,h,l,m,q){if(g[1]==="not")if((f.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,h);else{g=k.filter(g[3],h,l,true^q);l||m.push.apply(m,
-g);return false}else if(n.match.POS.test(g[0])||n.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled===true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,h,l){return!!k(l[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},
-text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"===g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},
-setFilters:{first:function(g,h){return h===0},last:function(g,h,l,m){return h===m.length-1},even:function(g,h){return h%2===0},odd:function(g,h){return h%2===1},lt:function(g,h,l){return h<l[3]-0},gt:function(g,h,l){return h>l[3]-0},nth:function(g,h,l){return l[3]-0===h},eq:function(g,h,l){return l[3]-0===h}},filter:{PSEUDO:function(g,h,l,m){var q=h[1],p=n.filters[q];if(p)return p(g,l,h,m);else if(q==="contains")return(g.textContent||g.innerText||a([g])||"").indexOf(h[3])>=0;else if(q==="not"){h=
-h[3];l=0;for(m=h.length;l<m;l++)if(h[l]===g)return false;return true}else k.error("Syntax error, unrecognized expression: "+q)},CHILD:function(g,h){var l=h[1],m=g;switch(l){case "only":case "first":for(;m=m.previousSibling;)if(m.nodeType===1)return false;if(l==="first")return true;m=g;case "last":for(;m=m.nextSibling;)if(m.nodeType===1)return false;return true;case "nth":l=h[2];var q=h[3];if(l===1&&q===0)return true;h=h[0];var p=g.parentNode;if(p&&(p.sizcache!==h||!g.nodeIndex)){var v=0;for(m=p.firstChild;m;m=
-m.nextSibling)if(m.nodeType===1)m.nodeIndex=++v;p.sizcache=h}g=g.nodeIndex-q;return l===0?g===0:g%l===0&&g/l>=0}},ID:function(g,h){return g.nodeType===1&&g.getAttribute("id")===h},TAG:function(g,h){return h==="*"&&g.nodeType===1||g.nodeName.toLowerCase()===h},CLASS:function(g,h){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(h)>-1},ATTR:function(g,h){var l=h[1];g=n.attrHandle[l]?n.attrHandle[l](g):g[l]!=null?g[l]:g.getAttribute(l);l=g+"";var m=h[2];h=h[4];return g==null?m==="!=":m===
-"="?l===h:m==="*="?l.indexOf(h)>=0:m==="~="?(" "+l+" ").indexOf(h)>=0:!h?l&&g!==false:m==="!="?l!==h:m==="^="?l.indexOf(h)===0:m==="$="?l.substr(l.length-h.length)===h:m==="|="?l===h||l.substr(0,h.length+1)===h+"-":false},POS:function(g,h,l,m){var q=n.setFilters[h[2]];if(q)return q(g,l,h,m)}}},r=n.match.POS;for(var u in n.match){n.match[u]=new RegExp(n.match[u].source+/(?![^\[]*\])(?![^\(]*\))/.source);n.leftMatch[u]=new RegExp(/(^(?:.|\r|\n)*?)/.source+n.match[u].source.replace(/\\(\d+)/g,function(g,
-h){return"\\"+(h-0+1)}))}var z=function(g,h){g=Array.prototype.slice.call(g,0);if(h){h.push.apply(h,g);return h}return g};try{Array.prototype.slice.call(s.documentElement.childNodes,0)}catch(C){z=function(g,h){h=h||[];if(j.call(g)==="[object Array]")Array.prototype.push.apply(h,g);else if(typeof g.length==="number")for(var l=0,m=g.length;l<m;l++)h.push(g[l]);else for(l=0;g[l];l++)h.push(g[l]);return h}}var B;if(s.documentElement.compareDocumentPosition)B=function(g,h){if(!g.compareDocumentPosition||
-!h.compareDocumentPosition){if(g==h)i=true;return g.compareDocumentPosition?-1:1}g=g.compareDocumentPosition(h)&4?-1:g===h?0:1;if(g===0)i=true;return g};else if("sourceIndex"in s.documentElement)B=function(g,h){if(!g.sourceIndex||!h.sourceIndex){if(g==h)i=true;return g.sourceIndex?-1:1}g=g.sourceIndex-h.sourceIndex;if(g===0)i=true;return g};else if(s.createRange)B=function(g,h){if(!g.ownerDocument||!h.ownerDocument){if(g==h)i=true;return g.ownerDocument?-1:1}var l=g.ownerDocument.createRange(),m=
-h.ownerDocument.createRange();l.setStart(g,0);l.setEnd(g,0);m.setStart(h,0);m.setEnd(h,0);g=l.compareBoundaryPoints(Range.START_TO_END,m);if(g===0)i=true;return g};(function(){var g=s.createElement("div"),h="script"+(new Date).getTime();g.innerHTML="<a name='"+h+"'/>";var l=s.documentElement;l.insertBefore(g,l.firstChild);if(s.getElementById(h)){n.find.ID=function(m,q,p){if(typeof q.getElementById!=="undefined"&&!p)return(q=q.getElementById(m[1]))?q.id===m[1]||typeof q.getAttributeNode!=="undefined"&&
-q.getAttributeNode("id").nodeValue===m[1]?[q]:w:[]};n.filter.ID=function(m,q){var p=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&p&&p.nodeValue===q}}l.removeChild(g);l=g=null})();(function(){var g=s.createElement("div");g.appendChild(s.createComment(""));if(g.getElementsByTagName("*").length>0)n.find.TAG=function(h,l){l=l.getElementsByTagName(h[1]);if(h[1]==="*"){h=[];for(var m=0;l[m];m++)l[m].nodeType===1&&h.push(l[m]);l=h}return l};g.innerHTML="<a href='#'></a>";
-if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")n.attrHandle.href=function(h){return h.getAttribute("href",2)};g=null})();s.querySelectorAll&&function(){var g=k,h=s.createElement("div");h.innerHTML="<p class='TEST'></p>";if(!(h.querySelectorAll&&h.querySelectorAll(".TEST").length===0)){k=function(m,q,p,v){q=q||s;if(!v&&q.nodeType===9&&!x(q))try{return z(q.querySelectorAll(m),p)}catch(t){}return g(m,q,p,v)};for(var l in g)k[l]=g[l];h=null}}();
-(function(){var g=s.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){n.order.splice(1,0,"CLASS");n.find.CLASS=function(h,l,m){if(typeof l.getElementsByClassName!=="undefined"&&!m)return l.getElementsByClassName(h[1])};g=null}}})();var E=s.compareDocumentPosition?function(g,h){return!!(g.compareDocumentPosition(h)&16)}:
-function(g,h){return g!==h&&(g.contains?g.contains(h):true)},x=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false},ga=function(g,h){var l=[],m="",q;for(h=h.nodeType?[h]:h;q=n.match.PSEUDO.exec(g);){m+=q[0];g=g.replace(n.match.PSEUDO,"")}g=n.relative[g]?g+"*":g;q=0;for(var p=h.length;q<p;q++)k(g,h[q],l);return k.filter(m,l)};c.find=k;c.expr=k.selectors;c.expr[":"]=c.expr.filters;c.unique=k.uniqueSort;c.text=a;c.isXMLDoc=x;c.contains=E})();var eb=/Until$/,fb=/^(?:parents|prevUntil|prevAll)/,
-gb=/,/;R=Array.prototype.slice;var Ia=function(a,b,d){if(c.isFunction(b))return c.grep(a,function(e,j){return!!b.call(e,j,e)===d});else if(b.nodeType)return c.grep(a,function(e){return e===b===d});else if(typeof b==="string"){var f=c.grep(a,function(e){return e.nodeType===1});if(Ua.test(b))return c.filter(b,f,!d);else b=c.filter(b,f)}return c.grep(a,function(e){return c.inArray(e,b)>=0===d})};c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,f=0,e=this.length;f<e;f++){d=b.length;
-c.find(a,this[f],b);if(f>0)for(var j=d;j<b.length;j++)for(var i=0;i<d;i++)if(b[i]===b[j]){b.splice(j--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=0,f=b.length;d<f;d++)if(c.contains(this,b[d]))return true})},not:function(a){return this.pushStack(Ia(this,a,false),"not",a)},filter:function(a){return this.pushStack(Ia(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){if(c.isArray(a)){var d=[],f=this[0],e,j=
-{},i;if(f&&a.length){e=0;for(var o=a.length;e<o;e++){i=a[e];j[i]||(j[i]=c.expr.match.POS.test(i)?c(i,b||this.context):i)}for(;f&&f.ownerDocument&&f!==b;){for(i in j){e=j[i];if(e.jquery?e.index(f)>-1:c(f).is(e)){d.push({selector:i,elem:f});delete j[i]}}f=f.parentNode}}return d}var k=c.expr.match.POS.test(a)?c(a,b||this.context):null;return this.map(function(n,r){for(;r&&r.ownerDocument&&r!==b;){if(k?k.index(r)>-1:c(r).is(a))return r;r=r.parentNode}return null})},index:function(a){if(!a||typeof a===
-"string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){a=typeof a==="string"?c(a,b||this.context):c.makeArray(a);b=c.merge(this.get(),a);return this.pushStack(qa(a[0])||qa(b[0])?b:c.unique(b))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",
-d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a,2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?
-a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a,b){c.fn[a]=function(d,f){var e=c.map(this,b,d);eb.test(a)||(f=d);if(f&&typeof f==="string")e=c.filter(f,e);e=this.length>1?c.unique(e):e;if((this.length>1||gb.test(f))&&fb.test(a))e=e.reverse();return this.pushStack(e,a,R.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return c.find.matches(a,b)},dir:function(a,b,d){var f=[];for(a=a[b];a&&a.nodeType!==9&&(d===w||a.nodeType!==1||!c(a).is(d));){a.nodeType===
-1&&f.push(a);a=a[b]}return f},nth:function(a,b,d){b=b||1;for(var f=0;a;a=a[d])if(a.nodeType===1&&++f===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var Ja=/ jQuery\d+="(?:\d+|null)"/g,V=/^\s+/,Ka=/(<([\w:]+)[^>]*?)\/>/g,hb=/^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,La=/<([\w:]+)/,ib=/<tbody/i,jb=/<|&#?\w+;/,ta=/<script|<object|<embed|<option|<style/i,ua=/checked\s*(?:[^=]|=\s*.checked.)/i,Ma=function(a,b,d){return hb.test(d)?
-a:b+"></"+d+">"},F={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};F.optgroup=F.option;F.tbody=F.tfoot=F.colgroup=F.caption=F.thead;F.th=F.td;if(!c.support.htmlSerialize)F._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d=
-c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==w)return this.empty().append((this[0]&&this[0].ownerDocument||s).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this},
-wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})},
-prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,
-this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,f;(f=this[d])!=null;d++)if(!a||c.filter(a,[f]).length){if(!b&&f.nodeType===1){c.cleanData(f.getElementsByTagName("*"));c.cleanData([f])}f.parentNode&&f.parentNode.removeChild(f)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild);
-return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Ja,"").replace(/=([^="'>\s]+\/)>/g,'="$1">').replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){ra(this,b);ra(this.find("*"),b.find("*"))}return b},html:function(a){if(a===w)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Ja,
-""):null;else if(typeof a==="string"&&!ta.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(La.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Ka,Ma);try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(f){this.empty().append(a)}}else c.isFunction(a)?this.each(function(e){var j=c(this),i=j.html();j.empty().append(function(){return a.call(this,e,i)})}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&
-this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d=c(this),f=d.html();d.replaceWith(a.call(this,b,f))});if(typeof a!=="string")a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){function f(u){return c.nodeName(u,"table")?u.getElementsByTagName("tbody")[0]||
-u.appendChild(u.ownerDocument.createElement("tbody")):u}var e,j,i=a[0],o=[],k;if(!c.support.checkClone&&arguments.length===3&&typeof i==="string"&&ua.test(i))return this.each(function(){c(this).domManip(a,b,d,true)});if(c.isFunction(i))return this.each(function(u){var z=c(this);a[0]=i.call(this,u,b?z.html():w);z.domManip(a,b,d)});if(this[0]){e=i&&i.parentNode;e=c.support.parentNode&&e&&e.nodeType===11&&e.childNodes.length===this.length?{fragment:e}:sa(a,this,o);k=e.fragment;if(j=k.childNodes.length===
-1?(k=k.firstChild):k.firstChild){b=b&&c.nodeName(j,"tr");for(var n=0,r=this.length;n<r;n++)d.call(b?f(this[n],j):this[n],n>0||e.cacheable||this.length>1?k.cloneNode(true):k)}o.length&&c.each(o,Qa)}return this}});c.fragments={};c.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var f=[];d=c(d);var e=this.length===1&&this[0].parentNode;if(e&&e.nodeType===11&&e.childNodes.length===1&&d.length===1){d[b](this[0]);
-return this}else{e=0;for(var j=d.length;e<j;e++){var i=(e>0?this.clone(true):this).get();c.fn[b].apply(c(d[e]),i);f=f.concat(i)}return this.pushStack(f,a,d.selector)}}});c.extend({clean:function(a,b,d,f){b=b||s;if(typeof b.createElement==="undefined")b=b.ownerDocument||b[0]&&b[0].ownerDocument||s;for(var e=[],j=0,i;(i=a[j])!=null;j++){if(typeof i==="number")i+="";if(i){if(typeof i==="string"&&!jb.test(i))i=b.createTextNode(i);else if(typeof i==="string"){i=i.replace(Ka,Ma);var o=(La.exec(i)||["",
-""])[1].toLowerCase(),k=F[o]||F._default,n=k[0],r=b.createElement("div");for(r.innerHTML=k[1]+i+k[2];n--;)r=r.lastChild;if(!c.support.tbody){n=ib.test(i);o=o==="table"&&!n?r.firstChild&&r.firstChild.childNodes:k[1]==="<table>"&&!n?r.childNodes:[];for(k=o.length-1;k>=0;--k)c.nodeName(o[k],"tbody")&&!o[k].childNodes.length&&o[k].parentNode.removeChild(o[k])}!c.support.leadingWhitespace&&V.test(i)&&r.insertBefore(b.createTextNode(V.exec(i)[0]),r.firstChild);i=r.childNodes}if(i.nodeType)e.push(i);else e=
-c.merge(e,i)}}if(d)for(j=0;e[j];j++)if(f&&c.nodeName(e[j],"script")&&(!e[j].type||e[j].type.toLowerCase()==="text/javascript"))f.push(e[j].parentNode?e[j].parentNode.removeChild(e[j]):e[j]);else{e[j].nodeType===1&&e.splice.apply(e,[j+1,0].concat(c.makeArray(e[j].getElementsByTagName("script"))));d.appendChild(e[j])}return e},cleanData:function(a){for(var b,d,f=c.cache,e=c.event.special,j=c.support.deleteExpando,i=0,o;(o=a[i])!=null;i++)if(d=o[c.expando]){b=f[d];if(b.events)for(var k in b.events)e[k]?
-c.event.remove(o,k):Ca(o,k,b.handle);if(j)delete o[c.expando];else o.removeAttribute&&o.removeAttribute(c.expando);delete f[d]}}});var kb=/z-?index|font-?weight|opacity|zoom|line-?height/i,Na=/alpha\([^)]*\)/,Oa=/opacity=([^)]*)/,ha=/float/i,ia=/-([a-z])/ig,lb=/([A-Z])/g,mb=/^-?\d+(?:px)?$/i,nb=/^-?\d/,ob={position:"absolute",visibility:"hidden",display:"block"},pb=["Left","Right"],qb=["Top","Bottom"],rb=s.defaultView&&s.defaultView.getComputedStyle,Pa=c.support.cssFloat?"cssFloat":"styleFloat",ja=
-function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){return X(this,a,b,true,function(d,f,e){if(e===w)return c.curCSS(d,f);if(typeof e==="number"&&!kb.test(f))e+="px";c.style(d,f,e)})};c.extend({style:function(a,b,d){if(!a||a.nodeType===3||a.nodeType===8)return w;if((b==="width"||b==="height")&&parseFloat(d)<0)d=w;var f=a.style||a,e=d!==w;if(!c.support.opacity&&b==="opacity"){if(e){f.zoom=1;b=parseInt(d,10)+""==="NaN"?"":"alpha(opacity="+d*100+")";a=f.filter||c.curCSS(a,"filter")||"";f.filter=
-Na.test(a)?a.replace(Na,b):b}return f.filter&&f.filter.indexOf("opacity=")>=0?parseFloat(Oa.exec(f.filter)[1])/100+"":""}if(ha.test(b))b=Pa;b=b.replace(ia,ja);if(e)f[b]=d;return f[b]},css:function(a,b,d,f){if(b==="width"||b==="height"){var e,j=b==="width"?pb:qb;function i(){e=b==="width"?a.offsetWidth:a.offsetHeight;f!=="border"&&c.each(j,function(){f||(e-=parseFloat(c.curCSS(a,"padding"+this,true))||0);if(f==="margin")e+=parseFloat(c.curCSS(a,"margin"+this,true))||0;else e-=parseFloat(c.curCSS(a,
-"border"+this+"Width",true))||0})}a.offsetWidth!==0?i():c.swap(a,ob,i);return Math.max(0,Math.round(e))}return c.curCSS(a,b,d)},curCSS:function(a,b,d){var f,e=a.style;if(!c.support.opacity&&b==="opacity"&&a.currentStyle){f=Oa.test(a.currentStyle.filter||"")?parseFloat(RegExp.$1)/100+"":"";return f===""?"1":f}if(ha.test(b))b=Pa;if(!d&&e&&e[b])f=e[b];else if(rb){if(ha.test(b))b="float";b=b.replace(lb,"-$1").toLowerCase();e=a.ownerDocument.defaultView;if(!e)return null;if(a=e.getComputedStyle(a,null))f=
-a.getPropertyValue(b);if(b==="opacity"&&f==="")f="1"}else if(a.currentStyle){d=b.replace(ia,ja);f=a.currentStyle[b]||a.currentStyle[d];if(!mb.test(f)&&nb.test(f)){b=e.left;var j=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;e.left=d==="fontSize"?"1em":f||0;f=e.pixelLeft+"px";e.left=b;a.runtimeStyle.left=j}}return f},swap:function(a,b,d){var f={};for(var e in b){f[e]=a.style[e];a.style[e]=b[e]}d.call(a);for(e in b)a.style[e]=f[e]}});if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=
-a.offsetWidth,d=a.offsetHeight,f=a.nodeName.toLowerCase()==="tr";return b===0&&d===0&&!f?true:b>0&&d>0&&!f?false:c.curCSS(a,"display")==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var sb=J(),tb=/<script(.|\s)*?\/script>/gi,ub=/select|textarea/i,vb=/color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,N=/=\?(&|$)/,ka=/\?/,wb=/(\?|&)_=.*?(&|$)/,xb=/^(\w+:)?\/\/([^\/?#]+)/,yb=/%20/g,zb=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!==
-"string")return zb.call(this,a);else if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var e=a.slice(f,a.length);a=a.slice(0,f)}f="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b==="object"){b=c.param(b,c.ajaxSettings.traditional);f="POST"}var j=this;c.ajax({url:a,type:f,dataType:"html",data:b,complete:function(i,o){if(o==="success"||o==="notmodified")j.html(e?c("<div />").append(i.responseText.replace(tb,"")).find(e):i.responseText);d&&j.each(d,[i.responseText,o,i])}});return this},
-serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ub.test(this.nodeName)||vb.test(this.type))}).map(function(a,b){a=c(this).val();return a==null?null:c.isArray(a)?c.map(a,function(d){return{name:b.name,value:d}}):{name:b.name,value:a}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),
-function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:f})},getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:f})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,
-global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:A.XMLHttpRequest&&(A.location.protocol!=="file:"||!A.ActiveXObject)?function(){return new A.XMLHttpRequest}:function(){try{return new A.ActiveXObject("Microsoft.XMLHTTP")}catch(a){}},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},etag:{},ajax:function(a){function b(){e.success&&
-e.success.call(k,o,i,x);e.global&&f("ajaxSuccess",[x,e])}function d(){e.complete&&e.complete.call(k,x,i);e.global&&f("ajaxComplete",[x,e]);e.global&&!--c.active&&c.event.trigger("ajaxStop")}function f(q,p){(e.context?c(e.context):c.event).trigger(q,p)}var e=c.extend(true,{},c.ajaxSettings,a),j,i,o,k=a&&a.context||e,n=e.type.toUpperCase();if(e.data&&e.processData&&typeof e.data!=="string")e.data=c.param(e.data,e.traditional);if(e.dataType==="jsonp"){if(n==="GET")N.test(e.url)||(e.url+=(ka.test(e.url)?
-"&":"?")+(e.jsonp||"callback")+"=?");else if(!e.data||!N.test(e.data))e.data=(e.data?e.data+"&":"")+(e.jsonp||"callback")+"=?";e.dataType="json"}if(e.dataType==="json"&&(e.data&&N.test(e.data)||N.test(e.url))){j=e.jsonpCallback||"jsonp"+sb++;if(e.data)e.data=(e.data+"").replace(N,"="+j+"$1");e.url=e.url.replace(N,"="+j+"$1");e.dataType="script";A[j]=A[j]||function(q){o=q;b();d();A[j]=w;try{delete A[j]}catch(p){}z&&z.removeChild(C)}}if(e.dataType==="script"&&e.cache===null)e.cache=false;if(e.cache===
-false&&n==="GET"){var r=J(),u=e.url.replace(wb,"$1_="+r+"$2");e.url=u+(u===e.url?(ka.test(e.url)?"&":"?")+"_="+r:"")}if(e.data&&n==="GET")e.url+=(ka.test(e.url)?"&":"?")+e.data;e.global&&!c.active++&&c.event.trigger("ajaxStart");r=(r=xb.exec(e.url))&&(r[1]&&r[1]!==location.protocol||r[2]!==location.host);if(e.dataType==="script"&&n==="GET"&&r){var z=s.getElementsByTagName("head")[0]||s.documentElement,C=s.createElement("script");C.src=e.url;if(e.scriptCharset)C.charset=e.scriptCharset;if(!j){var B=
-false;C.onload=C.onreadystatechange=function(){if(!B&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){B=true;b();d();C.onload=C.onreadystatechange=null;z&&C.parentNode&&z.removeChild(C)}}}z.insertBefore(C,z.firstChild);return w}var E=false,x=e.xhr();if(x){e.username?x.open(n,e.url,e.async,e.username,e.password):x.open(n,e.url,e.async);try{if(e.data||a&&a.contentType)x.setRequestHeader("Content-Type",e.contentType);if(e.ifModified){c.lastModified[e.url]&&x.setRequestHeader("If-Modified-Since",
-c.lastModified[e.url]);c.etag[e.url]&&x.setRequestHeader("If-None-Match",c.etag[e.url])}r||x.setRequestHeader("X-Requested-With","XMLHttpRequest");x.setRequestHeader("Accept",e.dataType&&e.accepts[e.dataType]?e.accepts[e.dataType]+", */*":e.accepts._default)}catch(ga){}if(e.beforeSend&&e.beforeSend.call(k,x,e)===false){e.global&&!--c.active&&c.event.trigger("ajaxStop");x.abort();return false}e.global&&f("ajaxSend",[x,e]);var g=x.onreadystatechange=function(q){if(!x||x.readyState===0||q==="abort"){E||
-d();E=true;if(x)x.onreadystatechange=c.noop}else if(!E&&x&&(x.readyState===4||q==="timeout")){E=true;x.onreadystatechange=c.noop;i=q==="timeout"?"timeout":!c.httpSuccess(x)?"error":e.ifModified&&c.httpNotModified(x,e.url)?"notmodified":"success";var p;if(i==="success")try{o=c.httpData(x,e.dataType,e)}catch(v){i="parsererror";p=v}if(i==="success"||i==="notmodified")j||b();else c.handleError(e,x,i,p);d();q==="timeout"&&x.abort();if(e.async)x=null}};try{var h=x.abort;x.abort=function(){x&&h.call(x);
-g("abort")}}catch(l){}e.async&&e.timeout>0&&setTimeout(function(){x&&!E&&g("timeout")},e.timeout);try{x.send(n==="POST"||n==="PUT"||n==="DELETE"?e.data:null)}catch(m){c.handleError(e,x,null,m);d()}e.async||g();return x}},handleError:function(a,b,d,f){if(a.error)a.error.call(a.context||a,b,d,f);if(a.global)(a.context?c(a.context):c.event).trigger("ajaxError",[b,a,f])},active:0,httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===
-1223||a.status===0}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"),f=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(f)c.etag[b]=f;return a.status===304||a.status===0},httpData:function(a,b,d){var f=a.getResponseHeader("content-type")||"",e=b==="xml"||!b&&f.indexOf("xml")>=0;a=e?a.responseXML:a.responseText;e&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b===
-"json"||!b&&f.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&f.indexOf("javascript")>=0)c.globalEval(a);return a},param:function(a,b){function d(i,o){if(c.isArray(o))c.each(o,function(k,n){b||/\[\]$/.test(i)?f(i,n):d(i+"["+(typeof n==="object"||c.isArray(n)?k:"")+"]",n)});else!b&&o!=null&&typeof o==="object"?c.each(o,function(k,n){d(i+"["+k+"]",n)}):f(i,o)}function f(i,o){o=c.isFunction(o)?o():o;e[e.length]=encodeURIComponent(i)+"="+encodeURIComponent(o)}var e=[];if(b===w)b=c.ajaxSettings.traditional;
-if(c.isArray(a)||a.jquery)c.each(a,function(){f(this.name,this.value)});else for(var j in a)d(j,a[j]);return e.join("&").replace(yb,"+")}});var la={},Ab=/toggle|show|hide/,Bb=/^([+-]=)?([\d+-.]+)(.*)$/,W,va=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b){if(a||a===0)return this.animate(K("show",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");
-this[a].style.display=d||"";if(c.css(this[a],"display")==="none"){d=this[a].nodeName;var f;if(la[d])f=la[d];else{var e=c("<"+d+" />").appendTo("body");f=e.css("display");if(f==="none")f="block";e.remove();la[d]=f}c.data(this[a],"olddisplay",f)}}a=0;for(b=this.length;a<b;a++)this[a].style.display=c.data(this[a],"olddisplay")||"";return this}},hide:function(a,b){if(a||a===0)return this.animate(K("hide",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");!d&&d!=="none"&&c.data(this[a],
-"olddisplay",c.css(this[a],"display"))}a=0;for(b=this.length;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b){var d=typeof a==="boolean";if(c.isFunction(a)&&c.isFunction(b))this._toggle.apply(this,arguments);else a==null||d?this.each(function(){var f=d?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(K("toggle",3),a,b);return this},fadeTo:function(a,b,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d)},
-animate:function(a,b,d,f){var e=c.speed(b,d,f);if(c.isEmptyObject(a))return this.each(e.complete);return this[e.queue===false?"each":"queue"](function(){var j=c.extend({},e),i,o=this.nodeType===1&&c(this).is(":hidden"),k=this;for(i in a){var n=i.replace(ia,ja);if(i!==n){a[n]=a[i];delete a[i];i=n}if(a[i]==="hide"&&o||a[i]==="show"&&!o)return j.complete.call(this);if((i==="height"||i==="width")&&this.style){j.display=c.css(this,"display");j.overflow=this.style.overflow}if(c.isArray(a[i])){(j.specialEasing=
-j.specialEasing||{})[i]=a[i][1];a[i]=a[i][0]}}if(j.overflow!=null)this.style.overflow="hidden";j.curAnim=c.extend({},a);c.each(a,function(r,u){var z=new c.fx(k,j,r);if(Ab.test(u))z[u==="toggle"?o?"show":"hide":u](a);else{var C=Bb.exec(u),B=z.cur(true)||0;if(C){u=parseFloat(C[2]);var E=C[3]||"px";if(E!=="px"){k.style[r]=(u||1)+E;B=(u||1)/z.cur(true)*B;k.style[r]=B+E}if(C[1])u=(C[1]==="-="?-1:1)*u+B;z.custom(B,u,E)}else z.custom(B,u,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);
-this.each(function(){for(var f=d.length-1;f>=0;f--)if(d[f].elem===this){b&&d[f](true);d.splice(f,1)}});b||this.dequeue();return this}});c.each({slideDown:K("show",1),slideUp:K("hide",1),slideToggle:K("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(a,b){c.fn[a]=function(d,f){return this.animate(b,d,f)}});c.extend({speed:function(a,b,d){var f=a&&typeof a==="object"?a:{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};f.duration=c.fx.off?0:typeof f.duration===
-"number"?f.duration:c.fx.speeds[f.duration]||c.fx.speeds._default;f.old=f.complete;f.complete=function(){f.queue!==false&&c(this).dequeue();c.isFunction(f.old)&&f.old.call(this)};return f},easing:{linear:function(a,b,d,f){return d+f*a},swing:function(a,b,d,f){return(-Math.cos(a*Math.PI)/2+0.5)*f+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||
-c.fx.step._default)(this);if((this.prop==="height"||this.prop==="width")&&this.elem.style)this.elem.style.display="block"},cur:function(a){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];return(a=parseFloat(c.css(this.elem,this.prop,a)))&&a>-10000?a:parseFloat(c.curCSS(this.elem,this.prop))||0},custom:function(a,b,d){function f(j){return e.step(j)}this.startTime=J();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;
-this.pos=this.state=0;var e=this;f.elem=this.elem;if(f()&&c.timers.push(f)&&!W)W=setInterval(c.fx.tick,13)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(a){var b=J(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=
-this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var f in this.options.curAnim)if(this.options.curAnim[f]!==true)d=false;if(d){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;a=c.data(this.elem,"olddisplay");this.elem.style.display=a?a:this.options.display;if(c.css(this.elem,"display")==="none")this.elem.style.display="block"}this.options.hide&&c(this.elem).hide();if(this.options.hide||this.options.show)for(var e in this.options.curAnim)c.style(this.elem,
-e,this.options.orig[e]);this.options.complete.call(this.elem)}return false}else{e=b-this.startTime;this.state=e/this.options.duration;a=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||a](this.state,e,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a=c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||
-c.fx.stop()},stop:function(){clearInterval(W);W=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a===b.elem}).length};c.fn.offset="getBoundingClientRect"in s.documentElement?
-function(a){var b=this[0];if(a)return this.each(function(e){c.offset.setOffset(this,a,e)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);var d=b.getBoundingClientRect(),f=b.ownerDocument;b=f.body;f=f.documentElement;return{top:d.top+(self.pageYOffset||c.support.boxModel&&f.scrollTop||b.scrollTop)-(f.clientTop||b.clientTop||0),left:d.left+(self.pageXOffset||c.support.boxModel&&f.scrollLeft||b.scrollLeft)-(f.clientLeft||b.clientLeft||0)}}:function(a){var b=
-this[0];if(a)return this.each(function(r){c.offset.setOffset(this,a,r)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d=b.offsetParent,f=b,e=b.ownerDocument,j,i=e.documentElement,o=e.body;f=(e=e.defaultView)?e.getComputedStyle(b,null):b.currentStyle;for(var k=b.offsetTop,n=b.offsetLeft;(b=b.parentNode)&&b!==o&&b!==i;){if(c.offset.supportsFixedPosition&&f.position==="fixed")break;j=e?e.getComputedStyle(b,null):b.currentStyle;
-k-=b.scrollTop;n-=b.scrollLeft;if(b===d){k+=b.offsetTop;n+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(b.nodeName))){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=d;d=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&j.overflow!=="visible"){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=j}if(f.position==="relative"||f.position==="static"){k+=o.offsetTop;n+=o.offsetLeft}if(c.offset.supportsFixedPosition&&
-f.position==="fixed"){k+=Math.max(i.scrollTop,o.scrollTop);n+=Math.max(i.scrollLeft,o.scrollLeft)}return{top:k,left:n}};c.offset={initialize:function(){var a=s.body,b=s.createElement("div"),d,f,e,j=parseFloat(c.curCSS(a,"marginTop",true))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
-a.insertBefore(b,a.firstChild);d=b.firstChild;f=d.firstChild;e=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=f.offsetTop!==5;this.doesAddBorderForTableAndCells=e.offsetTop===5;f.style.position="fixed";f.style.top="20px";this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15;f.style.position=f.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==j;a.removeChild(b);
-c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.curCSS(a,"marginTop",true))||0;d+=parseFloat(c.curCSS(a,"marginLeft",true))||0}return{top:b,left:d}},setOffset:function(a,b,d){if(/static/.test(c.curCSS(a,"position")))a.style.position="relative";var f=c(a),e=f.offset(),j=parseInt(c.curCSS(a,"top",true),10)||0,i=parseInt(c.curCSS(a,"left",true),10)||0;if(c.isFunction(b))b=b.call(a,
-d,e);d={top:b.top-e.top+j,left:b.left-e.left+i};"using"in b?b.using.call(a,d):f.css(d)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),f=/^body|html$/i.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.curCSS(a,"marginTop",true))||0;d.left-=parseFloat(c.curCSS(a,"marginLeft",true))||0;f.top+=parseFloat(c.curCSS(b[0],"borderTopWidth",true))||0;f.left+=parseFloat(c.curCSS(b[0],"borderLeftWidth",true))||0;return{top:d.top-
-f.top,left:d.left-f.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||s.body;a&&!/^body|html$/i.test(a.nodeName)&&c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(f){var e=this[0],j;if(!e)return null;if(f!==w)return this.each(function(){if(j=wa(this))j.scrollTo(!a?f:c(j).scrollLeft(),a?f:c(j).scrollTop());else this[d]=f});else return(j=wa(e))?"pageXOffset"in j?j[a?"pageYOffset":
-"pageXOffset"]:c.support.boxModel&&j.document.documentElement[d]||j.document.body[d]:e[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase();c.fn["inner"+b]=function(){return this[0]?c.css(this[0],d,false,"padding"):null};c.fn["outer"+b]=function(f){return this[0]?c.css(this[0],d,false,f?"margin":"border"):null};c.fn[d]=function(f){var e=this[0];if(!e)return f==null?null:this;if(c.isFunction(f))return this.each(function(j){var i=c(this);i[d](f.call(this,j,i[d]()))});return"scrollTo"in
-e&&e.document?e.document.compatMode==="CSS1Compat"&&e.document.documentElement["client"+b]||e.document.body["client"+b]:e.nodeType===9?Math.max(e.documentElement["client"+b],e.body["scroll"+b],e.documentElement["scroll"+b],e.body["offset"+b],e.documentElement["offset"+b]):f===w?c.css(e,d):this.css(d,typeof f==="string"?f:f+"px")}});A.jQuery=A.$=c})(window);
+(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!cj[a]){var b=f("<"+a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d===""){ck||(ck=c.createElement("iframe"),ck.frameBorder=ck.width=ck.height=0),c.body.appendChild(ck);if(!cl||!ck.createElement)cl=(ck.contentWindow||ck.contentDocument).document,cl.write("<!doctype><html><body></body></html>");b=cl.createElement(a),cl.body.appendChild(b),d=f.css(b,"display"),c.body.removeChild(ck)}cj[a]=d}return cj[a]}function cu(a,b){var c={};f.each(cp.concat.apply([],cp.slice(0,b)),function(){c[this]=a});return c}function ct(){cq=b}function cs(){setTimeout(ct,0);return cq=f.now()}function ci(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ch(){try{return new a.XMLHttpRequest}catch(b){}}function cb(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function ca(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function b_(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bF.test(a)?d(a,e):b_(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)b_(a+"["+e+"]",b[e],c,d);else d(a,b)}function b$(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bU,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=b$(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=b$(a,c,d,e,"*",g));return l}function bZ(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bQ),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bD(a,b,c){var d=b==="width"?bx:by,e=b==="width"?a.offsetWidth:a.offsetHeight;if(c==="border")return e;f.each(d,function(){c||(e-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?e+=parseFloat(f.css(a,"margin"+this))||0:e-=parseFloat(f.css(a,"border"+this+"Width"))||0});return e}function bn(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(bf,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bm(a){f.nodeName(a,"input")?bl(a):a.getElementsByTagName&&f.grep(a.getElementsByTagName("input"),bl)}function bl(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bk(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bj(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bi(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bh(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function X(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(S.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function W(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function O(a,b){return(a&&a!=="*"?a+".":"")+b.replace(A,"`").replace(B,"&")}function N(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(y,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function L(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function F(){return!0}function E(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function H(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(H,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=d.userAgent,x,y,z,A=Object.prototype.toString,B=Object.prototype.hasOwnProperty,C=Array.prototype.push,D=Array.prototype.slice,E=String.prototype.trim,F=Array.prototype.indexOf,G={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.1",length:0,size:function(){return this.length},toArray:function(){return D.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?C.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),y.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(D.apply(this,arguments),"slice",D.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:C,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;y.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!y){y=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",z,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",z),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&H()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):G[A.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!B.call(a,"constructor")&&!B.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||B.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:E?function(a){return a==null?"":E.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?C.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(F)return F.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=D.call(arguments,2),g=function(){return a.apply(c,f.concat(D.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){G["[object "+b+"]"]=b.toLowerCase()}),x=e.uaMatch(w),x.browser&&(e.browser[x.browser]=!0,e.browser.version=x.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?z=function(){c.removeEventListener("DOMContentLoaded",z,!1),e.ready()}:c.attachEvent&&(z=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",z),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};f=c.createElement("select"),g=f.appendChild(c.createElement("option")),h=a.getElementsByTagName("input")[0],j={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:h.value==="on",optSelected:g.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},h.checked=!0,j.noCloneChecked=h.cloneNode(!0).checked,f.disabled=!0,j.optDisabled=!g.disabled;try{delete a.test}catch(s){j.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function b(){j.noCloneEvent=!1,a.detachEvent("onclick",b)}),a.cloneNode(!0).fireEvent("onclick")),h=c.createElement("input"),h.value="t",h.setAttribute("type","radio"),j.radioValue=h.value==="t",h.setAttribute("checked","checked"),a.appendChild(h),k=c.createDocumentFragment(),k.appendChild(a.firstChild),j.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",l=c.createElement("body"),m={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"};for(q in m)l.style[q]=m[q];l.appendChild(a),b.insertBefore(l,b.firstChild),j.appendChecked=h.checked,j.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,j.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",j.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",n=a.getElementsByTagName("td"),r=n[0].offsetHeight===0,n[0].style.display="",n[1].style.display="none",j.reliableHiddenOffsets=r&&n[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(i=c.createElement("div"),i.style.width="0",i.style.marginRight="0",a.appendChild(i),j.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(i,null)||{marginRight:0}).marginRight,10)||0)===0),l.innerHTML="",b.removeChild(l);if(a.attachEvent)for(q in{submit:1,change:1,focusin:1})p="on"+q,r=p in a,r||(a.setAttribute(p,"return;"),r=typeof a[p]=="function"),j[q+"Bubbles"]=r;return j}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.addClass(a.call(this,b,c.attr("class")||""))});if(a&&typeof a=="string"){var b=(a||"").split(o);for(var c=0,d=this.length;c<d;c++){var e=this[c];if(e.nodeType===1)if(!e.className)e.className=a;else{var g=" "+e.className+" ",h=e.className;for(var i=0,j=b.length;i<j;i++)g.indexOf(" "+b[i]+" ")<0&&(h+=" "+b[i]);e.className=f.trim(h)}}}return this},removeClass:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.removeClass(a.call(this,b,c.attr("class")))});if(a&&typeof a=="string"||a===b){var c=(a||"").split(o);for(var d=0,e=this.length;d<e;d++){var g=this[d];if(g.nodeType===1&&g.className)if(a){var h=(" "+g.className+" ").replace(n," ");for(var i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){var d=f(this);d.toggleClass(a.call(this,c,d.attr("class"),b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;return(e.value||"").replace(p,"")}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);c=j&&f.attrFix[c]||c,i=f.attrHooks[c],i||(!t.test(c)||typeof d!="boolean"&&d!==b&&d.toLowerCase()!==c.toLowerCase()?v&&(f.nodeName(a,"form")||u.test(c))&&(i=v):i=w);if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j)return i.get(a,c);h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);c=i&&f.propFix[c]||c,h=f.propHooks[c];return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return a[f.propFix[c]||c]?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=b),a.setAttribute(c,c.toLowerCase()));return c}},f.attrHooks.value={get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return a.value},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=Object.prototype.hasOwnProperty,y=/\.(.*)$/,z=/^(?:textarea|input|select)$/i,A=/\./g,B=/ /g,C=/[^\w\s.|`]/g,D=function(a){return a.replace(C,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=E;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=E);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),D).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem
+)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,O(a.origType,a.selector),f.extend({},a,{handler:N,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,O(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?F:E):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=F;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=F;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=F,this.stopPropagation()},isDefaultPrevented:E,isPropagationStopped:E,isImmediatePropagationStopped:E};var G=function(a){var b=a.relatedTarget;a.type=a.data;try{if(b&&b!==c&&!b.parentNode)return;while(b&&b!==this)b=b.parentNode;b!==this&&f.event.handle.apply(this,arguments)}catch(d){}},H=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?H:G,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?H:G)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&L("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&L("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var I,J=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},K=function(c){var d=c.target,e,g;if(!!z.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=J(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:K,beforedeactivate:K,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&K.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&K.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",J(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in I)f.event.add(this,c+".specialChange",I[c]);return z.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return z.test(this.nodeName)}},I=f.event.special.change.filters,I.focus=I.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var M={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||E,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=y.exec(h),k="",j&&(k=j[0],h=h.replace(y,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,M[h]?(a.push(M[h]+k),h=h+k):h=(M[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+O(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+O(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var P=/Until$/,Q=/^(?:parents|prevUntil|prevAll)/,R=/,/,S=/^.[^:#\[\.,]*$/,T=Array.prototype.slice,U=f.expr.match.POS,V={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(X(this,a,!1),"not",a)},filter:function(a){return this.pushStack(X(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=U.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=U.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(W(c[0])||W(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=T.call(arguments);P.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!V[a]?f.unique(e):e,(this.length>1||R.test(d))&&Q.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var Y=/ jQuery\d+="(?:\d+|null)"/g,Z=/^\s+/,$=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,_=/<([\w:]+)/,ba=/<tbody/i,bb=/<|&#?\w+;/,bc=/<(?:script|object|embed|option|style)/i,bd=/checked\s*(?:[^=]|=\s*.checked.)/i,be=/\/(java|ecma)script/i,bf=/^\s*<!(?:\[CDATA\[|\-\-)/,bg={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Y,""):null;if(typeof a=="string"&&!bc.test(a)&&(f.support.leadingWhitespace||!Z.test(a))&&!bg[(_.exec(a)||["",""])[1].toLowerCase()]){a=a.replace($,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bd.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bh(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bn)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i=b&&b[0]?b[0].ownerDocument||b[0]:c;a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bc.test(a[0])&&(f.support.checkClone||!bd.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bj(a,d),e=bk(a),g=bk(d);for(h=0;e[h];++h)bj(e[h],g[h])}if(b){bi(a,d);if(c){e=bk(a),g=bk(d);for(h=0;e[h];++h)bi(e[h],g[h])}}return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||
+b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!bb.test(k))k=b.createTextNode(k);else{k=k.replace($,"<$1></$2>");var l=(_.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=ba.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Z.test(k)&&o.insertBefore(b.createTextNode(Z.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bm(k[i]);else bm(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||be.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bo=/alpha\([^)]*\)/i,bp=/opacity=([^)]*)/,bq=/-([a-z])/ig,br=/([A-Z]|^ms)/g,bs=/^-?\d+(?:px)?$/i,bt=/^-?\d/,bu=/^[+\-]=/,bv=/[^+\-\.\de]+/g,bw={position:"absolute",visibility:"hidden",display:"block"},bx=["Left","Right"],by=["Top","Bottom"],bz,bA,bB,bC=function(a,b){return b.toUpperCase()};f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bz(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{zIndex:!0,fontWeight:!0,opacity:!0,zoom:!0,lineHeight:!0,widows:!0,orphans:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bu.test(d)&&(d=+d.replace(bv,"")+parseFloat(f.css(a,c))),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bz)return bz(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]},camelCase:function(a){return a.replace(bq,bC)}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){a.offsetWidth!==0?e=bD(a,b,d):f.swap(a,bw,function(){e=bD(a,b,d)});if(e<=0){e=bz(a,b,b),e==="0px"&&bB&&(e=bB(a,b,b));if(e!=null)return e===""||e==="auto"?"0px":e}if(e<0||e==null){e=a.style[b];return e===""||e==="auto"?"0px":e}return typeof e=="string"?e:e+"px"}},set:function(a,b){if(!bs.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bp.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bo.test(g)?g.replace(bo,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,c){var d,e,g;c=c.replace(br,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bs.test(d)&&bt.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bE=/%20/g,bF=/\[\]$/,bG=/\r?\n/g,bH=/#.*$/,bI=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bJ=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bK=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bL=/^(?:GET|HEAD)$/,bM=/^\/\//,bN=/\?/,bO=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bP=/^(?:select|textarea)/i,bQ=/\s+/,bR=/([?&])_=[^&]*/,bS=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bT=f.fn.load,bU={},bV={},bW,bX;try{bW=e.href}catch(bY){bW=c.createElement("a"),bW.href="",bW=bW.href}bX=bS.exec(bW.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bT)return bT.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bO,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bP.test(this.nodeName)||bJ.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bG,"\r\n")}}):{name:b.name,value:c.replace(bG,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bW,isLocal:bK.test(bX[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bZ(bU),ajaxTransport:bZ(bV),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?ca(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=cb(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bI.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bH,"").replace(bM,bX[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bQ),d.crossDomain==null&&(r=bS.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bX[1]&&r[2]==bX[2]&&(r[3]||(r[1]==="http:"?80:443))==(bX[3]||(bX[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bU,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bL.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bN.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bR,"$1_="+x);d.url=y+(y===d.url?(bN.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bV,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)b_(g,a[g],c,e);return d.join("&").replace(bE,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cc=f.now(),cd=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cc++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(cd.test(b.url)||e&&cd.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(cd,l),b.url===j&&(e&&(k=k.replace(cd,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var ce=a.ActiveXObject?function(){for(var a in cg)cg[a](0,1)}:!1,cf=0,cg;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ch()||ci()}:ch,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,ce&&delete cg[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cf,ce&&(cg||(cg={},f(a).unload(ce)),cg[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cj={},ck,cl,cm=/^(?:toggle|show|hide)$/,cn=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,co,cp=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cq,cr=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cv(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cu("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cu("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cv(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cm.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=cn.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cu("show",1),slideUp:cu("hide",1),slideToggle:cu("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this),f.isFunction(d.old)&&d.old.call(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cq||cs(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!co&&(cr?(co=1,g=function(){co&&(cr(g),e.tick())},cr(g)):co=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cq||cs(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(co),co=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var cw=/^t(?:able|d|h)$/i,cx=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cy(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!cw.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){return this[0]?parseFloat(f.css(this[0],d,"padding")):null},f.fn["outer"+c]=function(a){return this[0]?parseFloat(f.css(this[0],d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window); \ No newline at end of file
diff --git a/lib/scripts/jquery/update.sh b/lib/scripts/jquery/update.sh
new file mode 100755
index 000000000..38f38bece
--- /dev/null
+++ b/lib/scripts/jquery/update.sh
@@ -0,0 +1,25 @@
+#!/bin/sh
+#
+# This script loads the latest jQuery and jQuery-UI 1.* versions from Google's CDN
+#
+# It also loads the 'smoothness' jQuery-UI theme and all referenced images.
+#
+# @author Andreas Gohr <andi@splitbrain.org>
+# @link https://code.google.com/apis/libraries/devguide.html#jquery
+
+# load jQuery
+wget -nv https://ajax.googleapis.com/ajax/libs/jquery/1/jquery.min.js -O jquery.min.js
+wget -nv https://ajax.googleapis.com/ajax/libs/jquery/1/jquery.js -O jquery.js
+
+# load jQuery-UI
+wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/jquery-ui.min.js -O jquery-ui.min.js
+wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/jquery-ui.js -O jquery-ui.js
+
+# load the smoothness theme
+mkdir -p jquery-ui-theme/images
+wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/themes/smoothness/jquery-ui.css -O jquery-ui-theme/smoothness.css
+images=`gawk 'match($0, /url\((images\/[^\)]+)\)/, m) { print m[1] }' jquery-ui-theme/smoothness.css`
+for img in $images
+do
+ wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/themes/smoothness/$img -O jquery-ui-theme/$img
+done