Merge branch 'jquery'

Conflicts:
	lib/scripts/edit.js
	lib/scripts/locktimer.js

Some whitespace (at end of line) cleanup

34 files changed, 9047 insertions, 1176 deletions

diff --git a/lib/exe/js.php b/lib/exe/js.php
index b2ae3f7fe..a3efff700 100644
--- a/lib/exe/js.php
+++ b/lib/exe/js.php
@@ -34,8 +34,19 @@ function js_out(){
     // The generated script depends on some dynamic options
     $cache = getCacheName('scripts'.$_SERVER['HTTP_HOST'].$_SERVER['SERVER_PORT'],'.js');
 
+    // load jQuery, minified if compression is eanbled.
+    $jquery_file_path = DOKU_INC.'lib/scripts/jquery/jquery';
+    if($conf['compress']) {
+        $jquery_file_path .= '.min';
+    }
+    $jquery_file_path .= '.js';
+
     // array of core files
     $files = array(
+                $jquery_file_path,
+                DOKU_INC.'lib/scripts/jquery/jquery.cookie.js',
+                DOKU_INC.'lib/scripts/jquery-ui/jquery-ui.core.min.js',
+                DOKU_INC.'lib/scripts/jquery-ui/jquery-ui.interactions.min.js',
                 DOKU_INC.'lib/scripts/helpers.js',
                 DOKU_INC.'lib/scripts/events.js',
                 DOKU_INC.'lib/scripts/delay.js',
diff --git a/lib/scripts/ajax.js b/lib/scripts/ajax.js
index 44dcee999..aa083978c 100644
--- a/lib/scripts/ajax.js
+++ b/lib/scripts/ajax.js
@@ -4,67 +4,82 @@
  * @license  GPL2 (http://www.gnu.org/licenses/gpl.html)
  * @author   Andreas Gohr <andi@splitbrain.org>
  * @author   Adrian Lang <lang@cosmocode.de>
+ * @author   Michal Rezler <m.rezler@centrum.cz>
  */
-var ajax_quicksearch = {
 
-    inObj:   null,
-    outObj:  null,
-    sackObj: null,
-    delay:   null,
+ (function ($) {
+    var init, clear_results, onCompletion;
 
-    init: function(inID, outID) {
+    var ajax_quicksearch = {
+        inObj: null,
+        outObj: null,
+        delay: null,
+    };
 
-        this.inObj  = $(inID);
-        this.outObj = $(outID);
+    init = function(inID, outID) {
 
-        // objects found?
-        if (this.inObj  === null) return;
-        if (this.outObj === null) return;
+        ajax_quicksearch.inObj  = $(inID);
+        ajax_quicksearch.outObj = $(outID);
 
-        // prepare AJAX
-        this.sackObj = new sack(DOKU_BASE + 'lib/exe/ajax.php');
-        this.sackObj.AjaxFailedAlert = '';
-        this.sackObj.encodeURIString = false;
-        this.sackObj.onCompletion = ajax_quicksearch.onCompletion;
+        // objects found?
+        if (ajax_quicksearch.inObj  === null) return;
+        if (ajax_quicksearch.outObj === null) return;
 
         // attach eventhandler to search field
-        this.delay = new Delay(function () {
+        ajax_quicksearch.delay = new Delay(function () {
             ajax_quicksearch.clear_results();
             var value = ajax_quicksearch.inObj.value;
             if(value === ''){ return; }
-            ajax_quicksearch.sackObj.runAJAX('call=qsearch&q=' + encodeURI(value));
+            $.post(
+                DOKU_BASE + 'lib/exe/ajax.php',
+                {
+                    call: 'qsearch',
+                    q: encodeURI(value)
+                },
+                function (data) {
+                    onCompletion(data);
+                },
+                'html'
+            );
         });
 
-        addEvent(this.inObj, 'keyup', function () {
-            ajax_quicksearch.clear_results();
-            ajax_quicksearch.delay.start();
-        });
+        $(ajax_quicksearch.inObj).keyup(
+            function() {
+                ajax_quicksearch.clear_results();
+                ajax_quicksearch.delay.start();
+            }
+        );
 
         // attach eventhandler to output field
-        addEvent(this.outObj, 'click', function () {
-            ajax_quicksearch.outObj.style.display = 'none';
-        });
-    },
+        $(ajax_quicksearch.outObj).click(
+            function() {
+                ajax_quicksearch.outObj.hide();
+            }
+        );
 
-    clear_results: function(){
-        ajax_quicksearch.outObj.style.display = 'none';
-        ajax_quicksearch.outObj.innerHTML = '';
-    },
+    };
 
-    onCompletion: function() {
-        var data = this.response; // 'this' is sack context
+    clear_results = function(){
+        ajax_quicksearch.outObj.hide();
+        ajax_quicksearch.outObj.text('');
+    };
+
+    onCompletion = function(data) {
         if (data === '') { return; }
 
         var outObj = ajax_quicksearch.outObj;
 
-        outObj.innerHTML = data;
-        outObj.style.display = 'block';
-        outObj.style['white-space'] = 'nowrap';
+        outObj.text(data);
+        outObj.show();
+        outObj.css('white-space', 'nowrap');
 
         // shorten namespaces if too long
         var width = outObj.clientWidth;
-        var links = outObj.getElementsByTagName('a');
-        for(var i=0; i<links.length; i++){
+        var links = $('ajax_quicksearch outObj a');
+
+        for (var i=0; i<links.length; i++) {
+            var content = links[i].text();
+
             // maximum allowed width:
             var max = width - links[i].offsetLeft;
             var isRTL = (document.documentElement.dir == 'rtl');
@@ -72,47 +87,44 @@ var ajax_quicksearch = {
             if(!isRTL && links[i].offsetWidth < max) continue;
             if(isRTL && links[i].offsetLeft > 0) continue;
 
-            var nsL = links[i].innerText.indexOf('(');
-            var nsR = links[i].innerText.indexOf(')');
+            var nsL = content.indexOf('(');
+            var nsR = content.indexOf(')');
             var eli = 0;
             var runaway = 0;
 
-            while( (nsR - nsL > 3) &&
+            while((nsR - nsL > 3) &&
                     (
                        (!isRTL && links[i].offsetWidth > max) ||
                        (isRTL && links[i].offsetLeft < 0)
                     )
                  ){
+
                 if(runaway++ > 500) return; // just in case something went wrong
 
                 if(eli){
                     // elipsis already inserted
                     if( (eli - nsL) > (nsR - eli) ){
                         // cut left
-                        links[i].innerText = links[i].innerText.substring(0,eli-2)+
-                                             links[i].innerText.substring(eli);
+                        content = content.substring(0,eli-2) + content.substring(eli);
                     }else{
                         // cut right
-                        links[i].innerText = links[i].innerText.substring(0,eli+1)+
-                                             links[i].innerText.substring(eli+2);
+                        content = content.substring(0,eli+1) + content.substring(eli+2);
                     }
                 }else{
                     // replace middle with ellipsis
                     var mid = Math.floor( nsL + ((nsR-nsL)/2) );
-                    links[i].innerText = links[i].innerText.substring(0,mid)+'…'+
-                                         links[i].innerText.substring(mid+1);
+                    content = content.substring(0,mid)+'…' + content.substring(mid+1);
                 }
-                eli = links[i].innerText.indexOf('…');
-                nsL = links[i].innerText.indexOf('(');
-                nsR = links[i].innerText.indexOf(')');
+
+                eli = content.indexOf('…');
+                nsL = content.indexOf('(');
+                nsR = content.indexOf(')');
             }
         }
-    }
-
-};
-
+    };
 
-addInitEvent(function(){
-    ajax_quicksearch.init('qsearch__in','qsearch__out');
-});
+    $(function () {
+        init('qsearch__in','qsearch__out');
+    });
 
+}(jQuery));
diff --git a/lib/scripts/cookie.js b/lib/scripts/cookie.js
index d7e6b3550..f7d9b5ffb 100644
--- a/lib/scripts/cookie.js
+++ b/lib/scripts/cookie.js
@@ -1,13 +1,14 @@
 /**
- * Handles the cookie used by several JavaScript functions
- *
- * Only a single cookie is written and read. You may only save
- * sime name-value pairs - no complex types!
- *
- * You should only use the getValue and setValue methods
- *
- * @author Andreas Gohr <andi@splitbrain.org>
- */
+* Handles the cookie used by several JavaScript functions
+*
+* Only a single cookie is written and read. You may only save
+* sime name-value pairs - no complex types!
+*
+* You should only use the getValue and setValue methods
+*
+* @author Andreas Gohr <andi@splitbrain.org>
+* @author Michal Rezler <m.rezler@centrum.cz>
+*/
 DokuCookie = {
     data: Array(),
     name: 'DOKU_PREFS',
@@ -18,21 +19,21 @@ DokuCookie = {
      * @author Andreas Gohr <andi@splitbrain.org>
      */
     setValue: function(key,val){
-        DokuCookie.init();
-        DokuCookie.data[key] = val;
+        this.init();
+        this.data[key] = val;
 
         // prepare expire date
         var now = new Date();
-        DokuCookie.fixDate(now);
+        this.fixDate(now);
         now.setTime(now.getTime() + 365 * 24 * 60 * 60 * 1000); //expire in a year
 
         //save the whole data array
         var text = '';
-        for(var key in DokuCookie.data){
-            if (!DokuCookie.data.hasOwnProperty(key)) continue;
-            text += '#'+escape(key)+'#'+DokuCookie.data[key];
+        for(var key in this.data){
+            if (!this.data.hasOwnProperty(key)) continue;
+            text += '#'+escape(key)+'#'+this.data[key];
         }
-        DokuCookie.setCookie(DokuCookie.name,text.substr(1),now,DOKU_BASE);
+        this.setCookie(this.name,text.substr(1),now,DOKU_BASE);
     },
 
     /**
@@ -41,8 +42,8 @@ DokuCookie = {
      * @author Andreas Gohr <andi@splitbrain.org>
      */
     getValue: function(key){
-        DokuCookie.init();
-        return DokuCookie.data[key];
+        this.init();
+        return this.data[key];
     },
 
     /**
@@ -51,12 +52,12 @@ DokuCookie = {
      * @author Andreas Gohr <andi@splitbrain.org>
      */
     init: function(){
-        if(DokuCookie.data.length) return;
-        var text  = DokuCookie.getCookie(DokuCookie.name);
+        if(this.data.length) return;
+        var text = this.getCookie(this.name);
         if(text){
             var parts = text.split('#');
             for(var i=0; i<parts.length; i+=2){
-                DokuCookie.data[unescape(parts[i])] = unescape(parts[i+1]);
+                this.data[unescape(parts[i])] = unescape(parts[i+1]);
             }
         }
     },
@@ -66,13 +67,15 @@ DokuCookie = {
      *
      * @link http://www.webreference.com/js/column8/functions.html
      */
-    setCookie: function(name, value, expires, path, domain, secure) {
-        var curCookie = name + "=" + escape(value) +
-            ((expires) ? "; expires=" + expires.toGMTString() : "") +
-            ((path) ? "; path=" + path : "") +
-            ((domain) ? "; domain=" + domain : "") +
-            ((secure) ? "; secure" : "");
-        document.cookie = curCookie;
+    setCookie: function(name, value, expires_, path_, domain_, secure_) {
+        var params = {
+            expires: expires_,
+            path: path_,
+            domain: domain_,
+            secure: secure_,
+        };
+
+        jQuery.cookie(name, value, params);
     },
 
     /**
@@ -81,20 +84,7 @@ DokuCookie = {
      * @link http://www.webreference.com/js/column8/functions.html
      */
     getCookie: function(name) {
-        var dc = document.cookie;
-        var prefix = name + "=";
-        var begin = dc.indexOf("; " + prefix);
-        if (begin == -1) {
-            begin = dc.indexOf(prefix);
-            if (begin !== 0){ return null; }
-        } else {
-            begin += 2;
-        }
-        var end = document.cookie.indexOf(";", begin);
-        if (end == -1){
-            end = dc.length;
-        }
-        return unescape(dc.substring(begin + prefix.length, end));
+        return unescape(jQuery.cookie(name));
     },
 
     /**
diff --git a/lib/scripts/edit.js b/lib/scripts/edit.js
index a96a346dc..a9623e14d 100644
--- a/lib/scripts/edit.js
+++ b/lib/scripts/edit.js
@@ -11,37 +11,41 @@
  * Style the buttons through the toolbutton class
  *
  * @author Andreas Gohr <andi@splitbrain.org>
+ * @author Michal Rezler <m.rezler@centrum.cz>
  */
 function createToolButton(icon,label,key,id,classname){
-    var btn = document.createElement('button');
-    var ico = document.createElement('img');
+    var $ = jQuery;
+    var btn = $('<button>');
+    var ico = $('<img />');
 
     // preapare the basic button stuff
-    btn.className = 'toolbutton';
+    btn.attr('class', 'toolbutton');
     if(classname){
-        btn.className += ' '+classname;
+        btn.attr('class', 'toolbutton '+classname);
     }
-    btn.title = label;
+
+    btn.attr('title', label);
     if(key){
-        btn.title += ' ['+key.toUpperCase()+']';
-        btn.accessKey = key;
+        btn.attr('title', label + ' ['+key.toUpperCase()+']')
+            .attr('accessKey', key);
     }
 
     // set IDs if given
     if(id){
-        btn.id = id;
-        ico.id = id+'_ico';
+        btn.attr('id', id);
+        ico.attr('id', id+'_ico');
     }
 
     // create the icon and add it to the button
     if(icon.substr(0,1) == '/'){
-        ico.src = icon;
+        ico.attr('src', icon);
     }else{
-        ico.src = DOKU_BASE+'lib/images/toolbar/'+icon;
+        ico.attr('src', DOKU_BASE+'lib/images/toolbar/'+icon);
     }
-    btn.appendChild(ico);
+    btn.append(ico);
 
-    return btn;
+    // we have to return a javascript object (for compatibility reasons)
+    return btn[0];
 }
 
 /**
@@ -60,45 +64,56 @@ function createToolButton(icon,label,key,id,classname){
  */
 function createPicker(id,props,edid){
     var icobase = props['icobase'];
-    var list    = props['list'];
+    var list = props['list'];
+    var $ = jQuery;
 
     // create the wrapping div
-    var picker            = document.createElement('div');
-    picker.className      = 'picker';
+    var picker = $('<div></div>');
+
+    var className = 'picker';
     if(props['class']){
-        picker.className += ' '+props['class'];
+        className += ' '+props['class'];
     }
-    picker.id               = id;
-    picker.style.position   = 'absolute';
-    picker.style.marginLeft = '-10000px'; // no display:none, to keep access keys working
-    picker.style.marginTop  = '-10000px';
+
+    picker.attr('class', className)
+        .attr('id', id)
+        .css('position', 'absolute')
+        .css('marginLeft', '-10000px') // no display:none, to keep access keys working
+        .css('marginTop', '-10000px');
 
     for(var key in list){
         if (!list.hasOwnProperty(key)) continue;
 
         if(isNaN(key)){
             // associative array -> treat as image/value pairs
-            var btn = document.createElement('button');
-            btn.className = 'pickerbutton';
-            var ico = document.createElement('img');
-            if(list[key].substr(0,1) == '/'){
-                ico.src = list[key];
-            }else{
-                ico.src = DOKU_BASE+'lib/images/'+icobase+'/'+list[key];
+            var btn = $('<button>');
+            btn.attr('class', 'pickerbutton')
+                .attr('title', key);
+
+            var ico = $('<img>');
+            if (list[key].substr(0,1) == '/') {
+                var src = list[key];
+            } else {
+                var src = DOKU_BASE+'lib/images/'+icobase+'/'+list[key];
             }
-            btn.title     = key;
-            btn.appendChild(ico);
-            addEvent(btn,'click',bind(pickerInsert,key,edid));
-            picker.appendChild(btn);
-        }else if(isString(list[key])){
+
+            ico.attr('src', src);
+            btn.append(ico);
+
+            btn.bind('click', bind(pickerInsert, key, edid));
+            picker.append(btn);
+        }else if (typeof (list[key]) == 'string'){
             // a list of text -> treat as text picker
-            var btn = document.createElement('button');
-            btn.className = 'pickerbutton';
-            var txt = document.createTextNode(list[key]);
-            btn.title     = list[key];
-            btn.appendChild(txt);
-            addEvent(btn,'click',bind(pickerInsert,list[key],edid));
-            picker.appendChild(btn);
+            var btn = $('<button>');
+            btn.attr('class', 'pickerbutton')
+                .attr('title', list[key]);
+
+            var txt = $(document.createTextNode(list[key]));
+            btn.append(txt);
+
+            btn.bind('click', bind(pickerInsert, list[key], edid));
+
+            picker.append(btn);
         }else{
             // a list of lists -> treat it as subtoolbar
             initToolbar(picker,edid,list);
@@ -106,9 +121,11 @@ function createPicker(id,props,edid){
         }
 
     }
-    var body = document.getElementsByTagName('body')[0];
-    body.appendChild(picker);
-    return picker;
+    var body = $('body');
+    body.append(picker);
+
+    // we have to return a javascript object (for compatibility reasons)
+    return picker[0];
 }
 
 /**
@@ -132,7 +149,7 @@ function pickerInsert(text,edid){
  */
 function addBtnActionSignature(btn, props, edid) {
     if(typeof(SIG) != 'undefined' && SIG != ''){
-        addEvent(btn,'click',bind(insertAtCarret,edid,SIG));
+        btn.bind('click', bind(insertAtCarret,edid,SIG));
         return true;
     }
     return false;
@@ -218,19 +235,6 @@ function keyHandler(e){
     }
 }
 
-//FIXME consolidate somewhere else
-addInitEvent(function(){
-    var field = $('wiki__text');
-    if(!field) return;
-    // in Firefox, keypress doesn't send the correct keycodes,
-    // in Opera, the default of keydown can't be prevented
-    if (is_opera) {
-        addEvent(field,'keypress',keyHandler);
-    } else {
-        addEvent(field,'keydown',keyHandler);
-    }
-});
-
 /**
  * Determine the current section level while editing
  *
@@ -271,18 +275,16 @@ function deleteDraft() {
     if (window.keepDraft) return;
 
     // remove a possibly saved draft using ajax
-    var dwform = $('dw__editform');
-    if(dwform){
-        var params = 'call=draftdel';
-        params += '&id='+encodeURIComponent(dwform.elements.id.value);
-
-        var sackobj = new sack(DOKU_BASE + 'lib/exe/ajax.php');
-        // this needs to be synchronous and GET to not be aborted upon page unload
-        sackobj.asynchronous = false;
-        sackobj.method = 'GET';
-        sackobj.AjaxFailedAlert = '';
-        sackobj.encodeURIString = false;
-        sackobj.runAJAX(params);
+    var dwform = jQuery('#dw__editform');
+    if(dwform.length != 0) {
+
+        jQuery.post(
+            DOKU_BASE + 'lib/exe/ajax.php',
+            {
+                call: 'draftdel',
+                id: jQuery('#dw__editform input[name=id]').val()
+            }
+        );
     }
 }
 
@@ -292,28 +294,38 @@ function deleteDraft() {
  *
  * Sets focus to the editbox as well
  */
-addInitEvent(function (){
-    var editform = $('dw__editform');
-    if (!editform) return;
-
-    var edit_text   = $('wiki__text');
-    if(edit_text) {
-        if(edit_text.readOnly) return;
+addInitEvent(function () {
+    var $ = jQuery;
+    var editform = $('#dw__editform');
+    if (editform.length == 0) return;
+
+    var edit_text = $('#wiki__text');
+    if (edit_text.length > 0) {
+        if(edit_text.attr('readOnly')) return;
+
+        // in Firefox, keypress doesn't send the correct keycodes,
+        // in Opera, the default of keydown can't be prevented
+        if (is_opera) {
+            edit_text.keypress(keyHandler);
+        } else {
+            edit_text.keydown(keyHandler);
+        }
 
         // set focus and place cursor at the start
-        var sel = getSelection(edit_text);
+        var sel = getSelection(edit_text.get(0));
         sel.start = 0;
         sel.end   = 0;
         setSelection(sel);
         edit_text.focus();
     }
 
-    var checkfunc = function(){
-        window.textChanged = true; //global var
+    var checkfunc = function() {
+        textChanged = true; //global var
         summaryCheck();
     };
-    addEvent(editform, 'change', checkfunc);
-    addEvent(editform, 'keydown', checkfunc);
+
+    editform.change(checkfunc);
+    editform.keydown(checkfunc);
 
     window.onbeforeunload = function(){
         if(window.textChanged) {
@@ -323,20 +335,25 @@ addInitEvent(function (){
     window.onunload = deleteDraft;
 
     // reset change memory var on submit
-    addEvent($('edbtn__save'), 'click', function(){
-        window.onbeforeunload = '';
-        window.textChanged = false;
-    });
-    addEvent($('edbtn__preview'), 'click', function(){
-        window.onbeforeunload = '';
-        window.textChanged = false;
-        window.keepDraft = true; // needed to keep draft on page unload
-    });
-
-    var summary = $('edit__summary');
-    addEvent(summary, 'change', summaryCheck);
-    addEvent(summary, 'keyup', summaryCheck);
-    if (window.textChanged) summaryCheck();
+    $('#edbtn__save').click(
+        function() {
+            window.onbeforeunload = '';
+            textChanged = false;
+        }
+    );
+    $('#edbtn__preview').click(
+        function() {
+            window.onbeforeunload = '';
+            textChanged = false;
+            window.keepDraft = true; // needed to keep draft on page unload
+        }
+    );
+
+    var summary = $('#edit__summary');
+    summary.change(summaryCheck);
+    summary.keyup(summaryCheck);
+
+    if (textChanged) summaryCheck();
 });
 
 /**
@@ -345,11 +362,11 @@ addInitEvent(function (){
  * @author Andreas Gohr <andi@splitbrain.org>
  */
 function summaryCheck(){
-    var sum = document.getElementById('edit__summary');
-    if(sum.value === ''){
-        sum.className='missing';
-    }else{
-        sum.className='edit';
+    var sum = jQuery('#edit__summary');
+
+    if (sum.val() === '') {
+        sum.attr('class', 'missing');
+    } else{
+        sum.attr('class', 'edit');
     }
 }
-
diff --git a/lib/scripts/index.js b/lib/scripts/index.js
index 9c7943d0c..da9ce96a4 100644
--- a/lib/scripts/index.js
+++ b/lib/scripts/index.js
@@ -1,43 +1,22 @@
+/*jslint white: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: false, strict: true, newcap: true, immed: true */
+/*global jQuery, window, DOKU_BASE*/
+"use strict";
+
 /**
  * Javascript for index view
  *
  * @author Andreas Gohr <andi@splitbrain.org>
+ * @author Pierre Spring <pierre.spring@caillou.ch>
  */
 
-var index = {
+(function ($) {
+    var throbber_delay, toggle;
 
      /**
      * Delay in ms before showing the throbber.
      * Used to skip the throbber for fast AJAX calls.
      */
-    throbber_delay: 500,
-
-    /**
-     * Attach event handlers to all "folders" below the given element
-     *
-     * @author Andreas Gohr <andi@splitbrain.org>
-     */
-    treeattach: function(obj){
-        if(!obj) return;
-
-        var items = getElementsByClass('idx_dir',obj,'a');
-        for(var i=0; i<items.length; i++){
-            var elem = items[i];
-
-            // attach action to make the link clickable by AJAX
-            addEvent(elem,'click',function(e){ return index.toggle(e,this); });
-
-            // get the listitem the elem belongs to
-            var listitem = elem.parentNode;
-            while (listitem.tagName != 'LI') {
-              listitem = listitem.parentNode;
-            }
-            //when there are uls under this listitem mark this listitem as opened
-            if (listitem.getElementsByTagName('ul').length) {
-              listitem.open = true;
-            }
-        }
-    },
+    throbber_delay = 500;
 
     /**
      * Open or close a subtree using AJAX
@@ -46,70 +25,71 @@ var index = {
      *
      * @author Andreas Gohr <andi@splitbrain.org>
      * @author Ben Coburn <btcoburn@silicodon.net>
+     * @author Pierre Spring <pierre.spring@caillou.ch>
      */
-    toggle: function(e,clicky){
-        var listitem = clicky.parentNode.parentNode;
+    toggle = function (e) {
+
+        var listitem, sublist, timeout, ul, clicky;
 
-        listitem.open = !listitem.open;
-        // listitem.open represents now the action to be done
+        clicky = $(this);
+        listitem = clicky.parentsUntil('li').last().parent();
+        sublist = listitem.find('ul').first();
 
         // if already open, close by removing the sublist
-        var sublists = listitem.getElementsByTagName('ul');
-        if(!listitem.open){
-            if (sublists.length) {
-              sublists[0].style.display='none';
-            }
-            listitem.className='closed';
+        if (listitem.hasClass('open')) {
+            sublist.slideUp(
+                function () {
+                    listitem.addClass('closed').removeClass('open');
+                }
+            );
             e.preventDefault();
-            return false;
+            return;
         }
 
         // just show if already loaded
-        if(sublists.length && listitem.open){
-            sublists[0].style.display='';
-            listitem.className='open';
+        if (sublist.size() > 0 && !listitem.hasClass('open')) {
+            listitem.addClass('open').removeClass('closed');
+            sublist.slideDown();
             e.preventDefault();
-            return false;
+            return;
         }
 
-        // prepare an AJAX call to fetch the subtree
-        var ajax = new sack(DOKU_BASE + 'lib/exe/ajax.php');
-        ajax.AjaxFailedAlert = '';
-        ajax.encodeURIString = false;
-        if(ajax.failed) return true;
-
         //prepare the new ul
-        var ul = document.createElement('ul');
-        ul.className = 'idx';
-        timeout = window.setTimeout(function(){
+        ul = $('<ul class="idx"/>');
+
+        timeout = window.setTimeout(function () {
             // show the throbber as needed
-            if (listitem.open) {
-              ul.innerHTML = '<li><img src="'+DOKU_BASE+'lib/images/throbber.gif" alt="loading..." title="loading..." /></li>';
-              listitem.appendChild(ul);
-              listitem.className='open';
-            }
-        }, this.throbber_delay);
-        ajax.elementObj = ul;
-        ajax.afterCompletion = function(){
-            window.clearTimeout(timeout);
-            index.treeattach(ul);
-            if (listitem.className!='open') {
-              if (!listitem.open) {
-                ul.style.display='none';
-              }
-              listitem.appendChild(ul);
-              if (listitem.open) {
-                listitem.className='open';
-              }
+            if (!listitem.hasClass('open')) {
+                ul.html('<li><img src="' + DOKU_BASE + 'lib/images/throbber.gif" alt="loading..." title="loading..." /></li>');
+                listitem
+                    .append(ul)
+                    .addClass('open')
+                    .removeClass('closed');
             }
-        };
-        ajax.runAJAX(clicky.search.substr(1)+'&call=index');
-        e.preventDefault();
-        return false;
-    }
-};
+        }, throbber_delay);
 
+        $.post(
+            DOKU_BASE + 'lib/exe/ajax.php',
+            clicky.attr('search').substr(1) + '&call=index',
+            function (data) {
+                window.clearTimeout(timeout);
+                ul.html(data);
+                if (listitem.className !== 'open') {
+                    if (ul.parent().size() === 0) {
+                        // if the UL has not been attached when showing the
+                        // throbber, then let's do it now.
+                        listitem.append(ul);
+                    }
+                    listitem.addClass('open').removeClass('closed');
+                }
+            },
+            'html'
+        );
+        e.preventDefault();
+    };
 
-addInitEvent(function(){
-    index.treeattach($('index__tree'));
-});
+    $(function () {
+        // Initialze tree when the DOM is ready.
+        $('#index__tree').delegate('a.idx_dir', 'click', toggle);
+    });
+}(jQuery));
\ No newline at end of file
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png
new file mode 100755
index 000000000..5b5dab2ab
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_flat_75_ffffff_40x100.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_flat_75_ffffff_40x100.png
new file mode 100755
index 000000000..ac8b229af
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_flat_75_ffffff_40x100.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png
new file mode 100755
index 000000000..ad3d6346e
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_65_ffffff_1x400.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_65_ffffff_1x400.png
new file mode 100755
index 000000000..42ccba269
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_65_ffffff_1x400.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_75_dadada_1x400.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_75_dadada_1x400.png
new file mode 100755
index 000000000..5a46b47cb
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_75_dadada_1x400.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png
new file mode 100755
index 000000000..86c2baa65
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png
new file mode 100755
index 000000000..4443fdc1a
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png
new file mode 100755
index 000000000..7c9fa6c6e
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_222222_256x240.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_222222_256x240.png
new file mode 100755
index 000000000..b273ff111
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_222222_256x240.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_2e83ff_256x240.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_2e83ff_256x240.png
new file mode 100755
index 000000000..09d1cdc85
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_2e83ff_256x240.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_454545_256x240.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_454545_256x240.png
new file mode 100755
index 000000000..59bd45b90
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_454545_256x240.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_888888_256x240.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_888888_256x240.png
new file mode 100755
index 000000000..6d02426c1
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_888888_256x240.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_cd0a0a_256x240.png b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_cd0a0a_256x240.png
new file mode 100755
index 000000000..18e611e73
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/images/ui-icons_cd0a0a_256x240.png
diff --git a/lib/scripts/jquery-ui/css/smoothness/jquery-ui-1.8.5.custom.css b/lib/scripts/jquery-ui/css/smoothness/jquery-ui-1.8.5.custom.css
new file mode 100755
index 000000000..0cb22be82
--- /dev/null
+++ b/lib/scripts/jquery-ui/css/smoothness/jquery-ui-1.8.5.custom.css
@@ -0,0 +1,572 @@
+/*
+ * jQuery UI CSS Framework @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right {  -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/*
+ * jQuery UI Resizable @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/*
+ * jQuery UI Autocomplete @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }	
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+	list-style:none;
+	padding: 2px;
+	margin: 0;
+	display:block;
+	float: left;
+}
+.ui-menu .ui-menu {
+	margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+	margin:0;
+	padding: 0;
+	zoom: 1;
+	float: left;
+	clear: left;
+	width: 100%;
+}
+.ui-menu .ui-menu-item a {
+	text-decoration:none;
+	display:block;
+	padding:.2em .4em;
+	line-height:1.5;
+	zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+	font-weight: normal;
+	margin: -1px;
+}
+/*
+ * jQuery UI Button @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; } 
+button.ui-button-icons-only { width: 3.7em; } 
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4;  }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative;  }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; } 
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI Datepicker @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px;  }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month, 
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0;  }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+    display: none; /*sorry for IE5*/
+    display/**/: block; /*sorry for IE5*/
+    position: absolute; /*must have*/
+    z-index: -1; /*must have*/
+    filter: mask(); /*must have*/
+    top: -4px; /*must have*/
+    left: -4px; /*must have*/
+    width: 200px; /*must have*/
+    height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
diff --git a/lib/scripts/jquery-ui/jquery-ui.core.min.js b/lib/scripts/jquery-ui/jquery-ui.core.min.js
new file mode 100755
index 000000000..f6ae71978
--- /dev/null
+++ b/lib/scripts/jquery-ui/jquery-ui.core.min.js
@@ -0,0 +1,66 @@
+/*!
+ * jQuery UI 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.5",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"));if(!isNaN(b)&&b!=0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind("mousedown.ui-disableSelection selectstart.ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c.style(this,h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c.style(this,
+h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.createElement("div"),b=document.body;c.extend(a.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.appendChild(a).offsetHeight===100;b.removeChild(a).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,
+d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
+;/*!
+ * jQuery UI Widget 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.substring(0,1)===
+"_")return h;e?this.each(function(){var g=b.data(this,a);if(!g)throw"cannot call methods on "+a+" prior to initialization; attempted to call method '"+d+"'";if(!b.isFunction(g[d]))throw"no such method '"+d+"' for "+a+" widget instance";var i=g[d].apply(g,f);if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",
+widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,b.metadata&&b.metadata.get(c)[this.widgetName],a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._init()},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+
+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a,e=this;if(arguments.length===0)return b.extend({},e.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}b.each(d,function(f,h){e._setOption(f,h)});return e},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},enable:function(){return this._setOption("disabled",
+false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+;/*!
+ * jQuery UI Mouse 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(a._preventClickEvent){a._preventClickEvent=false;b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&
+this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();
+return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.browser.safari||a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&
+this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=a.target==this._mouseDownEvent.target;this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-
+a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.scrollTo&&d.document){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j=
+{top:b.of.pageY,left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/
+2;if(b.at[1]==="bottom")j.top+=k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+parseInt(c.curCSS(this,"marginRight",true))||0,w=m+q+parseInt(c.curCSS(this,"marginBottom",true))||0,i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]===
+"center")i.top-=m/2;i.left=parseInt(i.left);i.top=parseInt(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();
+b.left=d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];
+b.left+=a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=
+c(b),g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;
\ No newline at end of file
diff --git a/lib/scripts/jquery-ui/jquery-ui.effects.min.js b/lib/scripts/jquery-ui/jquery-ui.effects.min.js
new file mode 100755
index 000000000..a4690d1d9
--- /dev/null
+++ b/lib/scripts/jquery-ui/jquery-ui.effects.min.js
@@ -0,0 +1,220 @@
+/*
+ * jQuery UI Effects 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||function(f,j){function l(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
+16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return m.transparent;return m[f.trim(c).toLowerCase()]}function r(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return l(b)}function n(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function o(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in s||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function t(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d=
+a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:f.fx.speeds[b]||f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=r(b.elem,a);b.end=l(b.end);b.colorInit=
+true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var m={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,
+183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,
+165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},p=["add","remove","toggle"],s={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,d){if(f.isFunction(b)){d=b;b=null}return this.each(function(){var e=f(this),g=e.attr("style")||" ",h=o(n.call(this)),q,u=e.attr("className");f.each(p,function(v,
+i){c[i]&&e[i+"Class"](c[i])});q=o(n.call(this));e.attr("className",u);e.animate(t(h,q),a,b,function(){f.each(p,function(v,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)})})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?
+f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.5",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==
+null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();
+var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});
+c.css({position:"relative",top:0,left:0})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments);a={options:a[1],duration:a[2],callback:a[3]};var b=f.effects[c];return b&&!f.fx.off?b.call(this,a):this},_show:f.fn.show,show:function(c){if(!c||
+typeof c=="number"||f.fx.speeds[c]||!f.effects[c])return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(!c||typeof c=="number"||f.fx.speeds[c]||!f.effects[c])return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(!c||typeof c=="number"||f.fx.speeds[c]||!f.effects[c]||typeof c==
+"boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,
+a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=
+e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+
+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/
+2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*
+a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;
+return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,
+a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
+;/*
+ * jQuery UI Effects Blind 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","left"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,g);b.effects.removeWrapper(a);
+c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Bounce 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","left"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
+3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
+b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Clip 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","left","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,c/2)}var h={};h[g.size]=
+f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Drop 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","left","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e=="show"?1:
+0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Explode 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
+0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
+e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
+;/*
+ * jQuery UI Effects Fade 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fade
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Fold 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","left"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],10)/100*
+f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Highlight 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
+this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Pulsate 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
+a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Scale 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
+b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
+1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","left","width","height","overflow","opacity"],g=["position","top","left","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],p=c.effects.setMode(a,
+b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};if(m=="box"||m=="both"){if(d.from.y!=
+d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);a.css("overflow","hidden").css(a.from);
+if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);child.to=c.effects.setTransition(child,
+f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,n?e:g);c.effects.removeWrapper(a);b.callback&&
+b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Shake 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","left"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=(h=="pos"?"-=":"+=")+
+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Slide 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","left"],e=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(e=="show")a.css(f,b=="pos"?-g:g);var i={};i[f]=(e=="show"?b=="pos"?
+"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Transfer 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
+b.dequeue()})})}})(jQuery);
+;
\ No newline at end of file
diff --git a/lib/scripts/jquery-ui/jquery-ui.interactions.min.js b/lib/scripts/jquery-ui/jquery-ui.interactions.min.js
new file mode 100755
index 000000000..8f655940a
--- /dev/null
+++ b/lib/scripts/jquery-ui/jquery-ui.interactions.min.js
@@ -0,0 +1,205 @@
+/*
+ * jQuery UI Draggable 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,
+b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
+"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&
+a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),
+10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+
+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+
+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-
+this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=
+this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.5"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");
+if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;
+c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=
+1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;
+this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=
+this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=
+d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;
+if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!=
+"HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-
+b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
+c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
+width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&
+o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=
+p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&
+(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
+10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
+;/*
+ * jQuery UI Droppable 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.5"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
+i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
+d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
+;/*
+ * jQuery UI Resizable 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
+f={width:c.size.width-(f?0:c.sizeDiff.width),height:c.size.height-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",
+b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=
+a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,
+k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),
+c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=
+this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+
+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,
+arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,
+{version:"1.8.5"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,
+function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=
+(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=
+false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-
+a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",
+b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top",
+"Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,
+f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=
+a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+
+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&
+e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",
+height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=
+d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d=
+e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.5"})})(jQuery);
+;/*
+ * jQuery UI Sortable 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,
+arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=
+c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,
+{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();
+if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
+a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");
+if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+
+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+
+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,
+c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==
+document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",
+null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):
+d(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||
+"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+
+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?
+2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},
+_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=
+this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=
+this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");
+if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=
+0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=
+this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},
+update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=
+null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));
+this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,
+null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||
+d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a==
+"string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition==
+"absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition==
+"relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},
+_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-
+this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),
+10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?
+this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=
+this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+
+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?
+g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
+e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==
+f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",
+f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",
+g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=
+0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});
+d.extend(d.ui.sortable,{version:"1.8.5"})})(jQuery);
+;
\ No newline at end of file
diff --git a/lib/scripts/jquery-ui/jquery-ui.widgets.min.js b/lib/scripts/jquery-ui/jquery-ui.widgets.min.js
new file mode 100755
index 000000000..81751fb80
--- /dev/null
+++ b/lib/scripts/jquery-ui/jquery-ui.widgets.min.js
@@ -0,0 +1,290 @@
+/*
+ * jQuery UI Accordion 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var f=d.closest(".ui-accordion-header");a.active=f.length?f:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",function(g){return a._keydown(g)}).next().attr("role",
+"tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(g){a._clickHandler.call(a,g,this);g.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);
+this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,f=this.headers.index(a.target),g=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:g=this.headers[(f+1)%d];break;case b.LEFT:case b.UP:g=this.headers[(f-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(g){c(a.target).attr("tabIndex",-1);c(g).attr("tabIndex",0);g.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);
+a.next().addClass("ui-accordion-content-active")}h=a.next();f=this.active.next();g={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):h,oldContent:f};d=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(h,f,g,b,d)}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+this.active.next().addClass("ui-accordion-content-active");var f=this.active.next(),g={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:f},h=this.active=c([]);this._toggle(h,f,g)}},_toggle:function(a,b,d,f,g){var h=this,e=h.options;h.toShow=a;h.toHide=b;h.data=d;var j=function(){if(h)return h._completed.apply(h,arguments)};h._trigger("changestart",null,h.data);h.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&f?{toShow:c([]),toHide:b,complete:j,
+down:g,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:g,autoHeight:e.autoHeight||e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;f=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!f[k]&&!c.easing[k])k="slide";f[k]||(f[k]=function(l){this.slide(l,{easing:k,duration:i||700})});
+f[k](d)}else{if(e.collapsible&&f)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.5",animations:{slide:function(a,
+b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),f=0,g={},h={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){h[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);g[i]={value:j[1],
+unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(h,{step:function(j,i){if(i.prop=="height")f=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=f*g[i.prop].value+g[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",paddingTop:"hide",
+paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function(e){e.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},_create:function(){var a=this,b=this.element[0].ownerDocument;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!a.options.disabled){var d=e.ui.keyCode;switch(c.keyCode){case d.PAGE_UP:a._move("previousPage",
+c);break;case d.PAGE_DOWN:a._move("nextPage",c);break;case d.UP:a._move("previous",c);c.preventDefault();break;case d.DOWN:a._move("next",c);c.preventDefault();break;case d.ENTER:case d.NUMPAD_ENTER:a.menu.element.is(":visible")&&c.preventDefault();case d.TAB:if(!a.menu.active)return;a.menu.select(c);break;case d.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);
+break}}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=e("<ul></ul>").addClass("ui-autocomplete").appendTo(e(this.options.appendTo||"body",b)[0]).mousedown(function(c){var d=a.menu.element[0];
+c.target===d&&setTimeout(function(){e(document).one("mousedown",function(f){f.target!==a.element[0]&&f.target!==d&&!e.ui.contains(d,f.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,d){d=d.item.data("item.autocomplete");false!==a._trigger("focus",null,{item:d})&&/^key/.test(c.originalEvent.type)&&a.element.val(d.value)},selected:function(c,d){d=d.item.data("item.autocomplete");var f=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();
+a.previous=f}if(false!==a._trigger("select",c,{item:d})){a.term=d.value;a.element.val(d.value)}a.close(c);a.selectedItem=d},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");e.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
+this.menu.element.remove();e.Widget.prototype.destroy.call(this)},_setOption:function(a,b){e.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(e(b||"body",this.element[0].ownerDocument)[0])},_initSource:function(){var a=this,b,c;if(e.isArray(this.options.source)){b=this.options.source;this.source=function(d,f){f(e.ui.autocomplete.filter(b,d.term))}}else if(typeof this.options.source==="string"){c=this.options.source;this.source=
+function(d,f){a.xhr&&a.xhr.abort();a.xhr=e.getJSON(c,d,function(g,i,h){h===a.xhr&&f(g);a.xhr=null})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search")!==false)return this._search(a)},_search:function(a){this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(a.length){a=
+this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this._trigger("close",a);this.menu.element.hide();this.menu.deactivate()}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return e.map(a,function(b){if(typeof b===
+"string")return{label:b,value:b};return e.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1),c;this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();this.menu.element.show().position(e.extend({of:this.element},this.options.position));a=b.width("").outerWidth();c=this.element.outerWidth();b.outerWidth(Math.max(a,c))},_renderMenu:function(a,b){var c=this;e.each(b,function(d,f){c._renderItem(a,f)})},
+_renderItem:function(a,b){return e("<li></li>").data("item.autocomplete",b).append(e("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});e.extend(e.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},
+filter:function(a,b){var c=new RegExp(e.ui.autocomplete.escapeRegex(b),"i");return e.grep(a,function(d){return c.test(d.label||d.value||d)})}})})(jQuery);
+(function(e){e.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(e(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(b){a.activate(b,e(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.attr("scrollTop"),f=this.element.height();if(c<0)this.element.attr("scrollTop",d+c);else c>=f&&this.element.attr("scrollTop",d+c-f+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})},
+deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(a,b,c){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0);
+a.length?this.activate(c,a):this.activate(c,this.element.children(b))}else this.activate(c,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||this.last())this.activate(a,this.element.children(":first"));else{var b=this.active.offset().top,c=this.element.height(),d=this.element.children("li").filter(function(){var f=e(this).offset().top-b-c+e(this).height();return f<10&&f>-10});d.length||(d=this.element.children(":last"));this.activate(a,d)}else this.activate(a,this.element.children(!this.active||
+this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(":last"));else{var b=this.active.offset().top,c=this.element.height();result=this.element.children("li").filter(function(){var d=e(this).offset().top-b+c-e(this).height();return d<10&&d>-10});result.length||(result=this.element.children(":first"));this.activate(a,result)}else this.activate(a,this.element.children(!this.active||this.first()?":last":":first"))},
+hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})})(jQuery);
+;/*
+ * jQuery UI Button 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,e=a([]);if(c)e=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return e};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",
+i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",e="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",
+function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(e)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");
+b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var f=b.element[0];h(f).not(f).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");
+g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(f){if(c.disabled)return false;if(f.keyCode==a.ui.keyCode.SPACE||f.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(f){f.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",
+c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var b=this.element.is(":checked");b&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=
+this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active  ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||
+this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"),
+c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,e=d.primary&&d.secondary;if(d.primary||d.secondary){b.addClass("ui-button-text-icon"+(e?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){b.addClass(e?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary");
+this.hasTitle||b.attr("title",c)}}else b.addClass("ui-button-text-only")}}});a.widget("ui.buttonset",{_create:function(){this.element.addClass("ui-buttonset");this._init()},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(":button, :submit, :reset, :checkbox, :radio, a, :data(button)").filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":visible").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *  jquery.ui.button.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function(c,j){c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",of:window,collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");
+if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||"&#160;",f=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog",
+"aria-labelledby":f}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var e=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);
+return false}).appendTo(e);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",f).html(d).prependTo(e);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;e.find("*").add(e).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&
+g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");
+b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0])d=Math.max(d,c(this).css("z-index"))});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,f=d.options;if(f.modal&&!a||!f.stack&&!f.modal)return d._trigger("focus",b);if(f.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=
+f.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;d.next().length&&d.appendTo("body");a._size();a._position(b.position);d.show(b.show);
+a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(f){if(f.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),e=g.filter(":first");g=g.filter(":last");if(f.target===g[0]&&!f.shiftKey){e.focus(1);return false}else if(f.target===e[0]&&f.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,
+f=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(f);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(e,h){h=c.isFunction(h)?{click:h,text:e}:h;e=c("<button></button>",h).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&e.button()});f.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(e){return{position:e.position,
+offset:e.offset}}var b=this,d=b.options,f=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(e,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",e,a(h))},drag:function(e,h){b._trigger("drag",e,a(h))},stop:function(e,h){d.position=[h.position.left-f.scrollLeft(),h.position.top-f.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);
+b._trigger("dragStop",e,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(e){return{originalPosition:e.originalPosition,originalSize:e.originalSize,position:e.position,size:e.size}}a=a===j?this.options.resizable:a;var d=this,f=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:d._minHeight(),
+handles:a,start:function(e,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",e,b(h))},resize:function(e,h){d._trigger("resize",e,b(h))},stop:function(e,h){c(this).removeClass("ui-dialog-resizing");f.height=c(this).height();f.width=c(this).width();d._trigger("resizeStop",e,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,
+a.height)},_position:function(a){var b=[],d=[0,0],f;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,e){if(+b[g]===b[g]){d[g]=b[g];b[g]=e}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(f=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a);
+f||this.uiDialog.hide()},_setOption:function(a,b){var d=this,f=d.uiDialog,g=f.is(":data(resizable)"),e=false;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);e=true;break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":f.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?f.addClass("ui-dialog-disabled"):f.removeClass("ui-dialog-disabled");break;case "draggable":b?
+d._makeDraggable():f.draggable("destroy");break;case "height":e=true;break;case "maxHeight":g&&f.resizable("option","maxHeight",b);e=true;break;case "maxWidth":g&&f.resizable("option","maxWidth",b);e=true;break;case "minHeight":g&&f.resizable("option","minHeight",b);e=true;break;case "minWidth":g&&f.resizable("option","minWidth",b);e=true;break;case "position":d._position(b);break;case "resizable":g&&!b&&f.resizable("destroy");g&&typeof b==="string"&&f.resizable("option","handles",b);!g&&b!==false&&
+d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||"&#160;"));break;case "width":e=true;break}c.Widget.prototype._setOption.apply(d,arguments);e&&d._size()},_size:function(){var a=this.options,b;this.element.css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();this.element.css(a.height==="auto"?{minHeight:Math.max(a.minHeight-b,0),height:c.support.minHeight?"auto":Math.max(a.minHeight-
+b,0)}:{minHeight:0,height:Math.max(a.height-b,0)}).show();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.5",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),
+function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=
+(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){this.oldInstances.push(this.instances.splice(c.inArray(a,this.instances),1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var b=0;c.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var a,
+b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<
+b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
+;/*
+ * jQuery UI Slider 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var a=this,b=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");b.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
+this.range=d([]);if(b.range){if(b.range===true){this.range=d("<div></div>");if(!b.values)b.values=[this._valueMin(),this._valueMin()];if(b.values.length&&b.values.length!==2)b.values=[b.values[0],b.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(b.range==="min"||b.range==="max")this.range.addClass("ui-slider-range-"+b.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
+if(b.values&&b.values.length)for(;d(".ui-slider-handle",this.element).length<b.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();
+else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!a.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
+false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");h=a._start(c,f);if(h===false)return}break}i=a.options.step;h=a.options.values&&a.options.values.length?(g=a.values(f)):(g=a.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=a._valueMin();break;case d.ui.keyCode.END:g=a._valueMax();break;case d.ui.keyCode.PAGE_UP:g=a._trimAlignValue(h+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=a._trimAlignValue(h-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h===
+a._valueMax())return;g=a._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===a._valueMin())return;g=a._trimAlignValue(h-i);break}a._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(c,e);a._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
+this._mouseDestroy();return this},_mouseCapture:function(a){var b=this.options,c,e,f,h,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(b.range===true&&this.values(1)===b.min){g+=1;f=d(this.handles[g])}if(this._start(a,
+g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();b=f.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-f.width()/2,top:a.pageY-b.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b=
+this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b=
+this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);
+c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var e;if(this.options.values&&this.options.values.length){e=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>e||b===1&&c<e))c=e;if(c!==this.values(b)){e=this.values();e[b]=c;a=this._trigger("slide",a,{handle:this.handles[b],value:c,values:e});this.values(b?0:1);a!==false&&this.values(b,c,true)}}else if(c!==this.value()){a=this._trigger("slide",a,{handle:this.handles[b],value:c});
+a!==false&&this.value(c)}},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value=
+this._trimAlignValue(a);this._refreshValue();this._change(null,0)}return this._value()},values:function(a,b){var c,e,f;if(arguments.length>1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(a):this.value();
+else return this._values()},_setOption:function(a,b){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(a){case "disabled":if(b){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
+this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a)},_values:function(a){var b,c;if(arguments.length){b=this.options.values[a];
+return b=this._trimAlignValue(b)}else{b=this.options.values.slice();for(c=0;c<b.length;c+=1)b[c]=this._trimAlignValue(b[c]);return b}},_trimAlignValue:function(a){if(a<this._valueMin())return this._valueMin();if(a>this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=a%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a=
+this.options.range,b=this.options,c=this,e=!this._animateOff?b.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},b.animate);if(k===1)c.range[e?"animate":"css"]({width:f-
+g+"%"},{queue:false,duration:b.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},b.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:b.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},
+b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.5"})})(jQuery);
+;/*
+ * jQuery UI Tabs 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading&#8230;</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(a,e){if(a=="selected")this.options.collapsible&&
+e==this.options.selected||this.select(e);else{this.options[a]=e;this._tabify()}},_tabId:function(a){return a.title&&a.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(a){return a.replace(/:/g,"\\:")},_cookie:function(){var a=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[a].concat(d.makeArray(arguments)))},_ui:function(a,e){return{tab:a,panel:e,index:this.anchors.index(a)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var a=
+d(this);a.html(a.data("label.tabs")).removeData("label.tabs")})},_tabify:function(a){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var b=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
+(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))b.panels=b.panels.add(b._sanitizeSelector(i));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=b._tabId(f);f.href="#"+i;f=d("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(b.panels[g-1]||b.list);f.data("destroy.tabs",true)}b.panels=b.panels.add(f)}else c.disabled.push(g)});if(a){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(b._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return b.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(c.selected>=0&&this.anchors.length){this.panels.eq(c.selected).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");b.element.queue("tabs",function(){b._trigger("show",null,b._ui(b.anchors[c.selected],b.panels[c.selected]))});this.load(c.selected)}d(window).bind("unload",function(){b.lis.add(b.anchors).unbind(".tabs");b.lis=b.anchors=b.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));this.element[c.collapsible?"addClass":
+"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);a=0;for(var j;j=this.lis[a];a++)d(j)[d.inArray(a,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+g)};this.lis.bind("mouseover.tabs",
+function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",function(){e(f,o);b._trigger("show",
+null,b._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");b._trigger("show",null,b._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){b.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);b.element.dequeue("tabs")})}:function(g,f){b.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");b.element.dequeue("tabs")};this.anchors.bind(c.event+".tabs",
+function(){var g=this,f=d(g).closest("li"),i=b.panels.filter(":not(.ui-tabs-hide)"),l=d(b._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||b.panels.filter(":animated").length||b._trigger("select",null,b._ui(this,l[0]))===false){this.blur();return false}c.selected=b.anchors.index(this);b.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=-1;c.cookie&&b._cookie(c.selected,c.cookie);b.element.queue("tabs",
+function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&b._cookie(c.selected,c.cookie);b.element.queue("tabs",function(){r(g,l)});b.load(b.anchors.index(this));this.blur();return false}c.cookie&&b._cookie(c.selected,c.cookie);if(l.length){i.length&&b.element.queue("tabs",function(){s(g,i)});b.element.queue("tabs",function(){r(g,l)});b.load(b.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",
+function(){return false})},_getIndex:function(a){if(typeof a=="string")a=this.anchors.index(this.anchors.filter("[href$="+a+"]"));return a},destroy:function(){var a=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=d.data(this,"href.tabs");if(e)this.href=
+e;var b=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){b.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});a.cookie&&this._cookie(null,a.cookie);return this},add:function(a,e,b){if(b===p)b=this.anchors.length;
+var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,a).replace(/#\{label\}/g,e));a=!a.indexOf("#")?a.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=d("#"+a);j.length||(j=d(h.panelTemplate).attr("id",a).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(b>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[b]);
+j.insertBefore(this.panels[b])}h.disabled=d.map(h.disabled,function(k){return k>=b?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[b],this.panels[b]));return this},remove:function(a){a=this._getIndex(a);var e=this.options,b=this.lis.eq(a).remove(),c=this.panels.eq(a).remove();
+if(b.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(a+(a+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=a}),function(h){return h>=a?--h:h});this._tabify();this._trigger("remove",null,this._ui(b.find("a")[0],c[0]));return this},enable:function(a){a=this._getIndex(a);var e=this.options;if(d.inArray(a,e.disabled)!=-1){this.lis.eq(a).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(b){return b!=a});this._trigger("enable",null,
+this._ui(this.anchors[a],this.panels[a]));return this}},disable:function(a){a=this._getIndex(a);var e=this.options;if(a!=e.selected){this.lis.eq(a).addClass("ui-state-disabled");e.disabled.push(a);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[a],this.panels[a]))}return this},select:function(a){a=this._getIndex(a);if(a==-1)if(this.options.collapsible&&this.options.selected!=-1)a=this.options.selected;else return this;this.anchors.eq(a).trigger(this.options.event+".tabs");return this},
+load:function(a){a=this._getIndex(a);var e=this,b=this.options,c=this.anchors.eq(a)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(a).addClass("ui-state-processing");if(b.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(b.spinner)}this.xhr=d.ajax(d.extend({},b.ajaxOptions,{url:h,success:function(k,n){d(e._sanitizeSelector(c.hash)).html(k);e._cleanup();b.cache&&d.data(c,"cache.tabs",
+true);e._trigger("load",null,e._ui(e.anchors[a],e.panels[a]));try{b.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[a],e.panels[a]));try{b.ajaxOptions.error(k,n,a,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},url:function(a,
+e){this.anchors.eq(a).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.5"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(a,e){var b=this,c=this.options,h=b._rotate||(b._rotate=function(j){clearTimeout(b.rotation);b.rotation=setTimeout(function(){var k=c.selected;b.select(++k<b.anchors.length?k:0)},a);j&&j.stopPropagation()});e=b._unrotate||(b._unrotate=!e?function(j){j.clientX&&b.rotate(null)}:
+function(){t=c.selected;h()});if(a){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(b.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
+;/*
+ * jQuery UI Datepicker 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function(d,G){function L(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
+"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
+"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
+minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>')}function E(a,b){d.extend(a,
+b);for(var c in b)if(b[c]==null||b[c]==G)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.5"}});var y=(new Date).getTime();d.extend(L.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=
+f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
+_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
+b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
+""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
+c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
+true);this._updateDatepicker(b);this._updateAlternate(b)}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{});b=b&&b.constructor==
+Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);
+d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},
+_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=
+d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;
+for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&
+this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&
+!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass,b.dpDiv).add(d("td."+d.datepicker._currentClass,b.dpDiv));c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();
+return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||
+a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,
+a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));
+var c=String.fromCharCode(a.charCode==G?a.keyCode:a.charCode);return a.ctrlKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||
+a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);
+d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&
+d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=d.datepicker._getBorders(b.dpDiv);b.dpDiv.find("iframe.ui-datepicker-cover").css({left:-i[0],top:-i[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,
+h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a)).find("iframe.ui-datepicker-cover").css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");
+this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");
+this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);var e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");
+a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus()},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),
+k=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>k&&k>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[b?"previousSibling":"nextSibling"];
+a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():
+"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&
+!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;
+b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=
+this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=
+d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,
+"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b==
+"object"?b.toString():b+"";if(b=="")return null;for(var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff,f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,k=c=-1,l=-1,u=-1,j=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"?4:p=="o"?
+3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,w,H){p=o(p)?H:w;for(w=0;w<p.length;w++)if(b.substr(s,p[w].length).toLowerCase()==p[w].toLowerCase()){s+=p[w].length;return w+1}throw"Unknown name at position "+s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(j)if(a.charAt(z)=="'"&&!o("'"))j=false;else r();else switch(a.charAt(z)){case "d":l=m("d");
+break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":k=m("m");break;case "M":k=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))r();else j=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>
+-1){k=1;l=u;do{e=this._getDaysInMonth(c,k-1);if(l<=e)break;k++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,k-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=k||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*
+60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=j+1<a.length&&a.charAt(j+1)==o)&&j++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},k=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var j=0;j<a.length;j++)if(u)if(a.charAt(j)==
+"'"&&!i("'"))u=false;else l+=a.charAt(j);else switch(a.charAt(j)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=k("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=k("M",b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+=
+"'";else u=true;break;default:l+=a.charAt(j)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+="0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==G?a.settings[b]:this._defaults[b]},
+_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,
+this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,k=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,j=u.exec(h);j;){switch(j[2]||"d"){case "d":case "D":g+=
+parseInt(j[1],10);break;case "w":case "W":g+=parseInt(j[1],10)*7;break;case "m":case "M":l+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break;case "y":case "Y":k+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break}j=u.exec(h)}return new Date(k,l,g)};if(b=(b=b==null?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):b)&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},
+_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?
+"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),k=
+this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),j=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=j&&n<j?j:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,
+"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-k,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+
+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+k,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+
+(c?"w":"e")+'">'+r+"</span></a>";k=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;k=!h?k:this.formatDate(k,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+
+y+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;k=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),w=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),I="",C=0;C<i[0];C++){for(var N=
+"",D=0;D<i[1];D++){var J=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?
+f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,j,o,C>0||D>0,z,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,
+A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<A;O++){x+="<tr>";var P=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,K=B&&!H||!F[0]||j&&q<j||o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==J.getTime()&&g==a.selectedMonth&&
+a._keyEvent||M.getTime()==q.getTime()&&M.getTime()==J.getTime()?" "+this._dayOverClass:"")+(K?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!w?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!B||w)&&F[2]?' title="'+F[2]+'"':"")+(K?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!w?"&#xa0;":K?'<span class="ui-state-default">'+q.getDate()+
+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==J.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");N+=x}I+=N}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':
+"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var k=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),j='<div class="ui-datepicker-title">',o="";if(h||!k)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+
+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(j+=o+(h||!(k&&l)?"&#xa0;":""));if(h||!l)j+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,
+i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(j+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)j+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";j+="</select>"}j+=this._get(a,"yearSuffix");if(u)j+=(h||!(k&&l)?"&#xa0;":"")+o;j+="</div>";return j},_adjustInstDate:function(a,b,c){var e=
+a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
+"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
+c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
+"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
+function(a){if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));
+return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new L;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.5";window["DP_jQuery_"+y]=d})(jQuery);
+;/*
+ * jQuery UI Progressbar 1.8.5
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ *   jquery.ui.core.js
+ *   jquery.ui.widget.js
+ */
+(function(b,c){b.widget("ui.progressbar",{options:{value:0},min:0,max:100,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===c)return this._value();this._setOption("value",a);return this},_setOption:function(a,d){if(a==="value"){this.options.value=d;this._refreshValue();this._trigger("change")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.max,Math.max(this.min,a))},_refreshValue:function(){var a=this.value();this.valueDiv.toggleClass("ui-corner-right",
+a===this.max).width(a+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.5"})})(jQuery);
+;
\ No newline at end of file
diff --git a/lib/scripts/jquery/jquery.cookie.js b/lib/scripts/jquery/jquery.cookie.js
new file mode 100644
index 000000000..6df1faca2
--- /dev/null
+++ b/lib/scripts/jquery/jquery.cookie.js
@@ -0,0 +1,96 @@
+/**
+ * Cookie plugin
+ *
+ * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
+ * Dual licensed under the MIT and GPL licenses:
+ * http://www.opensource.org/licenses/mit-license.php
+ * http://www.gnu.org/licenses/gpl.html
+ *
+ */
+
+/**
+ * Create a cookie with the given name and value and other optional parameters.
+ *
+ * @example $.cookie('the_cookie', 'the_value');
+ * @desc Set the value of a cookie.
+ * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true });
+ * @desc Create a cookie with all available options.
+ * @example $.cookie('the_cookie', 'the_value');
+ * @desc Create a session cookie.
+ * @example $.cookie('the_cookie', null);
+ * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain
+ *       used when the cookie was set.
+ *
+ * @param String name The name of the cookie.
+ * @param String value The value of the cookie.
+ * @param Object options An object literal containing key/value pairs to provide optional cookie attributes.
+ * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object.
+ *                             If a negative value is specified (e.g. a date in the past), the cookie will be deleted.
+ *                             If set to null or omitted, the cookie will be a session cookie and will not be retained
+ *                             when the the browser exits.
+ * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie).
+ * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie).
+ * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will
+ *                        require a secure protocol (like HTTPS).
+ * @type undefined
+ *
+ * @name $.cookie
+ * @cat Plugins/Cookie
+ * @author Klaus Hartl/klaus.hartl@stilbuero.de
+ */
+
+/**
+ * Get the value of a cookie with the given name.
+ *
+ * @example $.cookie('the_cookie');
+ * @desc Get the value of a cookie.
+ *
+ * @param String name The name of the cookie.
+ * @return The value of the cookie.
+ * @type String
+ *
+ * @name $.cookie
+ * @cat Plugins/Cookie
+ * @author Klaus Hartl/klaus.hartl@stilbuero.de
+ */
+jQuery.cookie = function(name, value, options) {
+    if (typeof value != 'undefined') { // name and value given, set cookie
+        options = options || {};
+        if (value === null) {
+            value = '';
+            options.expires = -1;
+        }
+        var expires = '';
+        if (options.expires && (typeof options.expires == 'number' || options.expires.toUTCString)) {
+            var date;
+            if (typeof options.expires == 'number') {
+                date = new Date();
+                date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000));
+            } else {
+                date = options.expires;
+            }
+            expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE
+        }
+        // CAUTION: Needed to parenthesize options.path and options.domain
+        // in the following expressions, otherwise they evaluate to undefined
+        // in the packed version for some reason...
+        var path = options.path ? '; path=' + (options.path) : '';
+        var domain = options.domain ? '; domain=' + (options.domain) : '';
+        var secure = options.secure ? '; secure' : '';
+        document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join('');
+    } else { // only name given, get cookie
+        var cookieValue = null;
+        if (document.cookie && document.cookie != '') {
+            var cookies = document.cookie.split(';');
+            for (var i = 0; i < cookies.length; i++) {
+                var cookie = jQuery.trim(cookies[i]);
+                // Does this cookie string begin with the name we want?
+                if (cookie.substring(0, name.length + 1) == (name + '=')) {
+                    cookieValue = decodeURIComponent(cookie.substring(name.length + 1));
+                    break;
+                }
+            }
+        }
+        return cookieValue;
+    }
+};
\ No newline at end of file
diff --git a/lib/scripts/jquery/jquery.js b/lib/scripts/jquery/jquery.js
new file mode 100644
index 000000000..fff677643
--- /dev/null
+++ b/lib/scripts/jquery/jquery.js
@@ -0,0 +1,6240 @@
+/*!
+ * jQuery JavaScript Library v1.4.2
+ * http://jquery.com/
+ *
+ * Copyright 2010, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2010, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Sat Feb 13 22:33:48 2010 -0500
+ */
+(function( window, undefined ) {
+
+// Define a local copy of jQuery
+var jQuery = function( selector, context ) {
+		// The jQuery object is actually just the init constructor 'enhanced'
+		return new jQuery.fn.init( selector, context );
+	},
+
+	// Map over jQuery in case of overwrite
+	_jQuery = window.jQuery,
+
+	// Map over the $ in case of overwrite
+	_$ = window.$,
+
+	// Use the correct document accordingly with window argument (sandbox)
+	document = window.document,
+
+	// A central reference to the root jQuery(document)
+	rootjQuery,
+
+	// A simple way to check for HTML strings or ID strings
+	// (both of which we optimize for)
+	quickExpr = /^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,
+
+	// Is it a simple selector
+	isSimple = /^.[^:#\[\.,]*$/,
+
+	// Check if a string has a non-whitespace character in it
+	rnotwhite = /\S/,
+
+	// Used for trimming whitespace
+	rtrim = /^(\s|\u00A0)+|(\s|\u00A0)+$/g,
+
+	// Match a standalone tag
+	rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
+
+	// Keep a UserAgent string for use with jQuery.browser
+	userAgent = navigator.userAgent,
+
+	// For matching the engine and version of the browser
+	browserMatch,
+	
+	// Has the ready events already been bound?
+	readyBound = false,
+	
+	// The functions to execute on DOM ready
+	readyList = [],
+
+	// The ready event handler
+	DOMContentLoaded,
+
+	// Save a reference to some core methods
+	toString = Object.prototype.toString,
+	hasOwnProperty = Object.prototype.hasOwnProperty,
+	push = Array.prototype.push,
+	slice = Array.prototype.slice,
+	indexOf = Array.prototype.indexOf;
+
+jQuery.fn = jQuery.prototype = {
+	init: function( selector, context ) {
+		var match, elem, ret, doc;
+
+		// Handle $(""), $(null), or $(undefined)
+		if ( !selector ) {
+			return this;
+		}
+
+		// Handle $(DOMElement)
+		if ( selector.nodeType ) {
+			this.context = this[0] = selector;
+			this.length = 1;
+			return this;
+		}
+		
+		// The body element only exists once, optimize finding it
+		if ( selector === "body" && !context ) {
+			this.context = document;
+			this[0] = document.body;
+			this.selector = "body";
+			this.length = 1;
+			return this;
+		}
+
+		// Handle HTML strings
+		if ( typeof selector === "string" ) {
+			// Are we dealing with HTML string or an ID?
+			match = quickExpr.exec( selector );
+
+			// Verify a match, and that no context was specified for #id
+			if ( match && (match[1] || !context) ) {
+
+				// HANDLE: $(html) -> $(array)
+				if ( match[1] ) {
+					doc = (context ? context.ownerDocument || context : document);
+
+					// If a single string is passed in and it's a single tag
+					// just do a createElement and skip the rest
+					ret = rsingleTag.exec( selector );
+
+					if ( ret ) {
+						if ( jQuery.isPlainObject( context ) ) {
+							selector = [ document.createElement( ret[1] ) ];
+							jQuery.fn.attr.call( selector, context, true );
+
+						} else {
+							selector = [ doc.createElement( ret[1] ) ];
+						}
+
+					} else {
+						ret = buildFragment( [ match[1] ], [ doc ] );
+						selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes;
+					}
+					
+					return jQuery.merge( this, selector );
+					
+				// HANDLE: $("#id")
+				} else {
+					elem = document.getElementById( match[2] );
+
+					if ( elem ) {
+						// Handle the case where IE and Opera return items
+						// by name instead of ID
+						if ( elem.id !== match[2] ) {
+							return rootjQuery.find( selector );
+						}
+
+						// Otherwise, we inject the element directly into the jQuery object
+						this.length = 1;
+						this[0] = elem;
+					}
+
+					this.context = document;
+					this.selector = selector;
+					return this;
+				}
+
+			// HANDLE: $("TAG")
+			} else if ( !context && /^\w+$/.test( selector ) ) {
+				this.selector = selector;
+				this.context = document;
+				selector = document.getElementsByTagName( selector );
+				return jQuery.merge( this, selector );
+
+			// HANDLE: $(expr, $(...))
+			} else if ( !context || context.jquery ) {
+				return (context || rootjQuery).find( selector );
+
+			// HANDLE: $(expr, context)
+			// (which is just equivalent to: $(context).find(expr)
+			} else {
+				return jQuery( context ).find( selector );
+			}
+
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( jQuery.isFunction( selector ) ) {
+			return rootjQuery.ready( selector );
+		}
+
+		if (selector.selector !== undefined) {
+			this.selector = selector.selector;
+			this.context = selector.context;
+		}
+
+		return jQuery.makeArray( selector, this );
+	},
+
+	// Start with an empty selector
+	selector: "",
+
+	// The current version of jQuery being used
+	jquery: "1.4.2",
+
+	// The default length of a jQuery object is 0
+	length: 0,
+
+	// The number of elements contained in the matched element set
+	size: function() {
+		return this.length;
+	},
+
+	toArray: function() {
+		return slice.call( this, 0 );
+	},
+
+	// Get the Nth element in the matched element set OR
+	// Get the whole matched element set as a clean array
+	get: function( num ) {
+		return num == null ?
+
+			// Return a 'clean' array
+			this.toArray() :
+
+			// Return just the object
+			( num < 0 ? this.slice(num)[ 0 ] : this[ num ] );
+	},
+
+	// Take an array of elements and push it onto the stack
+	// (returning the new matched element set)
+	pushStack: function( elems, name, selector ) {
+		// Build a new jQuery matched element set
+		var ret = jQuery();
+
+		if ( jQuery.isArray( elems ) ) {
+			push.apply( ret, elems );
+		
+		} else {
+			jQuery.merge( ret, elems );
+		}
+
+		// Add the old object onto the stack (as a reference)
+		ret.prevObject = this;
+
+		ret.context = this.context;
+
+		if ( name === "find" ) {
+			ret.selector = this.selector + (this.selector ? " " : "") + selector;
+		} else if ( name ) {
+			ret.selector = this.selector + "." + name + "(" + selector + ")";
+		}
+
+		// Return the newly-formed element set
+		return ret;
+	},
+
+	// Execute a callback for every element in the matched set.
+	// (You can seed the arguments with an array of args, but this is
+	// only used internally.)
+	each: function( callback, args ) {
+		return jQuery.each( this, callback, args );
+	},
+	
+	ready: function( fn ) {
+		// Attach the listeners
+		jQuery.bindReady();
+
+		// If the DOM is already ready
+		if ( jQuery.isReady ) {
+			// Execute the function immediately
+			fn.call( document, jQuery );
+
+		// Otherwise, remember the function for later
+		} else if ( readyList ) {
+			// Add the function to the wait list
+			readyList.push( fn );
+		}
+
+		return this;
+	},
+	
+	eq: function( i ) {
+		return i === -1 ?
+			this.slice( i ) :
+			this.slice( i, +i + 1 );
+	},
+
+	first: function() {
+		return this.eq( 0 );
+	},
+
+	last: function() {
+		return this.eq( -1 );
+	},
+
+	slice: function() {
+		return this.pushStack( slice.apply( this, arguments ),
+			"slice", slice.call(arguments).join(",") );
+	},
+
+	map: function( callback ) {
+		return this.pushStack( jQuery.map(this, function( elem, i ) {
+			return callback.call( elem, i, elem );
+		}));
+	},
+	
+	end: function() {
+		return this.prevObject || jQuery(null);
+	},
+
+	// For internal use only.
+	// Behaves like an Array's method, not like a jQuery method.
+	push: push,
+	sort: [].sort,
+	splice: [].splice
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+jQuery.extend = jQuery.fn.extend = function() {
+	// copy reference to target object
+	var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options, name, src, copy;
+
+	// Handle a deep copy situation
+	if ( typeof target === "boolean" ) {
+		deep = target;
+		target = arguments[1] || {};
+		// skip the boolean and the target
+		i = 2;
+	}
+
+	// Handle case when target is a string or something (possible in deep copy)
+	if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+		target = {};
+	}
+
+	// extend jQuery itself if only one argument is passed
+	if ( length === i ) {
+		target = this;
+		--i;
+	}
+
+	for ( ; i < length; i++ ) {
+		// Only deal with non-null/undefined values
+		if ( (options = arguments[ i ]) != null ) {
+			// Extend the base object
+			for ( name in options ) {
+				src = target[ name ];
+				copy = options[ name ];
+
+				// Prevent never-ending loop
+				if ( target === copy ) {
+					continue;
+				}
+
+				// Recurse if we're merging object literal values or arrays
+				if ( deep && copy && ( jQuery.isPlainObject(copy) || jQuery.isArray(copy) ) ) {
+					var clone = src && ( jQuery.isPlainObject(src) || jQuery.isArray(src) ) ? src
+						: jQuery.isArray(copy) ? [] : {};
+
+					// Never move original objects, clone them
+					target[ name ] = jQuery.extend( deep, clone, copy );
+
+				// Don't bring in undefined values
+				} else if ( copy !== undefined ) {
+					target[ name ] = copy;
+				}
+			}
+		}
+	}
+
+	// Return the modified object
+	return target;
+};
+
+jQuery.extend({
+	noConflict: function( deep ) {
+		window.$ = _$;
+
+		if ( deep ) {
+			window.jQuery = _jQuery;
+		}
+
+		return jQuery;
+	},
+	
+	// Is the DOM ready to be used? Set to true once it occurs.
+	isReady: false,
+	
+	// Handle when the DOM is ready
+	ready: function() {
+		// Make sure that the DOM is not already loaded
+		if ( !jQuery.isReady ) {
+			// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+			if ( !document.body ) {
+				return setTimeout( jQuery.ready, 13 );
+			}
+
+			// Remember that the DOM is ready
+			jQuery.isReady = true;
+
+			// If there are functions bound, to execute
+			if ( readyList ) {
+				// Execute all of them
+				var fn, i = 0;
+				while ( (fn = readyList[ i++ ]) ) {
+					fn.call( document, jQuery );
+				}
+
+				// Reset the list of functions
+				readyList = null;
+			}
+
+			// Trigger any bound ready events
+			if ( jQuery.fn.triggerHandler ) {
+				jQuery( document ).triggerHandler( "ready" );
+			}
+		}
+	},
+	
+	bindReady: function() {
+		if ( readyBound ) {
+			return;
+		}
+
+		readyBound = true;
+
+		// Catch cases where $(document).ready() is called after the
+		// browser event has already occurred.
+		if ( document.readyState === "complete" ) {
+			return jQuery.ready();
+		}
+
+		// Mozilla, Opera and webkit nightlies currently support this event
+		if ( document.addEventListener ) {
+			// Use the handy event callback
+			document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+			
+			// A fallback to window.onload, that will always work
+			window.addEventListener( "load", jQuery.ready, false );
+
+		// If IE event model is used
+		} else if ( document.attachEvent ) {
+			// ensure firing before onload,
+			// maybe late but safe also for iframes
+			document.attachEvent("onreadystatechange", DOMContentLoaded);
+			
+			// A fallback to window.onload, that will always work
+			window.attachEvent( "onload", jQuery.ready );
+
+			// If IE and not a frame
+			// continually check to see if the document is ready
+			var toplevel = false;
+
+			try {
+				toplevel = window.frameElement == null;
+			} catch(e) {}
+
+			if ( document.documentElement.doScroll && toplevel ) {
+				doScrollCheck();
+			}
+		}
+	},
+
+	// See test/unit/core.js for details concerning isFunction.
+	// Since version 1.3, DOM methods and functions like alert
+	// aren't supported. They return false on IE (#2968).
+	isFunction: function( obj ) {
+		return toString.call(obj) === "[object Function]";
+	},
+
+	isArray: function( obj ) {
+		return toString.call(obj) === "[object Array]";
+	},
+
+	isPlainObject: function( obj ) {
+		// Must be an Object.
+		// Because of IE, we also have to check the presence of the constructor property.
+		// Make sure that DOM nodes and window objects don't pass through, as well
+		if ( !obj || toString.call(obj) !== "[object Object]" || obj.nodeType || obj.setInterval ) {
+			return false;
+		}
+		
+		// Not own constructor property must be Object
+		if ( obj.constructor
+			&& !hasOwnProperty.call(obj, "constructor")
+			&& !hasOwnProperty.call(obj.constructor.prototype, "isPrototypeOf") ) {
+			return false;
+		}
+		
+		// Own properties are enumerated firstly, so to speed up,
+		// if last one is own, then all properties are own.
+	
+		var key;
+		for ( key in obj ) {}
+		
+		return key === undefined || hasOwnProperty.call( obj, key );
+	},
+
+	isEmptyObject: function( obj ) {
+		for ( var name in obj ) {
+			return false;
+		}
+		return true;
+	},
+	
+	error: function( msg ) {
+		throw msg;
+	},
+	
+	parseJSON: function( data ) {
+		if ( typeof data !== "string" || !data ) {
+			return null;
+		}
+
+		// Make sure leading/trailing whitespace is removed (IE can't handle it)
+		data = jQuery.trim( data );
+		
+		// Make sure the incoming data is actual JSON
+		// Logic borrowed from http://json.org/json2.js
+		if ( /^[\],:{}\s]*$/.test(data.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, "@")
+			.replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, "]")
+			.replace(/(?:^|:|,)(?:\s*\[)+/g, "")) ) {
+
+			// Try to use the native JSON parser first
+			return window.JSON && window.JSON.parse ?
+				window.JSON.parse( data ) :
+				(new Function("return " + data))();
+
+		} else {
+			jQuery.error( "Invalid JSON: " + data );
+		}
+	},
+
+	noop: function() {},
+
+	// Evalulates a script in a global context
+	globalEval: function( data ) {
+		if ( data && rnotwhite.test(data) ) {
+			// Inspired by code by Andrea Giammarchi
+			// http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
+			var head = document.getElementsByTagName("head")[0] || document.documentElement,
+				script = document.createElement("script");
+
+			script.type = "text/javascript";
+
+			if ( jQuery.support.scriptEval ) {
+				script.appendChild( document.createTextNode( data ) );
+			} else {
+				script.text = data;
+			}
+
+			// Use insertBefore instead of appendChild to circumvent an IE6 bug.
+			// This arises when a base node is used (#2709).
+			head.insertBefore( script, head.firstChild );
+			head.removeChild( script );
+		}
+	},
+
+	nodeName: function( elem, name ) {
+		return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
+	},
+
+	// args is for internal usage only
+	each: function( object, callback, args ) {
+		var name, i = 0,
+			length = object.length,
+			isObj = length === undefined || jQuery.isFunction(object);
+
+		if ( args ) {
+			if ( isObj ) {
+				for ( name in object ) {
+					if ( callback.apply( object[ name ], args ) === false ) {
+						break;
+					}
+				}
+			} else {
+				for ( ; i < length; ) {
+					if ( callback.apply( object[ i++ ], args ) === false ) {
+						break;
+					}
+				}
+			}
+
+		// A special, fast, case for the most common use of each
+		} else {
+			if ( isObj ) {
+				for ( name in object ) {
+					if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
+						break;
+					}
+				}
+			} else {
+				for ( var value = object[0];
+					i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {}
+			}
+		}
+
+		return object;
+	},
+
+	trim: function( text ) {
+		return (text || "").replace( rtrim, "" );
+	},
+
+	// results is for internal usage only
+	makeArray: function( array, results ) {
+		var ret = results || [];
+
+		if ( array != null ) {
+			// The window, strings (and functions) also have 'length'
+			// The extra typeof function check is to prevent crashes
+			// in Safari 2 (See: #3039)
+			if ( array.length == null || typeof array === "string" || jQuery.isFunction(array) || (typeof array !== "function" && array.setInterval) ) {
+				push.call( ret, array );
+			} else {
+				jQuery.merge( ret, array );
+			}
+		}
+
+		return ret;
+	},
+
+	inArray: function( elem, array ) {
+		if ( array.indexOf ) {
+			return array.indexOf( elem );
+		}
+
+		for ( var i = 0, length = array.length; i < length; i++ ) {
+			if ( array[ i ] === elem ) {
+				return i;
+			}
+		}
+
+		return -1;
+	},
+
+	merge: function( first, second ) {
+		var i = first.length, j = 0;
+
+		if ( typeof second.length === "number" ) {
+			for ( var l = second.length; j < l; j++ ) {
+				first[ i++ ] = second[ j ];
+			}
+		
+		} else {
+			while ( second[j] !== undefined ) {
+				first[ i++ ] = second[ j++ ];
+			}
+		}
+
+		first.length = i;
+
+		return first;
+	},
+
+	grep: function( elems, callback, inv ) {
+		var ret = [];
+
+		// Go through the array, only saving the items
+		// that pass the validator function
+		for ( var i = 0, length = elems.length; i < length; i++ ) {
+			if ( !inv !== !callback( elems[ i ], i ) ) {
+				ret.push( elems[ i ] );
+			}
+		}
+
+		return ret;
+	},
+
+	// arg is for internal usage only
+	map: function( elems, callback, arg ) {
+		var ret = [], value;
+
+		// Go through the array, translating each of the items to their
+		// new value (or values).
+		for ( var i = 0, length = elems.length; i < length; i++ ) {
+			value = callback( elems[ i ], i, arg );
+
+			if ( value != null ) {
+				ret[ ret.length ] = value;
+			}
+		}
+
+		return ret.concat.apply( [], ret );
+	},
+
+	// A global GUID counter for objects
+	guid: 1,
+
+	proxy: function( fn, proxy, thisObject ) {
+		if ( arguments.length === 2 ) {
+			if ( typeof proxy === "string" ) {
+				thisObject = fn;
+				fn = thisObject[ proxy ];
+				proxy = undefined;
+
+			} else if ( proxy && !jQuery.isFunction( proxy ) ) {
+				thisObject = proxy;
+				proxy = undefined;
+			}
+		}
+
+		if ( !proxy && fn ) {
+			proxy = function() {
+				return fn.apply( thisObject || this, arguments );
+			};
+		}
+
+		// Set the guid of unique handler to the same of original handler, so it can be removed
+		if ( fn ) {
+			proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+		}
+
+		// So proxy can be declared as an argument
+		return proxy;
+	},
+
+	// Use of jQuery.browser is frowned upon.
+	// More details: http://docs.jquery.com/Utilities/jQuery.browser
+	uaMatch: function( ua ) {
+		ua = ua.toLowerCase();
+
+		var match = /(webkit)[ \/]([\w.]+)/.exec( ua ) ||
+			/(opera)(?:.*version)?[ \/]([\w.]+)/.exec( ua ) ||
+			/(msie) ([\w.]+)/.exec( ua ) ||
+			!/compatible/.test( ua ) && /(mozilla)(?:.*? rv:([\w.]+))?/.exec( ua ) ||
+		  	[];
+
+		return { browser: match[1] || "", version: match[2] || "0" };
+	},
+
+	browser: {}
+});
+
+browserMatch = jQuery.uaMatch( userAgent );
+if ( browserMatch.browser ) {
+	jQuery.browser[ browserMatch.browser ] = true;
+	jQuery.browser.version = browserMatch.version;
+}
+
+// Deprecated, use jQuery.browser.webkit instead
+if ( jQuery.browser.webkit ) {
+	jQuery.browser.safari = true;
+}
+
+if ( indexOf ) {
+	jQuery.inArray = function( elem, array ) {
+		return indexOf.call( array, elem );
+	};
+}
+
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
+
+// Cleanup functions for the document ready method
+if ( document.addEventListener ) {
+	DOMContentLoaded = function() {
+		document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+		jQuery.ready();
+	};
+
+} else if ( document.attachEvent ) {
+	DOMContentLoaded = function() {
+		// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+		if ( document.readyState === "complete" ) {
+			document.detachEvent( "onreadystatechange", DOMContentLoaded );
+			jQuery.ready();
+		}
+	};
+}
+
+// The DOM ready check for Internet Explorer
+function doScrollCheck() {
+	if ( jQuery.isReady ) {
+		return;
+	}
+
+	try {
+		// If IE is used, use the trick by Diego Perini
+		// http://javascript.nwbox.com/IEContentLoaded/
+		document.documentElement.doScroll("left");
+	} catch( error ) {
+		setTimeout( doScrollCheck, 1 );
+		return;
+	}
+
+	// and execute any waiting functions
+	jQuery.ready();
+}
+
+function evalScript( i, elem ) {
+	if ( elem.src ) {
+		jQuery.ajax({
+			url: elem.src,
+			async: false,
+			dataType: "script"
+		});
+	} else {
+		jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
+	}
+
+	if ( elem.parentNode ) {
+		elem.parentNode.removeChild( elem );
+	}
+}
+
+// Mutifunctional method to get and set values to a collection
+// The value/s can be optionally by executed if its a function
+function access( elems, key, value, exec, fn, pass ) {
+	var length = elems.length;
+	
+	// Setting many attributes
+	if ( typeof key === "object" ) {
+		for ( var k in key ) {
+			access( elems, k, key[k], exec, fn, value );
+		}
+		return elems;
+	}
+	
+	// Setting one attribute
+	if ( value !== undefined ) {
+		// Optionally, function values get executed if exec is true
+		exec = !pass && exec && jQuery.isFunction(value);
+		
+		for ( var i = 0; i < length; i++ ) {
+			fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+		}
+		
+		return elems;
+	}
+	
+	// Getting an attribute
+	return length ? fn( elems[0], key ) : undefined;
+}
+
+function now() {
+	return (new Date).getTime();
+}
+(function() {
+
+	jQuery.support = {};
+
+	var root = document.documentElement,
+		script = document.createElement("script"),
+		div = document.createElement("div"),
+		id = "script" + now();
+
+	div.style.display = "none";
+	div.innerHTML = "   <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+
+	var all = div.getElementsByTagName("*"),
+		a = div.getElementsByTagName("a")[0];
+
+	// Can't get basic test support
+	if ( !all || !all.length || !a ) {
+		return;
+	}
+
+	jQuery.support = {
+		// IE strips leading whitespace when .innerHTML is used
+		leadingWhitespace: div.firstChild.nodeType === 3,
+
+		// Make sure that tbody elements aren't automatically inserted
+		// IE will insert them into empty tables
+		tbody: !div.getElementsByTagName("tbody").length,
+
+		// Make sure that link elements get serialized correctly by innerHTML
+		// This requires a wrapper element in IE
+		htmlSerialize: !!div.getElementsByTagName("link").length,
+
+		// Get the style information from getAttribute
+		// (IE uses .cssText insted)
+		style: /red/.test( a.getAttribute("style") ),
+
+		// Make sure that URLs aren't manipulated
+		// (IE normalizes it by default)
+		hrefNormalized: a.getAttribute("href") === "/a",
+
+		// Make sure that element opacity exists
+		// (IE uses filter instead)
+		// Use a regex to work around a WebKit issue. See #5145
+		opacity: /^0.55$/.test( a.style.opacity ),
+
+		// Verify style float existence
+		// (IE uses styleFloat instead of cssFloat)
+		cssFloat: !!a.style.cssFloat,
+
+		// Make sure that if no value is specified for a checkbox
+		// that it defaults to "on".
+		// (WebKit defaults to "" instead)
+		checkOn: div.getElementsByTagName("input")[0].value === "on",
+
+		// Make sure that a selected-by-default option has a working selected property.
+		// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+		optSelected: document.createElement("select").appendChild( document.createElement("option") ).selected,
+
+		parentNode: div.removeChild( div.appendChild( document.createElement("div") ) ).parentNode === null,
+
+		// Will be defined later
+		deleteExpando: true,
+		checkClone: false,
+		scriptEval: false,
+		noCloneEvent: true,
+		boxModel: null
+	};
+
+	script.type = "text/javascript";
+	try {
+		script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
+	} catch(e) {}
+
+	root.insertBefore( script, root.firstChild );
+
+	// Make sure that the execution of code works by injecting a script
+	// tag with appendChild/createTextNode
+	// (IE doesn't support this, fails, and uses .text instead)
+	if ( window[ id ] ) {
+		jQuery.support.scriptEval = true;
+		delete window[ id ];
+	}
+
+	// Test to see if it's possible to delete an expando from an element
+	// Fails in Internet Explorer
+	try {
+		delete script.test;
+	
+	} catch(e) {
+		jQuery.support.deleteExpando = false;
+	}
+
+	root.removeChild( script );
+
+	if ( div.attachEvent && div.fireEvent ) {
+		div.attachEvent("onclick", function click() {
+			// Cloning a node shouldn't copy over any
+			// bound event handlers (IE does this)
+			jQuery.support.noCloneEvent = false;
+			div.detachEvent("onclick", click);
+		});
+		div.cloneNode(true).fireEvent("onclick");
+	}
+
+	div = document.createElement("div");
+	div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>";
+
+	var fragment = document.createDocumentFragment();
+	fragment.appendChild( div.firstChild );
+
+	// WebKit doesn't clone checked state correctly in fragments
+	jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
+
+	// Figure out if the W3C box model works as expected
+	// document.body must exist before we can do this
+	jQuery(function() {
+		var div = document.createElement("div");
+		div.style.width = div.style.paddingLeft = "1px";
+
+		document.body.appendChild( div );
+		jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
+		document.body.removeChild( div ).style.display = 'none';
+
+		div = null;
+	});
+
+	// Technique from Juriy Zaytsev
+	// http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
+	var eventSupported = function( eventName ) { 
+		var el = document.createElement("div"); 
+		eventName = "on" + eventName; 
+
+		var isSupported = (eventName in el); 
+		if ( !isSupported ) { 
+			el.setAttribute(eventName, "return;"); 
+			isSupported = typeof el[eventName] === "function"; 
+		} 
+		el = null; 
+
+		return isSupported; 
+	};
+	
+	jQuery.support.submitBubbles = eventSupported("submit");
+	jQuery.support.changeBubbles = eventSupported("change");
+
+	// release memory in IE
+	root = script = div = all = a = null;
+})();
+
+jQuery.props = {
+	"for": "htmlFor",
+	"class": "className",
+	readonly: "readOnly",
+	maxlength: "maxLength",
+	cellspacing: "cellSpacing",
+	rowspan: "rowSpan",
+	colspan: "colSpan",
+	tabindex: "tabIndex",
+	usemap: "useMap",
+	frameborder: "frameBorder"
+};
+var expando = "jQuery" + now(), uuid = 0, windowData = {};
+
+jQuery.extend({
+	cache: {},
+	
+	expando:expando,
+
+	// The following elements throw uncatchable exceptions if you
+	// attempt to add expando properties to them.
+	noData: {
+		"embed": true,
+		"object": true,
+		"applet": true
+	},
+
+	data: function( elem, name, data ) {
+		if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+			return;
+		}
+
+		elem = elem == window ?
+			windowData :
+			elem;
+
+		var id = elem[ expando ], cache = jQuery.cache, thisCache;
+
+		if ( !id && typeof name === "string" && data === undefined ) {
+			return null;
+		}
+
+		// Compute a unique ID for the element
+		if ( !id ) { 
+			id = ++uuid;
+		}
+
+		// Avoid generating a new cache unless none exists and we
+		// want to manipulate it.
+		if ( typeof name === "object" ) {
+			elem[ expando ] = id;
+			thisCache = cache[ id ] = jQuery.extend(true, {}, name);
+
+		} else if ( !cache[ id ] ) {
+			elem[ expando ] = id;
+			cache[ id ] = {};
+		}
+
+		thisCache = cache[ id ];
+
+		// Prevent overriding the named cache with undefined values
+		if ( data !== undefined ) {
+			thisCache[ name ] = data;
+		}
+
+		return typeof name === "string" ? thisCache[ name ] : thisCache;
+	},
+
+	removeData: function( elem, name ) {
+		if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+			return;
+		}
+
+		elem = elem == window ?
+			windowData :
+			elem;
+
+		var id = elem[ expando ], cache = jQuery.cache, thisCache = cache[ id ];
+
+		// If we want to remove a specific section of the element's data
+		if ( name ) {
+			if ( thisCache ) {
+				// Remove the section of cache data
+				delete thisCache[ name ];
+
+				// If we've removed all the data, remove the element's cache
+				if ( jQuery.isEmptyObject(thisCache) ) {
+					jQuery.removeData( elem );
+				}
+			}
+
+		// Otherwise, we want to remove all of the element's data
+		} else {
+			if ( jQuery.support.deleteExpando ) {
+				delete elem[ jQuery.expando ];
+
+			} else if ( elem.removeAttribute ) {
+				elem.removeAttribute( jQuery.expando );
+			}
+
+			// Completely remove the data cache
+			delete cache[ id ];
+		}
+	}
+});
+
+jQuery.fn.extend({
+	data: function( key, value ) {
+		if ( typeof key === "undefined" && this.length ) {
+			return jQuery.data( this[0] );
+
+		} else if ( typeof key === "object" ) {
+			return this.each(function() {
+				jQuery.data( this, key );
+			});
+		}
+
+		var parts = key.split(".");
+		parts[1] = parts[1] ? "." + parts[1] : "";
+
+		if ( value === undefined ) {
+			var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+
+			if ( data === undefined && this.length ) {
+				data = jQuery.data( this[0], key );
+			}
+			return data === undefined && parts[1] ?
+				this.data( parts[0] ) :
+				data;
+		} else {
+			return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function() {
+				jQuery.data( this, key, value );
+			});
+		}
+	},
+
+	removeData: function( key ) {
+		return this.each(function() {
+			jQuery.removeData( this, key );
+		});
+	}
+});
+jQuery.extend({
+	queue: function( elem, type, data ) {
+		if ( !elem ) {
+			return;
+		}
+
+		type = (type || "fx") + "queue";
+		var q = jQuery.data( elem, type );
+
+		// Speed up dequeue by getting out quickly if this is just a lookup
+		if ( !data ) {
+			return q || [];
+		}
+
+		if ( !q || jQuery.isArray(data) ) {
+			q = jQuery.data( elem, type, jQuery.makeArray(data) );
+
+		} else {
+			q.push( data );
+		}
+
+		return q;
+	},
+
+	dequeue: function( elem, type ) {
+		type = type || "fx";
+
+		var queue = jQuery.queue( elem, type ), fn = queue.shift();
+
+		// If the fx queue is dequeued, always remove the progress sentinel
+		if ( fn === "inprogress" ) {
+			fn = queue.shift();
+		}
+
+		if ( fn ) {
+			// Add a progress sentinel to prevent the fx queue from being
+			// automatically dequeued
+			if ( type === "fx" ) {
+				queue.unshift("inprogress");
+			}
+
+			fn.call(elem, function() {
+				jQuery.dequeue(elem, type);
+			});
+		}
+	}
+});
+
+jQuery.fn.extend({
+	queue: function( type, data ) {
+		if ( typeof type !== "string" ) {
+			data = type;
+			type = "fx";
+		}
+
+		if ( data === undefined ) {
+			return jQuery.queue( this[0], type );
+		}
+		return this.each(function( i, elem ) {
+			var queue = jQuery.queue( this, type, data );
+
+			if ( type === "fx" && queue[0] !== "inprogress" ) {
+				jQuery.dequeue( this, type );
+			}
+		});
+	},
+	dequeue: function( type ) {
+		return this.each(function() {
+			jQuery.dequeue( this, type );
+		});
+	},
+
+	// Based off of the plugin by Clint Helfers, with permission.
+	// http://blindsignals.com/index.php/2009/07/jquery-delay/
+	delay: function( time, type ) {
+		time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
+		type = type || "fx";
+
+		return this.queue( type, function() {
+			var elem = this;
+			setTimeout(function() {
+				jQuery.dequeue( elem, type );
+			}, time );
+		});
+	},
+
+	clearQueue: function( type ) {
+		return this.queue( type || "fx", [] );
+	}
+});
+var rclass = /[\n\t]/g,
+	rspace = /\s+/,
+	rreturn = /\r/g,
+	rspecialurl = /href|src|style/,
+	rtype = /(button|input)/i,
+	rfocusable = /(button|input|object|select|textarea)/i,
+	rclickable = /^(a|area)$/i,
+	rradiocheck = /radio|checkbox/;
+
+jQuery.fn.extend({
+	attr: function( name, value ) {
+		return access( this, name, value, true, jQuery.attr );
+	},
+
+	removeAttr: function( name, fn ) {
+		return this.each(function(){
+			jQuery.attr( this, name, "" );
+			if ( this.nodeType === 1 ) {
+				this.removeAttribute( name );
+			}
+		});
+	},
+
+	addClass: function( value ) {
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.addClass( value.call(this, i, self.attr("class")) );
+			});
+		}
+
+		if ( value && typeof value === "string" ) {
+			var classNames = (value || "").split( rspace );
+
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var elem = this[i];
+
+				if ( elem.nodeType === 1 ) {
+					if ( !elem.className ) {
+						elem.className = value;
+
+					} else {
+						var className = " " + elem.className + " ", setClass = elem.className;
+						for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+							if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) {
+								setClass += " " + classNames[c];
+							}
+						}
+						elem.className = jQuery.trim( setClass );
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	removeClass: function( value ) {
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.removeClass( value.call(this, i, self.attr("class")) );
+			});
+		}
+
+		if ( (value && typeof value === "string") || value === undefined ) {
+			var classNames = (value || "").split(rspace);
+
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var elem = this[i];
+
+				if ( elem.nodeType === 1 && elem.className ) {
+					if ( value ) {
+						var className = (" " + elem.className + " ").replace(rclass, " ");
+						for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+							className = className.replace(" " + classNames[c] + " ", " ");
+						}
+						elem.className = jQuery.trim( className );
+
+					} else {
+						elem.className = "";
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	toggleClass: function( value, stateVal ) {
+		var type = typeof value, isBool = typeof stateVal === "boolean";
+
+		if ( jQuery.isFunction( value ) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal );
+			});
+		}
+
+		return this.each(function() {
+			if ( type === "string" ) {
+				// toggle individual class names
+				var className, i = 0, self = jQuery(this),
+					state = stateVal,
+					classNames = value.split( rspace );
+
+				while ( (className = classNames[ i++ ]) ) {
+					// check each className given, space seperated list
+					state = isBool ? state : !self.hasClass( className );
+					self[ state ? "addClass" : "removeClass" ]( className );
+				}
+
+			} else if ( type === "undefined" || type === "boolean" ) {
+				if ( this.className ) {
+					// store className if set
+					jQuery.data( this, "__className__", this.className );
+				}
+
+				// toggle whole className
+				this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || "";
+			}
+		});
+	},
+
+	hasClass: function( selector ) {
+		var className = " " + selector + " ";
+		for ( var i = 0, l = this.length; i < l; i++ ) {
+			if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
+				return true;
+			}
+		}
+
+		return false;
+	},
+
+	val: function( value ) {
+		if ( value === undefined ) {
+			var elem = this[0];
+
+			if ( elem ) {
+				if ( jQuery.nodeName( elem, "option" ) ) {
+					return (elem.attributes.value || {}).specified ? elem.value : elem.text;
+				}
+
+				// We need to handle select boxes special
+				if ( jQuery.nodeName( elem, "select" ) ) {
+					var index = elem.selectedIndex,
+						values = [],
+						options = elem.options,
+						one = elem.type === "select-one";
+
+					// Nothing was selected
+					if ( index < 0 ) {
+						return null;
+					}
+
+					// Loop through all the selected options
+					for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+						var option = options[ i ];
+
+						if ( option.selected ) {
+							// Get the specifc value for the option
+							value = jQuery(option).val();
+
+							// We don't need an array for one selects
+							if ( one ) {
+								return value;
+							}
+
+							// Multi-Selects return an array
+							values.push( value );
+						}
+					}
+
+					return values;
+				}
+
+				// Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+				if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) {
+					return elem.getAttribute("value") === null ? "on" : elem.value;
+				}
+				
+
+				// Everything else, we just grab the value
+				return (elem.value || "").replace(rreturn, "");
+
+			}
+
+			return undefined;
+		}
+
+		var isFunction = jQuery.isFunction(value);
+
+		return this.each(function(i) {
+			var self = jQuery(this), val = value;
+
+			if ( this.nodeType !== 1 ) {
+				return;
+			}
+
+			if ( isFunction ) {
+				val = value.call(this, i, self.val());
+			}
+
+			// Typecast each time if the value is a Function and the appended
+			// value is therefore different each time.
+			if ( typeof val === "number" ) {
+				val += "";
+			}
+
+			if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) {
+				this.checked = jQuery.inArray( self.val(), val ) >= 0;
+
+			} else if ( jQuery.nodeName( this, "select" ) ) {
+				var values = jQuery.makeArray(val);
+
+				jQuery( "option", this ).each(function() {
+					this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+				});
+
+				if ( !values.length ) {
+					this.selectedIndex = -1;
+				}
+
+			} else {
+				this.value = val;
+			}
+		});
+	}
+});
+
+jQuery.extend({
+	attrFn: {
+		val: true,
+		css: true,
+		html: true,
+		text: true,
+		data: true,
+		width: true,
+		height: true,
+		offset: true
+	},
+		
+	attr: function( elem, name, value, pass ) {
+		// don't set attributes on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return undefined;
+		}
+
+		if ( pass && name in jQuery.attrFn ) {
+			return jQuery(elem)[name](value);
+		}
+
+		var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ),
+			// Whether we are setting (or getting)
+			set = value !== undefined;
+
+		// Try to normalize/fix the name
+		name = notxml && jQuery.props[ name ] || name;
+
+		// Only do all the following if this is a node (faster for style)
+		if ( elem.nodeType === 1 ) {
+			// These attributes require special treatment
+			var special = rspecialurl.test( name );
+
+			// Safari mis-reports the default selected property of an option
+			// Accessing the parent's selectedIndex property fixes it
+			if ( name === "selected" && !jQuery.support.optSelected ) {
+				var parent = elem.parentNode;
+				if ( parent ) {
+					parent.selectedIndex;
+	
+					// Make sure that it also works with optgroups, see #5701
+					if ( parent.parentNode ) {
+						parent.parentNode.selectedIndex;
+					}
+				}
+			}
+
+			// If applicable, access the attribute via the DOM 0 way
+			if ( name in elem && notxml && !special ) {
+				if ( set ) {
+					// We can't allow the type property to be changed (since it causes problems in IE)
+					if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) {
+						jQuery.error( "type property can't be changed" );
+					}
+
+					elem[ name ] = value;
+				}
+
+				// browsers index elements by id/name on forms, give priority to attributes.
+				if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) {
+					return elem.getAttributeNode( name ).nodeValue;
+				}
+
+				// elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+				// http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+				if ( name === "tabIndex" ) {
+					var attributeNode = elem.getAttributeNode( "tabIndex" );
+
+					return attributeNode && attributeNode.specified ?
+						attributeNode.value :
+						rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+							0 :
+							undefined;
+				}
+
+				return elem[ name ];
+			}
+
+			if ( !jQuery.support.style && notxml && name === "style" ) {
+				if ( set ) {
+					elem.style.cssText = "" + value;
+				}
+
+				return elem.style.cssText;
+			}
+
+			if ( set ) {
+				// convert the value to a string (all browsers do this but IE) see #1070
+				elem.setAttribute( name, "" + value );
+			}
+
+			var attr = !jQuery.support.hrefNormalized && notxml && special ?
+					// Some attributes require a special call on IE
+					elem.getAttribute( name, 2 ) :
+					elem.getAttribute( name );
+
+			// Non-existent attributes return null, we normalize to undefined
+			return attr === null ? undefined : attr;
+		}
+
+		// elem is actually elem.style ... set the style
+		// Using attr for specific style information is now deprecated. Use style instead.
+		return jQuery.style( elem, name, value );
+	}
+});
+var rnamespaces = /\.(.*)$/,
+	fcleanup = function( nm ) {
+		return nm.replace(/[^\w\s\.\|`]/g, function( ch ) {
+			return "\\" + ch;
+		});
+	};
+
+/*
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code originated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+
+	// Bind an event to an element
+	// Original by Dean Edwards
+	add: function( elem, types, handler, data ) {
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		// For whatever reason, IE has trouble passing the window object
+		// around, causing it to be cloned in the process
+		if ( elem.setInterval && ( elem !== window && !elem.frameElement ) ) {
+			elem = window;
+		}
+
+		var handleObjIn, handleObj;
+
+		if ( handler.handler ) {
+			handleObjIn = handler;
+			handler = handleObjIn.handler;
+		}
+
+		// Make sure that the function being executed has a unique ID
+		if ( !handler.guid ) {
+			handler.guid = jQuery.guid++;
+		}
+
+		// Init the element's event structure
+		var elemData = jQuery.data( elem );
+
+		// If no elemData is found then we must be trying to bind to one of the
+		// banned noData elements
+		if ( !elemData ) {
+			return;
+		}
+
+		var events = elemData.events = elemData.events || {},
+			eventHandle = elemData.handle, eventHandle;
+
+		if ( !eventHandle ) {
+			elemData.handle = eventHandle = function() {
+				// Handle the second event of a trigger and when
+				// an event is called after a page has unloaded
+				return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
+					jQuery.event.handle.apply( eventHandle.elem, arguments ) :
+					undefined;
+			};
+		}
+
+		// Add elem as a property of the handle function
+		// This is to prevent a memory leak with non-native events in IE.
+		eventHandle.elem = elem;
+
+		// Handle multiple events separated by a space
+		// jQuery(...).bind("mouseover mouseout", fn);
+		types = types.split(" ");
+
+		var type, i = 0, namespaces;
+
+		while ( (type = types[ i++ ]) ) {
+			handleObj = handleObjIn ?
+				jQuery.extend({}, handleObjIn) :
+				{ handler: handler, data: data };
+
+			// Namespaced event handlers
+			if ( type.indexOf(".") > -1 ) {
+				namespaces = type.split(".");
+				type = namespaces.shift();
+				handleObj.namespace = namespaces.slice(0).sort().join(".");
+
+			} else {
+				namespaces = [];
+				handleObj.namespace = "";
+			}
+
+			handleObj.type = type;
+			handleObj.guid = handler.guid;
+
+			// Get the current list of functions bound to this event
+			var handlers = events[ type ],
+				special = jQuery.event.special[ type ] || {};
+
+			// Init the event handler queue
+			if ( !handlers ) {
+				handlers = events[ type ] = [];
+
+				// Check for a special event handler
+				// Only use addEventListener/attachEvent if the special
+				// events handler returns false
+				if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+					// Bind the global event handler to the element
+					if ( elem.addEventListener ) {
+						elem.addEventListener( type, eventHandle, false );
+
+					} else if ( elem.attachEvent ) {
+						elem.attachEvent( "on" + type, eventHandle );
+					}
+				}
+			}
+			
+			if ( special.add ) { 
+				special.add.call( elem, handleObj ); 
+
+				if ( !handleObj.handler.guid ) {
+					handleObj.handler.guid = handler.guid;
+				}
+			}
+
+			// Add the function to the element's handler list
+			handlers.push( handleObj );
+
+			// Keep track of which events have been used, for global triggering
+			jQuery.event.global[ type ] = true;
+		}
+
+		// Nullify elem to prevent memory leaks in IE
+		elem = null;
+	},
+
+	global: {},
+
+	// Detach an event or set of events from an element
+	remove: function( elem, types, handler, pos ) {
+		// don't do events on text and comment nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		var ret, type, fn, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
+			elemData = jQuery.data( elem ),
+			events = elemData && elemData.events;
+
+		if ( !elemData || !events ) {
+			return;
+		}
+
+		// types is actually an event object here
+		if ( types && types.type ) {
+			handler = types.handler;
+			types = types.type;
+		}
+
+		// Unbind all events for the element
+		if ( !types || typeof types === "string" && types.charAt(0) === "." ) {
+			types = types || "";
+
+			for ( type in events ) {
+				jQuery.event.remove( elem, type + types );
+			}
+
+			return;
+		}
+
+		// Handle multiple events separated by a space
+		// jQuery(...).unbind("mouseover mouseout", fn);
+		types = types.split(" ");
+
+		while ( (type = types[ i++ ]) ) {
+			origType = type;
+			handleObj = null;
+			all = type.indexOf(".") < 0;
+			namespaces = [];
+
+			if ( !all ) {
+				// Namespaced event handlers
+				namespaces = type.split(".");
+				type = namespaces.shift();
+
+				namespace = new RegExp("(^|\\.)" + 
+					jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)")
+			}
+
+			eventType = events[ type ];
+
+			if ( !eventType ) {
+				continue;
+			}
+
+			if ( !handler ) {
+				for ( var j = 0; j < eventType.length; j++ ) {
+					handleObj = eventType[ j ];
+
+					if ( all || namespace.test( handleObj.namespace ) ) {
+						jQuery.event.remove( elem, origType, handleObj.handler, j );
+						eventType.splice( j--, 1 );
+					}
+				}
+
+				continue;
+			}
+
+			special = jQuery.event.special[ type ] || {};
+
+			for ( var j = pos || 0; j < eventType.length; j++ ) {
+				handleObj = eventType[ j ];
+
+				if ( handler.guid === handleObj.guid ) {
+					// remove the given handler for the given type
+					if ( all || namespace.test( handleObj.namespace ) ) {
+						if ( pos == null ) {
+							eventType.splice( j--, 1 );
+						}
+
+						if ( special.remove ) {
+							special.remove.call( elem, handleObj );
+						}
+					}
+
+					if ( pos != null ) {
+						break;
+					}
+				}
+			}
+
+			// remove generic event handler if no more handlers exist
+			if ( eventType.length === 0 || pos != null && eventType.length === 1 ) {
+				if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
+					removeEvent( elem, type, elemData.handle );
+				}
+
+				ret = null;
+				delete events[ type ];
+			}
+		}
+
+		// Remove the expando if it's no longer used
+		if ( jQuery.isEmptyObject( events ) ) {
+			var handle = elemData.handle;
+			if ( handle ) {
+				handle.elem = null;
+			}
+
+			delete elemData.events;
+			delete elemData.handle;
+
+			if ( jQuery.isEmptyObject( elemData ) ) {
+				jQuery.removeData( elem );
+			}
+		}
+	},
+
+	// bubbling is internal
+	trigger: function( event, data, elem /*, bubbling */ ) {
+		// Event object or event type
+		var type = event.type || event,
+			bubbling = arguments[3];
+
+		if ( !bubbling ) {
+			event = typeof event === "object" ?
+				// jQuery.Event object
+				event[expando] ? event :
+				// Object literal
+				jQuery.extend( jQuery.Event(type), event ) :
+				// Just the event type (string)
+				jQuery.Event(type);
+
+			if ( type.indexOf("!") >= 0 ) {
+				event.type = type = type.slice(0, -1);
+				event.exclusive = true;
+			}
+
+			// Handle a global trigger
+			if ( !elem ) {
+				// Don't bubble custom events when global (to avoid too much overhead)
+				event.stopPropagation();
+
+				// Only trigger if we've ever bound an event for it
+				if ( jQuery.event.global[ type ] ) {
+					jQuery.each( jQuery.cache, function() {
+						if ( this.events && this.events[type] ) {
+							jQuery.event.trigger( event, data, this.handle.elem );
+						}
+					});
+				}
+			}
+
+			// Handle triggering a single element
+
+			// don't do events on text and comment nodes
+			if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+				return undefined;
+			}
+
+			// Clean up in case it is reused
+			event.result = undefined;
+			event.target = elem;
+
+			// Clone the incoming data, if any
+			data = jQuery.makeArray( data );
+			data.unshift( event );
+		}
+
+		event.currentTarget = elem;
+
+		// Trigger the event, it is assumed that "handle" is a function
+		var handle = jQuery.data( elem, "handle" );
+		if ( handle ) {
+			handle.apply( elem, data );
+		}
+
+		var parent = elem.parentNode || elem.ownerDocument;
+
+		// Trigger an inline bound script
+		try {
+			if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) {
+				if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) {
+					event.result = false;
+				}
+			}
+
+		// prevent IE from throwing an error for some elements with some event types, see #3533
+		} catch (e) {}
+
+		if ( !event.isPropagationStopped() && parent ) {
+			jQuery.event.trigger( event, data, parent, true );
+
+		} else if ( !event.isDefaultPrevented() ) {
+			var target = event.target, old,
+				isClick = jQuery.nodeName(target, "a") && type === "click",
+				special = jQuery.event.special[ type ] || {};
+
+			if ( (!special._default || special._default.call( elem, event ) === false) && 
+				!isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) {
+
+				try {
+					if ( target[ type ] ) {
+						// Make sure that we don't accidentally re-trigger the onFOO events
+						old = target[ "on" + type ];
+
+						if ( old ) {
+							target[ "on" + type ] = null;
+						}
+
+						jQuery.event.triggered = true;
+						target[ type ]();
+					}
+
+				// prevent IE from throwing an error for some elements with some event types, see #3533
+				} catch (e) {}
+
+				if ( old ) {
+					target[ "on" + type ] = old;
+				}
+
+				jQuery.event.triggered = false;
+			}
+		}
+	},
+
+	handle: function( event ) {
+		var all, handlers, namespaces, namespace, events;
+
+		event = arguments[0] = jQuery.event.fix( event || window.event );
+		event.currentTarget = this;
+
+		// Namespaced event handlers
+		all = event.type.indexOf(".") < 0 && !event.exclusive;
+
+		if ( !all ) {
+			namespaces = event.type.split(".");
+			event.type = namespaces.shift();
+			namespace = new RegExp("(^|\\.)" + namespaces.slice(0).sort().join("\\.(?:.*\\.)?") + "(\\.|$)");
+		}
+
+		var events = jQuery.data(this, "events"), handlers = events[ event.type ];
+
+		if ( events && handlers ) {
+			// Clone the handlers to prevent manipulation
+			handlers = handlers.slice(0);
+
+			for ( var j = 0, l = handlers.length; j < l; j++ ) {
+				var handleObj = handlers[ j ];
+
+				// Filter the functions by class
+				if ( all || namespace.test( handleObj.namespace ) ) {
+					// Pass in a reference to the handler function itself
+					// So that we can later remove it
+					event.handler = handleObj.handler;
+					event.data = handleObj.data;
+					event.handleObj = handleObj;
+	
+					var ret = handleObj.handler.apply( this, arguments );
+
+					if ( ret !== undefined ) {
+						event.result = ret;
+						if ( ret === false ) {
+							event.preventDefault();
+							event.stopPropagation();
+						}
+					}
+
+					if ( event.isImmediatePropagationStopped() ) {
+						break;
+					}
+				}
+			}
+		}
+
+		return event.result;
+	},
+
+	props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+
+	fix: function( event ) {
+		if ( event[ expando ] ) {
+			return event;
+		}
+
+		// store a copy of the original event object
+		// and "clone" to set read-only properties
+		var originalEvent = event;
+		event = jQuery.Event( originalEvent );
+
+		for ( var i = this.props.length, prop; i; ) {
+			prop = this.props[ --i ];
+			event[ prop ] = originalEvent[ prop ];
+		}
+
+		// Fix target property, if necessary
+		if ( !event.target ) {
+			event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+		}
+
+		// check if target is a textnode (safari)
+		if ( event.target.nodeType === 3 ) {
+			event.target = event.target.parentNode;
+		}
+
+		// Add relatedTarget, if necessary
+		if ( !event.relatedTarget && event.fromElement ) {
+			event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement;
+		}
+
+		// Calculate pageX/Y if missing and clientX/Y available
+		if ( event.pageX == null && event.clientX != null ) {
+			var doc = document.documentElement, body = document.body;
+			event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
+			event.pageY = event.clientY + (doc && doc.scrollTop  || body && body.scrollTop  || 0) - (doc && doc.clientTop  || body && body.clientTop  || 0);
+		}
+
+		// Add which for key events
+		if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) {
+			event.which = event.charCode || event.keyCode;
+		}
+
+		// Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+		if ( !event.metaKey && event.ctrlKey ) {
+			event.metaKey = event.ctrlKey;
+		}
+
+		// Add which for click: 1 === left; 2 === middle; 3 === right
+		// Note: button is not normalized, so don't use it
+		if ( !event.which && event.button !== undefined ) {
+			event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+		}
+
+		return event;
+	},
+
+	// Deprecated, use jQuery.guid instead
+	guid: 1E8,
+
+	// Deprecated, use jQuery.proxy instead
+	proxy: jQuery.proxy,
+
+	special: {
+		ready: {
+			// Make sure the ready event is setup
+			setup: jQuery.bindReady,
+			teardown: jQuery.noop
+		},
+
+		live: {
+			add: function( handleObj ) {
+				jQuery.event.add( this, handleObj.origType, jQuery.extend({}, handleObj, {handler: liveHandler}) ); 
+			},
+
+			remove: function( handleObj ) {
+				var remove = true,
+					type = handleObj.origType.replace(rnamespaces, "");
+				
+				jQuery.each( jQuery.data(this, "events").live || [], function() {
+					if ( type === this.origType.replace(rnamespaces, "") ) {
+						remove = false;
+						return false;
+					}
+				});
+
+				if ( remove ) {
+					jQuery.event.remove( this, handleObj.origType, liveHandler );
+				}
+			}
+
+		},
+
+		beforeunload: {
+			setup: function( data, namespaces, eventHandle ) {
+				// We only want to do this special case on windows
+				if ( this.setInterval ) {
+					this.onbeforeunload = eventHandle;
+				}
+
+				return false;
+			},
+			teardown: function( namespaces, eventHandle ) {
+				if ( this.onbeforeunload === eventHandle ) {
+					this.onbeforeunload = null;
+				}
+			}
+		}
+	}
+};
+
+var removeEvent = document.removeEventListener ?
+	function( elem, type, handle ) {
+		elem.removeEventListener( type, handle, false );
+	} : 
+	function( elem, type, handle ) {
+		elem.detachEvent( "on" + type, handle );
+	};
+
+jQuery.Event = function( src ) {
+	// Allow instantiation without the 'new' keyword
+	if ( !this.preventDefault ) {
+		return new jQuery.Event( src );
+	}
+
+	// Event object
+	if ( src && src.type ) {
+		this.originalEvent = src;
+		this.type = src.type;
+	// Event type
+	} else {
+		this.type = src;
+	}
+
+	// timeStamp is buggy for some events on Firefox(#3843)
+	// So we won't rely on the native value
+	this.timeStamp = now();
+
+	// Mark it as fixed
+	this[ expando ] = true;
+};
+
+function returnFalse() {
+	return false;
+}
+function returnTrue() {
+	return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+	preventDefault: function() {
+		this.isDefaultPrevented = returnTrue;
+
+		var e = this.originalEvent;
+		if ( !e ) {
+			return;
+		}
+		
+		// if preventDefault exists run it on the original event
+		if ( e.preventDefault ) {
+			e.preventDefault();
+		}
+		// otherwise set the returnValue property of the original event to false (IE)
+		e.returnValue = false;
+	},
+	stopPropagation: function() {
+		this.isPropagationStopped = returnTrue;
+
+		var e = this.originalEvent;
+		if ( !e ) {
+			return;
+		}
+		// if stopPropagation exists run it on the original event
+		if ( e.stopPropagation ) {
+			e.stopPropagation();
+		}
+		// otherwise set the cancelBubble property of the original event to true (IE)
+		e.cancelBubble = true;
+	},
+	stopImmediatePropagation: function() {
+		this.isImmediatePropagationStopped = returnTrue;
+		this.stopPropagation();
+	},
+	isDefaultPrevented: returnFalse,
+	isPropagationStopped: returnFalse,
+	isImmediatePropagationStopped: returnFalse
+};
+
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function( event ) {
+	// Check if mouse(over|out) are still within the same parent element
+	var parent = event.relatedTarget;
+
+	// Firefox sometimes assigns relatedTarget a XUL element
+	// which we cannot access the parentNode property of
+	try {
+		// Traverse up the tree
+		while ( parent && parent !== this ) {
+			parent = parent.parentNode;
+		}
+
+		if ( parent !== this ) {
+			// set the correct event type
+			event.type = event.data;
+
+			// handle event if we actually just moused on to a non sub-element
+			jQuery.event.handle.apply( this, arguments );
+		}
+
+	// assuming we've left the element since we most likely mousedover a xul element
+	} catch(e) { }
+},
+
+// In case of event delegation, we only need to rename the event.type,
+// liveHandler will take care of the rest.
+delegate = function( event ) {
+	event.type = event.data;
+	jQuery.event.handle.apply( this, arguments );
+};
+
+// Create mouseenter and mouseleave events
+jQuery.each({
+	mouseenter: "mouseover",
+	mouseleave: "mouseout"
+}, function( orig, fix ) {
+	jQuery.event.special[ orig ] = {
+		setup: function( data ) {
+			jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig );
+		},
+		teardown: function( data ) {
+			jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement );
+		}
+	};
+});
+
+// submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+	jQuery.event.special.submit = {
+		setup: function( data, namespaces ) {
+			if ( this.nodeName.toLowerCase() !== "form" ) {
+				jQuery.event.add(this, "click.specialSubmit", function( e ) {
+					var elem = e.target, type = elem.type;
+
+					if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) {
+						return trigger( "submit", this, arguments );
+					}
+				});
+	 
+				jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
+					var elem = e.target, type = elem.type;
+
+					if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
+						return trigger( "submit", this, arguments );
+					}
+				});
+
+			} else {
+				return false;
+			}
+		},
+
+		teardown: function( namespaces ) {
+			jQuery.event.remove( this, ".specialSubmit" );
+		}
+	};
+
+}
+
+// change delegation, happens here so we have bind.
+if ( !jQuery.support.changeBubbles ) {
+
+	var formElems = /textarea|input|select/i,
+
+	changeFilters,
+
+	getVal = function( elem ) {
+		var type = elem.type, val = elem.value;
+
+		if ( type === "radio" || type === "checkbox" ) {
+			val = elem.checked;
+
+		} else if ( type === "select-multiple" ) {
+			val = elem.selectedIndex > -1 ?
+				jQuery.map( elem.options, function( elem ) {
+					return elem.selected;
+				}).join("-") :
+				"";
+
+		} else if ( elem.nodeName.toLowerCase() === "select" ) {
+			val = elem.selectedIndex;
+		}
+
+		return val;
+	},
+
+	testChange = function testChange( e ) {
+		var elem = e.target, data, val;
+
+		if ( !formElems.test( elem.nodeName ) || elem.readOnly ) {
+			return;
+		}
+
+		data = jQuery.data( elem, "_change_data" );
+		val = getVal(elem);
+
+		// the current data will be also retrieved by beforeactivate
+		if ( e.type !== "focusout" || elem.type !== "radio" ) {
+			jQuery.data( elem, "_change_data", val );
+		}
+		
+		if ( data === undefined || val === data ) {
+			return;
+		}
+
+		if ( data != null || val ) {
+			e.type = "change";
+			return jQuery.event.trigger( e, arguments[1], elem );
+		}
+	};
+
+	jQuery.event.special.change = {
+		filters: {
+			focusout: testChange, 
+
+			click: function( e ) {
+				var elem = e.target, type = elem.type;
+
+				if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) {
+					return testChange.call( this, e );
+				}
+			},
+
+			// Change has to be called before submit
+			// Keydown will be called before keypress, which is used in submit-event delegation
+			keydown: function( e ) {
+				var elem = e.target, type = elem.type;
+
+				if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") ||
+					(e.keyCode === 32 && (type === "checkbox" || type === "radio")) ||
+					type === "select-multiple" ) {
+					return testChange.call( this, e );
+				}
+			},
+
+			// Beforeactivate happens also before the previous element is blurred
+			// with this event you can't trigger a change event, but you can store
+			// information/focus[in] is not needed anymore
+			beforeactivate: function( e ) {
+				var elem = e.target;
+				jQuery.data( elem, "_change_data", getVal(elem) );
+			}
+		},
+
+		setup: function( data, namespaces ) {
+			if ( this.type === "file" ) {
+				return false;
+			}
+
+			for ( var type in changeFilters ) {
+				jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
+			}
+
+			return formElems.test( this.nodeName );
+		},
+
+		teardown: function( namespaces ) {
+			jQuery.event.remove( this, ".specialChange" );
+
+			return formElems.test( this.nodeName );
+		}
+	};
+
+	changeFilters = jQuery.event.special.change.filters;
+}
+
+function trigger( type, elem, args ) {
+	args[0].type = type;
+	return jQuery.event.handle.apply( elem, args );
+}
+
+// Create "bubbling" focus and blur events
+if ( document.addEventListener ) {
+	jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+		jQuery.event.special[ fix ] = {
+			setup: function() {
+				this.addEventListener( orig, handler, true );
+			}, 
+			teardown: function() { 
+				this.removeEventListener( orig, handler, true );
+			}
+		};
+
+		function handler( e ) { 
+			e = jQuery.event.fix( e );
+			e.type = fix;
+			return jQuery.event.handle.call( this, e );
+		}
+	});
+}
+
+jQuery.each(["bind", "one"], function( i, name ) {
+	jQuery.fn[ name ] = function( type, data, fn ) {
+		// Handle object literals
+		if ( typeof type === "object" ) {
+			for ( var key in type ) {
+				this[ name ](key, data, type[key], fn);
+			}
+			return this;
+		}
+		
+		if ( jQuery.isFunction( data ) ) {
+			fn = data;
+			data = undefined;
+		}
+
+		var handler = name === "one" ? jQuery.proxy( fn, function( event ) {
+			jQuery( this ).unbind( event, handler );
+			return fn.apply( this, arguments );
+		}) : fn;
+
+		if ( type === "unload" && name !== "one" ) {
+			this.one( type, data, fn );
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				jQuery.event.add( this[i], type, handler, data );
+			}
+		}
+
+		return this;
+	};
+});
+
+jQuery.fn.extend({
+	unbind: function( type, fn ) {
+		// Handle object literals
+		if ( typeof type === "object" && !type.preventDefault ) {
+			for ( var key in type ) {
+				this.unbind(key, type[key]);
+			}
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				jQuery.event.remove( this[i], type, fn );
+			}
+		}
+
+		return this;
+	},
+	
+	delegate: function( selector, types, data, fn ) {
+		return this.live( types, data, fn, selector );
+	},
+	
+	undelegate: function( selector, types, fn ) {
+		if ( arguments.length === 0 ) {
+				return this.unbind( "live" );
+		
+		} else {
+			return this.die( types, null, fn, selector );
+		}
+	},
+	
+	trigger: function( type, data ) {
+		return this.each(function() {
+			jQuery.event.trigger( type, data, this );
+		});
+	},
+
+	triggerHandler: function( type, data ) {
+		if ( this[0] ) {
+			var event = jQuery.Event( type );
+			event.preventDefault();
+			event.stopPropagation();
+			jQuery.event.trigger( event, data, this[0] );
+			return event.result;
+		}
+	},
+
+	toggle: function( fn ) {
+		// Save reference to arguments for access in closure
+		var args = arguments, i = 1;
+
+		// link all the functions, so any of them can unbind this click handler
+		while ( i < args.length ) {
+			jQuery.proxy( fn, args[ i++ ] );
+		}
+
+		return this.click( jQuery.proxy( fn, function( event ) {
+			// Figure out which function to execute
+			var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+			jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+			// Make sure that clicks stop
+			event.preventDefault();
+
+			// and execute the function
+			return args[ lastToggle ].apply( this, arguments ) || false;
+		}));
+	},
+
+	hover: function( fnOver, fnOut ) {
+		return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+	}
+});
+
+var liveMap = {
+	focus: "focusin",
+	blur: "focusout",
+	mouseenter: "mouseover",
+	mouseleave: "mouseout"
+};
+
+jQuery.each(["live", "die"], function( i, name ) {
+	jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) {
+		var type, i = 0, match, namespaces, preType,
+			selector = origSelector || this.selector,
+			context = origSelector ? this : jQuery( this.context );
+
+		if ( jQuery.isFunction( data ) ) {
+			fn = data;
+			data = undefined;
+		}
+
+		types = (types || "").split(" ");
+
+		while ( (type = types[ i++ ]) != null ) {
+			match = rnamespaces.exec( type );
+			namespaces = "";
+
+			if ( match )  {
+				namespaces = match[0];
+				type = type.replace( rnamespaces, "" );
+			}
+
+			if ( type === "hover" ) {
+				types.push( "mouseenter" + namespaces, "mouseleave" + namespaces );
+				continue;
+			}
+
+			preType = type;
+
+			if ( type === "focus" || type === "blur" ) {
+				types.push( liveMap[ type ] + namespaces );
+				type = type + namespaces;
+
+			} else {
+				type = (liveMap[ type ] || type) + namespaces;
+			}
+
+			if ( name === "live" ) {
+				// bind live handler
+				context.each(function(){
+					jQuery.event.add( this, liveConvert( type, selector ),
+						{ data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
+				});
+
+			} else {
+				// unbind live handler
+				context.unbind( liveConvert( type, selector ), fn );
+			}
+		}
+		
+		return this;
+	}
+});
+
+function liveHandler( event ) {
+	var stop, elems = [], selectors = [], args = arguments,
+		related, match, handleObj, elem, j, i, l, data,
+		events = jQuery.data( this, "events" );
+
+	// Make sure we avoid non-left-click bubbling in Firefox (#3861)
+	if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) {
+		return;
+	}
+
+	event.liveFired = this;
+
+	var live = events.live.slice(0);
+
+	for ( j = 0; j < live.length; j++ ) {
+		handleObj = live[j];
+
+		if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) {
+			selectors.push( handleObj.selector );
+
+		} else {
+			live.splice( j--, 1 );
+		}
+	}
+
+	match = jQuery( event.target ).closest( selectors, event.currentTarget );
+
+	for ( i = 0, l = match.length; i < l; i++ ) {
+		for ( j = 0; j < live.length; j++ ) {
+			handleObj = live[j];
+
+			if ( match[i].selector === handleObj.selector ) {
+				elem = match[i].elem;
+				related = null;
+
+				// Those two events require additional checking
+				if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) {
+					related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
+				}
+
+				if ( !related || related !== elem ) {
+					elems.push({ elem: elem, handleObj: handleObj });
+				}
+			}
+		}
+	}
+
+	for ( i = 0, l = elems.length; i < l; i++ ) {
+		match = elems[i];
+		event.currentTarget = match.elem;
+		event.data = match.handleObj.data;
+		event.handleObj = match.handleObj;
+
+		if ( match.handleObj.origHandler.apply( match.elem, args ) === false ) {
+			stop = false;
+			break;
+		}
+	}
+
+	return stop;
+}
+
+function liveConvert( type, selector ) {
+	return "live." + (type && type !== "*" ? type + "." : "") + selector.replace(/\./g, "`").replace(/ /g, "&");
+}
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup error").split(" "), function( i, name ) {
+
+	// Handle event binding
+	jQuery.fn[ name ] = function( fn ) {
+		return fn ? this.bind( name, fn ) : this.trigger( name );
+	};
+
+	if ( jQuery.attrFn ) {
+		jQuery.attrFn[ name ] = true;
+	}
+});
+
+// Prevent memory leaks in IE
+// Window isn't included so as not to unbind existing unload events
+// More info:
+//  - http://isaacschlueter.com/2006/10/msie-memory-leaks/
+if ( window.attachEvent && !window.addEventListener ) {
+	window.attachEvent("onunload", function() {
+		for ( var id in jQuery.cache ) {
+			if ( jQuery.cache[ id ].handle ) {
+				// Try/Catch is to handle iframes being unloaded, see #4280
+				try {
+					jQuery.event.remove( jQuery.cache[ id ].handle.elem );
+				} catch(e) {}
+			}
+		}
+	});
+}
+/*!
+ * Sizzle CSS Selector Engine - v1.0
+ *  Copyright 2009, The Dojo Foundation
+ *  Released under the MIT, BSD, and GPL Licenses.
+ *  More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+	done = 0,
+	toString = Object.prototype.toString,
+	hasDuplicate = false,
+	baseHasDuplicate = true;
+
+// Here we check if the JavaScript engine is using some sort of
+// optimization where it does not always call our comparision
+// function. If that is the case, discard the hasDuplicate value.
+//   Thus far that includes Google Chrome.
+[0, 0].sort(function(){
+	baseHasDuplicate = false;
+	return 0;
+});
+
+var Sizzle = function(selector, context, results, seed) {
+	results = results || [];
+	var origContext = context = context || document;
+
+	if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
+		return [];
+	}
+	
+	if ( !selector || typeof selector !== "string" ) {
+		return results;
+	}
+
+	var parts = [], m, set, checkSet, extra, prune = true, contextXML = isXML(context),
+		soFar = selector;
+	
+	// Reset the position of the chunker regexp (start from head)
+	while ( (chunker.exec(""), m = chunker.exec(soFar)) !== null ) {
+		soFar = m[3];
+		
+		parts.push( m[1] );
+		
+		if ( m[2] ) {
+			extra = m[3];
+			break;
+		}
+	}
+
+	if ( parts.length > 1 && origPOS.exec( selector ) ) {
+		if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+			set = posProcess( parts[0] + parts[1], context );
+		} else {
+			set = Expr.relative[ parts[0] ] ?
+				[ context ] :
+				Sizzle( parts.shift(), context );
+
+			while ( parts.length ) {
+				selector = parts.shift();
+
+				if ( Expr.relative[ selector ] ) {
+					selector += parts.shift();
+				}
+				
+				set = posProcess( selector, set );
+			}
+		}
+	} else {
+		// Take a shortcut and set the context if the root selector is an ID
+		// (but not if it'll be faster if the inner selector is an ID)
+		if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
+				Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+			var ret = Sizzle.find( parts.shift(), context, contextXML );
+			context = ret.expr ? Sizzle.filter( ret.expr, ret.set )[0] : ret.set[0];
+		}
+
+		if ( context ) {
+			var ret = seed ?
+				{ expr: parts.pop(), set: makeArray(seed) } :
+				Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+			set = ret.expr ? Sizzle.filter( ret.expr, ret.set ) : ret.set;
+
+			if ( parts.length > 0 ) {
+				checkSet = makeArray(set);
+			} else {
+				prune = false;
+			}
+
+			while ( parts.length ) {
+				var cur = parts.pop(), pop = cur;
+
+				if ( !Expr.relative[ cur ] ) {
+					cur = "";
+				} else {
+					pop = parts.pop();
+				}
+
+				if ( pop == null ) {
+					pop = context;
+				}
+
+				Expr.relative[ cur ]( checkSet, pop, contextXML );
+			}
+		} else {
+			checkSet = parts = [];
+		}
+	}
+
+	if ( !checkSet ) {
+		checkSet = set;
+	}
+
+	if ( !checkSet ) {
+		Sizzle.error( cur || selector );
+	}
+
+	if ( toString.call(checkSet) === "[object Array]" ) {
+		if ( !prune ) {
+			results.push.apply( results, checkSet );
+		} else if ( context && context.nodeType === 1 ) {
+			for ( var i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+					results.push( set[i] );
+				}
+			}
+		} else {
+			for ( var i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+					results.push( set[i] );
+				}
+			}
+		}
+	} else {
+		makeArray( checkSet, results );
+	}
+
+	if ( extra ) {
+		Sizzle( extra, origContext, results, seed );
+		Sizzle.uniqueSort( results );
+	}
+
+	return results;
+};
+
+Sizzle.uniqueSort = function(results){
+	if ( sortOrder ) {
+		hasDuplicate = baseHasDuplicate;
+		results.sort(sortOrder);
+
+		if ( hasDuplicate ) {
+			for ( var i = 1; i < results.length; i++ ) {
+				if ( results[i] === results[i-1] ) {
+					results.splice(i--, 1);
+				}
+			}
+		}
+	}
+
+	return results;
+};
+
+Sizzle.matches = function(expr, set){
+	return Sizzle(expr, null, null, set);
+};
+
+Sizzle.find = function(expr, context, isXML){
+	var set, match;
+
+	if ( !expr ) {
+		return [];
+	}
+
+	for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
+		var type = Expr.order[i], match;
+		
+		if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
+			var left = match[1];
+			match.splice(1,1);
+
+			if ( left.substr( left.length - 1 ) !== "\\" ) {
+				match[1] = (match[1] || "").replace(/\\/g, "");
+				set = Expr.find[ type ]( match, context, isXML );
+				if ( set != null ) {
+					expr = expr.replace( Expr.match[ type ], "" );
+					break;
+				}
+			}
+		}
+	}
+
+	if ( !set ) {
+		set = context.getElementsByTagName("*");
+	}
+
+	return {set: set, expr: expr};
+};
+
+Sizzle.filter = function(expr, set, inplace, not){
+	var old = expr, result = [], curLoop = set, match, anyFound,
+		isXMLFilter = set && set[0] && isXML(set[0]);
+
+	while ( expr && set.length ) {
+		for ( var type in Expr.filter ) {
+			if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
+				var filter = Expr.filter[ type ], found, item, left = match[1];
+				anyFound = false;
+
+				match.splice(1,1);
+
+				if ( left.substr( left.length - 1 ) === "\\" ) {
+					continue;
+				}
+
+				if ( curLoop === result ) {
+					result = [];
+				}
+
+				if ( Expr.preFilter[ type ] ) {
+					match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+
+					if ( !match ) {
+						anyFound = found = true;
+					} else if ( match === true ) {
+						continue;
+					}
+				}
+
+				if ( match ) {
+					for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
+						if ( item ) {
+							found = filter( item, match, i, curLoop );
+							var pass = not ^ !!found;
+
+							if ( inplace && found != null ) {
+								if ( pass ) {
+									anyFound = true;
+								} else {
+									curLoop[i] = false;
+								}
+							} else if ( pass ) {
+								result.push( item );
+								anyFound = true;
+							}
+						}
+					}
+				}
+
+				if ( found !== undefined ) {
+					if ( !inplace ) {
+						curLoop = result;
+					}
+
+					expr = expr.replace( Expr.match[ type ], "" );
+
+					if ( !anyFound ) {
+						return [];
+					}
+
+					break;
+				}
+			}
+		}
+
+		// Improper expression
+		if ( expr === old ) {
+			if ( anyFound == null ) {
+				Sizzle.error( expr );
+			} else {
+				break;
+			}
+		}
+
+		old = expr;
+	}
+
+	return curLoop;
+};
+
+Sizzle.error = function( msg ) {
+	throw "Syntax error, unrecognized expression: " + msg;
+};
+
+var Expr = Sizzle.selectors = {
+	order: [ "ID", "NAME", "TAG" ],
+	match: {
+		ID: /#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+		CLASS: /\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+		NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,
+		ATTR: /\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
+		TAG: /^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,
+		CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,
+		POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,
+		PSEUDO: /:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
+	},
+	leftMatch: {},
+	attrMap: {
+		"class": "className",
+		"for": "htmlFor"
+	},
+	attrHandle: {
+		href: function(elem){
+			return elem.getAttribute("href");
+		}
+	},
+	relative: {
+		"+": function(checkSet, part){
+			var isPartStr = typeof part === "string",
+				isTag = isPartStr && !/\W/.test(part),
+				isPartStrNotTag = isPartStr && !isTag;
+
+			if ( isTag ) {
+				part = part.toLowerCase();
+			}
+
+			for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
+				if ( (elem = checkSet[i]) ) {
+					while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+
+					checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
+						elem || false :
+						elem === part;
+				}
+			}
+
+			if ( isPartStrNotTag ) {
+				Sizzle.filter( part, checkSet, true );
+			}
+		},
+		">": function(checkSet, part){
+			var isPartStr = typeof part === "string";
+
+			if ( isPartStr && !/\W/.test(part) ) {
+				part = part.toLowerCase();
+
+				for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+					var elem = checkSet[i];
+					if ( elem ) {
+						var parent = elem.parentNode;
+						checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
+					}
+				}
+			} else {
+				for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+					var elem = checkSet[i];
+					if ( elem ) {
+						checkSet[i] = isPartStr ?
+							elem.parentNode :
+							elem.parentNode === part;
+					}
+				}
+
+				if ( isPartStr ) {
+					Sizzle.filter( part, checkSet, true );
+				}
+			}
+		},
+		"": function(checkSet, part, isXML){
+			var doneName = done++, checkFn = dirCheck;
+
+			if ( typeof part === "string" && !/\W/.test(part) ) {
+				var nodeCheck = part = part.toLowerCase();
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML);
+		},
+		"~": function(checkSet, part, isXML){
+			var doneName = done++, checkFn = dirCheck;
+
+			if ( typeof part === "string" && !/\W/.test(part) ) {
+				var nodeCheck = part = part.toLowerCase();
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML);
+		}
+	},
+	find: {
+		ID: function(match, context, isXML){
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+				return m ? [m] : [];
+			}
+		},
+		NAME: function(match, context){
+			if ( typeof context.getElementsByName !== "undefined" ) {
+				var ret = [], results = context.getElementsByName(match[1]);
+
+				for ( var i = 0, l = results.length; i < l; i++ ) {
+					if ( results[i].getAttribute("name") === match[1] ) {
+						ret.push( results[i] );
+					}
+				}
+
+				return ret.length === 0 ? null : ret;
+			}
+		},
+		TAG: function(match, context){
+			return context.getElementsByTagName(match[1]);
+		}
+	},
+	preFilter: {
+		CLASS: function(match, curLoop, inplace, result, not, isXML){
+			match = " " + match[1].replace(/\\/g, "") + " ";
+
+			if ( isXML ) {
+				return match;
+			}
+
+			for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
+				if ( elem ) {
+					if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) {
+						if ( !inplace ) {
+							result.push( elem );
+						}
+					} else if ( inplace ) {
+						curLoop[i] = false;
+					}
+				}
+			}
+
+			return false;
+		},
+		ID: function(match){
+			return match[1].replace(/\\/g, "");
+		},
+		TAG: function(match, curLoop){
+			return match[1].toLowerCase();
+		},
+		CHILD: function(match){
+			if ( match[1] === "nth" ) {
+				// parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+				var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
+					match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
+					!/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+				// calculate the numbers (first)n+(last) including if they are negative
+				match[2] = (test[1] + (test[2] || 1)) - 0;
+				match[3] = test[3] - 0;
+			}
+
+			// TODO: Move to normal caching system
+			match[0] = done++;
+
+			return match;
+		},
+		ATTR: function(match, curLoop, inplace, result, not, isXML){
+			var name = match[1].replace(/\\/g, "");
+			
+			if ( !isXML && Expr.attrMap[name] ) {
+				match[1] = Expr.attrMap[name];
+			}
+
+			if ( match[2] === "~=" ) {
+				match[4] = " " + match[4] + " ";
+			}
+
+			return match;
+		},
+		PSEUDO: function(match, curLoop, inplace, result, not){
+			if ( match[1] === "not" ) {
+				// If we're dealing with a complex expression, or a simple one
+				if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
+					match[3] = Sizzle(match[3], null, null, curLoop);
+				} else {
+					var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+					if ( !inplace ) {
+						result.push.apply( result, ret );
+					}
+					return false;
+				}
+			} else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
+				return true;
+			}
+			
+			return match;
+		},
+		POS: function(match){
+			match.unshift( true );
+			return match;
+		}
+	},
+	filters: {
+		enabled: function(elem){
+			return elem.disabled === false && elem.type !== "hidden";
+		},
+		disabled: function(elem){
+			return elem.disabled === true;
+		},
+		checked: function(elem){
+			return elem.checked === true;
+		},
+		selected: function(elem){
+			// Accessing this property makes selected-by-default
+			// options in Safari work properly
+			elem.parentNode.selectedIndex;
+			return elem.selected === true;
+		},
+		parent: function(elem){
+			return !!elem.firstChild;
+		},
+		empty: function(elem){
+			return !elem.firstChild;
+		},
+		has: function(elem, i, match){
+			return !!Sizzle( match[3], elem ).length;
+		},
+		header: function(elem){
+			return /h\d/i.test( elem.nodeName );
+		},
+		text: function(elem){
+			return "text" === elem.type;
+		},
+		radio: function(elem){
+			return "radio" === elem.type;
+		},
+		checkbox: function(elem){
+			return "checkbox" === elem.type;
+		},
+		file: function(elem){
+			return "file" === elem.type;
+		},
+		password: function(elem){
+			return "password" === elem.type;
+		},
+		submit: function(elem){
+			return "submit" === elem.type;
+		},
+		image: function(elem){
+			return "image" === elem.type;
+		},
+		reset: function(elem){
+			return "reset" === elem.type;
+		},
+		button: function(elem){
+			return "button" === elem.type || elem.nodeName.toLowerCase() === "button";
+		},
+		input: function(elem){
+			return /input|select|textarea|button/i.test(elem.nodeName);
+		}
+	},
+	setFilters: {
+		first: function(elem, i){
+			return i === 0;
+		},
+		last: function(elem, i, match, array){
+			return i === array.length - 1;
+		},
+		even: function(elem, i){
+			return i % 2 === 0;
+		},
+		odd: function(elem, i){
+			return i % 2 === 1;
+		},
+		lt: function(elem, i, match){
+			return i < match[3] - 0;
+		},
+		gt: function(elem, i, match){
+			return i > match[3] - 0;
+		},
+		nth: function(elem, i, match){
+			return match[3] - 0 === i;
+		},
+		eq: function(elem, i, match){
+			return match[3] - 0 === i;
+		}
+	},
+	filter: {
+		PSEUDO: function(elem, match, i, array){
+			var name = match[1], filter = Expr.filters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+			} else if ( name === "contains" ) {
+				return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0;
+			} else if ( name === "not" ) {
+				var not = match[3];
+
+				for ( var i = 0, l = not.length; i < l; i++ ) {
+					if ( not[i] === elem ) {
+						return false;
+					}
+				}
+
+				return true;
+			} else {
+				Sizzle.error( "Syntax error, unrecognized expression: " + name );
+			}
+		},
+		CHILD: function(elem, match){
+			var type = match[1], node = elem;
+			switch (type) {
+				case 'only':
+				case 'first':
+					while ( (node = node.previousSibling) )	 {
+						if ( node.nodeType === 1 ) { 
+							return false; 
+						}
+					}
+					if ( type === "first" ) { 
+						return true; 
+					}
+					node = elem;
+				case 'last':
+					while ( (node = node.nextSibling) )	 {
+						if ( node.nodeType === 1 ) { 
+							return false; 
+						}
+					}
+					return true;
+				case 'nth':
+					var first = match[2], last = match[3];
+
+					if ( first === 1 && last === 0 ) {
+						return true;
+					}
+					
+					var doneName = match[0],
+						parent = elem.parentNode;
+	
+					if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
+						var count = 0;
+						for ( node = parent.firstChild; node; node = node.nextSibling ) {
+							if ( node.nodeType === 1 ) {
+								node.nodeIndex = ++count;
+							}
+						} 
+						parent.sizcache = doneName;
+					}
+					
+					var diff = elem.nodeIndex - last;
+					if ( first === 0 ) {
+						return diff === 0;
+					} else {
+						return ( diff % first === 0 && diff / first >= 0 );
+					}
+			}
+		},
+		ID: function(elem, match){
+			return elem.nodeType === 1 && elem.getAttribute("id") === match;
+		},
+		TAG: function(elem, match){
+			return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match;
+		},
+		CLASS: function(elem, match){
+			return (" " + (elem.className || elem.getAttribute("class")) + " ")
+				.indexOf( match ) > -1;
+		},
+		ATTR: function(elem, match){
+			var name = match[1],
+				result = Expr.attrHandle[ name ] ?
+					Expr.attrHandle[ name ]( elem ) :
+					elem[ name ] != null ?
+						elem[ name ] :
+						elem.getAttribute( name ),
+				value = result + "",
+				type = match[2],
+				check = match[4];
+
+			return result == null ?
+				type === "!=" :
+				type === "=" ?
+				value === check :
+				type === "*=" ?
+				value.indexOf(check) >= 0 :
+				type === "~=" ?
+				(" " + value + " ").indexOf(check) >= 0 :
+				!check ?
+				value && result !== false :
+				type === "!=" ?
+				value !== check :
+				type === "^=" ?
+				value.indexOf(check) === 0 :
+				type === "$=" ?
+				value.substr(value.length - check.length) === check :
+				type === "|=" ?
+				value === check || value.substr(0, check.length + 1) === check + "-" :
+				false;
+		},
+		POS: function(elem, match, i, array){
+			var name = match[2], filter = Expr.setFilters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+			}
+		}
+	}
+};
+
+var origPOS = Expr.match.POS;
+
+for ( var type in Expr.match ) {
+	Expr.match[ type ] = new RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
+	Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, function(all, num){
+		return "\\" + (num - 0 + 1);
+	}));
+}
+
+var makeArray = function(array, results) {
+	array = Array.prototype.slice.call( array, 0 );
+
+	if ( results ) {
+		results.push.apply( results, array );
+		return results;
+	}
+	
+	return array;
+};
+
+// Perform a simple check to determine if the browser is capable of
+// converting a NodeList to an array using builtin methods.
+// Also verifies that the returned array holds DOM nodes
+// (which is not the case in the Blackberry browser)
+try {
+	Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
+
+// Provide a fallback method if it does not work
+} catch(e){
+	makeArray = function(array, results) {
+		var ret = results || [];
+
+		if ( toString.call(array) === "[object Array]" ) {
+			Array.prototype.push.apply( ret, array );
+		} else {
+			if ( typeof array.length === "number" ) {
+				for ( var i = 0, l = array.length; i < l; i++ ) {
+					ret.push( array[i] );
+				}
+			} else {
+				for ( var i = 0; array[i]; i++ ) {
+					ret.push( array[i] );
+				}
+			}
+		}
+
+		return ret;
+	};
+}
+
+var sortOrder;
+
+if ( document.documentElement.compareDocumentPosition ) {
+	sortOrder = function( a, b ) {
+		if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return a.compareDocumentPosition ? -1 : 1;
+		}
+
+		var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1;
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+} else if ( "sourceIndex" in document.documentElement ) {
+	sortOrder = function( a, b ) {
+		if ( !a.sourceIndex || !b.sourceIndex ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return a.sourceIndex ? -1 : 1;
+		}
+
+		var ret = a.sourceIndex - b.sourceIndex;
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+} else if ( document.createRange ) {
+	sortOrder = function( a, b ) {
+		if ( !a.ownerDocument || !b.ownerDocument ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return a.ownerDocument ? -1 : 1;
+		}
+
+		var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange();
+		aRange.setStart(a, 0);
+		aRange.setEnd(a, 0);
+		bRange.setStart(b, 0);
+		bRange.setEnd(b, 0);
+		var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange);
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+}
+
+// Utility function for retreiving the text value of an array of DOM nodes
+function getText( elems ) {
+	var ret = "", elem;
+
+	for ( var i = 0; elems[i]; i++ ) {
+		elem = elems[i];
+
+		// Get the text from text nodes and CDATA nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 4 ) {
+			ret += elem.nodeValue;
+
+		// Traverse everything else, except comment nodes
+		} else if ( elem.nodeType !== 8 ) {
+			ret += getText( elem.childNodes );
+		}
+	}
+
+	return ret;
+}
+
+// Check to see if the browser returns elements by name when
+// querying by getElementById (and provide a workaround)
+(function(){
+	// We're going to inject a fake input element with a specified name
+	var form = document.createElement("div"),
+		id = "script" + (new Date).getTime();
+	form.innerHTML = "<a name='" + id + "'/>";
+
+	// Inject it into the root element, check its status, and remove it quickly
+	var root = document.documentElement;
+	root.insertBefore( form, root.firstChild );
+
+	// The workaround has to do additional checks after a getElementById
+	// Which slows things down for other browsers (hence the branching)
+	if ( document.getElementById( id ) ) {
+		Expr.find.ID = function(match, context, isXML){
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+				return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : [];
+			}
+		};
+
+		Expr.filter.ID = function(elem, match){
+			var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+			return elem.nodeType === 1 && node && node.nodeValue === match;
+		};
+	}
+
+	root.removeChild( form );
+	root = form = null; // release memory in IE
+})();
+
+(function(){
+	// Check to see if the browser returns only elements
+	// when doing getElementsByTagName("*")
+
+	// Create a fake element
+	var div = document.createElement("div");
+	div.appendChild( document.createComment("") );
+
+	// Make sure no comments are found
+	if ( div.getElementsByTagName("*").length > 0 ) {
+		Expr.find.TAG = function(match, context){
+			var results = context.getElementsByTagName(match[1]);
+
+			// Filter out possible comments
+			if ( match[1] === "*" ) {
+				var tmp = [];
+
+				for ( var i = 0; results[i]; i++ ) {
+					if ( results[i].nodeType === 1 ) {
+						tmp.push( results[i] );
+					}
+				}
+
+				results = tmp;
+			}
+
+			return results;
+		};
+	}
+
+	// Check to see if an attribute returns normalized href attributes
+	div.innerHTML = "<a href='#'></a>";
+	if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
+			div.firstChild.getAttribute("href") !== "#" ) {
+		Expr.attrHandle.href = function(elem){
+			return elem.getAttribute("href", 2);
+		};
+	}
+
+	div = null; // release memory in IE
+})();
+
+if ( document.querySelectorAll ) {
+	(function(){
+		var oldSizzle = Sizzle, div = document.createElement("div");
+		div.innerHTML = "<p class='TEST'></p>";
+
+		// Safari can't handle uppercase or unicode characters when
+		// in quirks mode.
+		if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+			return;
+		}
+	
+		Sizzle = function(query, context, extra, seed){
+			context = context || document;
+
+			// Only use querySelectorAll on non-XML documents
+			// (ID selectors don't work in non-HTML documents)
+			if ( !seed && context.nodeType === 9 && !isXML(context) ) {
+				try {
+					return makeArray( context.querySelectorAll(query), extra );
+				} catch(e){}
+			}
+		
+			return oldSizzle(query, context, extra, seed);
+		};
+
+		for ( var prop in oldSizzle ) {
+			Sizzle[ prop ] = oldSizzle[ prop ];
+		}
+
+		div = null; // release memory in IE
+	})();
+}
+
+(function(){
+	var div = document.createElement("div");
+
+	div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+
+	// Opera can't find a second classname (in 9.6)
+	// Also, make sure that getElementsByClassName actually exists
+	if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
+		return;
+	}
+
+	// Safari caches class attributes, doesn't catch changes (in 3.2)
+	div.lastChild.className = "e";
+
+	if ( div.getElementsByClassName("e").length === 1 ) {
+		return;
+	}
+	
+	Expr.order.splice(1, 0, "CLASS");
+	Expr.find.CLASS = function(match, context, isXML) {
+		if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
+			return context.getElementsByClassName(match[1]);
+		}
+	};
+
+	div = null; // release memory in IE
+})();
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+		if ( elem ) {
+			elem = elem[dir];
+			var match = false;
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 && !isXML ){
+					elem.sizcache = doneName;
+					elem.sizset = i;
+				}
+
+				if ( elem.nodeName.toLowerCase() === cur ) {
+					match = elem;
+					break;
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+		if ( elem ) {
+			elem = elem[dir];
+			var match = false;
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 ) {
+					if ( !isXML ) {
+						elem.sizcache = doneName;
+						elem.sizset = i;
+					}
+					if ( typeof cur !== "string" ) {
+						if ( elem === cur ) {
+							match = true;
+							break;
+						}
+
+					} else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+						match = elem;
+						break;
+					}
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+var contains = document.compareDocumentPosition ? function(a, b){
+	return !!(a.compareDocumentPosition(b) & 16);
+} : function(a, b){
+	return a !== b && (a.contains ? a.contains(b) : true);
+};
+
+var isXML = function(elem){
+	// documentElement is verified for cases where it doesn't yet exist
+	// (such as loading iframes in IE - #4833) 
+	var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+	return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+var posProcess = function(selector, context){
+	var tmpSet = [], later = "", match,
+		root = context.nodeType ? [context] : context;
+
+	// Position selectors must be done after the filter
+	// And so must :not(positional) so we move all PSEUDOs to the end
+	while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+		later += match[0];
+		selector = selector.replace( Expr.match.PSEUDO, "" );
+	}
+
+	selector = Expr.relative[selector] ? selector + "*" : selector;
+
+	for ( var i = 0, l = root.length; i < l; i++ ) {
+		Sizzle( selector, root[i], tmpSet );
+	}
+
+	return Sizzle.filter( later, tmpSet );
+};
+
+// EXPOSE
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.filters;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = getText;
+jQuery.isXMLDoc = isXML;
+jQuery.contains = contains;
+
+return;
+
+window.Sizzle = Sizzle;
+
+})();
+var runtil = /Until$/,
+	rparentsprev = /^(?:parents|prevUntil|prevAll)/,
+	// Note: This RegExp should be improved, or likely pulled from Sizzle
+	rmultiselector = /,/,
+	slice = Array.prototype.slice;
+
+// Implement the identical functionality for filter and not
+var winnow = function( elements, qualifier, keep ) {
+	if ( jQuery.isFunction( qualifier ) ) {
+		return jQuery.grep(elements, function( elem, i ) {
+			return !!qualifier.call( elem, i, elem ) === keep;
+		});
+
+	} else if ( qualifier.nodeType ) {
+		return jQuery.grep(elements, function( elem, i ) {
+			return (elem === qualifier) === keep;
+		});
+
+	} else if ( typeof qualifier === "string" ) {
+		var filtered = jQuery.grep(elements, function( elem ) {
+			return elem.nodeType === 1;
+		});
+
+		if ( isSimple.test( qualifier ) ) {
+			return jQuery.filter(qualifier, filtered, !keep);
+		} else {
+			qualifier = jQuery.filter( qualifier, filtered );
+		}
+	}
+
+	return jQuery.grep(elements, function( elem, i ) {
+		return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
+	});
+};
+
+jQuery.fn.extend({
+	find: function( selector ) {
+		var ret = this.pushStack( "", "find", selector ), length = 0;
+
+		for ( var i = 0, l = this.length; i < l; i++ ) {
+			length = ret.length;
+			jQuery.find( selector, this[i], ret );
+
+			if ( i > 0 ) {
+				// Make sure that the results are unique
+				for ( var n = length; n < ret.length; n++ ) {
+					for ( var r = 0; r < length; r++ ) {
+						if ( ret[r] === ret[n] ) {
+							ret.splice(n--, 1);
+							break;
+						}
+					}
+				}
+			}
+		}
+
+		return ret;
+	},
+
+	has: function( target ) {
+		var targets = jQuery( target );
+		return this.filter(function() {
+			for ( var i = 0, l = targets.length; i < l; i++ ) {
+				if ( jQuery.contains( this, targets[i] ) ) {
+					return true;
+				}
+			}
+		});
+	},
+
+	not: function( selector ) {
+		return this.pushStack( winnow(this, selector, false), "not", selector);
+	},
+
+	filter: function( selector ) {
+		return this.pushStack( winnow(this, selector, true), "filter", selector );
+	},
+	
+	is: function( selector ) {
+		return !!selector && jQuery.filter( selector, this ).length > 0;
+	},
+
+	closest: function( selectors, context ) {
+		if ( jQuery.isArray( selectors ) ) {
+			var ret = [], cur = this[0], match, matches = {}, selector;
+
+			if ( cur && selectors.length ) {
+				for ( var i = 0, l = selectors.length; i < l; i++ ) {
+					selector = selectors[i];
+
+					if ( !matches[selector] ) {
+						matches[selector] = jQuery.expr.match.POS.test( selector ) ? 
+							jQuery( selector, context || this.context ) :
+							selector;
+					}
+				}
+
+				while ( cur && cur.ownerDocument && cur !== context ) {
+					for ( selector in matches ) {
+						match = matches[selector];
+
+						if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) {
+							ret.push({ selector: selector, elem: cur });
+							delete matches[selector];
+						}
+					}
+					cur = cur.parentNode;
+				}
+			}
+
+			return ret;
+		}
+
+		var pos = jQuery.expr.match.POS.test( selectors ) ? 
+			jQuery( selectors, context || this.context ) : null;
+
+		return this.map(function( i, cur ) {
+			while ( cur && cur.ownerDocument && cur !== context ) {
+				if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selectors) ) {
+					return cur;
+				}
+				cur = cur.parentNode;
+			}
+			return null;
+		});
+	},
+	
+	// Determine the position of an element within
+	// the matched set of elements
+	index: function( elem ) {
+		if ( !elem || typeof elem === "string" ) {
+			return jQuery.inArray( this[0],
+				// If it receives a string, the selector is used
+				// If it receives nothing, the siblings are used
+				elem ? jQuery( elem ) : this.parent().children() );
+		}
+		// Locate the position of the desired element
+		return jQuery.inArray(
+			// If it receives a jQuery object, the first element is used
+			elem.jquery ? elem[0] : elem, this );
+	},
+
+	add: function( selector, context ) {
+		var set = typeof selector === "string" ?
+				jQuery( selector, context || this.context ) :
+				jQuery.makeArray( selector ),
+			all = jQuery.merge( this.get(), set );
+
+		return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
+			all :
+			jQuery.unique( all ) );
+	},
+
+	andSelf: function() {
+		return this.add( this.prevObject );
+	}
+});
+
+// A painfully simple check to see if an element is disconnected
+// from a document (should be improved, where feasible).
+function isDisconnected( node ) {
+	return !node || !node.parentNode || node.parentNode.nodeType === 11;
+}
+
+jQuery.each({
+	parent: function( elem ) {
+		var parent = elem.parentNode;
+		return parent && parent.nodeType !== 11 ? parent : null;
+	},
+	parents: function( elem ) {
+		return jQuery.dir( elem, "parentNode" );
+	},
+	parentsUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "parentNode", until );
+	},
+	next: function( elem ) {
+		return jQuery.nth( elem, 2, "nextSibling" );
+	},
+	prev: function( elem ) {
+		return jQuery.nth( elem, 2, "previousSibling" );
+	},
+	nextAll: function( elem ) {
+		return jQuery.dir( elem, "nextSibling" );
+	},
+	prevAll: function( elem ) {
+		return jQuery.dir( elem, "previousSibling" );
+	},
+	nextUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "nextSibling", until );
+	},
+	prevUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "previousSibling", until );
+	},
+	siblings: function( elem ) {
+		return jQuery.sibling( elem.parentNode.firstChild, elem );
+	},
+	children: function( elem ) {
+		return jQuery.sibling( elem.firstChild );
+	},
+	contents: function( elem ) {
+		return jQuery.nodeName( elem, "iframe" ) ?
+			elem.contentDocument || elem.contentWindow.document :
+			jQuery.makeArray( elem.childNodes );
+	}
+}, function( name, fn ) {
+	jQuery.fn[ name ] = function( until, selector ) {
+		var ret = jQuery.map( this, fn, until );
+		
+		if ( !runtil.test( name ) ) {
+			selector = until;
+		}
+
+		if ( selector && typeof selector === "string" ) {
+			ret = jQuery.filter( selector, ret );
+		}
+
+		ret = this.length > 1 ? jQuery.unique( ret ) : ret;
+
+		if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
+			ret = ret.reverse();
+		}
+
+		return this.pushStack( ret, name, slice.call(arguments).join(",") );
+	};
+});
+
+jQuery.extend({
+	filter: function( expr, elems, not ) {
+		if ( not ) {
+			expr = ":not(" + expr + ")";
+		}
+
+		return jQuery.find.matches(expr, elems);
+	},
+	
+	dir: function( elem, dir, until ) {
+		var matched = [], cur = elem[dir];
+		while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+			if ( cur.nodeType === 1 ) {
+				matched.push( cur );
+			}
+			cur = cur[dir];
+		}
+		return matched;
+	},
+
+	nth: function( cur, result, dir, elem ) {
+		result = result || 1;
+		var num = 0;
+
+		for ( ; cur; cur = cur[dir] ) {
+			if ( cur.nodeType === 1 && ++num === result ) {
+				break;
+			}
+		}
+
+		return cur;
+	},
+
+	sibling: function( n, elem ) {
+		var r = [];
+
+		for ( ; n; n = n.nextSibling ) {
+			if ( n.nodeType === 1 && n !== elem ) {
+				r.push( n );
+			}
+		}
+
+		return r;
+	}
+});
+var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
+	rleadingWhitespace = /^\s+/,
+	rxhtmlTag = /(<([\w:]+)[^>]*?)\/>/g,
+	rselfClosing = /^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,
+	rtagName = /<([\w:]+)/,
+	rtbody = /<tbody/i,
+	rhtml = /<|&#?\w+;/,
+	rnocache = /<script|<object|<embed|<option|<style/i,
+	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,  // checked="checked" or checked (html5)
+	fcloseTag = function( all, front, tag ) {
+		return rselfClosing.test( tag ) ?
+			all :
+			front + "></" + tag + ">";
+	},
+	wrapMap = {
+		option: [ 1, "<select multiple='multiple'>", "</select>" ],
+		legend: [ 1, "<fieldset>", "</fieldset>" ],
+		thead: [ 1, "<table>", "</table>" ],
+		tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+		td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+		col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+		area: [ 1, "<map>", "</map>" ],
+		_default: [ 0, "", "" ]
+	};
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// IE can't serialize <link> and <script> tags normally
+if ( !jQuery.support.htmlSerialize ) {
+	wrapMap._default = [ 1, "div<div>", "</div>" ];
+}
+
+jQuery.fn.extend({
+	text: function( text ) {
+		if ( jQuery.isFunction(text) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.text( text.call(this, i, self.text()) );
+			});
+		}
+
+		if ( typeof text !== "object" && text !== undefined ) {
+			return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+		}
+
+		return jQuery.text( this );
+	},
+
+	wrapAll: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each(function(i) {
+				jQuery(this).wrapAll( html.call(this, i) );
+			});
+		}
+
+		if ( this[0] ) {
+			// The elements to wrap the target around
+			var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+			if ( this[0].parentNode ) {
+				wrap.insertBefore( this[0] );
+			}
+
+			wrap.map(function() {
+				var elem = this;
+
+				while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+					elem = elem.firstChild;
+				}
+
+				return elem;
+			}).append(this);
+		}
+
+		return this;
+	},
+
+	wrapInner: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each(function(i) {
+				jQuery(this).wrapInner( html.call(this, i) );
+			});
+		}
+
+		return this.each(function() {
+			var self = jQuery( this ), contents = self.contents();
+
+			if ( contents.length ) {
+				contents.wrapAll( html );
+
+			} else {
+				self.append( html );
+			}
+		});
+	},
+
+	wrap: function( html ) {
+		return this.each(function() {
+			jQuery( this ).wrapAll( html );
+		});
+	},
+
+	unwrap: function() {
+		return this.parent().each(function() {
+			if ( !jQuery.nodeName( this, "body" ) ) {
+				jQuery( this ).replaceWith( this.childNodes );
+			}
+		}).end();
+	},
+
+	append: function() {
+		return this.domManip(arguments, true, function( elem ) {
+			if ( this.nodeType === 1 ) {
+				this.appendChild( elem );
+			}
+		});
+	},
+
+	prepend: function() {
+		return this.domManip(arguments, true, function( elem ) {
+			if ( this.nodeType === 1 ) {
+				this.insertBefore( elem, this.firstChild );
+			}
+		});
+	},
+
+	before: function() {
+		if ( this[0] && this[0].parentNode ) {
+			return this.domManip(arguments, false, function( elem ) {
+				this.parentNode.insertBefore( elem, this );
+			});
+		} else if ( arguments.length ) {
+			var set = jQuery(arguments[0]);
+			set.push.apply( set, this.toArray() );
+			return this.pushStack( set, "before", arguments );
+		}
+	},
+
+	after: function() {
+		if ( this[0] && this[0].parentNode ) {
+			return this.domManip(arguments, false, function( elem ) {
+				this.parentNode.insertBefore( elem, this.nextSibling );
+			});
+		} else if ( arguments.length ) {
+			var set = this.pushStack( this, "after", arguments );
+			set.push.apply( set, jQuery(arguments[0]).toArray() );
+			return set;
+		}
+	},
+	
+	// keepData is for internal use only--do not document
+	remove: function( selector, keepData ) {
+		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+			if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
+				if ( !keepData && elem.nodeType === 1 ) {
+					jQuery.cleanData( elem.getElementsByTagName("*") );
+					jQuery.cleanData( [ elem ] );
+				}
+
+				if ( elem.parentNode ) {
+					 elem.parentNode.removeChild( elem );
+				}
+			}
+		}
+		
+		return this;
+	},
+
+	empty: function() {
+		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+			// Remove element nodes and prevent memory leaks
+			if ( elem.nodeType === 1 ) {
+				jQuery.cleanData( elem.getElementsByTagName("*") );
+			}
+
+			// Remove any remaining nodes
+			while ( elem.firstChild ) {
+				elem.removeChild( elem.firstChild );
+			}
+		}
+		
+		return this;
+	},
+
+	clone: function( events ) {
+		// Do the clone
+		var ret = this.map(function() {
+			if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
+				// IE copies events bound via attachEvent when
+				// using cloneNode. Calling detachEvent on the
+				// clone will also remove the events from the orignal
+				// In order to get around this, we use innerHTML.
+				// Unfortunately, this means some modifications to
+				// attributes in IE that are actually only stored
+				// as properties will not be copied (such as the
+				// the name attribute on an input).
+				var html = this.outerHTML, ownerDocument = this.ownerDocument;
+				if ( !html ) {
+					var div = ownerDocument.createElement("div");
+					div.appendChild( this.cloneNode(true) );
+					html = div.innerHTML;
+				}
+
+				return jQuery.clean([html.replace(rinlinejQuery, "")
+					// Handle the case in IE 8 where action=/test/> self-closes a tag
+					.replace(/=([^="'>\s]+\/)>/g, '="$1">')
+					.replace(rleadingWhitespace, "")], ownerDocument)[0];
+			} else {
+				return this.cloneNode(true);
+			}
+		});
+
+		// Copy the events from the original to the clone
+		if ( events === true ) {
+			cloneCopyEvent( this, ret );
+			cloneCopyEvent( this.find("*"), ret.find("*") );
+		}
+
+		// Return the cloned set
+		return ret;
+	},
+
+	html: function( value ) {
+		if ( value === undefined ) {
+			return this[0] && this[0].nodeType === 1 ?
+				this[0].innerHTML.replace(rinlinejQuery, "") :
+				null;
+
+		// See if we can take a shortcut and just use innerHTML
+		} else if ( typeof value === "string" && !rnocache.test( value ) &&
+			(jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
+			!wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
+
+			value = value.replace(rxhtmlTag, fcloseTag);
+
+			try {
+				for ( var i = 0, l = this.length; i < l; i++ ) {
+					// Remove element nodes and prevent memory leaks
+					if ( this[i].nodeType === 1 ) {
+						jQuery.cleanData( this[i].getElementsByTagName("*") );
+						this[i].innerHTML = value;
+					}
+				}
+
+			// If using innerHTML throws an exception, use the fallback method
+			} catch(e) {
+				this.empty().append( value );
+			}
+
+		} else if ( jQuery.isFunction( value ) ) {
+			this.each(function(i){
+				var self = jQuery(this), old = self.html();
+				self.empty().append(function(){
+					return value.call( this, i, old );
+				});
+			});
+
+		} else {
+			this.empty().append( value );
+		}
+
+		return this;
+	},
+
+	replaceWith: function( value ) {
+		if ( this[0] && this[0].parentNode ) {
+			// Make sure that the elements are removed from the DOM before they are inserted
+			// this can help fix replacing a parent with child elements
+			if ( jQuery.isFunction( value ) ) {
+				return this.each(function(i) {
+					var self = jQuery(this), old = self.html();
+					self.replaceWith( value.call( this, i, old ) );
+				});
+			}
+
+			if ( typeof value !== "string" ) {
+				value = jQuery(value).detach();
+			}
+
+			return this.each(function() {
+				var next = this.nextSibling, parent = this.parentNode;
+
+				jQuery(this).remove();
+
+				if ( next ) {
+					jQuery(next).before( value );
+				} else {
+					jQuery(parent).append( value );
+				}
+			});
+		} else {
+			return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value );
+		}
+	},
+
+	detach: function( selector ) {
+		return this.remove( selector, true );
+	},
+
+	domManip: function( args, table, callback ) {
+		var results, first, value = args[0], scripts = [], fragment, parent;
+
+		// We can't cloneNode fragments that contain checked, in WebKit
+		if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
+			return this.each(function() {
+				jQuery(this).domManip( args, table, callback, true );
+			});
+		}
+
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				args[0] = value.call(this, i, table ? self.html() : undefined);
+				self.domManip( args, table, callback );
+			});
+		}
+
+		if ( this[0] ) {
+			parent = value && value.parentNode;
+
+			// If we're in a fragment, just use that instead of building a new one
+			if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
+				results = { fragment: parent };
+
+			} else {
+				results = buildFragment( args, this, scripts );
+			}
+			
+			fragment = results.fragment;
+			
+			if ( fragment.childNodes.length === 1 ) {
+				first = fragment = fragment.firstChild;
+			} else {
+				first = fragment.firstChild;
+			}
+
+			if ( first ) {
+				table = table && jQuery.nodeName( first, "tr" );
+
+				for ( var i = 0, l = this.length; i < l; i++ ) {
+					callback.call(
+						table ?
+							root(this[i], first) :
+							this[i],
+						i > 0 || results.cacheable || this.length > 1  ?
+							fragment.cloneNode(true) :
+							fragment
+					);
+				}
+			}
+
+			if ( scripts.length ) {
+				jQuery.each( scripts, evalScript );
+			}
+		}
+
+		return this;
+
+		function root( elem, cur ) {
+			return jQuery.nodeName(elem, "table") ?
+				(elem.getElementsByTagName("tbody")[0] ||
+				elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+				elem;
+		}
+	}
+});
+
+function cloneCopyEvent(orig, ret) {
+	var i = 0;
+
+	ret.each(function() {
+		if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) {
+			return;
+		}
+
+		var oldData = jQuery.data( orig[i++] ), curData = jQuery.data( this, oldData ), events = oldData && oldData.events;
+
+		if ( events ) {
+			delete curData.handle;
+			curData.events = {};
+
+			for ( var type in events ) {
+				for ( var handler in events[ type ] ) {
+					jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data );
+				}
+			}
+		}
+	});
+}
+
+function buildFragment( args, nodes, scripts ) {
+	var fragment, cacheable, cacheresults,
+		doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document);
+
+	// Only cache "small" (1/2 KB) strings that are associated with the main document
+	// Cloning options loses the selected state, so don't cache them
+	// IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
+	// Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
+	if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
+		!rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
+
+		cacheable = true;
+		cacheresults = jQuery.fragments[ args[0] ];
+		if ( cacheresults ) {
+			if ( cacheresults !== 1 ) {
+				fragment = cacheresults;
+			}
+		}
+	}
+
+	if ( !fragment ) {
+		fragment = doc.createDocumentFragment();
+		jQuery.clean( args, doc, fragment, scripts );
+	}
+
+	if ( cacheable ) {
+		jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1;
+	}
+
+	return { fragment: fragment, cacheable: cacheable };
+}
+
+jQuery.fragments = {};
+
+jQuery.each({
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function( name, original ) {
+	jQuery.fn[ name ] = function( selector ) {
+		var ret = [], insert = jQuery( selector ),
+			parent = this.length === 1 && this[0].parentNode;
+		
+		if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
+			insert[ original ]( this[0] );
+			return this;
+			
+		} else {
+			for ( var i = 0, l = insert.length; i < l; i++ ) {
+				var elems = (i > 0 ? this.clone(true) : this).get();
+				jQuery.fn[ original ].apply( jQuery(insert[i]), elems );
+				ret = ret.concat( elems );
+			}
+		
+			return this.pushStack( ret, name, insert.selector );
+		}
+	};
+});
+
+jQuery.extend({
+	clean: function( elems, context, fragment, scripts ) {
+		context = context || document;
+
+		// !context.createElement fails in IE with an error but returns typeof 'object'
+		if ( typeof context.createElement === "undefined" ) {
+			context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+		}
+
+		var ret = [];
+
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			if ( typeof elem === "number" ) {
+				elem += "";
+			}
+
+			if ( !elem ) {
+				continue;
+			}
+
+			// Convert html string into DOM nodes
+			if ( typeof elem === "string" && !rhtml.test( elem ) ) {
+				elem = context.createTextNode( elem );
+
+			} else if ( typeof elem === "string" ) {
+				// Fix "XHTML"-style tags in all browsers
+				elem = elem.replace(rxhtmlTag, fcloseTag);
+
+				// Trim whitespace, otherwise indexOf won't work as expected
+				var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
+					wrap = wrapMap[ tag ] || wrapMap._default,
+					depth = wrap[0],
+					div = context.createElement("div");
+
+				// Go to html and back, then peel off extra wrappers
+				div.innerHTML = wrap[1] + elem + wrap[2];
+
+				// Move to the right depth
+				while ( depth-- ) {
+					div = div.lastChild;
+				}
+
+				// Remove IE's autoinserted <tbody> from table fragments
+				if ( !jQuery.support.tbody ) {
+
+					// String was a <table>, *may* have spurious <tbody>
+					var hasBody = rtbody.test(elem),
+						tbody = tag === "table" && !hasBody ?
+							div.firstChild && div.firstChild.childNodes :
+
+							// String was a bare <thead> or <tfoot>
+							wrap[1] === "<table>" && !hasBody ?
+								div.childNodes :
+								[];
+
+					for ( var j = tbody.length - 1; j >= 0 ; --j ) {
+						if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+							tbody[ j ].parentNode.removeChild( tbody[ j ] );
+						}
+					}
+
+				}
+
+				// IE completely kills leading whitespace when innerHTML is used
+				if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+					div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+				}
+
+				elem = div.childNodes;
+			}
+
+			if ( elem.nodeType ) {
+				ret.push( elem );
+			} else {
+				ret = jQuery.merge( ret, elem );
+			}
+		}
+
+		if ( fragment ) {
+			for ( var i = 0; ret[i]; i++ ) {
+				if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+					scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+				
+				} else {
+					if ( ret[i].nodeType === 1 ) {
+						ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
+					}
+					fragment.appendChild( ret[i] );
+				}
+			}
+		}
+
+		return ret;
+	},
+	
+	cleanData: function( elems ) {
+		var data, id, cache = jQuery.cache,
+			special = jQuery.event.special,
+			deleteExpando = jQuery.support.deleteExpando;
+		
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			id = elem[ jQuery.expando ];
+			
+			if ( id ) {
+				data = cache[ id ];
+				
+				if ( data.events ) {
+					for ( var type in data.events ) {
+						if ( special[ type ] ) {
+							jQuery.event.remove( elem, type );
+
+						} else {
+							removeEvent( elem, type, data.handle );
+						}
+					}
+				}
+				
+				if ( deleteExpando ) {
+					delete elem[ jQuery.expando ];
+
+				} else if ( elem.removeAttribute ) {
+					elem.removeAttribute( jQuery.expando );
+				}
+				
+				delete cache[ id ];
+			}
+		}
+	}
+});
+// exclude the following css properties to add px
+var rexclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
+	ralpha = /alpha\([^)]*\)/,
+	ropacity = /opacity=([^)]*)/,
+	rfloat = /float/i,
+	rdashAlpha = /-([a-z])/ig,
+	rupper = /([A-Z])/g,
+	rnumpx = /^-?\d+(?:px)?$/i,
+	rnum = /^-?\d/,
+
+	cssShow = { position: "absolute", visibility: "hidden", display:"block" },
+	cssWidth = [ "Left", "Right" ],
+	cssHeight = [ "Top", "Bottom" ],
+
+	// cache check for defaultView.getComputedStyle
+	getComputedStyle = document.defaultView && document.defaultView.getComputedStyle,
+	// normalize float css property
+	styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat",
+	fcamelCase = function( all, letter ) {
+		return letter.toUpperCase();
+	};
+
+jQuery.fn.css = function( name, value ) {
+	return access( this, name, value, true, function( elem, name, value ) {
+		if ( value === undefined ) {
+			return jQuery.curCSS( elem, name );
+		}
+		
+		if ( typeof value === "number" && !rexclude.test(name) ) {
+			value += "px";
+		}
+
+		jQuery.style( elem, name, value );
+	});
+};
+
+jQuery.extend({
+	style: function( elem, name, value ) {
+		// don't set styles on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return undefined;
+		}
+
+		// ignore negative width and height values #1599
+		if ( (name === "width" || name === "height") && parseFloat(value) < 0 ) {
+			value = undefined;
+		}
+
+		var style = elem.style || elem, set = value !== undefined;
+
+		// IE uses filters for opacity
+		if ( !jQuery.support.opacity && name === "opacity" ) {
+			if ( set ) {
+				// IE has trouble with opacity if it does not have layout
+				// Force it by setting the zoom level
+				style.zoom = 1;
+
+				// Set the alpha filter to set the opacity
+				var opacity = parseInt( value, 10 ) + "" === "NaN" ? "" : "alpha(opacity=" + value * 100 + ")";
+				var filter = style.filter || jQuery.curCSS( elem, "filter" ) || "";
+				style.filter = ralpha.test(filter) ? filter.replace(ralpha, opacity) : opacity;
+			}
+
+			return style.filter && style.filter.indexOf("opacity=") >= 0 ?
+				(parseFloat( ropacity.exec(style.filter)[1] ) / 100) + "":
+				"";
+		}
+
+		// Make sure we're using the right name for getting the float value
+		if ( rfloat.test( name ) ) {
+			name = styleFloat;
+		}
+
+		name = name.replace(rdashAlpha, fcamelCase);
+
+		if ( set ) {
+			style[ name ] = value;
+		}
+
+		return style[ name ];
+	},
+
+	css: function( elem, name, force, extra ) {
+		if ( name === "width" || name === "height" ) {
+			var val, props = cssShow, which = name === "width" ? cssWidth : cssHeight;
+
+			function getWH() {
+				val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
+
+				if ( extra === "border" ) {
+					return;
+				}
+
+				jQuery.each( which, function() {
+					if ( !extra ) {
+						val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
+					}
+
+					if ( extra === "margin" ) {
+						val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0;
+					} else {
+						val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
+					}
+				});
+			}
+
+			if ( elem.offsetWidth !== 0 ) {
+				getWH();
+			} else {
+				jQuery.swap( elem, props, getWH );
+			}
+
+			return Math.max(0, Math.round(val));
+		}
+
+		return jQuery.curCSS( elem, name, force );
+	},
+
+	curCSS: function( elem, name, force ) {
+		var ret, style = elem.style, filter;
+
+		// IE uses filters for opacity
+		if ( !jQuery.support.opacity && name === "opacity" && elem.currentStyle ) {
+			ret = ropacity.test(elem.currentStyle.filter || "") ?
+				(parseFloat(RegExp.$1) / 100) + "" :
+				"";
+
+			return ret === "" ?
+				"1" :
+				ret;
+		}
+
+		// Make sure we're using the right name for getting the float value
+		if ( rfloat.test( name ) ) {
+			name = styleFloat;
+		}
+
+		if ( !force && style && style[ name ] ) {
+			ret = style[ name ];
+
+		} else if ( getComputedStyle ) {
+
+			// Only "float" is needed here
+			if ( rfloat.test( name ) ) {
+				name = "float";
+			}
+
+			name = name.replace( rupper, "-$1" ).toLowerCase();
+
+			var defaultView = elem.ownerDocument.defaultView;
+
+			if ( !defaultView ) {
+				return null;
+			}
+
+			var computedStyle = defaultView.getComputedStyle( elem, null );
+
+			if ( computedStyle ) {
+				ret = computedStyle.getPropertyValue( name );
+			}
+
+			// We should always get a number back from opacity
+			if ( name === "opacity" && ret === "" ) {
+				ret = "1";
+			}
+
+		} else if ( elem.currentStyle ) {
+			var camelCase = name.replace(rdashAlpha, fcamelCase);
+
+			ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
+
+			// From the awesome hack by Dean Edwards
+			// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+			// If we're not dealing with a regular pixel number
+			// but a number that has a weird ending, we need to convert it to pixels
+			if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
+				// Remember the original values
+				var left = style.left, rsLeft = elem.runtimeStyle.left;
+
+				// Put in the new values to get a computed value out
+				elem.runtimeStyle.left = elem.currentStyle.left;
+				style.left = camelCase === "fontSize" ? "1em" : (ret || 0);
+				ret = style.pixelLeft + "px";
+
+				// Revert the changed values
+				style.left = left;
+				elem.runtimeStyle.left = rsLeft;
+			}
+		}
+
+		return ret;
+	},
+
+	// A method for quickly swapping in/out CSS properties to get correct calculations
+	swap: function( elem, options, callback ) {
+		var old = {};
+
+		// Remember the old values, and insert the new ones
+		for ( var name in options ) {
+			old[ name ] = elem.style[ name ];
+			elem.style[ name ] = options[ name ];
+		}
+
+		callback.call( elem );
+
+		// Revert the old values
+		for ( var name in options ) {
+			elem.style[ name ] = old[ name ];
+		}
+	}
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+	jQuery.expr.filters.hidden = function( elem ) {
+		var width = elem.offsetWidth, height = elem.offsetHeight,
+			skip = elem.nodeName.toLowerCase() === "tr";
+
+		return width === 0 && height === 0 && !skip ?
+			true :
+			width > 0 && height > 0 && !skip ?
+				false :
+				jQuery.curCSS(elem, "display") === "none";
+	};
+
+	jQuery.expr.filters.visible = function( elem ) {
+		return !jQuery.expr.filters.hidden( elem );
+	};
+}
+var jsc = now(),
+	rscript = /<script(.|\s)*?\/script>/gi,
+	rselectTextarea = /select|textarea/i,
+	rinput = /color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,
+	jsre = /=\?(&|$)/,
+	rquery = /\?/,
+	rts = /(\?|&)_=.*?(&|$)/,
+	rurl = /^(\w+:)?\/\/([^\/?#]+)/,
+	r20 = /%20/g,
+
+	// Keep a copy of the old load method
+	_load = jQuery.fn.load;
+
+jQuery.fn.extend({
+	load: function( url, params, callback ) {
+		if ( typeof url !== "string" ) {
+			return _load.call( this, url );
+
+		// Don't do a request if no elements are being requested
+		} else if ( !this.length ) {
+			return this;
+		}
+
+		var off = url.indexOf(" ");
+		if ( off >= 0 ) {
+			var selector = url.slice(off, url.length);
+			url = url.slice(0, off);
+		}
+
+		// Default to a GET request
+		var type = "GET";
+
+		// If the second parameter was provided
+		if ( params ) {
+			// If it's a function
+			if ( jQuery.isFunction( params ) ) {
+				// We assume that it's the callback
+				callback = params;
+				params = null;
+
+			// Otherwise, build a param string
+			} else if ( typeof params === "object" ) {
+				params = jQuery.param( params, jQuery.ajaxSettings.traditional );
+				type = "POST";
+			}
+		}
+
+		var self = this;
+
+		// Request the remote document
+		jQuery.ajax({
+			url: url,
+			type: type,
+			dataType: "html",
+			data: params,
+			complete: function( res, status ) {
+				// If successful, inject the HTML into all the matched elements
+				if ( status === "success" || status === "notmodified" ) {
+					// See if a selector was specified
+					self.html( selector ?
+						// Create a dummy div to hold the results
+						jQuery("<div />")
+							// inject the contents of the document in, removing the scripts
+							// to avoid any 'Permission Denied' errors in IE
+							.append(res.responseText.replace(rscript, ""))
+
+							// Locate the specified elements
+							.find(selector) :
+
+						// If not, just inject the full result
+						res.responseText );
+				}
+
+				if ( callback ) {
+					self.each( callback, [res.responseText, status, res] );
+				}
+			}
+		});
+
+		return this;
+	},
+
+	serialize: function() {
+		return jQuery.param(this.serializeArray());
+	},
+	serializeArray: function() {
+		return this.map(function() {
+			return this.elements ? jQuery.makeArray(this.elements) : this;
+		})
+		.filter(function() {
+			return this.name && !this.disabled &&
+				(this.checked || rselectTextarea.test(this.nodeName) ||
+					rinput.test(this.type));
+		})
+		.map(function( i, elem ) {
+			var val = jQuery(this).val();
+
+			return val == null ?
+				null :
+				jQuery.isArray(val) ?
+					jQuery.map( val, function( val, i ) {
+						return { name: elem.name, value: val };
+					}) :
+					{ name: elem.name, value: val };
+		}).get();
+	}
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) {
+	jQuery.fn[o] = function( f ) {
+		return this.bind(o, f);
+	};
+});
+
+jQuery.extend({
+
+	get: function( url, data, callback, type ) {
+		// shift arguments if data argument was omited
+		if ( jQuery.isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = null;
+		}
+
+		return jQuery.ajax({
+			type: "GET",
+			url: url,
+			data: data,
+			success: callback,
+			dataType: type
+		});
+	},
+
+	getScript: function( url, callback ) {
+		return jQuery.get(url, null, callback, "script");
+	},
+
+	getJSON: function( url, data, callback ) {
+		return jQuery.get(url, data, callback, "json");
+	},
+
+	post: function( url, data, callback, type ) {
+		// shift arguments if data argument was omited
+		if ( jQuery.isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = {};
+		}
+
+		return jQuery.ajax({
+			type: "POST",
+			url: url,
+			data: data,
+			success: callback,
+			dataType: type
+		});
+	},
+
+	ajaxSetup: function( settings ) {
+		jQuery.extend( jQuery.ajaxSettings, settings );
+	},
+
+	ajaxSettings: {
+		url: location.href,
+		global: true,
+		type: "GET",
+		contentType: "application/x-www-form-urlencoded",
+		processData: true,
+		async: true,
+		/*
+		timeout: 0,
+		data: null,
+		username: null,
+		password: null,
+		traditional: false,
+		*/
+		// Create the request object; Microsoft failed to properly
+		// implement the XMLHttpRequest in IE7 (can't request local files),
+		// so we use the ActiveXObject when it is available
+		// This function can be overriden by calling jQuery.ajaxSetup
+		xhr: window.XMLHttpRequest && (window.location.protocol !== "file:" || !window.ActiveXObject) ?
+			function() {
+				return new window.XMLHttpRequest();
+			} :
+			function() {
+				try {
+					return new window.ActiveXObject("Microsoft.XMLHTTP");
+				} catch(e) {}
+			},
+		accepts: {
+			xml: "application/xml, text/xml",
+			html: "text/html",
+			script: "text/javascript, application/javascript",
+			json: "application/json, text/javascript",
+			text: "text/plain",
+			_default: "*/*"
+		}
+	},
+
+	// Last-Modified header cache for next request
+	lastModified: {},
+	etag: {},
+
+	ajax: function( origSettings ) {
+		var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings);
+		
+		var jsonp, status, data,
+			callbackContext = origSettings && origSettings.context || s,
+			type = s.type.toUpperCase();
+
+		// convert data if not already a string
+		if ( s.data && s.processData && typeof s.data !== "string" ) {
+			s.data = jQuery.param( s.data, s.traditional );
+		}
+
+		// Handle JSONP Parameter Callbacks
+		if ( s.dataType === "jsonp" ) {
+			if ( type === "GET" ) {
+				if ( !jsre.test( s.url ) ) {
+					s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?";
+				}
+			} else if ( !s.data || !jsre.test(s.data) ) {
+				s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?";
+			}
+			s.dataType = "json";
+		}
+
+		// Build temporary JSONP function
+		if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) {
+			jsonp = s.jsonpCallback || ("jsonp" + jsc++);
+
+			// Replace the =? sequence both in the query string and the data
+			if ( s.data ) {
+				s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
+			}
+
+			s.url = s.url.replace(jsre, "=" + jsonp + "$1");
+
+			// We need to make sure
+			// that a JSONP style response is executed properly
+			s.dataType = "script";
+
+			// Handle JSONP-style loading
+			window[ jsonp ] = window[ jsonp ] || function( tmp ) {
+				data = tmp;
+				success();
+				complete();
+				// Garbage collect
+				window[ jsonp ] = undefined;
+
+				try {
+					delete window[ jsonp ];
+				} catch(e) {}
+
+				if ( head ) {
+					head.removeChild( script );
+				}
+			};
+		}
+
+		if ( s.dataType === "script" && s.cache === null ) {
+			s.cache = false;
+		}
+
+		if ( s.cache === false && type === "GET" ) {
+			var ts = now();
+
+			// try replacing _= if it is there
+			var ret = s.url.replace(rts, "$1_=" + ts + "$2");
+
+			// if nothing was replaced, add timestamp to the end
+			s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : "");
+		}
+
+		// If data is available, append data to url for get requests
+		if ( s.data && type === "GET" ) {
+			s.url += (rquery.test(s.url) ? "&" : "?") + s.data;
+		}
+
+		// Watch for a new set of requests
+		if ( s.global && ! jQuery.active++ ) {
+			jQuery.event.trigger( "ajaxStart" );
+		}
+
+		// Matches an absolute URL, and saves the domain
+		var parts = rurl.exec( s.url ),
+			remote = parts && (parts[1] && parts[1] !== location.protocol || parts[2] !== location.host);
+
+		// If we're requesting a remote document
+		// and trying to load JSON or Script with a GET
+		if ( s.dataType === "script" && type === "GET" && remote ) {
+			var head = document.getElementsByTagName("head")[0] || document.documentElement;
+			var script = document.createElement("script");
+			script.src = s.url;
+			if ( s.scriptCharset ) {
+				script.charset = s.scriptCharset;
+			}
+
+			// Handle Script loading
+			if ( !jsonp ) {
+				var done = false;
+
+				// Attach handlers for all browsers
+				script.onload = script.onreadystatechange = function() {
+					if ( !done && (!this.readyState ||
+							this.readyState === "loaded" || this.readyState === "complete") ) {
+						done = true;
+						success();
+						complete();
+
+						// Handle memory leak in IE
+						script.onload = script.onreadystatechange = null;
+						if ( head && script.parentNode ) {
+							head.removeChild( script );
+						}
+					}
+				};
+			}
+
+			// Use insertBefore instead of appendChild  to circumvent an IE6 bug.
+			// This arises when a base node is used (#2709 and #4378).
+			head.insertBefore( script, head.firstChild );
+
+			// We handle everything using the script element injection
+			return undefined;
+		}
+
+		var requestDone = false;
+
+		// Create the request object
+		var xhr = s.xhr();
+
+		if ( !xhr ) {
+			return;
+		}
+
+		// Open the socket
+		// Passing null username, generates a login popup on Opera (#2865)
+		if ( s.username ) {
+			xhr.open(type, s.url, s.async, s.username, s.password);
+		} else {
+			xhr.open(type, s.url, s.async);
+		}
+
+		// Need an extra try/catch for cross domain requests in Firefox 3
+		try {
+			// Set the correct header, if data is being sent
+			if ( s.data || origSettings && origSettings.contentType ) {
+				xhr.setRequestHeader("Content-Type", s.contentType);
+			}
+
+			// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+			if ( s.ifModified ) {
+				if ( jQuery.lastModified[s.url] ) {
+					xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]);
+				}
+
+				if ( jQuery.etag[s.url] ) {
+					xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]);
+				}
+			}
+
+			// Set header so the called script knows that it's an XMLHttpRequest
+			// Only send the header if it's not a remote XHR
+			if ( !remote ) {
+				xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+			}
+
+			// Set the Accepts header for the server, depending on the dataType
+			xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
+				s.accepts[ s.dataType ] + ", */*" :
+				s.accepts._default );
+		} catch(e) {}
+
+		// Allow custom headers/mimetypes and early abort
+		if ( s.beforeSend && s.beforeSend.call(callbackContext, xhr, s) === false ) {
+			// Handle the global AJAX counter
+			if ( s.global && ! --jQuery.active ) {
+				jQuery.event.trigger( "ajaxStop" );
+			}
+
+			// close opended socket
+			xhr.abort();
+			return false;
+		}
+
+		if ( s.global ) {
+			trigger("ajaxSend", [xhr, s]);
+		}
+
+		// Wait for a response to come back
+		var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) {
+			// The request was aborted
+			if ( !xhr || xhr.readyState === 0 || isTimeout === "abort" ) {
+				// Opera doesn't call onreadystatechange before this point
+				// so we simulate the call
+				if ( !requestDone ) {
+					complete();
+				}
+
+				requestDone = true;
+				if ( xhr ) {
+					xhr.onreadystatechange = jQuery.noop;
+				}
+
+			// The transfer is complete and the data is available, or the request timed out
+			} else if ( !requestDone && xhr && (xhr.readyState === 4 || isTimeout === "timeout") ) {
+				requestDone = true;
+				xhr.onreadystatechange = jQuery.noop;
+
+				status = isTimeout === "timeout" ?
+					"timeout" :
+					!jQuery.httpSuccess( xhr ) ?
+						"error" :
+						s.ifModified && jQuery.httpNotModified( xhr, s.url ) ?
+							"notmodified" :
+							"success";
+
+				var errMsg;
+
+				if ( status === "success" ) {
+					// Watch for, and catch, XML document parse errors
+					try {
+						// process the data (runs the xml through httpData regardless of callback)
+						data = jQuery.httpData( xhr, s.dataType, s );
+					} catch(err) {
+						status = "parsererror";
+						errMsg = err;
+					}
+				}
+
+				// Make sure that the request was successful or notmodified
+				if ( status === "success" || status === "notmodified" ) {
+					// JSONP handles its own success callback
+					if ( !jsonp ) {
+						success();
+					}
+				} else {
+					jQuery.handleError(s, xhr, status, errMsg);
+				}
+
+				// Fire the complete handlers
+				complete();
+
+				if ( isTimeout === "timeout" ) {
+					xhr.abort();
+				}
+
+				// Stop memory leaks
+				if ( s.async ) {
+					xhr = null;
+				}
+			}
+		};
+
+		// Override the abort handler, if we can (IE doesn't allow it, but that's OK)
+		// Opera doesn't fire onreadystatechange at all on abort
+		try {
+			var oldAbort = xhr.abort;
+			xhr.abort = function() {
+				if ( xhr ) {
+					oldAbort.call( xhr );
+				}
+
+				onreadystatechange( "abort" );
+			};
+		} catch(e) { }
+
+		// Timeout checker
+		if ( s.async && s.timeout > 0 ) {
+			setTimeout(function() {
+				// Check to see if the request is still happening
+				if ( xhr && !requestDone ) {
+					onreadystatechange( "timeout" );
+				}
+			}, s.timeout);
+		}
+
+		// Send the data
+		try {
+			xhr.send( type === "POST" || type === "PUT" || type === "DELETE" ? s.data : null );
+		} catch(e) {
+			jQuery.handleError(s, xhr, null, e);
+			// Fire the complete handlers
+			complete();
+		}
+
+		// firefox 1.5 doesn't fire statechange for sync requests
+		if ( !s.async ) {
+			onreadystatechange();
+		}
+
+		function success() {
+			// If a local callback was specified, fire it and pass it the data
+			if ( s.success ) {
+				s.success.call( callbackContext, data, status, xhr );
+			}
+
+			// Fire the global callback
+			if ( s.global ) {
+				trigger( "ajaxSuccess", [xhr, s] );
+			}
+		}
+
+		function complete() {
+			// Process result
+			if ( s.complete ) {
+				s.complete.call( callbackContext, xhr, status);
+			}
+
+			// The request was completed
+			if ( s.global ) {
+				trigger( "ajaxComplete", [xhr, s] );
+			}
+
+			// Handle the global AJAX counter
+			if ( s.global && ! --jQuery.active ) {
+				jQuery.event.trigger( "ajaxStop" );
+			}
+		}
+		
+		function trigger(type, args) {
+			(s.context ? jQuery(s.context) : jQuery.event).trigger(type, args);
+		}
+
+		// return XMLHttpRequest to allow aborting the request etc.
+		return xhr;
+	},
+
+	handleError: function( s, xhr, status, e ) {
+		// If a local callback was specified, fire it
+		if ( s.error ) {
+			s.error.call( s.context || s, xhr, status, e );
+		}
+
+		// Fire the global callback
+		if ( s.global ) {
+			(s.context ? jQuery(s.context) : jQuery.event).trigger( "ajaxError", [xhr, s, e] );
+		}
+	},
+
+	// Counter for holding the number of active queries
+	active: 0,
+
+	// Determines if an XMLHttpRequest was successful or not
+	httpSuccess: function( xhr ) {
+		try {
+			// IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
+			return !xhr.status && location.protocol === "file:" ||
+				// Opera returns 0 when status is 304
+				( xhr.status >= 200 && xhr.status < 300 ) ||
+				xhr.status === 304 || xhr.status === 1223 || xhr.status === 0;
+		} catch(e) {}
+
+		return false;
+	},
+
+	// Determines if an XMLHttpRequest returns NotModified
+	httpNotModified: function( xhr, url ) {
+		var lastModified = xhr.getResponseHeader("Last-Modified"),
+			etag = xhr.getResponseHeader("Etag");
+
+		if ( lastModified ) {
+			jQuery.lastModified[url] = lastModified;
+		}
+
+		if ( etag ) {
+			jQuery.etag[url] = etag;
+		}
+
+		// Opera returns 0 when status is 304
+		return xhr.status === 304 || xhr.status === 0;
+	},
+
+	httpData: function( xhr, type, s ) {
+		var ct = xhr.getResponseHeader("content-type") || "",
+			xml = type === "xml" || !type && ct.indexOf("xml") >= 0,
+			data = xml ? xhr.responseXML : xhr.responseText;
+
+		if ( xml && data.documentElement.nodeName === "parsererror" ) {
+			jQuery.error( "parsererror" );
+		}
+
+		// Allow a pre-filtering function to sanitize the response
+		// s is checked to keep backwards compatibility
+		if ( s && s.dataFilter ) {
+			data = s.dataFilter( data, type );
+		}
+
+		// The filter can actually parse the response
+		if ( typeof data === "string" ) {
+			// Get the JavaScript object, if JSON is used.
+			if ( type === "json" || !type && ct.indexOf("json") >= 0 ) {
+				data = jQuery.parseJSON( data );
+
+			// If the type is "script", eval it in global context
+			} else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) {
+				jQuery.globalEval( data );
+			}
+		}
+
+		return data;
+	},
+
+	// Serialize an array of form elements or a set of
+	// key/values into a query string
+	param: function( a, traditional ) {
+		var s = [];
+		
+		// Set traditional to true for jQuery <= 1.3.2 behavior.
+		if ( traditional === undefined ) {
+			traditional = jQuery.ajaxSettings.traditional;
+		}
+		
+		// If an array was passed in, assume that it is an array of form elements.
+		if ( jQuery.isArray(a) || a.jquery ) {
+			// Serialize the form elements
+			jQuery.each( a, function() {
+				add( this.name, this.value );
+			});
+			
+		} else {
+			// If traditional, encode the "old" way (the way 1.3.2 or older
+			// did it), otherwise encode params recursively.
+			for ( var prefix in a ) {
+				buildParams( prefix, a[prefix] );
+			}
+		}
+
+		// Return the resulting serialization
+		return s.join("&").replace(r20, "+");
+
+		function buildParams( prefix, obj ) {
+			if ( jQuery.isArray(obj) ) {
+				// Serialize array item.
+				jQuery.each( obj, function( i, v ) {
+					if ( traditional || /\[\]$/.test( prefix ) ) {
+						// Treat each array item as a scalar.
+						add( prefix, v );
+					} else {
+						// If array item is non-scalar (array or object), encode its
+						// numeric index to resolve deserialization ambiguity issues.
+						// Note that rack (as of 1.0.0) can't currently deserialize
+						// nested arrays properly, and attempting to do so may cause
+						// a server error. Possible fixes are to modify rack's
+						// deserialization algorithm or to provide an option or flag
+						// to force array serialization to be shallow.
+						buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v );
+					}
+				});
+					
+			} else if ( !traditional && obj != null && typeof obj === "object" ) {
+				// Serialize object item.
+				jQuery.each( obj, function( k, v ) {
+					buildParams( prefix + "[" + k + "]", v );
+				});
+					
+			} else {
+				// Serialize scalar item.
+				add( prefix, obj );
+			}
+		}
+
+		function add( key, value ) {
+			// If value is a function, invoke it and return its value
+			value = jQuery.isFunction(value) ? value() : value;
+			s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
+		}
+	}
+});
+var elemdisplay = {},
+	rfxtypes = /toggle|show|hide/,
+	rfxnum = /^([+-]=)?([\d+-.]+)(.*)$/,
+	timerId,
+	fxAttrs = [
+		// height animations
+		[ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
+		// width animations
+		[ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
+		// opacity animations
+		[ "opacity" ]
+	];
+
+jQuery.fn.extend({
+	show: function( speed, callback ) {
+		if ( speed || speed === 0) {
+			return this.animate( genFx("show", 3), speed, callback);
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var old = jQuery.data(this[i], "olddisplay");
+
+				this[i].style.display = old || "";
+
+				if ( jQuery.css(this[i], "display") === "none" ) {
+					var nodeName = this[i].nodeName, display;
+
+					if ( elemdisplay[ nodeName ] ) {
+						display = elemdisplay[ nodeName ];
+
+					} else {
+						var elem = jQuery("<" + nodeName + " />").appendTo("body");
+
+						display = elem.css("display");
+
+						if ( display === "none" ) {
+							display = "block";
+						}
+
+						elem.remove();
+
+						elemdisplay[ nodeName ] = display;
+					}
+
+					jQuery.data(this[i], "olddisplay", display);
+				}
+			}
+
+			// Set the display of the elements in a second loop
+			// to avoid the constant reflow
+			for ( var j = 0, k = this.length; j < k; j++ ) {
+				this[j].style.display = jQuery.data(this[j], "olddisplay") || "";
+			}
+
+			return this;
+		}
+	},
+
+	hide: function( speed, callback ) {
+		if ( speed || speed === 0 ) {
+			return this.animate( genFx("hide", 3), speed, callback);
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var old = jQuery.data(this[i], "olddisplay");
+				if ( !old && old !== "none" ) {
+					jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display"));
+				}
+			}
+
+			// Set the display of the elements in a second loop
+			// to avoid the constant reflow
+			for ( var j = 0, k = this.length; j < k; j++ ) {
+				this[j].style.display = "none";
+			}
+
+			return this;
+		}
+	},
+
+	// Save the old toggle function
+	_toggle: jQuery.fn.toggle,
+
+	toggle: function( fn, fn2 ) {
+		var bool = typeof fn === "boolean";
+
+		if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
+			this._toggle.apply( this, arguments );
+
+		} else if ( fn == null || bool ) {
+			this.each(function() {
+				var state = bool ? fn : jQuery(this).is(":hidden");
+				jQuery(this)[ state ? "show" : "hide" ]();
+			});
+
+		} else {
+			this.animate(genFx("toggle", 3), fn, fn2);
+		}
+
+		return this;
+	},
+
+	fadeTo: function( speed, to, callback ) {
+		return this.filter(":hidden").css("opacity", 0).show().end()
+					.animate({opacity: to}, speed, callback);
+	},
+
+	animate: function( prop, speed, easing, callback ) {
+		var optall = jQuery.speed(speed, easing, callback);
+
+		if ( jQuery.isEmptyObject( prop ) ) {
+			return this.each( optall.complete );
+		}
+
+		return this[ optall.queue === false ? "each" : "queue" ](function() {
+			var opt = jQuery.extend({}, optall), p,
+				hidden = this.nodeType === 1 && jQuery(this).is(":hidden"),
+				self = this;
+
+			for ( p in prop ) {
+				var name = p.replace(rdashAlpha, fcamelCase);
+
+				if ( p !== name ) {
+					prop[ name ] = prop[ p ];
+					delete prop[ p ];
+					p = name;
+				}
+
+				if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) {
+					return opt.complete.call(this);
+				}
+
+				if ( ( p === "height" || p === "width" ) && this.style ) {
+					// Store display property
+					opt.display = jQuery.css(this, "display");
+
+					// Make sure that nothing sneaks out
+					opt.overflow = this.style.overflow;
+				}
+
+				if ( jQuery.isArray( prop[p] ) ) {
+					// Create (if needed) and add to specialEasing
+					(opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1];
+					prop[p] = prop[p][0];
+				}
+			}
+
+			if ( opt.overflow != null ) {
+				this.style.overflow = "hidden";
+			}
+
+			opt.curAnim = jQuery.extend({}, prop);
+
+			jQuery.each( prop, function( name, val ) {
+				var e = new jQuery.fx( self, opt, name );
+
+				if ( rfxtypes.test(val) ) {
+					e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+
+				} else {
+					var parts = rfxnum.exec(val),
+						start = e.cur(true) || 0;
+
+					if ( parts ) {
+						var end = parseFloat( parts[2] ),
+							unit = parts[3] || "px";
+
+						// We need to compute starting value
+						if ( unit !== "px" ) {
+							self.style[ name ] = (end || 1) + unit;
+							start = ((end || 1) / e.cur(true)) * start;
+							self.style[ name ] = start + unit;
+						}
+
+						// If a +=/-= token was provided, we're doing a relative animation
+						if ( parts[1] ) {
+							end = ((parts[1] === "-=" ? -1 : 1) * end) + start;
+						}
+
+						e.custom( start, end, unit );
+
+					} else {
+						e.custom( start, val, "" );
+					}
+				}
+			});
+
+			// For JS strict compliance
+			return true;
+		});
+	},
+
+	stop: function( clearQueue, gotoEnd ) {
+		var timers = jQuery.timers;
+
+		if ( clearQueue ) {
+			this.queue([]);
+		}
+
+		this.each(function() {
+			// go in reverse order so anything added to the queue during the loop is ignored
+			for ( var i = timers.length - 1; i >= 0; i-- ) {
+				if ( timers[i].elem === this ) {
+					if (gotoEnd) {
+						// force the next step to be the last
+						timers[i](true);
+					}
+
+					timers.splice(i, 1);
+				}
+			}
+		});
+
+		// start the next in the queue if the last step wasn't forced
+		if ( !gotoEnd ) {
+			this.dequeue();
+		}
+
+		return this;
+	}
+
+});
+
+// Generate shortcuts for custom animations
+jQuery.each({
+	slideDown: genFx("show", 1),
+	slideUp: genFx("hide", 1),
+	slideToggle: genFx("toggle", 1),
+	fadeIn: { opacity: "show" },
+	fadeOut: { opacity: "hide" }
+}, function( name, props ) {
+	jQuery.fn[ name ] = function( speed, callback ) {
+		return this.animate( props, speed, callback );
+	};
+});
+
+jQuery.extend({
+	speed: function( speed, easing, fn ) {
+		var opt = speed && typeof speed === "object" ? speed : {
+			complete: fn || !fn && easing ||
+				jQuery.isFunction( speed ) && speed,
+			duration: speed,
+			easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
+		};
+
+		opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+			jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default;
+
+		// Queueing
+		opt.old = opt.complete;
+		opt.complete = function() {
+			if ( opt.queue !== false ) {
+				jQuery(this).dequeue();
+			}
+			if ( jQuery.isFunction( opt.old ) ) {
+				opt.old.call( this );
+			}
+		};
+
+		return opt;
+	},
+
+	easing: {
+		linear: function( p, n, firstNum, diff ) {
+			return firstNum + diff * p;
+		},
+		swing: function( p, n, firstNum, diff ) {
+			return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
+		}
+	},
+
+	timers: [],
+
+	fx: function( elem, options, prop ) {
+		this.options = options;
+		this.elem = elem;
+		this.prop = prop;
+
+		if ( !options.orig ) {
+			options.orig = {};
+		}
+	}
+
+});
+
+jQuery.fx.prototype = {
+	// Simple function for setting a style value
+	update: function() {
+		if ( this.options.step ) {
+			this.options.step.call( this.elem, this.now, this );
+		}
+
+		(jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
+
+		// Set display property to block for height/width animations
+		if ( ( this.prop === "height" || this.prop === "width" ) && this.elem.style ) {
+			this.elem.style.display = "block";
+		}
+	},
+
+	// Get the current size
+	cur: function( force ) {
+		if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) {
+			return this.elem[ this.prop ];
+		}
+
+		var r = parseFloat(jQuery.css(this.elem, this.prop, force));
+		return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0;
+	},
+
+	// Start an animation from one number to another
+	custom: function( from, to, unit ) {
+		this.startTime = now();
+		this.start = from;
+		this.end = to;
+		this.unit = unit || this.unit || "px";
+		this.now = this.start;
+		this.pos = this.state = 0;
+
+		var self = this;
+		function t( gotoEnd ) {
+			return self.step(gotoEnd);
+		}
+
+		t.elem = this.elem;
+
+		if ( t() && jQuery.timers.push(t) && !timerId ) {
+			timerId = setInterval(jQuery.fx.tick, 13);
+		}
+	},
+
+	// Simple 'show' function
+	show: function() {
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+		this.options.show = true;
+
+		// Begin the animation
+		// Make sure that we start at a small width/height to avoid any
+		// flash of content
+		this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur());
+
+		// Start by showing the element
+		jQuery( this.elem ).show();
+	},
+
+	// Simple 'hide' function
+	hide: function() {
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+		this.options.hide = true;
+
+		// Begin the animation
+		this.custom(this.cur(), 0);
+	},
+
+	// Each step of an animation
+	step: function( gotoEnd ) {
+		var t = now(), done = true;
+
+		if ( gotoEnd || t >= this.options.duration + this.startTime ) {
+			this.now = this.end;
+			this.pos = this.state = 1;
+			this.update();
+
+			this.options.curAnim[ this.prop ] = true;
+
+			for ( var i in this.options.curAnim ) {
+				if ( this.options.curAnim[i] !== true ) {
+					done = false;
+				}
+			}
+
+			if ( done ) {
+				if ( this.options.display != null ) {
+					// Reset the overflow
+					this.elem.style.overflow = this.options.overflow;
+
+					// Reset the display
+					var old = jQuery.data(this.elem, "olddisplay");
+					this.elem.style.display = old ? old : this.options.display;
+
+					if ( jQuery.css(this.elem, "display") === "none" ) {
+						this.elem.style.display = "block";
+					}
+				}
+
+				// Hide the element if the "hide" operation was done
+				if ( this.options.hide ) {
+					jQuery(this.elem).hide();
+				}
+
+				// Reset the properties, if the item has been hidden or shown
+				if ( this.options.hide || this.options.show ) {
+					for ( var p in this.options.curAnim ) {
+						jQuery.style(this.elem, p, this.options.orig[p]);
+					}
+				}
+
+				// Execute the complete function
+				this.options.complete.call( this.elem );
+			}
+
+			return false;
+
+		} else {
+			var n = t - this.startTime;
+			this.state = n / this.options.duration;
+
+			// Perform the easing function, defaults to swing
+			var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop];
+			var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear");
+			this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration);
+			this.now = this.start + ((this.end - this.start) * this.pos);
+
+			// Perform the next step of the animation
+			this.update();
+		}
+
+		return true;
+	}
+};
+
+jQuery.extend( jQuery.fx, {
+	tick: function() {
+		var timers = jQuery.timers;
+
+		for ( var i = 0; i < timers.length; i++ ) {
+			if ( !timers[i]() ) {
+				timers.splice(i--, 1);
+			}
+		}
+
+		if ( !timers.length ) {
+			jQuery.fx.stop();
+		}
+	},
+		
+	stop: function() {
+		clearInterval( timerId );
+		timerId = null;
+	},
+	
+	speeds: {
+		slow: 600,
+ 		fast: 200,
+ 		// Default speed
+ 		_default: 400
+	},
+
+	step: {
+		opacity: function( fx ) {
+			jQuery.style(fx.elem, "opacity", fx.now);
+		},
+
+		_default: function( fx ) {
+			if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
+				fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit;
+			} else {
+				fx.elem[ fx.prop ] = fx.now;
+			}
+		}
+	}
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+	jQuery.expr.filters.animated = function( elem ) {
+		return jQuery.grep(jQuery.timers, function( fn ) {
+			return elem === fn.elem;
+		}).length;
+	};
+}
+
+function genFx( type, num ) {
+	var obj = {};
+
+	jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
+		obj[ this ] = type;
+	});
+
+	return obj;
+}
+if ( "getBoundingClientRect" in document.documentElement ) {
+	jQuery.fn.offset = function( options ) {
+		var elem = this[0];
+
+		if ( options ) { 
+			return this.each(function( i ) {
+				jQuery.offset.setOffset( this, options, i );
+			});
+		}
+
+		if ( !elem || !elem.ownerDocument ) {
+			return null;
+		}
+
+		if ( elem === elem.ownerDocument.body ) {
+			return jQuery.offset.bodyOffset( elem );
+		}
+
+		var box = elem.getBoundingClientRect(), doc = elem.ownerDocument, body = doc.body, docElem = doc.documentElement,
+			clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0,
+			top  = box.top  + (self.pageYOffset || jQuery.support.boxModel && docElem.scrollTop  || body.scrollTop ) - clientTop,
+			left = box.left + (self.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft;
+
+		return { top: top, left: left };
+	};
+
+} else {
+	jQuery.fn.offset = function( options ) {
+		var elem = this[0];
+
+		if ( options ) { 
+			return this.each(function( i ) {
+				jQuery.offset.setOffset( this, options, i );
+			});
+		}
+
+		if ( !elem || !elem.ownerDocument ) {
+			return null;
+		}
+
+		if ( elem === elem.ownerDocument.body ) {
+			return jQuery.offset.bodyOffset( elem );
+		}
+
+		jQuery.offset.initialize();
+
+		var offsetParent = elem.offsetParent, prevOffsetParent = elem,
+			doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement,
+			body = doc.body, defaultView = doc.defaultView,
+			prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
+			top = elem.offsetTop, left = elem.offsetLeft;
+
+		while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
+			if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+				break;
+			}
+
+			computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
+			top  -= elem.scrollTop;
+			left -= elem.scrollLeft;
+
+			if ( elem === offsetParent ) {
+				top  += elem.offsetTop;
+				left += elem.offsetLeft;
+
+				if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.nodeName)) ) {
+					top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
+					left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+				}
+
+				prevOffsetParent = offsetParent, offsetParent = elem.offsetParent;
+			}
+
+			if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
+				top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
+				left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+			}
+
+			prevComputedStyle = computedStyle;
+		}
+
+		if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
+			top  += body.offsetTop;
+			left += body.offsetLeft;
+		}
+
+		if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+			top  += Math.max( docElem.scrollTop, body.scrollTop );
+			left += Math.max( docElem.scrollLeft, body.scrollLeft );
+		}
+
+		return { top: top, left: left };
+	};
+}
+
+jQuery.offset = {
+	initialize: function() {
+		var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.curCSS(body, "marginTop", true) ) || 0,
+			html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
+
+		jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
+
+		container.innerHTML = html;
+		body.insertBefore( container, body.firstChild );
+		innerDiv = container.firstChild;
+		checkDiv = innerDiv.firstChild;
+		td = innerDiv.nextSibling.firstChild.firstChild;
+
+		this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
+		this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
+
+		checkDiv.style.position = "fixed", checkDiv.style.top = "20px";
+		// safari subtracts parent border width here which is 5px
+		this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15);
+		checkDiv.style.position = checkDiv.style.top = "";
+
+		innerDiv.style.overflow = "hidden", innerDiv.style.position = "relative";
+		this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
+
+		this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
+
+		body.removeChild( container );
+		body = container = innerDiv = checkDiv = table = td = null;
+		jQuery.offset.initialize = jQuery.noop;
+	},
+
+	bodyOffset: function( body ) {
+		var top = body.offsetTop, left = body.offsetLeft;
+
+		jQuery.offset.initialize();
+
+		if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
+			top  += parseFloat( jQuery.curCSS(body, "marginTop",  true) ) || 0;
+			left += parseFloat( jQuery.curCSS(body, "marginLeft", true) ) || 0;
+		}
+
+		return { top: top, left: left };
+	},
+	
+	setOffset: function( elem, options, i ) {
+		// set position first, in-case top/left are set even on static elem
+		if ( /static/.test( jQuery.curCSS( elem, "position" ) ) ) {
+			elem.style.position = "relative";
+		}
+		var curElem   = jQuery( elem ),
+			curOffset = curElem.offset(),
+			curTop    = parseInt( jQuery.curCSS( elem, "top",  true ), 10 ) || 0,
+			curLeft   = parseInt( jQuery.curCSS( elem, "left", true ), 10 ) || 0;
+
+		if ( jQuery.isFunction( options ) ) {
+			options = options.call( elem, i, curOffset );
+		}
+
+		var props = {
+			top:  (options.top  - curOffset.top)  + curTop,
+			left: (options.left - curOffset.left) + curLeft
+		};
+		
+		if ( "using" in options ) {
+			options.using.call( elem, props );
+		} else {
+			curElem.css( props );
+		}
+	}
+};
+
+
+jQuery.fn.extend({
+	position: function() {
+		if ( !this[0] ) {
+			return null;
+		}
+
+		var elem = this[0],
+
+		// Get *real* offsetParent
+		offsetParent = this.offsetParent(),
+
+		// Get correct offsets
+		offset       = this.offset(),
+		parentOffset = /^body|html$/i.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+		// Subtract element margins
+		// note: when an element has margin: auto the offsetLeft and marginLeft
+		// are the same in Safari causing offset.left to incorrectly be 0
+		offset.top  -= parseFloat( jQuery.curCSS(elem, "marginTop",  true) ) || 0;
+		offset.left -= parseFloat( jQuery.curCSS(elem, "marginLeft", true) ) || 0;
+
+		// Add offsetParent borders
+		parentOffset.top  += parseFloat( jQuery.curCSS(offsetParent[0], "borderTopWidth",  true) ) || 0;
+		parentOffset.left += parseFloat( jQuery.curCSS(offsetParent[0], "borderLeftWidth", true) ) || 0;
+
+		// Subtract the two offsets
+		return {
+			top:  offset.top  - parentOffset.top,
+			left: offset.left - parentOffset.left
+		};
+	},
+
+	offsetParent: function() {
+		return this.map(function() {
+			var offsetParent = this.offsetParent || document.body;
+			while ( offsetParent && (!/^body|html$/i.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+				offsetParent = offsetParent.offsetParent;
+			}
+			return offsetParent;
+		});
+	}
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( ["Left", "Top"], function( i, name ) {
+	var method = "scroll" + name;
+
+	jQuery.fn[ method ] = function(val) {
+		var elem = this[0], win;
+		
+		if ( !elem ) {
+			return null;
+		}
+
+		if ( val !== undefined ) {
+			// Set the scroll offset
+			return this.each(function() {
+				win = getWindow( this );
+
+				if ( win ) {
+					win.scrollTo(
+						!i ? val : jQuery(win).scrollLeft(),
+						 i ? val : jQuery(win).scrollTop()
+					);
+
+				} else {
+					this[ method ] = val;
+				}
+			});
+		} else {
+			win = getWindow( elem );
+
+			// Return the scroll offset
+			return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
+				jQuery.support.boxModel && win.document.documentElement[ method ] ||
+					win.document.body[ method ] :
+				elem[ method ];
+		}
+	};
+});
+
+function getWindow( elem ) {
+	return ("scrollTo" in elem && elem.document) ?
+		elem :
+		elem.nodeType === 9 ?
+			elem.defaultView || elem.parentWindow :
+			false;
+}
+// Create innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function( i, name ) {
+
+	var type = name.toLowerCase();
+
+	// innerHeight and innerWidth
+	jQuery.fn["inner" + name] = function() {
+		return this[0] ?
+			jQuery.css( this[0], type, false, "padding" ) :
+			null;
+	};
+
+	// outerHeight and outerWidth
+	jQuery.fn["outer" + name] = function( margin ) {
+		return this[0] ?
+			jQuery.css( this[0], type, false, margin ? "margin" : "border" ) :
+			null;
+	};
+
+	jQuery.fn[ type ] = function( size ) {
+		// Get window width or height
+		var elem = this[0];
+		if ( !elem ) {
+			return size == null ? null : this;
+		}
+		
+		if ( jQuery.isFunction( size ) ) {
+			return this.each(function( i ) {
+				var self = jQuery( this );
+				self[ type ]( size.call( this, i, self[ type ]() ) );
+			});
+		}
+
+		return ("scrollTo" in elem && elem.document) ? // does it walk and quack like a window?
+			// Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+			elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] ||
+			elem.document.body[ "client" + name ] :
+
+			// Get document width or height
+			(elem.nodeType === 9) ? // is it a document
+				// Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+				Math.max(
+					elem.documentElement["client" + name],
+					elem.body["scroll" + name], elem.documentElement["scroll" + name],
+					elem.body["offset" + name], elem.documentElement["offset" + name]
+				) :
+
+				// Get or set width or height on the element
+				size === undefined ?
+					// Get width or height on the element
+					jQuery.css( elem, type ) :
+
+					// Set the width or height on the element (default to pixels if value is unitless)
+					this.css( type, typeof size === "string" ? size : size + "px" );
+	};
+
+});
+// Expose jQuery to the global object
+window.jQuery = window.$ = jQuery;
+
+})(window);
diff --git a/lib/scripts/jquery/jquery.min.js b/lib/scripts/jquery/jquery.min.js
new file mode 100644
index 000000000..7c2430802
--- /dev/null
+++ b/lib/scripts/jquery/jquery.min.js
@@ -0,0 +1,154 @@
+/*!
+ * jQuery JavaScript Library v1.4.2
+ * http://jquery.com/
+ *
+ * Copyright 2010, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2010, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Sat Feb 13 22:33:48 2010 -0500
+ */
+(function(A,w){function ma(){if(!c.isReady){try{s.documentElement.doScroll("left")}catch(a){setTimeout(ma,1);return}c.ready()}}function Qa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function X(a,b,d,f,e,j){var i=a.length;if(typeof b==="object"){for(var o in b)X(a,o,b[o],f,e,d);return a}if(d!==w){f=!j&&f&&c.isFunction(d);for(o=0;o<i;o++)e(a[o],b,f?d.call(a[o],o,e(a[o],b)):d,j);return a}return i?
+e(a[0],b):w}function J(){return(new Date).getTime()}function Y(){return false}function Z(){return true}function na(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function oa(a){var b,d=[],f=[],e=arguments,j,i,o,k,n,r;i=c.data(this,"events");if(!(a.liveFired===this||!i||!i.live||a.button&&a.type==="click")){a.liveFired=this;var u=i.live.slice(0);for(k=0;k<u.length;k++){i=u[k];i.origType.replace(O,"")===a.type?f.push(i.selector):u.splice(k--,1)}j=c(a.target).closest(f,a.currentTarget);n=0;for(r=
+j.length;n<r;n++)for(k=0;k<u.length;k++){i=u[k];if(j[n].selector===i.selector){o=j[n].elem;f=null;if(i.preType==="mouseenter"||i.preType==="mouseleave")f=c(a.relatedTarget).closest(i.selector)[0];if(!f||f!==o)d.push({elem:o,handleObj:i})}}n=0;for(r=d.length;n<r;n++){j=d[n];a.currentTarget=j.elem;a.data=j.handleObj.data;a.handleObj=j.handleObj;if(j.handleObj.origHandler.apply(j.elem,e)===false){b=false;break}}return b}}function pa(a,b){return"live."+(a&&a!=="*"?a+".":"")+b.replace(/\./g,"`").replace(/ /g,
+"&")}function qa(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function ra(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var f=c.data(a[d++]),e=c.data(this,f);if(f=f&&f.events){delete e.handle;e.events={};for(var j in f)for(var i in f[j])c.event.add(this,j,f[j][i],f[j][i].data)}}})}function sa(a,b,d){var f,e,j;b=b&&b[0]?b[0].ownerDocument||b[0]:s;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&b===s&&!ta.test(a[0])&&(c.support.checkClone||!ua.test(a[0]))){e=
+true;if(j=c.fragments[a[0]])if(j!==1)f=j}if(!f){f=b.createDocumentFragment();c.clean(a,b,f,d)}if(e)c.fragments[a[0]]=j?f:1;return{fragment:f,cacheable:e}}function K(a,b){var d={};c.each(va.concat.apply([],va.slice(0,b)),function(){d[this]=a});return d}function wa(a){return"scrollTo"in a&&a.document?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var c=function(a,b){return new c.fn.init(a,b)},Ra=A.jQuery,Sa=A.$,s=A.document,T,Ta=/^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,Ua=/^.[^:#\[\.,]*$/,Va=/\S/,
+Wa=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,Xa=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,P=navigator.userAgent,xa=false,Q=[],L,$=Object.prototype.toString,aa=Object.prototype.hasOwnProperty,ba=Array.prototype.push,R=Array.prototype.slice,ya=Array.prototype.indexOf;c.fn=c.prototype={init:function(a,b){var d,f;if(!a)return this;if(a.nodeType){this.context=this[0]=a;this.length=1;return this}if(a==="body"&&!b){this.context=s;this[0]=s.body;this.selector="body";this.length=1;return this}if(typeof a==="string")if((d=Ta.exec(a))&&
+(d[1]||!b))if(d[1]){f=b?b.ownerDocument||b:s;if(a=Xa.exec(a))if(c.isPlainObject(b)){a=[s.createElement(a[1])];c.fn.attr.call(a,b,true)}else a=[f.createElement(a[1])];else{a=sa([d[1]],[f]);a=(a.cacheable?a.fragment.cloneNode(true):a.fragment).childNodes}return c.merge(this,a)}else{if(b=s.getElementById(d[2])){if(b.id!==d[2])return T.find(a);this.length=1;this[0]=b}this.context=s;this.selector=a;return this}else if(!b&&/^\w+$/.test(a)){this.selector=a;this.context=s;a=s.getElementsByTagName(a);return c.merge(this,
+a)}else return!b||b.jquery?(b||T).find(a):c(b).find(a);else if(c.isFunction(a))return T.ready(a);if(a.selector!==w){this.selector=a.selector;this.context=a.context}return c.makeArray(a,this)},selector:"",jquery:"1.4.2",length:0,size:function(){return this.length},toArray:function(){return R.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this.slice(a)[0]:this[a]},pushStack:function(a,b,d){var f=c();c.isArray(a)?ba.apply(f,a):c.merge(f,a);f.prevObject=this;f.context=this.context;if(b===
+"find")f.selector=this.selector+(this.selector?" ":"")+d;else if(b)f.selector=this.selector+"."+b+"("+d+")";return f},each:function(a,b){return c.each(this,a,b)},ready:function(a){c.bindReady();if(c.isReady)a.call(s,c);else Q&&Q.push(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(R.apply(this,arguments),"slice",R.call(arguments).join(","))},map:function(a){return this.pushStack(c.map(this,
+function(b,d){return a.call(b,d,b)}))},end:function(){return this.prevObject||c(null)},push:ba,sort:[].sort,splice:[].splice};c.fn.init.prototype=c.fn;c.extend=c.fn.extend=function(){var a=arguments[0]||{},b=1,d=arguments.length,f=false,e,j,i,o;if(typeof a==="boolean"){f=a;a=arguments[1]||{};b=2}if(typeof a!=="object"&&!c.isFunction(a))a={};if(d===b){a=this;--b}for(;b<d;b++)if((e=arguments[b])!=null)for(j in e){i=a[j];o=e[j];if(a!==o)if(f&&o&&(c.isPlainObject(o)||c.isArray(o))){i=i&&(c.isPlainObject(i)||
+c.isArray(i))?i:c.isArray(o)?[]:{};a[j]=c.extend(f,i,o)}else if(o!==w)a[j]=o}return a};c.extend({noConflict:function(a){A.$=Sa;if(a)A.jQuery=Ra;return c},isReady:false,ready:function(){if(!c.isReady){if(!s.body)return setTimeout(c.ready,13);c.isReady=true;if(Q){for(var a,b=0;a=Q[b++];)a.call(s,c);Q=null}c.fn.triggerHandler&&c(s).triggerHandler("ready")}},bindReady:function(){if(!xa){xa=true;if(s.readyState==="complete")return c.ready();if(s.addEventListener){s.addEventListener("DOMContentLoaded",
+L,false);A.addEventListener("load",c.ready,false)}else if(s.attachEvent){s.attachEvent("onreadystatechange",L);A.attachEvent("onload",c.ready);var a=false;try{a=A.frameElement==null}catch(b){}s.documentElement.doScroll&&a&&ma()}}},isFunction:function(a){return $.call(a)==="[object Function]"},isArray:function(a){return $.call(a)==="[object Array]"},isPlainObject:function(a){if(!a||$.call(a)!=="[object Object]"||a.nodeType||a.setInterval)return false;if(a.constructor&&!aa.call(a,"constructor")&&!aa.call(a.constructor.prototype,
+"isPrototypeOf"))return false;var b;for(b in a);return b===w||aa.call(a,b)},isEmptyObject:function(a){for(var b in a)return false;return true},error:function(a){throw a;},parseJSON:function(a){if(typeof a!=="string"||!a)return null;a=c.trim(a);if(/^[\],:{}\s]*$/.test(a.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"")))return A.JSON&&A.JSON.parse?A.JSON.parse(a):(new Function("return "+
+a))();else c.error("Invalid JSON: "+a)},noop:function(){},globalEval:function(a){if(a&&Va.test(a)){var b=s.getElementsByTagName("head")[0]||s.documentElement,d=s.createElement("script");d.type="text/javascript";if(c.support.scriptEval)d.appendChild(s.createTextNode(a));else d.text=a;b.insertBefore(d,b.firstChild);b.removeChild(d)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,b,d){var f,e=0,j=a.length,i=j===w||c.isFunction(a);if(d)if(i)for(f in a){if(b.apply(a[f],
+d)===false)break}else for(;e<j;){if(b.apply(a[e++],d)===false)break}else if(i)for(f in a){if(b.call(a[f],f,a[f])===false)break}else for(d=a[0];e<j&&b.call(d,e,d)!==false;d=a[++e]);return a},trim:function(a){return(a||"").replace(Wa,"")},makeArray:function(a,b){b=b||[];if(a!=null)a.length==null||typeof a==="string"||c.isFunction(a)||typeof a!=="function"&&a.setInterval?ba.call(b,a):c.merge(b,a);return b},inArray:function(a,b){if(b.indexOf)return b.indexOf(a);for(var d=0,f=b.length;d<f;d++)if(b[d]===
+a)return d;return-1},merge:function(a,b){var d=a.length,f=0;if(typeof b.length==="number")for(var e=b.length;f<e;f++)a[d++]=b[f];else for(;b[f]!==w;)a[d++]=b[f++];a.length=d;return a},grep:function(a,b,d){for(var f=[],e=0,j=a.length;e<j;e++)!d!==!b(a[e],e)&&f.push(a[e]);return f},map:function(a,b,d){for(var f=[],e,j=0,i=a.length;j<i;j++){e=b(a[j],j,d);if(e!=null)f[f.length]=e}return f.concat.apply([],f)},guid:1,proxy:function(a,b,d){if(arguments.length===2)if(typeof b==="string"){d=a;a=d[b];b=w}else if(b&&
+!c.isFunction(b)){d=b;b=w}if(!b&&a)b=function(){return a.apply(d||this,arguments)};if(a)b.guid=a.guid=a.guid||b.guid||c.guid++;return b},uaMatch:function(a){a=a.toLowerCase();a=/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version)?[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||!/compatible/.test(a)&&/(mozilla)(?:.*? rv:([\w.]+))?/.exec(a)||[];return{browser:a[1]||"",version:a[2]||"0"}},browser:{}});P=c.uaMatch(P);if(P.browser){c.browser[P.browser]=true;c.browser.version=P.version}if(c.browser.webkit)c.browser.safari=
+true;if(ya)c.inArray=function(a,b){return ya.call(b,a)};T=c(s);if(s.addEventListener)L=function(){s.removeEventListener("DOMContentLoaded",L,false);c.ready()};else if(s.attachEvent)L=function(){if(s.readyState==="complete"){s.detachEvent("onreadystatechange",L);c.ready()}};(function(){c.support={};var a=s.documentElement,b=s.createElement("script"),d=s.createElement("div"),f="script"+J();d.style.display="none";d.innerHTML="   <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+var e=d.getElementsByTagName("*"),j=d.getElementsByTagName("a")[0];if(!(!e||!e.length||!j)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(j.getAttribute("style")),hrefNormalized:j.getAttribute("href")==="/a",opacity:/^0.55$/.test(j.style.opacity),cssFloat:!!j.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:s.createElement("select").appendChild(s.createElement("option")).selected,
+parentNode:d.removeChild(d.appendChild(s.createElement("div"))).parentNode===null,deleteExpando:true,checkClone:false,scriptEval:false,noCloneEvent:true,boxModel:null};b.type="text/javascript";try{b.appendChild(s.createTextNode("window."+f+"=1;"))}catch(i){}a.insertBefore(b,a.firstChild);if(A[f]){c.support.scriptEval=true;delete A[f]}try{delete b.test}catch(o){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function k(){c.support.noCloneEvent=
+false;d.detachEvent("onclick",k)});d.cloneNode(true).fireEvent("onclick")}d=s.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=s.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var k=s.createElement("div");k.style.width=k.style.paddingLeft="1px";s.body.appendChild(k);c.boxModel=c.support.boxModel=k.offsetWidth===2;s.body.removeChild(k).style.display="none"});a=function(k){var n=
+s.createElement("div");k="on"+k;var r=k in n;if(!r){n.setAttribute(k,"return;");r=typeof n[k]==="function"}return r};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=e=j=null}})();c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};var G="jQuery"+J(),Ya=0,za={};c.extend({cache:{},expando:G,noData:{embed:true,object:true,
+applet:true},data:function(a,b,d){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var f=a[G],e=c.cache;if(!f&&typeof b==="string"&&d===w)return null;f||(f=++Ya);if(typeof b==="object"){a[G]=f;e[f]=c.extend(true,{},b)}else if(!e[f]){a[G]=f;e[f]={}}a=e[f];if(d!==w)a[b]=d;return typeof b==="string"?a[b]:a}},removeData:function(a,b){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var d=a[G],f=c.cache,e=f[d];if(b){if(e){delete e[b];c.isEmptyObject(e)&&c.removeData(a)}}else{if(c.support.deleteExpando)delete a[c.expando];
+else a.removeAttribute&&a.removeAttribute(c.expando);delete f[d]}}}});c.fn.extend({data:function(a,b){if(typeof a==="undefined"&&this.length)return c.data(this[0]);else if(typeof a==="object")return this.each(function(){c.data(this,a)});var d=a.split(".");d[1]=d[1]?"."+d[1]:"";if(b===w){var f=this.triggerHandler("getData"+d[1]+"!",[d[0]]);if(f===w&&this.length)f=c.data(this[0],a);return f===w&&d[1]?this.data(d[0]):f}else return this.trigger("setData"+d[1]+"!",[d[0],b]).each(function(){c.data(this,
+a,b)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var f=c.data(a,b);if(!d)return f||[];if(!f||c.isArray(d))f=c.data(a,b,c.makeArray(d));else f.push(d);return f}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),f=d.shift();if(f==="inprogress")f=d.shift();if(f){b==="fx"&&d.unshift("inprogress");f.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===
+w)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this,a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var Aa=/[\n\t]/g,ca=/\s+/,Za=/\r/g,$a=/href|src|style/,ab=/(button|input)/i,bb=/(button|input|object|select|textarea)/i,
+cb=/^(a|area)$/i,Ba=/radio|checkbox/;c.fn.extend({attr:function(a,b){return X(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(n){var r=c(this);r.addClass(a.call(this,n,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1)if(e.className){for(var j=" "+e.className+" ",
+i=e.className,o=0,k=b.length;o<k;o++)if(j.indexOf(" "+b[o]+" ")<0)i+=" "+b[o];e.className=c.trim(i)}else e.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(k){var n=c(this);n.removeClass(a.call(this,k,n.attr("class")))});if(a&&typeof a==="string"||a===w)for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1&&e.className)if(a){for(var j=(" "+e.className+" ").replace(Aa," "),i=0,o=b.length;i<o;i++)j=j.replace(" "+b[i]+" ",
+" ");e.className=c.trim(j)}else e.className=""}return this},toggleClass:function(a,b){var d=typeof a,f=typeof b==="boolean";if(c.isFunction(a))return this.each(function(e){var j=c(this);j.toggleClass(a.call(this,e,j.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var e,j=0,i=c(this),o=b,k=a.split(ca);e=k[j++];){o=f?o:!i.hasClass(e);i[o?"addClass":"removeClass"](e)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this,"__className__",this.className);this.className=
+this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(Aa," ").indexOf(a)>-1)return true;return false},val:function(a){if(a===w){var b=this[0];if(b){if(c.nodeName(b,"option"))return(b.attributes.value||{}).specified?b.value:b.text;if(c.nodeName(b,"select")){var d=b.selectedIndex,f=[],e=b.options;b=b.type==="select-one";if(d<0)return null;var j=b?d:0;for(d=b?d+1:e.length;j<d;j++){var i=
+e[j];if(i.selected){a=c(i).val();if(b)return a;f.push(a)}}return f}if(Ba.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Za,"")}return w}var o=c.isFunction(a);return this.each(function(k){var n=c(this),r=a;if(this.nodeType===1){if(o)r=a.call(this,k,n.val());if(typeof r==="number")r+="";if(c.isArray(r)&&Ba.test(this.type))this.checked=c.inArray(n.val(),r)>=0;else if(c.nodeName(this,"select")){var u=c.makeArray(r);c("option",this).each(function(){this.selected=
+c.inArray(c(this).val(),u)>=0});if(!u.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(a,b,d,f){if(!a||a.nodeType===3||a.nodeType===8)return w;if(f&&b in c.attrFn)return c(a)[b](d);f=a.nodeType!==1||!c.isXMLDoc(a);var e=d!==w;b=f&&c.props[b]||b;if(a.nodeType===1){var j=$a.test(b);if(b in a&&f&&!j){if(e){b==="type"&&ab.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");
+a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&&b.specified?b.value:bb.test(a.nodeName)||cb.test(a.nodeName)&&a.href?0:w;return a[b]}if(!c.support.style&&f&&b==="style"){if(e)a.style.cssText=""+d;return a.style.cssText}e&&a.setAttribute(b,""+d);a=!c.support.hrefNormalized&&f&&j?a.getAttribute(b,2):a.getAttribute(b);return a===null?w:a}return c.style(a,b,d)}});var O=/\.(.*)$/,db=function(a){return a.replace(/[^\w\s\.\|`]/g,
+function(b){return"\\"+b})};c.event={add:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){if(a.setInterval&&a!==A&&!a.frameElement)a=A;var e,j;if(d.handler){e=d;d=e.handler}if(!d.guid)d.guid=c.guid++;if(j=c.data(a)){var i=j.events=j.events||{},o=j.handle;if(!o)j.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem,arguments):w};o.elem=a;b=b.split(" ");for(var k,n=0,r;k=b[n++];){j=e?c.extend({},e):{handler:d,data:f};if(k.indexOf(".")>-1){r=k.split(".");
+k=r.shift();j.namespace=r.slice(0).sort().join(".")}else{r=[];j.namespace=""}j.type=k;j.guid=d.guid;var u=i[k],z=c.event.special[k]||{};if(!u){u=i[k]=[];if(!z.setup||z.setup.call(a,f,r,o)===false)if(a.addEventListener)a.addEventListener(k,o,false);else a.attachEvent&&a.attachEvent("on"+k,o)}if(z.add){z.add.call(a,j);if(!j.handler.guid)j.handler.guid=d.guid}u.push(j);c.event.global[k]=true}a=null}}},global:{},remove:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){var e,j=0,i,o,k,n,r,u,z=c.data(a),
+C=z&&z.events;if(z&&C){if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(e in C)c.event.remove(a,e+b)}else{for(b=b.split(" ");e=b[j++];){n=e;i=e.indexOf(".")<0;o=[];if(!i){o=e.split(".");e=o.shift();k=new RegExp("(^|\\.)"+c.map(o.slice(0).sort(),db).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(r=C[e])if(d){n=c.event.special[e]||{};for(B=f||0;B<r.length;B++){u=r[B];if(d.guid===u.guid){if(i||k.test(u.namespace)){f==null&&r.splice(B--,1);n.remove&&n.remove.call(a,u)}if(f!=
+null)break}}if(r.length===0||f!=null&&r.length===1){if(!n.teardown||n.teardown.call(a,o)===false)Ca(a,e,z.handle);delete C[e]}}else for(var B=0;B<r.length;B++){u=r[B];if(i||k.test(u.namespace)){c.event.remove(a,n,u.handler,B);r.splice(B--,1)}}}if(c.isEmptyObject(C)){if(b=z.handle)b.elem=null;delete z.events;delete z.handle;c.isEmptyObject(z)&&c.removeData(a)}}}}},trigger:function(a,b,d,f){var e=a.type||a;if(!f){a=typeof a==="object"?a[G]?a:c.extend(c.Event(e),a):c.Event(e);if(e.indexOf("!")>=0){a.type=
+e=e.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[e]&&c.each(c.cache,function(){this.events&&this.events[e]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType===8)return w;a.result=w;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(f=c.data(d,"handle"))&&f.apply(d,b);f=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+e]&&d["on"+e].apply(d,b)===false)a.result=false}catch(j){}if(!a.isPropagationStopped()&&
+f)c.event.trigger(a,b,f,true);else if(!a.isDefaultPrevented()){f=a.target;var i,o=c.nodeName(f,"a")&&e==="click",k=c.event.special[e]||{};if((!k._default||k._default.call(d,a)===false)&&!o&&!(f&&f.nodeName&&c.noData[f.nodeName.toLowerCase()])){try{if(f[e]){if(i=f["on"+e])f["on"+e]=null;c.event.triggered=true;f[e]()}}catch(n){}if(i)f["on"+e]=i;c.event.triggered=false}}},handle:function(a){var b,d,f,e;a=arguments[0]=c.event.fix(a||A.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive;
+if(!b){d=a.type.split(".");a.type=d.shift();f=new RegExp("(^|\\.)"+d.slice(0).sort().join("\\.(?:.*\\.)?")+"(\\.|$)")}e=c.data(this,"events");d=e[a.type];if(e&&d){d=d.slice(0);e=0;for(var j=d.length;e<j;e++){var i=d[e];if(b||f.test(i.namespace)){a.handler=i.handler;a.data=i.data;a.handleObj=i;i=i.handler.apply(this,arguments);if(i!==w){a.result=i;if(i===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+fix:function(a){if(a[G])return a;var b=a;a=c.Event(b);for(var d=this.props.length,f;d;){f=this.props[--d];a[f]=b[f]}if(!a.target)a.target=a.srcElement||s;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=s.documentElement;d=s.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop||
+d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(!a.which&&(a.charCode||a.charCode===0?a.charCode:a.keyCode))a.which=a.charCode||a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==w)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a){c.event.add(this,a.origType,c.extend({},a,{handler:oa}))},remove:function(a){var b=true,d=a.origType.replace(O,"");c.each(c.data(this,
+"events").live||[],function(){if(d===this.origType.replace(O,""))return b=false});b&&c.event.remove(this,a.origType,oa)}},beforeunload:{setup:function(a,b,d){if(this.setInterval)this.onbeforeunload=d;return false},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};var Ca=s.removeEventListener?function(a,b,d){a.removeEventListener(b,d,false)}:function(a,b,d){a.detachEvent("on"+b,d)};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=
+a;this.type=a.type}else this.type=a;this.timeStamp=J();this[G]=true};c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=Z;var a=this.originalEvent;if(a){a.preventDefault&&a.preventDefault();a.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=Z;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=Z;this.stopPropagation()},isDefaultPrevented:Y,isPropagationStopped:Y,
+isImmediatePropagationStopped:Y};var Da=function(a){var b=a.relatedTarget;try{for(;b&&b!==this;)b=b.parentNode;if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}}catch(d){}},Ea=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?Ea:Da,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?Ea:Da)}}});if(!c.support.submitBubbles)c.event.special.submit=
+{setup:function(){if(this.nodeName.toLowerCase()!=="form"){c.event.add(this,"click.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="submit"||d==="image")&&c(b).closest("form").length)return na("submit",this,arguments)});c.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="text"||d==="password")&&c(b).closest("form").length&&a.keyCode===13)return na("submit",this,arguments)})}else return false},teardown:function(){c.event.remove(this,".specialSubmit")}};
+if(!c.support.changeBubbles){var da=/textarea|input|select/i,ea,Fa=function(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(f){return f.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},fa=function(a,b){var d=a.target,f,e;if(!(!da.test(d.nodeName)||d.readOnly)){f=c.data(d,"_change_data");e=Fa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data",
+e);if(!(f===w||e===f))if(f!=null||e){a.type="change";return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:fa,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return fa.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return fa.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a,
+"_change_data",Fa(a))}},setup:function(){if(this.type==="file")return false;for(var a in ea)c.event.add(this,a+".specialChange",ea[a]);return da.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return da.test(this.nodeName)}};ea=c.event.special.change.filters}s.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(f){f=c.event.fix(f);f.type=b;return c.event.handle.call(this,f)}c.event.special[b]={setup:function(){this.addEventListener(a,
+d,true)},teardown:function(){this.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,f,e){if(typeof d==="object"){for(var j in d)this[b](j,f,d[j],e);return this}if(c.isFunction(f)){e=f;f=w}var i=b==="one"?c.proxy(e,function(k){c(this).unbind(k,i);return e.apply(this,arguments)}):e;if(d==="unload"&&b!=="one")this.one(d,f,e);else{j=0;for(var o=this.length;j<o;j++)c.event.add(this[j],d,i,f)}return this}});c.fn.extend({unbind:function(a,b){if(typeof a==="object"&&
+!a.preventDefault)for(var d in a)this.unbind(d,a[d]);else{d=0;for(var f=this.length;d<f;d++)c.event.remove(this[d],a,b)}return this},delegate:function(a,b,d,f){return this.live(b,d,f,a)},undelegate:function(a,b,d){return arguments.length===0?this.unbind("live"):this.die(b,null,d,a)},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){a=c.Event(a);a.preventDefault();a.stopPropagation();c.event.trigger(a,b,this[0]);return a.result}},
+toggle:function(a){for(var b=arguments,d=1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(f){var e=(c.data(this,"lastToggle"+a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,e+1);f.preventDefault();return b[e].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var Ga={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};c.each(["live","die"],function(a,b){c.fn[b]=function(d,f,e,j){var i,o=0,k,n,r=j||this.selector,
+u=j?this:c(this.context);if(c.isFunction(f)){e=f;f=w}for(d=(d||"").split(" ");(i=d[o++])!=null;){j=O.exec(i);k="";if(j){k=j[0];i=i.replace(O,"")}if(i==="hover")d.push("mouseenter"+k,"mouseleave"+k);else{n=i;if(i==="focus"||i==="blur"){d.push(Ga[i]+k);i+=k}else i=(Ga[i]||i)+k;b==="live"?u.each(function(){c.event.add(this,pa(i,r),{data:f,selector:r,handler:e,origType:i,origHandler:e,preType:n})}):u.unbind(pa(i,r),e)}}return this}});c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),
+function(a,b){c.fn[b]=function(d){return d?this.bind(b,d):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});A.attachEvent&&!A.addEventListener&&A.attachEvent("onunload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}});(function(){function a(g){for(var h="",l,m=0;g[m];m++){l=g[m];if(l.nodeType===3||l.nodeType===4)h+=l.nodeValue;else if(l.nodeType!==8)h+=a(l.childNodes)}return h}function b(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];
+if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1&&!p){t.sizcache=l;t.sizset=q}if(t.nodeName.toLowerCase()===h){y=t;break}t=t[g]}m[q]=y}}}function d(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1){if(!p){t.sizcache=l;t.sizset=q}if(typeof h!=="string"){if(t===h){y=true;break}}else if(k.filter(h,[t]).length>0){y=t;break}}t=t[g]}m[q]=y}}}var f=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+e=0,j=Object.prototype.toString,i=false,o=true;[0,0].sort(function(){o=false;return 0});var k=function(g,h,l,m){l=l||[];var q=h=h||s;if(h.nodeType!==1&&h.nodeType!==9)return[];if(!g||typeof g!=="string")return l;for(var p=[],v,t,y,S,H=true,M=x(h),I=g;(f.exec(""),v=f.exec(I))!==null;){I=v[3];p.push(v[1]);if(v[2]){S=v[3];break}}if(p.length>1&&r.exec(g))if(p.length===2&&n.relative[p[0]])t=ga(p[0]+p[1],h);else for(t=n.relative[p[0]]?[h]:k(p.shift(),h);p.length;){g=p.shift();if(n.relative[g])g+=p.shift();
+t=ga(g,t)}else{if(!m&&p.length>1&&h.nodeType===9&&!M&&n.match.ID.test(p[0])&&!n.match.ID.test(p[p.length-1])){v=k.find(p.shift(),h,M);h=v.expr?k.filter(v.expr,v.set)[0]:v.set[0]}if(h){v=m?{expr:p.pop(),set:z(m)}:k.find(p.pop(),p.length===1&&(p[0]==="~"||p[0]==="+")&&h.parentNode?h.parentNode:h,M);t=v.expr?k.filter(v.expr,v.set):v.set;if(p.length>0)y=z(t);else H=false;for(;p.length;){var D=p.pop();v=D;if(n.relative[D])v=p.pop();else D="";if(v==null)v=h;n.relative[D](y,v,M)}}else y=[]}y||(y=t);y||k.error(D||
+g);if(j.call(y)==="[object Array]")if(H)if(h&&h.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&E(h,y[g])))l.push(t[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&l.push(t[g]);else l.push.apply(l,y);else z(y,l);if(S){k(S,q,l,m);k.uniqueSort(l)}return l};k.uniqueSort=function(g){if(B){i=o;g.sort(B);if(i)for(var h=1;h<g.length;h++)g[h]===g[h-1]&&g.splice(h--,1)}return g};k.matches=function(g,h){return k(g,null,null,h)};k.find=function(g,h,l){var m,q;if(!g)return[];
+for(var p=0,v=n.order.length;p<v;p++){var t=n.order[p];if(q=n.leftMatch[t].exec(g)){var y=q[1];q.splice(1,1);if(y.substr(y.length-1)!=="\\"){q[1]=(q[1]||"").replace(/\\/g,"");m=n.find[t](q,h,l);if(m!=null){g=g.replace(n.match[t],"");break}}}}m||(m=h.getElementsByTagName("*"));return{set:m,expr:g}};k.filter=function(g,h,l,m){for(var q=g,p=[],v=h,t,y,S=h&&h[0]&&x(h[0]);g&&h.length;){for(var H in n.filter)if((t=n.leftMatch[H].exec(g))!=null&&t[2]){var M=n.filter[H],I,D;D=t[1];y=false;t.splice(1,1);if(D.substr(D.length-
+1)!=="\\"){if(v===p)p=[];if(n.preFilter[H])if(t=n.preFilter[H](t,v,l,p,m,S)){if(t===true)continue}else y=I=true;if(t)for(var U=0;(D=v[U])!=null;U++)if(D){I=M(D,t,U,v);var Ha=m^!!I;if(l&&I!=null)if(Ha)y=true;else v[U]=false;else if(Ha){p.push(D);y=true}}if(I!==w){l||(v=p);g=g.replace(n.match[H],"");if(!y)return[];break}}}if(g===q)if(y==null)k.error(g);else break;q=g}return v};k.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var n=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+CLASS:/\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},
+relative:{"+":function(g,h){var l=typeof h==="string",m=l&&!/\W/.test(h);l=l&&!m;if(m)h=h.toLowerCase();m=0;for(var q=g.length,p;m<q;m++)if(p=g[m]){for(;(p=p.previousSibling)&&p.nodeType!==1;);g[m]=l||p&&p.nodeName.toLowerCase()===h?p||false:p===h}l&&k.filter(h,g,true)},">":function(g,h){var l=typeof h==="string";if(l&&!/\W/.test(h)){h=h.toLowerCase();for(var m=0,q=g.length;m<q;m++){var p=g[m];if(p){l=p.parentNode;g[m]=l.nodeName.toLowerCase()===h?l:false}}}else{m=0;for(q=g.length;m<q;m++)if(p=g[m])g[m]=
+l?p.parentNode:p.parentNode===h;l&&k.filter(h,g,true)}},"":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("parentNode",h,m,g,p,l)},"~":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("previousSibling",h,m,g,p,l)}},find:{ID:function(g,h,l){if(typeof h.getElementById!=="undefined"&&!l)return(g=h.getElementById(g[1]))?[g]:[]},NAME:function(g,h){if(typeof h.getElementsByName!=="undefined"){var l=[];
+h=h.getElementsByName(g[1]);for(var m=0,q=h.length;m<q;m++)h[m].getAttribute("name")===g[1]&&l.push(h[m]);return l.length===0?null:l}},TAG:function(g,h){return h.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,h,l,m,q,p){g=" "+g[1].replace(/\\/g,"")+" ";if(p)return g;p=0;for(var v;(v=h[p])!=null;p++)if(v)if(q^(v.className&&(" "+v.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))l||m.push(v);else if(l)h[p]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},
+CHILD:function(g){if(g[1]==="nth"){var h=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=h[1]+(h[2]||1)-0;g[3]=h[3]-0}g[0]=e++;return g},ATTR:function(g,h,l,m,q,p){h=g[1].replace(/\\/g,"");if(!p&&n.attrMap[h])g[1]=n.attrMap[h];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,h,l,m,q){if(g[1]==="not")if((f.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,h);else{g=k.filter(g[3],h,l,true^q);l||m.push.apply(m,
+g);return false}else if(n.match.POS.test(g[0])||n.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled===true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,h,l){return!!k(l[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},
+text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"===g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},
+setFilters:{first:function(g,h){return h===0},last:function(g,h,l,m){return h===m.length-1},even:function(g,h){return h%2===0},odd:function(g,h){return h%2===1},lt:function(g,h,l){return h<l[3]-0},gt:function(g,h,l){return h>l[3]-0},nth:function(g,h,l){return l[3]-0===h},eq:function(g,h,l){return l[3]-0===h}},filter:{PSEUDO:function(g,h,l,m){var q=h[1],p=n.filters[q];if(p)return p(g,l,h,m);else if(q==="contains")return(g.textContent||g.innerText||a([g])||"").indexOf(h[3])>=0;else if(q==="not"){h=
+h[3];l=0;for(m=h.length;l<m;l++)if(h[l]===g)return false;return true}else k.error("Syntax error, unrecognized expression: "+q)},CHILD:function(g,h){var l=h[1],m=g;switch(l){case "only":case "first":for(;m=m.previousSibling;)if(m.nodeType===1)return false;if(l==="first")return true;m=g;case "last":for(;m=m.nextSibling;)if(m.nodeType===1)return false;return true;case "nth":l=h[2];var q=h[3];if(l===1&&q===0)return true;h=h[0];var p=g.parentNode;if(p&&(p.sizcache!==h||!g.nodeIndex)){var v=0;for(m=p.firstChild;m;m=
+m.nextSibling)if(m.nodeType===1)m.nodeIndex=++v;p.sizcache=h}g=g.nodeIndex-q;return l===0?g===0:g%l===0&&g/l>=0}},ID:function(g,h){return g.nodeType===1&&g.getAttribute("id")===h},TAG:function(g,h){return h==="*"&&g.nodeType===1||g.nodeName.toLowerCase()===h},CLASS:function(g,h){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(h)>-1},ATTR:function(g,h){var l=h[1];g=n.attrHandle[l]?n.attrHandle[l](g):g[l]!=null?g[l]:g.getAttribute(l);l=g+"";var m=h[2];h=h[4];return g==null?m==="!=":m===
+"="?l===h:m==="*="?l.indexOf(h)>=0:m==="~="?(" "+l+" ").indexOf(h)>=0:!h?l&&g!==false:m==="!="?l!==h:m==="^="?l.indexOf(h)===0:m==="$="?l.substr(l.length-h.length)===h:m==="|="?l===h||l.substr(0,h.length+1)===h+"-":false},POS:function(g,h,l,m){var q=n.setFilters[h[2]];if(q)return q(g,l,h,m)}}},r=n.match.POS;for(var u in n.match){n.match[u]=new RegExp(n.match[u].source+/(?![^\[]*\])(?![^\(]*\))/.source);n.leftMatch[u]=new RegExp(/(^(?:.|\r|\n)*?)/.source+n.match[u].source.replace(/\\(\d+)/g,function(g,
+h){return"\\"+(h-0+1)}))}var z=function(g,h){g=Array.prototype.slice.call(g,0);if(h){h.push.apply(h,g);return h}return g};try{Array.prototype.slice.call(s.documentElement.childNodes,0)}catch(C){z=function(g,h){h=h||[];if(j.call(g)==="[object Array]")Array.prototype.push.apply(h,g);else if(typeof g.length==="number")for(var l=0,m=g.length;l<m;l++)h.push(g[l]);else for(l=0;g[l];l++)h.push(g[l]);return h}}var B;if(s.documentElement.compareDocumentPosition)B=function(g,h){if(!g.compareDocumentPosition||
+!h.compareDocumentPosition){if(g==h)i=true;return g.compareDocumentPosition?-1:1}g=g.compareDocumentPosition(h)&4?-1:g===h?0:1;if(g===0)i=true;return g};else if("sourceIndex"in s.documentElement)B=function(g,h){if(!g.sourceIndex||!h.sourceIndex){if(g==h)i=true;return g.sourceIndex?-1:1}g=g.sourceIndex-h.sourceIndex;if(g===0)i=true;return g};else if(s.createRange)B=function(g,h){if(!g.ownerDocument||!h.ownerDocument){if(g==h)i=true;return g.ownerDocument?-1:1}var l=g.ownerDocument.createRange(),m=
+h.ownerDocument.createRange();l.setStart(g,0);l.setEnd(g,0);m.setStart(h,0);m.setEnd(h,0);g=l.compareBoundaryPoints(Range.START_TO_END,m);if(g===0)i=true;return g};(function(){var g=s.createElement("div"),h="script"+(new Date).getTime();g.innerHTML="<a name='"+h+"'/>";var l=s.documentElement;l.insertBefore(g,l.firstChild);if(s.getElementById(h)){n.find.ID=function(m,q,p){if(typeof q.getElementById!=="undefined"&&!p)return(q=q.getElementById(m[1]))?q.id===m[1]||typeof q.getAttributeNode!=="undefined"&&
+q.getAttributeNode("id").nodeValue===m[1]?[q]:w:[]};n.filter.ID=function(m,q){var p=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&p&&p.nodeValue===q}}l.removeChild(g);l=g=null})();(function(){var g=s.createElement("div");g.appendChild(s.createComment(""));if(g.getElementsByTagName("*").length>0)n.find.TAG=function(h,l){l=l.getElementsByTagName(h[1]);if(h[1]==="*"){h=[];for(var m=0;l[m];m++)l[m].nodeType===1&&h.push(l[m]);l=h}return l};g.innerHTML="<a href='#'></a>";
+if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")n.attrHandle.href=function(h){return h.getAttribute("href",2)};g=null})();s.querySelectorAll&&function(){var g=k,h=s.createElement("div");h.innerHTML="<p class='TEST'></p>";if(!(h.querySelectorAll&&h.querySelectorAll(".TEST").length===0)){k=function(m,q,p,v){q=q||s;if(!v&&q.nodeType===9&&!x(q))try{return z(q.querySelectorAll(m),p)}catch(t){}return g(m,q,p,v)};for(var l in g)k[l]=g[l];h=null}}();
+(function(){var g=s.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){n.order.splice(1,0,"CLASS");n.find.CLASS=function(h,l,m){if(typeof l.getElementsByClassName!=="undefined"&&!m)return l.getElementsByClassName(h[1])};g=null}}})();var E=s.compareDocumentPosition?function(g,h){return!!(g.compareDocumentPosition(h)&16)}:
+function(g,h){return g!==h&&(g.contains?g.contains(h):true)},x=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false},ga=function(g,h){var l=[],m="",q;for(h=h.nodeType?[h]:h;q=n.match.PSEUDO.exec(g);){m+=q[0];g=g.replace(n.match.PSEUDO,"")}g=n.relative[g]?g+"*":g;q=0;for(var p=h.length;q<p;q++)k(g,h[q],l);return k.filter(m,l)};c.find=k;c.expr=k.selectors;c.expr[":"]=c.expr.filters;c.unique=k.uniqueSort;c.text=a;c.isXMLDoc=x;c.contains=E})();var eb=/Until$/,fb=/^(?:parents|prevUntil|prevAll)/,
+gb=/,/;R=Array.prototype.slice;var Ia=function(a,b,d){if(c.isFunction(b))return c.grep(a,function(e,j){return!!b.call(e,j,e)===d});else if(b.nodeType)return c.grep(a,function(e){return e===b===d});else if(typeof b==="string"){var f=c.grep(a,function(e){return e.nodeType===1});if(Ua.test(b))return c.filter(b,f,!d);else b=c.filter(b,f)}return c.grep(a,function(e){return c.inArray(e,b)>=0===d})};c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,f=0,e=this.length;f<e;f++){d=b.length;
+c.find(a,this[f],b);if(f>0)for(var j=d;j<b.length;j++)for(var i=0;i<d;i++)if(b[i]===b[j]){b.splice(j--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=0,f=b.length;d<f;d++)if(c.contains(this,b[d]))return true})},not:function(a){return this.pushStack(Ia(this,a,false),"not",a)},filter:function(a){return this.pushStack(Ia(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){if(c.isArray(a)){var d=[],f=this[0],e,j=
+{},i;if(f&&a.length){e=0;for(var o=a.length;e<o;e++){i=a[e];j[i]||(j[i]=c.expr.match.POS.test(i)?c(i,b||this.context):i)}for(;f&&f.ownerDocument&&f!==b;){for(i in j){e=j[i];if(e.jquery?e.index(f)>-1:c(f).is(e)){d.push({selector:i,elem:f});delete j[i]}}f=f.parentNode}}return d}var k=c.expr.match.POS.test(a)?c(a,b||this.context):null;return this.map(function(n,r){for(;r&&r.ownerDocument&&r!==b;){if(k?k.index(r)>-1:c(r).is(a))return r;r=r.parentNode}return null})},index:function(a){if(!a||typeof a===
+"string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){a=typeof a==="string"?c(a,b||this.context):c.makeArray(a);b=c.merge(this.get(),a);return this.pushStack(qa(a[0])||qa(b[0])?b:c.unique(b))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",
+d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a,2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?
+a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a,b){c.fn[a]=function(d,f){var e=c.map(this,b,d);eb.test(a)||(f=d);if(f&&typeof f==="string")e=c.filter(f,e);e=this.length>1?c.unique(e):e;if((this.length>1||gb.test(f))&&fb.test(a))e=e.reverse();return this.pushStack(e,a,R.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return c.find.matches(a,b)},dir:function(a,b,d){var f=[];for(a=a[b];a&&a.nodeType!==9&&(d===w||a.nodeType!==1||!c(a).is(d));){a.nodeType===
+1&&f.push(a);a=a[b]}return f},nth:function(a,b,d){b=b||1;for(var f=0;a;a=a[d])if(a.nodeType===1&&++f===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var Ja=/ jQuery\d+="(?:\d+|null)"/g,V=/^\s+/,Ka=/(<([\w:]+)[^>]*?)\/>/g,hb=/^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,La=/<([\w:]+)/,ib=/<tbody/i,jb=/<|&#?\w+;/,ta=/<script|<object|<embed|<option|<style/i,ua=/checked\s*(?:[^=]|=\s*.checked.)/i,Ma=function(a,b,d){return hb.test(d)?
+a:b+"></"+d+">"},F={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};F.optgroup=F.option;F.tbody=F.tfoot=F.colgroup=F.caption=F.thead;F.th=F.td;if(!c.support.htmlSerialize)F._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d=
+c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==w)return this.empty().append((this[0]&&this[0].ownerDocument||s).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this},
+wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})},
+prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,
+this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,f;(f=this[d])!=null;d++)if(!a||c.filter(a,[f]).length){if(!b&&f.nodeType===1){c.cleanData(f.getElementsByTagName("*"));c.cleanData([f])}f.parentNode&&f.parentNode.removeChild(f)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild);
+return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Ja,"").replace(/=([^="'>\s]+\/)>/g,'="$1">').replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){ra(this,b);ra(this.find("*"),b.find("*"))}return b},html:function(a){if(a===w)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Ja,
+""):null;else if(typeof a==="string"&&!ta.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(La.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Ka,Ma);try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(f){this.empty().append(a)}}else c.isFunction(a)?this.each(function(e){var j=c(this),i=j.html();j.empty().append(function(){return a.call(this,e,i)})}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&
+this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d=c(this),f=d.html();d.replaceWith(a.call(this,b,f))});if(typeof a!=="string")a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){function f(u){return c.nodeName(u,"table")?u.getElementsByTagName("tbody")[0]||
+u.appendChild(u.ownerDocument.createElement("tbody")):u}var e,j,i=a[0],o=[],k;if(!c.support.checkClone&&arguments.length===3&&typeof i==="string"&&ua.test(i))return this.each(function(){c(this).domManip(a,b,d,true)});if(c.isFunction(i))return this.each(function(u){var z=c(this);a[0]=i.call(this,u,b?z.html():w);z.domManip(a,b,d)});if(this[0]){e=i&&i.parentNode;e=c.support.parentNode&&e&&e.nodeType===11&&e.childNodes.length===this.length?{fragment:e}:sa(a,this,o);k=e.fragment;if(j=k.childNodes.length===
+1?(k=k.firstChild):k.firstChild){b=b&&c.nodeName(j,"tr");for(var n=0,r=this.length;n<r;n++)d.call(b?f(this[n],j):this[n],n>0||e.cacheable||this.length>1?k.cloneNode(true):k)}o.length&&c.each(o,Qa)}return this}});c.fragments={};c.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var f=[];d=c(d);var e=this.length===1&&this[0].parentNode;if(e&&e.nodeType===11&&e.childNodes.length===1&&d.length===1){d[b](this[0]);
+return this}else{e=0;for(var j=d.length;e<j;e++){var i=(e>0?this.clone(true):this).get();c.fn[b].apply(c(d[e]),i);f=f.concat(i)}return this.pushStack(f,a,d.selector)}}});c.extend({clean:function(a,b,d,f){b=b||s;if(typeof b.createElement==="undefined")b=b.ownerDocument||b[0]&&b[0].ownerDocument||s;for(var e=[],j=0,i;(i=a[j])!=null;j++){if(typeof i==="number")i+="";if(i){if(typeof i==="string"&&!jb.test(i))i=b.createTextNode(i);else if(typeof i==="string"){i=i.replace(Ka,Ma);var o=(La.exec(i)||["",
+""])[1].toLowerCase(),k=F[o]||F._default,n=k[0],r=b.createElement("div");for(r.innerHTML=k[1]+i+k[2];n--;)r=r.lastChild;if(!c.support.tbody){n=ib.test(i);o=o==="table"&&!n?r.firstChild&&r.firstChild.childNodes:k[1]==="<table>"&&!n?r.childNodes:[];for(k=o.length-1;k>=0;--k)c.nodeName(o[k],"tbody")&&!o[k].childNodes.length&&o[k].parentNode.removeChild(o[k])}!c.support.leadingWhitespace&&V.test(i)&&r.insertBefore(b.createTextNode(V.exec(i)[0]),r.firstChild);i=r.childNodes}if(i.nodeType)e.push(i);else e=
+c.merge(e,i)}}if(d)for(j=0;e[j];j++)if(f&&c.nodeName(e[j],"script")&&(!e[j].type||e[j].type.toLowerCase()==="text/javascript"))f.push(e[j].parentNode?e[j].parentNode.removeChild(e[j]):e[j]);else{e[j].nodeType===1&&e.splice.apply(e,[j+1,0].concat(c.makeArray(e[j].getElementsByTagName("script"))));d.appendChild(e[j])}return e},cleanData:function(a){for(var b,d,f=c.cache,e=c.event.special,j=c.support.deleteExpando,i=0,o;(o=a[i])!=null;i++)if(d=o[c.expando]){b=f[d];if(b.events)for(var k in b.events)e[k]?
+c.event.remove(o,k):Ca(o,k,b.handle);if(j)delete o[c.expando];else o.removeAttribute&&o.removeAttribute(c.expando);delete f[d]}}});var kb=/z-?index|font-?weight|opacity|zoom|line-?height/i,Na=/alpha\([^)]*\)/,Oa=/opacity=([^)]*)/,ha=/float/i,ia=/-([a-z])/ig,lb=/([A-Z])/g,mb=/^-?\d+(?:px)?$/i,nb=/^-?\d/,ob={position:"absolute",visibility:"hidden",display:"block"},pb=["Left","Right"],qb=["Top","Bottom"],rb=s.defaultView&&s.defaultView.getComputedStyle,Pa=c.support.cssFloat?"cssFloat":"styleFloat",ja=
+function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){return X(this,a,b,true,function(d,f,e){if(e===w)return c.curCSS(d,f);if(typeof e==="number"&&!kb.test(f))e+="px";c.style(d,f,e)})};c.extend({style:function(a,b,d){if(!a||a.nodeType===3||a.nodeType===8)return w;if((b==="width"||b==="height")&&parseFloat(d)<0)d=w;var f=a.style||a,e=d!==w;if(!c.support.opacity&&b==="opacity"){if(e){f.zoom=1;b=parseInt(d,10)+""==="NaN"?"":"alpha(opacity="+d*100+")";a=f.filter||c.curCSS(a,"filter")||"";f.filter=
+Na.test(a)?a.replace(Na,b):b}return f.filter&&f.filter.indexOf("opacity=")>=0?parseFloat(Oa.exec(f.filter)[1])/100+"":""}if(ha.test(b))b=Pa;b=b.replace(ia,ja);if(e)f[b]=d;return f[b]},css:function(a,b,d,f){if(b==="width"||b==="height"){var e,j=b==="width"?pb:qb;function i(){e=b==="width"?a.offsetWidth:a.offsetHeight;f!=="border"&&c.each(j,function(){f||(e-=parseFloat(c.curCSS(a,"padding"+this,true))||0);if(f==="margin")e+=parseFloat(c.curCSS(a,"margin"+this,true))||0;else e-=parseFloat(c.curCSS(a,
+"border"+this+"Width",true))||0})}a.offsetWidth!==0?i():c.swap(a,ob,i);return Math.max(0,Math.round(e))}return c.curCSS(a,b,d)},curCSS:function(a,b,d){var f,e=a.style;if(!c.support.opacity&&b==="opacity"&&a.currentStyle){f=Oa.test(a.currentStyle.filter||"")?parseFloat(RegExp.$1)/100+"":"";return f===""?"1":f}if(ha.test(b))b=Pa;if(!d&&e&&e[b])f=e[b];else if(rb){if(ha.test(b))b="float";b=b.replace(lb,"-$1").toLowerCase();e=a.ownerDocument.defaultView;if(!e)return null;if(a=e.getComputedStyle(a,null))f=
+a.getPropertyValue(b);if(b==="opacity"&&f==="")f="1"}else if(a.currentStyle){d=b.replace(ia,ja);f=a.currentStyle[b]||a.currentStyle[d];if(!mb.test(f)&&nb.test(f)){b=e.left;var j=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;e.left=d==="fontSize"?"1em":f||0;f=e.pixelLeft+"px";e.left=b;a.runtimeStyle.left=j}}return f},swap:function(a,b,d){var f={};for(var e in b){f[e]=a.style[e];a.style[e]=b[e]}d.call(a);for(e in b)a.style[e]=f[e]}});if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=
+a.offsetWidth,d=a.offsetHeight,f=a.nodeName.toLowerCase()==="tr";return b===0&&d===0&&!f?true:b>0&&d>0&&!f?false:c.curCSS(a,"display")==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var sb=J(),tb=/<script(.|\s)*?\/script>/gi,ub=/select|textarea/i,vb=/color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,N=/=\?(&|$)/,ka=/\?/,wb=/(\?|&)_=.*?(&|$)/,xb=/^(\w+:)?\/\/([^\/?#]+)/,yb=/%20/g,zb=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!==
+"string")return zb.call(this,a);else if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var e=a.slice(f,a.length);a=a.slice(0,f)}f="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b==="object"){b=c.param(b,c.ajaxSettings.traditional);f="POST"}var j=this;c.ajax({url:a,type:f,dataType:"html",data:b,complete:function(i,o){if(o==="success"||o==="notmodified")j.html(e?c("<div />").append(i.responseText.replace(tb,"")).find(e):i.responseText);d&&j.each(d,[i.responseText,o,i])}});return this},
+serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ub.test(this.nodeName)||vb.test(this.type))}).map(function(a,b){a=c(this).val();return a==null?null:c.isArray(a)?c.map(a,function(d){return{name:b.name,value:d}}):{name:b.name,value:a}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),
+function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:f})},getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:f})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,
+global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:A.XMLHttpRequest&&(A.location.protocol!=="file:"||!A.ActiveXObject)?function(){return new A.XMLHttpRequest}:function(){try{return new A.ActiveXObject("Microsoft.XMLHTTP")}catch(a){}},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},etag:{},ajax:function(a){function b(){e.success&&
+e.success.call(k,o,i,x);e.global&&f("ajaxSuccess",[x,e])}function d(){e.complete&&e.complete.call(k,x,i);e.global&&f("ajaxComplete",[x,e]);e.global&&!--c.active&&c.event.trigger("ajaxStop")}function f(q,p){(e.context?c(e.context):c.event).trigger(q,p)}var e=c.extend(true,{},c.ajaxSettings,a),j,i,o,k=a&&a.context||e,n=e.type.toUpperCase();if(e.data&&e.processData&&typeof e.data!=="string")e.data=c.param(e.data,e.traditional);if(e.dataType==="jsonp"){if(n==="GET")N.test(e.url)||(e.url+=(ka.test(e.url)?
+"&":"?")+(e.jsonp||"callback")+"=?");else if(!e.data||!N.test(e.data))e.data=(e.data?e.data+"&":"")+(e.jsonp||"callback")+"=?";e.dataType="json"}if(e.dataType==="json"&&(e.data&&N.test(e.data)||N.test(e.url))){j=e.jsonpCallback||"jsonp"+sb++;if(e.data)e.data=(e.data+"").replace(N,"="+j+"$1");e.url=e.url.replace(N,"="+j+"$1");e.dataType="script";A[j]=A[j]||function(q){o=q;b();d();A[j]=w;try{delete A[j]}catch(p){}z&&z.removeChild(C)}}if(e.dataType==="script"&&e.cache===null)e.cache=false;if(e.cache===
+false&&n==="GET"){var r=J(),u=e.url.replace(wb,"$1_="+r+"$2");e.url=u+(u===e.url?(ka.test(e.url)?"&":"?")+"_="+r:"")}if(e.data&&n==="GET")e.url+=(ka.test(e.url)?"&":"?")+e.data;e.global&&!c.active++&&c.event.trigger("ajaxStart");r=(r=xb.exec(e.url))&&(r[1]&&r[1]!==location.protocol||r[2]!==location.host);if(e.dataType==="script"&&n==="GET"&&r){var z=s.getElementsByTagName("head")[0]||s.documentElement,C=s.createElement("script");C.src=e.url;if(e.scriptCharset)C.charset=e.scriptCharset;if(!j){var B=
+false;C.onload=C.onreadystatechange=function(){if(!B&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){B=true;b();d();C.onload=C.onreadystatechange=null;z&&C.parentNode&&z.removeChild(C)}}}z.insertBefore(C,z.firstChild);return w}var E=false,x=e.xhr();if(x){e.username?x.open(n,e.url,e.async,e.username,e.password):x.open(n,e.url,e.async);try{if(e.data||a&&a.contentType)x.setRequestHeader("Content-Type",e.contentType);if(e.ifModified){c.lastModified[e.url]&&x.setRequestHeader("If-Modified-Since",
+c.lastModified[e.url]);c.etag[e.url]&&x.setRequestHeader("If-None-Match",c.etag[e.url])}r||x.setRequestHeader("X-Requested-With","XMLHttpRequest");x.setRequestHeader("Accept",e.dataType&&e.accepts[e.dataType]?e.accepts[e.dataType]+", */*":e.accepts._default)}catch(ga){}if(e.beforeSend&&e.beforeSend.call(k,x,e)===false){e.global&&!--c.active&&c.event.trigger("ajaxStop");x.abort();return false}e.global&&f("ajaxSend",[x,e]);var g=x.onreadystatechange=function(q){if(!x||x.readyState===0||q==="abort"){E||
+d();E=true;if(x)x.onreadystatechange=c.noop}else if(!E&&x&&(x.readyState===4||q==="timeout")){E=true;x.onreadystatechange=c.noop;i=q==="timeout"?"timeout":!c.httpSuccess(x)?"error":e.ifModified&&c.httpNotModified(x,e.url)?"notmodified":"success";var p;if(i==="success")try{o=c.httpData(x,e.dataType,e)}catch(v){i="parsererror";p=v}if(i==="success"||i==="notmodified")j||b();else c.handleError(e,x,i,p);d();q==="timeout"&&x.abort();if(e.async)x=null}};try{var h=x.abort;x.abort=function(){x&&h.call(x);
+g("abort")}}catch(l){}e.async&&e.timeout>0&&setTimeout(function(){x&&!E&&g("timeout")},e.timeout);try{x.send(n==="POST"||n==="PUT"||n==="DELETE"?e.data:null)}catch(m){c.handleError(e,x,null,m);d()}e.async||g();return x}},handleError:function(a,b,d,f){if(a.error)a.error.call(a.context||a,b,d,f);if(a.global)(a.context?c(a.context):c.event).trigger("ajaxError",[b,a,f])},active:0,httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===
+1223||a.status===0}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"),f=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(f)c.etag[b]=f;return a.status===304||a.status===0},httpData:function(a,b,d){var f=a.getResponseHeader("content-type")||"",e=b==="xml"||!b&&f.indexOf("xml")>=0;a=e?a.responseXML:a.responseText;e&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b===
+"json"||!b&&f.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&f.indexOf("javascript")>=0)c.globalEval(a);return a},param:function(a,b){function d(i,o){if(c.isArray(o))c.each(o,function(k,n){b||/\[\]$/.test(i)?f(i,n):d(i+"["+(typeof n==="object"||c.isArray(n)?k:"")+"]",n)});else!b&&o!=null&&typeof o==="object"?c.each(o,function(k,n){d(i+"["+k+"]",n)}):f(i,o)}function f(i,o){o=c.isFunction(o)?o():o;e[e.length]=encodeURIComponent(i)+"="+encodeURIComponent(o)}var e=[];if(b===w)b=c.ajaxSettings.traditional;
+if(c.isArray(a)||a.jquery)c.each(a,function(){f(this.name,this.value)});else for(var j in a)d(j,a[j]);return e.join("&").replace(yb,"+")}});var la={},Ab=/toggle|show|hide/,Bb=/^([+-]=)?([\d+-.]+)(.*)$/,W,va=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b){if(a||a===0)return this.animate(K("show",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");
+this[a].style.display=d||"";if(c.css(this[a],"display")==="none"){d=this[a].nodeName;var f;if(la[d])f=la[d];else{var e=c("<"+d+" />").appendTo("body");f=e.css("display");if(f==="none")f="block";e.remove();la[d]=f}c.data(this[a],"olddisplay",f)}}a=0;for(b=this.length;a<b;a++)this[a].style.display=c.data(this[a],"olddisplay")||"";return this}},hide:function(a,b){if(a||a===0)return this.animate(K("hide",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");!d&&d!=="none"&&c.data(this[a],
+"olddisplay",c.css(this[a],"display"))}a=0;for(b=this.length;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b){var d=typeof a==="boolean";if(c.isFunction(a)&&c.isFunction(b))this._toggle.apply(this,arguments);else a==null||d?this.each(function(){var f=d?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(K("toggle",3),a,b);return this},fadeTo:function(a,b,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d)},
+animate:function(a,b,d,f){var e=c.speed(b,d,f);if(c.isEmptyObject(a))return this.each(e.complete);return this[e.queue===false?"each":"queue"](function(){var j=c.extend({},e),i,o=this.nodeType===1&&c(this).is(":hidden"),k=this;for(i in a){var n=i.replace(ia,ja);if(i!==n){a[n]=a[i];delete a[i];i=n}if(a[i]==="hide"&&o||a[i]==="show"&&!o)return j.complete.call(this);if((i==="height"||i==="width")&&this.style){j.display=c.css(this,"display");j.overflow=this.style.overflow}if(c.isArray(a[i])){(j.specialEasing=
+j.specialEasing||{})[i]=a[i][1];a[i]=a[i][0]}}if(j.overflow!=null)this.style.overflow="hidden";j.curAnim=c.extend({},a);c.each(a,function(r,u){var z=new c.fx(k,j,r);if(Ab.test(u))z[u==="toggle"?o?"show":"hide":u](a);else{var C=Bb.exec(u),B=z.cur(true)||0;if(C){u=parseFloat(C[2]);var E=C[3]||"px";if(E!=="px"){k.style[r]=(u||1)+E;B=(u||1)/z.cur(true)*B;k.style[r]=B+E}if(C[1])u=(C[1]==="-="?-1:1)*u+B;z.custom(B,u,E)}else z.custom(B,u,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);
+this.each(function(){for(var f=d.length-1;f>=0;f--)if(d[f].elem===this){b&&d[f](true);d.splice(f,1)}});b||this.dequeue();return this}});c.each({slideDown:K("show",1),slideUp:K("hide",1),slideToggle:K("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(a,b){c.fn[a]=function(d,f){return this.animate(b,d,f)}});c.extend({speed:function(a,b,d){var f=a&&typeof a==="object"?a:{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};f.duration=c.fx.off?0:typeof f.duration===
+"number"?f.duration:c.fx.speeds[f.duration]||c.fx.speeds._default;f.old=f.complete;f.complete=function(){f.queue!==false&&c(this).dequeue();c.isFunction(f.old)&&f.old.call(this)};return f},easing:{linear:function(a,b,d,f){return d+f*a},swing:function(a,b,d,f){return(-Math.cos(a*Math.PI)/2+0.5)*f+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||
+c.fx.step._default)(this);if((this.prop==="height"||this.prop==="width")&&this.elem.style)this.elem.style.display="block"},cur:function(a){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];return(a=parseFloat(c.css(this.elem,this.prop,a)))&&a>-10000?a:parseFloat(c.curCSS(this.elem,this.prop))||0},custom:function(a,b,d){function f(j){return e.step(j)}this.startTime=J();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;
+this.pos=this.state=0;var e=this;f.elem=this.elem;if(f()&&c.timers.push(f)&&!W)W=setInterval(c.fx.tick,13)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(a){var b=J(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=
+this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var f in this.options.curAnim)if(this.options.curAnim[f]!==true)d=false;if(d){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;a=c.data(this.elem,"olddisplay");this.elem.style.display=a?a:this.options.display;if(c.css(this.elem,"display")==="none")this.elem.style.display="block"}this.options.hide&&c(this.elem).hide();if(this.options.hide||this.options.show)for(var e in this.options.curAnim)c.style(this.elem,
+e,this.options.orig[e]);this.options.complete.call(this.elem)}return false}else{e=b-this.startTime;this.state=e/this.options.duration;a=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||a](this.state,e,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a=c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||
+c.fx.stop()},stop:function(){clearInterval(W);W=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a===b.elem}).length};c.fn.offset="getBoundingClientRect"in s.documentElement?
+function(a){var b=this[0];if(a)return this.each(function(e){c.offset.setOffset(this,a,e)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);var d=b.getBoundingClientRect(),f=b.ownerDocument;b=f.body;f=f.documentElement;return{top:d.top+(self.pageYOffset||c.support.boxModel&&f.scrollTop||b.scrollTop)-(f.clientTop||b.clientTop||0),left:d.left+(self.pageXOffset||c.support.boxModel&&f.scrollLeft||b.scrollLeft)-(f.clientLeft||b.clientLeft||0)}}:function(a){var b=
+this[0];if(a)return this.each(function(r){c.offset.setOffset(this,a,r)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d=b.offsetParent,f=b,e=b.ownerDocument,j,i=e.documentElement,o=e.body;f=(e=e.defaultView)?e.getComputedStyle(b,null):b.currentStyle;for(var k=b.offsetTop,n=b.offsetLeft;(b=b.parentNode)&&b!==o&&b!==i;){if(c.offset.supportsFixedPosition&&f.position==="fixed")break;j=e?e.getComputedStyle(b,null):b.currentStyle;
+k-=b.scrollTop;n-=b.scrollLeft;if(b===d){k+=b.offsetTop;n+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(b.nodeName))){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=d;d=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&j.overflow!=="visible"){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=j}if(f.position==="relative"||f.position==="static"){k+=o.offsetTop;n+=o.offsetLeft}if(c.offset.supportsFixedPosition&&
+f.position==="fixed"){k+=Math.max(i.scrollTop,o.scrollTop);n+=Math.max(i.scrollLeft,o.scrollLeft)}return{top:k,left:n}};c.offset={initialize:function(){var a=s.body,b=s.createElement("div"),d,f,e,j=parseFloat(c.curCSS(a,"marginTop",true))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
+a.insertBefore(b,a.firstChild);d=b.firstChild;f=d.firstChild;e=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=f.offsetTop!==5;this.doesAddBorderForTableAndCells=e.offsetTop===5;f.style.position="fixed";f.style.top="20px";this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15;f.style.position=f.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==j;a.removeChild(b);
+c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.curCSS(a,"marginTop",true))||0;d+=parseFloat(c.curCSS(a,"marginLeft",true))||0}return{top:b,left:d}},setOffset:function(a,b,d){if(/static/.test(c.curCSS(a,"position")))a.style.position="relative";var f=c(a),e=f.offset(),j=parseInt(c.curCSS(a,"top",true),10)||0,i=parseInt(c.curCSS(a,"left",true),10)||0;if(c.isFunction(b))b=b.call(a,
+d,e);d={top:b.top-e.top+j,left:b.left-e.left+i};"using"in b?b.using.call(a,d):f.css(d)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),f=/^body|html$/i.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.curCSS(a,"marginTop",true))||0;d.left-=parseFloat(c.curCSS(a,"marginLeft",true))||0;f.top+=parseFloat(c.curCSS(b[0],"borderTopWidth",true))||0;f.left+=parseFloat(c.curCSS(b[0],"borderLeftWidth",true))||0;return{top:d.top-
+f.top,left:d.left-f.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||s.body;a&&!/^body|html$/i.test(a.nodeName)&&c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(f){var e=this[0],j;if(!e)return null;if(f!==w)return this.each(function(){if(j=wa(this))j.scrollTo(!a?f:c(j).scrollLeft(),a?f:c(j).scrollTop());else this[d]=f});else return(j=wa(e))?"pageXOffset"in j?j[a?"pageYOffset":
+"pageXOffset"]:c.support.boxModel&&j.document.documentElement[d]||j.document.body[d]:e[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase();c.fn["inner"+b]=function(){return this[0]?c.css(this[0],d,false,"padding"):null};c.fn["outer"+b]=function(f){return this[0]?c.css(this[0],d,false,f?"margin":"border"):null};c.fn[d]=function(f){var e=this[0];if(!e)return f==null?null:this;if(c.isFunction(f))return this.each(function(j){var i=c(this);i[d](f.call(this,j,i[d]()))});return"scrollTo"in
+e&&e.document?e.document.compatMode==="CSS1Compat"&&e.document.documentElement["client"+b]||e.document.body["client"+b]:e.nodeType===9?Math.max(e.documentElement["client"+b],e.body["scroll"+b],e.documentElement["scroll"+b],e.body["offset"+b],e.documentElement["offset"+b]):f===w?c.css(e,d):this.css(d,typeof f==="string"?f:f+"px")}});A.jQuery=A.$=c})(window);
diff --git a/lib/scripts/linkwiz.js b/lib/scripts/linkwiz.js
index fec43ad5e..e9a1d71b3 100644
--- a/lib/scripts/linkwiz.js
+++ b/lib/scripts/linkwiz.js
@@ -2,294 +2,318 @@
  * The Link Wizard
  *
  * @author Andreas Gohr <gohr@cosmocode.de>
+ * @author Pierre Spring <pierre.spring@caillou.ch>
  */
-var linkwiz = {
-    wiz:    null,
-    entry:  null,
-    result: null,
-    timer:  null,
-    sack:   null,
-    textArea: null,
-    selected: -1,
-    selection: null,
-
-    /**
-     * Initialize the linkwizard by creating the needed HTML
-     * and attaching the eventhandlers
-     */
-    init: function(textArea){
-        // prepare AJAX object
-        linkwiz.sack = new sack(DOKU_BASE + 'lib/exe/ajax.php');
-        linkwiz.sack.AjaxFailedAlert = '';
-        linkwiz.sack.encodeURIString = false;
-
-        // create HTML Structure
-        linkwiz.wiz = document.createElement('div');
-        linkwiz.wiz.id = 'link__wiz';
-        linkwiz.wiz.className     = 'picker';
-        linkwiz.wiz.style.top  = (findPosY(textArea)+20)+'px';
-        linkwiz.wiz.style.left = (findPosX(textArea)+80)+'px';
-        linkwiz.wiz.style.marginLeft = '-10000px';
-        linkwiz.wiz.style.marginTop  = '-10000px';
-        linkwiz.wiz.style.position = 'absolute';
-
-        linkwiz.wiz.innerHTML =
-             '<div id="link__wiz_header">'+
-             '<img src="'+DOKU_BASE+'lib/images/close.png" width="16" height="16" align="right" alt="" id="link__wiz_close" />'+
-             LANG['linkwiz']+'</div>'+
-             '<div>'+LANG['linkto']+' <input type="text" class="edit" id="link__wiz_entry" autocomplete="off" /></div>'+
-             '<div id="link__wiz_result"></div>';
-        $('dw__editform').parentNode.appendChild(linkwiz.wiz);
-        linkwiz.textArea = textArea;
-        linkwiz.result = $('link__wiz_result');
-        linkwiz.entry = $('link__wiz_entry');
-
-        // attach event handlers
-        var obj;
-        obj = $('link__wiz_close');
-        obj.onclick = linkwiz.hide;
-
-        linkwiz.sack.elementObj = linkwiz.result;
-        addEvent(linkwiz.entry,'keyup',linkwiz.onEntry);
-        addEvent(linkwiz.result,'click',linkwiz.onResultClick);
-        drag.attach(linkwiz.wiz,$('link__wiz_header'));
-    },
-
-    /**
-     * handle all keyup events in the entry field
-     */
-    onEntry: function(e){
-        if(e.keyCode == 37 || e.keyCode == 39){ //left/right
-            return true; //ignore
-        }
-        if(e.keyCode == 27){
-            linkwiz.hide();
-            e.preventDefault();
-            e.stopPropagation();
-            return false;
-        }
-        if(e.keyCode == 38){ //Up
-            linkwiz.select(linkwiz.selected -1);
-            e.preventDefault();
-            e.stopPropagation();
-            return false;
-        }
-        if(e.keyCode == 40){ //Down
-            linkwiz.select(linkwiz.selected +1);
-            e.preventDefault();
-            e.stopPropagation();
-            return false;
-        }
-        if(e.keyCode == 13){ //Enter
-            if(linkwiz.selected > -1){
-                var obj = linkwiz.getResult(linkwiz.selected);
+(function($){
+    $.fn.extend({
+        linkwiz: function(editor) {
+
+            var wiz;
+            var entry;
+            var result;
+            var timer;
+            var textArea;
+            var selected;
+            var selection;
+
+            /**
+             * Initialize the linkwizard by creating the needed HTML
+             * and attaching the eventhandlers
+             */
+            var init = function(textAreaElement){
+
+
+                // create HTML Structure
+                wiz = document.createElement('div');
+                wiz.style.position = 'absolute';
+                wiz.id = 'link__wiz';
+                wiz.className     = 'picker';
+                wiz.style.top  = (findPosY(textAreaElement)+20)+'px';
+                wiz.style.left = (findPosX(textAreaElement)+80)+'px';
+                wiz.style.marginLeft = '-10000px';
+                wiz.style.marginTop  = '-10000px';
+
+                wiz.innerHTML =
+                     '<div id="link__wiz_header">'+
+                     '<img src="'+DOKU_BASE+'lib/images/close.png" width="16" height="16" align="right" alt="" id="link__wiz_close" />'+
+                     LANG['linkwiz']+'</div>'+
+                     '<div>'+LANG['linkto']+' <input type="text" class="edit" id="link__wiz_entry" autocomplete="off" /></div>'+
+                     '<div id="link__wiz_result"></div>';
+                $('#dw__editform')[0].parentNode.appendChild(wiz);
+                textArea = textAreaElement;
+                result = $('#link__wiz_result')[0];
+                entry = $('#link__wiz_entry')[0];
+
+                // attach event handlers
+                var obj;
+                var obj = $('#link__wiz_close')[0];
+                obj.onclick = hide;
+
+                addEvent(entry,'keyup',onEntry);
+                addEvent(result,'click',onResultClick);
+
+                $(wiz).draggable({handle: '#link__wiz_header'});
+
+            };
+
+            /**
+             * handle all keyup events in the entry field
+             */
+            var onEntry = function(e){
+                if(e.keyCode == 37 || e.keyCode == 39){ //left/right
+                    return true; //ignore
+                }
+                if(e.keyCode == 27){
+                    hide();
+                    e.preventDefault();
+                    e.stopPropagation();
+                    return false;
+                }
+                if(e.keyCode == 38){ //Up
+                    select(selected -1);
+                    e.preventDefault();
+                    e.stopPropagation();
+                    return false;
+                }
+                if(e.keyCode == 40){ //Down
+                    select(selected +1);
+                    e.preventDefault();
+                    e.stopPropagation();
+                    return false;
+                }
+                if(e.keyCode == 13){ //Enter
+                    if(selected > -1){
+                        var obj = getResult(selected);
+                        if(obj){
+                            var a = $(obj).find('a')[0];
+                            resultClick(a);
+                        }
+                    }else if(entry.value){
+                        insertLink(entry.value);
+                    }
+
+                    e.preventDefault();
+                    e.stopPropagation();
+                    return false;
+                }
+                autocomplete();
+            };
+
+            /**
+             * Get one of the result by index
+             *
+             * @param int result div to return
+             * @returns DOMObject or null
+             */
+            var getResult = function(num){
+                var obj;
+                var childs = $(result).find('div');
+                var obj = childs[num];
                 if(obj){
-                    var a = obj.getElementsByTagName('A')[0];
-                    linkwiz.resultClick(a);
+                    return obj;
+                }else{
+                    return null;
+                }
+            };
+
+            /**
+             * Select the given result
+             */
+            var select = function(num){
+                if(num < 0){
+                    deselect();
+                    return;
                 }
-            }else if(linkwiz.entry.value){
-                linkwiz.insertLink(linkwiz.entry.value);
-            }
 
-            e.preventDefault();
-            e.stopPropagation();
-            return false;
-        }
-        linkwiz.autocomplete();
-    },
-
-    /**
-     * Get one of the result by index
-     *
-     * @param int result div to return
-     * @returns DOMObject or null
-     */
-    getResult: function(num){
-        var obj;
-        var childs = linkwiz.result.getElementsByTagName('DIV');
-        obj = childs[num];
-        if(obj){
-            return obj;
-        }else{
-            return null;
-        }
-    },
-
-    /**
-     * Select the given result
-     */
-    select: function(num){
-        if(num < 0){
-            linkwiz.deselect();
-            return;
-        }
+                var obj = getResult(num);
+                if(obj){
+                    deselect();
+                    obj.className += ' selected';
+
+                    // make sure the item is viewable in the scroll view
+                    // FIXME check IE compatibility
+                    if(obj.offsetTop > result.scrollTop + result.clientHeight){
+                        result.scrollTop += obj.clientHeight;
+                    }else if(obj.offsetTop - result.clientHeight < result.scrollTop){ // this works but isn't quite right, fixes welcome
+                        result.scrollTop -= obj.clientHeight;
+                    }
+                    // now recheck - if still not in view, the user used the mouse to scroll
+                    if( (obj.offsetTop > result.scrollTop + result.clientHeight) ||
+                        (obj.offsetTop < result.scrollTop) ){
+                        obj.scrollIntoView();
+                    }
+
+                    selected = num;
+                }
+            };
+
+            /**
+             * deselect a result if any is selected
+             */
+            var deselect = function(){
+                if(selected > -1){
+                    var obj = getResult(selected);
+                    if(obj){
+                        obj.className = obj.className.replace(/ ?selected/,'');
+                    }
+                }
+                selected = -1;
+            };
+
+            /**
+             * Handle clicks in the result set an dispatch them to
+             * resultClick()
+             */
+            var onResultClick = function(e){
+                if(e.target.tagName != 'A') return;
+                e.stopPropagation();
+                e.preventDefault();
+                resultClick(e.target);
+                return false;
+            };
+
+            /**
+             * Handles the "click" on a given result anchor
+             */
+            var resultClick = function(a){
+                var id = a.title;
+                if(id == '' || id.substr(id.length-1) == ':'){
+                    entry.value = id;
+                    autocomplete_exec();
+                }else{
+                    entry.value = id;
+                    if(a.nextSibling && a.nextSibling.tagName == 'SPAN'){
+                        insertLink(a.nextSibling.innerHTML);
+                    }else{
+                        insertLink('');
+                    }
+                }
+            };
+
+            /**
+             * Insert the id currently in the entry box to the textarea,
+             * replacing the current selection or at the curso postion.
+             * When no selection is available the given title will be used
+             * as link title instead
+             */
+            var insertLink = function(title){
+                if(!entry.value) return;
+
+                var sel = getSelection(textArea);
+                if(sel.start == 0 && sel.end == 0) sel = selection;
+
+                var stxt = sel.getText();
+
+                // don't include trailing space in selection
+                if(stxt.charAt(stxt.length - 1) == ' '){
+                    sel.end--;
+                    var stxt = sel.getText();
+                }
 
-        var obj = linkwiz.getResult(num);
-        if(obj){
-            linkwiz.deselect();
-            obj.className += ' selected';
-
-            // make sure the item is viewable in the scroll view
-            // FIXME check IE compatibility
-            if(obj.offsetTop > linkwiz.result.scrollTop + linkwiz.result.clientHeight){
-                linkwiz.result.scrollTop += obj.clientHeight;
-            }else if(obj.offsetTop - linkwiz.result.clientHeight < linkwiz.result.scrollTop){ // this works but isn't quite right, fixes welcome
-                linkwiz.result.scrollTop -= obj.clientHeight;
-            }
-            // now recheck - if still not in view, the user used the mouse to scroll
-            if( (obj.offsetTop > linkwiz.result.scrollTop + linkwiz.result.clientHeight) ||
-                (obj.offsetTop < linkwiz.result.scrollTop) ){
-                obj.scrollIntoView();
-            }
-
-            linkwiz.selected = num;
-        }
-    },
-
-    /**
-     * deselect a result if any is selected
-     */
-    deselect: function(){
-        if(linkwiz.selected > -1){
-            var obj = linkwiz.getResult(linkwiz.selected);
-            if(obj){
-                obj.className = obj.className.replace(/ ?selected/,'');
-            }
-        }
-        linkwiz.selected = -1;
-    },
-
-    /**
-     * Handle clicks in the result set an dispatch them to
-     * resultClick()
-     */
-    onResultClick: function(e){
-        if(e.target.tagName != 'A') return;
-        e.stopPropagation();
-        e.preventDefault();
-        linkwiz.resultClick(e.target);
-        return false;
-    },
-
-    /**
-     * Handles the "click" on a given result anchor
-     */
-    resultClick: function(a){
-        var id = a.title;
-        if(id == '' || id.substr(id.length-1) == ':'){
-            linkwiz.entry.value = id;
-            linkwiz.autocomplete_exec();
-        }else{
-            linkwiz.entry.value = id;
-            if(a.nextSibling && a.nextSibling.tagName == 'SPAN'){
-                linkwiz.insertLink(a.nextSibling.innerHTML);
-            }else{
-                linkwiz.insertLink('');
-            }
-        }
-    },
-
-    /**
-     * Insert the id currently in the entry box to the textarea,
-     * replacing the current selection or at the curso postion.
-     * When no selection is available the given title will be used
-     * as link title instead
-     */
-    insertLink: function(title){
-        if(!linkwiz.entry.value) return;
-
-        var sel = getSelection(linkwiz.textArea);
-        if(sel.start == 0 && sel.end == 0) sel = linkwiz.selection;
-
-        var stxt = sel.getText();
-
-        // don't include trailing space in selection
-        if(stxt.charAt(stxt.length - 1) == ' '){
-            sel.end--;
-            stxt = sel.getText();
-        }
+                if(!stxt && !DOKU_UHC) stxt=title;
 
-        if(!stxt && !DOKU_UHC) stxt=title;
+                // prepend colon inside namespaces for non namespace pages
+                if(textArea.form['id'].value.indexOf(':') != -1 &&
+                   entry.value.indexOf(':') == -1){
+                    entry.value = ':'+entry.value;
+                }
 
-        // prepend colon inside namespaces for non namespace pages
-        if(linkwiz.textArea.form['id'].value.indexOf(':') != -1 &&
-           linkwiz.entry.value.indexOf(':') == -1){
-            linkwiz.entry.value = ':'+linkwiz.entry.value;
-        }
+                var link = '[['+entry.value+'|';
+                if(stxt) link += stxt;
+                link += ']]';
+
+                var so = entry.value.length+3;
+                var eo = 2;
+
+                pasteText(sel,link,{startofs: so, endofs: eo});
+                hide();
+                // reset the entry to the parent namespace and remove : at the beginning
+                entry.value = entry.value.replace(/(^:)?[^:]*$/, '');
+            };
+
+            /**
+             * Start the page/namespace lookup timer
+             *
+             * Calls autocomplete_exec when the timer runs out
+             */
+            var autocomplete = function(){
+                if(timer !== null){
+                    window.clearTimeout(timer);
+                    timer = null;
+                }
 
-        var link = '[['+linkwiz.entry.value+'|';
-        if(stxt) link += stxt;
-        link += ']]';
-
-        var so = linkwiz.entry.value.length+3;
-        var eo = 2;
-
-        pasteText(sel,link,{startofs: so, endofs: eo});
-        linkwiz.hide();
-        // reset the entry to the parent namespace and remove : at the beginning
-        linkwiz.entry.value = linkwiz.entry.value.replace(/(^:)?[^:]*$/, '');
-    },
-
-    /**
-     * Start the page/namespace lookup timer
-     *
-     * Calls autocomplete_exec when the timer runs out
-     */
-    autocomplete: function(){
-        if(linkwiz.timer !== null){
-            window.clearTimeout(linkwiz.timer);
-            linkwiz.timer = null;
-        }
+                timer = window.setTimeout(autocomplete_exec,350);
+            };
+
+            /**
+             * Executes the AJAX call for the page/namespace lookup
+             */
+            var autocomplete_exec = function(){
+                deselect();
+                result.innerHTML = '<img src="'+DOKU_BASE+'lib/images/throbber.gif" alt="" width="16" height="16" />';
+
+                // because we need to use POST, we
+                // can not use the .load() function.
+                $.post(
+                    DOKU_BASE + 'lib/exe/ajax.php',
+                    {
+                        call: 'linkwiz',
+                        q: entry.value
+                    },
+                    function (data) {
+                        result.innerHTML = data;
+                    },
+                    'html'
+                );
+            };
+
+            /**
+             * Clears the result area
+             */
+            var clear = function(){
+                result.innerHTML = 'Search for a matching page name above, or browse through the pages on the right';
+                entry.value = '';
+            };
+
+            /**
+             * Show the linkwizard
+             */
+            var show = function(){
+                selection  = getSelection(textArea);
+                wiz.style.marginLeft = '0px';
+                wiz.style.marginTop = '0px';
+                entry.focus();
+                autocomplete();
+            };
+
+            /**
+             * Hide the link wizard
+             */
+            var hide = function(){
+                wiz.style.marginLeft = '-10000px';
+                wiz.style.marginTop  = '-10000px';
+                textArea.focus();
+            };
+
+            /**
+             * Toggle the link wizard
+             */
+            var toggle = function(){
+                if(wiz.style.marginLeft == '-10000px'){
+                    show();
+                }else{
+                    hide();
+                }
+            };
 
-        linkwiz.timer = window.setTimeout(linkwiz.autocomplete_exec,350);
-    },
-
-    /**
-     * Executes the AJAX call for the page/namespace lookup
-     */
-    autocomplete_exec: function(){
-        linkwiz.deselect();
-        linkwiz.result.innerHTML = '<img src="'+DOKU_BASE+'lib/images/throbber.gif" alt="" width="16" height="16" />';
-        linkwiz.sack.runAJAX('call=linkwiz&q='+encodeURI(linkwiz.entry.value));
-    },
-
-    /**
-     * Clears the result area
-     */
-    clear: function(){
-        linkwiz.result.innerHTML = 'Search for a matching page name above, or browse through the pages on the right';
-        linkwiz.entry.value = '';
-    },
-
-    /**
-     * Show the linkwizard
-     */
-    show: function(){
-        linkwiz.selection  = getSelection(linkwiz.textArea);
-        linkwiz.wiz.style.marginLeft = '0px';
-        linkwiz.wiz.style.marginTop = '0px';
-        linkwiz.entry.focus();
-        linkwiz.autocomplete();
-    },
-
-    /**
-     * Hide the link wizard
-     */
-    hide: function(){
-        linkwiz.wiz.style.marginLeft = '-10000px';
-        linkwiz.wiz.style.marginTop  = '-10000px';
-        linkwiz.textArea.focus();
-    },
-
-    /**
-     * Toggle the link wizard
-     */
-    toggle: function(){
-        if(linkwiz.wiz.style.marginLeft == '-10000px'){
-            linkwiz.show();
-        }else{
-            linkwiz.hide();
-        }
-    }
-};
+            init($(editor)[0]);
 
+            return this.each(function() {
+                $(this).click(function (e) {
+                    e.preventDefault();
+                    toggle();
+                });
+            });
+        }
+    });
+})(jQuery);
diff --git a/lib/scripts/locktimer.js b/lib/scripts/locktimer.js
index 0db7d2b15..60508a8e7 100644
--- a/lib/scripts/locktimer.js
+++ b/lib/scripts/locktimer.js
@@ -1,13 +1,13 @@
 /**
- * Class managing the timer to display a warning on a expiring lock
- */
+* Class managing the timer to display a warning on a expiring lock
+*/
 var locktimer = {
-    sack:     null,
-    timeout:  0,
-    timerID:  null,
+    sack: null,
+    timeout: 0,
+    timerID: null,
     lasttime: null,
-    msg:      '',
-    pageid:   '',
+    msg: '',
+    pageid: '',
 
     init: function(timeout,msg,draft,edid){
         var edit = $(edid);
@@ -15,50 +15,50 @@ var locktimer = {
         if(edit.readOnly) return;
 
         // init values
-        locktimer.timeout  = timeout*1000;
-        locktimer.msg      = msg;
-        locktimer.draft    = draft;
-        locktimer.lasttime = new Date();
+        this.timeout = timeout*1000;
+        this.msg = msg;
+        this.draft = draft;
+        this.lasttime = new Date();
 
-        if(!$('dw__editform')) return;
-        locktimer.pageid = $('dw__editform').elements.id.value;
-        if(!locktimer.pageid) return;
+        if(jQuery('#dw__editform').length == 0) return;
+        this.pageid = jQuery('#dw__editform input[name=id]').val();
+        if(!this.pageid) return;
 
-        // init ajax component
-        locktimer.sack = new sack(DOKU_BASE + 'lib/exe/ajax.php');
-        locktimer.sack.AjaxFailedAlert = '';
-        locktimer.sack.encodeURIString = false;
-        locktimer.sack.onCompletion = locktimer.refreshed;
+        if(jQuery('#wiki__text').attr('readonly')) return;
 
         // register refresh event
-        addEvent($('dw__editform'),'keypress',function(){locktimer.refresh();});
+        jQuery('#dw__editform').keypress(
+            function() {
+                locktimer.refresh();
+            }
+        );
         // start timer
-        locktimer.reset();
+        this.reset();
     },
 
     /**
      * (Re)start the warning timer
      */
     reset: function(){
-        locktimer.clear();
-        locktimer.timerID = window.setTimeout("locktimer.warning()", locktimer.timeout);
+        this.clear();
+        this.timerID = window.setTimeout("locktimer.warning()", this.timeout);
     },
 
     /**
      * Display the warning about the expiring lock
      */
     warning: function(){
-        locktimer.clear();
-        alert(locktimer.msg);
+        this.clear();
+        alert(this.msg);
     },
 
     /**
      * Remove the current warning timer
      */
     clear: function(){
-        if(locktimer.timerID !== null){
-            window.clearTimeout(locktimer.timerID);
-            locktimer.timerID = null;
+        if(this.timerID !== null){
+            window.clearTimeout(this.timerID);
+            this.timerID = null;
         }
     },
 
@@ -69,34 +69,42 @@ var locktimer = {
      */
     refresh: function(){
         var now = new Date();
+        var params = {};
         // refresh every minute only
-        if(now.getTime() - locktimer.lasttime.getTime() > 30*1000){
-            var params = 'call=lock&id='+encodeURIComponent(locktimer.pageid);
-            var dwform = $('dw__editform');
-            if(locktimer.draft && dwform.elements.wikitext){
-                params += '&prefix='+encodeURIComponent(dwform.elements.prefix.value);
-                params += '&wikitext='+encodeURIComponent(dwform.elements.wikitext.value);
-                params += '&suffix='+encodeURIComponent(dwform.elements.suffix.value);
-                if(dwform.elements.date){
-                    params += '&date='+encodeURIComponent(dwform.elements.date.value);
+        if(now.getTime() - this.lasttime.getTime() > 30*1000){
+            params['call'] = 'lock';
+            params['id'] = locktimer.pageid;
+
+            if(locktimer.draft && jQuery('#dw__editform textarea[name=wikitext]').length > 0){
+                params['prefix'] = jQuery('#dw__editform input[name=prefix]').val();
+                params['wikitext'] = jQuery('#dw__editform textarea[name=wikitext]').val();
+                params['suffix'] = jQuery('#dw__editform input[name=suffix]').val();
+                if(jQuery('#dw__editform input[name=date]').length > 0) {
+                    params['date'] = jQuery('#dw__editform input[name=id]').val();
                 }
             }
-            locktimer.sack.runAJAX(params);
-            locktimer.lasttime = now;
+
+            jQuery.post(
+                DOKU_BASE + 'lib/exe/ajax.php',
+                params,
+                function (data) {
+                    locktimer.refreshed(data);
+                },
+                'html'
+            );
+            this.lasttime = now;
         }
     },
 
     /**
      * Callback. Resets the warning timer
      */
-    refreshed: function(){
-        var data  = this.response;
+    refreshed: function(data){
         var error = data.charAt(0);
-            data  = data.substring(1);
+        data = data.substring(1);
 
-        $('draft__status').innerHTML=data;
+        jQuery('#draft__status').html(data);
         if(error != '1') return; // locking failed
-        locktimer.reset();
+        this.reset();
     }
 };
-
diff --git a/lib/scripts/media.js b/lib/scripts/media.js
index 57f599163..cf4a839d9 100644
--- a/lib/scripts/media.js
+++ b/lib/scripts/media.js
@@ -1,372 +1,59 @@
+/*jslint white: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: false, strict: true, newcap: true, immed: true */
+/*global jQuery, window, DOKU_BASE*/
+"use strict";
+
+// * refactor once the jQuery port is over ;)
+
 /**
  * JavaScript functionality for the media management popup
  *
  * @author Andreas Gohr <andi@splitbrain.org>
+ * @author Pierre Spring <pierre.spring@caillou.ch>
  */
-var media_manager = {
-    keepopen: false,
-    hide: false,
-    align: false,
-    popup: false,
-    id: false,
-    display: false,
-    link: false,
-    size: false,
-    ext: false,
-
-    /**
-     * Attach event handlers to all "folders" below the given element
-     *
-     * @author Andreas Gohr <andi@splitbrain.org>
-     */
-    treeattach: function(obj){
-        if(!obj) return;
-
-        var items = obj.getElementsByTagName('li');
-        for(var i=0; i<items.length; i++){
-            var elem = items[i];
-
-            // attach action to make the +/- clickable
-            var clicky = elem.getElementsByTagName('img')[0];
-            clicky.style.cursor = 'pointer';
-            addEvent(clicky,'click',function(event){ return media_manager.toggle(event,this); });
-
-            // attach action load folder list via AJAX
-            var link = elem.getElementsByTagName('a')[0];
-            link.style.cursor = 'pointer';
-            addEvent(link,'click',function(event){ return media_manager.list(event,this); });
-        }
-    },
-
-    /**
-     * Attach the image selector action to all links below the given element
-     * also add the action to autofill the "upload as" field
-     *
-     * @author Andreas Gohr <andi@splitbrain.org>
-     */
-    selectorattach: function(obj){
-        if(!obj) return;
-
-        var items = getElementsByClass('select',obj,'a');
-        for(var i=0; i<items.length; i++){
-            var elem = items[i];
-            elem.style.cursor = 'pointer';
-            addEvent(elem,'click',function(event){ return media_manager.select(event,this); });
-        }
-
-        // hide syntax example
-        items = getElementsByClass('example',obj,'div');
-        for(var i=0; i<items.length; i++){
-            elem = items[i];
-            elem.style.display = 'none';
-        }
-
-        var file = $('upload__file');
-        if(!file) return;
-        addEvent(file,'change',media_manager.suggest);
-    },
-
-    /**
-     * Attach deletion confirmation dialog to the delete buttons.
-     *
-     * Michael Klier <chi@chimeric.de>
-     */
-    confirmattach: function(obj){
-        if(!obj) return;
-
-        items = getElementsByClass('btn_media_delete',obj,'a');
-        for(var i=0; i<items.length; i++){
-            var elem = items[i];
-            addEvent(elem,'click',function(e){
-                if(e.target.tagName == 'IMG'){
-                    var name = e.target.parentNode.title;
-                }else{
-                    var name = e.target.title;
-                }
-                if(!confirm(LANG['del_confirm'] + "\n" + name)) {
-                    e.preventDefault();
-                    return false;
-                } else {
-                    return true;
-                }
-            });
-        }
-    },
-
-    /**
-     * Creates checkboxes for additional options
-     *
-     * @author Andreas Gohr <andi@splitbrain.org>
-     */
-    attachoptions: function(obj){
-        if(!obj) return;
-
-        // keep open
-        if(opener){
-            var kobox  = document.createElement('input');
-            kobox.type = 'checkbox';
-            kobox.id   = 'media__keepopen';
-            if(DokuCookie.getValue('keepopen')){
-                kobox.checked  = true;
-                kobox.defaultChecked = true; //IE wants this
-                media_manager.keepopen = true;
-            }
-            addEvent(kobox,'click',function(event){ return media_manager.togglekeepopen(event,this); });
-
-            var kolbl  = document.createElement('label');
-            kolbl.htmlFor   = 'media__keepopen';
-            kolbl.innerHTML = LANG['keepopen'];
-
-            var kobr = document.createElement('br');
-
-            obj.appendChild(kobox);
-            obj.appendChild(kolbl);
-            obj.appendChild(kobr);
-        }
-
-        // hide details
-        var hdbox  = document.createElement('input');
-        hdbox.type = 'checkbox';
-        hdbox.id   = 'media__hide';
-        if(DokuCookie.getValue('hide')){
-            hdbox.checked = true;
-            hdbox.defaultChecked = true; //IE wants this
-            media_manager.hide    = true;
-        }
-        addEvent(hdbox,'click',function(event){ return media_manager.togglehide(event,this); });
-
-        var hdlbl  = document.createElement('label');
-        hdlbl.htmlFor   = 'media__hide';
-        hdlbl.innerHTML = LANG['hidedetails'];
-
-        var hdbr = document.createElement('br');
-
-        obj.appendChild(hdbox);
-        obj.appendChild(hdlbl);
-        obj.appendChild(hdbr);
-        media_manager.updatehide();
-    },
-
-    /**
-     * Toggles the keep open state
-     *
-     * @author Andreas Gohr <andi@splitbrain.org>
-     */
-    togglekeepopen: function(event,cb){
-        if(cb.checked){
-            DokuCookie.setValue('keepopen',1);
-            media_manager.keepopen = true;
-        }else{
-            DokuCookie.setValue('keepopen','');
-            media_manager.keepopen = false;
-        }
-    },
+(function ($) {
+    var toggle, list, prepare_content, insert, confirmattach, attachoptions, initpopup, updatehide, setalign, setsize, inSet, outSet, media_manager, hasFlash;
 
-    /**
-     * Toggles the hide details state
-     *
-     * @author Andreas Gohr <andi@splitbrain.org>
-     */
-    togglehide: function(event,cb){
-        if(cb.checked){
-            DokuCookie.setValue('hide',1);
-            media_manager.hide = true;
-        }else{
-            DokuCookie.setValue('hide','');
-            media_manager.hide = false;
-        }
-        media_manager.updatehide();
-    },
+    var media_manager = {
+        keepopen: false,
+        hide: false,
+        align: false,
+        popup: false,
+        display: false,
+        link: false,
+        size: false,
+        ext: false,
+    };
 
-    /**
-     * Sets the visibility of the image details accordingly to the
-     * chosen hide state
-     *
-     * @author Andreas Gohr <andi@splitbrain.org>
-     */
-    updatehide: function(){
-        var obj = $('media__content');
-        if(!obj) return;
-        var details = getElementsByClass('detail',obj,'div');
-        for(var i=0; i<details.length; i++){
-            if(media_manager.hide){
-                details[i].style.display = 'none';
-            }else{
-                details[i].style.display = '';
-            }
-        }
-    },
 
-    /**
-     * shows the popup for a image link
-     */
-    select: function(event,link){
-        var id = link.name.substr(2);
-
-        media_manager.id = id;
-        if(!opener){
-            // if we don't run in popup display example
-            var ex = $('ex'+id.replace(/:/g,'_'));
-            if(ex.style.display == ''){
-                ex.style.display = 'none';
-            } else {
-                ex.style.display = '';
-            }
-            return false;
-        }
-
-        media_manager.ext = false;
-        var dot = id.lastIndexOf(".");
-        if (dot != -1) {
-            var ext = id.substr(dot,id.length);
-
-            if (ext != '.jpg' && ext != '.jpeg' && ext != '.png' && ext != '.gif' && ext != '.swf') {
-                media_manager.insert(null);
-                return false;
-            }
-        } else {
-            media_manager.insert(null);
-            return false;
-        }
 
-        media_manager.popup.style.display = 'inline';
-        media_manager.popup.style.left = event.pageX + 'px';
-        media_manager.popup.style.top = event.pageY + 'px';
-
-        // set all buttons to outset
-        for (var i = 1; i < 5; i++) {
-            media_manager.outSet('media__linkbtn' + i);
-            media_manager.outSet('media__alignbtn' + i);
-            media_manager.outSet('media__sizebtn' + i);
-        }
-
-        if (ext == '.swf') {
-            media_manager.ext = 'swf';
-
-            // disable display buttons for detail and linked image
-            $('media__linkbtn1').style.display = 'none';
-            $('media__linkbtn2').style.display = 'none';
-
-            // set the link button to default
-            if (media_manager.link !== false) {
-                if ( media_manager.link == '2' || media_manager.link == '1')  {
-                    media_manager.inSet('media__linkbtn3');
-                    media_manager.link = '3';
-                    DokuCookie.setValue('link','3');
-                } else {
-                    media_manager.inSet('media__linkbtn'+media_manager.link);
-                }
-            } else if (DokuCookie.getValue('link')) {
-                if ( DokuCookie.getValue('link') == '2' ||  DokuCookie.getValue('link') == '1')  {
-                    // this options are not availible
-                    media_manager.inSet('media__linkbtn3');
-                    media_manager.link = '3';
-                    DokuCookie.setValue('link','3');
-                } else {
-                    media_manager.inSet('media__linkbtn'+DokuCookie.getValue('link'));
-                    media_manager.link = DokuCookie.getValue('link');
-                }
-            } else {
-                // default case
-                media_manager.link = '3';
-                media_manager.inSet('media__linkbtn3');
-                DokuCookie.setValue('link','3');
-            }
-
-            // disable button for original size
-            $('media__sizebtn4').style.display = 'none';
-            if (media_manager.size == 4) {
-                media_manager.size = 2;
-                DokuCookie.setValue('size', '2');
-                media_manager.inSet('media__sizebtn2');
-            }
-
-        } else {
-            media_manager.ext = 'img';
-
-            // ensure that the display buttons are there
-            $('media__linkbtn1').style.display = 'inline';
-            $('media__linkbtn2').style.display = 'inline';
-            $('media__sizebtn4').style.display = 'inline';
-
-            // set the link button to default
-            if (DokuCookie.getValue('link')) {
-                media_manager.link = DokuCookie.getValue('link');
-            }
-            if (!media_manager.link) {
-                // default case
-                media_manager.link = '1';
-                DokuCookie.setValue('link','1');
-            }
-            media_manager.inSet('media__linkbtn'+media_manager.link);
-        }
-
-        if (media_manager.link == '4') {
-            media_manager.align = false;
-            media_manager.size = false;
-            $('media__align').style.display = 'none';
-            $('media__size').style.display = 'none';
-        } else {
-            $('media__align').style.display = 'block';
-            $('media__size').style.display = 'block';
-
-            // set the align button to default
-            if (media_manager.align !== false) {
-                media_manager.inSet('media__alignbtn'+media_manager.align);
-            } else if (DokuCookie.getValue('align')) {
-                media_manager.inSet('media__alignbtn'+DokuCookie.getValue('align'));
-                media_manager.align = DokuCookie.getValue('align');
-            } else {
-                // default case
-                media_manager.align = '1';
-                media_manager.inSet('media__alignbtn1');
-                DokuCookie.setValue('align','1');
-            }
-
-            // set the size button to default
-            if (DokuCookie.getValue('size')) {
-                media_manager.size = DokuCookie.getValue('size');
-            }
-            if (!media_manager.size || (media_manager.size === '4' && ext === '.swf')) {
-                // default case
-                media_manager.size = '2';
-                DokuCookie.setValue('size','2');
-            }
-            media_manager.inSet('media__sizebtn'+media_manager.size);
-
-            $('media__sendbtn').focus();
-        }
-
-       return false;
-    },
 
     /**
      * build the popup window
      *
      * @author Dominik Eckelmann <eckelmann@cosmocode.de>
      */
-    initpopup: function() {
+    initpopup = function() {
+        var popup;
 
-        media_manager.popup = document.createElement('div');
-        media_manager.popup.setAttribute('id','media__popup');
-        media_manager.popup.style.display = 'none';
+        popup = document.createElement('div');
+        popup.setAttribute('id','media__popup');
+        popup.style.display = "none";
 
         var root = document.getElementById('media__manager');
         if (root === null) return;
-        root.appendChild(media_manager.popup);
+        root.appendChild(popup);
 
         var headline    = document.createElement('h1');
         headline.innerHTML = LANG.mediatitle;
         var headlineimg = document.createElement('img');
         headlineimg.src = DOKU_BASE + 'lib/images/close.png';
         headlineimg.id  = 'media__closeimg';
-        addEvent(headlineimg,'click',function(event){ return media_manager.closePopup(event,this); });
+        $(headlineimg).click(function () {$(popup).hide()});
         headline.insertBefore(headlineimg, headline.firstChild);
-        media_manager.popup.appendChild(headline);
-        drag.attach(media_manager.popup,headline);
+        popup.appendChild(headline);
+        $(popup).draggable({handle: headline});
 
         // link
-
         var linkp = document.createElement('p');
 
         linkp.id = "media__linkstyle";
@@ -385,7 +72,7 @@ var media_manager = {
             linkbtn.id    = "media__linkbtn" + (i+1);
             linkbtn.title = LANG['media' + linkbtns[i]];
             linkbtn.style.borderStyle = 'outset';
-            addEvent(linkbtn,'click',function(event){ return media_manager.setlink(event,this); });
+            $(linkbtn).click(function (event) { return setlink(event,this); });
 
             var linkimg = document.createElement('img');
             linkimg.src = DOKU_BASE + 'lib/images/media_link_' + linkbtns[i] + '.png';
@@ -394,7 +81,7 @@ var media_manager = {
             linkp.appendChild(linkbtn);
         }
 
-        media_manager.popup.appendChild(linkp);
+        popup.appendChild(linkp);
 
         // align
 
@@ -419,12 +106,12 @@ var media_manager = {
             alignbtn.className = 'button';
             alignbtn.appendChild(alignimg);
             alignbtn.style.borderStyle = 'outset';
-            addEvent(alignbtn,'click',function(event){ return media_manager.setalign(event,this); });
+            $(alignbtn).click(function (event) { return setalign(event,this); });
 
             alignp.appendChild(alignbtn);
         }
 
-        media_manager.popup.appendChild(alignp);
+        popup.appendChild(alignp);
 
         // size
 
@@ -451,15 +138,15 @@ var media_manager = {
             sizebtn.id    = 'media__sizebtn' + (size + 1);
             sizebtn.title = LANG['media' + sizebtns[size]];
             sizebtn.style.borderStyle = 'outset';
-            addEvent(sizebtn,'click',function(event){ return media_manager.setsize(event,this); });
+            $(sizebtn).click(function (event) { return setsize(event,this); });
         }
 
-        media_manager.popup.appendChild(sizep);
+        popup.appendChild(sizep);
 
         // send and close button
 
         var btnp = document.createElement('p');
-        media_manager.popup.appendChild(btnp);
+        popup.appendChild(btnp);
         btnp.setAttribute('class','btnlbl');
 
         var btn  = document.createElement('input');
@@ -468,24 +155,45 @@ var media_manager = {
         btn.setAttribute('class','button');
         btn.value = LANG['mediainsert'];
         btnp.appendChild(btn);
-        addEvent(btn,'click',function(event){ return media_manager.insert(event); });
-    },
+    };
+
+    // moved from helpers.js temporarily here
+    /**
+     * Very simplistic Flash plugin check, probably works for Flash 8 and higher only
+     *
+     */
+    hasFlash = function(version){
+        var ver = 0;
+        try{
+            if(navigator.plugins != null && navigator.plugins.length > 0){
+               ver = navigator.plugins["Shockwave Flash"].description.split(' ')[2].split('.')[0];
+            }else{
+               var axo = new ActiveXObject("ShockwaveFlash.ShockwaveFlash");
+               ver = axo.GetVariable("$version").split(' ')[1].split(',')[0];
+            }
+        }catch(e){ }
+
+        if(ver >= version) return true;
+        return false;
+    };
 
     /**
      * Insert the clicked image into the opener's textarea
      *
      * @author Andreas Gohr <andi@splitbrain.org>
      * @author Dominik Eckelmann <eckelmann@cosmocode.de>
+     * @author Pierre Spring <pierre.spring@caillou.ch>
      */
-    insert: function(event){
-        var id = media_manager.id;
+    insert = function (id) {
+        var opts, optsstart, alignleft, alignright;
+
         // set syntax options
-        $('media__popup').style.display = 'none';
+        $('#media__popup').hide();
 
-        var opts       = '';
-        var optsstart  = '';
-        var alignleft  = '';
-        var alignright = '';
+        opts = '';
+        optsstart = '';
+        alignleft = '';
+        alignright = '';
 
         if (media_manager.ext == 'img' || media_manager.ext == 'swf') {
 
@@ -543,237 +251,501 @@ var media_manager = {
         if(!media_manager.keepopen) window.close();
         opener.focus();
         return false;
-    },
+    };
 
     /**
-     * list the content of a namespace using AJAX
+     * Prefills the wikiname.
      *
      * @author Andreas Gohr <andi@splitbrain.org>
      */
-    list: function(event,link){
-        // prepare an AJAX call to fetch the subtree
-        var ajax = new sack(DOKU_BASE + 'lib/exe/ajax.php');
-        ajax.AjaxFailedAlert = '';
-        ajax.encodeURIString = false;
-        if(ajax.failed) return true;
-
-        cleanMsgArea();
+    suggest = function(){
+        var file, name, text;
 
-        var content = $('media__content');
-        content.innerHTML = '<img src="'+DOKU_BASE+'lib/images/loading.gif" alt="..." class="load" />';
-
-        ajax.elementObj = content;
-        ajax.afterCompletion = function(){
-            media_manager.selectorattach(content);
-            media_manager.confirmattach(content);
-            media_manager.updatehide();
-            media_manager.initFlashUpload();
-        };
-        ajax.runAJAX(link.search.substr(1)+'&call=medialist');
-        return false;
-    },
+        file = $(this);
+        name = $('#upload__name');
+        if(!file.size() || !name.size()) return;
 
+        text = file.val();
+        text = text.substr(text.lastIndexOf('/')+1);
+        text = text.substr(text.lastIndexOf('\\')+1);
+        name.val(text);
+    };
 
     /**
      * Open or close a subtree using AJAX
      *
      * @author Andreas Gohr <andi@splitbrain.org>
+     * @author Pierre Spring <pierre.spring@caillou.ch>
      */
-    toggle: function(event,clicky){
-        var listitem = clicky.parentNode;
+    toggle = function (event) {
+        var clicky, listitem, sublist, link, ul;
+
+        event.preventDefault(); // TODO: really here?
+
+        var clicky = $(this);
+        var listitem = clicky.parent();
 
         // if already open, close by removing the sublist
-        var sublists = listitem.getElementsByTagName('ul');
-        if(sublists.length){
-            listitem.removeChild(sublists[0]);
-            clicky.src = DOKU_BASE+'lib/images/plus.gif';
-            return false;
+        sublist = listitem.find('ul').first();
+        if(sublist.size()){
+            sublist.remove(); // TODO: really? we could just hide it, right?
+            clicky.attr('src', DOKU_BASE + 'lib/images/plus.gif');
+            return;
         }
 
         // get the enclosed link (is always the first one)
-        var link = listitem.getElementsByTagName('a')[0];
-
-        // prepare an AJAX call to fetch the subtree
-        var ajax = new sack(DOKU_BASE + 'lib/exe/ajax.php');
-        ajax.AjaxFailedAlert = '';
-        ajax.encodeURIString = false;
-        if(ajax.failed) return true;
+        link = listitem.find('a').first();
 
         //prepare the new ul
-        var ul = document.createElement('ul');
+        ul = $('<ul/>');
+
         //fixme add classname here
-        listitem.appendChild(ul);
-        ajax.elementObj = ul;
-        ajax.afterCompletion = function(){ media_manager.treeattach(ul); };
-        ajax.runAJAX(link.search.substr(1)+'&call=medians');
-        clicky.src = DOKU_BASE+'lib/images/minus.gif';
-        return false;
-    },
+
+        $.post(
+            DOKU_BASE + 'lib/exe/ajax.php',
+            link.attr('search').substr(1) + '&call=medians',
+            function (data) {
+                ul.html(data);
+                listitem.append(ul);
+            },
+            'html'
+        );
+
+        clicky.attr('src', DOKU_BASE + 'lib/images/minus.gif');
+    };
 
     /**
-     * Prefills the wikiname.
+     * list the content of a namespace using AJAX
      *
      * @author Andreas Gohr <andi@splitbrain.org>
+     * @author Pierre Spring <pierre.spring@caillou.ch>
      */
-    suggest: function(){
-        var file = $('upload__file');
-        var name = $('upload__name');
-        if(!file || !name) return;
+    list = function (event) {
+        var link, content;
+        link = $(this);
 
-        var text = file.value;
-        text = text.substr(text.lastIndexOf('/')+1);
-        text = text.substr(text.lastIndexOf('\\')+1);
-        name.value = text;
-    },
+        event.preventDefault();
+
+        cleanMsgArea();
+        content = $('#media__content');
+        content.html('<img src="' + DOKU_BASE + 'lib/images/loading.gif" alt="..." class="load" />');
+
+        // fetch the subtree
+        $.post(
+            DOKU_BASE + 'lib/exe/ajax.php',
+            link.attr('search').substr(1)+'&call=medialist',
+            function (data) {
+                content.html(data);
+                prepare_content(content);
+                updatehide();
+            },
+            'html'
+        );
+
+    };
+
+    prepare_content = function (content) {
+        // hide syntax example
+        content.find('div.example:visible').hide();
+        initFlashUpload();
+    };
+
+    /**
+         * shows the popup for a image link
+         */
+        select = function(event){
+            var link, id, dot, ext;
+
+            event.preventDefault();
+
+            link = $(this);
+            id = link.attr('name').substr(2);
+
+            if(!opener){
+                // if we don't run in popup display example
+                // the id's are a bit wired and $('#ex_wiki_dokuwiki-128.png') will not be found
+                // by Sizzle (the CSS Selector Engine used by jQuery),
+                // hence the document.getElementById() call
+                $(document.getElementById('ex_'+id.replace(/:/g,'_').replace(/^_/,''))).toggle();
+                return;
+            }
+
+            link = link[0];
+
+            media_manager.ext = false;
+            dot = id.lastIndexOf(".");
+
+            if (-1 === dot) {
+                insert(id);
+                return;
+            }
+
+            ext = id.substr(dot);
+
+            if (ext != '.jpg' && ext != '.jpeg' && ext != '.png' && ext != '.gif' && ext != '.swf') {
+                insert(id);
+                return;
+            }
+
+            // remove old callback from the insert button and set the new one.
+            $('#media__sendbtn').unbind().click(function () {insert(id)});
+
+            $('#media__popup').show()
+                .css('left', event.pageX + 'px')
+                .css('top', event.pageY + 'px');
+
+            $('#media__popup button.button').each(function (index, element) { outSet(element) } );
+
+
+            if (ext == '.swf') {
+                media_manager.ext = 'swf';
+
+                // disable display buttons for detail and linked image
+                $('#media__linkbtn1').hide();
+                $('#media__linkbtn2').hide();
+
+                // set the link button to default
+                if (media_manager.link != false) {
+                    if ( media_manager.link == '2' || media_manager.link == '1')  {
+                        inSet('media__linkbtn3');
+                        media_manager.link = '3';
+                        DokuCookie.setValue('link','3');
+                    } else {
+                        inSet('media__linkbtn'+media_manager.link);
+                    }
+                } else if (DokuCookie.getValue('link')) {
+                    if ( DokuCookie.getValue('link') == '2' ||  DokuCookie.getValue('link') == '1')  {
+                        // this options are not availible
+                        inSet('media__linkbtn3');
+                        media_manager.link = '3';
+                        DokuCookie.setValue('link','3');
+                    } else {
+                        inSet('media__linkbtn'+DokuCookie.getValue('link'));
+                        media_manager.link = DokuCookie.getValue('link');
+                    }
+                } else {
+                    // default case
+                    media_manager.link = '3';
+                    inSet('media__linkbtn3');
+                    DokuCookie.setValue('link','3');
+                }
+
+                // disable button for original size
+                $('#media__sizebtn4').hide();
+
+            } else {
+                media_manager.ext = 'img';
+
+                // ensure that the display buttons are there
+                $('#media__linkbtn1').show();
+                $('#media__linkbtn2').show();
+                $('#media__sizebtn4').show();
+
+                // set the link button to default
+                if (DokuCookie.getValue('link')) {
+                    media_manager.link = DokuCookie.getValue('link');
+                }
+                if (media_manager.link == false) {
+                    // default case
+                    media_manager.link = '1';
+                    DokuCookie.setValue('link','1');
+                }
+                inSet('media__linkbtn'+media_manager.link);
+            }
+
+            if (media_manager.link == '4') {
+                media_manager.align = false;
+                media_manager.size = false;
+                $('#media__align').hide();
+                $('#media__size').hide();
+            } else {
+                $('#media__align').show();
+                $('#media__size').show();
+
+                // set the align button to default
+                if (media_manager.align != false) {
+                    inSet('media__alignbtn'+media_manager.align);
+                } else if (DokuCookie.getValue('align')) {
+                    inSet('media__alignbtn'+DokuCookie.getValue('align'));
+                    media_manager.align = DokuCookie.getValue('align');
+                } else {
+                    // default case
+                    media_manager.align = '0';
+                    inSet('media__alignbtn0');
+                    DokuCookie.setValue('align','0');
+                }
+
+                // set the size button to default
+                if (DokuCookie.getValue('size')) {
+                    media_manager.size = DokuCookie.getValue('size');
+                }
+                if (media_manager.size == false || (media_manager.size === '4' && ext === '.swf')) {
+                    // default case
+                    media_manager.size = '2';
+                    DokuCookie.setValue('size','2');
+                }
+                inSet('media__sizebtn'+media_manager.size);
+
+                $('#media__sendbtn').focus();
+            }
+
+           return;
+        };
+
+    /**
+     * Deletion confirmation dialog to the delete buttons.
+     *
+     * @author Michael Klier <chi@chimeric.de>
+     * @author Pierre Spring <pierre.spring@caillou.ch>
+     */
+    confirmattach = function(e){
+        if(!confirm(LANG['del_confirm'] + "\n" + jQuery(this).attr('title'))) {
+            e.preventDefault();
+        }
+    };
+
+    /**
+     * Creates checkboxes for additional options
+     *
+     * @author Andreas Gohr <andi@splitbrain.org>
+     * @author Pierre Spring <pierre.spring@caillou.ch>
+     */
+    attachoptions = function(){
+        obj = $('#media__opts')[0];
+        if(!obj) return;
+
+        // keep open
+        if(opener){
+            var kobox  = document.createElement('input');
+            kobox.type = 'checkbox';
+            kobox.id   = 'media__keepopen';
+            if(DokuCookie.getValue('keepopen')){
+                kobox.checked  = true;
+                kobox.defaultChecked = true; //IE wants this
+                media_manager.keepopen = true;
+            }
+
+            $(kobox).click(
+                function () {
+                    toggleOption(this, 'keepopen');
+                }
+            );
 
+            var kolbl  = document.createElement('label');
+            kolbl.htmlFor   = 'media__keepopen';
+            kolbl.innerHTML = LANG['keepopen'];
+
+            var kobr = document.createElement('br');
+
+            obj.appendChild(kobox);
+            obj.appendChild(kolbl);
+            obj.appendChild(kobr);
+        }
 
-    initFlashUpload: function(){
+        // hide details
+        var hdbox  = document.createElement('input');
+        hdbox.type = 'checkbox';
+        hdbox.id   = 'media__hide';
+        if(DokuCookie.getValue('hide')){
+            hdbox.checked = true;
+            hdbox.defaultChecked = true; //IE wants this
+            media_manager.hide    = true;
+        }
+        $(hdbox).click(
+            function () {
+                toggleOption(this, 'hide');
+                updatehide();
+            }
+        );
+
+        var hdlbl  = document.createElement('label');
+        hdlbl.htmlFor   = 'media__hide';
+        hdlbl.innerHTML = LANG['hidedetails'];
+
+        var hdbr = document.createElement('br');
+
+        obj.appendChild(hdbox);
+        obj.appendChild(hdlbl);
+        obj.appendChild(hdbr);
+        updatehide();
+    };
+
+    /**
+     * Generalized toggler
+     *
+     * @author Pierre Spring <pierre.spring@caillou.ch>
+     */
+    toggleOption = function (checkbox, variable) {
+        if (checkbox.checked) {
+            DokuCookie.setValue(variable, 1);
+            media_manager[variable] = true;
+        } else {
+            DokuCookie.setValue(variable, '');
+            media_manager[variable] = false;
+        }
+    };
+
+    initFlashUpload = function () {
+        var oform, oflash, title;
         if(!hasFlash(8)) return;
-        var oform  = $('dw__upload');
-        var oflash = $('dw__flashupload');
-        if(!oform || !oflash) return;
-
-        var clicky = document.createElement('img');
-        clicky.src     = DOKU_BASE+'lib/images/multiupload.png';
-        clicky.title   = LANG['mu_btn'];
-        clicky.alt     = LANG['mu_btn'];
-        clicky.style.cursor = 'pointer';
-        clicky.onclick = function(){
-                            oform.style.display  = 'none';
-                            oflash.style.display = '';
-                         };
-        oform.appendChild(clicky);
-    },
+
+        oform  = $('#dw__upload');
+        oflash = $('#dw__flashupload');
+
+        if(!oform.size() || !oflash.size()) return;
+
+        title = LANG['mu_btn'];
+
+        $('<img/>').attr('src', DOKU_BASE+'lib/images/multiupload.png')
+            .attr('title', title)
+            .attr('alt', title)
+            .css('cursor', 'pointer')
+            .click(
+                function () {
+                    oform.hide();
+                    oflash.show();
+                }
+            )
+            .appendTo(oform);
+    };
 
     /**
-     * closes the link type popup
+     * Sets the visibility of the image details accordingly to the
+     * chosen hide state
+     *
+     * @author Andreas Gohr <andi@splitbrain.org>
      */
-    closePopup: function(event) {
-        $('media__popup').style.display = 'none';
-    },
+    updatehide = function(){
+        var content = $('#media__content');
+        if(0 === content.size()) {
+            return;
+        }
+        content.find('div.detail').each(
+            function (index, element) {
+                if(media_manager.hide){
+                    element.style.display = 'none';
+                }else{
+                    element.style.display = '';
+                }
+            }
+
+        );
+    };
 
     /**
      * set the align
      *
      * @author Dominik Eckelmann <eckelmann@cosmocode.de>
      */
-    setalign: function(event,cb){
+    setalign = function(event,cb){
 
         var id = cb.id.substring(cb.id.length -1);
         if(id){
             DokuCookie.setValue('align',id);
             media_manager.align = id;
             for (var i = 1; i<=4; i++) {
-                media_manager.outSet("media__alignbtn" + i);
+                outSet("media__alignbtn" + i);
             }
-            media_manager.inSet("media__alignbtn"+id);
+            inSet("media__alignbtn"+id);
         }else{
             DokuCookie.setValue('align','');
             media_manager.align = false;
         }
-    },
+    };
+
     /**
      * set the link type
      *
      * @author Dominik Eckelmann <eckelmann@cosmocode.de>
      */
-    setlink: function(event,cb){
+    setlink = function(event,cb){
         var id = cb.id.substring(cb.id.length -1);
         if(id){
             DokuCookie.setValue('link',id);
             for (var i = 1; i<=4; i++) {
-                media_manager.outSet("media__linkbtn"+i);
+                outSet("media__linkbtn"+i);
             }
-            media_manager.inSet("media__linkbtn"+id);
+            inSet("media__linkbtn"+id);
 
-            var size = document.getElementById("media__size");
-            var align = document.getElementById("media__align");
+            var size = $("#media__size");
+            var align = $("#media__align");
             if (id != '4') {
-                size.style.display  = "block";
-                align.style.display = "block";
+                size.show();
+                align.show();
                 if (media_manager.link == '4') {
                     media_manager.align = '1';
                     DokuCookie.setValue('align', '1');
-                    media_manager.inSet('media__alignbtn1');
+                    inSet('media__alignbtn1');
 
                     media_manager.size = '2';
                     DokuCookie.setValue('size', '2');
-                    media_manager.inSet('media__sizebtn2');
+                    inSet('media__sizebtn2');
                 }
 
             } else {
-                size.style.display  = "none";
-                align.style.display = "none";
+                size.hide();
+                align.hide();
             }
             media_manager.link = id;
         }else{
             DokuCookie.setValue('link','');
             media_manager.link = false;
         }
-    },
-
-    /**
-     * set the display type
-     *
-     * @author Dominik Eckelmann <eckelmann@cosmocode.de>
-     */
-    setdisplay: function(event,cb){
-        if(cb.value){
-            DokuCookie.setValue('display',cb.value);
-            media_manager.display = cb.value;
-            media_manager.outSet("media__displaybtn1");
-            media_manager.outSet("media__displaybtn2");
-            media_manager.inSet("media__displaybtn"+cb.value);
-
-        }else{
-            DokuCookie.setValue('display','');
-            media_manager.align = false;
-        }
-    },
-
-    /**
-     * sets the border to outset
-     */
-    outSet: function(id) {
-        var ele = document.getElementById(id);
-        if (ele == null) return;
-        ele.style.borderStyle = "outset";
-    },
-    /**
-     * sets the border to inset
-     */
-    inSet: function(id) {
-        var ele = document.getElementById(id);
-        if (ele == null) return;
-        ele.style.borderStyle = "inset";
-    },
+    };
 
     /**
      * set the image size
      *
      * @author Dominik Eckelmann <eckelmann@cosmocode.de>
      */
-    setsize: function(event,cb){
+    setsize = function(event,cb){
         var id = cb.id.substring(cb.id.length -1);
         if (id) {
             DokuCookie.setValue('size',id);
             media_manager.size = id;
             for (var i = 1 ; i <=4 ; ++i) {
-                media_manager.outSet("media__sizebtn" + i);
+                outSet("media__sizebtn" + i);
             }
-            media_manager.inSet("media__sizebtn"+id);
+            inSet("media__sizebtn"+id);
         } else {
             DokuCookie.setValue('size','');
             media_manager.width = false;
         }
-    }
-};
-
-addInitEvent(function(){
-    media_manager.treeattach($('media__tree'));
-    media_manager.selectorattach($('media__content'));
-    media_manager.confirmattach($('media__content'));
-    media_manager.attachoptions($('media__opts'));
-    media_manager.initpopup();
-    media_manager.initFlashUpload();
-});
+    };
+
+    /**
+     * sets the border to inset
+     */
+    inSet = function(id) {
+        var ele = $('#' + id).css('border-style', 'inset');
+    };
+
+    /**
+     * sets the border to outset
+     */
+    outSet = function(element) {
+        if ('string' === typeof element) {
+            element = '#' + element;
+        }
+        $(element).css('border-style', 'outset');
+    };
+
+    $(function () {
+        var content = $('#media__content');
+        prepare_content(content);
+
+        attachoptions();
+        initpopup();
+
+        // add the action to autofill the "upload as" field
+        content.delegate('#upload__file', 'change', suggest)
+            // Attach the image selector action to all links
+            .delegate('a.select', 'click', select)
+            // Attach deletion confirmation dialog to the delete buttons
+            .delegate('#media__content a.btn_media_delete', 'click', confirmattach);
+
+
+        $('#media__tree').delegate('img', 'click', toggle)
+            .delegate('a', 'click', list);
+    });
+}(jQuery));
diff --git a/lib/scripts/script.js b/lib/scripts/script.js
index 2cc1246f9..a99735c99 100644
--- a/lib/scripts/script.js
+++ b/lib/scripts/script.js
@@ -1,3 +1,8 @@
+// if jQuery was loaded, let's make it noConflict here.
+if ('function' === typeof jQuery && 'function' === typeof jQuery.noConflict) {
+    jQuery.noConflict();
+}
+
 /**
  * Some of these scripts were taken from wikipedia.org and were modified for DokuWiki
  */
diff --git a/lib/scripts/subscriptions.js b/lib/scripts/subscriptions.js
index d701f258f..79b1caf1a 100644
--- a/lib/scripts/subscriptions.js
+++ b/lib/scripts/subscriptions.js
@@ -2,45 +2,40 @@
  * Hide list subscription style if target is a page
  *
  * @author Adrian Lang <lang@cosmocode.de>
+ * @author Pierre Spring <pierre.spring@caillou.ch>
  */
+(function ($) {
+    $(function () {
+        var form, list, digest;
 
-addInitEvent(function () {
-    var form = $('subscribe__form');
-    if (!form) {
-        return;
-    }
+        form = $('#subscribe__form');
 
-    var styleradios = {};
-
-    function update_state() {
-        if (!this.checked) {
+        if (0 === form.size()) {
             return;
         }
-        if (this.value.match(/:$/)) {
-            styleradios.list.parentNode.style.display = '';
-        } else {
-            styleradios.list.parentNode.style.display = 'none';
-            if (styleradios.list.checked) {
-                styleradios.digest.checked = 'checked';
-            }
-        }
-    }
 
-    var cur_sel = null;
+        list = form.find("input[name='sub_style'][value='list']");
+        digest = form.find("input[name='sub_style'][value='digest']");
 
-    var inputs = form.getElementsByTagName('input');
-    for (var i = 0; i < inputs.length ; ++i) {
-        switch (inputs[i].name) {
-        case 'sub_target':
-            addEvent(inputs[i], 'click', update_state);
-            if (inputs[i].checked) {
-                cur_sel = inputs[i];
-            }
-            break;
-        case 'sub_style':
-            styleradios[inputs[i].value] = inputs[i];
-            break;
-        }
-    }
-    update_state.call(cur_sel);
-});
+        form.find("input[name='sub_target']")
+            .click(
+                function () {
+                    var input = $(this);
+                    if (!input.is(':checked')) {
+                        return;
+                    }
+
+                    if (input.val().match(/:$/)) {
+                        list.parent().show();
+                    } else {
+                        list.parent().hide();
+                        if (list.is(':checked')) {
+                            digest.attr('checked', 'checked');
+                        }
+                    }
+                }
+            )
+            .filter(':checked')
+            .click();
+    });
+}(jQuery));
diff --git a/lib/scripts/toolbar.js b/lib/scripts/toolbar.js
index d458960ab..c8dfe394d 100644
--- a/lib/scripts/toolbar.js
+++ b/lib/scripts/toolbar.js
@@ -12,47 +12,55 @@ var pickercounter=0;
  * @author Andreas Gohr <andi@splitbrain.org>
  */
 function initToolbar(tbid,edid,tb, allowblock){
-    var toolbar = $(tbid);
-    if(!toolbar) return;
-    var edit = $(edid);
-    if(!edit) return;
-    if(edit.readOnly) return;
+    var $ = jQuery;
+    if (typeof tbid == 'string') {
+        var toolbar = $('#' + tbid);
+    } else {
+        var toolbar = $(tbid);
+    }
+
+    if(toolbar.length == 0) return;
+
+    var edit = $('#' + edid);
+    if(edit.length == 0) return;
+
+    if(edit.attr('readOnly')) return;
 
     if (typeof allowblock === 'undefined') {
         allowblock = true;
     }
 
     //empty the toolbar area:
-    toolbar.innerHTML='';
+    toolbar.html('');
 
     var cnt = tb.length;
+
     for(var i=0; i<cnt; i++){
         if (!allowblock && tb[i].block === true) {
             continue;
         }
         var actionFunc;
 
-        // create new button
-        var btn = createToolButton(tb[i]['icon'],
+        // create new button (jQuery object)
+        var btn = $(createToolButton(tb[i]['icon'],
                                    tb[i]['title'],
                                    tb[i]['key'],
                                    tb[i]['id'],
-                                   tb[i]['class']);
-
+                                   tb[i]['class']));
 
         // type is a tb function -> assign it as onclick
         actionFunc = 'tb_'+tb[i]['type'];
-        if( isFunction(window[actionFunc]) ){
-            addEvent(btn,'click', bind(window[actionFunc],btn,tb[i],edid));
-            toolbar.appendChild(btn);
+        if( $.isFunction(window[actionFunc]) ){
+            btn.bind('click', bind(window[actionFunc],btn,tb[i],edid) );
+            toolbar.append(btn);
             continue;
         }
 
         // type is a init function -> execute it
         actionFunc = 'addBtnAction'+tb[i]['type'].charAt(0).toUpperCase()+tb[i]['type'].substring(1);
-        if( isFunction(window[actionFunc]) ){
+        if( $.isFunction(window[actionFunc]) ){
             if(window[actionFunc](btn, tb[i], edid)){
-                toolbar.appendChild(btn);
+                toolbar.append(btn);
             }
             continue;
         }
@@ -197,10 +205,14 @@ function tb_autohead(btn, props, edid){
 function addBtnActionPicker(btn, props, edid) {
     var pickerid = 'picker'+(pickercounter++);
     createPicker(pickerid, props, edid);
-    addEvent(btn,'click',function(){
-        pickerToggle(pickerid,btn);
-        return false;
-    });
+
+    btn.click(
+        function() {
+            pickerToggle(pickerid,btn);
+            return false;
+        }
+    );
+
     return true;
 }
 
@@ -214,11 +226,7 @@ function addBtnActionPicker(btn, props, edid) {
  * @author Andreas Gohr <gohr@cosmocode.de>
  */
 function addBtnActionLinkwiz(btn, props, edid) {
-    linkwiz.init($(edid));
-    addEvent(btn,'click',function(){
-        linkwiz.toggle();
-        return false;
-    });
+    jQuery(btn).linkwiz(jQuery('#' + edid));
     return true;
 }
 
@@ -228,17 +236,18 @@ function addBtnActionLinkwiz(btn, props, edid) {
  * @author Andreas Gohr <andi@splitbrain.org>
  */
 function pickerToggle(pickerid,btn){
-    var picker = $(pickerid);
-    if(picker.style.marginLeft == '-10000px'){
-        var x = findPosX(btn);
-        var y = findPosY(btn);
-        picker.style.left = (x+3)+'px';
-        picker.style.top = (y+btn.offsetHeight+3)+'px';
-        picker.style.marginLeft = '0px';
-        picker.style.marginTop  = '0px';
-    }else{
-        picker.style.marginLeft = '-10000px';
-        picker.style.marginTop  = '-10000px';
+    var picker = jQuery('#' + pickerid);
+    if (picker.css('marginLeft') == '-10000px'){
+        var x = findPosX(btn[0]);
+        var y = findPosY(btn[0]);
+
+        picker.css('left',(x+3)+'px')
+            .css('top', (y+btn[0].offsetHeight+3)+'px')
+            .css('marginLeft', '0px')
+            .css('marginTop', '0px');
+    } else {
+        picker.css('marginLeft', '-10000px')
+            .css('marginTop', '-10000px');
     }
 }
 
@@ -248,10 +257,10 @@ function pickerToggle(pickerid,btn){
  * @author Andreas Gohr <andi@splitbrain.org>
  */
 function pickerClose(){
-    var pobjs = getElementsByClass('picker');
+    var pobjs = jQuery('#picker');
     for(var i=0; i<pobjs.length; i++){
-        pobjs[i].style.marginLeft = '-10000px';
-        pobjs[i].style.marginTop  = '-10000px';
+        pobjs[i].css('marginLeft', '-10000px')
+            .css('marginTop', '-10000px');
     }
 }
 
diff --git a/lib/tpl/default/_linkwiz.css b/lib/tpl/default/_linkwiz.css
index 060707377..fd40a0019 100644
--- a/lib/tpl/default/_linkwiz.css
+++ b/lib/tpl/default/_linkwiz.css
@@ -16,6 +16,7 @@
     background-color: __background_alt__;
     height: 16px;
     margin-bottom: 5px;
+    cursor: move;
 }
 
 #link__wiz_close {
diff --git a/lib/tpl/default/media.css b/lib/tpl/default/media.css
index d412fd9cf..7b558a80b 100644
--- a/lib/tpl/default/media.css
+++ b/lib/tpl/default/media.css
@@ -32,6 +32,10 @@
     margin-bottom: 0.5em;
 }
 
+#media__manager a.select {
+    cursor: pointer;
+}
+
 /* --- Tree formatting --- */
 
 #media__tree img {