diff options
Diffstat (limited to 'lib')
525 files changed, 25726 insertions, 3093 deletions
diff --git a/lib/_fla/.htaccess b/lib/_fla/.htaccess index 9a7d38c12..055d099c7 100644 --- a/lib/_fla/.htaccess +++ b/lib/_fla/.htaccess @@ -1,3 +1,4 @@ ## no access to the fla directory order allow,deny deny from all +Satisfy All diff --git a/lib/exe/ajax.php b/lib/exe/ajax.php index e514762fd..2bfa3680c 100644 --- a/lib/exe/ajax.php +++ b/lib/exe/ajax.php @@ -8,7 +8,7 @@ //fix for Opera XMLHttpRequests if(!count($_POST) && !empty($HTTP_RAW_POST_DATA)){ - parse_str($HTTP_RAW_POST_DATA, $_POST); + parse_str($HTTP_RAW_POST_DATA, $_POST); } if(!defined('DOKU_INC')) define('DOKU_INC',dirname(__FILE__).'/../../'); @@ -20,25 +20,25 @@ header('Content-Type: text/html; charset=utf-8'); //call the requested function -if(isset($_POST['call'])) - $call = $_POST['call']; -else if(isset($_GET['call'])) - $call = $_GET['call']; -else - exit; - +if(isset($_POST['call'])){ + $call = $_POST['call']; +}else if(isset($_GET['call'])){ + $call = $_GET['call']; +}else{ + exit; +} $callfn = 'ajax_'.$call; if(function_exists($callfn)){ - $callfn(); + $callfn(); }else{ - $evt = new Doku_Event('AJAX_CALL_UNKNOWN', $call); - if ($evt->advise_before()) { - print "AJAX call '".htmlspecialchars($call)."' unknown!\n"; - exit; - } - $evt->advise_after(); - unset($evt); + $evt = new Doku_Event('AJAX_CALL_UNKNOWN', $call); + if ($evt->advise_before()) { + print "AJAX call '".htmlspecialchars($call)."' unknown!\n"; + exit; + } + $evt->advise_after(); + unset($evt); } /** @@ -47,33 +47,33 @@ if(function_exists($callfn)){ * @author Andreas Gohr <andi@splitbrain.org> */ function ajax_qsearch(){ - global $conf; - global $lang; - - $query = $_POST['q']; - if(empty($query)) $query = $_GET['q']; - if(empty($query)) return; - - $data = ft_pageLookup($query, true, useHeading('navigation')); - - if(!count($data)) return; - - print '<strong>'.$lang['quickhits'].'</strong>'; - print '<ul>'; - foreach($data as $id => $title){ - if (useHeading('navigation')) { - $name = $title; - } else { - $ns = getNS($id); - if($ns){ - $name = shorten(noNS($id), ' ('.$ns.')',30); - }else{ - $name = $id; + global $conf; + global $lang; + + $query = $_POST['q']; + if(empty($query)) $query = $_GET['q']; + if(empty($query)) return; + + $data = ft_pageLookup($query, true, useHeading('navigation')); + + if(!count($data)) return; + + print '<strong>'.$lang['quickhits'].'</strong>'; + print '<ul>'; + foreach($data as $id => $title){ + if (useHeading('navigation')) { + $name = $title; + } else { + $ns = getNS($id); + if($ns){ + $name = noNS($id).' ('.$ns.')'; + }else{ + $name = $id; + } } + echo '<li>' . html_wikilink(':'.$id,$name) . '</li>'; } - echo '<li>' . html_wikilink(':'.$id,$name) . '</li>'; - } - print '</ul>'; + print '</ul>'; } /** @@ -83,36 +83,36 @@ function ajax_qsearch(){ * @author Mike Frysinger <vapier@gentoo.org> */ function ajax_suggestions() { - global $conf; - global $lang; - - $query = cleanID($_POST['q']); - if(empty($query)) $query = cleanID($_GET['q']); - if(empty($query)) return; - - $data = array(); - $data = ft_pageLookup($query); - if(!count($data)) return; - $data = array_keys($data); - - // limit results to 15 hits - $data = array_slice($data, 0, 15); - $data = array_map('trim',$data); - $data = array_map('noNS',$data); - $data = array_unique($data); - sort($data); - - /* now construct a json */ - $suggestions = array( - $query, // the original query - $data, // some suggestions - array(), // no description - array() // no urls - ); - $json = new JSON(); - - header('Content-Type: application/x-suggestions+json'); - print $json->encode($suggestions); + global $conf; + global $lang; + + $query = cleanID($_POST['q']); + if(empty($query)) $query = cleanID($_GET['q']); + if(empty($query)) return; + + $data = array(); + $data = ft_pageLookup($query); + if(!count($data)) return; + $data = array_keys($data); + + // limit results to 15 hits + $data = array_slice($data, 0, 15); + $data = array_map('trim',$data); + $data = array_map('noNS',$data); + $data = array_unique($data); + sort($data); + + /* now construct a json */ + $suggestions = array( + $query, // the original query + $data, // some suggestions + array(), // no description + array() // no urls + ); + $json = new JSON(); + + header('Content-Type: application/x-suggestions+json'); + print $json->encode($suggestions); } /** @@ -121,32 +121,42 @@ function ajax_suggestions() { * Andreas Gohr <andi@splitbrain.org> */ function ajax_lock(){ - global $conf; - global $lang; - $id = cleanID($_POST['id']); - if(empty($id)) return; + global $conf; + global $lang; + global $ID; + global $INFO; - if(!checklock($id)){ - lock($id); - echo 1; - } + $ID = cleanID($_POST['id']); + if(empty($ID)) return; - if($conf['usedraft'] && $_POST['wikitext']){ - $client = $_SERVER['REMOTE_USER']; - if(!$client) $client = clientIP(true); + $INFO = pageinfo(); + + if (!$INFO['writable']) { + echo 'Permission denied'; + return; + } - $draft = array('id' => $id, - 'prefix' => substr($_POST['prefix'], 0, -1), - 'text' => $_POST['wikitext'], - 'suffix' => $_POST['suffix'], - 'date' => (int) $_POST['date'], - 'client' => $client, - ); - $cname = getCacheName($draft['client'].$id,'.draft'); - if(io_saveFile($cname,serialize($draft))){ - echo $lang['draftdate'].' '.dformat(); + if(!checklock($ID)){ + lock($ID); + echo 1; + } + + if($conf['usedraft'] && $_POST['wikitext']){ + $client = $_SERVER['REMOTE_USER']; + if(!$client) $client = clientIP(true); + + $draft = array('id' => $ID, + 'prefix' => substr($_POST['prefix'], 0, -1), + 'text' => $_POST['wikitext'], + 'suffix' => $_POST['suffix'], + 'date' => (int) $_POST['date'], + 'client' => $client, + ); + $cname = getCacheName($draft['client'].$ID,'.draft'); + if(io_saveFile($cname,serialize($draft))){ + echo $lang['draftdate'].' '.dformat(); + } } - } } @@ -156,14 +166,14 @@ function ajax_lock(){ * @author Andreas Gohr <andi@splitbrain.org> */ function ajax_draftdel(){ - $id = cleanID($_REQUEST['id']); - if(empty($id)) return; + $id = cleanID($_REQUEST['id']); + if(empty($id)) return; - $client = $_SERVER['REMOTE_USER']; - if(!$client) $client = clientIP(true); + $client = $_SERVER['REMOTE_USER']; + if(!$client) $client = clientIP(true); - $cname = getCacheName($client.$id,'.draft'); - @unlink($cname); + $cname = getCacheName($client.$id,'.draft'); + @unlink($cname); } /** @@ -172,22 +182,20 @@ function ajax_draftdel(){ * @author Andreas Gohr <andi@splitbrain.org> */ function ajax_medians(){ - global $conf; - - // wanted namespace - $ns = cleanID($_POST['ns']); - $dir = utf8_encodeFN(str_replace(':','/',$ns)); - - $lvl = count(explode(':',$ns)); - - $data = array(); - search($data,$conf['mediadir'],'search_index',array('nofiles' => true),$dir); - foreach($data as $item){ - $item['level'] = $lvl+1; - echo media_nstree_li($item); - echo media_nstree_item($item); - echo '</li>'; - } + global $conf; + + // wanted namespace + $ns = cleanID($_POST['ns']); + $dir = utf8_encodeFN(str_replace(':','/',$ns)); + + $lvl = count(explode(':',$ns)); + + $data = array(); + search($data,$conf['mediadir'],'search_index',array('nofiles' => true),$dir); + foreach(array_keys($data) as $item){ + $data[$item]['level'] = $lvl+1; + } + echo html_buildlist($data, 'idx', 'media_nstree_item', 'media_nstree_li'); } /** @@ -196,11 +204,11 @@ function ajax_medians(){ * @author Andreas Gohr <andi@splitbrain.org> */ function ajax_medialist(){ - global $conf; - global $NS; + global $conf; + global $NS; - $NS = $_POST['ns']; - tpl_mediaContent(true); + $NS = $_POST['ns']; + tpl_mediaContent(true); } /** @@ -209,24 +217,20 @@ function ajax_medialist(){ * @author Andreas Gohr <andi@splitbrain.org> */ function ajax_index(){ - global $conf; - - // wanted namespace - $ns = cleanID($_POST['idx']); - $dir = utf8_encodeFN(str_replace(':','/',$ns)); - - $lvl = count(explode(':',$ns)); - - $data = array(); - search($data,$conf['datadir'],'search_index',array('ns' => $ns),$dir); - foreach($data as $item){ - $item['level'] = $lvl+1; - echo html_li_index($item); - echo '<div class="li">'; - echo html_list_index($item); - echo '</div>'; - echo '</li>'; - } + global $conf; + + // wanted namespace + $ns = cleanID($_POST['idx']); + $dir = utf8_encodeFN(str_replace(':','/',$ns)); + + $lvl = count(explode(':',$ns)); + + $data = array(); + search($data,$conf['datadir'],'search_index',array('ns' => $ns),$dir); + foreach(array_keys($data) as $item){ + $data[$item]['level'] = $lvl+1; + } + echo html_buildlist($data, 'idx', 'html_list_index', 'html_li_index'); } /** @@ -235,107 +239,105 @@ function ajax_index(){ * @author Andreas Gohr <gohr@cosmocode.de> */ function ajax_linkwiz(){ - global $conf; - global $lang; - - $q = ltrim($_POST['q'],':'); - $id = noNS($q); - $ns = getNS($q); - - $ns = cleanID($ns); - $id = cleanID($id); - - $nsd = utf8_encodeFN(str_replace(':','/',$ns)); - $idd = utf8_encodeFN(str_replace(':','/',$id)); - - $data = array(); - if($q && !$ns){ - - // use index to lookup matching pages - $pages = array(); - $pages = ft_pageLookup($id,true); - - // result contains matches in pages and namespaces - // we now extract the matching namespaces to show - // them seperately - $dirs = array(); - - - foreach($pages as $pid => $title){ - if(strpos(noNS($pid),$id) === false){ - // match was in the namespace - $dirs[getNS($pid)] = 1; // assoc array avoids dupes - }else{ - // it is a matching page, add it to the result - $data[] = array( - 'id' => $pid, - 'title' => $title, - 'type' => 'f', - ); - } - unset($pages[$pid]); - } - foreach($dirs as $dir => $junk){ - $data[] = array( - 'id' => $dir, - 'type' => 'd', - ); - } + global $conf; + global $lang; + + $q = ltrim(trim($_POST['q']),':'); + $id = noNS($q); + $ns = getNS($q); + + $ns = cleanID($ns); + $id = cleanID($id); + + $nsd = utf8_encodeFN(str_replace(':','/',$ns)); + $idd = utf8_encodeFN(str_replace(':','/',$id)); + + $data = array(); + if($q && !$ns){ + + // use index to lookup matching pages + $pages = array(); + $pages = ft_pageLookup($id,true); + + // result contains matches in pages and namespaces + // we now extract the matching namespaces to show + // them seperately + $dirs = array(); + + foreach($pages as $pid => $title){ + if(strpos(noNS($pid),$id) === false){ + // match was in the namespace + $dirs[getNS($pid)] = 1; // assoc array avoids dupes + }else{ + // it is a matching page, add it to the result + $data[] = array( + 'id' => $pid, + 'title' => $title, + 'type' => 'f', + ); + } + unset($pages[$pid]); + } + foreach($dirs as $dir => $junk){ + $data[] = array( + 'id' => $dir, + 'type' => 'd', + ); + } - }else{ - - $opts = array( - 'depth' => 1, - 'listfiles' => true, - 'listdirs' => true, - 'pagesonly' => true, - 'firsthead' => true, - 'sneakyacl' => $conf['sneaky_index'], - ); - if($id) $opts['filematch'] = '^.*\/'.$id; - if($id) $opts['dirmatch'] = '^.*\/'.$id; - search($data,$conf['datadir'],'search_universal',$opts,$nsd); - - // add back to upper - if($ns){ - array_unshift($data,array( - 'id' => getNS($ns), - 'type' => 'u', - )); - } - } + }else{ - // fixme sort results in a useful way ? + $opts = array( + 'depth' => 1, + 'listfiles' => true, + 'listdirs' => true, + 'pagesonly' => true, + 'firsthead' => true, + 'sneakyacl' => $conf['sneaky_index'], + ); + if($id) $opts['filematch'] = '^.*\/'.$id; + if($id) $opts['dirmatch'] = '^.*\/'.$id; + search($data,$conf['datadir'],'search_universal',$opts,$nsd); + + // add back to upper + if($ns){ + array_unshift($data,array( + 'id' => getNS($ns), + 'type' => 'u', + )); + } + } - if(!count($data)){ - echo $lang['nothingfound']; - exit; - } + // fixme sort results in a useful way ? - // output the found data - $even = 1; - foreach($data as $item){ - $even *= -1; //zebra + if(!count($data)){ + echo $lang['nothingfound']; + exit; + } - if(($item['type'] == 'd' || $item['type'] == 'u') && $item['id']) $item['id'] .= ':'; - $link = wl($item['id']); + // output the found data + $even = 1; + foreach($data as $item){ + $even *= -1; //zebra - echo '<div class="'.(($even > 0)?'even':'odd').' type_'.$item['type'].'">'; + if(($item['type'] == 'd' || $item['type'] == 'u') && $item['id']) $item['id'] .= ':'; + $link = wl($item['id']); + echo '<div class="'.(($even > 0)?'even':'odd').' type_'.$item['type'].'">'; - if($item['type'] == 'u'){ - $name = $lang['upperns']; - }else{ - $name = htmlspecialchars($item['id']); - } + if($item['type'] == 'u'){ + $name = $lang['upperns']; + }else{ + $name = htmlspecialchars($item['id']); + } - echo '<a href="'.$link.'" title="'.htmlspecialchars($item['id']).'" class="wikilink1">'.$name.'</a>'; + echo '<a href="'.$link.'" title="'.htmlspecialchars($item['id']).'" class="wikilink1">'.$name.'</a>'; - if($item['title']){ - echo '<span>'.htmlspecialchars($item['title']).'</span>'; + if($item['title']){ + echo '<span>'.htmlspecialchars($item['title']).'</span>'; + } + echo '</div>'; } - echo '</div>'; - } } diff --git a/lib/exe/css.php b/lib/exe/css.php index e64ebc22a..8f86f2433 100644 --- a/lib/exe/css.php +++ b/lib/exe/css.php @@ -30,10 +30,10 @@ function css_out(){ global $lang; global $config_cascade; - $style = ''; + $mediatype = 'screen'; if (isset($_REQUEST['s']) && in_array($_REQUEST['s'], array('all', 'print', 'feed'))) { - $style = $_REQUEST['s']; + $mediatype = $_REQUEST['s']; } $tpl = trim(preg_replace('/[^\w-]+/','',$_REQUEST['t'])); @@ -46,7 +46,7 @@ function css_out(){ } // The generated script depends on some dynamic options - $cache = getCacheName('styles'.$_SERVER['HTTP_HOST'].$_SERVER['SERVER_PORT'].DOKU_BASE.$tplinc.$style,'.css'); + $cache = new cache('styles'.$_SERVER['HTTP_HOST'].$_SERVER['SERVER_PORT'].DOKU_BASE.$tplinc.$mediatype,'.css'); // load template styles $tplstyles = array(); @@ -60,49 +60,41 @@ function css_out(){ // Array of needed files and their web locations, the latter ones // are needed to fix relative paths in the stylesheets $files = array(); - //if (isset($tplstyles['all'])) $files = array_merge($files, $tplstyles['all']); - if(!empty($style)){ - $files[DOKU_INC.'lib/styles/'.$style.'.css'] = DOKU_BASE.'lib/styles/'; - // load plugin, template, user styles - $files = array_merge($files, css_pluginstyles($style)); - if (isset($tplstyles[$style])) $files = array_merge($files, $tplstyles[$style]); - - if(isset($config_cascade['userstyle'][$style])){ - $files[$config_cascade['userstyle'][$style]] = DOKU_BASE; - } - }else{ - $files[DOKU_INC.'lib/styles/style.css'] = DOKU_BASE.'lib/styles/'; - // load plugin, template, user styles - $files = array_merge($files, css_pluginstyles('screen')); - if (isset($tplstyles['screen'])) $files = array_merge($files, $tplstyles['screen']); + // load core styles + $files[DOKU_INC.'lib/styles/'.$mediatype.'.css'] = DOKU_BASE.'lib/styles/'; + // load jQuery-UI theme + $files[DOKU_INC.'lib/scripts/jquery/jquery-ui-theme/smoothness.css'] = DOKU_BASE.'lib/scripts/jquery/jquery-ui-theme/'; + // load plugin styles + $files = array_merge($files, css_pluginstyles($mediatype)); + // load template styles + if (isset($tplstyles[$mediatype])) { + $files = array_merge($files, $tplstyles[$mediatype]); + } + // if old 'default' userstyle setting exists, make it 'screen' userstyle for backwards compatibility + if (isset($config_cascade['userstyle']['default'])) { + $config_cascade['userstyle']['screen'] = $config_cascade['userstyle']['default']; + } + // load user styles + if(isset($config_cascade['userstyle'][$mediatype])){ + $files[$config_cascade['userstyle'][$mediatype]] = DOKU_BASE; + } + // load rtl styles + // @todo: this currently adds the rtl styles only to the 'screen' media type + // but 'print' and 'all' should also be supported + if ($mediatype=='screen') { if($lang['direction'] == 'rtl'){ if (isset($tplstyles['rtl'])) $files = array_merge($files, $tplstyles['rtl']); } - if(isset($config_cascade['userstyle']['default'])){ - $files[$config_cascade['userstyle']['default']] = DOKU_BASE; - } } - // check cache age & handle conditional request - header('Cache-Control: public, max-age=3600'); - header('Pragma: public'); - if(css_cacheok($cache,array_keys($files),$tplinc)){ - http_conditionalRequest(filemtime($cache)); - if($conf['allowdebug']) header("X-CacheUsed: $cache"); - - // finally send output - if ($conf['gzip_output'] && http_gzip_valid($cache)) { - header('Vary: Accept-Encoding'); - header('Content-Encoding: gzip'); - readfile($cache.".gz"); - } else { - if (!http_sendfile($cache)) readfile($cache); - } + $cache_files = array_merge(array_keys($files), getConfigFiles('main')); + $cache_files[] = $tplinc.'style.ini'; + $cache_files[] = __FILE__; - return; - } else { - http_conditionalRequest(time()); - } + // check cache age & handle conditional request + // This may exit if a cache can be used + http_cached($cache->cache, + $cache->useCache(array('files' => $cache_files))); // start output buffering and build the stylesheet ob_start(); @@ -123,50 +115,21 @@ function css_out(){ // apply style replacements $css = css_applystyle($css,$tplinc); + // place all @import statements at the top of the file + $css = css_moveimports($css); + // compress whitespace and comments if($conf['compress']){ $css = css_compress($css); } - // save cache file - io_saveFile($cache,$css); - if(function_exists('gzopen')) io_saveFile("$cache.gz",$css); - - // finally send output - if ($conf['gzip_output']) { - header('Vary: Accept-Encoding'); - header('Content-Encoding: gzip'); - print gzencode($css,9,FORCE_GZIP); - } else { - print $css; + // embed small images right into the stylesheet + if($conf['cssdatauri']){ + $base = preg_quote(DOKU_BASE,'#'); + $css = preg_replace_callback('#(url\([ \'"]*)('.$base.')(.*?(?:\.(png|gif)))#i','css_datauri',$css); } -} - -/** - * Checks if a CSS Cache file still is valid - * - * @author Andreas Gohr <andi@splitbrain.org> - */ -function css_cacheok($cache,$files,$tplinc){ - global $config_cascade; - - if(isset($_REQUEST['purge'])) return false; //support purge request - - $ctime = @filemtime($cache); - if(!$ctime) return false; //There is no cache - - // some additional files to check - $files = array_merge($files, getConfigFiles('main')); - $files[] = $tplinc.'style.ini'; - $files[] = __FILE__; - // now walk the files - foreach($files as $file){ - if(@filemtime($file) > $ctime){ - return false; - } - } - return true; + http_cached_finish($cache->cache, $css); } /** @@ -199,7 +162,7 @@ function css_interwiki(){ // default style echo 'a.interwiki {'; echo ' background: transparent url('.DOKU_BASE.'lib/images/interwiki.png) 0px 1px no-repeat;'; - echo ' padding-left: 16px;'; + echo ' padding: 1px 0px 1px 16px;'; echo '}'; // additional styles when icon available @@ -264,30 +227,53 @@ function css_loadfile($file,$location=''){ $css = io_readFile($file); if(!$location) return $css; - $css = preg_replace('#(url\([ \'"]*)((?!/|http://|https://| |\'|"))#','\\1'.$location.'\\3',$css); + $css = preg_replace('#(url\([ \'"]*)(?!/|data:|http://|https://| |\'|")#','\\1'.$location,$css); + $css = preg_replace('#(@import\s+[\'"])(?!/|data:|http://|https://)#', '\\1'.$location, $css); + return $css; } +/** + * Converte local image URLs to data URLs if the filesize is small + * + * Callback for preg_replace_callback + */ +function css_datauri($match){ + global $conf; + + $pre = unslash($match[1]); + $base = unslash($match[2]); + $url = unslash($match[3]); + $ext = unslash($match[4]); + + $local = DOKU_INC.$url; + $size = @filesize($local); + if($size && $size < $conf['cssdatauri']){ + $data = base64_encode(file_get_contents($local)); + } + if($data){ + $url = 'data:image/'.$ext.';base64,'.$data; + }else{ + $url = $base.$url; + } + return $pre.$url; +} + /** * Returns a list of possible Plugin Styles (no existance check here) * * @author Andreas Gohr <andi@splitbrain.org> */ -function css_pluginstyles($mode='screen'){ +function css_pluginstyles($mediatype='screen'){ global $lang; $list = array(); $plugins = plugin_list(); foreach ($plugins as $p){ - if($mode == 'all'){ - $list[DOKU_PLUGIN."$p/all.css"] = DOKU_BASE."lib/plugins/$p/"; - }elseif($mode == 'print'){ - $list[DOKU_PLUGIN."$p/print.css"] = DOKU_BASE."lib/plugins/$p/"; - }elseif($mode == 'feed'){ - $list[DOKU_PLUGIN."$p/feed.css"] = DOKU_BASE."lib/plugins/$p/"; - }else{ + $list[DOKU_PLUGIN."$p/$mediatype.css"] = DOKU_BASE."lib/plugins/$p/"; + // alternative for screen.css + if ($mediatype=='screen') { $list[DOKU_PLUGIN."$p/style.css"] = DOKU_BASE."lib/plugins/$p/"; - $list[DOKU_PLUGIN."$p/screen.css"] = DOKU_BASE."lib/plugins/$p/"; } if($lang['direction'] == 'rtl'){ $list[DOKU_PLUGIN."$p/rtl.css"] = DOKU_BASE."lib/plugins/$p/"; @@ -297,6 +283,29 @@ function css_pluginstyles($mode='screen'){ } /** + * Move all @import statements in a combined stylesheet to the top so they + * aren't ignored by the browser. + * + * @author Gabriel Birke <birke@d-scribe.de> + */ +function css_moveimports($css) +{ + if(!preg_match_all('/@import\s+(?:url\([^)]+\)|"[^"]+")\s*[^;]*;\s*/', $css, $matches, PREG_OFFSET_CAPTURE)) { + return $css; + } + $newCss = ""; + $imports = ""; + $offset = 0; + foreach($matches[0] as $match) { + $newCss .= substr($css, $offset, $match[1] - $offset); + $imports .= $match[0]; + $offset = $match[1] + strlen($match[0]); + } + $newCss .= substr($css, $offset); + return $imports.$newCss; +} + +/** * Very simple CSS optimizer * * @author Andreas Gohr <andi@splitbrain.org> diff --git a/lib/exe/indexer.php b/lib/exe/indexer.php index 58b0d0787..95e2af05b 100644 --- a/lib/exe/indexer.php +++ b/lib/exe/indexer.php @@ -11,9 +11,6 @@ require_once(DOKU_INC.'inc/init.php'); session_write_close(); //close session if(!defined('NL')) define('NL',"\n"); -// Version tag used to force rebuild on upgrade -define('INDEXER_VERSION', 2); - // keep running after browser closes connection @ignore_user_abort(true); @@ -136,41 +133,8 @@ function runIndexer(){ if(!$ID) return false; - // check if indexing needed - $idxtag = metaFN($ID,'.indexed'); - if(@file_exists($idxtag)){ - if(io_readFile($idxtag) >= INDEXER_VERSION){ - $last = @filemtime($idxtag); - if($last > @filemtime(wikiFN($ID))){ - print "runIndexer(): index for $ID up to date".NL; - return false; - } - } - } - - // try to aquire a lock - $lock = $conf['lockdir'].'/_indexer.lock'; - while(!@mkdir($lock,$conf['dmode'])){ - usleep(50); - if(time()-@filemtime($lock) > 60*5){ - // looks like a stale lock - remove it - @rmdir($lock); - print "runIndexer(): stale lock removed".NL; - }else{ - print "runIndexer(): indexer locked".NL; - return false; - } - } - if($conf['dperm']) chmod($lock, $conf['dperm']); - // do the work - idx_addPage($ID); - - // we're finished - save and free lock - io_saveFile(metaFN($ID,'.indexed'),INDEXER_VERSION); - @rmdir($lock); - print "runIndexer(): finished".NL; - return true; + return idx_addPage($ID, true); } /** diff --git a/lib/exe/js.php b/lib/exe/js.php index 117021308..93d5439e0 100644 --- a/lib/exe/js.php +++ b/lib/exe/js.php @@ -32,27 +32,37 @@ function js_out(){ global $config_cascade; // The generated script depends on some dynamic options - $cache = getCacheName('scripts'.$_SERVER['HTTP_HOST'].$_SERVER['SERVER_PORT'],'.js'); + $cache = new cache('scripts'.$_SERVER['HTTP_HOST'].$_SERVER['SERVER_PORT'], + '.js'); + + // load minified version for some files + $min = $conf['compress'] ? '.min' : ''; // array of core files $files = array( + DOKU_INC."lib/scripts/jquery/jquery$min.js", + DOKU_INC.'lib/scripts/jquery/jquery.cookie.js', + DOKU_INC."lib/scripts/jquery/jquery-ui$min.js", DOKU_INC.'lib/scripts/helpers.js', - DOKU_INC.'lib/scripts/events.js', DOKU_INC.'lib/scripts/delay.js', DOKU_INC.'lib/scripts/cookie.js', DOKU_INC.'lib/scripts/script.js', DOKU_INC.'lib/scripts/tw-sack.js', - DOKU_INC.'lib/scripts/ajax.js', + DOKU_INC.'lib/scripts/qsearch.js', + DOKU_INC.'lib/scripts/tree.js', DOKU_INC.'lib/scripts/index.js', DOKU_INC.'lib/scripts/drag.js', DOKU_INC.'lib/scripts/textselection.js', DOKU_INC.'lib/scripts/toolbar.js', DOKU_INC.'lib/scripts/edit.js', + DOKU_INC.'lib/scripts/editor.js', + DOKU_INC.'lib/scripts/locktimer.js', DOKU_INC.'lib/scripts/linkwiz.js', DOKU_INC.'lib/scripts/media.js', - DOKU_INC.'lib/scripts/subscriptions.js', + DOKU_INC.'lib/scripts/compatibility.js', # disabled for FS#1958 DOKU_INC.'lib/scripts/hotkeys.js', DOKU_TPLINC.'script.js', + DOKU_INC.'lib/scripts/behaviour.js', ); // add possible plugin scripts and userscript @@ -61,25 +71,13 @@ function js_out(){ $files[] = $config_cascade['userscript']['default']; } + $cache_files = array_merge($files, getConfigFiles('main')); + $cache_files[] = __FILE__; + // check cache age & handle conditional request - header('Cache-Control: public, max-age=3600'); - header('Pragma: public'); - if(js_cacheok($cache,$files)){ - http_conditionalRequest(filemtime($cache)); - if($conf['allowdebug']) header("X-CacheUsed: $cache"); - - // finally send output - if ($conf['gzip_output'] && http_gzip_valid($cache)) { - header('Vary: Accept-Encoding'); - header('Content-Encoding: gzip'); - readfile($cache.".gz"); - } else { - if (!http_sendfile($cache)) readfile($cache); - } - return; - } else { - http_conditionalRequest(time()); - } + // This may exit if a cache can be used + http_cached($cache->cache, + $cache->useCache(array('files' => $cache_files))); // start output buffering and build the script ob_start(); @@ -108,14 +106,10 @@ function js_out(){ // init stuff js_runonstart("addEvent(document,'click',closePopups)"); - js_runonstart('addTocToggle()'); - js_runonstart("initSizeCtl('size__ctl','wiki__text')"); js_runonstart("initToolbar('tool__bar','wiki__text',toolbar)"); if($conf['locktime'] != 0){ - js_runonstart("locktimer.init(".($conf['locktime'] - 60).",'".js_escape($lang['willexpire'])."',".$conf['usedraft'].")"); + js_runonstart("locktimer.init(".($conf['locktime'] - 60).",'".js_escape($lang['willexpire'])."',".$conf['usedraft'].", 'wiki__text')"); } - js_runonstart('scrollToMarker()'); - js_runonstart('focusMarker()'); // init hotkeys - must have been done after init of toolbar # disabled for FS#1958 js_runonstart('initializeHotkeys()'); @@ -130,18 +124,7 @@ function js_out(){ $js .= "\n"; // https://bugzilla.mozilla.org/show_bug.cgi?id=316033 - // save cache file - io_saveFile($cache,$js); - if(function_exists('gzopen')) io_saveFile("$cache.gz",$js); - - // finally send output - if ($conf['gzip_output']) { - header('Vary: Accept-Encoding'); - header('Content-Encoding: gzip'); - print gzencode($js,9,FORCE_GZIP); - } else { - print $js; - } + http_cached_finish($cache->cache, $js); } /** @@ -173,32 +156,7 @@ function js_load($file){ } $data = str_replace($match[0],$idata,$data); } - echo $data; -} - -/** - * Checks if a JavaScript Cache file still is valid - * - * @author Andreas Gohr <andi@splitbrain.org> - */ -function js_cacheok($cache,$files){ - if(isset($_REQUEST['purge'])) return false; //support purge request - - $ctime = @filemtime($cache); - if(!$ctime) return false; //There is no cache - - // some additional files to check - $files = array_merge($files, getConfigFiles('main')); - $files[] = DOKU_CONF.'userscript.js'; - $files[] = __FILE__; - - // now walk the files - foreach($files as $file){ - if(@filemtime($file) > $ctime){ - return false; - } - } - return true; + echo "$data\n"; } /** @@ -285,7 +243,7 @@ function js_compress($s){ // items that don't need spaces next to them $chars = "^&|!+\-*\/%=\?:;,{}()<>% \t\n\r'\"[]"; - $regex_starters = array("(", "=", "[", "," , ":"); + $regex_starters = array("(", "=", "[", "," , ":", "!"); $whitespaces_chars = array(" ", "\t", "\n", "\r", "\0", "\x0B"); diff --git a/lib/exe/mediamanager.php b/lib/exe/mediamanager.php index c79a25c08..02fde5a8d 100644 --- a/lib/exe/mediamanager.php +++ b/lib/exe/mediamanager.php @@ -82,18 +82,24 @@ // handle deletion if($DEL) { - $INUSE = media_inuse($DEL); - if(!$INUSE) { - if(media_delete($DEL,$AUTH)) { - msg(sprintf($lang['deletesucc'],noNS($DEL)),1); - } else { - msg(sprintf($lang['deletefail'],noNS($DEL)),-1); + $res = 0; + if(checkSecurityToken()) { + $res = media_delete($DEL,$AUTH); + } + if ($res & DOKU_MEDIA_DELETED) { + $msg = sprintf($lang['deletesucc'], noNS($DEL)); + if ($res & DOKU_MEDIA_EMPTY_NS) { + // current namespace was removed. redirecting to root ns passing msg along + send_redirect(DOKU_URL.'lib/exe/mediamanager.php?msg1='. + rawurlencode($msg).'&edid='.$_REQUEST['edid']); } - } else { + msg($msg,1); + } elseif ($res & DOKU_MEDIA_INUSE) { if(!$conf['refshow']) { - unset($INUSE); msg(sprintf($lang['mediainuse'],noNS($DEL)),0); } + } else { + msg(sprintf($lang['deletefail'],noNS($DEL)),-1); } } diff --git a/lib/exe/xmlrpc.php b/lib/exe/xmlrpc.php index d232930a3..8b572d213 100644 --- a/lib/exe/xmlrpc.php +++ b/lib/exe/xmlrpc.php @@ -1,7 +1,7 @@ <?php if(!defined('DOKU_INC')) define('DOKU_INC',dirname(__FILE__).'/../../'); -// fix when '<?xml' isn't on the very first line +// fix when '< ?xml' isn't on the very first line if(isset($HTTP_RAW_POST_DATA)) $HTTP_RAW_POST_DATA = trim($HTTP_RAW_POST_DATA); /** @@ -30,26 +30,9 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { global $USERINFO; if(!$conf['useacl']) return true; //no ACL - then no checks + if(trim($conf['xmlrpcuser']) == '') return true; //no restrictions - $allowed = explode(',',$conf['xmlrpcuser']); - $allowed = array_map('trim', $allowed); - $allowed = array_unique($allowed); - $allowed = array_filter($allowed); - - if(!count($allowed)) return true; //no restrictions - - $user = $_SERVER['REMOTE_USER']; - $groups = (array) $USERINFO['grps']; - - if(in_array($user,$allowed)) return true; //user explicitly mentioned - - //check group memberships - foreach($groups as $group){ - if(in_array('@'.$group,$allowed)) return true; - } - - //still here? no access! - return false; + return auth_isMember($conf['xmlrpcuser'],$_SERVER['REMOTE_USER'],(array) $USERINFO['grps']); } /** @@ -296,6 +279,7 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * Return a raw wiki page */ function rawPage($id,$rev=''){ + $id = cleanID($id); if(auth_quickaclcheck($id) < AUTH_READ){ return new IXR_Error(1, 'You are not allowed to read this page'); } @@ -351,6 +335,7 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * Return a wiki page rendered to html */ function htmlPage($id,$rev=''){ + $id = cleanID($id); if(auth_quickaclcheck($id) < AUTH_READ){ return new IXR_Error(1, 'You are not allowed to read this page'); } @@ -362,9 +347,8 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { */ function listPages(){ $list = array(); - $pages = array_filter(array_filter(idx_getIndex('page', ''), - 'isVisiblePage'), - 'page_exists'); + $pages = idx_get_indexer()->getPages(); + $pages = array_filter(array_filter($pages,'isVisiblePage'),'page_exists'); foreach(array_keys($pages) as $idx) { $perm = auth_quickaclcheck($pages[$idx]); @@ -488,6 +472,7 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * Return some basic data about a page */ function pageInfo($id,$rev=''){ + $id = cleanID($id); if(auth_quickaclcheck($id) < AUTH_READ){ return new IXR_Error(1, 'You are not allowed to read this page'); } @@ -559,27 +544,7 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { unlock($id); // run the indexer if page wasn't indexed yet - if(!@file_exists(metaFN($id, '.indexed'))) { - // try to aquire a lock - $lock = $conf['lockdir'].'/_indexer.lock'; - while(!@mkdir($lock,$conf['dmode'])){ - usleep(50); - if(time()-@filemtime($lock) > 60*5){ - // looks like a stale lock - remove it - @rmdir($lock); - }else{ - return false; - } - } - if($conf['dperm']) chmod($lock, $conf['dperm']); - - // do the work - idx_addPage($id); - - // we're finished - save and free lock - io_saveFile(metaFN($id,'.indexed'),INDEXER_VERSION); - @rmdir($lock); - } + idx_addPage($id); return 0; } @@ -601,64 +566,27 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * Michael Klier <chi@chimeric.de> */ function putAttachment($id, $file, $params) { - global $conf; - global $lang; - + $id = cleanID($id); $auth = auth_quickaclcheck(getNS($id).':*'); - if($auth >= AUTH_UPLOAD) { - if(!isset($id)) { - return new IXR_ERROR(1, 'Filename not given.'); - } - $ftmp = $conf['tmpdir'] . '/' . md5($id.clientIP()); - - // save temporary file - @unlink($ftmp); - $buff = base64_decode($file); - io_saveFile($ftmp, $buff); + if(!isset($id)) { + return new IXR_ERROR(1, 'Filename not given.'); + } - // get filename - list($iext, $imime,$dl) = mimetype($id); - $id = cleanID($id); - $fn = mediaFN($id); - - // get filetype regexp - $types = array_keys(getMimeTypes()); - $types = array_map(create_function('$q','return preg_quote($q,"/");'),$types); - $regex = join('|',$types); - - // because a temp file was created already - if(preg_match('/\.('.$regex.')$/i',$fn)) { - //check for overwrite - $overwrite = @file_exists($fn); - if($overwrite && (!$params['ow'] || $auth < AUTH_DELETE)) { - return new IXR_ERROR(1, $lang['uploadexist'].'1'); - } - // check for valid content - $ok = media_contentcheck($ftmp, $imime); - if($ok == -1) { - return new IXR_ERROR(1, sprintf($lang['uploadexist'].'2', ".$iext")); - } elseif($ok == -2) { - return new IXR_ERROR(1, $lang['uploadspam']); - } elseif($ok == -3) { - return new IXR_ERROR(1, $lang['uploadxss']); - } + global $conf; - // prepare event data - $data[0] = $ftmp; - $data[1] = $fn; - $data[2] = $id; - $data[3] = $imime; - $data[4] = $overwrite; + $ftmp = $conf['tmpdir'] . '/' . md5($id.clientIP()); - // trigger event - return trigger_event('MEDIA_UPLOAD_FINISH', $data, array($this, '_media_upload_action'), true); + // save temporary file + @unlink($ftmp); + $buff = base64_decode($file); + io_saveFile($ftmp, $buff); - } else { - return new IXR_ERROR(1, $lang['uploadwrong']); - } + $res = media_save(array('name' => $ftmp), $id, $params['ow'], $auth, 'rename'); + if (is_array($res)) { + return new IXR_ERROR(-$res[1], $res[0]); } else { - return new IXR_ERROR(1, "You don't have permissions to upload files."); + return $res; } } @@ -668,56 +596,17 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * @author Gina Haeussge <osd@foosel.net> */ function deleteAttachment($id){ + $id = cleanID($id); $auth = auth_quickaclcheck(getNS($id).':*'); - if($auth < AUTH_DELETE) return new IXR_ERROR(1, "You don't have permissions to delete files."); - global $conf; - global $lang; - - // check for references if needed - $mediareferences = array(); - if($conf['refcheck']){ - $mediareferences = ft_mediause($id,$conf['refshow']); - } - - if(!count($mediareferences)){ - $file = mediaFN($id); - if(@unlink($file)){ - addMediaLogEntry(time(), $id, DOKU_CHANGE_TYPE_DELETE); - io_sweepNS($id,'mediadir'); - return 0; - } - //something went wrong - return new IXR_ERROR(1, 'Could not delete file'); - } else { + $res = media_delete($id, $auth); + if ($res & DOKU_MEDIA_DELETED) { + return 0; + } elseif ($res & DOKU_MEDIA_NOT_AUTH) { + return new IXR_ERROR(1, "You don't have permissions to delete files."); + } elseif ($res & DOKU_MEDIA_INUSE) { return new IXR_ERROR(1, 'File is still referenced'); - } - } - - /** - * Moves the temporary file to its final destination. - * - * Michael Klier <chi@chimeric.de> - */ - function _media_upload_action($data) { - global $conf; - - if(is_array($data) && count($data)===5) { - io_createNamespace($data[2], 'media'); - if(rename($data[0], $data[1])) { - chmod($data[1], $conf['fmode']); - media_notify($data[2], $data[1], $data[3]); - // add a log entry to the media changelog - if ($data[4]) { - addMediaLogEntry(time(), $data[2], DOKU_CHANGE_TYPE_EDIT); - } else { - addMediaLogEntry(time(), $data[2], DOKU_CHANGE_TYPE_CREATE); - } - return $data[2]; - } else { - return new IXR_ERROR(1, 'Upload failed.'); - } } else { - return new IXR_ERROR(1, 'Upload failed.'); + return new IXR_ERROR(1, 'Could not delete file'); } } @@ -725,6 +614,7 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * Returns the permissions of a given wiki page */ function aclCheck($id) { + $id = cleanID($id); return auth_quickaclcheck($id); } @@ -734,13 +624,14 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * @author Michael Klier <chi@chimeric.de> */ function listLinks($id) { + $id = cleanID($id); if(auth_quickaclcheck($id) < AUTH_READ){ return new IXR_Error(1, 'You are not allowed to read this page'); } $links = array(); // resolve page instructions - $ins = p_cached_instructions(wikiFN(cleanID($id))); + $ins = p_cached_instructions(wikiFN($id)); // instantiate new Renderer - needed for interwiki links include(DOKU_INC.'inc/parser/xhtml.php'); @@ -848,6 +739,10 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { * @author Michael Klier <chi@chimeric.de> */ function pageVersions($id, $first) { + $id = cleanID($id); + if(auth_quickaclcheck($id) < AUTH_READ){ + return new IXR_Error(1, 'You are not allowed to read this page'); + } global $conf; $versions = array(); @@ -923,7 +818,8 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { $unlockfail = array(); foreach((array) $set['lock'] as $id){ - if(checklock($id)){ + $id = cleanID($id); + if(auth_quickaclcheck($id) < AUTH_EDIT || checklock($id)){ $lockfail[] = $id; }else{ lock($id); @@ -932,10 +828,11 @@ class dokuwiki_xmlrpc_server extends IXR_IntrospectionServer { } foreach((array) $set['unlock'] as $id){ - if(unlock($id)){ - $unlocked[] = $id; - }else{ + $id = cleanID($id); + if(auth_quickaclcheck($id) < AUTH_EDIT || !unlock($id)){ $unlockfail[] = $id; + }else{ + $unlocked[] = $id; } } diff --git a/lib/images/admin/acl.png b/lib/images/admin/acl.png Binary files differindex 96fb4cd56..c8f610c12 100644 --- a/lib/images/admin/acl.png +++ b/lib/images/admin/acl.png diff --git a/lib/images/admin/config.png b/lib/images/admin/config.png Binary files differindex e4d376d85..3ec3923d1 100644 --- a/lib/images/admin/config.png +++ b/lib/images/admin/config.png diff --git a/lib/images/admin/plugin.png b/lib/images/admin/plugin.png Binary files differindex e2823bac7..f71124e5c 100644 --- a/lib/images/admin/plugin.png +++ b/lib/images/admin/plugin.png diff --git a/lib/images/admin/popularity.png b/lib/images/admin/popularity.png Binary files differindex 4e22aaf0d..19392367a 100644 --- a/lib/images/admin/popularity.png +++ b/lib/images/admin/popularity.png diff --git a/lib/images/admin/revert.png b/lib/images/admin/revert.png Binary files differindex 002d3a75b..5304f1b76 100644 --- a/lib/images/admin/revert.png +++ b/lib/images/admin/revert.png diff --git a/lib/images/admin/usermanager.png b/lib/images/admin/usermanager.png Binary files differindex c5c8dc6d6..898544ce9 100644 --- a/lib/images/admin/usermanager.png +++ b/lib/images/admin/usermanager.png diff --git a/lib/images/close.png b/lib/images/close.png Binary files differindex e1b498c14..4ccef0603 100644 --- a/lib/images/close.png +++ b/lib/images/close.png diff --git a/lib/images/del.png b/lib/images/del.png Binary files differindex a3260d718..e59ded55f 100644 --- a/lib/images/del.png +++ b/lib/images/del.png diff --git a/lib/images/diff.png b/lib/images/diff.png Binary files differindex 0b98d79ac..657b10999 100644 --- a/lib/images/diff.png +++ b/lib/images/diff.png diff --git a/lib/images/error.png b/lib/images/error.png Binary files differindex 8a1ba4c66..7bd84f7a3 100644 --- a/lib/images/error.png +++ b/lib/images/error.png diff --git a/lib/images/fileicons/bz2.png b/lib/images/fileicons/bz2.png Binary files differindex d48cae038..6ec2f98ef 100644 --- a/lib/images/fileicons/bz2.png +++ b/lib/images/fileicons/bz2.png diff --git a/lib/images/fileicons/c.png b/lib/images/fileicons/c.png Binary files differindex 9446afcb4..6f57337c7 100644 --- a/lib/images/fileicons/c.png +++ b/lib/images/fileicons/c.png diff --git a/lib/images/fileicons/conf.png b/lib/images/fileicons/conf.png Binary files differindex ddffe6fd1..20c20fa3d 100644 --- a/lib/images/fileicons/conf.png +++ b/lib/images/fileicons/conf.png diff --git a/lib/images/fileicons/cpp.png b/lib/images/fileicons/cpp.png Binary files differindex 2dc51b16d..6f2797da5 100644 --- a/lib/images/fileicons/cpp.png +++ b/lib/images/fileicons/cpp.png diff --git a/lib/images/fileicons/cs.png b/lib/images/fileicons/cs.png Binary files differindex d5db29ba5..d3afa112c 100644 --- a/lib/images/fileicons/cs.png +++ b/lib/images/fileicons/cs.png diff --git a/lib/images/fileicons/csv.png b/lib/images/fileicons/csv.png Binary files differindex 3a8835360..b604453c4 100644 --- a/lib/images/fileicons/csv.png +++ b/lib/images/fileicons/csv.png diff --git a/lib/images/fileicons/deb.png b/lib/images/fileicons/deb.png Binary files differindex 9229d8783..8fe57327a 100644 --- a/lib/images/fileicons/deb.png +++ b/lib/images/fileicons/deb.png diff --git a/lib/images/fileicons/doc.png b/lib/images/fileicons/doc.png Binary files differindex 932567f8a..79d8ff1cd 100644 --- a/lib/images/fileicons/doc.png +++ b/lib/images/fileicons/doc.png diff --git a/lib/images/fileicons/docx.png b/lib/images/fileicons/docx.png Binary files differindex 932567f8a..79d8ff1cd 100644 --- a/lib/images/fileicons/docx.png +++ b/lib/images/fileicons/docx.png diff --git a/lib/images/fileicons/file.png b/lib/images/fileicons/file.png Binary files differindex 817014fa7..8158a8a21 100644 --- a/lib/images/fileicons/file.png +++ b/lib/images/fileicons/file.png diff --git a/lib/images/fileicons/gif.png b/lib/images/fileicons/gif.png Binary files differindex aa4cc23a5..1d9dd562a 100644 --- a/lib/images/fileicons/gif.png +++ b/lib/images/fileicons/gif.png diff --git a/lib/images/fileicons/gz.png b/lib/images/fileicons/gz.png Binary files differindex 2426bd169..48f19596c 100644 --- a/lib/images/fileicons/gz.png +++ b/lib/images/fileicons/gz.png diff --git a/lib/images/fileicons/htm.png b/lib/images/fileicons/htm.png Binary files differindex 1a6812185..d45e4c19a 100644 --- a/lib/images/fileicons/htm.png +++ b/lib/images/fileicons/htm.png diff --git a/lib/images/fileicons/html.png b/lib/images/fileicons/html.png Binary files differindex 1a6812185..d45e4c19a 100644 --- a/lib/images/fileicons/html.png +++ b/lib/images/fileicons/html.png diff --git a/lib/images/fileicons/jpeg.png b/lib/images/fileicons/jpeg.png Binary files differindex aa4cc23a5..1d9dd562a 100644 --- a/lib/images/fileicons/jpeg.png +++ b/lib/images/fileicons/jpeg.png diff --git a/lib/images/fileicons/jpg.png b/lib/images/fileicons/jpg.png Binary files differindex aa4cc23a5..1d9dd562a 100644 --- a/lib/images/fileicons/jpg.png +++ b/lib/images/fileicons/jpg.png diff --git a/lib/images/fileicons/lua.png b/lib/images/fileicons/lua.png Binary files differindex 7c07d023f..994c6e8f0 100644 --- a/lib/images/fileicons/lua.png +++ b/lib/images/fileicons/lua.png diff --git a/lib/images/fileicons/mp3.png b/lib/images/fileicons/mp3.png Binary files differindex 928705d7a..411dad080 100644 --- a/lib/images/fileicons/mp3.png +++ b/lib/images/fileicons/mp3.png diff --git a/lib/images/fileicons/odc.png b/lib/images/fileicons/odc.png Binary files differindex 47f65c84d..4d6676c3a 100644 --- a/lib/images/fileicons/odc.png +++ b/lib/images/fileicons/odc.png diff --git a/lib/images/fileicons/odf.png b/lib/images/fileicons/odf.png Binary files differindex a2fbc5195..cb88d68e6 100644 --- a/lib/images/fileicons/odf.png +++ b/lib/images/fileicons/odf.png diff --git a/lib/images/fileicons/odg.png b/lib/images/fileicons/odg.png Binary files differindex 74f6303d3..a07216f4a 100644 --- a/lib/images/fileicons/odg.png +++ b/lib/images/fileicons/odg.png diff --git a/lib/images/fileicons/odi.png b/lib/images/fileicons/odi.png Binary files differindex 74f6303d3..a07216f4a 100644 --- a/lib/images/fileicons/odi.png +++ b/lib/images/fileicons/odi.png diff --git a/lib/images/fileicons/odp.png b/lib/images/fileicons/odp.png Binary files differindex 2a94290d7..2f2574af6 100644 --- a/lib/images/fileicons/odp.png +++ b/lib/images/fileicons/odp.png diff --git a/lib/images/fileicons/ods.png b/lib/images/fileicons/ods.png Binary files differindex 47f65c84d..4d6676c3a 100644 --- a/lib/images/fileicons/ods.png +++ b/lib/images/fileicons/ods.png diff --git a/lib/images/fileicons/odt.png b/lib/images/fileicons/odt.png Binary files differindex b0c21fc1f..f9c126efd 100644 --- a/lib/images/fileicons/odt.png +++ b/lib/images/fileicons/odt.png diff --git a/lib/images/fileicons/ogg.png b/lib/images/fileicons/ogg.png Binary files differindex 62cea6aaa..0a21eae65 100644 --- a/lib/images/fileicons/ogg.png +++ b/lib/images/fileicons/ogg.png diff --git a/lib/images/fileicons/pdf.png b/lib/images/fileicons/pdf.png Binary files differindex 638066dea..029dcffec 100644 --- a/lib/images/fileicons/pdf.png +++ b/lib/images/fileicons/pdf.png diff --git a/lib/images/fileicons/php.png b/lib/images/fileicons/php.png Binary files differindex e735f875b..f81e405de 100644 --- a/lib/images/fileicons/php.png +++ b/lib/images/fileicons/php.png diff --git a/lib/images/fileicons/pl.png b/lib/images/fileicons/pl.png Binary files differindex 6ac381cd7..92f3f9754 100644 --- a/lib/images/fileicons/pl.png +++ b/lib/images/fileicons/pl.png diff --git a/lib/images/fileicons/png.png b/lib/images/fileicons/png.png Binary files differindex aa4cc23a5..1d9dd562a 100644 --- a/lib/images/fileicons/png.png +++ b/lib/images/fileicons/png.png diff --git a/lib/images/fileicons/ppt.png b/lib/images/fileicons/ppt.png Binary files differindex adaefc602..b7afb2266 100644 --- a/lib/images/fileicons/ppt.png +++ b/lib/images/fileicons/ppt.png diff --git a/lib/images/fileicons/pptx.png b/lib/images/fileicons/pptx.png Binary files differindex adaefc602..b7afb2266 100644 --- a/lib/images/fileicons/pptx.png +++ b/lib/images/fileicons/pptx.png diff --git a/lib/images/fileicons/ps.png b/lib/images/fileicons/ps.png Binary files differindex c51c763ab..40a80baad 100644 --- a/lib/images/fileicons/ps.png +++ b/lib/images/fileicons/ps.png diff --git a/lib/images/fileicons/py.png b/lib/images/fileicons/py.png Binary files differindex a21b8da49..15a727c54 100644 --- a/lib/images/fileicons/py.png +++ b/lib/images/fileicons/py.png diff --git a/lib/images/fileicons/rar.png b/lib/images/fileicons/rar.png Binary files differindex a6af4d1ca..c761a4f7f 100644 --- a/lib/images/fileicons/rar.png +++ b/lib/images/fileicons/rar.png diff --git a/lib/images/fileicons/rb.png b/lib/images/fileicons/rb.png Binary files differindex 45f448978..408f708a1 100644 --- a/lib/images/fileicons/rb.png +++ b/lib/images/fileicons/rb.png diff --git a/lib/images/fileicons/rpm.png b/lib/images/fileicons/rpm.png Binary files differindex 22212eafa..5cf727de0 100644 --- a/lib/images/fileicons/rpm.png +++ b/lib/images/fileicons/rpm.png diff --git a/lib/images/fileicons/rtf.png b/lib/images/fileicons/rtf.png Binary files differindex d8bada5fe..99fe3d8fd 100644 --- a/lib/images/fileicons/rtf.png +++ b/lib/images/fileicons/rtf.png diff --git a/lib/images/fileicons/sql.png b/lib/images/fileicons/sql.png Binary files differindex f60054a3a..a7b0684c7 100644 --- a/lib/images/fileicons/sql.png +++ b/lib/images/fileicons/sql.png diff --git a/lib/images/fileicons/swf.png b/lib/images/fileicons/swf.png Binary files differindex 0729ed020..ecc7309ad 100644 --- a/lib/images/fileicons/swf.png +++ b/lib/images/fileicons/swf.png diff --git a/lib/images/fileicons/sxc.png b/lib/images/fileicons/sxc.png Binary files differindex 47f65c84d..4d6676c3a 100644 --- a/lib/images/fileicons/sxc.png +++ b/lib/images/fileicons/sxc.png diff --git a/lib/images/fileicons/sxd.png b/lib/images/fileicons/sxd.png Binary files differindex 74f6303d3..a07216f4a 100644 --- a/lib/images/fileicons/sxd.png +++ b/lib/images/fileicons/sxd.png diff --git a/lib/images/fileicons/sxi.png b/lib/images/fileicons/sxi.png Binary files differindex 2a94290d7..2f2574af6 100644 --- a/lib/images/fileicons/sxi.png +++ b/lib/images/fileicons/sxi.png diff --git a/lib/images/fileicons/sxw.png b/lib/images/fileicons/sxw.png Binary files differindex b0c21fc1f..f9c126efd 100644 --- a/lib/images/fileicons/sxw.png +++ b/lib/images/fileicons/sxw.png diff --git a/lib/images/fileicons/tar.png b/lib/images/fileicons/tar.png Binary files differindex 5a2f717fc..a28c86f2d 100644 --- a/lib/images/fileicons/tar.png +++ b/lib/images/fileicons/tar.png diff --git a/lib/images/fileicons/tgz.png b/lib/images/fileicons/tgz.png Binary files differindex 2426bd169..48f19596c 100644 --- a/lib/images/fileicons/tgz.png +++ b/lib/images/fileicons/tgz.png diff --git a/lib/images/fileicons/txt.png b/lib/images/fileicons/txt.png Binary files differindex da20009c6..bb94949f6 100644 --- a/lib/images/fileicons/txt.png +++ b/lib/images/fileicons/txt.png diff --git a/lib/images/fileicons/wav.png b/lib/images/fileicons/wav.png Binary files differindex 79e80760e..c167f4fdb 100644 --- a/lib/images/fileicons/wav.png +++ b/lib/images/fileicons/wav.png diff --git a/lib/images/fileicons/xls.png b/lib/images/fileicons/xls.png Binary files differindex e8cd58dc0..24911b802 100644 --- a/lib/images/fileicons/xls.png +++ b/lib/images/fileicons/xls.png diff --git a/lib/images/fileicons/xlsx.png b/lib/images/fileicons/xlsx.png Binary files differindex e8cd58dc0..24911b802 100644 --- a/lib/images/fileicons/xlsx.png +++ b/lib/images/fileicons/xlsx.png diff --git a/lib/images/fileicons/xml.png b/lib/images/fileicons/xml.png Binary files differindex eb4632397..ae9831b34 100644 --- a/lib/images/fileicons/xml.png +++ b/lib/images/fileicons/xml.png diff --git a/lib/images/fileicons/zip.png b/lib/images/fileicons/zip.png Binary files differindex 999ffbe80..fb8850c9a 100644 --- a/lib/images/fileicons/zip.png +++ b/lib/images/fileicons/zip.png diff --git a/lib/images/history.png b/lib/images/history.png Binary files differindex ef9e311d3..82a418d44 100644 --- a/lib/images/history.png +++ b/lib/images/history.png diff --git a/lib/images/info.png b/lib/images/info.png Binary files differindex a237c1782..121c7336d 100644 --- a/lib/images/info.png +++ b/lib/images/info.png diff --git a/lib/images/interwiki.png b/lib/images/interwiki.png Binary files differindex 73d6f8d39..f957e71e5 100644 --- a/lib/images/interwiki.png +++ b/lib/images/interwiki.png diff --git a/lib/images/interwiki/amazon.de.gif b/lib/images/interwiki/amazon.de.gif Binary files differindex f52c1c581..6e36a051a 100644 --- a/lib/images/interwiki/amazon.de.gif +++ b/lib/images/interwiki/amazon.de.gif diff --git a/lib/images/interwiki/amazon.gif b/lib/images/interwiki/amazon.gif Binary files differindex f52c1c581..6e36a051a 100644 --- a/lib/images/interwiki/amazon.gif +++ b/lib/images/interwiki/amazon.gif diff --git a/lib/images/interwiki/amazon.uk.gif b/lib/images/interwiki/amazon.uk.gif Binary files differindex f52c1c581..6e36a051a 100644 --- a/lib/images/interwiki/amazon.uk.gif +++ b/lib/images/interwiki/amazon.uk.gif diff --git a/lib/images/interwiki/callto.gif b/lib/images/interwiki/callto.gif Binary files differnew file mode 100644 index 000000000..f6d424554 --- /dev/null +++ b/lib/images/interwiki/callto.gif diff --git a/lib/images/interwiki/doku.gif b/lib/images/interwiki/doku.gif Binary files differindex 7dc4248e8..3ccf01227 100644 --- a/lib/images/interwiki/doku.gif +++ b/lib/images/interwiki/doku.gif diff --git a/lib/images/interwiki/google.gif b/lib/images/interwiki/google.gif Binary files differindex fb39f6152..3a28437f3 100644 --- a/lib/images/interwiki/google.gif +++ b/lib/images/interwiki/google.gif diff --git a/lib/images/interwiki/meatball.gif b/lib/images/interwiki/meatball.gif Binary files differindex 7ac545436..8a4cbdbfc 100644 --- a/lib/images/interwiki/meatball.gif +++ b/lib/images/interwiki/meatball.gif diff --git a/lib/images/interwiki/paypal.gif b/lib/images/interwiki/paypal.gif Binary files differnew file mode 100644 index 000000000..1d2834062 --- /dev/null +++ b/lib/images/interwiki/paypal.gif diff --git a/lib/images/interwiki/phpfn.gif b/lib/images/interwiki/phpfn.gif Binary files differindex 638d4c450..89ac1db94 100644 --- a/lib/images/interwiki/phpfn.gif +++ b/lib/images/interwiki/phpfn.gif diff --git a/lib/images/interwiki/sb.gif b/lib/images/interwiki/sb.gif Binary files differindex e272a29b7..710e4945b 100644 --- a/lib/images/interwiki/sb.gif +++ b/lib/images/interwiki/sb.gif diff --git a/lib/images/interwiki/skype.png b/lib/images/interwiki/skype.png Binary files differnew file mode 100644 index 000000000..c70216702 --- /dev/null +++ b/lib/images/interwiki/skype.png diff --git a/lib/images/interwiki/wiki.gif b/lib/images/interwiki/wiki.gif Binary files differindex e8dc5d274..df241d6bb 100644 --- a/lib/images/interwiki/wiki.gif +++ b/lib/images/interwiki/wiki.gif diff --git a/lib/images/interwiki/wp.gif b/lib/images/interwiki/wp.gif Binary files differindex ca853b8c9..b07fd893d 100644 --- a/lib/images/interwiki/wp.gif +++ b/lib/images/interwiki/wp.gif diff --git a/lib/images/interwiki/wpde.gif b/lib/images/interwiki/wpde.gif Binary files differindex ca853b8c9..b07fd893d 100644 --- a/lib/images/interwiki/wpde.gif +++ b/lib/images/interwiki/wpde.gif diff --git a/lib/images/interwiki/wpes.gif b/lib/images/interwiki/wpes.gif Binary files differindex ca853b8c9..b07fd893d 100644 --- a/lib/images/interwiki/wpes.gif +++ b/lib/images/interwiki/wpes.gif diff --git a/lib/images/interwiki/wpfr.gif b/lib/images/interwiki/wpfr.gif Binary files differindex ca853b8c9..b07fd893d 100644 --- a/lib/images/interwiki/wpfr.gif +++ b/lib/images/interwiki/wpfr.gif diff --git a/lib/images/interwiki/wpjp.gif b/lib/images/interwiki/wpjp.gif Binary files differindex ca853b8c9..b07fd893d 100644 --- a/lib/images/interwiki/wpjp.gif +++ b/lib/images/interwiki/wpjp.gif diff --git a/lib/images/interwiki/wpmeta.gif b/lib/images/interwiki/wpmeta.gif Binary files differindex ca853b8c9..b07fd893d 100644 --- a/lib/images/interwiki/wpmeta.gif +++ b/lib/images/interwiki/wpmeta.gif diff --git a/lib/images/interwiki/wppl.gif b/lib/images/interwiki/wppl.gif Binary files differindex ca853b8c9..b07fd893d 100644 --- a/lib/images/interwiki/wppl.gif +++ b/lib/images/interwiki/wppl.gif diff --git a/lib/images/license/badge/cc-by-nc-nd.png b/lib/images/license/badge/cc-by-nc-nd.png Binary files differindex 49f272f82..94aae9e09 100644 --- a/lib/images/license/badge/cc-by-nc-nd.png +++ b/lib/images/license/badge/cc-by-nc-nd.png diff --git a/lib/images/license/badge/cc-by-nc-sa.png b/lib/images/license/badge/cc-by-nc-sa.png Binary files differindex 0f2a0f107..51141f5ec 100644 --- a/lib/images/license/badge/cc-by-nc-sa.png +++ b/lib/images/license/badge/cc-by-nc-sa.png diff --git a/lib/images/license/badge/cc-by-nc.png b/lib/images/license/badge/cc-by-nc.png Binary files differindex 5f9821470..aeb8cdc8c 100644 --- a/lib/images/license/badge/cc-by-nc.png +++ b/lib/images/license/badge/cc-by-nc.png diff --git a/lib/images/license/badge/cc-by-nd.png b/lib/images/license/badge/cc-by-nd.png Binary files differindex 8f317035e..6a2e59a68 100644 --- a/lib/images/license/badge/cc-by-nd.png +++ b/lib/images/license/badge/cc-by-nd.png diff --git a/lib/images/license/badge/cc-by-sa.png b/lib/images/license/badge/cc-by-sa.png Binary files differindex f0a944e0b..f0aa4aaf0 100644 --- a/lib/images/license/badge/cc-by-sa.png +++ b/lib/images/license/badge/cc-by-sa.png diff --git a/lib/images/license/badge/cc-by.png b/lib/images/license/badge/cc-by.png Binary files differindex 822491edb..c7389b2f6 100644 --- a/lib/images/license/badge/cc-by.png +++ b/lib/images/license/badge/cc-by.png diff --git a/lib/images/license/badge/cc-zero.png b/lib/images/license/badge/cc-zero.png Binary files differindex 8a0ef3e3b..fd3dff422 100644 --- a/lib/images/license/badge/cc-zero.png +++ b/lib/images/license/badge/cc-zero.png diff --git a/lib/images/license/badge/cc.png b/lib/images/license/badge/cc.png Binary files differindex a66f4d1a0..8ac73aa4e 100644 --- a/lib/images/license/badge/cc.png +++ b/lib/images/license/badge/cc.png diff --git a/lib/images/license/badge/gnufdl.png b/lib/images/license/badge/gnufdl.png Binary files differindex 1371aba88..e92910128 100644 --- a/lib/images/license/badge/gnufdl.png +++ b/lib/images/license/badge/gnufdl.png diff --git a/lib/images/license/badge/publicdomain.png b/lib/images/license/badge/publicdomain.png Binary files differindex cedc39c62..8148d037a 100644 --- a/lib/images/license/badge/publicdomain.png +++ b/lib/images/license/badge/publicdomain.png diff --git a/lib/images/license/button/cc-by-nc-nd.png b/lib/images/license/button/cc-by-nc-nd.png Binary files differindex b27ead2f6..ac58d8627 100644 --- a/lib/images/license/button/cc-by-nc-nd.png +++ b/lib/images/license/button/cc-by-nc-nd.png diff --git a/lib/images/license/button/cc-by-nc-sa.png b/lib/images/license/button/cc-by-nc-sa.png Binary files differindex 1c54f994d..a9d23c0b6 100644 --- a/lib/images/license/button/cc-by-nc-sa.png +++ b/lib/images/license/button/cc-by-nc-sa.png diff --git a/lib/images/license/button/cc-by-nc.png b/lib/images/license/button/cc-by-nc.png Binary files differindex 33c7b1fa4..d936464ad 100644 --- a/lib/images/license/button/cc-by-nc.png +++ b/lib/images/license/button/cc-by-nc.png diff --git a/lib/images/license/button/cc-by-nd.png b/lib/images/license/button/cc-by-nd.png Binary files differindex 52073c043..3fc490870 100644 --- a/lib/images/license/button/cc-by-nd.png +++ b/lib/images/license/button/cc-by-nd.png diff --git a/lib/images/license/button/cc-by-sa.png b/lib/images/license/button/cc-by-sa.png Binary files differindex 0b1880f91..3c6270a0d 100644 --- a/lib/images/license/button/cc-by-sa.png +++ b/lib/images/license/button/cc-by-sa.png diff --git a/lib/images/license/button/cc-by.png b/lib/images/license/button/cc-by.png Binary files differindex 99d8efd35..867daaee4 100644 --- a/lib/images/license/button/cc-by.png +++ b/lib/images/license/button/cc-by.png diff --git a/lib/images/license/button/cc-zero.png b/lib/images/license/button/cc-zero.png Binary files differindex fc99eff61..251efcd1c 100644 --- a/lib/images/license/button/cc-zero.png +++ b/lib/images/license/button/cc-zero.png diff --git a/lib/images/license/button/cc.png b/lib/images/license/button/cc.png Binary files differindex adfa085bd..9c492950f 100644 --- a/lib/images/license/button/cc.png +++ b/lib/images/license/button/cc.png diff --git a/lib/images/license/button/gnufdl.png b/lib/images/license/button/gnufdl.png Binary files differindex cb815ac13..0b52ea12e 100644 --- a/lib/images/license/button/gnufdl.png +++ b/lib/images/license/button/gnufdl.png diff --git a/lib/images/license/button/publicdomain.png b/lib/images/license/button/publicdomain.png Binary files differindex f78e73d02..54ea38b64 100644 --- a/lib/images/license/button/publicdomain.png +++ b/lib/images/license/button/publicdomain.png diff --git a/lib/images/loading.gif b/lib/images/loading.gif Binary files differindex 240bd88c5..35058e20f 100644 --- a/lib/images/loading.gif +++ b/lib/images/loading.gif diff --git a/lib/images/magnifier.png b/lib/images/magnifier.png Binary files differindex cf3d97f75..89febff10 100644 --- a/lib/images/magnifier.png +++ b/lib/images/magnifier.png diff --git a/lib/images/media_align_center.png b/lib/images/media_align_center.png Binary files differindex 3db90fc17..807f9d9a8 100644 --- a/lib/images/media_align_center.png +++ b/lib/images/media_align_center.png diff --git a/lib/images/media_align_left.png b/lib/images/media_align_left.png Binary files differindex cebbb1a9a..fa6cf33ca 100644 --- a/lib/images/media_align_left.png +++ b/lib/images/media_align_left.png diff --git a/lib/images/media_align_noalign.png b/lib/images/media_align_noalign.png Binary files differindex 74f34e5f1..263e090fe 100644 --- a/lib/images/media_align_noalign.png +++ b/lib/images/media_align_noalign.png diff --git a/lib/images/media_align_right.png b/lib/images/media_align_right.png Binary files differindex 5f54a4a49..33539dbdb 100644 --- a/lib/images/media_align_right.png +++ b/lib/images/media_align_right.png diff --git a/lib/images/media_link_direct.png b/lib/images/media_link_direct.png Binary files differindex 4bdb3541e..4350b803d 100644 --- a/lib/images/media_link_direct.png +++ b/lib/images/media_link_direct.png diff --git a/lib/images/media_link_displaylnk.png b/lib/images/media_link_displaylnk.png Binary files differindex 25eacb7c2..53927566a 100644 --- a/lib/images/media_link_displaylnk.png +++ b/lib/images/media_link_displaylnk.png diff --git a/lib/images/media_link_lnk.png b/lib/images/media_link_lnk.png Binary files differindex 1209164ca..5ff4ee182 100644 --- a/lib/images/media_link_lnk.png +++ b/lib/images/media_link_lnk.png diff --git a/lib/images/media_link_nolnk.png b/lib/images/media_link_nolnk.png Binary files differindex fc3c393ca..c9378c7fd 100644 --- a/lib/images/media_link_nolnk.png +++ b/lib/images/media_link_nolnk.png diff --git a/lib/images/media_size_large.png b/lib/images/media_size_large.png Binary files differindex e2fb548d9..012a418c3 100644 --- a/lib/images/media_size_large.png +++ b/lib/images/media_size_large.png diff --git a/lib/images/media_size_medium.png b/lib/images/media_size_medium.png Binary files differindex b33157256..1469f519f 100644 --- a/lib/images/media_size_medium.png +++ b/lib/images/media_size_medium.png diff --git a/lib/images/media_size_original.png b/lib/images/media_size_original.png Binary files differindex d179aa2db..f58d056aa 100644 --- a/lib/images/media_size_original.png +++ b/lib/images/media_size_original.png diff --git a/lib/images/media_size_small.png b/lib/images/media_size_small.png Binary files differindex 04efe7080..a0aafa4a7 100644 --- a/lib/images/media_size_small.png +++ b/lib/images/media_size_small.png diff --git a/lib/images/minus.gif b/lib/images/minus.gif Binary files differindex 499a2e2aa..7e8cbd754 100644 --- a/lib/images/minus.gif +++ b/lib/images/minus.gif diff --git a/lib/images/multiupload.png b/lib/images/multiupload.png Binary files differindex 1e8efa063..bc16c76d6 100644 --- a/lib/images/multiupload.png +++ b/lib/images/multiupload.png diff --git a/lib/images/notify.png b/lib/images/notify.png Binary files differindex 6e0015df4..c18ef1001 100644 --- a/lib/images/notify.png +++ b/lib/images/notify.png diff --git a/lib/images/ns.png b/lib/images/ns.png Binary files differindex da3c2a2d7..c35e832da 100644 --- a/lib/images/ns.png +++ b/lib/images/ns.png diff --git a/lib/images/page.png b/lib/images/page.png Binary files differindex 03ddd799f..b1b7ebe94 100644 --- a/lib/images/page.png +++ b/lib/images/page.png diff --git a/lib/images/pencil.png b/lib/images/pencil.png Binary files differindex 0bfecd50e..78142b61e 100644 --- a/lib/images/pencil.png +++ b/lib/images/pencil.png diff --git a/lib/images/plus.gif b/lib/images/plus.gif Binary files differindex 9306686d8..3da3b9458 100644 --- a/lib/images/plus.gif +++ b/lib/images/plus.gif diff --git a/lib/images/smileys/delete.gif b/lib/images/smileys/delete.gif Binary files differindex d668348b9..e94c68c56 100644 --- a/lib/images/smileys/delete.gif +++ b/lib/images/smileys/delete.gif diff --git a/lib/images/smileys/facepalm.gif b/lib/images/smileys/facepalm.gif Binary files differnew file mode 100644 index 000000000..5bebb2097 --- /dev/null +++ b/lib/images/smileys/facepalm.gif diff --git a/lib/images/smileys/fixme.gif b/lib/images/smileys/fixme.gif Binary files differindex b66ea99d6..e19141370 100644 --- a/lib/images/smileys/fixme.gif +++ b/lib/images/smileys/fixme.gif diff --git a/lib/images/smileys/icon_arrow.gif b/lib/images/smileys/icon_arrow.gif Binary files differindex 2880055cc..6771defd3 100644 --- a/lib/images/smileys/icon_arrow.gif +++ b/lib/images/smileys/icon_arrow.gif diff --git a/lib/images/smileys/icon_biggrin.gif b/lib/images/smileys/icon_biggrin.gif Binary files differindex d3527723c..aa29c14f6 100644 --- a/lib/images/smileys/icon_biggrin.gif +++ b/lib/images/smileys/icon_biggrin.gif diff --git a/lib/images/smileys/icon_confused.gif b/lib/images/smileys/icon_confused.gif Binary files differindex 0c49e0698..0ea9ed241 100644 --- a/lib/images/smileys/icon_confused.gif +++ b/lib/images/smileys/icon_confused.gif diff --git a/lib/images/smileys/icon_cool.gif b/lib/images/smileys/icon_cool.gif Binary files differindex cead0306c..3469ad482 100644 --- a/lib/images/smileys/icon_cool.gif +++ b/lib/images/smileys/icon_cool.gif diff --git a/lib/images/smileys/icon_cry.gif b/lib/images/smileys/icon_cry.gif Binary files differindex 7d54b1f99..25aea5753 100644 --- a/lib/images/smileys/icon_cry.gif +++ b/lib/images/smileys/icon_cry.gif diff --git a/lib/images/smileys/icon_doubt.gif b/lib/images/smileys/icon_doubt.gif Binary files differindex fd7903b19..b4afc6da7 100644 --- a/lib/images/smileys/icon_doubt.gif +++ b/lib/images/smileys/icon_doubt.gif diff --git a/lib/images/smileys/icon_doubt2.gif b/lib/images/smileys/icon_doubt2.gif Binary files differindex eb4b70b66..1f57eb963 100644 --- a/lib/images/smileys/icon_doubt2.gif +++ b/lib/images/smileys/icon_doubt2.gif diff --git a/lib/images/smileys/icon_eek.gif b/lib/images/smileys/icon_eek.gif Binary files differindex 5d3978106..276b01d55 100644 --- a/lib/images/smileys/icon_eek.gif +++ b/lib/images/smileys/icon_eek.gif diff --git a/lib/images/smileys/icon_evil.gif b/lib/images/smileys/icon_evil.gif Binary files differindex ab1aa8e12..d756916c9 100644 --- a/lib/images/smileys/icon_evil.gif +++ b/lib/images/smileys/icon_evil.gif diff --git a/lib/images/smileys/icon_exclaim.gif b/lib/images/smileys/icon_exclaim.gif Binary files differindex 6e50e2eec..215b32e76 100644 --- a/lib/images/smileys/icon_exclaim.gif +++ b/lib/images/smileys/icon_exclaim.gif diff --git a/lib/images/smileys/icon_frown.gif b/lib/images/smileys/icon_frown.gif Binary files differindex d2ac78c04..d46caf78f 100644 --- a/lib/images/smileys/icon_frown.gif +++ b/lib/images/smileys/icon_frown.gif diff --git a/lib/images/smileys/icon_fun.gif b/lib/images/smileys/icon_fun.gif Binary files differindex a8bb8a303..6d3c44276 100644 --- a/lib/images/smileys/icon_fun.gif +++ b/lib/images/smileys/icon_fun.gif diff --git a/lib/images/smileys/icon_idea.gif b/lib/images/smileys/icon_idea.gif Binary files differindex a40ae0d7e..41eaa0624 100644 --- a/lib/images/smileys/icon_idea.gif +++ b/lib/images/smileys/icon_idea.gif diff --git a/lib/images/smileys/icon_kaddi.gif b/lib/images/smileys/icon_kaddi.gif Binary files differindex 1410f7f1e..56344bbb0 100644 --- a/lib/images/smileys/icon_kaddi.gif +++ b/lib/images/smileys/icon_kaddi.gif diff --git a/lib/images/smileys/icon_lol.gif b/lib/images/smileys/icon_lol.gif Binary files differindex 374ba150f..d1c20c07a 100644 --- a/lib/images/smileys/icon_lol.gif +++ b/lib/images/smileys/icon_lol.gif diff --git a/lib/images/smileys/icon_mrgreen.gif b/lib/images/smileys/icon_mrgreen.gif Binary files differindex b54cd0f94..fc5d91683 100644 --- a/lib/images/smileys/icon_mrgreen.gif +++ b/lib/images/smileys/icon_mrgreen.gif diff --git a/lib/images/smileys/icon_neutral.gif b/lib/images/smileys/icon_neutral.gif Binary files differindex 4f311567e..c82a974c7 100644 --- a/lib/images/smileys/icon_neutral.gif +++ b/lib/images/smileys/icon_neutral.gif diff --git a/lib/images/smileys/icon_question.gif b/lib/images/smileys/icon_question.gif Binary files differindex 9d072265b..4e3092498 100644 --- a/lib/images/smileys/icon_question.gif +++ b/lib/images/smileys/icon_question.gif diff --git a/lib/images/smileys/icon_razz.gif b/lib/images/smileys/icon_razz.gif Binary files differindex 29da2a2fc..310655eec 100644 --- a/lib/images/smileys/icon_razz.gif +++ b/lib/images/smileys/icon_razz.gif diff --git a/lib/images/smileys/icon_redface.gif b/lib/images/smileys/icon_redface.gif Binary files differindex ad7628320..160c20f33 100644 --- a/lib/images/smileys/icon_redface.gif +++ b/lib/images/smileys/icon_redface.gif diff --git a/lib/images/smileys/icon_rolleyes.gif b/lib/images/smileys/icon_rolleyes.gif Binary files differindex d7f5f2f4b..502c5c174 100644 --- a/lib/images/smileys/icon_rolleyes.gif +++ b/lib/images/smileys/icon_rolleyes.gif diff --git a/lib/images/smileys/icon_sad.gif b/lib/images/smileys/icon_sad.gif Binary files differindex d2ac78c04..d46caf78f 100644 --- a/lib/images/smileys/icon_sad.gif +++ b/lib/images/smileys/icon_sad.gif diff --git a/lib/images/smileys/icon_silenced.gif b/lib/images/smileys/icon_silenced.gif Binary files differindex 448399b2b..5f722e04e 100644 --- a/lib/images/smileys/icon_silenced.gif +++ b/lib/images/smileys/icon_silenced.gif diff --git a/lib/images/smileys/icon_smile.gif b/lib/images/smileys/icon_smile.gif Binary files differindex 7b1f6d304..df125e2b5 100644 --- a/lib/images/smileys/icon_smile.gif +++ b/lib/images/smileys/icon_smile.gif diff --git a/lib/images/smileys/icon_smile2.gif b/lib/images/smileys/icon_smile2.gif Binary files differindex 769639d32..6b4909c81 100644 --- a/lib/images/smileys/icon_smile2.gif +++ b/lib/images/smileys/icon_smile2.gif diff --git a/lib/images/smileys/icon_surprised.gif b/lib/images/smileys/icon_surprised.gif Binary files differindex cb2142431..aaa94f1da 100644 --- a/lib/images/smileys/icon_surprised.gif +++ b/lib/images/smileys/icon_surprised.gif diff --git a/lib/images/smileys/icon_twisted.gif b/lib/images/smileys/icon_twisted.gif Binary files differindex 502fe247e..eaec19338 100644 --- a/lib/images/smileys/icon_twisted.gif +++ b/lib/images/smileys/icon_twisted.gif diff --git a/lib/images/smileys/icon_wink.gif b/lib/images/smileys/icon_wink.gif Binary files differindex d14828804..78b6ad3db 100644 --- a/lib/images/smileys/icon_wink.gif +++ b/lib/images/smileys/icon_wink.gif diff --git a/lib/images/success.png b/lib/images/success.png Binary files differindex a5ae9f11b..9241adbb2 100644 --- a/lib/images/success.png +++ b/lib/images/success.png diff --git a/lib/images/throbber.gif b/lib/images/throbber.gif Binary files differindex d04bd3949..27178a8cf 100644 --- a/lib/images/throbber.gif +++ b/lib/images/throbber.gif diff --git a/lib/images/toolbar/bold.png b/lib/images/toolbar/bold.png Binary files differindex 7ebe99ee9..51ddb8880 100644 --- a/lib/images/toolbar/bold.png +++ b/lib/images/toolbar/bold.png diff --git a/lib/images/toolbar/chars.png b/lib/images/toolbar/chars.png Binary files differindex 3f3396aeb..bad37e503 100644 --- a/lib/images/toolbar/chars.png +++ b/lib/images/toolbar/chars.png diff --git a/lib/images/toolbar/h.png b/lib/images/toolbar/h.png Binary files differindex aae052462..6a48cbbc0 100644 --- a/lib/images/toolbar/h.png +++ b/lib/images/toolbar/h.png diff --git a/lib/images/toolbar/h1.png b/lib/images/toolbar/h1.png Binary files differindex 93dae935f..85bd06e6c 100644 --- a/lib/images/toolbar/h1.png +++ b/lib/images/toolbar/h1.png diff --git a/lib/images/toolbar/h2.png b/lib/images/toolbar/h2.png Binary files differindex f0eee3bd0..be2c60031 100644 --- a/lib/images/toolbar/h2.png +++ b/lib/images/toolbar/h2.png diff --git a/lib/images/toolbar/h3.png b/lib/images/toolbar/h3.png Binary files differindex 8cfd4c077..350da88b6 100644 --- a/lib/images/toolbar/h3.png +++ b/lib/images/toolbar/h3.png diff --git a/lib/images/toolbar/h4.png b/lib/images/toolbar/h4.png Binary files differindex 7b8f51a1b..bc1b7038f 100644 --- a/lib/images/toolbar/h4.png +++ b/lib/images/toolbar/h4.png diff --git a/lib/images/toolbar/h5.png b/lib/images/toolbar/h5.png Binary files differindex 44b00d9c8..b6c263dfb 100644 --- a/lib/images/toolbar/h5.png +++ b/lib/images/toolbar/h5.png diff --git a/lib/images/toolbar/hequal.png b/lib/images/toolbar/hequal.png Binary files differindex 8fc6b0d75..da4e921ff 100644 --- a/lib/images/toolbar/hequal.png +++ b/lib/images/toolbar/hequal.png diff --git a/lib/images/toolbar/hminus.png b/lib/images/toolbar/hminus.png Binary files differindex f9d67adcb..c00f70223 100644 --- a/lib/images/toolbar/hminus.png +++ b/lib/images/toolbar/hminus.png diff --git a/lib/images/toolbar/hplus.png b/lib/images/toolbar/hplus.png Binary files differindex 66f3d5e33..6124b5c33 100644 --- a/lib/images/toolbar/hplus.png +++ b/lib/images/toolbar/hplus.png diff --git a/lib/images/toolbar/hr.png b/lib/images/toolbar/hr.png Binary files differindex f86a8ec94..de3a8a55b 100644 --- a/lib/images/toolbar/hr.png +++ b/lib/images/toolbar/hr.png diff --git a/lib/images/toolbar/image.png b/lib/images/toolbar/image.png Binary files differindex 1aab5d7de..70b12fcc2 100644 --- a/lib/images/toolbar/image.png +++ b/lib/images/toolbar/image.png diff --git a/lib/images/toolbar/italic.png b/lib/images/toolbar/italic.png Binary files differindex 324e7c036..d69e66070 100644 --- a/lib/images/toolbar/italic.png +++ b/lib/images/toolbar/italic.png diff --git a/lib/images/toolbar/link.png b/lib/images/toolbar/link.png Binary files differindex 41e52c6ab..01105b0d3 100644 --- a/lib/images/toolbar/link.png +++ b/lib/images/toolbar/link.png diff --git a/lib/images/toolbar/linkextern.png b/lib/images/toolbar/linkextern.png Binary files differindex 75afd3dc2..acc0c6fc5 100644 --- a/lib/images/toolbar/linkextern.png +++ b/lib/images/toolbar/linkextern.png diff --git a/lib/images/toolbar/mono.png b/lib/images/toolbar/mono.png Binary files differindex 178cec9f2..b91ad2e0d 100644 --- a/lib/images/toolbar/mono.png +++ b/lib/images/toolbar/mono.png diff --git a/lib/images/toolbar/ol.png b/lib/images/toolbar/ol.png Binary files differindex 3162fa21d..186f1fad4 100644 --- a/lib/images/toolbar/ol.png +++ b/lib/images/toolbar/ol.png diff --git a/lib/images/toolbar/sig.png b/lib/images/toolbar/sig.png Binary files differindex ef997b7cd..72fdad0a0 100644 --- a/lib/images/toolbar/sig.png +++ b/lib/images/toolbar/sig.png diff --git a/lib/images/toolbar/smiley.png b/lib/images/toolbar/smiley.png Binary files differindex e92845cb4..85036c1a8 100644 --- a/lib/images/toolbar/smiley.png +++ b/lib/images/toolbar/smiley.png diff --git a/lib/images/toolbar/strike.png b/lib/images/toolbar/strike.png Binary files differindex 203aacc2b..e532d1f07 100644 --- a/lib/images/toolbar/strike.png +++ b/lib/images/toolbar/strike.png diff --git a/lib/images/toolbar/ul.png b/lib/images/toolbar/ul.png Binary files differindex 471171db4..008820722 100644 --- a/lib/images/toolbar/ul.png +++ b/lib/images/toolbar/ul.png diff --git a/lib/images/toolbar/underline.png b/lib/images/toolbar/underline.png Binary files differindex bf9665a68..fa271517c 100644 --- a/lib/images/toolbar/underline.png +++ b/lib/images/toolbar/underline.png diff --git a/lib/images/trash.png b/lib/images/trash.png Binary files differindex ebad933c8..350c5e1cf 100644 --- a/lib/images/trash.png +++ b/lib/images/trash.png diff --git a/lib/images/up.png b/lib/images/up.png Binary files differindex 557d5e6a9..b1eac912d 100644 --- a/lib/images/up.png +++ b/lib/images/up.png diff --git a/lib/plugins/acl/admin.php b/lib/plugins/acl/admin.php index 3e7bd8121..7c12b3374 100644 --- a/lib/plugins/acl/admin.php +++ b/lib/plugins/acl/admin.php @@ -17,7 +17,7 @@ if(!defined('DOKU_INC')) die(); class admin_plugin_acl extends DokuWiki_Admin_Plugin { var $acl = null; var $ns = null; - /** + /** * The currently selected item, associative array with id and type. * Populated from (in this order): * $_REQUEST['current_ns'] @@ -37,7 +37,7 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { return array( 'author' => 'Andreas Gohr', 'email' => 'andi@splitbrain.org', - 'date' => '2010-01-17', + 'date' => '2011-04-16', 'name' => 'ACL Manager', 'desc' => 'Manage Page Access Control Lists', 'url' => 'http://dokuwiki.org/plugin:acl', @@ -72,7 +72,7 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { global $config_cascade; // fresh 1:1 copy without replacements - $AUTH_ACL = file(DOKU_CONF.'acl.auth.php'); + $AUTH_ACL = file($config_cascade['acl']['default']); // namespace given? @@ -253,19 +253,12 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { $data = $this->_get_tree($ns); // wrap a list with the root level around the other namespaces - $item = array( 'level' => 0, 'id' => '*', 'type' => 'd', - 'open' =>'true', 'label' => '['.$lang['mediaroot'].']'); + array_unshift($data, array( 'level' => 0, 'id' => '*', 'type' => 'd', + 'open' =>'true', 'label' => '['.$lang['mediaroot'].']')); - echo '<ul class="acltree">'; - echo $this->_html_li_acl($item); - echo '<div class="li">'; - echo $this->_html_list_acl($item); - echo '</div>'; echo html_buildlist($data,'acl', array($this,'_html_list_acl'), array($this,'_html_li_acl')); - echo '</li>'; - echo '</ul>'; } @@ -449,7 +442,7 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { $user = ''; $groups = array(ltrim($who,'@')); }else{ - $user = auth_nameencode($who); + $user = $who; $info = $auth->getUserData($user); if($info === false){ $groups = array(); @@ -521,7 +514,7 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { } // highlight? - if( ($item['type']== $this->current_item['type'] && $item['id'] == $this->current_item['id'])) + if( ($item['type']== $this->current_item['type'] && $item['id'] == $this->current_item['id'])) $cl = ' cur'; // namespace or page? @@ -711,7 +704,7 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { $new_config = $acl_config.$new_acl; - return io_saveFile(DOKU_CONF.'acl.auth.php', $new_config); + return io_saveFile($config_cascade['acl']['default'], $new_config); } /** @@ -729,7 +722,7 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { // save all non!-matching $new_config = preg_grep("/$acl_pattern/", $acl_config, PREG_GREP_INVERT); - return io_saveFile(DOKU_CONF.'acl.auth.php', join('',$new_config)); + return io_saveFile($config_cascade['acl']['default'], join('',$new_config)); } /** @@ -800,38 +793,42 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { echo '<select name="acl_t" class="edit">'.NL; echo ' <option value="__g__" class="aclgroup"'.$gsel.'>'.$this->getLang('acl_group').':</option>'.NL; echo ' <option value="__u__" class="acluser"'.$usel.'>'.$this->getLang('acl_user').':</option>'.NL; - echo ' <optgroup label=" ">'.NL; - foreach($this->specials as $ug){ - if($ug == $this->who){ - $sel = ' selected="selected"'; - $inlist = true; - }else{ - $sel = ''; - } + if (!empty($this->specials)) { + echo ' <optgroup label=" ">'.NL; + foreach($this->specials as $ug){ + if($ug == $this->who){ + $sel = ' selected="selected"'; + $inlist = true; + }else{ + $sel = ''; + } - if($ug{0} == '@'){ - echo ' <option value="'.hsc($ug).'" class="aclgroup"'.$sel.'>'.hsc($ug).'</option>'.NL; - }else{ - echo ' <option value="'.hsc($ug).'" class="acluser"'.$sel.'>'.hsc($ug).'</option>'.NL; + if($ug{0} == '@'){ + echo ' <option value="'.hsc($ug).'" class="aclgroup"'.$sel.'>'.hsc($ug).'</option>'.NL; + }else{ + echo ' <option value="'.hsc($ug).'" class="acluser"'.$sel.'>'.hsc($ug).'</option>'.NL; + } } + echo ' </optgroup>'.NL; } - echo ' </optgroup>'.NL; - echo ' <optgroup label=" ">'.NL; - foreach($this->usersgroups as $ug){ - if($ug == $this->who){ - $sel = ' selected="selected"'; - $inlist = true; - }else{ - $sel = ''; - } + if (!empty($this->usersgroups)) { + echo ' <optgroup label=" ">'.NL; + foreach($this->usersgroups as $ug){ + if($ug == $this->who){ + $sel = ' selected="selected"'; + $inlist = true; + }else{ + $sel = ''; + } - if($ug{0} == '@'){ - echo ' <option value="'.hsc($ug).'" class="aclgroup"'.$sel.'>'.hsc($ug).'</option>'.NL; - }else{ - echo ' <option value="'.hsc($ug).'" class="acluser"'.$sel.'>'.hsc($ug).'</option>'.NL; + if($ug{0} == '@'){ + echo ' <option value="'.hsc($ug).'" class="aclgroup"'.$sel.'>'.hsc($ug).'</option>'.NL; + }else{ + echo ' <option value="'.hsc($ug).'" class="acluser"'.$sel.'>'.hsc($ug).'</option>'.NL; + } } + echo ' </optgroup>'.NL; } - echo ' </optgroup>'.NL; echo '</select>'.NL; return $inlist; } diff --git a/lib/plugins/acl/ajax.php b/lib/plugins/acl/ajax.php index d91586a5d..d704fa8c9 100644 --- a/lib/plugins/acl/ajax.php +++ b/lib/plugins/acl/ajax.php @@ -44,13 +44,10 @@ if($ajax == 'info'){ $data = $acl->_get_tree($ns,$ns); - foreach($data as $item){ - $item['level'] = $lvl+1; - echo $acl->_html_li_acl($item); - echo '<div class="li">'; - echo $acl->_html_list_acl($item); - echo '</div>'; - echo '</li>'; + foreach(array_keys($data) as $item){ + $data[$item]['level'] = $lvl+1; } + echo html_buildlist($data, 'acl', array($acl, '_html_list_acl'), + array($acl, '_html_li_acl')); } diff --git a/lib/plugins/acl/lang/ar/help.txt b/lib/plugins/acl/lang/ar/help.txt index afae13a86..70f5cf645 100644 --- a/lib/plugins/acl/lang/ar/help.txt +++ b/lib/plugins/acl/lang/ar/help.txt @@ -8,4 +8,4 @@ في الجدول في الأسفل تجد قواعد التحكم بالوصول معروضة. يمكنك استخدامها لحذف أو تغيير عدة قواعد بسرعة. -قراءة [[doku>acl|المستندات الرسمية عن ACL]] قد يساعدك على الفهم الكامل لطريقة عمل التحكم بالوصول في دوكي ويكي. +قراءة [[doku>acl|المستندات الرسمية عن ACL]] قد يساعدك على الفهم الكامل لطريقة عمل التحكم بالوصول في دوكو ويكي. diff --git a/lib/plugins/acl/lang/ar/lang.php b/lib/plugins/acl/lang/ar/lang.php index 552ce90d9..7c05b721c 100644 --- a/lib/plugins/acl/lang/ar/lang.php +++ b/lib/plugins/acl/lang/ar/lang.php @@ -6,6 +6,7 @@ * @author Mostafa Hussein <mostafa@gmail.com> * @author Yaman Hokan <always.smile.yh@hotmail.com> * @author Usama Akkad <uahello@gmail.com> + * @author uahello@gmail.com */ $lang['admin_acl'] = 'إدارة قوائم التحكم بالدخول'; $lang['acl_group'] = 'مجموعة'; diff --git a/lib/plugins/acl/lang/bg/help.txt b/lib/plugins/acl/lang/bg/help.txt index 23028cb35..2de453420 100644 --- a/lib/plugins/acl/lang/bg/help.txt +++ b/lib/plugins/acl/lang/bg/help.txt @@ -1,11 +1,11 @@ === Помощ === -На тази страница можете да добавяте и премахвате разрешения за определяне на имена и страници във Вашето Wiki. +От тук можете да добавяте и премахвате права за именни пространства и страници във вашето Wiki. -Левият панел показва всички налични имена и страници. +Левият панел показва всички налични именни пространства и страници. -Формата по-горе ви позволява да видите и промените разрешенията на избрания потребител или група. +Формата отгоре ви позволява да преглеждате и променяте правата на избран потребител или група. -В таблицата по-долу са показани всички актуални правила за контрол на достъпа. Можете да я използвате за бързо изтриване или промяна на множество правила. +В таблицата отдолу са показани всички актуални правила за контрол на достъпа. Можете да я ползвате за бързо изтриване или промяна на множество правила. -Четене на [[doku>acl|ACL документацията]] може да ви помогне да разберете напълно как работи контрола на достъпа в DokuWiki.
\ No newline at end of file +За да разберете как работи контрола на достъпа в DokuWiki трябва да прочетете [[doku>acl|документацията относно ACL]].
\ No newline at end of file diff --git a/lib/plugins/acl/lang/bg/lang.php b/lib/plugins/acl/lang/bg/lang.php index 9facd4259..0746e32c9 100644 --- a/lib/plugins/acl/lang/bg/lang.php +++ b/lib/plugins/acl/lang/bg/lang.php @@ -5,6 +5,7 @@ * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) * @author Nikolay Vladimirov <nikolay@vladimiroff.com> * @author Viktor Usunov <usun0v@mail.bg> + * @author Kiril <neohidra@gmail.com> */ $lang['admin_acl'] = 'Управление на списъците за достъп'; $lang['acl_group'] = 'Група'; @@ -13,17 +14,17 @@ $lang['acl_perms'] = 'Права за'; $lang['page'] = 'Страница'; $lang['namespace'] = 'Именно пространство'; $lang['btn_select'] = 'Избери'; -$lang['p_user_id'] = 'Потребителят <b class="acluser">%s</b> има в момента следните права за страницата <b class="aclpage">%s</b>: <i>%s</i>.'; -$lang['p_user_ns'] = 'Потребителят <b class="acluser">%s</b> има в момента следните права в именното пространство <b class="aclns">%s</b>: <i>%s</i>.'; -$lang['p_group_id'] = 'Членове на групата <b class="aclgroup">%s</b> имат в момента следните права за страницата <b class="aclpage">%s</b>: <i>%s</i>.'; -$lang['p_group_ns'] = 'Членове на групата <b class="aclgroup">%s</b> имат в момента следните права в именното пространство <b class="aclns">%s</b>: <i>%s</i>.'; -$lang['p_choose_id'] = 'Моля <b>въведете потребител или група</b> в полето горе, за да видите или промените правата за страницата <b class="aclpage">%s</b>.'; -$lang['p_choose_ns'] = 'Моля <b>въведете потребител или група</b> в полето горе, за да видите или промените правата за именното пространство <b class="aclns">%s</b>.'; -$lang['p_inherited'] = 'Забележка: Тези разрешения не са определени изрично, но са били наследени от други групи или именни пространства.'; -$lang['p_isadmin'] = 'Забележка: Избраните група или потребител притежават пълни права, според конфигурацията им.'; -$lang['p_include'] = 'Висши разрешения включват по-нисши такива. Създаване или премахване на разрешения се прилага само за именни пространства, не за страници.'; +$lang['p_user_id'] = 'Потребителят <b class="acluser">%s</b> в момента има следните права за страницата <b class="aclpage">%s</b>: <i>%s</i>.'; +$lang['p_user_ns'] = 'Потребителят <b class="acluser">%s</b> в момента има следните права за именното пространство <b class="aclns">%s</b>: <i>%s</i>.'; +$lang['p_group_id'] = 'Членовете на групата <b class="aclgroup">%s</b> в момента имат следните права за страницата <b class="aclpage">%s</b>: <i>%s</i>.'; +$lang['p_group_ns'] = 'Членовете на групата <b class="aclgroup">%s</b> в момента имат следните права за именното пространство <b class="aclns">%s</b>: <i>%s</i>.'; +$lang['p_choose_id'] = 'Моля, <b>въведете потребител или група</b> в полето отгоре, за да видите или промените правата за страницата <b class="aclpage">%s</b>.'; +$lang['p_choose_ns'] = 'Моля, <b>въведете потребител или група</b> в полето отгоре, за да видите или промените правата за именното пространство <b class="aclns">%s</b>.'; +$lang['p_inherited'] = 'Бележка: Тези разрешения не са зададени директно, а са наследени от други групи или именни пространства.'; +$lang['p_isadmin'] = 'Бележка: Избраната група или потребител има всички права, защото е определен за суперпотребител.'; +$lang['p_include'] = 'Висши права включват по-нисшите такива. Правата за създаване, качване и изтриване са приложими само за именни пространства, но не за страници.'; $lang['current'] = 'Текущи ACL права'; -$lang['where'] = 'Страница/Именно постранство'; +$lang['where'] = 'Страница/Именно пространство'; $lang['who'] = 'Потребител/Група'; $lang['perm'] = 'Права'; $lang['acl_perm0'] = 'Никакви'; @@ -32,5 +33,5 @@ $lang['acl_perm2'] = 'Редактиране'; $lang['acl_perm4'] = 'Създаване'; $lang['acl_perm8'] = 'Качване'; $lang['acl_perm16'] = 'Изтриване'; -$lang['acl_new'] = 'Добавяне на ново'; -$lang['acl_mod'] = 'Промяна на вписване'; +$lang['acl_new'] = 'Добавяне на право'; +$lang['acl_mod'] = 'Промяна на записа'; diff --git a/lib/plugins/acl/lang/cs/lang.php b/lib/plugins/acl/lang/cs/lang.php index 311b79ae9..7c1efbd4c 100644 --- a/lib/plugins/acl/lang/cs/lang.php +++ b/lib/plugins/acl/lang/cs/lang.php @@ -8,6 +8,7 @@ * @author tomas@valenta.cz * @author Marek Sacha <sachamar@fel.cvut.cz> * @author Lefty <lefty@multihost.cz> + * @author Vojta Beran <xmamut@email.cz> */ $lang['admin_acl'] = 'Správa přístupových práv'; $lang['acl_group'] = 'Skupina'; diff --git a/lib/plugins/acl/lang/de-informal/lang.php b/lib/plugins/acl/lang/de-informal/lang.php index fdb6f5a89..e24584a55 100644 --- a/lib/plugins/acl/lang/de-informal/lang.php +++ b/lib/plugins/acl/lang/de-informal/lang.php @@ -6,6 +6,7 @@ * @author Juergen Schwarzer <jschwarzer@freenet.de> * @author Marcel Metz <marcel_metz@gmx.de> * @author Matthias Schulte <post@lupo49.de> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['admin_acl'] = 'Zugriffskontrollsystem Management'; $lang['acl_group'] = 'Gruppe'; diff --git a/lib/plugins/acl/lang/de/lang.php b/lib/plugins/acl/lang/de/lang.php index 0d30fe7a1..3c6bf8cf0 100644 --- a/lib/plugins/acl/lang/de/lang.php +++ b/lib/plugins/acl/lang/de/lang.php @@ -17,6 +17,8 @@ * @author Blitzi94@gmx.de * @author Robert Bogenschneider <robog@GMX.de> * @author Robert Bogenschneider <robog@gmx.de> + * @author Niels Lange <niels@boldencursief.nl> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['admin_acl'] = 'Zugangsverwaltung'; $lang['acl_group'] = 'Gruppe'; diff --git a/lib/plugins/acl/lang/es/lang.php b/lib/plugins/acl/lang/es/lang.php index e63448a00..096320af9 100644 --- a/lib/plugins/acl/lang/es/lang.php +++ b/lib/plugins/acl/lang/es/lang.php @@ -19,6 +19,7 @@ * @author Fernando J. Gómez <fjgomez@gmail.com> * @author Victor Castelan <victorcastelan@gmail.com> * @author Mauro Javier Giamberardino <mgiamberardino@gmail.com> + * @author emezeta <emezeta@infoprimo.com> */ $lang['admin_acl'] = 'Administración de lista de control de acceso'; $lang['acl_group'] = 'Grupo'; diff --git a/lib/plugins/acl/lang/et/lang.php b/lib/plugins/acl/lang/et/lang.php index 2f7208b7c..bc4c73a16 100644 --- a/lib/plugins/acl/lang/et/lang.php +++ b/lib/plugins/acl/lang/et/lang.php @@ -3,21 +3,26 @@ * Estonian language file * * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) - * @author Oliver S6ro <seem.iges@mail.ee> - * @author Aari Juhanson <aari@vmg.vil.ee> - * @author Kaiko Kaur <kaiko@kultuur.edu.ee> + * @author Oliver S6ro <seem.iges@mail.ee> + * @author Aari Juhanson <aari@vmg.vil.ee> + * @author Kaiko Kaur <kaiko@kultuur.edu.ee> + * @author kristian.kankainen@kuu.la + * @author Rivo Zängov <eraser@eraser.ee> */ - -$lang['admin_acl'] = 'Ligipääsukontrolli nimekirja haldamine'; -$lang['acl_group'] = 'Grupp'; -$lang['acl_user'] = 'Kasutaja'; -$lang['acl_perms'] = 'Lubatud'; -$lang['page'] = 'leht'; -$lang['namespace'] = 'alajaotus'; - -$lang['acl_perm1'] = 'Lugemine'; -$lang['acl_perm2'] = 'Toimetamine'; -$lang['acl_perm4'] = 'Tekitamine'; -$lang['acl_perm8'] = 'Üles laadimine'; -$lang['acl_new'] = 'Uue kirje lisamine'; -//Setup VIM: ex: et ts=2 : +$lang['admin_acl'] = 'Ligipääsukontrolli nimekirja haldamine'; +$lang['acl_group'] = 'Grupp'; +$lang['acl_user'] = 'Kasutaja'; +$lang['acl_perms'] = 'Lubatud'; +$lang['page'] = 'leht'; +$lang['namespace'] = 'alajaotus'; +$lang['btn_select'] = 'Vali'; +$lang['who'] = 'Kasutaja/Grupp'; +$lang['perm'] = 'Õigused'; +$lang['acl_perm0'] = 'Pole'; +$lang['acl_perm1'] = 'Lugemine'; +$lang['acl_perm2'] = 'Toimetamine'; +$lang['acl_perm4'] = 'Tekitamine'; +$lang['acl_perm8'] = 'Üles laadimine'; +$lang['acl_perm16'] = 'Kustuta'; +$lang['acl_new'] = 'Uue kirje lisamine'; +$lang['acl_mod'] = 'Muuda sissekannet'; diff --git a/lib/plugins/acl/lang/fi/lang.php b/lib/plugins/acl/lang/fi/lang.php index 04074d8d4..4f145e0f6 100644 --- a/lib/plugins/acl/lang/fi/lang.php +++ b/lib/plugins/acl/lang/fi/lang.php @@ -5,6 +5,7 @@ * @author otto@valjakko.net * @author Otto Vainio <otto@valjakko.net> * @author Teemu Mattila <ghcsystems@gmail.com> + * @author Sami Olmari <sami@olmari.fi> */ $lang['admin_acl'] = 'Käyttöoikeudet (ACL)'; $lang['acl_group'] = 'Ryhmä'; diff --git a/lib/plugins/acl/lang/fr/lang.php b/lib/plugins/acl/lang/fr/lang.php index 63e529aab..fd3f40dfc 100644 --- a/lib/plugins/acl/lang/fr/lang.php +++ b/lib/plugins/acl/lang/fr/lang.php @@ -20,6 +20,8 @@ * @author Philippe Bajoit <philippe.bajoit@gmail.com> * @author Florian Gaub <floriang@floriang.net> * @author Samuel Dorsaz samuel.dorsaz@novelion.net + * @author Johan Guilbaud <guilbaud.johan@gmail.com> + * @author schplurtz@laposte.net */ $lang['admin_acl'] = 'Gestion de la liste des contrôles d\'accès (ACL)'; $lang['acl_group'] = 'Groupe'; diff --git a/lib/plugins/acl/lang/he/lang.php b/lib/plugins/acl/lang/he/lang.php index ac00730dd..91025f4b8 100644 --- a/lib/plugins/acl/lang/he/lang.php +++ b/lib/plugins/acl/lang/he/lang.php @@ -7,6 +7,7 @@ * @author Dotan Kamber <kamberd@yahoo.com> * @author Moshe Kaplan <mokplan@gmail.com> * @author Yaron Yogev <yaronyogev@gmail.com> + * @author Yaron Shahrabani <sh.yaron@gmail.com> */ $lang['admin_acl'] = 'ניהול רשימת בקרת גישות'; $lang['acl_group'] = 'קבוצה'; diff --git a/lib/plugins/acl/lang/hr/help.txt b/lib/plugins/acl/lang/hr/help.txt new file mode 100644 index 000000000..4e7cfc3c2 --- /dev/null +++ b/lib/plugins/acl/lang/hr/help.txt @@ -0,0 +1,11 @@ +=== Brza Pomoć: === + +Na ovoj stranici možeš dodavati i brisati dozvole za imenske prostore i stranice u svom wiki-u. + +Lijevi prozor prikazuje sve dostupne imenske prostore i stranice. + +Forma iznad ti omogućuje pregled i mijenjanje dozvola odabranom korisniku ili grupi. + +U tablici ispod prikazana su sva trenutno postavljena pravila kontrole pristupa. Koristite je za višestruko brisanje ili mijenjanje pravila. + +Čitanje [[doku>acl|službena dokumentacija o ACL]] može vam pomoći potpuno razumijeti kako kontrola pristupa radi u DokuWiki.
\ No newline at end of file diff --git a/lib/plugins/acl/lang/hr/lang.php b/lib/plugins/acl/lang/hr/lang.php index d2094b77b..8c21f1b0b 100644 --- a/lib/plugins/acl/lang/hr/lang.php +++ b/lib/plugins/acl/lang/hr/lang.php @@ -4,4 +4,33 @@ * * @author Branko Rihtman <theney@gmail.com> * @author Dražen Odobašić <dodobasic@gmail.com> + * @author Dejan Igrec dejan.igrec@gmail.com */ +$lang['admin_acl'] = 'Upravljanje listom kontrole pristupa'; +$lang['acl_group'] = 'Grupa'; +$lang['acl_user'] = 'Korisnik'; +$lang['acl_perms'] = 'Dozvole za'; +$lang['page'] = 'Stranica'; +$lang['namespace'] = 'Imenski prostor'; +$lang['btn_select'] = 'Odaberi'; +$lang['p_user_id'] = 'Korisnik <b class="acluser">%s</b> trenutno ima sljedeće dozvole na stranici <b class="aclpage">%s</b>: <i>%s</i>.'; +$lang['p_user_ns'] = 'Korisnik <b class="acluser">%s</b> trenutno ima sljedeće dozvole u imenskom prostoru <b class="aclns">%s</b>: <i>%s</i>.'; +$lang['p_group_id'] = 'Članovi grupe <b class="aclgroup">%s</b> trenutno imaju sljedeće dozvole na stranici <b class="aclpage">%s</b>: <i>%s</i>.'; +$lang['p_group_ns'] = 'Članovi grupe <b class="aclgroup">%s</b> trenutno imaju sljedeće dozvole u imenskom prostoru <b class="aclns">%s</b>: <i>%s</i>.'; +$lang['p_choose_id'] = 'Molim <b>unesti korisnika ili grupu</b> u gornju formu za pregled ili uređivanje dozvola postavljenih za stranicu <b class="aclpage">%s</b>.'; +$lang['p_choose_ns'] = 'Molim <b>unesti korisnika ili grupu</b> u gornju formu za pregled ili uređivanje dozvola postavljenih za imenski prostor <b class="aclns">%s</b>.'; +$lang['p_inherited'] = 'Napomena: Ove dozvole nisu postavljene eksplicitno već su naslijeđene od drugih grupa ili nadređenih imenskih prostora.'; +$lang['p_isadmin'] = 'Napomena: Odabrana grupa ili korisnik uvijek ima sve dozvole jer je postavljen kao superuser.'; +$lang['p_include'] = 'Više dozvole uključuju sve niže. Dozvole Kreiraj, Učitaj i Briši se primjenjuju samo na imenske prostore, ne stranice.'; +$lang['current'] = 'Trenutna ACL Pravila'; +$lang['where'] = 'Stranica/Imenski prostor'; +$lang['who'] = 'Korisnik/Grupa'; +$lang['perm'] = 'Dozvole'; +$lang['acl_perm0'] = 'Ništa'; +$lang['acl_perm1'] = 'Čitaj'; +$lang['acl_perm2'] = 'Uredi'; +$lang['acl_perm4'] = 'Kreiraj'; +$lang['acl_perm8'] = 'Učitaj'; +$lang['acl_perm16'] = 'Briši'; +$lang['acl_new'] = 'Dodaj novi Zapis'; +$lang['acl_mod'] = 'Promijeni Zapis'; diff --git a/lib/plugins/acl/lang/hu/lang.php b/lib/plugins/acl/lang/hu/lang.php index 318287073..255d838b6 100644 --- a/lib/plugins/acl/lang/hu/lang.php +++ b/lib/plugins/acl/lang/hu/lang.php @@ -5,8 +5,9 @@ * @author Sandor TIHANYI <stihanyi+dw@gmail.com> * @author Siaynoq Mage <siaynoqmage@gmail.com> * @author schilling.janos@gmail.com - * @author Szabó Dávid (szabo.david@gyumolcstarhely.hu) * @author Szabó Dávid <szabo.david@gyumolcstarhely.hu> + * @author Sándor TIHANYI <stihanyi+dw@gmail.com> + * @author David Szabo <szabo.david@gyumolcstarhely.hu> */ $lang['admin_acl'] = 'Hozzáférési lista (ACL) kezelő'; $lang['acl_group'] = 'Csoport:'; diff --git a/lib/plugins/acl/lang/it/lang.php b/lib/plugins/acl/lang/it/lang.php index 89e421bbb..f789b979f 100644 --- a/lib/plugins/acl/lang/it/lang.php +++ b/lib/plugins/acl/lang/it/lang.php @@ -12,6 +12,7 @@ * @author snarchio@alice.it * @author robocap <robocap1@gmail.com> * @author Osman Tekin osman.tekin93@hotmail.it + * @author Jacopo Corbetta <jacopo.corbetta@gmail.com> */ $lang['admin_acl'] = 'Gestione Lista Controllo Accessi (ACL)'; $lang['acl_group'] = 'Gruppo'; diff --git a/lib/plugins/acl/lang/kk/lang.php b/lib/plugins/acl/lang/kk/lang.php new file mode 100644 index 000000000..dde5b9577 --- /dev/null +++ b/lib/plugins/acl/lang/kk/lang.php @@ -0,0 +1,6 @@ +<?php +/** + * kazakh language file + * + * @author Nurgozha Kaliaskarov astana08@gmail.com + */ diff --git a/lib/plugins/acl/lang/la/help.txt b/lib/plugins/acl/lang/la/help.txt index ba974f48c..553884c30 100644 --- a/lib/plugins/acl/lang/la/help.txt +++ b/lib/plugins/acl/lang/la/help.txt @@ -1,8 +1,8 @@ === Auxilium: === -Hic facultates spatiorum nominis paginarumque addere delereue potes. +Hic facultates generum paginarumque addere delereue potes. -Tabella sinistra omnes paginas spatia nominisque ostendit. +Tabella sinistra omnes paginas generaque ostendit. His campis mutare facultates electorum Sodalium Gregumque potes. diff --git a/lib/plugins/acl/lang/la/lang.php b/lib/plugins/acl/lang/la/lang.php index dd6043602..941de1f79 100644 --- a/lib/plugins/acl/lang/la/lang.php +++ b/lib/plugins/acl/lang/la/lang.php @@ -2,25 +2,26 @@ /** * Latin language file * + * @author Massimiliano Vassalli <vassalli.max@gmail.com> */ -$lang['admin_acl'] = 'Aditus Administrationis Aditus'; +$lang['admin_acl'] = 'Administratio Indicis Custodiae Aditus'; $lang['acl_group'] = 'Grex'; $lang['acl_user'] = 'Sodalis'; $lang['acl_perms'] = 'Facultas:'; $lang['page'] = 'Pagina'; -$lang['namespace'] = 'Spatium nominis'; +$lang['namespace'] = 'Genus'; $lang['btn_select'] = 'eligere'; $lang['p_user_id'] = 'Sodalis <b class="acluser">%s</b> nunc has facultates paginae "<b class="aclpage">%s</b> habes: <i>%s</i>.'; -$lang['p_user_ns'] = 'Sodalis <b class="acluser">%s</b> nunc has facultates spatio nominis "<b class="aclns">%s</b> habes: <i>%s</i>.'; +$lang['p_user_ns'] = 'Sodalis <b class="acluser">%s</b> nunc has facultates generis "<b class="aclns">%s</b> habes: <i>%s</i>.'; $lang['p_group_id'] = 'Socius\a gregis <b class="aclgroup">%s</b> nunc has facultates paginae "<b class="aclpage">%s</b> habes: <i>%s</i>.'; -$lang['p_group_ns'] = 'Socius\a gregis <b class="aclgroup">%s</b> nunc has facultates paginae "<b class="aclns">%s</b> habes: <i>%s</i>.'; +$lang['p_group_ns'] = 'Socius\a gregis <b class="aclgroup">%s</b> nunc has facultates generis "<b class="aclns">%s</b> habes: <i>%s</i>.'; $lang['p_choose_id'] = '<b>Sodalis grexue</b> in campo insere ut facultates paginae <b class="aclpage">%s</b> uideas.'; -$lang['p_choose_ns'] = '<b>Sodalis grexue</b> in campo insere ut facultates paginae <b class="aclns">%s</b> uideas.'; -$lang['p_inherited'] = 'Caue: hae facultates et huic rei et aliis gregibus uel spatiis nominis legitimae sunt.'; +$lang['p_choose_ns'] = '<b>Sodalis grexue</b> in campo insere ut facultates generis <b class="aclns">%s</b> uideas.'; +$lang['p_inherited'] = 'Caue: hae facultates et huic rei et aliis gregibus uel generibus legitimae sunt.'; $lang['p_isadmin'] = 'Caue: electi greges semper plenum ius habent, eo quod ut magister\stra elegitur.'; -$lang['p_include'] = 'Maiores facultates minores includunt. Creare, onerare uel delere facultates solum spatis nominis, non paginis potes'; -$lang['current'] = 'Communes AAA leges'; -$lang['where'] = 'Pagina/Spatium nominis'; +$lang['p_include'] = 'Maiores facultates minores includunt. Creandi, onerandi uel delendi facultates solum generibus, non paginis sunt.'; +$lang['current'] = 'Communes ICA leges'; +$lang['where'] = 'Pagina/Genus'; $lang['who'] = 'Sodalis/Grex'; $lang['perm'] = 'Facultates'; $lang['acl_perm0'] = 'Nihil'; diff --git a/lib/plugins/acl/lang/no/lang.php b/lib/plugins/acl/lang/no/lang.php index cd9e2edfb..71df0b382 100644 --- a/lib/plugins/acl/lang/no/lang.php +++ b/lib/plugins/acl/lang/no/lang.php @@ -15,6 +15,7 @@ * @author Lisa Ditlefsen <lisa@vervesearch.com> * @author Erik Pedersen <erik.pedersen@shaw.ca> * @author Erik Bjørn Pedersen <erik.pedersen@shaw.ca> + * @author Rune Rasmussen syntaxerror.no@gmail.com */ $lang['admin_acl'] = 'Administrasjon av lister for adgangskontroll (ACL)'; $lang['acl_group'] = 'Gruppe'; diff --git a/lib/plugins/acl/lang/pt/lang.php b/lib/plugins/acl/lang/pt/lang.php index 6e094fd74..d90bab624 100644 --- a/lib/plugins/acl/lang/pt/lang.php +++ b/lib/plugins/acl/lang/pt/lang.php @@ -8,6 +8,7 @@ * @author Enrico Nicoletto <liverig@gmail.com> * @author Fil <fil@meteopt.com> * @author André Neves <drakferion@gmail.com> + * @author José Campos zecarlosdecampos@gmail.com */ $lang['admin_acl'] = 'Gestão de ACLs'; $lang['acl_group'] = 'Grupo'; diff --git a/lib/plugins/acl/lang/ru/help.txt b/lib/plugins/acl/lang/ru/help.txt index a3c1b4f64..7807105a8 100644 --- a/lib/plugins/acl/lang/ru/help.txt +++ b/lib/plugins/acl/lang/ru/help.txt @@ -1,11 +1,7 @@ -=== Краткая справка: === +=== Краткая справка === -На этой странице вы можете добавить или удалить права доступа к пространствам имён и страницам вашей вики. - -На панели слева отображены доступные пространства имён и страницы. - -Форма выше позволяет вам просмотреть и изменить права доступа для выбранного пользователя или группы. - -Текущие права доступа отображены в таблице ниже. Вы можете использовать её для быстрого удаления или изменения правил. - -Прочтение [[doku>acl|официальной документации по ACL]] может помочь вам в полном понимании работы управления правами доступа в «ДокуВики». +На этой странице вы можете добавить или удалить права доступа к пространствам имён и страницам своей вики.\\ +На панели слева отображены доступные пространства имён и страницы.\\ +Форма выше позволяет вам просмотреть и изменить права доступа для выбранного пользователя или группы.\\ +Текущие права доступа отображены в таблице ниже. Вы можете использовать её для быстрого удаления или изменения правил.\\ +Прочтение [[doku>acl|официальной документации по ACL]] может помочь вам в полном понимании работы управления правами доступа в «ДокуВики». diff --git a/lib/plugins/acl/lang/ru/lang.php b/lib/plugins/acl/lang/ru/lang.php index 0c02dfbb1..6d04dde21 100644 --- a/lib/plugins/acl/lang/ru/lang.php +++ b/lib/plugins/acl/lang/ru/lang.php @@ -13,13 +13,15 @@ * @author Vlad Tsybenko <vlad.development@gmail.com> * @author Aleksey Osadchiy <rfc@nm.ru> * @author Aleksandr Selivanov <alexgearbox@gmail.com> + * @author Ladyko Andrey <fylh@succexy.spb.ru> + * @author Eugene <windy.wanderer@gmail.com> */ $lang['admin_acl'] = 'Управление списками контроля доступа'; $lang['acl_group'] = 'Группа'; $lang['acl_user'] = 'Пользователь'; $lang['acl_perms'] = 'Права доступа для'; $lang['page'] = 'Страница'; -$lang['namespace'] = 'Пространство имен'; +$lang['namespace'] = 'Пространство имён'; $lang['btn_select'] = 'Выбрать'; $lang['p_user_id'] = 'Сейчас пользователь <b class="acluser">%s</b> имеет следующие права на доступ к странице <b class="aclpage">%s</b>: <i>%s</i>.'; $lang['p_user_ns'] = 'Сейчас пользователь <b class="acluser">%s</b> имеет следующие права на доступ к пространству имён <b class="aclns">%s</b>: <i>%s</i>.'; diff --git a/lib/plugins/acl/lang/sl/help.txt b/lib/plugins/acl/lang/sl/help.txt new file mode 100644 index 000000000..eada41c29 --- /dev/null +++ b/lib/plugins/acl/lang/sl/help.txt @@ -0,0 +1,11 @@ +=== Hitra pomo === + +Na tej strani je mogoe dodajati, odstranjevati in spreminjati dovoljenja za delo z wiki stranmi in imenskimi prostori. + +Na veli strani so izpisani vsi imenski prostori in strani. + +Na obrazcu zgoraj je mogoe pregledovati in spreminjati dovoljenja za izbranega uporabnika ali skupino. + +V preglednici spodaj so prikazana vsa pravila nadzora. Ta je mogoe hitro spreminjati ali brisati. + +Ve podrobnosti o delovanju nadzora dostopa sistema DokuWiki je mogoe najti v [[doku>acl|uradni dokumentaciji ACL]]. diff --git a/lib/plugins/acl/lang/sl/lang.php b/lib/plugins/acl/lang/sl/lang.php index 32141fbce..3fb391570 100644 --- a/lib/plugins/acl/lang/sl/lang.php +++ b/lib/plugins/acl/lang/sl/lang.php @@ -4,14 +4,30 @@ * * @author Dejan Levec <webphp@gmail.com> * @author Boštjan Seničar <senicar@gmail.com> + * @author Gregor Skumavc (grega.skumavc@gmail.com) + * @author Matej Urbančič (mateju@svn.gnome.org) */ +$lang['admin_acl'] = 'Upravljanje dostopa'; $lang['acl_group'] = 'Skupina'; $lang['acl_user'] = 'Uporabnik'; $lang['acl_perms'] = 'Dovoljenja za'; $lang['page'] = 'Stran'; +$lang['namespace'] = 'Imenski prostor'; $lang['btn_select'] = 'Izberi'; +$lang['p_user_id'] = 'Uporabnik %s ima naslednja dovoljenja za stran %s: %s.'; +$lang['p_user_ns'] = 'Uporabnik %s ima naslednja dovoljenja za imenski prostor %s: %s.'; +$lang['p_group_id'] = 'Uporabniška skupina %s ima naslednja dovoljenja za stran %s: %s.'; +$lang['p_group_ns'] = 'Uporabniška skupina %s ima naslednja dovoljenja za imenski prostor %s: %s.'; +$lang['p_choose_id'] = 'Vnesite ime <b>uporabnika ali skupine</b> v zgornji obrazec za ogled ali urejanje dovoljenj za stran %s.'; +$lang['p_choose_ns'] = 'Vnesite ime <b>uporabnika ali skupine</b> v zgornji obrazec za ogled ali urejanje dovoljenj za imenski prostor %s.'; +$lang['p_inherited'] = 'Opomba: trenutna dovoljenja niso bila posebej določena, temveč so bila prevzeta iz drugih skupin ali višjih imenskih prostorov.'; +$lang['p_isadmin'] = 'Opomba: izbrana skupina ali uporabnik imajo vsa dovoljenja za spreminjanje, saj so določeni kot skrbniki sistema.'; +$lang['p_include'] = 'Višja dovoljenja vključujejo tudi nižja. '; +$lang['current'] = 'Trenutna pravila dostopa'; +$lang['where'] = 'Stran / Imenski prostor'; $lang['who'] = 'Uporabnik/Skupina'; $lang['perm'] = 'Dovoljenja'; +$lang['acl_perm0'] = 'Nič'; $lang['acl_perm1'] = 'Preberi'; $lang['acl_perm2'] = 'Uredi'; $lang['acl_perm4'] = 'Ustvari'; diff --git a/lib/plugins/acl/lang/sv/lang.php b/lib/plugins/acl/lang/sv/lang.php index b5fd3b866..7f963d5e1 100644 --- a/lib/plugins/acl/lang/sv/lang.php +++ b/lib/plugins/acl/lang/sv/lang.php @@ -15,6 +15,7 @@ * @author Bogge Bogge <bogge@bogge.com> * @author Peter Åström <eaustreum@gmail.com> * @author Håkan Sandell <hakan.sandell@home.se> + * @author mikael@mallander.net */ $lang['admin_acl'] = 'Hantera behörighetslistan (ACL)'; $lang['acl_group'] = 'Grupp'; diff --git a/lib/plugins/acl/lang/zh-tw/help.txt b/lib/plugins/acl/lang/zh-tw/help.txt index 871c1f4f1..bc1bddb00 100644 --- a/lib/plugins/acl/lang/zh-tw/help.txt +++ b/lib/plugins/acl/lang/zh-tw/help.txt @@ -1,11 +1,12 @@ === 快速指南: === -在此頁面你可以為你的wiki中的namespace以及頁面增加或移除權限 +你可以用這個頁面為維基中的命名空間或頁面增加或移除權限。 -左方的面板顯示了所有的namespace以及頁面 +左方面板顯示了所有命名空間和頁面。 -上方的表格允許你觀看以及修改被選擇的使用者或群組的權限 +上方表格允許你觀看及修改選取的使用者或群組的權限。 -下方的表格顯示了目前所有的存取控制規則(ACL) 你可以使用它快速的刪除或更改多項規則 +下方表格顯示了目前所有的存取控制表 (ACL)，你可以用它快速刪除或更改多項規則。 + +閱讀 [[doku>acl|official documentation on ACL]] 可以幫助你完整地了解 DokuWiki 存取控制的運作。 -閱讀 [[doku>acl|official documentation on ACL]] 也許可以幫助你去完整地了解在DokuWiki中, 存取控制是如何運作的. diff --git a/lib/plugins/acl/lang/zh-tw/lang.php b/lib/plugins/acl/lang/zh-tw/lang.php index d64e85a92..085537864 100644 --- a/lib/plugins/acl/lang/zh-tw/lang.php +++ b/lib/plugins/acl/lang/zh-tw/lang.php @@ -9,32 +9,34 @@ * @author Wayne San <waynesan@zerozone.tw> * @author Li-Jiun Huang <ljhuang.tw@gmai.com> * @author Cheng-Wei Chien <e.cwchien@gmail.com> + * @author Danny Lin <danny0838@pchome.com.tw> + * @author Shuo-Ting Jian <shoting@gmail.com> */ -$lang['admin_acl'] = '設定 ACL 存取名單'; +$lang['admin_acl'] = '管理存取控制表 (ACL)'; $lang['acl_group'] = '群組'; -$lang['acl_user'] = '帳號'; +$lang['acl_user'] = '使用者'; $lang['acl_perms'] = '設定權限於'; $lang['page'] = '頁面'; $lang['namespace'] = '命名空間'; $lang['btn_select'] = '選擇'; -$lang['p_user_id'] = '使用者 <b class="acluser">%s</b> 在頁面 <b class="aclpage">%s</b>目前擁有以下的權限: <i>%s</i>.'; -$lang['p_user_ns'] = '用戶 <b class=\"acluser\">%s</b> 當前在命名空間 <b class=\"aclns\">%s</b> 擁有以下權限：<i>%s</i>。'; -$lang['p_group_id'] = '群組 <b class="aclgroup">%s</b> 的成員目前對於頁面 <b class="aclpage">%s</b> 擁有以下的權限: <i>%s</i>.'; -$lang['p_group_ns'] = '<b class=\"aclgroup\">%s</b> 組成員當前在命名空間 <b class=\"aclns\">%s</b> 擁有以下權限：<i>%s</i>。'; -$lang['p_choose_id'] = '請在上方的表格中 <b>輸入一個帳號或群組</b> 來觀看或編輯頁面 <b class="aclpage">%s</b> 的權限.'; -$lang['p_choose_ns'] = '請在上表中<b>輸入用戶名或組名稱</b>，來查看或編輯命名空間 <b class=\"aclns\">%s</b> 的權限設置。'; -$lang['p_inherited'] = '請注意：這些權限並沒有明確設定，而是從其他組或更高級的名稱空間繼承而來。'; -$lang['p_isadmin'] = '請注意：選定的組或用戶擁有完全權限，因為它被設定為超級用戶。'; -$lang['p_include'] = '較高的權限亦包含了較低的權限。新增、上傳與刪除權限只能在命名空間中使用，而非頁面。'; -$lang['current'] = '目前的ACL規則'; +$lang['p_user_id'] = '使用者 <b class="acluser">%s</b> 目前在頁面 <b class="aclpage">%s</b> 擁有以下權限：<i>%s</i>。'; +$lang['p_user_ns'] = '使用者 <b class=\"acluser\">%s</b> 目前在命名空間 <b class=\"aclns\">%s</b> 擁有以下權限：<i>%s</i>。'; +$lang['p_group_id'] = '群組 <b class="aclgroup">%s</b> 的成員目前在頁面 <b class="aclpage">%s</b> 擁有以下權限：<i>%s</i>。'; +$lang['p_group_ns'] = '群組 <b class=\"aclgroup\">%s</b> 的成員目前在命名空間 <b class=\"aclns\">%s</b> 擁有以下權限：<i>%s</i>。'; +$lang['p_choose_id'] = '請在上方表格<b>輸入使用者或群組</b>以檢視或編輯頁面 <b class="aclpage">%s</b> 的權限設定。'; +$lang['p_choose_ns'] = '請在上方表格<b>輸入使用者或群組</b>以檢視或編輯命名空間 <b class=\"aclns\">%s</b> 的權限設定。'; +$lang['p_inherited'] = '注意：這些權限並未明確指定，而是從群組或上層的命名空間繼承而來。'; +$lang['p_isadmin'] = '注意：選取的群組或使用者擁有完整權限，因為它被設定為超級使用者。'; +$lang['p_include'] = '較高的權限亦包含了較低的權限。新增、上傳與刪除權限只能設定在命名空間，不能設定在頁面。'; +$lang['current'] = '目前的存取控制規則'; $lang['where'] = '頁面/命名空間'; $lang['who'] = '使用者/群組'; $lang['perm'] = '權限'; $lang['acl_perm0'] = '無'; -$lang['acl_perm1'] = '讀取權限'; +$lang['acl_perm1'] = '讀取頁面'; $lang['acl_perm2'] = '編輯頁面'; $lang['acl_perm4'] = '新增頁面'; $lang['acl_perm8'] = '上傳圖檔'; $lang['acl_perm16'] = '刪除檔案'; -$lang['acl_new'] = '新增管理規則'; +$lang['acl_new'] = '增加規則'; $lang['acl_mod'] = '修改規則'; diff --git a/lib/plugins/acl/lang/zh/lang.php b/lib/plugins/acl/lang/zh/lang.php index d79a78089..581d08539 100644 --- a/lib/plugins/acl/lang/zh/lang.php +++ b/lib/plugins/acl/lang/zh/lang.php @@ -11,6 +11,8 @@ * @author ben <ben@livetom.com> * @author lainme <lainme993@gmail.com> * @author caii <zhoucaiqi@gmail.com> + * @author Hiphen Lee <jacob.b.leung@gmail.com> + * @author caii, patent agent in China <zhoucaiqi@gmail.com> */ $lang['admin_acl'] = '访问控制列表（ACL）管理器'; $lang['acl_group'] = '组'; diff --git a/lib/plugins/acl/pix/group.png b/lib/plugins/acl/pix/group.png Binary files differindex 7fb4e1f1e..d80eb2606 100644 --- a/lib/plugins/acl/pix/group.png +++ b/lib/plugins/acl/pix/group.png diff --git a/lib/plugins/acl/pix/ns.png b/lib/plugins/acl/pix/ns.png Binary files differindex da3c2a2d7..c35e832da 100644 --- a/lib/plugins/acl/pix/ns.png +++ b/lib/plugins/acl/pix/ns.png diff --git a/lib/plugins/acl/pix/page.png b/lib/plugins/acl/pix/page.png Binary files differindex 03ddd799f..b1b7ebe94 100644 --- a/lib/plugins/acl/pix/page.png +++ b/lib/plugins/acl/pix/page.png diff --git a/lib/plugins/acl/pix/user.png b/lib/plugins/acl/pix/user.png Binary files differindex 8fd539e9c..7b4a507a0 100644 --- a/lib/plugins/acl/pix/user.png +++ b/lib/plugins/acl/pix/user.png diff --git a/lib/plugins/acl/script.js b/lib/plugins/acl/script.js index d5d0371a9..5b6c9ce1b 100644 --- a/lib/plugins/acl/script.js +++ b/lib/plugins/acl/script.js @@ -1,59 +1,53 @@ +/** + * ACL Manager AJAX enhancements + * + * @author Andreas Gohr <andi@splitbrain.org> + */ acl = { + /** + * Initialize the object and attach the event handlers + */ init: function(){ - this.ctl = $('acl_manager'); - if(!this.ctl) return; - - var sel = $('acl__user').getElementsByTagName('select')[0]; + if(!jQuery('#acl_manager').length) return; //FIXME only one underscore!! - addEvent(sel,'change',acl.userselhandler); - addEvent($('acl__tree'),'click',acl.treehandler); - addEvent($('acl__user').getElementsByTagName('input')[1],'click',acl.loadinfo); + jQuery('#acl__user select').change(acl.userselhandler); + jQuery('#acl__tree').click(acl.treehandler); + jQuery('#acl__user input[type=submit]').click(acl.loadinfo); }, - /** * Handle user dropdown + * + * Hides or shows the user/group entry box depending on what was selected in the + * dropdown element */ userselhandler: function(e){ // make entry field visible/invisible if(this.value == '__g__' || this.value == '__u__'){ - $('acl__user').getElementsByTagName('input')[0].style.display = ''; //acl_w - $('acl__user').getElementsByTagName('input')[1].style.display = ''; //submit + jQuery('#acl__user input').show(); }else{ - $('acl__user').getElementsByTagName('input')[0].style.display = 'none'; - $('acl__user').getElementsByTagName('input')[1].style.display = 'none'; + jQuery('#acl__user input').hide(); } - acl.loadinfo(); }, /** * Load the current permission info and edit form - * - * @param frm - Form element with needed data */ loadinfo: function(){ - // get form - var frm = $('acl__detail').getElementsByTagName('form')[0]; - - // prepare an AJAX call - var ajax = new sack(DOKU_BASE + 'lib/plugins/acl/ajax.php'); - ajax.AjaxFailedAlert = ''; - ajax.encodeURIString = false; - if(ajax.failed) return true; - - // prepare data - var data = Array(); - data[0] = ajax.encVar('ns',frm.elements['ns'].value); - data[1] = ajax.encVar('id',frm.elements['id'].value); - data[2] = ajax.encVar('acl_t',frm.elements['acl_t'].value); - data[3] = ajax.encVar('acl_w',frm.elements['acl_w'].value); - data[4] = ajax.encVar('sectok',frm.elements['sectok'].value); - data[5] = ajax.encVar('ajax','info'); - - ajax.elementObj = $('acl__info'); - - ajax.runAJAX(data.join('&')); + var frm = jQuery('#acl__detail form')[0]; + + jQuery('#acl__info').load( + DOKU_BASE + 'lib/plugins/acl/ajax.php', + { + 'ns': frm.elements['ns'].value, + 'id': frm.elements['id'].value, + 'acl_t': frm.elements['acl_t'].value, + 'acl_w': frm.elements['acl_w'].value, + 'sectok': frm.elements['sectok'].value, + 'ajax': 'info', + } + ); return false; }, @@ -74,55 +68,40 @@ acl = { }, /** - * htmlspecialchars equivalent - * - * @todo put in gloabl scripts lib? - */ - hsc: function(str) { - str = str.replace(/&/g,"&"); - str = str.replace(/\"/g,"""); - str = str.replace(/\'/g,"'"); - str = str.replace(/</g,"<"); - str = str.replace(/>/g,">"); - return str; - }, - - - /** * Open or close a subtree using AJAX * * @author Andreas Gohr <andi@splitbrain.org> + * @param DOMElement clicky - the plus/minus icon in front of a namespace */ treetoggle: function(clicky){ - var listitem = clicky.parentNode.parentNode; + var listitem = jQuery(clicky).parent().parent(); // if already open, close by removing the sublist - var sublists = listitem.getElementsByTagName('ul'); + var sublists = listitem.find('ul'); if(sublists.length){ - listitem.removeChild(sublists[0]); + listitem.remove('ul'); clicky.src = DOKU_BASE+'lib/images/plus.gif'; clicky.alt = '+'; return false; } - // get the enclosed link (is always the first one) - var link = listitem.getElementsByTagName('a')[0]; + // prepare new ul to load into it via ajax + var ul = document.createElement('ul'); + listitem[0].appendChild(ul); - // prepare an AJAX call to fetch the subtree - var ajax = new sack(DOKU_BASE + 'lib/plugins/acl/ajax.php'); - ajax.AjaxFailedAlert = ''; - ajax.encodeURIString = false; - if(ajax.failed) return true; + // get the enclosed link and the edit form + var link = listitem.find('a')[0]; + var frm = jQuery('#acl__detail form')[0]; + + // prepare ajax data + var data = acl.parseatt(link.search); + data['ajax'] = 'tree'; + data['current_ns'] = frm.elements['ns'].value; + data['current_id'] = frm.elements['id'].value; + + // run ajax + jQuery(ul).load(DOKU_BASE + 'lib/plugins/acl/ajax.php', data); - //prepare the new ul - var ul = document.createElement('ul'); - listitem.appendChild(ul); - ajax.elementObj = ul; - ajax.setVar('ajax', 'tree'); - var frm = $('acl__detail').getElementsByTagName('form')[0]; - ajax.setVar('current_ns', encodeURIComponent(frm.elements['ns'].value)); - ajax.setVar('current_id', encodeURIComponent(frm.elements['id'].value)); - ajax.runAJAX(link.search.substr(1)); clicky.src = DOKU_BASE+'lib/images/minus.gif'; return false; }, @@ -130,30 +109,30 @@ acl = { /** * Handles all clicks in the tree, dispatching the right action based on the * clicked element + * + * @param Event e The event object that caused the execution */ treehandler: function(e){ if(e.target.src){ // is it an image? acl.treetoggle(e.target); } else if(e.target.href){ // is it a link? // remove highlighting - var obj = getElementsByClass('cur',$('acl__tree'),'a'); - for(var i=0; i<obj.length; i++){ - obj[i].className = obj[i].className.replace(/ cur/,''); - } + jQuery('#acl__tree a.cur').removeClass('cur'); + + var link = jQuery(e.target); // add new highlighting - e.target.className += ' cur'; + link.addClass('cur'); // set new page to detail form - var frm = $('acl__detail').getElementsByTagName('form')[0]; - if(e.target.className.search(/wikilink1/) > -1){ - frm.elements['ns'].value = ''; - frm.elements['id'].value = acl.hsc(acl.parseatt(e.target.search)['id']); - }else if(e.target.className.search(/idx_dir/) > -1){ - frm.elements['ns'].value = acl.hsc(acl.parseatt(e.target.search)['ns']); - frm.elements['id'].value = ''; + var frm = jQuery('#acl__detail form')[0]; + if(link.hasClass('wikilink1')){ + jQuery('#acl__detail form input[name=ns]').val(''); + jQuery('#acl__detail form input[name=id]').val(acl.parseatt(link[0].search)['id']); + }else if(link.hasClass('idx_dir')){ + jQuery('#acl__detail form input[name=ns]').val(acl.parseatt(link[0].search)['ns']); + jQuery('#acl__detail form input[name=id]').val(''); } - acl.loadinfo(); } @@ -164,4 +143,4 @@ acl = { }; -addInitEvent(acl.init); +jQuery(acl.init); diff --git a/lib/plugins/config/admin.php b/lib/plugins/config/admin.php index d245d3fce..e24f3b87b 100644 --- a/lib/plugins/config/admin.php +++ b/lib/plugins/config/admin.php @@ -113,7 +113,7 @@ class admin_plugin_config extends DokuWiki_Admin_Plugin { // rewrite config is broken. Add $ID as hidden field to remember // current ID in most cases. ptln('<form action="'.script().'" method="post">'); - ptln('<input type="hidden" name="id" value="'.$ID.'" />'); + ptln('<div class="no"><input type="hidden" name="id" value="'.$ID.'" /></div>'); formSecurityToken(); $this->_print_h1('dokuwiki_settings', $this->getLang('_header_dokuwiki')); diff --git a/lib/plugins/config/images/danger.png b/lib/plugins/config/images/danger.png Binary files differindex c37bd062e..7bd84f7a3 100644 --- a/lib/plugins/config/images/danger.png +++ b/lib/plugins/config/images/danger.png diff --git a/lib/plugins/config/images/security.png b/lib/plugins/config/images/security.png Binary files differindex 2ebc4f6f9..1800f8e56 100644 --- a/lib/plugins/config/images/security.png +++ b/lib/plugins/config/images/security.png diff --git a/lib/plugins/config/images/warning.png b/lib/plugins/config/images/warning.png Binary files differindex 628cf2dae..c5e482f84 100644 --- a/lib/plugins/config/images/warning.png +++ b/lib/plugins/config/images/warning.png diff --git a/lib/plugins/config/lang/ar/intro.txt b/lib/plugins/config/lang/ar/intro.txt index 3e09db401..d447ec315 100644 --- a/lib/plugins/config/lang/ar/intro.txt +++ b/lib/plugins/config/lang/ar/intro.txt @@ -1,6 +1,6 @@ ====== مدير الضبط ====== -استخدم هذه الصفحة للتحكم باعدادات دوكي ويكي المثبتة عندك. للمساعدة في أمر ما أشر إلى [[doku>config]]. لمعلومات اكثر عن هذه الاضافة انظر [[doku>plugin:config]]. +استخدم هذه الصفحة للتحكم باعدادات دوكو ويكي المثبتة عندك. للمساعدة في أمر ما أشر إلى [[doku>config]]. لمعلومات اكثر عن هذه الاضافة انظر [[doku>plugin:config]]. الاعدادات الظاهرة بخلفية حمراء فاتحة اعدادات محمية ولا يمكن تغييرها بهذه الاضافة. الاعدادات الظاهرة بخلفية زرقاء هي القيم الافتراضية والاعدادات الظاهرة بخلفية بيضاء خصصت لهذا التثبيت محليا. الاعدادات الزرقاء والبيضاء يمكن تغييرها. diff --git a/lib/plugins/config/lang/ar/lang.php b/lib/plugins/config/lang/ar/lang.php index 5d0ff76b9..63d258485 100644 --- a/lib/plugins/config/lang/ar/lang.php +++ b/lib/plugins/config/lang/ar/lang.php @@ -4,6 +4,7 @@ * * @author Yaman Hokan <always.smile.yh@hotmail.com> * @author Usama Akkad <uahello@gmail.com> + * @author uahello@gmail.com */ $lang['menu'] = 'الإعدادات'; $lang['error'] = 'لم تحدث الاعدادات بسبب قيمة غير صالحة، رجاء راجع تغييراتك ثم ارسلها. @@ -16,7 +17,7 @@ $lang['danger'] = 'خطر: تغيير هذا الخيار قد ي $lang['warning'] = 'تحذير: تغييرهذا الخيار قد يؤدي لسلوك غير متوقع.'; $lang['security'] = 'تحذير أمني: تغيير هذا الخيار قد يؤدي إلى مخاطرة أمنية.'; $lang['_configuration_manager'] = 'مدير الاعدادات'; -$lang['_header_dokuwiki'] = 'اعدادات دوكي ويكي'; +$lang['_header_dokuwiki'] = 'اعدادات دوكو ويكي'; $lang['_header_plugin'] = 'اعدادات الملحقات'; $lang['_header_template'] = 'اعدادات القوالب'; $lang['_header_undefined'] = 'اعدادات غير محددة'; @@ -32,6 +33,7 @@ $lang['_network'] = 'اعدادات الشبكة'; $lang['_plugin_sufix'] = 'اعدادات الملحقات'; $lang['_template_sufix'] = 'اعدادات القوالب'; $lang['_msg_setting_undefined'] = 'لا بيانات إعدادات.'; +$lang['_msg_setting_no_class'] = 'لا صنف إعدادات.'; $lang['_msg_setting_no_default'] = 'لا قيمة افتراضية.'; $lang['fmode'] = 'نمط انشاء الملفات'; $lang['dmode'] = 'نمط انشاء المجلدات'; @@ -45,6 +47,8 @@ $lang['template'] = 'القالب'; $lang['license'] = 'تحت أي رخصة تريد اصدار المحتوى؟'; $lang['fullpath'] = 'اظهر المحتوى الكامل للصفحات في '; $lang['recent'] = 'أحدث التغييرات'; +$lang['breadcrumbs'] = 'عدد العناقيد للزيارات'; +$lang['youarehere'] = 'عناقيد هرمية'; $lang['typography'] = 'اعمل استبدالات طبوغرافية'; $lang['htmlok'] = 'مكّن تضمين HTML'; $lang['phpok'] = 'مكّن تضمين PHP'; @@ -74,16 +78,17 @@ $lang['defaultgroup'] = 'المجموعة الافتراضية'; $lang['superuser'] = 'مجموعة المستخدم المتفوق أو مستخدم أو قائمة مفصولة بالفاصلة مستخدم1،@مجموعة، مستخدم2 صلاحيتهم الوصول الكامل لكل الصفحات و الوظائف بغض النظر عن اعدادات ACL'; $lang['manager'] = 'مجموعة المدراء أو مستخدم أو قائمة مفصولة بالفاصلة مستخدم1،@مجموعة، مستخدم2 صلاحيتهم بعض الوظائف الادارية'; $lang['profileconfirm'] = 'اكد تغيير اللاحة بكلمة المرور'; -$lang['disableactions'] = 'عطّل اجراءات دوكي ويكي'; +$lang['disableactions'] = 'عطّل اجراءات دوكو ويكي'; $lang['disableactions_check'] = 'تحقق'; $lang['disableactions_subscription'] = 'اشترك/الغ الاشتراك'; $lang['disableactions_wikicode'] = 'اعرض المصدر/صدّر صرفا'; $lang['disableactions_other'] = 'اجراءات أخرى (مفصولة بالفاصلة)'; -$lang['sneaky_index'] = 'افتراضيا، ستعرض دوكي ويكي كل اسماء النطاقات في عرض الفهرس. تفعيل هذا الخيار سيخفي مالا يملك المستخدم صلاحية قراءته. قد يؤدي هذا إلى اخفاء نطاقات فرعية متاحة. وقد يؤدي لجعل صفحة الفهرس معطلة في بعض اعدادات ACL.'; +$lang['sneaky_index'] = 'افتراضيا، ستعرض دوكو ويكي كل اسماء النطاقات في عرض الفهرس. تفعيل هذا الخيار سيخفي مالا يملك المستخدم صلاحية قراءته. قد يؤدي هذا إلى اخفاء نطاقات فرعية متاحة. وقد يؤدي لجعل صفحة الفهرس معطلة في بعض اعدادات ACL.'; $lang['auth_security_timeout'] = 'زمن انتهاء أمان المواثقة (ثوان)'; $lang['securecookie'] = 'هل يفرض على كعكات التصفح المعدة عبر HTTPS ان ترسل فقط عبر HTTPS من قبل المتصفح؟ عطل هذا إن كان الولوج للويكي مؤمنا فقط عبر SSL لكن تصفح الويكي غير مؤمن.'; $lang['xmlrpc'] = 'مكّن/عطل واجهة XML-RPC.'; -$lang['updatecheck'] = 'تحقق من التحديثات و تنبيهات الأمان؟ دوكو ويكي ستحتاج للاتصال ب splitbrain.org لأجل ذلك'; +$lang['xmlrpcuser'] = 'احصر الوصول لـ XML-RPC بمستخدمين أو مجموعات مفصولة بالفاصلة هنا. اتركها فارغة لتمكين الوصول للجميع.'; +$lang['updatecheck'] = 'تحقق من التحديثات و تنبيهات الأمان؟ دوكو ويكي ستحتاج للاتصال ب update.dokuwiki.org لأجل ذلك'; $lang['userewrite'] = 'استعمل عناوين URLs جميلة'; $lang['useslash'] = 'استخدم الشرطة كفاصل النطاق في العناوين'; $lang['usedraft'] = 'احفظ المسودة تلقائيا أثناء التحرير'; @@ -98,6 +103,7 @@ $lang['fetchsize'] = 'الحجم الأعظمي (بايت) ل fetch. $lang['notify'] = 'ارسل تنبيهات التغيير لهذا البريد'; $lang['registernotify'] = 'ارسل بيانات عن المستخدمين المسجلين جديدا لهذا البريد'; $lang['mailfrom'] = 'البريد الالكتروني ليستخدم للرسائل الآلية'; +$lang['mailprefix'] = 'بادئة موضوع البريد لتستخدم مع الرسائل الآلية'; $lang['gzip_output'] = 'استخدم ترميز-محتوى gzip ل xhtml'; $lang['gdlib'] = 'اصدار مكتبة GD'; $lang['im_convert'] = 'المسار إلى اداة تحويل ImageMagick'; @@ -108,6 +114,9 @@ $lang['compress'] = 'رُص مخرجات CSS و جافا سكربت $lang['hidepages'] = 'أخف الصفحات المنطبق عليها (تعابير شرطية)'; $lang['send404'] = 'ارسل "HTTP 404/Page Not Found" للصفحات غير الموجودة'; $lang['sitemap'] = 'ولد خرائط موقع جوجل (أيام)'; +$lang['xsendfile'] = 'استخدم ترويسة X-Sendfile لتمكين خادم الوب من تقديم ملفات ثابتة؟ يجب أن يكون خادم الوب داعما له.'; +$lang['renderer__core'] = '%s (نواة دوكو ويكي)'; +$lang['renderer__plugin'] = '%s (ملحق)'; $lang['rememberme'] = 'اسمح بكعكات الدخول الدائم (تذكرني)'; $lang['rss_type'] = 'نوع تلقيمات XML'; $lang['rss_linkto'] = 'تلقيمات XML توصل إلى'; @@ -116,6 +125,7 @@ $lang['rss_update'] = 'تحديث تلقيم XML (ثوان)'; $lang['recent_days'] = 'مدة إبقاء أحدث التغييرات (ايام)'; $lang['rss_show_summary'] = 'تلقيم XML يظهر ملخصا في العنوان'; $lang['target____wiki'] = 'النافذة الهدف للروابط الداخلية'; +$lang['target____interwiki'] = 'النافذة الهدف للروابط الممرة interwiki'; $lang['target____extern'] = 'النافذة الهدف للروابط الخارجية'; $lang['target____media'] = 'النافذة الهدف لروابط الوسائط'; $lang['target____windows'] = 'النافذة الهدف لروابط النوافذ'; @@ -124,6 +134,7 @@ $lang['proxy____port'] = 'منفذ الوكيل'; $lang['proxy____user'] = 'اسم مستخدم الوكيل'; $lang['proxy____pass'] = 'كلمة سر الوكيل'; $lang['proxy____ssl'] = 'استخدم ssl للاتصال بالوكيل'; +$lang['proxy____except'] = 'تعبير شرطي لمقابلة العناوين التي ستتجاوز البروكسي.'; $lang['safemodehack'] = 'مكّن hack الوضع الآمن'; $lang['ftp____host'] = 'خادوم FTP ل hack الوضع الآمن'; $lang['ftp____port'] = 'منفذ FTP ل hack الوضع الآمن'; @@ -136,7 +147,10 @@ $lang['typography_o_1'] = 'استبعاد الاقتباس المفرد'; $lang['typography_o_2'] = 'تضمين علامات اقتباس مفردة (قد لا يعمل دائما)'; $lang['userewrite_o_0'] = 'لاشيء'; $lang['userewrite_o_1'] = '.htaccess'; +$lang['userewrite_o_2'] = 'دو'; $lang['deaccent_o_0'] = 'معطل'; +$lang['deaccent_o_1'] = 'أزل اللهجة'; +$lang['deaccent_o_2'] = 'اجعلها لاتينية'; $lang['gdlib_o_0'] = 'مكتبة GD غير متوفرة'; $lang['gdlib_o_1'] = 'الاصدار 1.x'; $lang['gdlib_o_2'] = 'اكتشاف تلقائي'; @@ -145,6 +159,7 @@ $lang['rss_type_o_rss1'] = 'RSS 1.0'; $lang['rss_type_o_rss2'] = 'RSS 2.0'; $lang['rss_type_o_atom'] = 'أتوم 0.3'; $lang['rss_type_o_atom1'] = 'أتوم 1.0'; +$lang['rss_content_o_abstract'] = 'خلاصة'; $lang['rss_content_o_diff'] = 'الفروق الموحدة'; $lang['rss_content_o_htmldiff'] = 'جدول الفروق بهيئة HTML'; $lang['rss_content_o_html'] = 'محتوى HTML الكامل للصفحة'; @@ -156,11 +171,15 @@ $lang['compression_o_0'] = 'لا شيء'; $lang['compression_o_gz'] = 'gzip'; $lang['compression_o_bz2'] = 'bz2'; $lang['xsendfile_o_0'] = 'لا تستخدم'; +$lang['xsendfile_o_1'] = 'ترويسة lighttpd مملوكة (قبل الاصدار 1.5)'; +$lang['xsendfile_o_2'] = 'ترويسة X-Sendfile قياسية'; +$lang['xsendfile_o_3'] = 'ترويسة Nginx X-Accel-Redirect مملوكة'; $lang['showuseras_o_loginname'] = 'اسم الدخول'; $lang['showuseras_o_username'] = 'اسم المستخدم الكامل'; $lang['showuseras_o_email'] = 'عنوان بريد المستخدم (مبهم تبعا لاعدادات حارس_البريد)'; $lang['showuseras_o_email_link'] = 'عنوان بريد المستخدم كـ مالتيو: رابط'; $lang['useheading_o_0'] = 'أبدا'; -$lang['useheading_o_navigation'] = 'ال'; +$lang['useheading_o_navigation'] = 'التنقل فقط'; $lang['useheading_o_content'] = 'محتوى الويكي فقط'; $lang['useheading_o_1'] = 'دائما'; +$lang['readdircache'] = 'المدة القصوى لتخزين '; diff --git a/lib/plugins/config/lang/bg/intro.txt b/lib/plugins/config/lang/bg/intro.txt index 8723a77a4..db09e6838 100644 --- a/lib/plugins/config/lang/bg/intro.txt +++ b/lib/plugins/config/lang/bg/intro.txt @@ -1,7 +1,7 @@ -====== Управление на настройките ====== +====== Диспечер на настройките ====== -Използвайте тази страница за да управлявате настройките на вашета Dokuwiki инсталация. За отделните настройки вижте [[doku>config]]. За повече подробности за тази приставка вижте [[doku>plugin:config]]. +От тук можете да управлявате настройките на вашето Dokuwiki. За отделните настройки вижте [[doku>config]]. За повече информация относно тази приставка вижте [[doku>plugin:config]]. -Настройките показани със светло червен фон за защитени и не могат да се променят с тази приставка. Настройките показани със син фон са стандартните стойности и настройките с бял фон са били настроени локално за тази конкретна инсталация. Както сините, така и белите настройки могат да се променят. +Настройките изобразени със светло червен фон са защитени и не могат да бъдат променяни с тази приставка. Настройките показани със син фон са стандартните стойности, а настройките с бял фон са били настроени локално за тази конкретна инсталация. Можете да променяте както сините, така и белите настройки. -Не забравяйте да натиснете бутона **ЗАПИС** преди да напуснете страницата, иначе промените ви ще бъдат загубени. +Не забравяйте да натиснете бутона **ЗАПИС** преди да напуснете страницата, в противен случай промените няма да бъдат приложени. diff --git a/lib/plugins/config/lang/bg/lang.php b/lib/plugins/config/lang/bg/lang.php index 855f0b2c2..2489b0d25 100644 --- a/lib/plugins/config/lang/bg/lang.php +++ b/lib/plugins/config/lang/bg/lang.php @@ -5,150 +5,155 @@ * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) * @author Nikolay Vladimirov <nikolay@vladimiroff.com> * @author Viktor Usunov <usun0v@mail.bg> + * @author Kiril <neohidra@gmail.com> */ $lang['menu'] = 'Настройки'; -$lang['error'] = 'Невъзможно е обновяването на настройките, поради невалидна стойност, моля, прегледайте промените си и пробвайте отново. - <br />Неверните стойности ще бъдат обградени с червена рамка.'; -$lang['updated'] = 'Обновяването на настройките бе успешно.'; +$lang['error'] = 'Обновяването на настройките не е възможно, поради невалидна стойност, моля, прегледайте промените си и пробвайте отново. +<br />Неверните стойности ще бъдат обградени с червена рамка.'; +$lang['updated'] = 'Обновяването на настройките е успешно.'; $lang['nochoice'] = '(няма друг възможен избор)'; -$lang['locked'] = 'Невъзможно е обновяването на файлът с настройките, ако това не е нарочно, проверете,<br /> дали локалните име на файл и права са верни.'; -$lang['danger'] = 'Внимание: промяна на тази опция може да направи уикито и конфигурационното меню недостъпни.'; -$lang['warning'] = 'Предупреждение: промяна на тази опция може предизвика нежелани реакции.'; -$lang['security'] = 'Предупреждение: промяната на тази опция може да представлява риск за сигурността.'; -$lang['_configuration_manager'] = 'Управление на настройките'; -$lang['_header_dokuwiki'] = 'DokuWiki настройки'; -$lang['_header_plugin'] = 'Настройки на приставките'; -$lang['_header_template'] = 'Настройки на шаблоните'; +$lang['locked'] = 'Обновяването на файла с настройките не е възможно, ако това не е нарочно, проверете,<br /> дали името на локалния файл с настройки и правата са верни.'; +$lang['danger'] = 'Внимание: промяна на опцията може да направи wiki-то и менюто за настройване недостъпни.'; +$lang['warning'] = 'Предупреждение: промяна на опцията може предизвика нежелани последици.'; +$lang['security'] = 'Предупреждение: промяна на опцията може да представлява риск за сигурността.'; +$lang['_configuration_manager'] = 'Диспечер на настройките'; +$lang['_header_dokuwiki'] = 'Настройки на DokuWiki'; +$lang['_header_plugin'] = 'Настройки на приставки'; +$lang['_header_template'] = 'Настройки на шаблони'; $lang['_header_undefined'] = 'Неопределени настройки'; $lang['_basic'] = 'Основни настройки'; -$lang['_display'] = 'Настройки на показването'; -$lang['_authentication'] = 'Настройки на идентификацията'; -$lang['_anti_spam'] = 'Анти-спам настройки'; -$lang['_editing'] = 'Настройки на редактирането'; +$lang['_display'] = 'Настройки за изобразяване'; +$lang['_authentication'] = 'Настройки за удостоверяване'; +$lang['_anti_spam'] = 'Настройки за борба със SPAM-ма'; +$lang['_editing'] = 'Настройки за редактиране'; $lang['_links'] = 'Настройки на препратките'; $lang['_media'] = 'Настройки на медията'; $lang['_advanced'] = 'Допълнителни настройки'; $lang['_network'] = 'Мрежови настройки'; -$lang['_plugin_sufix'] = 'Настройки на приставките'; -$lang['_template_sufix'] = 'Настройки на шаблони'; -$lang['_msg_setting_undefined'] = 'Няма метаданни на настройките.'; +$lang['_plugin_sufix'] = ' - настройки на приставката'; +$lang['_template_sufix'] = ' - настройки на шаблона'; +$lang['_msg_setting_undefined'] = 'Няма метаданни за настройките.'; $lang['_msg_setting_no_class'] = 'Няма клас настройки.'; $lang['_msg_setting_no_default'] = 'Няма стандартна стойност.'; -$lang['fmode'] = 'Режим(права) на създаване на файловете'; -$lang['dmode'] = 'Режим(права) за създаване на директориите'; +$lang['fmode'] = 'Режим (права) за създаване на файлове'; +$lang['dmode'] = 'Режим (права) за създаване на директории'; $lang['lang'] = 'Език'; -$lang['basedir'] = 'Главна директория'; -$lang['baseurl'] = 'Главен адрес (URL)'; +$lang['basedir'] = 'Главна директория (напр. <code>/dokuwiki/</code>). Оставете празно, за да бъде засечена автоматично.'; +$lang['baseurl'] = 'URL адрес (напр. <code>http://www.yourserver.com</code>). Оставете празно, за да бъде засечен автоматично.'; $lang['savedir'] = 'Директория за записване на данните'; $lang['start'] = 'Име на началната страница'; -$lang['title'] = 'Име на Wiki'; +$lang['title'] = 'Име на Wiki-то'; $lang['template'] = 'Шаблон'; $lang['license'] = 'Под какъв лиценз да бъде публикувано съдържанието?'; -$lang['fullpath'] = 'Показване на пълния път до страниците в долния им край.'; -$lang['recent'] = 'Последни промени'; +$lang['fullpath'] = 'Показване на пълния път до страниците в долния колонтитул.'; +$lang['recent'] = 'Скорошни промени'; $lang['breadcrumbs'] = 'Брой на следите'; $lang['youarehere'] = 'Йерархични следи'; -$lang['typography'] = 'Поправяне на разместени букви'; -$lang['htmlok'] = 'Позволяване на вграден HTML код'; -$lang['phpok'] = 'Позволяване на вграден PHP код'; +$lang['typography'] = 'Замяна на последователност от символи с типографски еквивалент'; +$lang['htmlok'] = 'Разрешаване вграждането на HTML код'; +$lang['phpok'] = 'Разрешаване вграждането на PHP код'; $lang['dformat'] = 'Формат на датата (виж. <a href="http://www.php.net/strftime">strftime</a> функцията на PHP)'; $lang['signature'] = 'Подпис'; -$lang['toptoclevel'] = 'Главно ниво за съдържанието'; -$lang['tocminheads'] = 'Минимална сума на заглавията, която определя дали съдържанието е създадено'; -$lang['maxtoclevel'] = 'Максимално ниво на съдържанието'; -$lang['maxseclevel'] = 'Максимално ниво на редактиране на секция'; -$lang['camelcase'] = 'Използване на CamelCase за препратки'; -$lang['deaccent'] = 'Окончателни имена на страници'; -$lang['useheading'] = 'Използване на първото заглавие за име на страница'; -$lang['refcheck'] = 'Проверка за препратка на медия'; -$lang['refshow'] = 'Брой на показани медийни препратки'; -$lang['allowdebug'] = 'Пускане на debug <b>изключете, ако не е нужен!</b>'; -$lang['usewordblock'] = 'Блокиране на спам базирано на списък от думи'; -$lang['indexdelay'] = 'Забавяне преди индексиране(секунди)'; -$lang['relnofollow'] = 'Използване на rel="nofollow" за външни връзки'; -$lang['mailguard'] = 'Промяна на адреса на електронната поща във форма непозволяваща пращането на спам'; -$lang['iexssprotect'] = 'Проверяване на качените файлове за възможно зловреден JavaScript и HTML код'; -$lang['showuseras'] = 'Какво да се показва на дисплея за потребителя, който последно е променил тази страница'; -$lang['useacl'] = 'Използване на списъци за достъп'; -$lang['autopasswd'] = 'Автоматично генериране на пароли'; -$lang['authtype'] = 'Метод на идентификация'; +$lang['toptoclevel'] = 'Главно ниво (заглавие) за съдържанието'; +$lang['tocminheads'] = 'Минимален брой заглавия, определящ дали да бъде създадено съдържание'; +$lang['maxtoclevel'] = 'Максимален брой нива (заглавия) за включване в съдържанието'; +$lang['maxseclevel'] = 'Максимален брой нива предоставяни за самостоятелно редактиране'; +$lang['camelcase'] = 'Ползване на CamelCase за линкове'; +$lang['deaccent'] = 'Почистване имената на страниците (на файловете)'; +$lang['useheading'] = 'Ползване на първото заглавие за име на страница'; +$lang['refcheck'] = 'Проверка за препратка към медия, преди да бъде изтрита'; +$lang['refshow'] = 'Брой на показваните медийни препратки'; +$lang['allowdebug'] = 'Включване на режи debug - <b>изключете, ако не е нужен!</b>'; +$lang['usewordblock'] = 'Блокиране на SPAM въз основа на на списък от думи'; +$lang['indexdelay'] = 'Забавяне преди индексиране (сек)'; +$lang['relnofollow'] = 'Ползване на rel="nofollow" за външни препратки'; +$lang['mailguard'] = 'Промяна на адресите на ел. поща (във форма непозволяваща пращането на SPAM)'; +$lang['iexssprotect'] = 'Проверяване на качените файлове за вероятен зловреден JavaScript и HTML код'; +$lang['showuseras'] = 'Какво да се показва за потребителя, който последно е променил страницата'; +$lang['useacl'] = 'Ползване на списъци за достъп'; +$lang['autopasswd'] = 'Автоматично генериране на пароли, на нови потребители и пращане по пощата'; +$lang['authtype'] = 'Метод за удостоверяване'; $lang['passcrypt'] = 'Метод за криптиране на паролите'; -$lang['defaultgroup'] = 'Група по подразбиране'; -$lang['superuser'] = 'Супер потребител - група или потребител с пълен достъп до всички страници и функции без значение от настройките на списъците за достъп (ACL)'; -$lang['manager'] = 'Управител - група или потребител, с достъп до определени управляващи фунции '; +$lang['defaultgroup'] = 'Стандартна група'; +$lang['superuser'] = 'Супер потребител - група, потребител или списък със стойности разделени чрез запетая (user1,@group1,user2) с пълен достъп до всички страници и функции без значение от настройките на списъците за достъп (ACL)'; +$lang['manager'] = 'Управител - група, потребител или списък със стойности разделени чрез запетая (user1,@group1,user2) с достъп до определени управленски фунции '; $lang['profileconfirm'] = 'Потвърждаване на промени в профила с парола'; -$lang['disableactions'] = 'Изключване на DokuWiki функции'; +$lang['disableactions'] = 'Изключване функции на DokuWiki'; $lang['disableactions_check'] = 'Проверка'; -$lang['disableactions_subscription'] = 'Записване/Отписване'; +$lang['disableactions_subscription'] = 'Абониране/Отписване'; $lang['disableactions_wikicode'] = 'Преглед на кода/Експортиране на оригинална версия'; $lang['disableactions_other'] = 'Други действия (разделени със запетая)'; -$lang['sneaky_index'] = 'По подразбиране DokuWiki ще показва всички именни пространства в индекса. Избирането на настройката ще доведе до скриване на тези, за които потребителят няма права за четене. Това може да означава и скриване на достъпните подименни пространства. Това може да направи индекса неизползваем при определени настрокйки на списъците за контрол на достъп (ACL). '; -$lang['auth_security_timeout'] = 'Изчакване при вписване преди Timeout (в секунди)'; -$lang['securecookie'] = 'Да се изпращат ли бисквитки, посочени чрез HTTPS, само чрез HTTPS от браузъра? Забранете тази опция, когато SSL се използва само за вписване в системата, а четенето е възможно и без SSL. +$lang['sneaky_index'] = 'Стандартно DokuWiki ще показва всички именни пространства в индекса. Опцията скрива тези, за които потребителят няма права за четене. Това може да доведе и до скриване на иначе достъпни подименни пространства. С определени настройки на списъците за контрол на достъпа (ACL) може да направи индекса неизползваем. '; +$lang['auth_security_timeout'] = 'Автоматично проверяване на удостоверяването всеки (сек)'; +$lang['securecookie'] = 'Да се изпращат ли бисквитките зададени чрез HTTPS, само чрез HTTPS от браузъра? Изключете опцията, когато SSL се ползва само за вписване, а четенето е без SSL. '; -$lang['xmlrpc'] = 'Включи/изключи XML-RPC интерфейса'; -$lang['xmlrpcuser'] = 'Ограничаване на XML-RPC достъп до дадени тук и отделени със запетая групи или потребители. Оставете празни да даде достъп до всички.'; -$lang['updatecheck'] = 'Проверка за нови версии и предупреждения за сигурност? Dokiwiki трябва да може да се свърже със splitbrain.org за тази функционалност.'; -$lang['userewrite'] = 'Използване на валидни URL'; -$lang['useslash'] = 'Използване на наклонена черта за разделител на именнипространсвта в URL'; -$lang['usedraft'] = 'Автоматично запазване на чернова при редактиране'; +$lang['xmlrpc'] = 'Включване/Изключване на интерфейса XML-RPC.'; +$lang['xmlrpcuser'] = 'Ограничаване на XML-RPC достъпа до отделени със запетая групи или потребители. Оставете празно, за да даде достъп на всеки.'; +$lang['updatecheck'] = 'Проверяване за за нови версии и предупреждения за сигурността? Необходимо е Dokiwiki да може да се свързва със update.dokuwiki.org за тази функционалност.'; +$lang['userewrite'] = 'Ползване на nice URL адреси'; +$lang['useslash'] = 'Ползване на наклонена черта за разделител на именните пространства в URL'; +$lang['usedraft'] = 'Автоматично запазване на чернова по време на редактиране'; $lang['sepchar'] = 'Разделител между думите в имената на страници'; -$lang['canonical'] = 'Използване на уеднаквени URL'; -$lang['autoplural'] = 'Проверка за множествено число в препратките'; +$lang['canonical'] = 'Ползване на напълно уеднаквени URL адреси (абсолютни адреси - http://server/path)'; +$lang['fnencode'] = 'Метод за кодиране на не-ASCII именуваните файлове.'; +$lang['autoplural'] = 'Проверяване за множествено число в препратките'; $lang['compression'] = 'Метод за компресия на attic файлове'; -$lang['cachetime'] = 'Максимална възраст на кеша (сек)'; -$lang['locktime'] = 'Максимална възраст на заключващите файлове (сек)'; -$lang['fetchsize'] = 'Максимален размер (байтове), който fetch.php може да дърпа'; -$lang['notify'] = 'Пращане на съобщения за промени на тази e-поща'; -$lang['registernotify'] = 'Пращане информация на нови потребители на тази е-поща'; -$lang['mailfrom'] = 'Адрес на е-поща, който да се използва за пращане на автоматичната поща'; -$lang['gzip_output'] = 'Използване gzip Кодиране на съдържанието(Content-Encoding) за xhtml'; +$lang['cachetime'] = 'Макс. период за съхраняване на кеша (сек)'; +$lang['locktime'] = 'Макс. период за съхраняване на заключените файлове (сек)'; +$lang['fetchsize'] = 'Максимален размер (байтове), който fetch.php може да сваля'; +$lang['notify'] = 'Пращане на съобщения за промени по странците на следната eл. поща'; +$lang['registernotify'] = 'Пращане на информация за нови потребители на следната ел. поща'; +$lang['mailfrom'] = 'Ел. поща, която да се ползва за автоматично изпращане на ел. писма'; +$lang['mailprefix'] = 'Представка за темите (поле subject) на автоматично изпращаните ел. писма'; +$lang['gzip_output'] = 'Кодиране на съдържанието с gzip за xhtml'; $lang['gdlib'] = 'Версия на GD Lib'; $lang['im_convert'] = 'Път до инструмента за трансформация на ImageMagick'; $lang['jpg_quality'] = 'Kачество на JPG компресията (0-100)'; -$lang['subscribers'] = 'Поддръжка за абониране към страница'; -$lang['compress'] = 'Компактен CSS и javascript изход'; -$lang['hidepages'] = 'Скриване на съвпадащи имена на страници(regular expressions)'; +$lang['subscribers'] = 'Включване на поддръжката за абониране към страници'; +$lang['subscribe_time'] = 'Време след което абонаментните списъци и обобщения се изпращат (сек); Трябва да е по-малко от времето определено в recent_days.'; +$lang['compress'] = 'Компактен CSS и javascript изглед'; +$lang['hidepages'] = 'Скриване на съвпадащите страници (regular expressions)'; $lang['send404'] = 'Пращане на "HTTP 404/Page Not Found" за несъществуващи страници'; $lang['sitemap'] = 'Генериране на Google sitemap (дни)'; -$lang['broken_iua'] = 'Отметнете, ако ignore_user_abort функцията не работи, търсенето може да не се извършва правилно.Известно е, че комбинацията IIS+PHP/CGI е лоша. Вижте <a href="http://bugs.splitbrain.org/?do=details&task_id=852">Грешка 852</a> за повече информация.'; -$lang['xsendfile'] = 'Използване на Х-Sendfile header, за позволяване на уеб сървъра да дава статични файлове? Вашият уеб сървър трябва да поддържа това.'; -$lang['renderer_xhtml'] = 'Показвай main (XHTML) код за wiki'; -$lang['renderer__core'] = '%s (DokuWiki ядро)'; +$lang['broken_iua'] = 'Отметнете, ако ignore_user_abort функцията не работи. Може да попречи на търсенето в страниците. Знае се, че комбинацията IIS+PHP/CGI е лоша. Вижте <a href="http://bugs.splitbrain.org/?do=details&task_id=852">Грешка 852</a> за повече информация.'; +$lang['xsendfile'] = 'Ползване на Х-Sendfile header, за да може уебсървъра да дава статични файлове? Вашият уебсървър трябва да го поддържа.'; +$lang['renderer_xhtml'] = 'Представяне на основните изходни данни (xhtml) от wiki-то с'; +$lang['renderer__core'] = '%s (ядрото на DokuWiki)'; $lang['renderer__plugin'] = '%s (приставка)'; -$lang['rememberme'] = 'Остави постоянни бисквитки за вход (запомни ме)'; -$lang['rss_type'] = 'Вид на XML източника (feed)'; -$lang['rss_linkto'] = 'XML feed препраща към'; -$lang['rss_content'] = 'Какво да се показва в XML feed елементите?'; -$lang['rss_update'] = 'Интервал на обновяване XML източника (сек)'; -$lang['recent_days'] = 'Колко последни промени да се пазят (дни)'; -$lang['rss_show_summary'] = 'XML feed show summary in title'; +$lang['rememberme'] = 'Ползване на постоянни бисквитки за вписване (за функцията "Запомни ме")'; +$lang['rss_type'] = 'Тип на XML емисията'; +$lang['rss_linkto'] = 'XML емисията препраща към'; +$lang['rss_content'] = 'Какво да показват елементите на XML емисията?'; +$lang['rss_update'] = 'Интервал на актуализиране на XML емисията (сек)'; +$lang['recent_days'] = 'Колко от скорошните промени да се пазят (дни)'; +$lang['rss_show_summary'] = 'Показване на обобщение в заглавието на XML емисията'; $lang['target____wiki'] = 'Прозорец за вътрешни препратки'; -$lang['target____interwiki'] = 'Прозорец за вътрешни уики препратки'; +$lang['target____interwiki'] = 'Прозорец за препратки в wiki-то'; $lang['target____extern'] = 'Прозорец за външни препратки'; -$lang['target____media'] = 'Прозорец за препратки към медия'; -$lang['target____windows'] = 'Прозорец за препратки към прозорци'; +$lang['target____media'] = 'Прозорец за медийни препратки'; +$lang['target____windows'] = 'Прозорец за препратки към Windows'; $lang['proxy____host'] = 'Име на прокси сървър'; -$lang['proxy____port'] = 'Порт на проксито'; +$lang['proxy____port'] = 'Порт за проксито'; $lang['proxy____user'] = 'Потребител за проксито'; $lang['proxy____pass'] = 'Парола за проксито'; -$lang['proxy____ssl'] = 'Използване на ssl за връзка към проксито'; -$lang['safemodehack'] = 'Позволи safemode хак'; -$lang['ftp____host'] = 'FTP сървър за safemode хака'; -$lang['ftp____port'] = 'FTP порт за safemode хака'; -$lang['ftp____user'] = 'FTP потребител за safemode хака'; -$lang['ftp____pass'] = 'FTP парола за safemode хака'; -$lang['ftp____root'] = 'FTP главна директория safemode хака'; +$lang['proxy____ssl'] = 'Ползване на SSL при свързване с проксито'; +$lang['proxy____except'] = 'Регулярен израз определящ за кои URL адреси да не се ползва прокси сървър.'; +$lang['safemodehack'] = 'Ползване на хака safemode'; +$lang['ftp____host'] = 'FTP сървър за хака safemode'; +$lang['ftp____port'] = 'FTP порт за хака safemode'; +$lang['ftp____user'] = 'FTP потребител за хака safemode'; +$lang['ftp____pass'] = 'FTP парола за хака safemode'; +$lang['ftp____root'] = 'FTP главна директория за хака safemode'; $lang['license_o_'] = 'Нищо не е избрано'; $lang['typography_o_0'] = 'без'; $lang['typography_o_1'] = 'с изключение на единични кавички'; -$lang['typography_o_2'] = 'всякаква форма за кавичките (не винаги работи)'; +$lang['typography_o_2'] = 'включително единични кавички (не винаги работи)'; $lang['userewrite_o_0'] = 'без'; -$lang['userewrite_o_1'] = '.htaccess файл'; +$lang['userewrite_o_1'] = 'файлът .htaccess'; $lang['userewrite_o_2'] = 'вътрешно от DokuWiki '; $lang['deaccent_o_0'] = 'изключено'; $lang['deaccent_o_1'] = 'премахване на акценти'; -$lang['deaccent_o_2'] = 'романизация'; +$lang['deaccent_o_2'] = 'транслитерация'; $lang['gdlib_o_0'] = 'GD Lib не е достъпна'; $lang['gdlib_o_1'] = 'Версия 1.x'; $lang['gdlib_o_2'] = 'Автоматично разпознаване'; @@ -158,12 +163,12 @@ $lang['rss_type_o_rss2'] = 'RSS версия 2.0'; $lang['rss_type_o_atom'] = 'Atom версия 0.3'; $lang['rss_type_o_atom1'] = 'Atom версия 1.0'; $lang['rss_content_o_abstract'] = 'Извлечение'; -$lang['rss_content_o_diff'] = 'Обединен Diff'; -$lang['rss_content_o_htmldiff'] = 'Diff таблица в HTML формат'; +$lang['rss_content_o_diff'] = 'Обединени разлики'; +$lang['rss_content_o_htmldiff'] = 'Таблица с разликите в HTML формат'; $lang['rss_content_o_html'] = 'Цялото съдържание на HTML страницата'; $lang['rss_linkto_o_diff'] = 'изглед на разликите'; $lang['rss_linkto_o_page'] = 'променената страница'; -$lang['rss_linkto_o_rev'] = 'списък на текущите версии'; +$lang['rss_linkto_o_rev'] = 'списък на версиите'; $lang['rss_linkto_o_current'] = 'текущата страница'; $lang['compression_o_0'] = 'без'; $lang['compression_o_gz'] = 'gzip'; @@ -172,11 +177,12 @@ $lang['xsendfile_o_0'] = 'не използвайте'; $lang['xsendfile_o_1'] = 'Специфичен lighttpd header (преди версия 1.5)'; $lang['xsendfile_o_2'] = 'Стандартен X-Sendfile header'; $lang['xsendfile_o_3'] = 'Специфичен Nginx X-Accel-Redirect header за пренасочване'; -$lang['showuseras_o_loginname'] = 'Потребителско име'; +$lang['showuseras_o_loginname'] = 'Име за вписване'; $lang['showuseras_o_username'] = 'Пълно потребителско име'; -$lang['showuseras_o_email'] = 'Пълен адрес на електронната поща на потребителя'; -$lang['showuseras_o_email_link'] = 'Адрес на електронната поща на потребителя под формата на mailto: линк'; +$lang['showuseras_o_email'] = 'Ел, поща (променени според настройките на mailguard)'; +$lang['showuseras_o_email_link'] = 'Ел. поща под формата на връзка тип mailto:'; $lang['useheading_o_0'] = 'Никога'; $lang['useheading_o_navigation'] = 'Само за навигация'; -$lang['useheading_o_content'] = 'Само за Wiki съдържание'; +$lang['useheading_o_content'] = 'Само за съдържанието на Wiki-то'; $lang['useheading_o_1'] = 'Винаги'; +$lang['readdircache'] = 'Максимален период за съхраняване кеша на readdir (сек)'; diff --git a/lib/plugins/config/lang/ca-valencia/lang.php b/lib/plugins/config/lang/ca-valencia/lang.php index 239213433..76f11a4a5 100644 --- a/lib/plugins/config/lang/ca-valencia/lang.php +++ b/lib/plugins/config/lang/ca-valencia/lang.php @@ -88,7 +88,7 @@ $lang['auth_security_timeout'] = 'Temps de seguritat màxim per a l\'autenticaci $lang['securecookie'] = '¿El navegador deuria enviar per HTTPS només les galletes que s\'han generat per HTTPS? Desactive esta opció quan utilise SSL només en la pàgina d\'inici de sessió.'; $lang['xmlrpc'] = 'Activar/desactivar interfaç XML-RPC.'; $lang['xmlrpcuser'] = 'Restringir l\'accés XML-RPC a la llista d\'usuaris i grups separada per comes definida ací. Deixar buit per a donar accés a tots.'; -$lang['updatecheck'] = '¿Buscar actualisacions i advertències de seguritat? DokuWiki necessita conectar a splitbrain.org per ad açò.'; +$lang['updatecheck'] = '¿Buscar actualisacions i advertències de seguritat? DokuWiki necessita conectar a update.dokuwiki.org per ad açò.'; $lang['userewrite'] = 'Utilisar URL millorades'; $lang['useslash'] = 'Utilisar \'/\' per a separar espais de noms en les URL'; $lang['usedraft'] = 'Guardar automàticament un borrador mentres edite'; diff --git a/lib/plugins/config/lang/ca/lang.php b/lib/plugins/config/lang/ca/lang.php index f0d622d35..d53cf1031 100644 --- a/lib/plugins/config/lang/ca/lang.php +++ b/lib/plugins/config/lang/ca/lang.php @@ -88,7 +88,7 @@ $lang['auth_security_timeout'] = 'Temps d\'espera de seguretat en l\'autenticaci $lang['securecookie'] = 'Les galetes que s\'han creat via HTTPS, només s\'han d\'enviar des del navegador per HTTPS? Inhabiliteu aquesta opció si només l\'inici de sessió del wiki es fa amb SSL i la navegació del wiki es fa sense seguretat.'; $lang['xmlrpc'] = 'Habilita/inhabilita la interfície XML-RPC'; $lang['xmlrpcuser'] = 'Restringeix l\'accés per XML-RPC als usuaris o grups següents, separats per comes. Deixeu aquest camp en blanc per donar accés a tothom.'; -$lang['updatecheck'] = 'Comprova actualitzacions i avisos de seguretat. DokuWiki necessitarà contactar amb splitbrain.org per utilitzar aquesta característica.'; +$lang['updatecheck'] = 'Comprova actualitzacions i avisos de seguretat. DokuWiki necessitarà contactar amb update.dokuwiki.org per utilitzar aquesta característica.'; $lang['userewrite'] = 'Utilitza URL nets'; $lang['useslash'] = 'Utilitza la barra / com a separador d\'espais en els URL'; $lang['usedraft'] = 'Desa automàticament un esborrany mentre s\'edita'; diff --git a/lib/plugins/config/lang/cs/lang.php b/lib/plugins/config/lang/cs/lang.php index 06839c1d0..9126a041a 100644 --- a/lib/plugins/config/lang/cs/lang.php +++ b/lib/plugins/config/lang/cs/lang.php @@ -8,6 +8,7 @@ * @author tomas@valenta.cz * @author Marek Sacha <sachamar@fel.cvut.cz> * @author Lefty <lefty@multihost.cz> + * @author Vojta Beran <xmamut@email.cz> */ $lang['menu'] = 'Správa nastavení'; $lang['error'] = 'Nastavení nebyla změněna kvůli alespoň jedné neplatné položce, @@ -98,7 +99,7 @@ $lang['auth_security_timeout'] = 'Časový limit pro autentikaci (v sekundách)' $lang['securecookie'] = 'Má prohlížeč posílat cookies nastavené přes HTTPS opět jen přes HTTPS? Vypněte tuto volbu, pokud chcete, aby bylo pomocí SSL zabezpečeno pouze přihlašování do wiki, ale obsah budete prohlížet nezabezpečeně.'; $lang['xmlrpc'] = 'Povolit/Zakázat rozhraní XML-RPC.'; $lang['xmlrpcuser'] = 'Omezit přístup pomocí XML-RPC pouze na zde zadané skupiny či uživatele (oddělené čárkami). Necháte-li pole prázdné, dáte přístup komukoliv.'; -$lang['updatecheck'] = 'Kontrolovat aktualizace a bezpečnostní varování? DokuWiki potřebuje pro tuto funkci přístup k splitbrain.org'; +$lang['updatecheck'] = 'Kontrolovat aktualizace a bezpečnostní varování? DokuWiki potřebuje pro tuto funkci přístup k update.dokuwiki.org'; $lang['userewrite'] = 'Používat "pěkná" URL'; $lang['useslash'] = 'Používat lomítko jako oddělovač jmenných prostorů v URL'; $lang['usedraft'] = 'Během editace ukládat koncept automaticky'; @@ -112,7 +113,8 @@ $lang['locktime'] = 'Maximální životnost zámkových souborů (v $lang['fetchsize'] = 'Maximální velikost souboru (v bajtech), co ještě fetch.php bude stahovat z externích zdrojů'; $lang['notify'] = 'Posílat oznámení o změnách na následující emailovou adresu'; $lang['registernotify'] = 'Posílat informace o nově registrovaných uživatelích na tuto mailovou adresu'; -$lang['mailfrom'] = 'Emailová adresa, která se bude používat pro automatické maily'; +$lang['mailfrom'] = 'E-mailová adresa, která se bude používat pro automatické maily'; +$lang['mailprefix'] = 'Předpona předmětu e-mailu, která se bude používat pro automatické maily'; $lang['gzip_output'] = 'Používat pro xhtml Content-Encoding gzip'; $lang['gdlib'] = 'Verze GD knihovny'; $lang['im_convert'] = 'Cesta k nástroji convert z balíku ImageMagick'; diff --git a/lib/plugins/config/lang/da/lang.php b/lib/plugins/config/lang/da/lang.php index bc2bc0560..a4c0bba75 100644 --- a/lib/plugins/config/lang/da/lang.php +++ b/lib/plugins/config/lang/da/lang.php @@ -94,7 +94,7 @@ $lang['auth_security_timeout'] = 'Tidsudløb for bekræftelse (sekunder)'; $lang['securecookie'] = 'Skal datafiler skabt af HTTPS kun sendes af HTTPS gennem browseren? Slå denne valgmulighed fra hvis kun brugen af din wiki er SSL-beskyttet, mens den almindelige tilgang udefra ikke er sikret.'; $lang['xmlrpc'] = 'Slå XML-RPC-grænseflade til/fra.'; $lang['xmlrpcuser'] = 'Begræns XML-RPC-adgang til de nævnte og med komma adskilte grupper eller brugere. Lad den stå tom for at give alle adgang.'; -$lang['updatecheck'] = 'Kig efter opdateringer og sikkerhedsadvarsler? DokuWiki er nødt til at kontakte splitbrain.org for at tilgå denne funktion.'; +$lang['updatecheck'] = 'Kig efter opdateringer og sikkerhedsadvarsler? DokuWiki er nødt til at kontakte update.dokuwiki.org for at tilgå denne funktion.'; $lang['userewrite'] = 'Brug pæne netadresser'; $lang['useslash'] = 'Brug skråstreg som navnerumsdeler i netadresser'; $lang['usedraft'] = 'Gem automatisk en kladde under redigering'; diff --git a/lib/plugins/config/lang/de-informal/lang.php b/lib/plugins/config/lang/de-informal/lang.php index 01beeeeb9..ab7f59eac 100644 --- a/lib/plugins/config/lang/de-informal/lang.php +++ b/lib/plugins/config/lang/de-informal/lang.php @@ -6,6 +6,7 @@ * @author Juergen Schwarzer <jschwarzer@freenet.de> * @author Marcel Metz <marcel_metz@gmx.de> * @author Matthias Schulte <post@lupo49.de> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Einstellungen'; $lang['error'] = 'Einstellungen wurden nicht aktualisiert auf Grund eines ungültigen Wertes. Bitte überprüfe deine Änderungen und versuche es erneut.<br />Die/der ungültige(n) Wert(e) werden durch eine rote Umrandung hervorgehoben.'; @@ -87,7 +88,7 @@ $lang['auth_security_timeout'] = 'Zeitüberschreitung bei der Authentifizierung $lang['securecookie'] = 'Sollen Cookies, die via HTTPS gesetzt wurden nur per HTTPS versendet werden? Deaktiviere diese Option, wenn nur der Login deines Wikis mit SSL gesichert ist, aber das Betrachten des Wikis ungesichert geschieht.'; $lang['xmlrpc'] = 'Aktiviere/Deaktiviere die XML-RPC-Schnittstelle'; $lang['xmlrpcuser'] = 'XML-RPC-Zugriff auf folgende Gruppen oder Benutzer (kommasepariert) beschränken. Wenn du dieses Feld leer lässt, wir der Zugriff jedem gewährt.'; -$lang['updatecheck'] = 'Automatisch auf Updates und Sicherheitswarnungen prüfen? DokuWiki muss sich dafür mit splitbrain.org verbinden.'; +$lang['updatecheck'] = 'Automatisch auf Updates und Sicherheitswarnungen prüfen? DokuWiki muss sich dafür mit update.dokuwiki.org verbinden.'; $lang['userewrite'] = 'Benutze schöne URLs'; $lang['useslash'] = 'Benutze Schrägstrich als Namensraumtrenner in URLs'; $lang['usedraft'] = 'Speichere automatisch Entwürfe während der Bearbeitung'; @@ -102,6 +103,7 @@ $lang['fetchsize'] = 'Maximale Größe (in Bytes), die fetch.php von $lang['notify'] = 'Sende Änderungsbenachrichtigungen an diese E-Mail-Adresse.'; $lang['registernotify'] = 'Sende Information bei neu registrierten Benutzern an diese E-Mail-Adresse.'; $lang['mailfrom'] = 'Absenderadresse für automatisch erzeugte E-Mails'; +$lang['mailprefix'] = 'Präfix für E-Mail-Betreff beim automatischen Versand von Benachrichtigungen'; $lang['gzip_output'] = 'Seiten mit gzip komprimiert ausliefern'; $lang['gdlib'] = 'GD Lib Version'; $lang['im_convert'] = 'Pfad zu ImageMagicks Konvertierwerkzeug'; diff --git a/lib/plugins/config/lang/de/lang.php b/lib/plugins/config/lang/de/lang.php index 9a8ca3b30..b4746d757 100644 --- a/lib/plugins/config/lang/de/lang.php +++ b/lib/plugins/config/lang/de/lang.php @@ -13,6 +13,8 @@ * @author Blitzi94@gmx.de * @author Robert Bogenschneider <robog@GMX.de> * @author Robert Bogenschneider <robog@gmx.de> + * @author Niels Lange <niels@boldencursief.nl> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Konfiguration'; $lang['error'] = 'Die Einstellungen wurden wegen einer fehlerhaften Eingabe nicht gespeichert. @@ -97,7 +99,7 @@ $lang['auth_security_timeout'] = 'Authentifikations-Timeout (Sekunden)'; $lang['securecookie'] = 'Sollen Cookies, die via HTTPS gesetzt wurden nur per HTTPS versendet werden? Deaktivieren Sie diese Option, wenn nur der Login Ihres Wikis mit SSL gesichert ist, aber das Betrachten des Wikis ungesichert geschieht.'; $lang['xmlrpc'] = 'XML-RPC-Zugriff erlauben.'; $lang['xmlrpcuser'] = 'XML-RPC-Zugriff auf folgende Gruppen oder Benutzer (kommasepariert) beschränken. Wenn Sie dieses Feld leer lassen, wir der Zugriff jedem gewährt.'; -$lang['updatecheck'] = 'Automatisch auf Updates und Sicherheitswarnungen prüfen? DokuWiki muss sich dafür mit splitbrain.org verbinden.'; +$lang['updatecheck'] = 'Automatisch auf Updates und Sicherheitswarnungen prüfen? DokuWiki muss sich dafür mit update.dokuwiki.org verbinden.'; $lang['userewrite'] = 'URL rewriting'; $lang['useslash'] = 'Schrägstrich (/) als Namensraumtrenner in URLs verwenden'; $lang['usedraft'] = 'Während des Bearbeitens automatisch Zwischenentwürfe speichern'; @@ -112,6 +114,7 @@ $lang['fetchsize'] = 'Maximale Größe (in Bytes), die fetch.php von $lang['notify'] = 'Änderungsmitteilungen an diese E-Mail-Adresse versenden'; $lang['registernotify'] = 'Information über neu registrierte Nutzer an diese E-Mail-Adresse senden'; $lang['mailfrom'] = 'Absender-E-Mail-Adresse für automatische Mails'; +$lang['mailprefix'] = 'Präfix für E-Mail-Betreff beim automatischen Versand von Benachrichtigungen'; $lang['gzip_output'] = 'Seiten mit gzip komprimiert ausliefern'; $lang['gdlib'] = 'GD Lib Version'; $lang['im_convert'] = 'Pfad zu ImageMagicks Konvertierwerkzeug'; diff --git a/lib/plugins/config/lang/el/lang.php b/lib/plugins/config/lang/el/lang.php index df9029506..ed7af0ff4 100644 --- a/lib/plugins/config/lang/el/lang.php +++ b/lib/plugins/config/lang/el/lang.php @@ -93,7 +93,7 @@ $lang['auth_security_timeout'] = 'Διάρκεια χρόνου για ασφά $lang['securecookie'] = 'Τα cookies που έχουν οριστεί μέσω HTTPS πρέπει επίσης να αποστέλλονται μόνο μέσω HTTPS από τον φυλλομετρητή? Απενεργοποιήστε αυτή την επιλογή όταν μόνο η είσοδος στο wiki σας διασφαλίζεται μέσω SSL αλλά η περιήγηση γίνεται και χωρίς αυτό.'; $lang['xmlrpc'] = 'Ενεργοποίηση/Απενεργοποίηση της διασύνδεσης XML-RPC '; $lang['xmlrpcuser'] = 'Περιορισμός XML-RPC πρόσβασης στις ομάδες η τους χρήστες (διαχωριζόμενοι με κόμμα). Αφήστε το κενό για πρόσβαση από όλους.'; -$lang['updatecheck'] = 'Έλεγχος για ύπαρξη νέων εκδόσεων και ενημερώσεων ασφαλείας της εφαρμογής? Απαιτείται η σύνδεση με το splitbrain.org για να λειτουργήσει σωστά αυτή η επιλογή.'; +$lang['updatecheck'] = 'Έλεγχος για ύπαρξη νέων εκδόσεων και ενημερώσεων ασφαλείας της εφαρμογής? Απαιτείται η σύνδεση με το update.dokuwiki.org για να λειτουργήσει σωστά αυτή η επιλογή.'; $lang['userewrite'] = 'Χρήση ωραίων URLs'; $lang['useslash'] = 'Χρήση slash σαν διαχωριστικό φακέλων στα URLs'; $lang['usedraft'] = 'Αυτόματη αποθήκευση αντιγράφων κατά την τροποποίηση σελίδων'; @@ -108,6 +108,7 @@ $lang['fetchsize'] = 'Μέγιστο μέγεθος (σε bytes) ε $lang['notify'] = 'Αποστολή ενημέρωσης για αλλαγές σε αυτή την e-mail διεύθυνση'; $lang['registernotify'] = 'Αποστολή ενημερωτικών μηνυμάτων σε αυτή την e-mail διεύθυνση κατά την εγγραφή νέων χρηστών'; $lang['mailfrom'] = 'e-mail διεύθυνση αποστολέα για μηνύματα από την εφαρμογή'; +$lang['mailprefix'] = 'Πρόθεμα θέματος που να χρησιμοποιείται για τα αυτόματα μηνύματα ηλεκτρονικού ταχυδρομείου.'; $lang['gzip_output'] = 'Χρήση gzip Content-Encoding για την xhtml'; $lang['gdlib'] = 'Έκδοση βιβλιοθήκης GD'; $lang['im_convert'] = 'Διαδρομή προς το εργαλείο μετατροπής εικόνων του ImageMagick'; diff --git a/lib/plugins/config/lang/en/lang.php b/lib/plugins/config/lang/en/lang.php index 9003337df..8609e278f 100644 --- a/lib/plugins/config/lang/en/lang.php +++ b/lib/plugins/config/lang/en/lang.php @@ -111,7 +111,7 @@ $lang['xmlrpc'] = 'Enable/disable XML-RPC interface.'; $lang['xmlrpcuser'] = 'Restrict XML-RPC access to the comma separated groups or users given here. Leave empty to give access to everyone.'; /* Advanced Options */ -$lang['updatecheck'] = 'Check for updates and security warnings? DokuWiki needs to contact splitbrain.org for this feature.'; +$lang['updatecheck'] = 'Check for updates and security warnings? DokuWiki needs to contact update.dokuwiki.org for this feature.'; $lang['userewrite'] = 'Use nice URLs'; $lang['useslash'] = 'Use slash as namespace separator in URLs'; $lang['usedraft'] = 'Automatically save a draft while editing'; @@ -126,6 +126,7 @@ $lang['fetchsize'] = 'Maximum size (bytes) fetch.php may download from extern' $lang['notify'] = 'Send change notifications to this email address'; $lang['registernotify'] = 'Send info on newly registered users to this email address'; $lang['mailfrom'] = 'Email address to use for automatic mails'; +$lang['mailprefix'] = 'Email subject prefix to use for automatic mails'; $lang['gzip_output'] = 'Use gzip Content-Encoding for xhtml'; $lang['gdlib'] = 'GD Lib version'; $lang['im_convert'] = 'Path to ImageMagick\'s convert tool'; @@ -133,6 +134,7 @@ $lang['jpg_quality'] = 'JPG compression quality (0-100)'; $lang['subscribers'] = 'Enable page subscription support'; $lang['subscribe_time'] = 'Time after which subscription lists and digests are sent (sec); This should be smaller than the time specified in recent_days.'; $lang['compress'] = 'Compact CSS and javascript output'; +$lang['cssdatauri'] = 'Size in bytes up to which images referenced in CSS files should be embedded right into the stylesheet to reduce HTTP request header overhead. This technique won\'t work in IE < 8! <code>400</code> to <code>600</code> bytes is a good value. Set <code>0</code> to disable.'; $lang['hidepages'] = 'Hide matching pages (regular expressions)'; $lang['send404'] = 'Send "HTTP 404/Page Not Found" for non existing pages'; $lang['sitemap'] = 'Generate Google sitemap (days)'; diff --git a/lib/plugins/config/lang/eo/lang.php b/lib/plugins/config/lang/eo/lang.php index b519aa4e3..8a9ee3840 100644 --- a/lib/plugins/config/lang/eo/lang.php +++ b/lib/plugins/config/lang/eo/lang.php @@ -93,7 +93,7 @@ $lang['auth_security_timeout'] = 'Sekureca Templimo por aŭtentigo (sekundoj)'; $lang['securecookie'] = 'Ĉu kuketoj difinitaj per HTTPS nur estu senditaj de la foliumilo per HTTPS? Malebligu tiun ĉi opcion kiam nur la ensaluto al via vikio estas sekurigita per SSL, sed foliumado de la vikio estas farita malsekure.'; $lang['xmlrpc'] = 'Ebligi/malebligi la interfacon XML-RPC.'; $lang['xmlrpcuser'] = 'Permesi XML-RPC-an aliron al certaj grupoj aŭ uzantoj, bonvolu meti iliajn komoseparitajn nomojn tie ĉi. Alirebli de ĉiu, ĝin lasu malplena.'; -$lang['updatecheck'] = 'Ĉu kontroli aktualigojn kaj sekurecajn avizojn? DokuWiki bezonas kontakti splitbrain.org por tiu ĉi trajto.'; +$lang['updatecheck'] = 'Ĉu kontroli aktualigojn kaj sekurecajn avizojn? DokuWiki bezonas kontakti update.dokuwiki.org por tiu ĉi trajto.'; $lang['userewrite'] = 'Uzi netajn URL-ojn'; $lang['useslash'] = 'Uzi frakcistrekon kiel apartigsignaĵo por nomspacoj en URL-oj'; $lang['usedraft'] = 'Aŭtomate konservi skizon dum redaktado'; @@ -108,6 +108,7 @@ $lang['fetchsize'] = 'Maksimuma grandeco (bitokoj) permesita al "fet $lang['notify'] = 'Sendi avizojn pri ŝanĝoj al tiu ĉi retadreso'; $lang['registernotify'] = 'Sendi informon pri ĵus aliĝintoj al tiu ĉi retadreso'; $lang['mailfrom'] = 'Retadreso uzota por aŭtomataj retmesaĝoj '; +$lang['mailprefix'] = 'Retpoŝta temo-prefikso por uzi en aŭtomataj mesaĝoj'; $lang['gzip_output'] = 'Uzi gzip-a enhav-enkodigo por XHTML'; $lang['gdlib'] = 'Versio de GD Lib'; $lang['im_convert'] = 'Pado al la konvertilo de ImageMagick'; diff --git a/lib/plugins/config/lang/es/lang.php b/lib/plugins/config/lang/es/lang.php index 2e5d0d01a..5355d64ad 100644 --- a/lib/plugins/config/lang/es/lang.php +++ b/lib/plugins/config/lang/es/lang.php @@ -19,6 +19,7 @@ * @author Fernando J. Gómez <fjgomez@gmail.com> * @author Victor Castelan <victorcastelan@gmail.com> * @author Mauro Javier Giamberardino <mgiamberardino@gmail.com> + * @author emezeta <emezeta@infoprimo.com> */ $lang['menu'] = 'Parámetros de configuración'; $lang['error'] = 'Los parámetros no han sido actualizados a causa de un valor inválido, por favor revise los cambios y re-envíe el formulario. <br /> Los valores incorrectos se mostrarán con un marco rojo alrededor.'; @@ -100,7 +101,7 @@ $lang['auth_security_timeout'] = 'Tiempo de Autenticación (en segundos), por mo $lang['securecookie'] = 'Las cookies establecidas por HTTPS, ¿el naveagdor solo puede enviarlas por HTTPS? Inhabilite esta opción cuando solo se asegure con SSL la entrada, pero no la navegación de su wiki.'; $lang['xmlrpc'] = 'Habilitar/Deshabilitar interfaz XML-RPC'; $lang['xmlrpcuser'] = 'Restringir el acceso XML-RPC a los grupos o usuarios separados por coma mencionados aquí. Dejar en blanco para dar acceso a todo el mundo. '; -$lang['updatecheck'] = '¿Comprobar actualizaciones y advertencias de seguridad? Esta característica requiere que DokuWiki se conecte a splitbrain.org.'; +$lang['updatecheck'] = '¿Comprobar actualizaciones y advertencias de seguridad? Esta característica requiere que DokuWiki se conecte a update.dokuwiki.org.'; $lang['userewrite'] = 'Usar URLs bonitas'; $lang['useslash'] = 'Usar barra (/) como separador de espacios de nombres en las URLs'; $lang['usedraft'] = 'Guardar automáticamente un borrador mientras se edita'; @@ -115,6 +116,7 @@ $lang['fetchsize'] = 'Tamaño máximo (bytes) que fetch.php puede de $lang['notify'] = 'Enviar notificación de cambios a esta dirección de correo electrónico'; $lang['registernotify'] = 'Enviar información cuando se registran nuevos usuarios a esta dirección de correo electrónico'; $lang['mailfrom'] = 'Dirección de correo electrónico para emails automáticos'; +$lang['mailprefix'] = 'Asunto por defecto que se utilizará en mails automáticos.'; $lang['gzip_output'] = 'Usar gzip Content-Encoding para xhtml'; $lang['gdlib'] = 'Versión de GD Lib'; $lang['im_convert'] = 'Ruta a la herramienta de conversión de ImageMagick'; diff --git a/lib/plugins/config/lang/et/lang.php b/lib/plugins/config/lang/et/lang.php new file mode 100644 index 000000000..27f2e87ac --- /dev/null +++ b/lib/plugins/config/lang/et/lang.php @@ -0,0 +1,32 @@ +<?php +/** + * Estonian language file + * + * @author kristian.kankainen@kuu.la + * @author Rivo Zängov <eraser@eraser.ee> + */ +$lang['menu'] = 'Seadete haldamine'; +$lang['_configuration_manager'] = 'Seadete haldamine'; +$lang['_basic'] = 'Peamised seaded'; +$lang['_display'] = 'Näitamise seaded'; +$lang['_authentication'] = 'Audentimise seaded'; +$lang['_anti_spam'] = 'Spämmitõrje seaded'; +$lang['_editing'] = 'Muutmise seaded'; +$lang['_links'] = 'Lingi seaded'; +$lang['_media'] = 'Meedia seaded'; +$lang['_advanced'] = 'Laiendatud seaded'; +$lang['_network'] = 'Võrgu seaded'; +$lang['_plugin_sufix'] = 'Plugina seaded'; +$lang['_template_sufix'] = 'Kujunduse seaded'; +$lang['title'] = 'Wiki pealkiri'; +$lang['template'] = 'Kujundus'; +$lang['recent'] = 'Viimased muudatused'; +$lang['signature'] = 'Allkiri'; +$lang['defaultgroup'] = 'Vaikimisi grupp'; +$lang['disableactions_check'] = 'Kontrolli'; +$lang['compression_o_0'] = 'pole'; +$lang['compression_o_gz'] = 'gzip'; +$lang['compression_o_bz2'] = 'bz2'; +$lang['xsendfile_o_0'] = 'ära kasuta'; +$lang['useheading_o_0'] = 'Mitte kunagi'; +$lang['useheading_o_1'] = 'Alati'; diff --git a/lib/plugins/config/lang/eu/lang.php b/lib/plugins/config/lang/eu/lang.php index a50bd6d4e..9d001d494 100644 --- a/lib/plugins/config/lang/eu/lang.php +++ b/lib/plugins/config/lang/eu/lang.php @@ -85,7 +85,7 @@ $lang['auth_security_timeout'] = 'Kautotze Segurtasun Denbora-Muga (segunduak)'; $lang['securecookie'] = 'HTTPS bidez ezarritako cookie-ak HTTPS bidez bakarrik bidali beharko lituzke nabigatzaileak? Ezgaitu aukera hau bakarrik saio hasierak SSL bidezko segurtasuna badu baina wiki-areb nabigazioa modu ez seguruan egiten bada. '; $lang['xmlrpc'] = 'Gaitu/ezgaitu XML-RPC interfazea.'; $lang['xmlrpcuser'] = 'XML-RPC atzipena mugatu hemen emandako komaz bereiztutako talde eta erabiltzaileei. Utzi hutsik atzipena guztiei emateko.'; -$lang['updatecheck'] = 'Konprobatu eguneratze eta segurtasun oharrak? DokuWiki-k honetarako splitbrain.org kontaktatu behar du.'; +$lang['updatecheck'] = 'Konprobatu eguneratze eta segurtasun oharrak? DokuWiki-k honetarako update.dokuwiki.org kontaktatu behar du.'; $lang['userewrite'] = 'Erabili URL politak'; $lang['useslash'] = 'Erabili barra (/) izen-espazio banatzaile moduan URLetan'; $lang['usedraft'] = 'Automatikoki zirriborroa gorde editatze garaian'; @@ -100,6 +100,7 @@ $lang['fetchsize'] = 'Kanpo esteketatik fetch.php-k deskargatu dezak $lang['notify'] = 'Aldaketen jakinarazpenak posta-e helbide honetara bidali'; $lang['registernotify'] = 'Erregistratu berri diren erabiltzaileei buruzko informazioa post-e helbide honetara bidali'; $lang['mailfrom'] = 'Posta automatikoentzat erabiliko den posta-e helbidea'; +$lang['mailprefix'] = 'Posta automatikoen gaientzat erabili beharreko aurrizkia'; $lang['gzip_output'] = 'Gzip Eduki-Kodeketa erabili xhtml-rentzat'; $lang['gdlib'] = 'GD Lib bertsioa'; $lang['im_convert'] = 'ImageMagick-en aldaketa tresnara bidea'; diff --git a/lib/plugins/config/lang/fa/lang.php b/lib/plugins/config/lang/fa/lang.php index 98744f366..42cc3ed05 100644 --- a/lib/plugins/config/lang/fa/lang.php +++ b/lib/plugins/config/lang/fa/lang.php @@ -88,7 +88,7 @@ $lang['auth_security_timeout'] = 'زمان انقضای معتبرسازی به $lang['securecookie'] = 'آیا کوکیها باید با قرارداد HTTPS ارسال شوند؟ این گزینه را زمانی که فقط صفحهی ورود ویکیتان با SSL امن شده است، اما ویکی را ناامن مرور میکنید، غیرفعال نمایید.'; $lang['xmlrpc'] = 'فعال/غیرفعال کردن XML-RPC'; $lang['xmlrpcuser'] = 'محمدود کردن دسترسی به XML-RPC توسط گروه های جدا شده توسط ویرگول ویا اعضای داده شده در اینجا. این مکان را خالی بگزارید تا به همه دسترسی داده شود.'; -$lang['updatecheck'] = 'هشدارهای به روز رسانی و امنیتی بررسی شود؟ برای اینکار DokuWiki با سرور splitbrain.org تماس خواهد گرفت.'; +$lang['updatecheck'] = 'هشدارهای به روز رسانی و امنیتی بررسی شود؟ برای اینکار DokuWiki با سرور update.dokuwiki.org تماس خواهد گرفت.'; $lang['userewrite'] = 'از زیباکنندهی آدرسها استفاده شود'; $lang['useslash'] = 'از اسلش «/» برای جداکنندهی آدرس فضاینامها استفاده شود'; $lang['usedraft'] = 'ایجاد خودکار چرکنویس در زمان نگارش'; @@ -103,11 +103,13 @@ $lang['fetchsize'] = 'بیشینهی حجمی که فایل fetch $lang['notify'] = 'تغییرات به این ایمیل ارسال شود'; $lang['registernotify'] = 'اطلاعات کاربران تازه وارد به این ایمیل ارسال شود'; $lang['mailfrom'] = 'آدرس ایمیلی که برای ایمیلهای خودکار استفاده میشود'; +$lang['mailprefix'] = 'پیشوند تیتر ایمیل (جهت ایمیل های خودکار)'; $lang['gzip_output'] = 'استفاده از gzip برای xhtmlها'; $lang['gdlib'] = 'نگارش کتابخانهی GD'; $lang['im_convert'] = 'مسیر ابزار convert از برنامهی ImageMagick'; $lang['jpg_quality'] = 'کیفیت فشرده سازی JPEG (از 0 تا 100)'; $lang['subscribers'] = 'توانایی عضویت در صفحات باشد'; +$lang['subscribe_time'] = 'زمان مورد نیاز برای ارسال خبر نامه ها (ثانیه); این مقدار می بایست کمتر زمانی باشد که در recent_days تعریف شده است.'; $lang['compress'] = 'فشردهسازی کدهای CSS و JavaScript'; $lang['hidepages'] = 'مخفی کردن صفحات با فرمت زیر (از عبارات منظم استفاده شود)'; $lang['send404'] = 'ارسال «HTTP 404/Page Not Found» برای صفحاتی که وجود ندارند'; diff --git a/lib/plugins/config/lang/fi/lang.php b/lib/plugins/config/lang/fi/lang.php index b033e312b..0e9bad030 100644 --- a/lib/plugins/config/lang/fi/lang.php +++ b/lib/plugins/config/lang/fi/lang.php @@ -5,6 +5,7 @@ * @author otto@valjakko.net * @author Otto Vainio <otto@valjakko.net> * @author Teemu Mattila <ghcsystems@gmail.com> + * @author Sami Olmari <sami@olmari.fi> */ $lang['menu'] = 'Asetukset'; $lang['error'] = 'Asetuksia ei päivitetty väärän arvon vuoksi. Tarkista muutokset ja lähetä sivu uudestaan. @@ -88,7 +89,7 @@ $lang['auth_security_timeout'] = 'Autentikoinnin aikakatkaisu (sekunteja)'; $lang['securecookie'] = 'Lähetetäänkö HTTPS:n kautta asetetut evästetiedot HTTPS-yhteydellä? Kytke pois, jos vain wikisi kirjautuminen on suojattu SSL:n avulla, mutta muuten wikiä käytetään ilman suojausta.'; $lang['xmlrpc'] = 'Käytä/poista XML-RPC liityntää'; $lang['xmlrpcuser'] = 'Estä XML-RPC:n käyttö pilkulla erotetun listan ryhmille tai käyttäjille. Jätä tyhjäksi salliaksesi käyttö kaikille.'; -$lang['updatecheck'] = 'Tarkista päivityksiä ja turvavaroituksia? Tätä varten DokuWikin pitää ottaa yhteys splitbrain.orgiin.'; +$lang['updatecheck'] = 'Tarkista päivityksiä ja turvavaroituksia? Tätä varten DokuWikin pitää ottaa yhteys update.dokuwiki.orgiin.'; $lang['userewrite'] = 'Käytä siivottuja URLeja'; $lang['useslash'] = 'Käytä kauttaviivaa nimiavaruuksien erottimena URL-osoitteissa'; $lang['usedraft'] = 'Tallenna vedos muokkaustilassa automaattisesti '; @@ -103,6 +104,7 @@ $lang['fetchsize'] = 'Suurin koko (bytejä), jonka fetch.php voi lad $lang['notify'] = 'Lähetä muutosilmoitukset tähän osoitteeseen'; $lang['registernotify'] = 'Lähetä ilmoitus uusista rekisteröitymisistä tähän osoitteeseen'; $lang['mailfrom'] = 'Sähköpostiosoite automaattisia postituksia varten'; +$lang['mailprefix'] = 'Etuliite automaattisesti lähetettyihin dähköposteihin'; $lang['gzip_output'] = 'Käytä gzip "Content-Encoding"-otsaketta xhtml-tiedostojen lähettämiseen'; $lang['gdlib'] = 'GD Lib versio'; $lang['im_convert'] = 'ImageMagick-muunnostyökalun polku'; @@ -110,6 +112,7 @@ $lang['jpg_quality'] = 'JPG pakkauslaatu (0-100)'; $lang['subscribers'] = 'Salli tuki sivujen tilaamiselle'; $lang['subscribe_time'] = 'Aika jonka jälkeen tilauslinkit ja yhteenveto lähetetään (sek). Tämän pitäisi olla pienempi, kuin recent_days aika.'; $lang['compress'] = 'Pakkaa CSS ja javascript'; +$lang['cssdatauri'] = 'Maksimikoko tavuina jossa kuvat joihin viitataan CSS-tiedostoista olisi sisällytettynä suoraan tyylitiedostoon jotta HTTP-kyselyjen kaistaa saataisiin kutistettua. Tämä tekniikka ei toimi IE versiossa aikasempi kuin 8! <code>400:sta</code> <code>600:aan</code> tavua on hyvä arvo. Aseta <code>0</code> kytkeäksesi ominaisuuden pois.'; $lang['hidepages'] = 'Piilota seuraavat sivut (säännönmukainen lauseke)'; $lang['send404'] = 'Lähetä "HTTP 404/Page Not Found" puuttuvista sivuista'; $lang['sitemap'] = 'Luo Google sitemap (päiviä)'; diff --git a/lib/plugins/config/lang/fr/lang.php b/lib/plugins/config/lang/fr/lang.php index b51c260fc..1de255b40 100644 --- a/lib/plugins/config/lang/fr/lang.php +++ b/lib/plugins/config/lang/fr/lang.php @@ -15,6 +15,8 @@ * @author Philippe Bajoit <philippe.bajoit@gmail.com> * @author Florian Gaub <floriang@floriang.net> * @author Samuel Dorsaz samuel.dorsaz@novelion.net + * @author Johan Guilbaud <guilbaud.johan@gmail.com> + * @author schplurtz@laposte.net */ $lang['menu'] = 'Paramètres de configuration'; $lang['error'] = 'Paramètres non modifiés en raison d\'une valeur non valide, vérifiez vos réglages et réessayez. <br />Les valeurs erronées sont entourées d\'une bordure rouge.'; @@ -96,13 +98,13 @@ $lang['auth_security_timeout'] = 'Délai d\'expiration de sécurité (secondes)' $lang['securecookie'] = 'Les cookies mis via HTTPS doivent-ils n\'être envoyé par le navigateur que via HTTPS ? Ne désactivez cette option que si la connexion à votre wiki est sécurisée avec SSL mais que la navigation sur le wiki n\'est pas sécurisée.'; $lang['xmlrpc'] = 'Activer l\'interface XML-RPC.'; $lang['xmlrpcuser'] = 'Restreindre l\'accès à XML-RPC aux groupes et utilisateurs indiqués ici. Laisser vide afin que tout le monde y ait accès.'; -$lang['updatecheck'] = 'Vérifier les mises à jour ? DokuWiki doit pouvoir contacter splitbrain.org.'; +$lang['updatecheck'] = 'Vérifier les mises à jour ? DokuWiki doit pouvoir contacter update.dokuwiki.org.'; $lang['userewrite'] = 'URL esthétiques'; $lang['useslash'] = 'Utiliser « / » comme séparateur de catégorie dans les URL'; $lang['usedraft'] = 'Enregistrer automatiquement un brouillon pendant l\'édition'; $lang['sepchar'] = 'Séparateur de mots dans les noms de page'; $lang['canonical'] = 'Utiliser des URL canoniques'; -$lang['fnencode'] = 'Méhtode pou r l\'encodage des fichiers non-ASCII'; +$lang['fnencode'] = 'Méthode pour l\'encodage des fichiers non-ASCII'; $lang['autoplural'] = 'Rechercher les formes plurielles dans les liens'; $lang['compression'] = 'Méthode de compression pour les fichiers dans attic'; $lang['cachetime'] = 'Âge maximum d\'un fichier en cache (en secondes)'; @@ -111,6 +113,7 @@ $lang['fetchsize'] = 'Taille maximale (en octets) du fichier que fet $lang['notify'] = 'Notifier les modifications à cette adresse de courriel'; $lang['registernotify'] = 'Envoyer un courriel annonçant les nouveaux utilisateurs enregistrés à cette adresse'; $lang['mailfrom'] = 'Expéditeur des notifications par courriel du wiki'; +$lang['mailprefix'] = 'Préfixe à utiliser dans les objets des courriels automatiques'; $lang['gzip_output'] = 'Utiliser Content-Encoding gzip pour XHTML'; $lang['gdlib'] = 'Version de GD Lib'; $lang['im_convert'] = 'Chemin vers l\'outil de conversion d\'ImageMagick'; @@ -118,6 +121,7 @@ $lang['jpg_quality'] = 'Qualité de la compression JPEG (0-100)'; $lang['subscribers'] = 'Activer l\'abonnement aux pages'; $lang['subscribe_time'] = 'Délai après lequel les listes d\'abonnement et résumés sont envoyés (en secondes). Devrait être plus petit que le délai précisé dans recent_days.'; $lang['compress'] = 'Compresser CSS et JavaScript'; +$lang['cssdatauri'] = 'Taille maximale en octets pour inclure dans les feuilles de styles CSS, les images qui y sont référencées. Cette technique minimise les requêtes HTTP. Pour IE, ceci ne fonctionne qu\'à partir de la version 8 ! Valeurs correctes entre <code>400</code> et <code>600</code>. <code>0</code> pour désactiver.'; $lang['hidepages'] = 'Cacher les pages correspondant à (expression régulière)'; $lang['send404'] = 'Renvoyer "HTTP 404/Page Non Trouvée" pour les pages introuvables'; $lang['sitemap'] = 'Fréquence de génération une carte Google du site (en jours)'; @@ -161,7 +165,7 @@ $lang['userewrite_o_2'] = 'Interne à DokuWiki'; $lang['deaccent_o_0'] = 'off'; $lang['deaccent_o_1'] = 'supprimer les accents'; $lang['deaccent_o_2'] = 'convertir en roman'; -$lang['gdlib_o_0'] = 'GD Lib non disponible'; +$lang['gdlib_o_0'] = 'Librairie GD non disponible'; $lang['gdlib_o_1'] = 'version 1.x'; $lang['gdlib_o_2'] = 'auto-détectée'; $lang['rss_type_o_rss'] = 'RSS 0.91'; diff --git a/lib/plugins/config/lang/gl/lang.php b/lib/plugins/config/lang/gl/lang.php index ac91098cb..07d62b7af 100644 --- a/lib/plugins/config/lang/gl/lang.php +++ b/lib/plugins/config/lang/gl/lang.php @@ -86,7 +86,7 @@ $lang['auth_security_timeout'] = 'Tempo Límite de Seguridade de Autenticación $lang['securecookie'] = 'Deben enviarse só vía HTTPS polo navegador as cookies configuradas vía HTTPS? Desactiva esta opción cando só o inicio de sesión do teu wiki estea asegurado con SSL pero a navegación do mesmo se faga de xeito inseguro.'; $lang['xmlrpc'] = 'Activar/Desactivar interface XML-RPC'; $lang['xmlrpcuser'] = 'Restrinxir o acceso mediante XML-RPC á lista separada por comas dos grupos e/ou usuarios proporcionados aquí. Déixao baleiro para darlle acceso a todas as persoas.'; -$lang['updatecheck'] = 'Comprobar se hai actualizacións e avisos de seguridade? O DokuWiki precisa contactar con splitbrain.org para executar esta característica.'; +$lang['updatecheck'] = 'Comprobar se hai actualizacións e avisos de seguridade? O DokuWiki precisa contactar con update.dokuwiki.org para executar esta característica.'; $lang['userewrite'] = 'Utilizar URLs amigábeis'; $lang['useslash'] = 'Utilizar a barra inclinada (/) como separador de nome de espazo nos URLs'; $lang['usedraft'] = 'Gardar un borrador automaticamente no tempo da edición'; diff --git a/lib/plugins/config/lang/he/lang.php b/lib/plugins/config/lang/he/lang.php index a39d0ab5c..e80a1bd7a 100644 --- a/lib/plugins/config/lang/he/lang.php +++ b/lib/plugins/config/lang/he/lang.php @@ -7,6 +7,7 @@ * @author Dotan Kamber <kamberd@yahoo.com> * @author Moshe Kaplan <mokplan@gmail.com> * @author Yaron Yogev <yaronyogev@gmail.com> + * @author Yaron Shahrabani <sh.yaron@gmail.com> */ $lang['menu'] = 'הגדרות תצורה'; $lang['error'] = 'ההגדרות לא עודכנו בגלל ערך לא תקף, נא לעיין בשינויים ולשלוח שנית. @@ -82,7 +83,7 @@ $lang['disableactions_other'] = 'פעולות אחרות (מופרדות בפס $lang['sneaky_index'] = 'כברירת מחדל, דוקוויקי יציג את כל מרחבי השמות בתצוגת תוכן הענינים. בחירה באפשרות זאת תסתיר את אלו שבהם למשתמש אין הרשאות קריאה. התוצאה עלולה להיות הסתרת תת מרחבי שמות אליהם יש למשתמש גישה. באופן זה תוכן הענינים עלול להפוך לחסר תועלת עם הגדרות ACL מסוימות'; $lang['auth_security_timeout'] = 'מגבלת אבטח פסק הזמן להזדהות (שניות)'; $lang['xmlrpc'] = 'לאפשר.לחסום את מנשק XML-RPC'; -$lang['updatecheck'] = 'בדיקת עידכוני אבטחה והתראות? על DokuWiki להתקשר אל splitbrain.org לצורך כך.'; +$lang['updatecheck'] = 'בדיקת עידכוני אבטחה והתראות? על DokuWiki להתקשר אל update.dokuwiki.org לצורך כך.'; $lang['userewrite'] = 'השתמש בכתובות URL יפות'; $lang['useslash'] = 'השתמש בלוכסן להגדרת מרחבי שמות בכתובות'; $lang['usedraft'] = 'שמור טיוטות באופן אוטומטי בעת עריכה'; diff --git a/lib/plugins/config/lang/hr/lang.php b/lib/plugins/config/lang/hr/lang.php index d2094b77b..96f1d6afe 100644 --- a/lib/plugins/config/lang/hr/lang.php +++ b/lib/plugins/config/lang/hr/lang.php @@ -4,4 +4,5 @@ * * @author Branko Rihtman <theney@gmail.com> * @author Dražen Odobašić <dodobasic@gmail.com> + * @author Dejan Igrec dejan.igrec@gmail.com */ diff --git a/lib/plugins/config/lang/hu/lang.php b/lib/plugins/config/lang/hu/lang.php index 47c1e67c7..f991b7c95 100644 --- a/lib/plugins/config/lang/hu/lang.php +++ b/lib/plugins/config/lang/hu/lang.php @@ -5,8 +5,9 @@ * @author Sandor TIHANYI <stihanyi+dw@gmail.com> * @author Siaynoq Mage <siaynoqmage@gmail.com> * @author schilling.janos@gmail.com - * @author Szabó Dávid (szabo.david@gyumolcstarhely.hu) * @author Szabó Dávid <szabo.david@gyumolcstarhely.hu> + * @author Sándor TIHANYI <stihanyi+dw@gmail.com> + * @author David Szabo <szabo.david@gyumolcstarhely.hu> */ $lang['menu'] = 'Beállító Központ'; $lang['error'] = 'Helytelen érték miatt a módosítások nem mentődtek. Nézd át a módosításokat, és ments újra. @@ -90,7 +91,7 @@ $lang['auth_security_timeout'] = 'Authentikációs biztonsági időablak (másod $lang['securecookie'] = 'A böngészők a HTTPS felett beállított sütijüket csak HTTPS felett küldhetik? Kapcsoljuk ki ezt az opciót, ha csak a bejelentkezést védjük SSL-lel, a wiki tartalmának böngészése nyílt forgalommal történik.'; $lang['xmlrpc'] = 'XML-RPC interfész engedélyezése/tiltása'; $lang['xmlrpcuser'] = 'Korlátozza XML-RPC hozzáférést az itt megadott vesszővel elválasztott csoportok vagy felhasználók számára. Hagyja üresen, ha mindenki számára biztosítja a hozzáférést.'; -$lang['updatecheck'] = 'Frissítések és biztonsági figyelmeztetések figyelése. Ehhez a DokuWikinek kapcsolatba kell lépnie a splitbrain.org-gal.'; +$lang['updatecheck'] = 'Frissítések és biztonsági figyelmeztetések figyelése. Ehhez a DokuWikinek kapcsolatba kell lépnie a update.dokuwiki.org-gal.'; $lang['userewrite'] = 'Szép URL-ek használata'; $lang['useslash'] = 'Per-jel használata névtér-elválasztóként az URL-ekben'; $lang['usedraft'] = 'Piszkozat automatikus mentése szerkesztés alatt'; @@ -105,6 +106,7 @@ $lang['fetchsize'] = 'Maximális méret (bájtban), amit a fetch.php $lang['notify'] = 'Az oldal-változásokat erre az e-mail címre küldje'; $lang['registernotify'] = 'Értesítés egy újonnan regisztrált felhasználóról erre az e-mail címre'; $lang['mailfrom'] = 'Az automatikusan küldött levelekben használt e-mail cím'; +$lang['mailprefix'] = 'Előtag az automatikus e-mailek tárgyában'; $lang['gzip_output'] = 'gzip tömörítés használata xhtml-hez (Content-Encoding)'; $lang['gdlib'] = 'GD Lib verzió'; $lang['im_convert'] = 'Útvonal az ImageMagick csomag convert parancsához'; diff --git a/lib/plugins/config/lang/ia/lang.php b/lib/plugins/config/lang/ia/lang.php index 624b79485..689869b89 100644 --- a/lib/plugins/config/lang/ia/lang.php +++ b/lib/plugins/config/lang/ia/lang.php @@ -85,7 +85,7 @@ $lang['auth_security_timeout'] = 'Expiration pro securitate de authentication (s $lang['securecookie'] = 'Debe le cookies definite via HTTPS solmente esser inviate via HTTPS per le navigator? Disactiva iste option si solmente le apertura de sessiones a tu wiki es protegite con SSL ma le navigation del wiki es facite sin securitate.'; $lang['xmlrpc'] = 'Activar/disactivar interfacie XML-RPC.'; $lang['xmlrpcuser'] = 'Limitar le accesso a XML-RPC al gruppos o usatores date hic, separate per commas. Lassa isto vacue pro dar accesso a omnes.'; -$lang['updatecheck'] = 'Verificar si existe actualisationes e advertimentos de securitate? DokuWiki debe contactar splitbrain.org pro exequer iste function.'; +$lang['updatecheck'] = 'Verificar si existe actualisationes e advertimentos de securitate? DokuWiki debe contactar update.dokuwiki.org pro exequer iste function.'; $lang['userewrite'] = 'Usar URLs nette'; $lang['useslash'] = 'Usar le barra oblique ("/") como separator de spatios de nomines in URLs'; $lang['usedraft'] = 'Automaticamente salveguardar un version provisori durante le modification'; diff --git a/lib/plugins/config/lang/it/intro.txt b/lib/plugins/config/lang/it/intro.txt index 95e7151f3..617e8c7b5 100644 --- a/lib/plugins/config/lang/it/intro.txt +++ b/lib/plugins/config/lang/it/intro.txt @@ -4,6 +4,6 @@ Usa questa pagina per gestire la configurazione della tua installazione DokuWiki Le impostazioni con lo sfondo rosso chiaro sono protette e non possono essere modificate con questo plugin. Le impostazioni con lo sfondo blu contengono i valori predefiniti, e le impostazioni con lo sfondo bianco sono relative solo a questa particolare installazione. Sia le impostazioni su sfondo blu che quelle su sfondo bianco possono essere modificate. -Ricordati di premere il pulsante **SALVA** prima di lasciare questa pagina altrimenti le modifiche saranno perse. +Ricordati di premere il pulsante **SALVA** prima di lasciare questa pagina altrimenti le modifiche andranno perse. diff --git a/lib/plugins/config/lang/it/lang.php b/lib/plugins/config/lang/it/lang.php index 5bbc6894f..c4dd433ed 100644 --- a/lib/plugins/config/lang/it/lang.php +++ b/lib/plugins/config/lang/it/lang.php @@ -12,6 +12,7 @@ * @author snarchio@alice.it * @author robocap <robocap1@gmail.com> * @author Osman Tekin osman.tekin93@hotmail.it + * @author Jacopo Corbetta <jacopo.corbetta@gmail.com> */ $lang['menu'] = 'Configurazione Wiki'; $lang['error'] = 'Impostazioni non aggiornate a causa di un valore non corretto, controlla le modifiche apportate e salva di nuovo. @@ -95,7 +96,7 @@ $lang['auth_security_timeout'] = 'Tempo di sicurezza per l\'autenticazione (seco $lang['securecookie'] = 'Devono i cookies impostati tramite HTTPS essere inviati al browser solo tramite HTTPS? Disattiva questa opzione solo quando l\'accesso al tuo wiki viene effettuato con il protocollo SSL ma la navigazione del wiki non risulta sicura.'; $lang['xmlrpc'] = 'Abilita/disabilita interfaccia XML-RPC.'; $lang['xmlrpcuser'] = 'Limita l\'accesso XML-RPC ai gruppi o utenti indicati qui (separati da virgola). Lascia il campo vuoto per dare accesso a tutti.'; -$lang['updatecheck'] = 'Controllare aggiornamenti e avvisi di sicurezza? DokuWiki deve contattare splitbrain.org per questa funzione.'; +$lang['updatecheck'] = 'Controllare aggiornamenti e avvisi di sicurezza? DokuWiki deve contattare update.dokuwiki.org per questa funzione.'; $lang['userewrite'] = 'Usa il rewrite delle URL'; $lang['useslash'] = 'Usa la barra rovescia (slash) come separatore nelle URL'; $lang['usedraft'] = 'Salva una bozza in automatico in fase di modifica'; @@ -110,6 +111,7 @@ $lang['fetchsize'] = 'Dimensione massima (bytes) scaricabile da fetc $lang['notify'] = 'Invia notifiche sulle modifiche a questo indirizzo'; $lang['registernotify'] = 'Invia informazioni sui nuovi utenti registrati a questo indirizzo email'; $lang['mailfrom'] = 'Mittente per le mail automatiche'; +$lang['mailprefix'] = 'Prefisso da inserire nell\'oggetto delle mail automatiche'; $lang['gzip_output'] = 'Usa il Content-Encoding gzip per xhtml'; $lang['gdlib'] = 'Versione GD Lib '; $lang['im_convert'] = 'Percorso per il convertitore di ImageMagick'; @@ -182,7 +184,7 @@ $lang['xsendfile_o_0'] = 'non usare'; $lang['xsendfile_o_1'] = 'Header proprietario lighttpd (prima della versione 1.5)'; $lang['xsendfile_o_2'] = 'Header standard X-Sendfile'; $lang['xsendfile_o_3'] = 'Header proprietario Nginx X-Accel-Redirect'; -$lang['showuseras_o_loginname'] = 'Nome accesso'; +$lang['showuseras_o_loginname'] = 'Nome utente'; $lang['showuseras_o_username'] = 'Nome completo dell\'utente'; $lang['showuseras_o_email'] = 'Indirizzo email dell\'utente (offuscato in base alle impostazioni di sicurezza posta)'; $lang['showuseras_o_email_link'] = 'Indirizzo email dell\'utente come collegamento mailto:'; diff --git a/lib/plugins/config/lang/ja/lang.php b/lib/plugins/config/lang/ja/lang.php index 9ec416196..19f10af48 100644 --- a/lib/plugins/config/lang/ja/lang.php +++ b/lib/plugins/config/lang/ja/lang.php @@ -91,7 +91,7 @@ $lang['auth_security_timeout'] = '認証タイムアウト設定（秒）'; $lang['securecookie'] = 'クッキーをHTTPSにてセットする場合は、ブラウザよりHTTPS経由で送信された場合にみに制限しますか？ログインのみをSSLで行う場合は、この機能を無効にしてください。'; $lang['xmlrpc'] = 'XML-RPCインターフェースを有効/無効にする'; $lang['xmlrpcuser'] = 'XML-RPCアクセスを指定グループとユーザーに制限します（半角コンマ区切り）。 すべての人にアクセスを許可する場合は空のままにしてください。'; -$lang['updatecheck'] = 'DokuWikiの更新とセキュリティに関する情報をチェックしますか？ この機能は splitbrain.org への接続が必要です。'; +$lang['updatecheck'] = 'DokuWikiの更新とセキュリティに関する情報をチェックしますか？ この機能は update.dokuwiki.org への接続が必要です。'; $lang['userewrite'] = 'URLの書き換え'; $lang['useslash'] = 'URL上の名前空間の区切りにスラッシュを使用'; $lang['usedraft'] = '編集中の自動保存（ドラフト）機能を使用'; @@ -106,6 +106,7 @@ $lang['fetchsize'] = '外部からのダウンロード最大サイ $lang['notify'] = '変更を通知するメールアドレス'; $lang['registernotify'] = '新規ユーザー登録を通知するメールアドレス'; $lang['mailfrom'] = 'メール送信時の送信元アドレス'; +$lang['mailprefix'] = '自動メールの題名に使用する接頭語'; $lang['gzip_output'] = 'xhtmlに対するコンテンツ圧縮（gzip）を使用'; $lang['gdlib'] = 'GDlibバージョン'; $lang['im_convert'] = 'ImageMagick変換ツールへのパス'; diff --git a/lib/plugins/config/lang/kk/lang.php b/lib/plugins/config/lang/kk/lang.php new file mode 100644 index 000000000..dde5b9577 --- /dev/null +++ b/lib/plugins/config/lang/kk/lang.php @@ -0,0 +1,6 @@ +<?php +/** + * kazakh language file + * + * @author Nurgozha Kaliaskarov astana08@gmail.com + */ diff --git a/lib/plugins/config/lang/ko/lang.php b/lib/plugins/config/lang/ko/lang.php index 13f5efefe..20cfcdcfe 100644 --- a/lib/plugins/config/lang/ko/lang.php +++ b/lib/plugins/config/lang/ko/lang.php @@ -92,13 +92,13 @@ $lang['auth_security_timeout'] = '인증 보안 초과 시간(초)'; $lang['securecookie'] = 'HTTPS로 보내진 쿠키는 HTTPS에만 적용 할까요? 위키의 로그인 페이지만 SSL로 암호화 하고 위키 페이지는 그렇지 않은경우 꺼야 합니다.'; $lang['xmlrpc'] = 'XML-RPC 인터페이스 지원/무시'; $lang['xmlrpcuser'] = '주어진 그룹이나 유저들에게만 XML-RPC접근을 허락하려면 컴마로 구분하여 적으세요. 비어두면 모두에게 허용됩니다.'; -$lang['updatecheck'] = '업데이트와 보안 문제를 검사(DokuWiki를 splitbrain.org에 연결해야 합니다.)'; +$lang['updatecheck'] = '업데이트와 보안 문제를 검사(DokuWiki를 update.dokuwiki.org에 연결해야 합니다.)'; $lang['userewrite'] = 'URL rewriting기능 사용'; $lang['useslash'] = 'URL에서 네임스페이스 구분자로 슬래쉬 문자 사용'; $lang['usedraft'] = '편집하는 동안 자동으로 문서 초안 저장'; $lang['sepchar'] = '페이지 이름 단어 구분자'; $lang['canonical'] = '완전한 canonical URL 사용'; -$lang['fnencode'] = '아스키가 아닌 파일이르믈 인코딩 하는 방법.'; +$lang['fnencode'] = '아스키가 아닌 파일이름을 인코딩 하는 방법.'; $lang['autoplural'] = '링크 연결시 plural폼 검사'; $lang['compression'] = 'attic파일 압축 방법 선택'; $lang['cachetime'] = '최대 캐쉬 생존 시간(초)'; @@ -107,6 +107,7 @@ $lang['fetchsize'] = 'fetch.php가 외부에서 다운로드할 수 $lang['notify'] = '이메일 알람 기능'; $lang['registernotify'] = '신규 등록자 알람 기능'; $lang['mailfrom'] = '자동으로 보내지는 메일 발신자'; +$lang['mailprefix'] = '자동으로 보내지는 메일의 제목 말머리 내용'; $lang['gzip_output'] = 'xhml 내용 gzip 압축 여부'; $lang['gdlib'] = 'GD 라이브러리 버전'; $lang['im_convert'] = 'ImageMagick 위치'; diff --git a/lib/plugins/config/lang/la/intro.txt b/lib/plugins/config/lang/la/intro.txt index d23029ab1..573d34ac1 100644 --- a/lib/plugins/config/lang/la/intro.txt +++ b/lib/plugins/config/lang/la/intro.txt @@ -1,6 +1,6 @@ -====== Administrationis Administrator ====== +====== Optionum Administratio ====== -In hac pagina administratoris optiones mutare et inspicere potes. Auxilia in pagina [[doku>config]] sunt, si singulas res uidere uis, i ad paginam [[doku>plugin:config]]. +In hac pagina administratoris optiones mutare et inspicere potes. Auxilia in pagina [[doku>config|conformationis]] sunt, si singulas res uidere uis, i ad paginam [[doku>plugin:config|conformationis]]. Optiones ostensae rubro colore tutae et non nunc mutabiles sunt. Optiones ostensae caeruleo colore praecipuae sunt et optiones ostensae in area alba singulares huic uici sunt. Et caerulae et albae optiones mutabiles sunt. diff --git a/lib/plugins/config/lang/la/lang.php b/lib/plugins/config/lang/la/lang.php index ca0eb1c31..07d92ae36 100644 --- a/lib/plugins/config/lang/la/lang.php +++ b/lib/plugins/config/lang/la/lang.php @@ -2,6 +2,7 @@ /** * Latin language file * + * @author Massimiliano Vassalli <vassalli.max@gmail.com> */ $lang['menu'] = 'Optiones Administrationis'; $lang['error'] = 'Optiones non nouatae ob errores: rursum temptat. Errores rubro colore signati sunt.'; @@ -9,17 +10,17 @@ $lang['updated'] = 'Optiones feliciter nouatae.'; $lang['nochoice'] = '(nulla optio est)'; $lang['locked'] = 'Optio documenti non nouata est, <br/> optiones et facultates documenti inspicis.'; $lang['danger'] = 'CAVE: si has optiones mutabis, in administrationis indicem non inire potes.'; -$lang['warning'] = 'CAVE: si hae optiones mutantur, graues errores erunt.'; -$lang['security'] = 'CAVE: si hae optiones mutantur, graues errores erunt.'; -$lang['_configuration_manager'] = 'Administrationis Administrator'; +$lang['warning'] = 'CAVE: si hae optiones mutabis, graues errores erunt.'; +$lang['security'] = 'CAVE: si hae optiones mutabis, graues errores erunt.'; +$lang['_configuration_manager'] = 'Optionum administratio'; $lang['_header_dokuwiki'] = 'Vicis Optiones'; $lang['_header_plugin'] = 'Addendorum Optiones'; $lang['_header_template'] = 'Vicis Formae Optiones'; $lang['_header_undefined'] = 'Variae Optiones'; -$lang['_basic'] = 'Fundamenti Optiones'; -$lang['_display'] = 'Visiuae Optiones'; +$lang['_basic'] = 'Praecipuae Optiones'; +$lang['_display'] = 'Speciei Optiones'; $lang['_authentication'] = 'Confirmationis Optiones'; -$lang['_anti_spam'] = 'Malorum Optiones'; +$lang['_anti_spam'] = 'In Mala Optiones'; $lang['_editing'] = 'Recensendi Optiones'; $lang['_links'] = 'Nexi Optiones'; $lang['_media'] = 'Visiuorum Optiones'; @@ -70,7 +71,7 @@ $lang['autopasswd'] = 'Tessera machinatione generata'; $lang['authtype'] = 'Confirmationis finis'; $lang['passcrypt'] = 'Ratio tesserae tuendae'; $lang['defaultgroup'] = 'Grex communis'; -$lang['superuser'] = 'Magister\stra - grex, Sodalis uel index diuisus a uigulis sodalis1,@grex,sodalis2 cum plenis facultatibus sine AAA optionum termino'; +$lang['superuser'] = 'Magister\stra - grex, Sodalis uel index diuisus a uigulis sodalis1,@grex,sodalis2 cum plenis facultatibus sine ICA optionum termino'; $lang['manager'] = 'Administrator - grex, Sodalis uel index diuisus a uigulis sodalis1,@grex,sodalis2 cum certis facultatibus'; $lang['profileconfirm'] = 'Mutationes tessera confirmanda sunt'; $lang['disableactions'] = 'Vicis actiones ineptas facere'; @@ -78,14 +79,14 @@ $lang['disableactions_check'] = 'Inspicere'; $lang['disableactions_subscription'] = 'Inscribe/Delere'; $lang['disableactions_wikicode'] = 'Fontem uidere/Rudem transcribere'; $lang['disableactions_other'] = 'Aliae actiones (uirgulis diuisae)'; -$lang['sneaky_index'] = 'Hic uicis omnes spatia nomini in indice inserit. Si ineptam hanc optionem facias, solum ea spatia, quae Sodales uidere possunt, in indice erunt. Hoc suggreges et subspatia abscondere potest.'; +$lang['sneaky_index'] = 'Hic uicis omnia genera in indice inserit. Si ineptam hanc optionem facias, solum ea, quae Sodales uidere possunt, in indice erunt. Hoc suggreges et suggenera abscondere potest.'; $lang['auth_security_timeout'] = 'Confirmationis Tempus (secundis)'; $lang['securecookie'] = 'Formulae HTTPS mittine solum per HTTPS possunt? Ineptam hanc optio facias, si accessus uicis tutus est, sed interretis non.'; $lang['xmlrpc'] = 'Aptam\Ineptam XML-RPC administrationem facere'; $lang['xmlrpcuser'] = 'Accessus XML-RPC gregibus uel Sodalibus in hoc indice astringere. Nihil scribere ut omnes accessum habeant'; -$lang['updatecheck'] = 'Nouationes et fiducias inspicerene? Hic uicis connectere splitbrain.org debes.'; +$lang['updatecheck'] = 'Nouationes et fiducias inspicerene? Hic uicis connectere update.dokuwiki.org debes.'; $lang['userewrite'] = 'VRL formosis uti'; -$lang['useslash'] = 'Repagula ut spatium nominis diuidas uti'; +$lang['useslash'] = 'Repagula in URL, ut genera diuidas, uti'; $lang['usedraft'] = 'Propositum in recensione machinatione seruatur'; $lang['sepchar'] = 'Signum, quod paginas diuidit'; $lang['canonical'] = 'VRL perfecto uti'; @@ -99,7 +100,7 @@ $lang['notify'] = 'Adnotationis mutationes ad hunc cursum mittere $lang['registernotify'] = 'De nouis Sodalibus ad hunc cursum notas mittere'; $lang['mailfrom'] = 'Cursus interretialis, quo in cursibus uti'; $lang['gzip_output'] = 'gzip Argumentum-Codificans xhtml uti'; -$lang['gdlib'] = 'GD Lib uersio'; +$lang['gdlib'] = 'GD Lib forma'; $lang['im_convert'] = 'Domicilium machinae ImageMagick\'s'; $lang['jpg_quality'] = 'JPG compressio colorum (0-100)'; $lang['subscribers'] = 'Inscriptionis paginarum auxilium aptus facere'; @@ -148,7 +149,7 @@ $lang['deaccent_o_0'] = 'ex'; $lang['deaccent_o_1'] = 'accentum tollere'; $lang['deaccent_o_2'] = 'Latinis litteris'; $lang['gdlib_o_0'] = 'GD Lib inepta'; -$lang['gdlib_o_1'] = 'Versio 1.x'; +$lang['gdlib_o_1'] = 'Forma 1.x'; $lang['gdlib_o_2'] = 'Machinatione inspicere'; $lang['rss_type_o_rss'] = 'RSS 0.91'; $lang['rss_type_o_rss1'] = 'RSS 1.0'; diff --git a/lib/plugins/config/lang/lv/lang.php b/lib/plugins/config/lang/lv/lang.php index 64c828f77..2f5883269 100644 --- a/lib/plugins/config/lang/lv/lang.php +++ b/lib/plugins/config/lang/lv/lang.php @@ -86,7 +86,7 @@ $lang['auth_security_timeout'] = 'Autorizācijas drošības intervāls (sekundē $lang['securecookie'] = 'Vai pa HTTPS sūtāmās sīkdatnes sūtīt tikai pa HTTPS? Atslēdz šo iespēju, kad tikai pieteikšanās wiki sistēmā notiek pa SSL šifrētu savienojumu, bet skatīšana - pa nešifrētu.'; $lang['xmlrpc'] = 'Ieslēgt/izslēgt XML-RPC interfeisu.'; $lang['xmlrpcuser'] = 'Ierobežot XML-RPC piekļuvi norādītām lietotāju grupām vai lietotājiem (atdalīt ar komatiem!). Atstāt tukšu, lai piekļuve būtu visiem.'; -$lang['updatecheck'] = 'Pārbaudīt, vai pieejami atjauninājumi un drošības brīdinājumi? Dokuwiki sazināsies ar splitbrain.org'; +$lang['updatecheck'] = 'Pārbaudīt, vai pieejami atjauninājumi un drošības brīdinājumi? Dokuwiki sazināsies ar update.dokuwiki.org'; $lang['userewrite'] = 'Ērti lasāmas adreses (URL)'; $lang['useslash'] = 'Lietot slīpiņu par URL atdalītāju'; $lang['usedraft'] = 'Labojot automātiski saglabāt melnrakstu'; @@ -101,6 +101,7 @@ $lang['fetchsize'] = 'Maksimālais faila apjoms baitos, ko fetch.php $lang['notify'] = 'Nosūtīt izmaiņu paziņojumu uz epasta adresi'; $lang['registernotify'] = 'Nosūtīt paziņojumu par jauniem lietotājiem uz epasta adresi'; $lang['mailfrom'] = 'Epasta adrese automātiskajiem paziņojumiem'; +$lang['mailprefix'] = 'E-pasta temata prefikss automātiskajiem paziņojumiem'; $lang['gzip_output'] = 'Lietot gzip Content-Encoding priekš xhtml'; $lang['gdlib'] = 'GD Lib versija'; $lang['im_convert'] = 'Ceļš uz ImageMagick convert rīku'; diff --git a/lib/plugins/config/lang/mr/lang.php b/lib/plugins/config/lang/mr/lang.php index 79e8ea426..321e05546 100644 --- a/lib/plugins/config/lang/mr/lang.php +++ b/lib/plugins/config/lang/mr/lang.php @@ -88,7 +88,7 @@ $lang['auth_security_timeout'] = 'अधिकृत करण्याच्य $lang['securecookie'] = 'HTTPS वापरून सेट केलेले कूकीज ब्राउजरने HTTPS द्वाराच पाठवले पाहिजेत का? जर तुमच्या विकीचं फ़क्त लॉगिन पानच SSL वापरून सुरक्षित केलं असेल व पानांचं ब्राउजिंग असुरक्षित असेल तर हा पर्याय चालू करू नका.'; $lang['xmlrpc'] = 'XML-RPC इंटरफेस चालू/बंद करा'; $lang['xmlrpcuser'] = 'XML-RPC सुविधा फ़क्त इथे स्वल्पविरामाने अलग करून दिलेल्या गट किंवा वापरकर्त्याला उपलब्ध आहेत. सर्वाना ही सुविधा देण्यासाठी ही जागा रिकामी सोडा.'; -$lang['updatecheck'] = 'अपडेट आणि सुरक्षिततेविशयी सूचनान्वर पाळत ठेऊ का? या सुविधेसाठी डॉक्युविकीला splitbrain.org शी संपर्क साधावा लागेल.'; +$lang['updatecheck'] = 'अपडेट आणि सुरक्षिततेविशयी सूचनान्वर पाळत ठेऊ का? या सुविधेसाठी डॉक्युविकीला update.dokuwiki.org शी संपर्क साधावा लागेल.'; $lang['userewrite'] = 'छान छान URL वापर'; $lang['useslash'] = 'URL मधे नेमस्पेस अलग करण्यासाठी \'/\' चिह्न वापरा'; $lang['usedraft'] = 'संपादन करताना मसुदा आपोआप सुरक्षित करा'; diff --git a/lib/plugins/config/lang/nl/lang.php b/lib/plugins/config/lang/nl/lang.php index a9e0d935f..bf1ce46c1 100644 --- a/lib/plugins/config/lang/nl/lang.php +++ b/lib/plugins/config/lang/nl/lang.php @@ -94,7 +94,7 @@ $lang['auth_security_timeout'] = 'Authenticatiebeveiligings-timeout (seconden)'; $lang['securecookie'] = 'Moeten cookies die via HTTPS gezet zijn alleen via HTTPS verzonden worden door de browser? Zet deze optie uit als alleen het inloggen op de wiki beveiligd is, maar het gebruik verder niet.'; $lang['xmlrpc'] = 'Inschakelen/uitschakelen XML-RPC interface.'; $lang['xmlrpcuser'] = 'Beperk XML-RPC toegang tot de lijst met kommagescheiden groepen of gebruikers die hier zijn opgegeven. Laat leeg om iedereen toegang te geven.'; -$lang['updatecheck'] = 'Controleer op nieuwe versies en beveiligingswaarschuwingen? DokuWiki moet hiervoor contact opnemen met splitbrain.org.'; +$lang['updatecheck'] = 'Controleer op nieuwe versies en beveiligingswaarschuwingen? DokuWiki moet hiervoor contact opnemen met update.dokuwiki.org.'; $lang['userewrite'] = 'Gebruik nette URL\'s'; $lang['useslash'] = 'Gebruik slash (/) als scheiding tussen namepaces in URL\'s'; $lang['usedraft'] = 'Sla automatisch een concept op tijdens het wijzigen'; @@ -109,6 +109,7 @@ $lang['fetchsize'] = 'Maximum grootte (bytes) die fetch.php mag down $lang['notify'] = 'Stuur e-mailnotificaties naar dit adres'; $lang['registernotify'] = 'Stuur informatie over nieuw aangemelde gebruikers naar dit e-mailadres'; $lang['mailfrom'] = 'E-mailadres voor automatische e-mail'; +$lang['mailprefix'] = 'Te gebruiken voorvoegsel voor onderwerp automatische email'; $lang['gzip_output'] = 'Gebruik gzip Content-Encoding voor xhtml'; $lang['gdlib'] = 'Versie GD Lib '; $lang['im_convert'] = 'Path naar ImageMagick\'s convert tool'; diff --git a/lib/plugins/config/lang/no/lang.php b/lib/plugins/config/lang/no/lang.php index 4529b55fe..6ac765cbf 100644 --- a/lib/plugins/config/lang/no/lang.php +++ b/lib/plugins/config/lang/no/lang.php @@ -12,6 +12,7 @@ * @author Lisa Ditlefsen <lisa@vervesearch.com> * @author Erik Pedersen <erik.pedersen@shaw.ca> * @author Erik Bjørn Pedersen <erik.pedersen@shaw.ca> + * @author Rune Rasmussen syntaxerror.no@gmail.com */ $lang['menu'] = 'Konfigurasjonsinnstillinger'; $lang['error'] = 'Innstillingene ble ikke oppdatert på grunn av en eller flere ugyldig verdier. Vennligst se gjennom endringene og prøv på nytt. @@ -99,7 +100,7 @@ $lang['securecookie'] = 'Skal informasjonskapsler satt via HTTPS kun se $lang['xmlrpc'] = 'Slå på/slå av XML-RPC-grensesnitt'; $lang['xmlrpcuser'] = 'Å tillate XML-RPC-adgang til bestemte grupper eller brukere, sette deres navne (kommaseparert) her. Slik får du tilgang til alle, la feltet tomt. '; -$lang['updatecheck'] = 'Se etter oppdateringer og sikkerhetsadvarsler? Denne funksjonen er avhengig av å kontakte splitbrain.org.'; +$lang['updatecheck'] = 'Se etter oppdateringer og sikkerhetsadvarsler? Denne funksjonen er avhengig av å kontakte update.dokuwiki.org.'; $lang['userewrite'] = 'Bruk pene URLer'; $lang['useslash'] = 'Bruk / som skilletegn mellom navnerom i URLer'; $lang['usedraft'] = 'Lagre kladd automatisk under redigering'; diff --git a/lib/plugins/config/lang/pl/lang.php b/lib/plugins/config/lang/pl/lang.php index 88cd0f72b..c051e9e13 100644 --- a/lib/plugins/config/lang/pl/lang.php +++ b/lib/plugins/config/lang/pl/lang.php @@ -93,7 +93,7 @@ $lang['auth_security_timeout'] = 'Czas wygaśnięcia uwierzytelnienia (w sekunda $lang['securecookie'] = 'Czy ciasteczka wysłane do przeglądarki przez HTTPS powinny być przez nią odsyłane też tylko przez HTTPS? Odznacz tę opcję tylko wtedy, gdy logowanie użytkowników jest zabezpieczone SSL, ale przeglądanie stron odbywa się bez zabezpieczenia.'; $lang['xmlrpc'] = 'Włącz/wyłącz interfejs XML-RPC'; $lang['xmlrpcuser'] = 'Lista użytkowników i grup, którzy mogą korzystać z protokołu XML-RPC. Nazwy grup i użytkowników rozdziel przecinkami, puste pole oznacza dostęp dla wszystkich.'; -$lang['updatecheck'] = 'Sprawdzanie aktualizacji i bezpieczeństwa. DokuWiki będzie kontaktować się z serwerem splitbrain.org.'; +$lang['updatecheck'] = 'Sprawdzanie aktualizacji i bezpieczeństwa. DokuWiki będzie kontaktować się z serwerem update.dokuwiki.org.'; $lang['userewrite'] = 'Proste adresy URL'; $lang['useslash'] = 'Używanie ukośnika jako separatora w adresie URL'; $lang['usedraft'] = 'Automatyczne zapisywanie szkicu podczas edycji'; diff --git a/lib/plugins/config/lang/pt-br/lang.php b/lib/plugins/config/lang/pt-br/lang.php index 222123876..9e5798e30 100644 --- a/lib/plugins/config/lang/pt-br/lang.php +++ b/lib/plugins/config/lang/pt-br/lang.php @@ -91,7 +91,7 @@ $lang['profileconfirm'] = 'Confirmar mudanças no perfil com a senha'; $lang['disableactions'] = 'Desabilitar as ações do DokuWiki'; $lang['disableactions_check'] = 'Verificação'; $lang['disableactions_subscription'] = 'Monitoramento'; -$lang['disableactions_wikicode'] = 'Visualização da fonte/Exportação sem processamento'; +$lang['disableactions_wikicode'] = 'Ver a fonte/Exportar sem processamento'; $lang['disableactions_other'] = 'Outras ações (separadas por vírgula)'; $lang['sneaky_index'] = 'Por padrão, o DokuWiki irá exibir todos os espaços de nomes na visualização do índice. Ao habilitar essa opção, serão escondidos aqueles que o usuário não tiver permissão de leitura. Isso pode resultar na omissão de subespaços de nomes, tornando o índice inútil para certas configurações de ACL.'; $lang['auth_security_timeout'] = 'Tempo limite de segurança para autenticações (seg)'; @@ -113,12 +113,13 @@ $lang['fetchsize'] = 'Tamanho máximo (em bytes) que o "fetch.php" p $lang['notify'] = 'Enviar notificações de mudança para esse endereço de e-mail'; $lang['registernotify'] = 'Enviar informações de usuários registrados para esse endereço de e-mail'; $lang['mailfrom'] = 'Endereço de e-mail a ser utilizado para mensagens automáticas'; +$lang['mailprefix'] = 'Prefixo do assunto dos e-mails de envio automático'; $lang['gzip_output'] = 'Usar "Content-Encoding" do gzip para o código xhtml'; $lang['gdlib'] = 'Versão da biblioteca "GD Lib"'; $lang['im_convert'] = 'Caminho para a ferramenta de conversão ImageMagick'; $lang['jpg_quality'] = 'Qualidade de compressão do JPG (0-100)'; -$lang['subscribers'] = 'Habilitar o suporte a monitoramento de páginas'; -$lang['subscribe_time'] = 'Tempo de envio que as listas de inscrições serão enviadas (segundos); Este tempo deve ser menor que o tempo especificado em mudanças recentes.'; +$lang['subscribers'] = 'Habilitar o suporte ao monitoramento de páginas'; +$lang['subscribe_time'] = 'Tempo de espera antes do envio das listas e mensagens de monitoramento (segundos); este tempo deve ser menor que o especificado no parâmetro recent_days'; $lang['compress'] = 'Compactar as saídas de CSS e JavaScript'; $lang['hidepages'] = 'Esconder páginas correspondentes (expressão regular)'; $lang['send404'] = 'Enviar "HTTP 404/Página não encontrada" para páginas não existentes'; diff --git a/lib/plugins/config/lang/pt/lang.php b/lib/plugins/config/lang/pt/lang.php index 336de5b36..f4382aa94 100644 --- a/lib/plugins/config/lang/pt/lang.php +++ b/lib/plugins/config/lang/pt/lang.php @@ -6,6 +6,7 @@ * @author Enrico Nicoletto <liverig@gmail.com> * @author Fil <fil@meteopt.com> * @author André Neves <drakferion@gmail.com> + * @author José Campos zecarlosdecampos@gmail.com */ $lang['menu'] = 'Configuração'; $lang['error'] = 'Parâmetros de Configuração não actualizados devido a valores inválidos. Por favor, reveja as modificações que pretende efectuar antes de re-submetê-las.<br /> Os valores incorrectos serão mostrados dentro de uma "moldura" vermelha.'; @@ -103,6 +104,7 @@ $lang['fetchsize'] = 'Tamanho máximo (bytes) que o fetch.php pode t $lang['notify'] = 'Enviar notificações de mudanças para este endereço de email'; $lang['registernotify'] = 'Enviar informações de utilizadores registados para este endereço de email'; $lang['mailfrom'] = 'Endereço de email a ser utilizado para mensagens automáticas'; +$lang['mailprefix'] = 'Prefixo de email a ser utilizado para mensagens automáticas'; $lang['gzip_output'] = 'Usar "Content-Encoding" do gzip para o código xhtml'; $lang['gdlib'] = 'Versão GD Lib'; $lang['im_convert'] = 'Caminho para a ferramenta "convert" do ImageMagick'; @@ -110,6 +112,7 @@ $lang['jpg_quality'] = 'Compressão/Qualidade JPG (0-100)'; $lang['subscribers'] = 'Habilitar o suporte a subscrição de páginas '; $lang['subscribe_time'] = 'Tempo após o qual as listas de subscrição e "digests" são enviados (seg.); Isto deve ser inferior ao tempo especificado em recent_days.'; $lang['compress'] = 'Compactar as saídas de CSS e JavaScript'; +$lang['cssdatauri'] = 'Tamanho em bytes até ao qual as imagens referenciadas em ficheiros CSS devem ser embutidas diretamente no CSS para reduzir a carga de pedidos HTTP extra. Esta técnica não funciona em IE < 8! <code>400</code> a <code>600</code> bytes é um bom valor. Escolher <code>0</code> para desativar.'; $lang['hidepages'] = 'Esconder páginas correspondentes (expressões regulares)'; $lang['send404'] = 'Enviar "HTTP 404/Página não encontrada" para páginas não existentes'; $lang['sitemap'] = 'Gerar Sitemap Google (dias)'; diff --git a/lib/plugins/config/lang/ro/lang.php b/lib/plugins/config/lang/ro/lang.php index 7eb22c341..8ea923913 100644 --- a/lib/plugins/config/lang/ro/lang.php +++ b/lib/plugins/config/lang/ro/lang.php @@ -89,7 +89,7 @@ $lang['auth_security_timeout'] = 'Timpul de expirare al Autentificării Securiza $lang['securecookie'] = 'Cookies-urile setate via HTTPS să fie trimise doar via HTTPS de către browser? Dezactivaţi această opţiune numai când login-ul wiki-ului este securizat cu SSL dar navigarea wiki-ului se realizează nesecurizat.'; $lang['xmlrpc'] = 'Activează/dezactivează interfaţa XML-RPC'; $lang['xmlrpcuser'] = 'Restricţionaţi accesul XML-RPC la grupurile sau utilizatorii separaţi prin virgulă daţi aici. Lasaţi gol pentru a da acces tuturor.'; -$lang['updatecheck'] = 'Verificare actualizări şi avertismente privind securitatea? DokuWiki trebuie să contacteze splitbrain.org pentru această facilitate.'; +$lang['updatecheck'] = 'Verificare actualizări şi avertismente privind securitatea? DokuWiki trebuie să contacteze update.dokuwiki.org pentru această facilitate.'; $lang['userewrite'] = 'Folosire URL-uri "nice"'; $lang['useslash'] = 'Foloseşte slash-ul ca separator de spaţii de nume în URL-uri'; $lang['usedraft'] = 'Salvează automat o schiţă în timpul editării'; @@ -104,6 +104,7 @@ $lang['fetchsize'] = 'Dimensiunea maximă (byte) pe care fetch.php p $lang['notify'] = 'Trimite notificări privind modificările pe această adresă de email'; $lang['registernotify'] = 'Trimite informare noilor utilizatori înregistraţi pe această adresă de email'; $lang['mailfrom'] = 'Adresa de email utilizată pentru mailuri automate'; +$lang['mailprefix'] = 'Prefix subiect e-mail de folosit pentru mail-uri automate'; $lang['gzip_output'] = 'Foloseşte gzip pentru codarea conţinutului xhtml'; $lang['gdlib'] = 'Versiunea GD Lib'; $lang['im_convert'] = 'Calea către instrumentul de conversie ImageMagick'; @@ -136,6 +137,7 @@ $lang['proxy____port'] = 'Port Proxy'; $lang['proxy____user'] = 'Nume utilizator Proxy'; $lang['proxy____pass'] = 'Parolă Proxy'; $lang['proxy____ssl'] = 'Foloseşte SSL pentru conectare la Proxy'; +$lang['proxy____except'] = 'Expresie regulară de potrivit cu URL-uri pentru care proxy-ul trebuie păsuit.'; $lang['safemodehack'] = 'Activează safemode hack'; $lang['ftp____host'] = 'Server FTP pentru safemode hack'; $lang['ftp____port'] = 'Port FTP pentru safemode hack'; @@ -183,3 +185,4 @@ $lang['useheading_o_0'] = 'Niciodată'; $lang['useheading_o_navigation'] = 'Doar navigare'; $lang['useheading_o_content'] = 'Doar conţinutul Wiki'; $lang['useheading_o_1'] = 'Întotdeauna'; +$lang['readdircache'] = 'Vârsta maximă depozitare readdir (sec)'; diff --git a/lib/plugins/config/lang/ru/intro.txt b/lib/plugins/config/lang/ru/intro.txt index c66a69e64..a629d9332 100644 --- a/lib/plugins/config/lang/ru/intro.txt +++ b/lib/plugins/config/lang/ru/intro.txt @@ -1,9 +1,9 @@ ====== Настройки вики ====== -Здесь вы можете изменить настройки вашей «ДокуВики». Для справки по поводу конкретных опций смотрите [[doku>config]]. Дополнительные детали об этом плагине доступны здесь: [[doku>plugin:config]]. +Здесь вы можете изменить настройки своей «ДокуВики». Для справки по поводу конкретных опций смотрите [[doku>config]]. Дополнительные детали об этом плагине доступны здесь: [[doku>plugin:config]]. Настройки, отображаемые на светло-красном фоне, защищены от изменений и не могут быть отредактированы с помощью этого плагина. Голубым фоном отмечены настройки со значениями по умолчанию, а белым фоном — настройки, которые были локально изменены для этой конкретной «ДокуВики». Как голубые, так и белые настройки доступны для изменения. -Не забудьте нажать кнопку **Сохранить** перед тем, как покинуть эту страницу, иначе все ваши изменения будут потеряны. +Не забудьте нажать кнопку «**Сохранить**» перед тем, как покинуть эту страницу, иначе все ваши изменения будут потеряны. diff --git a/lib/plugins/config/lang/ru/lang.php b/lib/plugins/config/lang/ru/lang.php index 167c54eea..f29257a28 100644 --- a/lib/plugins/config/lang/ru/lang.php +++ b/lib/plugins/config/lang/ru/lang.php @@ -14,13 +14,14 @@ * @author Vlad Tsybenko <vlad.development@gmail.com> * @author Aleksey Osadchiy <rfc@nm.ru> * @author Aleksandr Selivanov <alexgearbox@gmail.com> + * @author Ladyko Andrey <fylh@succexy.spb.ru> + * @author Eugene <windy.wanderer@gmail.com> */ $lang['menu'] = 'Настройки вики'; -$lang['error'] = 'Настройки не были сохранены из-за ошибки в одном из значений. Пожалуйста, проверьте ваши изменения и попробуйте еще раз.<br />Неправильные значения будут обведены красной рамкой.'; +$lang['error'] = 'Настройки не были сохранены из-за ошибки в одном из значений. Пожалуйста, проверьте свои изменения и попробуйте ещё раз.<br />Неправильные значения будут обведены красной рамкой.'; $lang['updated'] = 'Настройки успешно сохранены.'; $lang['nochoice'] = '(нет других вариантов)'; -$lang['locked'] = 'Файл настройки недоступен для изменения. Если это не специально, <br /> -убедитесь, что файл локальной настройки имеет правильное имя и права доступа.'; +$lang['locked'] = 'Файл настройки недоступен для изменения. Если это не специально, <br />убедитесь, что файл локальной настройки имеет правильное имя и права доступа.'; $lang['danger'] = 'Внимание: изменение этой опции может сделать вашу вики и меню конфигурации недоступными.'; $lang['warning'] = 'Предостережение: изменение этой опции может вызвать непредсказуемое поведение.'; $lang['security'] = 'Предостережение по безопасности: изменение этой опции может вызвать риск, связанный с безопасностью.'; @@ -63,7 +64,7 @@ $lang['phpok'] = 'Разрешить PHP'; $lang['dformat'] = 'Формат даты и времени'; $lang['signature'] = 'Шаблон подписи'; $lang['toptoclevel'] = 'Мин. уровень в содержании'; -$lang['tocminheads'] = 'Минимальное количество заголовков, при котором будет составлено содержание'; +$lang['tocminheads'] = 'Мин. количество заголовков, при котором будет составлено содержание'; $lang['maxtoclevel'] = 'Макс. уровень в содержании'; $lang['maxseclevel'] = 'Макс. уровень для правки'; $lang['camelcase'] = 'Использовать ВикиРегистр для ссылок'; @@ -84,22 +85,22 @@ $lang['authtype'] = 'Механизм аутентификации' $lang['passcrypt'] = 'Метод шифрования пароля'; $lang['defaultgroup'] = 'Группа по умолчанию'; $lang['superuser'] = 'Суперпользователь — группа или пользователь с полным доступом ко всем страницам и функциям администрирования, независимо от установок ACL. Перечень разделяйте запятыми: user1,@group1,user2'; -$lang['manager'] = 'Менеджер — группа или пользователь с доступом к определенным функциям управления. Перечень разделяйте запятыми: user1,@group1,user2'; +$lang['manager'] = 'Менеджер — группа или пользователь с доступом к определённым функциям управления. Перечень разделяйте запятыми: user1,@group1,user2'; $lang['profileconfirm'] = 'Пароль для изменения профиля'; $lang['disableactions'] = 'Заблокировать операции «ДокуВики»'; $lang['disableactions_check'] = 'Проверка'; $lang['disableactions_subscription'] = 'Подписка/Отмена подписки'; $lang['disableactions_wikicode'] = 'Показ/экспорт исходного текста'; $lang['disableactions_other'] = 'Другие операции (через запятую)'; -$lang['sneaky_index'] = 'По умолчанию, «ДокуВики» показывает в индексе страниц все пространства имен. Включение этой опции скроет пространства имен, для которых пользователь не имеет прав чтения. Это может привести к скрытию доступных вложенных пространств имен и потере функциональности индекса страниц при некоторых конфигурациях прав доступа.'; +$lang['sneaky_index'] = 'По умолчанию, «ДокуВики» показывает в индексе страниц все пространства имён. Включение этой опции скроет пространства имён, для которых пользователь не имеет прав чтения. Это может привести к скрытию доступных вложенных пространств имён и потере функциональности индекса страниц при некоторых конфигурациях прав доступа.'; $lang['auth_security_timeout'] = 'Интервал для безопасности авторизации (сек.)'; $lang['securecookie'] = 'Должны ли куки (cookies), выставленные через HTTPS, отправляться браузером только через HTTPS. Отключите эту опцию в случае, когда только логин вашей вики передаётся через SSL, а обычный просмотр осуществляется в небезопасном режиме.'; $lang['xmlrpc'] = 'Включить/выключить XML-RPC интерфейс.'; -$lang['xmlrpcuser'] = 'Запретить XML-RPC доступ для списка групп и пользователей, перечисленных через запятую. Оставьте пустым, если хотите оставить доступ всем.'; -$lang['updatecheck'] = 'Проверять наличие обновлений и предупреждений о безопасности? Для этого «ДокуВики» потребуется связываться со <a href="http://www.splitbrain.org/">splitbrain.org</a>.'; +$lang['xmlrpcuser'] = 'Запретить XML-RPC-доступ для списка групп и пользователей, перечисленных через запятую. Оставьте пустым, если хотите оставить доступ всем.'; +$lang['updatecheck'] = 'Проверять наличие обновлений и предупреждений о безопасности? Для этого «ДокуВики» потребуется связываться с сайтом <a href="http://www.splitbrain.org/">splitbrain.org</a>.'; $lang['userewrite'] = 'Удобочитаемые адреса (URL)'; $lang['useslash'] = 'Использовать слэш'; -$lang['usedraft'] = 'Автоматически сохранять черновик в время правки'; +$lang['usedraft'] = 'Автоматически сохранять черновик во время правки'; $lang['sepchar'] = 'Разделитель слов в имени страницы'; $lang['canonical'] = 'Полные канонические адреса (URL)'; $lang['fnencode'] = 'Метод кодирования имён файлов, записанных не ASCII-символами.'; @@ -111,18 +112,19 @@ $lang['fetchsize'] = 'Максимальный размер файл $lang['notify'] = 'Электронный адрес для извещений'; $lang['registernotify'] = 'Посылать информацию о новых зарегистрированных пользователях на этот электронный адрес'; $lang['mailfrom'] = 'Электронный адрес вики (От:)'; +$lang['mailprefix'] = 'Префикс используемый для автоматического письма станет темой сообщений'; $lang['gzip_output'] = 'Использовать gzip-сжатие для xhtml'; $lang['gdlib'] = 'Версия LibGD'; $lang['im_convert'] = 'Путь к ImageMagick'; -$lang['jpg_quality'] = 'Качество сжатия JPG (0–100). Значение о умолчнию — 70.'; +$lang['jpg_quality'] = 'Качество сжатия JPG (0–100). Значение по умолчанию — 70.'; $lang['subscribers'] = 'Разрешить подписку на изменения'; -$lang['subscribe_time'] = 'Интервал рассылки подписок и сводок (сек.); Должен быть меньше, чем значение, указанное в recent_days.'; +$lang['subscribe_time'] = 'Интервал рассылки подписок и сводок (сек.). Должен быть меньше, чем значение, указанное в recent_days.'; $lang['compress'] = 'Сжимать файлы CSS и javascript'; $lang['hidepages'] = 'Скрыть страницы (рег. выражение)'; $lang['send404'] = 'Посылать «HTTP404/Page Not Found»'; $lang['sitemap'] = 'Число дней, через которое нужно создавать (обновлять) карту сайта для поисковиков (Гугл, Яндекс и др.)'; $lang['broken_iua'] = 'Возможно, функция ignore_user_abort не работает в вашей системе? Это может привести к потере функциональности индексирования поиска. Эта проблема присутствует, например, в IIS+PHP/CGI. Для дополнительной информации смотрите <a href="http://bugs.splitbrain.org/?do=details&task_id=852">баг 852</a>.'; -$lang['xsendfile'] = 'Используете заголовок X-Sendfile для загрузки файлов на вебсервер? Ваш вебсервер должен поддерживать это.'; +$lang['xsendfile'] = 'Используете заголовок X-Sendfile для загрузки файлов на веб-сервер? Ваш веб-сервер должен поддерживать это.'; $lang['renderer_xhtml'] = 'Обработчик основного (xhtml) вывода вики'; $lang['renderer__core'] = '%s (ядро dokuwiki)'; $lang['renderer__plugin'] = '%s (плагин)'; @@ -138,18 +140,18 @@ $lang['target____interwiki'] = 'target для ссылок между вики $lang['target____extern'] = 'target для внешних ссылок'; $lang['target____media'] = 'target для ссылок на медиафайлы'; $lang['target____windows'] = 'target для ссылок на сетевые каталоги'; -$lang['proxy____host'] = 'proxy - адрес'; -$lang['proxy____port'] = 'proxy - порт'; -$lang['proxy____user'] = 'proxy - имя пользователя'; -$lang['proxy____pass'] = 'proxy - пароль'; -$lang['proxy____ssl'] = 'proxy - ssl'; +$lang['proxy____host'] = 'proxy-адрес'; +$lang['proxy____port'] = 'proxy-порт'; +$lang['proxy____user'] = 'proxy-имя пользователя'; +$lang['proxy____pass'] = 'proxy-пароль'; +$lang['proxy____ssl'] = 'proxy-ssl'; $lang['proxy____except'] = 'Регулярное выражение для адресов (URL), для которых прокси должен быть пропущен.'; $lang['safemodehack'] = 'Включить обход safemode (хак)'; -$lang['ftp____host'] = 'ftp - адрес'; -$lang['ftp____port'] = 'ftp - порт'; -$lang['ftp____user'] = 'ftp - имя пользователя'; -$lang['ftp____pass'] = 'ftp - пароль'; -$lang['ftp____root'] = 'ftp - корневая директория'; +$lang['ftp____host'] = 'ftp-адрес'; +$lang['ftp____port'] = 'ftp-порт'; +$lang['ftp____user'] = 'ftp-имя пользователя'; +$lang['ftp____pass'] = 'ftp-пароль'; +$lang['ftp____root'] = 'ftp-корневая директория'; $lang['license_o_'] = 'Не выбрано'; $lang['typography_o_0'] = 'нет'; $lang['typography_o_1'] = 'Только двойные кавычки'; @@ -185,10 +187,10 @@ $lang['xsendfile_o_2'] = 'Стандартный заголовок X-Se $lang['xsendfile_o_3'] = 'Проприетарный заголовок Nginx X-Accel-Redirect'; $lang['showuseras_o_loginname'] = 'Логин'; $lang['showuseras_o_username'] = 'Полное имя пользователя'; -$lang['showuseras_o_email'] = 'Адрес электронной почты пользователя (зашифрован согласно настройкам mailguard)'; -$lang['showuseras_o_email_link'] = 'Адрес электронной почты пользователя в виде ссылки mailto:'; +$lang['showuseras_o_email'] = 'Адрес электропочты в шифрованном виде (см. mailguard)'; +$lang['showuseras_o_email_link'] = 'Адрес электропочты в виде ссылки mailto:'; $lang['useheading_o_0'] = 'Никогда'; $lang['useheading_o_navigation'] = 'Только навигация'; $lang['useheading_o_content'] = 'Только содержимое вики'; $lang['useheading_o_1'] = 'Всегда'; -$lang['readdircache'] = 'Максимальное время жизни кэша readdir (сек)'; +$lang['readdircache'] = 'Максимальное время жизни кэша readdir (сек.)'; diff --git a/lib/plugins/config/lang/sk/lang.php b/lib/plugins/config/lang/sk/lang.php index ad1ab110f..79f54dc4d 100644 --- a/lib/plugins/config/lang/sk/lang.php +++ b/lib/plugins/config/lang/sk/lang.php @@ -87,7 +87,7 @@ $lang['auth_security_timeout'] = 'Časový limit pri prihlasovaní (v sekundách $lang['securecookie'] = 'Mal by prehliadač posielať cookies nastavené cez HTTPS posielať iba cez HTTPS (bezpečné) pripojenie? Vypnite túto voľbu iba v prípade, ak je prihlasovanie do Vašej wiki zabezpečené SSL, ale prezeranie wiki je nezabezpečené.'; $lang['xmlrpc'] = 'Povoliť/zakázať XML-RPC rozhranie.'; $lang['xmlrpcuser'] = 'Obmedziť XML-RPC prístup iba pre uvedené skupiny alebo používateľov (oddelených čiarkami).'; -$lang['updatecheck'] = 'Kontrolovať aktualizácie a bezpečnostné upozornenia? DokuWiki potrebuje pre túto funkciu prístup k splitbrain.org.'; +$lang['updatecheck'] = 'Kontrolovať aktualizácie a bezpečnostné upozornenia? DokuWiki potrebuje pre túto funkciu prístup k update.dokuwiki.org.'; $lang['userewrite'] = 'Používať nice URLs'; $lang['useslash'] = 'Používať lomku (/) ako oddeľovač v URL'; $lang['usedraft'] = 'Automaticky ukladať koncept počas úpravy stránky'; @@ -102,6 +102,7 @@ $lang['fetchsize'] = 'Maximálna veľkosť (v bajtoch) pri sťahovan $lang['notify'] = 'Posielať upozornenia na zmeny na túto e-mailovú adresu'; $lang['registernotify'] = 'Posielať informáciu o nových užívateľoch na túto e-mailovú adresu'; $lang['mailfrom'] = 'E-mailová adresa na automatické e-maily'; +$lang['mailprefix'] = 'Prefix predmetu emailovej spravy zasielanej automaticky'; $lang['gzip_output'] = 'Používať gzip Content-Encoding pre xhtml'; $lang['gdlib'] = 'Verzia GD Lib'; $lang['im_convert'] = 'Cesta k ImageMagick convert tool'; diff --git a/lib/plugins/config/lang/sl/intro.txt b/lib/plugins/config/lang/sl/intro.txt new file mode 100644 index 000000000..506cd34bd --- /dev/null +++ b/lib/plugins/config/lang/sl/intro.txt @@ -0,0 +1,7 @@ +====== Splošne nastavitve ====== + +Na tej strani je mogoče spreminjati nastavitve sistema DokuWiki. Pomoč o posameznih nastavitvah je na voljo med [[doku>config|nastavitvami]]. Več podrobnosti o vstavku je na voljo na [[doku>plugin:config|nastavitvami vstavka]]. + +Nastavitve označene s svetlo rdečim ozadjem so zaščitene in jih s tem vstavkom ni mogoče spreminjati. Nastavitve označene s svetlo modrim ozadjem so privzete vrednosti in nastavitve z belim ozadjem so tiste, ki so bile določene krajevno posebej za to nastavitev. Spreminjati je mogoče vrednosti označene z modrimi in belim ozadjem. + +Spremembe je treba **shraniti**, da se uveljavijo, sicer se spremembe prezrejo. diff --git a/lib/plugins/config/lang/sl/lang.php b/lib/plugins/config/lang/sl/lang.php index 52b88a053..dadd01595 100644 --- a/lib/plugins/config/lang/sl/lang.php +++ b/lib/plugins/config/lang/sl/lang.php @@ -4,21 +4,183 @@ * * @author Dejan Levec <webphp@gmail.com> * @author Boštjan Seničar <senicar@gmail.com> + * @author Gregor Skumavc (grega.skumavc@gmail.com) + * @author Matej Urbančič (mateju@svn.gnome.org) */ -$lang['lang'] = 'Jezik'; + +$lang['menu'] = 'Splošne nastavitve'; +$lang['error'] = 'Nastavitve niso shranjene zaradi neveljavne vrednosti.<br />Neveljavna vrednost je označena z rdečim robom vnosnega polja.'; +$lang['updated'] = 'Nastavitve so uspešno posodobljene.'; +$lang['nochoice'] = '(ni drugih možnosti na voljo)'; +$lang['locked'] = 'Nastavitvene datoteke ni mogoče posodobiti.<br />Preverite dovoljenja za spreminjanje in ime nastavitvene datoteke.'; +$lang['danger'] = 'Opozorilo: spreminjanje te možnosti lahko povzroči težave v delovanju sistema wiki.'; +$lang['warning'] = 'Opozorilo: spreminjanje te možnosti lahko vpliva na pravilno delovanje sistema wiki.'; +$lang['security'] = 'Varnostno opozorilo: spreminjanje te možnosti lahko vpliva na varnost sistema.'; +$lang['_configuration_manager'] = 'Upravljalnik nastavitev'; +$lang['_header_dokuwiki'] = 'Nastavitve DokuWiki'; +$lang['_header_plugin'] = 'Nastavitve vstavkov'; +$lang['_header_template'] = 'Nastavitve predlog'; +$lang['_header_undefined'] = 'Neopredeljene nastavitve'; +$lang['_basic'] = 'Osnovne nastavitve'; +$lang['_display'] = 'Nastavitve prikazovanja'; +$lang['_authentication'] = 'Nastavitve overjanja'; +$lang['_anti_spam'] = 'Nastavitve neželenih sporočil (Anti-Spam)'; +$lang['_editing'] = 'Nastavitve urejanja'; +$lang['_links'] = 'Nastavitve povezav'; +$lang['_media'] = 'Predstavnostne nastavitve'; +$lang['_advanced'] = 'Napredne nastavitve'; +$lang['_network'] = 'Omrežne nastavitve'; +$lang['_plugin_sufix'] = 'nastavitve'; +$lang['_template_sufix'] = 'nastavitve'; +$lang['_msg_setting_undefined'] = 'Ni nastavitvenih metapodatkov.'; +$lang['_msg_setting_no_class'] = 'Ni nastavitvenega razreda.'; +$lang['_msg_setting_no_default'] = 'Ni privzete vrednosti.'; +$lang['fmode'] = 'Način ustvarjanja datotek'; +$lang['dmode'] = 'Način ustvarjanja map'; +$lang['lang'] = 'Jezik vmesnika'; +$lang['basedir'] = 'Pot do strežnika (npr. /dokuwiki/). Prazno polje določa samodejno zaznavanje'; +$lang['baseurl'] = 'Naslov URL strežnika (npr. http://www.streznik.si). Prazno polje določa samodejno zaznavanje'; +$lang['savedir'] = 'Mapa za shranjevanje podatkov'; +$lang['start'] = 'Ime začetne strani wiki'; +$lang['title'] = 'Naslov Wiki spletišča'; $lang['template'] = 'Predloga'; -$lang['recent'] = 'Zadnje spremembe'; +$lang['license'] = 'Pod pogoji katerega dovoljenja je objavljena vsebina?'; +$lang['fullpath'] = 'Pokaži polno pot strani v nogi strani'; +$lang['recent'] = 'Nedavne spremembe'; +$lang['breadcrumbs'] = 'Število drobtinic poti'; +$lang['youarehere'] = 'Hierarhične drobtinice poti'; +$lang['typography'] = 'Omogoči tipografske zamenjave'; +$lang['htmlok'] = 'Dovoli vstavljeno kodo HTML'; +$lang['phpok'] = 'Dovoli vstavljeno kodo PHP'; +$lang['dformat'] = 'Oblika zapisa časa (funkcija PHP <a href="http://www.php.net/strftime">strftime</a>)'; $lang['signature'] = 'Podpis'; +$lang['toptoclevel'] = 'Vrhnja raven kazala'; +$lang['tocminheads'] = 'Najmanjše število naslovov za izgradnjo kazala'; +$lang['maxtoclevel'] = 'Najvišja raven kazala'; +$lang['maxseclevel'] = 'Največja raven urejanja odseka'; +$lang['camelcase'] = 'Uporabi EnoBesedni zapisa za povezave'; +$lang['deaccent'] = 'Počisti imena strani'; +$lang['useheading'] = 'Uporabi prvi naslov za ime strani'; +$lang['refcheck'] = 'Preverjanje sklica predstavnih datotek'; +$lang['refshow'] = 'Število predstavnostnih sklicev za prikaz'; +$lang['allowdebug'] = 'Dovoli razhroščevanje (po potrebi!)'; +$lang['usewordblock'] = 'Zaustavi neželeno besedilo glede na seznam besed'; +$lang['indexdelay'] = 'Časovni zamik pred ustvarjanjem kazala (v sekundah)'; +$lang['relnofollow'] = 'Uporabni možnost rel="nofollow" pri zunanjih povezavah'; +$lang['mailguard'] = 'Šifriraj elektronske naslove'; +$lang['iexssprotect'] = 'Preveri poslane datoteke za zlonamerno kodo JavaScript ali HTML'; +$lang['showuseras'] = 'Kaj prikazati za prikaz uporabnika, ki je zadnji urejal stran'; +$lang['useacl'] = 'Uporabi seznam nadzora dostopa (ACL)'; +$lang['autopasswd'] = 'Samodejno ustvari gesla'; +$lang['authtype'] = 'Ozadnji način overitve'; +$lang['passcrypt'] = 'Način šifriranja gesel'; $lang['defaultgroup'] = 'Privzeta skupina'; +$lang['superuser'] = 'Skrbnik - skupina, uporabnik ali z vejico ločen seznam uporabnik1,@skupina1,uporabnik2 s polnim dostopom do vseh strani in možnosti, neodvisno od nastavitev nadzora dostopa ACL'; +$lang['manager'] = 'Upravljavec - skupina, uporabnik ali z vejico ločen seznam uporabnik1,@skupina1,uporabnik2 z dovoljenji za dostop do nekaterih možnosti upravljanja'; +$lang['profileconfirm'] = 'Potrdi spremembe profila z geslom'; +$lang['disableactions'] = 'Onemogoči dejanja DokuWiki'; $lang['disableactions_check'] = 'Preveri'; -$lang['userewrite'] = 'Uporabi lepše URL naslove'; +$lang['disableactions_subscription'] = 'Naročanje/Preklic naročnine'; +$lang['disableactions_wikicode'] = 'Pogled izvorne kode/Surovi izvoz'; +$lang['disableactions_other'] = 'Druga dejanja (z vejico ločen seznam)'; +$lang['sneaky_index'] = 'Privzeto pokaže sistem DokuWiki vse imenske prostore v pogledu kazala. Z omogočanjem te možnosti bodo skriti vsi imenski prostori, v katere prijavljen uporabnik nima dovoljenj dostopa. S tem je mogoče preprečiti dostop do podrejenih strani. Možnost lahko vpliva na uporabnost nastavitev nadzora dostopa ACL.'; +$lang['auth_security_timeout'] = 'Varnostna časovna omejitev overitve (v sekundah)'; +$lang['securecookie'] = 'Ali naj se piškotki poslani preko varne povezave HTTPS v brskalniku pošiljajo le preko HTTPS? Onemogočanje možnosti je priporočljivo le takrat, ko je prijava varovana s protokolom SSL, brskanje po strani pa ni posebej zavarovano.'; +$lang['xmlrpc'] = 'Omogoči/Onemogoči vmesnik XML-RPC.'; +$lang['xmlrpcuser'] = 'Omejitev dostopa do vmesnika XML-RPC z vejico ločenim seznamom skupin in uporabnikov. Prazno polje pomeni, prost dostop za vse uporabnike.'; +$lang['updatecheck'] = 'Ali naj sistem preveri za posodobitve in varnostna opozorila.'; +$lang['userewrite'] = 'Uporabi olepšan zapis naslovov URL'; +$lang['useslash'] = 'Uporabi poševnico kot ločilnik imenskih prostorov v naslovih URL'; +$lang['usedraft'] = 'Samodejno shrani osnutek med urejanjem strani'; +$lang['sepchar'] = 'Ločilnik besed imen strani'; +$lang['canonical'] = 'Uporabi polni kanonični zapis naslova URL'; +$lang['fnencode'] = 'Način kodiranja ne-ASCII imen datotek.'; +$lang['autoplural'] = 'Preveri množinske oblike povezav'; +$lang['compression'] = 'Način stiskanja za arhivirane datoteke'; +$lang['cachetime'] = 'Največja dovoljena starost predpomnilnika (v sekundah)'; +$lang['locktime'] = 'Največja dovoljena starost datotek zaklepa (v sekundah)'; +$lang['fetchsize'] = 'največja dovoljena velikost zunanjega prejemanja z datoteko fetch.php (v bajtih)'; +$lang['notify'] = 'Pošlji obvestila o spremembah na določen elektronski naslov'; +$lang['registernotify'] = 'Pošlji obvestila o novih vpisanih uporabnikih na določen elektronski naslov'; +$lang['mailfrom'] = 'Elektronski naslov za samodejno poslana sporočila'; +$lang['gzip_output'] = 'Uporabi stiskanje gzip vsebine za xhtml'; +$lang['gdlib'] = 'Različica GD Lib'; +$lang['im_convert'] = 'Pot do orodja za pretvarjanje slik ImageMagick'; +$lang['jpg_quality'] = 'Kakovost stiskanja datotek JPG (0-100)'; +$lang['subscribers'] = 'Omogoči podporo naročanju na strani'; +$lang['subscribe_time'] = 'Čas po katerem so poslani povzetki sprememb (v sekundah); Vrednost mora biti krajša od časa, ki je določen z nedavno_dni.'; +$lang['compress'] = 'Združi odvod CSS in JavaScript v brskalniku'; +$lang['hidepages'] = 'Skrij skladne strani (logični izraz)'; +$lang['send404'] = 'Pošlji "HTTP 404/Strani ni mogoče najti" pri dostopu do neobstoječih strani'; +$lang['sitemap'] = 'Ustvari Google kazalo strani (v dnevih)'; +$lang['broken_iua'] = 'Ali je možnost ignore_user_abort okvarjena na sistemu? Napaka lahko vpliva na delovanje iskalnika. Napake so pogoste ob uporabi IIS+PHP/CGI. Več o tem si je mogoče prebrati v <a href="http://bugs.splitbrain.org/?do=details&task_id=852">poročilu o hrošču 852</a>.'; +$lang['xsendfile'] = 'Uporabi glavo X-Sendfile za prejemanje statičnih datotek. Spletni strežnik mora možnost podpirati.'; +$lang['renderer_xhtml'] = 'Izrisovalnik za odvod Wiki strani (xhtml)'; +$lang['renderer__core'] = '%s (jedro dokuwiki)'; +$lang['renderer__plugin'] = '%s (vstavek)'; +$lang['rememberme'] = 'Dovoli trajne prijavne piškotke (trajno pomnenje prijave)'; +$lang['rss_type'] = 'Vrsta virov XML'; +$lang['rss_linkto'] = 'XML viri so povezani z'; +$lang['rss_content'] = 'Kaj prikazati med predmeti virov XML?'; +$lang['rss_update'] = 'Časovni razmik posodobitve virov XML (v sekundah)'; +$lang['recent_days'] = 'Koliko nedavnih sprememb naj se ohrani (v dnevih)'; +$lang['rss_show_summary'] = 'Viri XML so povzeti v naslovu'; +$lang['target____wiki'] = 'Ciljno okno za notranje povezave'; +$lang['target____interwiki'] = 'Ciljno okno za notranje wiki povezave'; +$lang['target____extern'] = 'Ciljno okno za zunanje povezave'; +$lang['target____media'] = 'Ciljno okno za predstavne povezave'; +$lang['target____windows'] = 'Ciljno okno za povezave oken'; +$lang['proxy____host'] = 'Ime posredniškega strežnika'; +$lang['proxy____port'] = 'Vrata posredniškega strežnika'; +$lang['proxy____user'] = 'Uporabniško ime posredniškega strežnika'; +$lang['proxy____pass'] = 'Geslo posredniškega strežnika'; +$lang['proxy____ssl'] = 'Uporabi varno povezavo SSL za povezavo z posredniškim strežnikom'; +$lang['proxy____except'] = 'Logični izrazi morajo biti skladni z naslovi URL, ki gredo mimo posredniškega strežnika.'; +$lang['safemodehack'] = 'Omogoči obhod načina SafeMode PHP'; +$lang['ftp____host'] = 'Strežnik FTP za obhod načina SafeMode'; +$lang['ftp____port'] = 'Vrata strežnika FTP za obhod načina SafeMode'; +$lang['ftp____user'] = 'Uporabniško ime za FTP za obhod načina SafeMode'; +$lang['ftp____pass'] = 'Geslo za strežnik FTP za obhod načina SafeMode'; +$lang['ftp____root'] = 'Korenska mapa FTP za obhod načina SafeMode'; +$lang['license_o_'] = 'Ni izbranega dovoljenja'; +$lang['typography_o_0'] = 'brez'; +$lang['typography_o_1'] = 'izloči enojne narekovaje'; +$lang['typography_o_2'] = 'z enojnimi narekovaji (lahko včasih ne deluje)'; +$lang['userewrite_o_0'] = 'brez'; $lang['userewrite_o_1'] = '.htaccess'; +$lang['userewrite_o_2'] = 'notranji DokuWiki'; +$lang['deaccent_o_0'] = 'onemogočeno'; +$lang['deaccent_o_1'] = 'odstrani naglasne oznake'; +$lang['deaccent_o_2'] = 'pretvori v romanski zapis'; +$lang['gdlib_o_0'] = 'Knjižnica GD Lib ni na voljo'; +$lang['gdlib_o_1'] = 'Različica 1.x'; +$lang['gdlib_o_2'] = 'Samodejno zaznavanje'; $lang['rss_type_o_rss'] = 'RSS 0.91'; $lang['rss_type_o_rss1'] = 'RSS 1.0'; $lang['rss_type_o_rss2'] = 'RSS 2.0'; $lang['rss_type_o_atom'] = 'Atom 0.3'; $lang['rss_type_o_atom1'] = 'Atom 1.0'; +$lang['rss_content_o_abstract'] = 'Povzetek'; +$lang['rss_content_o_diff'] = 'Poenotena primerjava'; +$lang['rss_content_o_htmldiff'] = 'HTML oblikovana preglednica primerjave'; +$lang['rss_content_o_html'] = 'Polna HTML vsebina strani'; +$lang['rss_linkto_o_diff'] = 'primerjalni pogled'; +$lang['rss_linkto_o_page'] = 'pregledana stran'; +$lang['rss_linkto_o_rev'] = 'seznam pregledovanj'; $lang['rss_linkto_o_current'] = 'trenutna stran'; -$lang['compression_o_0'] = 'brez stiskanja'; -$lang['compression_o_gz'] = 'gzip stiskanje'; -$lang['compression_o_bz2'] = 'bz2 stiskanje'; +$lang['compression_o_0'] = 'brez'; +$lang['compression_o_gz'] = 'gzip'; +$lang['compression_o_bz2'] = 'bz2'; +$lang['xsendfile_o_0'] = 'ne uporabi'; +$lang['xsendfile_o_1'] = 'plačniška glava lighttpd (pred različico 1.5)'; +$lang['xsendfile_o_2'] = 'običajna glava X-Sendfile'; +$lang['xsendfile_o_3'] = 'plačniška glava Nginx X-Accel-Redirect'; +$lang['showuseras_o_loginname'] = 'Prijavno ime'; +$lang['showuseras_o_username'] = 'Polno ime uporabnika'; +$lang['showuseras_o_email'] = 'Elektronski naslov uporabnika (šifriran po določilih varovanja)'; +$lang['showuseras_o_email_link'] = 'Elektronski naslov uporabnika kot povezava mailto:'; +$lang['useheading_o_0'] = 'nikoli'; +$lang['useheading_o_navigation'] = 'le za krmarjenje'; +$lang['useheading_o_content'] = 'le za vsebino Wiki'; +$lang['useheading_o_1'] = 'vedno'; +$lang['readdircache'] = 'Največja dovoljena starost predpomnilnika prebranih map (v sekundah)'; diff --git a/lib/plugins/config/lang/sq/lang.php b/lib/plugins/config/lang/sq/lang.php index 6cf8fd5af..adeb2a47d 100644 --- a/lib/plugins/config/lang/sq/lang.php +++ b/lib/plugins/config/lang/sq/lang.php @@ -85,7 +85,7 @@ $lang['auth_security_timeout'] = 'Koha e Përfundimit për Autentikim (sekonda)' $lang['securecookie'] = 'A duhet që cookies të vendosura nëpërmjet HTTPS të dërgohen vetëm nëpërmjet HTTPS nga shfletuesit? Caktivizojeni këtë alternativë kur vetëm hyrja në wiki-n tuaj sigurohet me SSL por shfletimi i wiki-t bëhet në mënyrë të pasigurtë.'; $lang['xmlrpc'] = 'Aktivizo/Caktivizo ndërfaqen XML-RPC'; $lang['xmlrpcuser'] = 'Kufizo aksesin XML-RPC vetëm tek grupet ose përdoruesit e ndarë me presje të dhënë këtu. Lëre bosh për t\'i dhënë akses të gjithëve.'; -$lang['updatecheck'] = 'Kontrollo për përditësime dhe paralajmërime sigurie? DokuWiki duhet të kontaktojë me splitbrain.org për këtë veti.'; +$lang['updatecheck'] = 'Kontrollo për përditësime dhe paralajmërime sigurie? DokuWiki duhet të kontaktojë me update.dokuwiki.org për këtë veti.'; $lang['userewrite'] = 'Përdor URL të këndshme.'; $lang['useslash'] = 'Përdor / si ndarës të hapësirave të emrit në URL'; $lang['usedraft'] = 'Ruaj automatikisht një skicë gjatë redaktimit'; diff --git a/lib/plugins/config/lang/sr/lang.php b/lib/plugins/config/lang/sr/lang.php index f66a7f717..5906dcd7e 100644 --- a/lib/plugins/config/lang/sr/lang.php +++ b/lib/plugins/config/lang/sr/lang.php @@ -86,7 +86,7 @@ $lang['auth_security_timeout'] = 'Временска пауза у аутент $lang['securecookie'] = 'Да ли колачићи који су постављени преко ХТТПС треба слати веб читачу само преко ХТТПС? Искључите ову опцију само ако је пријављивање на вики заштићено ССЛом а остали део викија незаштићен.'; $lang['xmlrpc'] = 'Укључи/искључи ИксМЛ-РПЦ интерфејс'; $lang['xmlrpcuser'] = 'Ограничи ИксМЛ-РПЦ приступ на наведене групе корисника раздвојене зарезом. Остави празно да би свима дао приступ.'; -$lang['updatecheck'] = 'Провера надоградњи и сигурносних упозорења? Dokuwiki мора да контактира splitbrain.org ради добијања информација.'; +$lang['updatecheck'] = 'Провера надоградњи и сигурносних упозорења? Dokuwiki мора да контактира update.dokuwiki.org ради добијања информација.'; $lang['userewrite'] = 'Направи леп УРЛ'; $lang['useslash'] = 'Користи косу црту у УРЛу за раздвајање именских простора '; $lang['usedraft'] = 'Аутоматски сачувај скицу у току писања измена'; diff --git a/lib/plugins/config/lang/sv/lang.php b/lib/plugins/config/lang/sv/lang.php index 3b5752ea1..dfd93d37d 100644 --- a/lib/plugins/config/lang/sv/lang.php +++ b/lib/plugins/config/lang/sv/lang.php @@ -15,6 +15,7 @@ * @author Bogge Bogge <bogge@bogge.com> * @author Peter Åström <eaustreum@gmail.com> * @author Håkan Sandell <hakan.sandell@home.se> + * @author mikael@mallander.net */ $lang['menu'] = 'Hantera inställningar'; $lang['error'] = 'Inställningarna uppdaterades inte på grund av ett felaktigt värde. Titta igenom dina ändringar och försök sedan spara igen. @@ -98,7 +99,7 @@ $lang['auth_security_timeout'] = 'Autentisieringssäkerhets timeout (sekunder)'; $lang['securecookie'] = 'Skall cookies som sätts via HTTPS endast skickas via HTTPS från webbläsaren? Avaktivera detta alternativ endast om inloggningen till din wiki är säkrad med SSL men läsning av wikin är osäkrad.'; $lang['xmlrpc'] = 'Aktivera/avaktivera XML-RPC-gränssnitt'; $lang['xmlrpcuser'] = 'Begränsa XML-RPC tillträde till komma separerade grupper eller användare som ges här. Lämna tomt för att ge tillgång till alla.'; -$lang['updatecheck'] = 'Kontrollera uppdateringar och säkerhetsvarningar? DokuWiki behöver kontakta splitbrain.org för den här funktionen.'; +$lang['updatecheck'] = 'Kontrollera uppdateringar och säkerhetsvarningar? DokuWiki behöver kontakta update.dokuwiki.org för den här funktionen.'; $lang['userewrite'] = 'Använd rena webbadresser'; $lang['useslash'] = 'Använd snedstreck för att separera namnrymder i webbadresser'; $lang['usedraft'] = 'Spara utkast automatiskt under redigering'; @@ -112,6 +113,7 @@ $lang['fetchsize'] = 'Maximal storlek (bytes) som fetch.php får lad $lang['notify'] = 'Skicka meddelande om ändrade sidor till den här e-postadressen'; $lang['registernotify'] = 'Skicka meddelande om nyregistrerade användare till en här e-postadressen'; $lang['mailfrom'] = 'Avsändaradress i automatiska e-postmeddelanden'; +$lang['mailprefix'] = 'Prefix i början på ämnesraden vid automatiska e-postmeddelanden'; $lang['gzip_output'] = 'Använd gzip Content-Encoding för xhtml'; $lang['gdlib'] = 'Version av GD-biblioteket'; $lang['im_convert'] = 'Sökväg till ImageMagicks konverteringsverktyg'; diff --git a/lib/plugins/config/lang/uk/lang.php b/lib/plugins/config/lang/uk/lang.php index f98e9463c..72d7e12f5 100644 --- a/lib/plugins/config/lang/uk/lang.php +++ b/lib/plugins/config/lang/uk/lang.php @@ -9,6 +9,7 @@ * @author Oleksandr Kunytsia <okunia@gmail.com> * @author Uko uko@uar.net * @author Ulrikhe Lukoie <lukoie@gmail>.com + * @author Kate Arzamastseva pshns@ukr.net */ $lang['menu'] = 'Настройка конфігурації'; $lang['error'] = 'Параметри не збережено через помилкові значення. Будь ласка, перегляньте ваші зміни та спробуйте ще раз @@ -92,7 +93,7 @@ $lang['auth_security_timeout'] = 'Таймаут аутентифікації ( $lang['securecookie'] = 'Чи повинен браузер надсилати файли cookies тільки через HTTPS? Вимкніть цей параметр, лише тоді, якщо вхід до Вікі захищено SSL, але перегляд сторінок відбувається у незахищеному режимі.'; $lang['xmlrpc'] = 'Дозволити/заборонити XML-RPC інтерфейс'; $lang['xmlrpcuser'] = 'Заборонити XML-RPC доступ до користувачів або груп поданих тут та розділених комою. Залишіть поле незаповненим, щоб дозволити доступ усім.'; -$lang['updatecheck'] = 'Перевірити наявність оновлень чи попереджень безпеки? Для цього ДокуВікі необхідно зв\'язатися зі splitbrain.org.'; +$lang['updatecheck'] = 'Перевірити наявність оновлень чи попереджень безпеки? Для цього ДокуВікі необхідно зв\'язатися зі update.dokuwiki.org.'; $lang['userewrite'] = 'Красиві URL'; $lang['useslash'] = 'Слеш, як розділювач просторів імен в URL'; $lang['usedraft'] = 'Автоматично зберігати чернетку при редагуванні'; @@ -107,6 +108,7 @@ $lang['fetchsize'] = 'Максимальний розмір (в ба $lang['notify'] = 'E-mail для сповіщень'; $lang['registernotify'] = 'Надсилати інформацію про нових користувачів на цю адресу'; $lang['mailfrom'] = 'E-mail для автоматичних повідомлень'; +$lang['mailprefix'] = 'Префікс теми повідомлення, що використовується в автоматичній розсилці електронних листів'; $lang['gzip_output'] = 'Використовувати gzip, як Content-Encoding для xhtml'; $lang['gdlib'] = 'Версія GD Lib'; $lang['im_convert'] = 'Шлях до ImageMagick'; @@ -187,4 +189,4 @@ $lang['useheading_o_0'] = 'Ніколи'; $lang['useheading_o_navigation'] = 'Лише для навігації'; $lang['useheading_o_content'] = 'Лише у змісті'; $lang['useheading_o_1'] = 'Завжди'; -$lang['readdircache'] = 'Макссимальний вік для файлів кешу (сек.)'; +$lang['readdircache'] = 'Максимальний вік для файлів кешу (сек.)'; diff --git a/lib/plugins/config/lang/zh-tw/intro.txt b/lib/plugins/config/lang/zh-tw/intro.txt index e27b18ba2..c257947d9 100644 --- a/lib/plugins/config/lang/zh-tw/intro.txt +++ b/lib/plugins/config/lang/zh-tw/intro.txt @@ -1,7 +1,7 @@ ====== 配置管理器 ====== -使用本頁中的內容來控制您的 Dokuwiki 設置。 每個單獨設置的相關信息請參閱 [[doku>config]]。 配置管理器的更多信息請參閱 [[doku>plugin:config]]。 +使用本頁控制您的 Dokuwiki 設定。每個獨立設定的相關訊息可參閱 [[doku>config]]。配置管理器的更多訊息請參閱 [[doku>plugin:config]]。 -淡紅色背景的項目被保護，不能通過這個管理器更改。 藍色背景的項目是系統的默認值，白色背景的項目是您作出更改的項目。藍色和白色的設置項目都可以更改。 +淡紅色背景的項目是被保護的，不能通過這個管理器更改。藍色背景的項目是系統的預設值，白色背景的項目是您更改過的。藍色和白色的設定項目都可以更改。 -離開本頁之前不要忘記點擊最后的 **保存** 按鈕，否則您做的修改不會生效。 +離開本頁之前不要忘記點擊最下面的 **儲存** 按鈕，否則您的修改將不會生效。 diff --git a/lib/plugins/config/lang/zh-tw/lang.php b/lib/plugins/config/lang/zh-tw/lang.php index c363fb709..29aeaec3b 100644 --- a/lib/plugins/config/lang/zh-tw/lang.php +++ b/lib/plugins/config/lang/zh-tw/lang.php @@ -7,150 +7,155 @@ * @author Wayne San <waynesan@zerozone.tw> * @author Li-Jiun Huang <ljhuang.tw@gmai.com> * @author Cheng-Wei Chien <e.cwchien@gmail.com> + * @author Danny Lin + * @author Shuo-Ting Jian <shoting@gmail.com> */ $lang['menu'] = '系統配置設定'; -$lang['error'] = '設定因為不合法的值而失敗，請檢查您的改變並重新送出。 -<br />不正確的值會被紅色方框圍住。'; +$lang['error'] = '設定因為不合法的值而未更新，請檢查您的更改並重新送出。 +<br />不正確的值會被紅色方框包住。'; $lang['updated'] = '成功地更新設定。'; -$lang['nochoice'] = '(無其他選項可選)'; -$lang['locked'] = '設定檔無法被更新, 如果這不是故意的, <br /> -請確定設定檔名以及權限是正確的.'; -$lang['danger'] = '危險：改變此選項可能使得您的 wiki 以及其設定選單無法存取。'; -$lang['warning'] = '警告：改變此選項可能導致未預期的行為。'; -$lang['security'] = '安全性警告：改變此選項可能造成安全上的危險。'; -$lang['_configuration_manager'] = '設定管理'; +$lang['nochoice'] = '(無其他可用選項)'; +$lang['locked'] = '設定檔無法更新，若非故意，請確認本地檔名及權限正確。'; +$lang['danger'] = '危險：改變此選項可能使您無法存取維基及配置選單。'; +$lang['warning'] = '警告：改變此選項可能導致不可預期的行為。'; +$lang['security'] = '安全性警告：改變此選項可能造成安全風險。'; +$lang['_configuration_manager'] = '配置管理'; $lang['_header_dokuwiki'] = 'DokuWiki 設定'; -$lang['_header_plugin'] = '外掛設定'; +$lang['_header_plugin'] = '插件設定'; $lang['_header_template'] = '樣板設定'; -$lang['_header_undefined'] = '不明確的設定'; +$lang['_header_undefined'] = '未定義設定'; $lang['_basic'] = '基本設定'; $lang['_display'] = '顯示設定'; $lang['_authentication'] = '認證設定'; -$lang['_anti_spam'] = 'Anti-Spam 設定'; +$lang['_anti_spam'] = '反垃圾設定'; $lang['_editing'] = '編輯設定'; $lang['_links'] = '連結設定'; $lang['_media'] = '媒體設定'; $lang['_advanced'] = '進階設定'; $lang['_network'] = '網路設定'; -$lang['_plugin_sufix'] = '外掛設定'; +$lang['_plugin_sufix'] = '插件設定'; $lang['_template_sufix'] = '樣板設定'; -$lang['_msg_setting_undefined'] = '设置的元数据不存在。'; -$lang['_msg_setting_no_class'] = '設置的分類不存在。'; +$lang['_msg_setting_undefined'] = '設定的後設數據不存在。'; +$lang['_msg_setting_no_class'] = '設定的分類不存在。'; $lang['_msg_setting_no_default'] = '無預設值'; $lang['fmode'] = '檔案建立模式'; $lang['dmode'] = '目錄建立模式'; $lang['lang'] = '語系'; $lang['basedir'] = '根目錄'; -$lang['baseurl'] = '根路徑（URL）'; +$lang['baseurl'] = '根路徑 (URL)'; $lang['savedir'] = '儲存資料的目錄'; $lang['start'] = '開始頁面的名稱'; -$lang['title'] = 'Wiki 標題'; +$lang['title'] = '維基標題'; $lang['template'] = '樣板'; $lang['license'] = '您希望您的內容為何種授權方式？'; $lang['fullpath'] = '顯示完整的路徑於頁面底部'; $lang['recent'] = '最近更新'; -$lang['breadcrumbs'] = '显示“足迹”的数量'; -$lang['youarehere'] = '顯示“您在這裡”'; -$lang['typography'] = '進行字符替換'; -$lang['htmlok'] = '允許嵌入式HTML'; -$lang['phpok'] = '允許嵌入式PHP'; -$lang['dformat'] = '日期格式(請見 PHP\'s <a href="http://www.php.net/strftime">strftime</a> function)'; +$lang['breadcrumbs'] = '導覽鏈數量'; +$lang['youarehere'] = '顯示階層式導覽鏈'; +$lang['typography'] = '進行字元替換'; +$lang['htmlok'] = '允許嵌入式 HTML'; +$lang['phpok'] = '允許嵌入式 PHP'; +$lang['dformat'] = '日期格式 (參見 PHP 的 <a href="http://www.php.net/strftime">strftime</a> 函數)'; $lang['signature'] = '簽名'; -$lang['toptoclevel'] = '本頁目錄的最高層級'; -$lang['tocminheads'] = '決定是否建立本頁目錄的最少標題數量'; -$lang['maxtoclevel'] = '本頁目錄顯示的最大層級'; +$lang['toptoclevel'] = '目錄表的最上層級'; +$lang['tocminheads'] = '決定是否建立目錄表的最少標題數量'; +$lang['maxtoclevel'] = '目錄表顯示的最大層級'; $lang['maxseclevel'] = '可編輯段落的最大層級'; -$lang['camelcase'] = '對鏈接使用 CamelCase'; +$lang['camelcase'] = '對連結使用 CamelCase'; $lang['deaccent'] = '清理頁面名稱'; $lang['useheading'] = '使用第一個標題作為頁面名稱'; $lang['refcheck'] = '媒體連結檢查'; $lang['refshow'] = '媒體連結的顯示數量'; -$lang['allowdebug'] = '允許 debug <b> 如果不需要則停用! </b>'; -$lang['usewordblock'] = '基於 wordlist 來限制 spam'; -$lang['indexdelay'] = '建立索引前的延遲時間(秒)'; -$lang['relnofollow'] = '使用 rel="nofollow" 於外部連結'; -$lang['mailguard'] = '暗化E-mail位址'; +$lang['allowdebug'] = '允許除錯 <b>(不需要請停用！)</b>'; +$lang['usewordblock'] = '根據字詞表阻擋垃圾訊息'; +$lang['indexdelay'] = '建立索引前的延遲時間 (秒)'; +$lang['relnofollow'] = '外部連結使用 rel="nofollow"'; +$lang['mailguard'] = '混淆 E-mail 位址'; $lang['iexssprotect'] = '檢查上傳的檔案中是否隱含惡意的 JavaScript 或 HTML 碼'; -$lang['showuseras'] = '在顯示最近修改頁面，將使用者顯示為：'; +$lang['showuseras'] = '將最後編輯頁面的使用者顯示為：'; $lang['useacl'] = '使用存取控制名單'; $lang['autopasswd'] = '自動產生密碼'; -$lang['authtype'] = '认证后台管理方式'; +$lang['authtype'] = '認證後台管理方式'; $lang['passcrypt'] = '密碼加密方式'; $lang['defaultgroup'] = '預設群組'; -$lang['superuser'] = '超級用戶 - 不論 ACL 如何設置，都能訪問所有頁面與功能的用戶組/用戶'; -$lang['manager'] = '管理员 - 能访问相应管理功能的用户组/用户'; +$lang['superuser'] = '超級用戶 - 不論 ACL 如何設定，都能訪問所有頁面與功能的用戶組/用戶'; +$lang['manager'] = '管理員 - 能訪問相應管理功能的用戶组/用戶'; $lang['profileconfirm'] = '修改個人資料時需要確認密碼'; -$lang['disableactions'] = '停用DokuWiki功能'; +$lang['disableactions'] = '停用的 DokuWiki 動作'; $lang['disableactions_check'] = '檢查'; $lang['disableactions_subscription'] = '訂閱/取消訂閱'; -$lang['disableactions_wikicode'] = '查看源文件/導出源文件'; -$lang['disableactions_other'] = '其他功能(以逗號分隔)'; -$lang['sneaky_index'] = '默認情況下，DokuWiki 在索引頁會顯示所有 namespace。啟用該選項能隱藏那些用戶沒有權限閱讀的頁面。但也可能將用戶能夠閱讀的子頁面一並隱藏。這有可能導致在特定 ACL 設置下，索引功能不可用。'; -$lang['auth_security_timeout'] = '認證確定的 Timeout (秒)'; -$lang['securecookie'] = '「cookies set via HTTPS」是否只能由瀏覽器經 HTTPS 傳送？當你登入 wiki 是被 SSL 所保護但瀏覽 wiki 是沒有被保護時，取消此選項。'; +$lang['disableactions_wikicode'] = '檢視原始碼/匯出原始檔'; +$lang['disableactions_other'] = '其他功能 (逗號分隔)'; +$lang['sneaky_index'] = '預設情況下，DokuWiki 會在索引頁會顯示所有命名空間。啟用此選項會隱藏用戶沒有閱讀權限的頁面，但也可能將能閱讀的子頁面一併隱藏。在特定 ACL 設定下，這可能導致索引無法使用。'; +$lang['auth_security_timeout'] = '安全認證的計時 (秒)'; +$lang['securecookie'] = 'HTTPS 頁面設定的 cookie 是否只能由瀏覽器經 HTTPS 傳送？取消此選項後，只有登入維基會被 SSL 保護而瀏覽時不會。'; $lang['xmlrpc'] = '啟用/停用 XML-RPC 介面'; -$lang['xmlrpcuser'] = 'XML-RPC 存取權限將局限於在此提供的群組或使用者（逗點分隔）。若要開放權限給所有人請留白。'; -$lang['updatecheck'] = '檢查更新與安全性警告? 使用此功能, DokuWiki 需要聯繫 splitbrain.org.'; -$lang['userewrite'] = '使用更整潔的 URL'; -$lang['useslash'] = '在 URL 中使用斜杠作为命名空间的分隔符'; +$lang['xmlrpcuser'] = 'XML-RPC 存取權限將局限於在此提供的群組或使用者 (逗號分隔)。若要開放權限給所有人請留白。'; +$lang['updatecheck'] = '檢查更新與安全性警告？DokuWiki 需要聯繫 update.dokuwiki.org 才能使用此功能。'; +$lang['userewrite'] = '使用好看的 URL'; +$lang['useslash'] = '在 URL 中使用斜線作為命名空間的分隔字元'; $lang['usedraft'] = '編輯時自動儲存草稿'; $lang['sepchar'] = '頁面名稱中單字的分隔字元'; -$lang['canonical'] = '使用完全標准的 URL'; -$lang['autoplural'] = '在鏈接中檢查多種格式'; +$lang['canonical'] = '使用最典型的 URL'; +$lang['fnencode'] = '非 ASCII 文件名稱的編輯方法。'; +$lang['autoplural'] = '檢查複數形式的連結 (英文)'; $lang['compression'] = 'attic 文件的壓縮方式'; -$lang['cachetime'] = 'cache的最大時間(秒)'; -$lang['locktime'] = '鎖定檔案的最大時間(秒)'; -$lang['fetchsize'] = 'fetch.php可以從外部下載的最大檔案尺寸(bytes)'; -$lang['notify'] = '寄送變更通知信到這個E-mail位址'; -$lang['registernotify'] = '寄送新使用者註冊資訊到這個E-mail位址'; +$lang['cachetime'] = '緩存的最大存在時間 (秒)'; +$lang['locktime'] = '檔案的最大鎖定時間 (秒)'; +$lang['fetchsize'] = 'fetch.php 可以從外部下載的最大檔案尺寸 (bytes)'; +$lang['notify'] = '寄送變更通知信到這個 E-mail 位址'; +$lang['registernotify'] = '寄送新使用者註冊資訊到這個 E-mail 位址'; $lang['mailfrom'] = '自動發送郵件時使用的郵件地址'; +$lang['mailprefix'] = '自動發送郵件時使用的標題前綴'; $lang['gzip_output'] = '對 xhtml 使用 gzip 內容編碼'; $lang['gdlib'] = 'GD Lib 版本'; -$lang['im_convert'] = 'ImageMagick的轉換工具路徑'; +$lang['im_convert'] = 'ImageMagick 的轉換工具路徑'; $lang['jpg_quality'] = 'JPG 壓縮品質(0-100)'; $lang['subscribers'] = '啟用頁面訂閱'; -$lang['compress'] = '緊密CSS與JavaScript的輸出'; -$lang['hidepages'] = '隱藏匹配的界面（正則表達式）'; -$lang['send404'] = '存取不存在的頁面時送出"HTTP 404/Page Not Found"'; -$lang['sitemap'] = '產生 Google sitemap (天)'; +$lang['subscribe_time'] = '訂閱列表和摘要發送的時間間隔 (秒)；這個值應該小於指定的最近更改保留時間 (recent_days)。'; +$lang['compress'] = '壓縮 CSS 與 JavaScript 的輸出'; +$lang['hidepages'] = '隱藏匹配的界面 (正規式)'; +$lang['send404'] = '存取不存在的頁面時送出 "HTTP 404/Page Not Found"'; +$lang['sitemap'] = '產生 Google 站台地圖 (天)'; $lang['broken_iua'] = 'ignore_user_abort 功能失效了？這有可能導致搜索索引不可用。IIS+PHP/CGI 已損壞。請參閱 <a href=\"http://bugs.splitbrain.org/?do=details&task_id=852\">Bug 852</a> 獲取更多信息。'; $lang['xsendfile'] = '使用 X-Sendfile 頭讓服務器發送狀態文件？您的服務器需要支持該功能。'; -$lang['renderer_xhtml'] = '主维基页面 (xhtml) 输出使用的渲染'; +$lang['renderer_xhtml'] = '主要維基輸出 (xhtml) 的的渲染器'; $lang['renderer__core'] = '%s (dokuwiki 核心)'; -$lang['renderer__plugin'] = '%s (外掛)'; -$lang['rememberme'] = '是否在登入畫面顯示記住我'; +$lang['renderer__plugin'] = '%s (插件)'; +$lang['rememberme'] = '允許自動登入 (記住我)'; $lang['rss_type'] = 'XML feed 類型'; $lang['rss_linkto'] = 'XML feed 連結到'; $lang['rss_content'] = 'XML feed 項目中顯示什麼呢？'; -$lang['rss_update'] = 'XML feed 更新間隔時間(秒)'; -$lang['recent_days'] = '保存多少天內的變更'; -$lang['rss_show_summary'] = '於標題中顯示簡要的XML feed'; +$lang['rss_update'] = 'XML feed 更新間隔時間 (秒)'; +$lang['recent_days'] = '儲存多少天內的變更'; +$lang['rss_show_summary'] = '於標題中顯示簡要的 XML feed'; $lang['target____wiki'] = '內部連結的目標視窗'; -$lang['target____interwiki'] = 'wiki內部連結的目標視窗'; +$lang['target____interwiki'] = '跨維基連結的目標視窗'; $lang['target____extern'] = '外部連結的目標視窗'; $lang['target____media'] = '媒體連結的目標視窗'; -$lang['target____windows'] = '視窗連結的目標視窗'; +$lang['target____windows'] = 'Windows 連結的目標視窗'; $lang['proxy____host'] = 'Proxy 伺服器名稱'; $lang['proxy____port'] = 'Proxy 連接埠'; $lang['proxy____user'] = 'Proxy 使用者名稱'; $lang['proxy____pass'] = 'Proxy 密碼'; $lang['proxy____ssl'] = '使用 SSL 連接到 Proxy'; +$lang['proxy____except'] = '比對 proxy 代理時應跳過的地址的正規式。'; $lang['safemodehack'] = '啟用 Safemode Hack'; -$lang['ftp____host'] = 'Safemode Hack 的 FTP 服務器'; +$lang['ftp____host'] = 'Safemode Hack 的 FTP 伺服器'; $lang['ftp____port'] = 'Safemode Hack 的 FTP 端口'; -$lang['ftp____user'] = 'Safemode Hack 的 FTP 用戶名'; +$lang['ftp____user'] = 'Safemode Hack 的 FTP 帳戶'; $lang['ftp____pass'] = 'Safemode Hack 的 FTP 密碼'; $lang['ftp____root'] = 'Safemode Hack 的 FTP 根路徑'; $lang['license_o_'] = '未選擇'; $lang['typography_o_0'] = '無'; -$lang['typography_o_1'] = '仅限双引号'; -$lang['typography_o_2'] = '所有引號（不一定能正常運行）'; +$lang['typography_o_1'] = '只限雙引號'; +$lang['typography_o_2'] = '包括單引號 (未必能運作)'; $lang['userewrite_o_0'] = '無'; $lang['userewrite_o_1'] = '.htaccess'; $lang['userewrite_o_2'] = 'DokuWiki 內部控制'; $lang['deaccent_o_0'] = '關閉'; $lang['deaccent_o_1'] = '移除重音符號'; -$lang['deaccent_o_2'] = '用羅馬字拼寫'; +$lang['deaccent_o_2'] = '羅馬字母轉寫'; $lang['gdlib_o_0'] = 'GD Lib 無法使用'; $lang['gdlib_o_1'] = '版本 1.x'; $lang['gdlib_o_2'] = '自動偵測'; @@ -159,11 +164,11 @@ $lang['rss_type_o_rss1'] = 'RSS 1.0'; $lang['rss_type_o_rss2'] = 'RSS 2.0'; $lang['rss_type_o_atom'] = 'Atom 0.3'; $lang['rss_type_o_atom1'] = 'Atom 1.0'; -$lang['rss_content_o_abstract'] = '概要'; -$lang['rss_content_o_diff'] = '統一差異'; -$lang['rss_content_o_htmldiff'] = 'HTML格式的差異對照表'; +$lang['rss_content_o_abstract'] = '摘要'; +$lang['rss_content_o_diff'] = '統一的差異'; +$lang['rss_content_o_htmldiff'] = 'HTML 格式的差異對照表'; $lang['rss_content_o_html'] = '完整的 HTML 頁面內容'; -$lang['rss_linkto_o_diff'] = '差別查看'; +$lang['rss_linkto_o_diff'] = '差異檢視'; $lang['rss_linkto_o_page'] = '已修訂的頁面'; $lang['rss_linkto_o_rev'] = '版本清單'; $lang['rss_linkto_o_current'] = '目前頁面'; @@ -171,14 +176,15 @@ $lang['compression_o_0'] = '無'; $lang['compression_o_gz'] = 'gzip'; $lang['compression_o_bz2'] = 'bz2'; $lang['xsendfile_o_0'] = '不使用'; -$lang['xsendfile_o_1'] = '專有 lighttpd 頭（1.5 發布前）'; -$lang['xsendfile_o_2'] = '標准 X-Sendfile 頭'; -$lang['xsendfile_o_3'] = '專有 Nginx X-Accel-Redirect 頭'; +$lang['xsendfile_o_1'] = '專有 lighttpd 標頭 (1.5 發布前)'; +$lang['xsendfile_o_2'] = '標準 X-Sendfile 標頭'; +$lang['xsendfile_o_3'] = '專有 Nginx X-Accel-Redirect 標頭'; $lang['showuseras_o_loginname'] = '登入名稱'; $lang['showuseras_o_username'] = '完整姓名'; -$lang['showuseras_o_email'] = '使用者的 email 位址 (根據郵件監控設定來暗化)'; -$lang['showuseras_o_email_link'] = '使用者的 eamil 位址標示成 mailto: link'; +$lang['showuseras_o_email'] = '使用者的 email 位址 (根據郵件監控設定混淆化)'; +$lang['showuseras_o_email_link'] = '使用者的 email 位址標示成 mailto: link'; $lang['useheading_o_0'] = '永不'; -$lang['useheading_o_navigation'] = '只有導覽'; -$lang['useheading_o_content'] = '只有 Wiki 內容'; +$lang['useheading_o_navigation'] = '僅導覽'; +$lang['useheading_o_content'] = '僅維基內容'; $lang['useheading_o_1'] = '總是'; +$lang['readdircache'] = 'readdir 緩存的最大存在時間 (秒)'; diff --git a/lib/plugins/config/lang/zh/lang.php b/lib/plugins/config/lang/zh/lang.php index 0419968c7..0aeb977e7 100644 --- a/lib/plugins/config/lang/zh/lang.php +++ b/lib/plugins/config/lang/zh/lang.php @@ -11,6 +11,8 @@ * @author ben <ben@livetom.com> * @author lainme <lainme993@gmail.com> * @author caii <zhoucaiqi@gmail.com> + * @author Hiphen Lee <jacob.b.leung@gmail.com> + * @author caii, patent agent in China <zhoucaiqi@gmail.com> */ $lang['menu'] = '配置设置'; $lang['error'] = '由于非法参数，设置没有更新。请检查您做的改动并重新提交。 @@ -109,6 +111,7 @@ $lang['fetchsize'] = 'fetch.php 能从外部下载的最大文件大 $lang['notify'] = '发送更改通知给这个邮件地址'; $lang['registernotify'] = '发送新注册用户的信息给这个邮件地址'; $lang['mailfrom'] = '自动发送邮件时使用的邮件地址'; +$lang['mailprefix'] = '自动发送邮件时使用的邮件地址前缀'; $lang['gzip_output'] = '对 xhtml 使用 gzip 内容编码'; $lang['gdlib'] = 'GD 库版本'; $lang['im_convert'] = 'ImageMagick 转换工具的路径'; diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php index b38f79906..54fe2ad9c 100644 --- a/lib/plugins/config/settings/config.class.php +++ b/lib/plugins/config/settings/config.class.php @@ -100,8 +100,8 @@ if (!class_exists('configuration')) { if ($this->locked) return false; -# $file = eval('return '.$this->_local_file.';'); - $file = $this->_local_files[0]; + // write back to the last file in the local config cascade + $file = end($this->_local_files); // backup current file (remove any existing backup) if (@file_exists($file) && $backup) { diff --git a/lib/plugins/config/settings/config.metadata.php b/lib/plugins/config/settings/config.metadata.php index c64fded81..5f2c32ea7 100644 --- a/lib/plugins/config/settings/config.metadata.php +++ b/lib/plugins/config/settings/config.metadata.php @@ -123,7 +123,7 @@ $meta['_authentication'] = array('fieldset'); $meta['useacl'] = array('onoff'); $meta['autopasswd'] = array('onoff'); $meta['authtype'] = array('authtype'); -$meta['passcrypt'] = array('multichoice','_choices' => array('smd5','md5','apr1','sha1','ssha','crypt','mysql','my411','kmd5')); +$meta['passcrypt'] = array('multichoice','_choices' => array('smd5','md5','apr1','sha1','ssha','crypt','mysql','my411','kmd5','pmd5','hmd5')); $meta['defaultgroup']= array('string'); $meta['superuser'] = array('string'); $meta['manager'] = array('string'); @@ -178,7 +178,9 @@ $meta['canonical'] = array('onoff'); $meta['fnencode'] = array('multichoice','_choices' => array('url','safe','utf-8')); $meta['autoplural'] = array('onoff'); $meta['mailfrom'] = array('richemail'); +$meta['mailprefix'] = array('string'); $meta['compress'] = array('onoff'); +$meta['cssdatauri'] = array('numeric','_pattern' => '/^\d+$/'); $meta['gzip_output'] = array('onoff'); $meta['hidepages'] = array('string'); $meta['send404'] = array('onoff'); diff --git a/lib/plugins/config/settings/extra.class.php b/lib/plugins/config/settings/extra.class.php index f6b69ead1..b4e35b1cc 100644 --- a/lib/plugins/config/settings/extra.class.php +++ b/lib/plugins/config/settings/extra.class.php @@ -90,7 +90,6 @@ if (!class_exists('setting_disableactions')) { // transfer some DokuWiki language strings to the plugin if (!$plugin->localised) $this->setupLocale(); $plugin->lang[$this->_key.'_revisions'] = $lang['btn_revs']; - $plugin->lang[$this->_key.'_register'] = $lang['register']; foreach ($this->_choices as $choice) if (isset($lang['btn_'.$choice])) $plugin->lang[$this->_key.'_'.$choice] = $lang['btn_'.$choice]; diff --git a/lib/plugins/info/lang/sl/lang.php b/lib/plugins/info/lang/sl/lang.php new file mode 100644 index 000000000..62936947c --- /dev/null +++ b/lib/plugins/info/lang/sl/lang.php @@ -0,0 +1,12 @@ +<?php +/** + * English language file + * + * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) + * @author Guillaume Turri <guillaume.turri@gmail.com> + */ + +$lang['encoding'] = 'utf-8'; +$lang['direction'] = 'ltr'; +$lang['onHidden'] = 'Click to display ⇲'; +$lang['onVisible'] = 'Click to hide ⇱'; diff --git a/lib/plugins/plugin/admin.php b/lib/plugins/plugin/admin.php index c662b565a..b2108f185 100644 --- a/lib/plugins/plugin/admin.php +++ b/lib/plugins/plugin/admin.php @@ -44,7 +44,7 @@ class admin_plugin_plugin extends DokuWiki_Admin_Plugin { function admin_plugin_plugin() { global $conf; - $this->disabled = (isset($conf['pluginmanager']) && ($conf['pluginmanager'] == 0)); + $this->disabled = plugin_isdisabled('plugin'); } /** diff --git a/lib/plugins/plugin/classes/ap_delete.class.php b/lib/plugins/plugin/classes/ap_delete.class.php index 231147479..581a6295f 100644 --- a/lib/plugins/plugin/classes/ap_delete.class.php +++ b/lib/plugins/plugin/classes/ap_delete.class.php @@ -6,7 +6,7 @@ class ap_delete extends ap_manage { if (!$this->dir_delete(DOKU_PLUGIN.plugin_directory($this->manager->plugin))) { $this->manager->error = sprintf($this->lang['error_delete'],$this->manager->plugin); } else { - msg("Plugin {$this->manager->plugin} successfully deleted."); + msg(sprintf($this->lang['deleted'],$this->plugin)); $this->refresh(); } } diff --git a/lib/plugins/plugin/classes/ap_download.class.php b/lib/plugins/plugin/classes/ap_download.class.php index beba0ab07..6aab4ba3c 100644 --- a/lib/plugins/plugin/classes/ap_download.class.php +++ b/lib/plugins/plugin/classes/ap_download.class.php @@ -1,7 +1,7 @@ <?php class ap_download extends ap_manage { - var $overwrite = false; + var $overwrite = true; /** * Initiate the plugin download @@ -114,7 +114,7 @@ class ap_download extends ap_manage { if ($tmp) $this->dir_delete($tmp); if (!$this->manager->error) { - msg('Plugin package ('.count($this->downloaded).' plugin'.(count($this->downloaded) != 1?'s':'').': '.join(',',$this->downloaded).') successfully installed.',1); + msg(sprintf($this->lang['packageinstalled'], count($this->downloaded), join(',',$this->downloaded)),1); $this->refresh(); return true; } diff --git a/lib/plugins/plugin/classes/ap_manage.class.php b/lib/plugins/plugin/classes/ap_manage.class.php index 2982a3ebb..fb148f263 100644 --- a/lib/plugins/plugin/classes/ap_manage.class.php +++ b/lib/plugins/plugin/classes/ap_manage.class.php @@ -176,7 +176,7 @@ class ap_manage { function dir_delete($path) { if (!is_string($path) || $path == "") return false; - if (is_dir($path)) { + if (is_dir($path) && !is_link($path)) { if (!$dh = @opendir($path)) return false; while ($f = readdir($dh)) { diff --git a/lib/plugins/plugin/lang/ar/admin_plugin.txt b/lib/plugins/plugin/lang/ar/admin_plugin.txt index 1aeaf13ad..2ef9fd595 100644 --- a/lib/plugins/plugin/lang/ar/admin_plugin.txt +++ b/lib/plugins/plugin/lang/ar/admin_plugin.txt @@ -1,4 +1,4 @@ ====== إدارة الإضافات ====== -على هذه الصفحة يمكنك إدارة كل ما يتعلق ب[[doku>plugins|إضافات]] دوكي ويكي. لتتمكن من تنزيل و تثبيت الإضافات يجب أن يكون دليل الاضافات قابلا للكتابة من خادوم الوب. +على هذه الصفحة يمكنك إدارة كل ما يتعلق ب[[doku>plugins|إضافات]] دوكو ويكي. لتتمكن من تنزيل و تثبيت الإضافات يجب أن يكون دليل الاضافات قابلا للكتابة من خادوم الوب. diff --git a/lib/plugins/plugin/lang/ar/lang.php b/lib/plugins/plugin/lang/ar/lang.php index 55987881c..fbc6d3c36 100644 --- a/lib/plugins/plugin/lang/ar/lang.php +++ b/lib/plugins/plugin/lang/ar/lang.php @@ -4,6 +4,7 @@ * * @author Yaman Hokan <always.smile.yh@hotmail.com> * @author Usama Akkad <uahello@gmail.com> + * @author uahello@gmail.com */ $lang['menu'] = 'إدارة الملحقات'; $lang['download'] = 'نزّل و ثبت اضافة جديدة'; diff --git a/lib/plugins/plugin/lang/bg/admin_plugin.txt b/lib/plugins/plugin/lang/bg/admin_plugin.txt index e74e88d00..bad73e136 100644 --- a/lib/plugins/plugin/lang/bg/admin_plugin.txt +++ b/lib/plugins/plugin/lang/bg/admin_plugin.txt @@ -1,3 +1,3 @@ ====== Управление на приставките ====== -На тази страница можете на управлявате всичко свързано с [[doku>plugins|приставките]] на Dokuwiki. За да можете да свалите и инсталирате приставка, вашата plugin директория трябва да е позволена за писане от сървъра. +От тази страница можете на управлявате [[doku>plugins|приставките]] на Dokuwiki. За да свалите и инсталирате приставка, е необходимо писането в директорията .../lib/plugins/ да е позволено на сървъра. diff --git a/lib/plugins/plugin/lang/bg/lang.php b/lib/plugins/plugin/lang/bg/lang.php index 99e7a2fe4..79f6e081f 100644 --- a/lib/plugins/plugin/lang/bg/lang.php +++ b/lib/plugins/plugin/lang/bg/lang.php @@ -5,6 +5,7 @@ * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) * @author Nikolay Vladimirov <nikolay@vladimiroff.com> * @author Viktor Usunov <usun0v@mail.bg> + * @author Kiril <neohidra@gmail.com> */ $lang['menu'] = 'Управление на приставките'; $lang['download'] = 'Сваляне и инсталиране на нова приставка'; @@ -16,37 +17,38 @@ $lang['btn_settings'] = 'настройки'; $lang['btn_download'] = 'Сваляне'; $lang['btn_enable'] = 'Запис'; $lang['url'] = 'URL'; -$lang['installed'] = 'Инсталирани:'; -$lang['lastupdate'] = 'Последно обновени:'; +$lang['installed'] = 'Инсталирана:'; +$lang['lastupdate'] = 'Актуализирана:'; $lang['source'] = 'Източник:'; $lang['unknown'] = 'непознат'; -$lang['updating'] = 'Качване ...'; -$lang['updated'] = 'Качването на приставката %s бе упешно.'; -$lang['updates'] = 'Обновяването на следните приставки бе успешно'; -$lang['update_none'] = 'Не бяха намерени нови версии.'; +$lang['updating'] = 'Актуализиране ...'; +$lang['updated'] = 'Приставката %s е качена успешно'; +$lang['updates'] = 'Следните приставки са актуализирани успешно'; +$lang['update_none'] = 'Не са намерени нови версии.'; $lang['deleting'] = 'Изтриване ...'; -$lang['deleted'] = 'Изтриването на приставката %s бе успешно.'; +$lang['deleted'] = 'Приставката %s е изтрита успешно.'; $lang['downloading'] = 'Сваляне ...'; -$lang['downloaded'] = 'Инсталирането на приставката %s бе успешно '; -$lang['downloads'] = 'Инсталирането на следните приставки бе успешно:'; -$lang['download_none'] = 'Не бяха намерени приставки или е имало грешка при свалянето и инсталирането.'; -$lang['plugin'] = 'Приставки:'; +$lang['downloaded'] = 'Приставката %s е инсталирана успешно '; +$lang['downloads'] = 'Следните приставки са инсталирани успешно:'; +$lang['download_none'] = 'Не са намерени приставки или е възникнала непозната грешка при свалянето и инсталирането.'; +$lang['plugin'] = 'Приставка:'; $lang['components'] = 'Компоненти'; -$lang['noinfo'] = 'Тази приставка не върна информация, може да е повредена.'; +$lang['noinfo'] = 'Приставка не върна информация, може да е повредена.'; $lang['name'] = 'Име:'; $lang['date'] = 'Дата:'; $lang['type'] = 'Тип:'; $lang['desc'] = 'Описание:'; $lang['author'] = 'Автор:'; -$lang['www'] = 'Сайт:'; -$lang['error'] = 'Имаше непозната грешка.'; -$lang['error_download'] = 'Свалянето на приставката %s бе невъзможно.'; -$lang['error_badurl'] = 'Предполагаем грешен адрес - не може да се определи име на файла от адреса(url)'; -$lang['error_dircreate'] = 'Създаването на временна директория за сваляне е невъзможно.'; -$lang['error_decompress'] = 'Разархивирането на сваленият файл е невъзможно.Това може да е резултат от грешно сваляне, в такъв случай трябва да опитате отново; или формата на компресия е непозната - в този случай трябва да свалите и инсталирате приставката ръчно.'; -$lang['error_copy'] = 'Имаше грешка при копирането на файл по време на инсталацията на приставката <em>%s</em>: дискът е пълен или правата за достъп до файловете са грешни. Това може да е довело до частично инсталирана приставка и оставяне на нестабилна инсталация на уикито ви.'; -$lang['error_delete'] = 'Имаше грешка при изтриването на приставката <em>%s</em>. Най-вероятната причина е недостатъчна права за достъп до файл или директория'; -$lang['enabled'] = 'Приставката %s бе включена.'; -$lang['notenabled'] = 'Приставката %s не бе включена, моля проверете файловите разрешения.'; -$lang['disabled'] = 'Приставката %s бе изключена.'; -$lang['notdisabled'] = 'Приставката %s не бе изключена, моля проверете файловите разрешения.'; +$lang['www'] = 'Уебстраница:'; +$lang['error'] = 'Възникна непозната грешка.'; +$lang['error_download'] = 'Свалянето на приставката %s е невъзможно.'; +$lang['error_badurl'] = 'Предполагаем грешен адрес - не може да се определи име на файла от URL адреса'; +$lang['error_dircreate'] = 'Създаването на временна директория за сваляне не е възможно.'; +$lang['error_decompress'] = 'Разархивирането на сваленият файл е невъзможно. Вероятно е резултат от грешка при свалянето, в този случай трябва да опитате отново; или формата на компресия е непознат - тогава трябва да свалите и инсталирате приставката ръчно.'; +$lang['error_copy'] = 'Възникна грешка при копиране на файл по време на инсталиране на приставката <em>%s</em>: вероятно дискът е пълен или правата за достъп до файловете са грешни. Може да доведе до частично инсталирана приставка и да причини нестабилно функциониране на wiki-то ви.'; +$lang['error_delete'] = 'Възникна грешка при изтриването на приставката <em>%s</em>. Най-вероятната причина е в правата за достъп до файл или директория'; +$lang['enabled'] = 'Приставката %s е включена.'; +$lang['notenabled'] = 'Приставката %s не може да бъде включена, моля проверете правата за файловете.'; +$lang['disabled'] = 'Приставката %s е изключена.'; +$lang['notdisabled'] = 'Приставката %s не е изключена, моля проверете правата за файловете.'; +$lang['packageinstalled'] = 'Пакетът е инсталиран успешно (%d приставка%s: %s).'; diff --git a/lib/plugins/plugin/lang/cs/lang.php b/lib/plugins/plugin/lang/cs/lang.php index 54de0ff18..7c0fb3468 100644 --- a/lib/plugins/plugin/lang/cs/lang.php +++ b/lib/plugins/plugin/lang/cs/lang.php @@ -9,6 +9,7 @@ * @author tomas@valenta.cz * @author Marek Sacha <sachamar@fel.cvut.cz> * @author Lefty <lefty@multihost.cz> + * @author Vojta Beran <xmamut@email.cz> */ $lang['menu'] = 'Správa pluginů'; $lang['download'] = 'Stáhnout a instalovat plugin'; @@ -55,3 +56,4 @@ $lang['enabled'] = 'Plugin %s aktivován.'; $lang['notenabled'] = 'Plugin %s nelze aktivovat, zkontrolujte práva k souborům.'; $lang['disabled'] = 'Plugin %s deaktivován.'; $lang['notdisabled'] = 'Plugin %s nelze deaktivovat, zkontrolujte práva k souborům.'; +$lang['packageinstalled'] = 'Plugin package (%d plugin%s: %s) úspěšně nainstalován.'; diff --git a/lib/plugins/plugin/lang/de-informal/lang.php b/lib/plugins/plugin/lang/de-informal/lang.php index 65050b896..0bd142e23 100644 --- a/lib/plugins/plugin/lang/de-informal/lang.php +++ b/lib/plugins/plugin/lang/de-informal/lang.php @@ -6,6 +6,7 @@ * @author Juergen Schwarzer <jschwarzer@freenet.de> * @author Marcel Metz <marcel_metz@gmx.de> * @author Matthias Schulte <post@lupo49.de> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Plugins verwalten'; $lang['download'] = 'Herunterladen und installieren einer neuen Erweiterung'; @@ -51,3 +52,4 @@ $lang['enabled'] = 'Erweiterung %s aktiviert.'; $lang['notenabled'] = 'Erweiterung %s konnte nicht aktiviert werden. Überprüfen sie die Zugriffsberechtigung der Datei.'; $lang['disabled'] = 'Erweiterung %s deaktiviert.'; $lang['notdisabled'] = 'Erweiterung %s konnte nicht deaktiviert werden - überprüfe Dateiberechtigungen'; +$lang['packageinstalled'] = 'Plugin-Paket (%d Plugin%s: %s) erfolgreich installiert.'; diff --git a/lib/plugins/plugin/lang/de/lang.php b/lib/plugins/plugin/lang/de/lang.php index e981f4a60..6c1bd033c 100644 --- a/lib/plugins/plugin/lang/de/lang.php +++ b/lib/plugins/plugin/lang/de/lang.php @@ -14,6 +14,8 @@ * @author Blitzi94@gmx.de * @author Robert Bogenschneider <robog@GMX.de> * @author Robert Bogenschneider <robog@gmx.de> + * @author Niels Lange <niels@boldencursief.nl> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Plugins verwalten'; $lang['download'] = 'Neues Plugin herunterladen und installieren'; @@ -59,3 +61,4 @@ $lang['enabled'] = 'Plugin %s wurde aktiviert.'; $lang['notenabled'] = 'Plugin %s konnte nicht aktiviert werden, überprüfen Sie die Dateirechte.'; $lang['disabled'] = 'Plugin %s wurde deaktiviert.'; $lang['notdisabled'] = 'Plugin %s konnte nicht deaktiviert werden, überprüfen Sie die Dateirechte.'; +$lang['packageinstalled'] = 'Plugin-Paket (%d Plugin%s: %s) erfolgreich installiert.'; diff --git a/lib/plugins/plugin/lang/en/lang.php b/lib/plugins/plugin/lang/en/lang.php index ccbd207e9..87570a708 100644 --- a/lib/plugins/plugin/lang/en/lang.php +++ b/lib/plugins/plugin/lang/en/lang.php @@ -73,5 +73,6 @@ $lang['enabled'] = 'Plugin %s enabled.'; $lang['notenabled'] = 'Plugin %s could not be enabled, check file permissions.'; $lang['disabled'] = 'Plugin %s disabled.'; $lang['notdisabled'] = 'Plugin %s could not be disabled, check file permissions.'; +$lang['packageinstalled'] = 'Plugin package (%d plugin(s): %s) successfully installed.'; //Setup VIM: ex: et ts=4 : diff --git a/lib/plugins/plugin/lang/es/lang.php b/lib/plugins/plugin/lang/es/lang.php index d26218b2d..207c48d2c 100644 --- a/lib/plugins/plugin/lang/es/lang.php +++ b/lib/plugins/plugin/lang/es/lang.php @@ -19,6 +19,7 @@ * @author Fernando J. Gómez <fjgomez@gmail.com> * @author Victor Castelan <victorcastelan@gmail.com> * @author Mauro Javier Giamberardino <mgiamberardino@gmail.com> + * @author emezeta <emezeta@infoprimo.com> */ $lang['menu'] = 'Administración de Plugins'; $lang['download'] = 'Descargar e instalar un nuevo plugin'; @@ -64,3 +65,4 @@ $lang['enabled'] = 'Plugin %s habilitado.'; $lang['notenabled'] = 'Plugin %s no puede ser habilitado, verifica los permisos del archivo.'; $lang['disabled'] = 'Plugin %s desabilitado.'; $lang['notdisabled'] = 'Plugin %s no puede ser desabilitado, verifica los permisos de archivo.'; +$lang['packageinstalled'] = 'Plugin (%d plugin%s: %s) instalado exitosamente.'; diff --git a/lib/plugins/plugin/lang/et/lang.php b/lib/plugins/plugin/lang/et/lang.php new file mode 100644 index 000000000..088acf39b --- /dev/null +++ b/lib/plugins/plugin/lang/et/lang.php @@ -0,0 +1,32 @@ +<?php +/** + * Estonian language file + * + * @author kristian.kankainen@kuu.la + * @author Rivo Zängov <eraser@eraser.ee> + */ +$lang['manage'] = 'Paigaldatud pluginad'; +$lang['btn_info'] = 'info'; +$lang['btn_update'] = 'uuenda'; +$lang['btn_delete'] = 'kustuta'; +$lang['btn_settings'] = 'seaded'; +$lang['btn_download'] = 'Lae alla'; +$lang['btn_enable'] = 'Salvesta'; +$lang['url'] = 'URL'; +$lang['installed'] = 'Paigaldatud:'; +$lang['lastupdate'] = 'Viimati uuendatud:'; +$lang['source'] = 'Allikas:'; +$lang['unknown'] = 'tundmatu'; +$lang['updating'] = 'Uuendamine ...'; +$lang['update_none'] = 'Uuendusi ei leitud.'; +$lang['deleting'] = 'Kustutamine ...'; +$lang['deleted'] = 'Plugin %s on kustutatud.'; +$lang['downloading'] = 'Allalaadimine ...'; +$lang['plugin'] = 'Plugin:'; +$lang['components'] = 'Komponendid'; +$lang['name'] = 'Nimi:'; +$lang['date'] = 'Kuupäev'; +$lang['type'] = 'Tüüp:'; +$lang['desc'] = 'Kirjeldus:'; +$lang['author'] = 'Autor:'; +$lang['www'] = 'Veeb:'; diff --git a/lib/plugins/plugin/lang/eu/lang.php b/lib/plugins/plugin/lang/eu/lang.php index 370aa9739..ebcda7e16 100644 --- a/lib/plugins/plugin/lang/eu/lang.php +++ b/lib/plugins/plugin/lang/eu/lang.php @@ -48,3 +48,4 @@ $lang['enabled'] = '%s Plugin-a gaitua.'; $lang['notenabled'] = '%s Plugin-a ezin izan da gaitu, egiaztatu fitxategi baimenak.'; $lang['disabled'] = '%s Plugin-a ezgaitua.'; $lang['notdisabled'] = '%s Plugin-a ezin izan da ezgaitu, egiaztatu fitxategi baimenak. '; +$lang['packageinstalled'] = 'Plugin paketea (%d plugin%s: %s) arrakastaz instalatua izan da.'; diff --git a/lib/plugins/plugin/lang/fa/lang.php b/lib/plugins/plugin/lang/fa/lang.php index f1a228931..19a839660 100644 --- a/lib/plugins/plugin/lang/fa/lang.php +++ b/lib/plugins/plugin/lang/fa/lang.php @@ -52,3 +52,4 @@ $lang['enabled'] = 'افزونهی %s فعال شد.'; $lang['notenabled'] = 'افزونهی %s قابلیت فعال کردن ندارد، دسترسیها را چک کنید.'; $lang['disabled'] = 'افزونهی %s غیرفعال شد.'; $lang['notdisabled'] = 'افزونهی %s قابلیت غیرفعال کردن ندارد، دسترسیها را چک کنید.'; +$lang['packageinstalled'] = 'بسته افزونه (%d افزونه%s: %s) به درستی نصب شد.'; diff --git a/lib/plugins/plugin/lang/fi/lang.php b/lib/plugins/plugin/lang/fi/lang.php index 817b4f20a..c348a2331 100644 --- a/lib/plugins/plugin/lang/fi/lang.php +++ b/lib/plugins/plugin/lang/fi/lang.php @@ -5,6 +5,7 @@ * @author otto@valjakko.net * @author Otto Vainio <otto@valjakko.net> * @author Teemu Mattila <ghcsystems@gmail.com> + * @author Sami Olmari <sami@olmari.fi> */ $lang['menu'] = 'Ylläpidä liitännäisiä'; $lang['download'] = 'Lataa ja asenna uusi liitännäinen'; @@ -50,3 +51,4 @@ $lang['enabled'] = 'Liitännäinen %s käytössä'; $lang['notenabled'] = 'Liitännäistä %s ei voitu ottaa käyttöön. Tarkista tiedostojen oikeudet.'; $lang['disabled'] = 'Liitännäinen %s pois käytössä'; $lang['notdisabled'] = 'Liitännäistä %s ei voitu ottaa pois käytöstä. Tarkista tiedostojen oikeudet.'; +$lang['packageinstalled'] = 'Pluginpaketti (%d plugin%s: %s:) asennettu onnistuneesti.'; diff --git a/lib/plugins/plugin/lang/fr/lang.php b/lib/plugins/plugin/lang/fr/lang.php index 79080f5f3..0ff26da19 100644 --- a/lib/plugins/plugin/lang/fr/lang.php +++ b/lib/plugins/plugin/lang/fr/lang.php @@ -15,6 +15,8 @@ * @author Philippe Bajoit <philippe.bajoit@gmail.com> * @author Florian Gaub <floriang@floriang.net> * @author Samuel Dorsaz samuel.dorsaz@novelion.net + * @author Johan Guilbaud <guilbaud.johan@gmail.com> + * @author schplurtz@laposte.net */ $lang['menu'] = 'Gestion des modules externes'; $lang['download'] = 'Télécharger et installer un nouveau module'; @@ -60,3 +62,4 @@ $lang['enabled'] = 'Module %s activé.'; $lang['notenabled'] = 'Le module %s n\'a pas pu être activé, vérifiez le fichier des permissions.'; $lang['disabled'] = 'Module %s désactivé.'; $lang['notdisabled'] = 'Le module %s n\'a pas pu être désactivé, vérifiez le fichier des permissions.'; +$lang['packageinstalled'] = 'Ensemble de modules (%d module(s): %s) installé avec succès.'; diff --git a/lib/plugins/plugin/lang/he/lang.php b/lib/plugins/plugin/lang/he/lang.php index c6e462193..47253e335 100644 --- a/lib/plugins/plugin/lang/he/lang.php +++ b/lib/plugins/plugin/lang/he/lang.php @@ -7,6 +7,7 @@ * @author Dotan Kamber <kamberd@yahoo.com> * @author Moshe Kaplan <mokplan@gmail.com> * @author Yaron Yogev <yaronyogev@gmail.com> + * @author Yaron Shahrabani <sh.yaron@gmail.com> */ $lang['menu'] = 'ניהול הרחבות'; $lang['download'] = 'הורדת והתקנת הרחבה חדשה'; diff --git a/lib/plugins/plugin/lang/hr/lang.php b/lib/plugins/plugin/lang/hr/lang.php index d2094b77b..96f1d6afe 100644 --- a/lib/plugins/plugin/lang/hr/lang.php +++ b/lib/plugins/plugin/lang/hr/lang.php @@ -4,4 +4,5 @@ * * @author Branko Rihtman <theney@gmail.com> * @author Dražen Odobašić <dodobasic@gmail.com> + * @author Dejan Igrec dejan.igrec@gmail.com */ diff --git a/lib/plugins/plugin/lang/hu/lang.php b/lib/plugins/plugin/lang/hu/lang.php index 32242ece9..25c7b6322 100644 --- a/lib/plugins/plugin/lang/hu/lang.php +++ b/lib/plugins/plugin/lang/hu/lang.php @@ -5,8 +5,9 @@ * @author Sandor TIHANYI <stihanyi+dw@gmail.com> * @author Siaynoq Mage <siaynoqmage@gmail.com> * @author schilling.janos@gmail.com - * @author Szabó Dávid (szabo.david@gyumolcstarhely.hu) * @author Szabó Dávid <szabo.david@gyumolcstarhely.hu> + * @author Sándor TIHANYI <stihanyi+dw@gmail.com> + * @author David Szabo <szabo.david@gyumolcstarhely.hu> */ $lang['menu'] = 'Bővítménykezelő'; $lang['download'] = 'Új bővítmény letöltése és telepítése'; @@ -52,3 +53,4 @@ $lang['enabled'] = 'A(z) %s bővítmény bekapcsolva.'; $lang['notenabled'] = 'A(z) %s bővítmény engedélyezése nem sikerült. Ellenőrizze a fájl-hozzáférési engedélyeket.'; $lang['disabled'] = 'A(z) %s bővítmény kikapcsolva.'; $lang['notdisabled'] = 'A(z) %s bővítmény kikapcsolása nem sikerült. Ellenőrizze a fájl-hozzáférési engedélyeket.'; +$lang['packageinstalled'] = 'A bővítmény csomag(ok) feltelepült(ek): %d plugin%s: %s'; diff --git a/lib/plugins/plugin/lang/it/lang.php b/lib/plugins/plugin/lang/it/lang.php index c7ce28a59..e675c5530 100644 --- a/lib/plugins/plugin/lang/it/lang.php +++ b/lib/plugins/plugin/lang/it/lang.php @@ -12,6 +12,7 @@ * @author snarchio@alice.it * @author robocap <robocap1@gmail.com> * @author Osman Tekin osman.tekin93@hotmail.it + * @author Jacopo Corbetta <jacopo.corbetta@gmail.com> */ $lang['menu'] = 'Gestione Plugin'; $lang['download'] = 'Scarica e installa un nuovo plugin'; diff --git a/lib/plugins/plugin/lang/ja/lang.php b/lib/plugins/plugin/lang/ja/lang.php index 0deb420c9..56a827b7e 100644 --- a/lib/plugins/plugin/lang/ja/lang.php +++ b/lib/plugins/plugin/lang/ja/lang.php @@ -53,3 +53,4 @@ $lang['enabled'] = 'プラグイン %s が有効です。'; $lang['notenabled'] = 'プラグイン %s を有効にすることができません。権限を確認してください。'; $lang['disabled'] = 'プラグイン %s が無効です。'; $lang['notdisabled'] = 'プラグイン %s を無効にすることができません。権限を確認してください。'; +$lang['packageinstalled'] = 'プラグインパッケージ（%d plugin%s: %s）は正しくインストールされました。'; diff --git a/lib/plugins/plugin/lang/kk/lang.php b/lib/plugins/plugin/lang/kk/lang.php new file mode 100644 index 000000000..dde5b9577 --- /dev/null +++ b/lib/plugins/plugin/lang/kk/lang.php @@ -0,0 +1,6 @@ +<?php +/** + * kazakh language file + * + * @author Nurgozha Kaliaskarov astana08@gmail.com + */ diff --git a/lib/plugins/plugin/lang/ko/lang.php b/lib/plugins/plugin/lang/ko/lang.php index 72c04ddab..ab305dcd8 100644 --- a/lib/plugins/plugin/lang/ko/lang.php +++ b/lib/plugins/plugin/lang/ko/lang.php @@ -53,3 +53,4 @@ $lang['enabled'] = '%s 플러그인을 켰습니다.'; $lang['notenabled'] = '%s 플러그인을 킬 수 없습니다. 파일 권한을 확인하십시오.'; $lang['disabled'] = '%s 플러그인을 껐습니다.'; $lang['notdisabled'] = '%s 플러그인을 끌 수 없습니다. 파일 권한을 확인하십시오.'; +$lang['packageinstalled'] = '플러그인 패키지(%d 개의 플러그인%s: %s)가 성공적으로 설치되었습니다.'; diff --git a/lib/plugins/plugin/lang/la/admin_plugin.txt b/lib/plugins/plugin/lang/la/admin_plugin.txt index 1a361140c..2a41977fc 100644 --- a/lib/plugins/plugin/lang/la/admin_plugin.txt +++ b/lib/plugins/plugin/lang/la/admin_plugin.txt @@ -1,3 +1,3 @@ ====== Addendorum Administratio ====== -In hac pagina omnia uicis [[doku>plugins|plugins]] mutare et administrare potes. Ut addenda capere et his uti, in scrinio addendorum scribere et legere potest.
\ No newline at end of file +In hac pagina omnia uicis [[doku>plugins|plugins]] mutare et administrare potes. Vt addenda capere et his uti, in scrinio addendorum scribere et legere potest.
\ No newline at end of file diff --git a/lib/plugins/plugin/lang/la/lang.php b/lib/plugins/plugin/lang/la/lang.php index 021dc84d5..cd2d81cbd 100644 --- a/lib/plugins/plugin/lang/la/lang.php +++ b/lib/plugins/plugin/lang/la/lang.php @@ -2,8 +2,9 @@ /** * Latin language file * + * @author Massimiliano Vassalli <vassalli.max@gmail.com> */ -$lang['menu'] = 'Administrationis addenda'; +$lang['menu'] = 'Addendorum administratio'; $lang['download'] = 'Noua addenda cape'; $lang['manage'] = 'Addenta in usu'; $lang['btn_info'] = 'Notae'; diff --git a/lib/plugins/plugin/lang/nl/lang.php b/lib/plugins/plugin/lang/nl/lang.php index cb7fc44fc..66cd7c0a2 100644 --- a/lib/plugins/plugin/lang/nl/lang.php +++ b/lib/plugins/plugin/lang/nl/lang.php @@ -56,3 +56,4 @@ $lang['enabled'] = 'Plugin %s ingeschakeld.'; $lang['notenabled'] = 'Plugin %s kon niet worden ingeschakeld, controleer bestandsrechten.'; $lang['disabled'] = 'Plugin %s uitgeschakeld.'; $lang['notdisabled'] = 'Plugin %s kon niet worden uitgeschakeld, controleer bestandsrechten.'; +$lang['packageinstalled'] = 'Plugin package (%d plugin%s: %s) succesvol geïnstalleerd.'; diff --git a/lib/plugins/plugin/lang/no/lang.php b/lib/plugins/plugin/lang/no/lang.php index 72d9c19ba..a95ea0085 100644 --- a/lib/plugins/plugin/lang/no/lang.php +++ b/lib/plugins/plugin/lang/no/lang.php @@ -12,6 +12,7 @@ * @author Lisa Ditlefsen <lisa@vervesearch.com> * @author Erik Pedersen <erik.pedersen@shaw.ca> * @author Erik Bjørn Pedersen <erik.pedersen@shaw.ca> + * @author Rune Rasmussen syntaxerror.no@gmail.com */ $lang['menu'] = 'Behandle tillegg'; $lang['download'] = 'Last ned og installer et tillegg'; diff --git a/lib/plugins/plugin/lang/pt-br/admin_plugin.txt b/lib/plugins/plugin/lang/pt-br/admin_plugin.txt index 1809bb585..9e49f5136 100644 --- a/lib/plugins/plugin/lang/pt-br/admin_plugin.txt +++ b/lib/plugins/plugin/lang/pt-br/admin_plugin.txt @@ -1,3 +1,3 @@ ====== Gerenciamento de Plug-ins ====== -Nesta página você pode gerenciar tudo relacionado aos [[doku>plug-ins|plug-ins]] do DokuWiki. Para você baixar e instalar um plug-in o servidor web deve ter permissão de escrita na pasta onde ficam os plug-ins. +Nesta página você pode gerenciar tudo relacionado aos [[doku>plugins|plug-ins]] do DokuWiki. Para você baixar e instalar um plug-in o servidor web deve ter permissão de escrita na pasta onde ficam os plug-ins. diff --git a/lib/plugins/plugin/lang/pt-br/lang.php b/lib/plugins/plugin/lang/pt-br/lang.php index 28955004f..bae962730 100644 --- a/lib/plugins/plugin/lang/pt-br/lang.php +++ b/lib/plugins/plugin/lang/pt-br/lang.php @@ -60,3 +60,4 @@ $lang['enabled'] = 'O plug-in %s foi habilitado.'; $lang['notenabled'] = 'Não foi possível habilitar o plug-in %s. Verifique as permissões de acesso.'; $lang['disabled'] = 'O plug-in %s foi desabilitado.'; $lang['notdisabled'] = 'Não foi possível desabilitar o plug-in %s. Verifique as permissões de acesso.'; +$lang['packageinstalled'] = 'O pacote do plugin (%d plugin%s: %s) foi instalado com sucesso.'; diff --git a/lib/plugins/plugin/lang/pt/lang.php b/lib/plugins/plugin/lang/pt/lang.php index 3e9e6ae04..1567741f9 100644 --- a/lib/plugins/plugin/lang/pt/lang.php +++ b/lib/plugins/plugin/lang/pt/lang.php @@ -6,6 +6,7 @@ * @author Enrico Nicoletto <liverig@gmail.com> * @author Fil <fil@meteopt.com> * @author André Neves <drakferion@gmail.com> + * @author José Campos zecarlosdecampos@gmail.com */ $lang['menu'] = 'Gerir Plugins'; $lang['download'] = 'Descarregar e instalar um novo plugin'; @@ -51,3 +52,4 @@ $lang['enabled'] = 'Plugin %s habilitado.'; $lang['notenabled'] = 'Plugin %s não pôde ser habilitado, verifique as permissões.'; $lang['disabled'] = 'Plugin %s desabilitado.'; $lang['notdisabled'] = 'Plugin %s não pôde ser desabilitado, verifique as permissões.'; +$lang['packageinstalled'] = 'Pacote de Plugins (%d plugin%s: %s) instalado com sucesso.'; diff --git a/lib/plugins/plugin/lang/ru/lang.php b/lib/plugins/plugin/lang/ru/lang.php index a33f95418..757b607f5 100644 --- a/lib/plugins/plugin/lang/ru/lang.php +++ b/lib/plugins/plugin/lang/ru/lang.php @@ -14,6 +14,8 @@ * @author Vlad Tsybenko <vlad.development@gmail.com> * @author Aleksey Osadchiy <rfc@nm.ru> * @author Aleksandr Selivanov <alexgearbox@gmail.com> + * @author Ladyko Andrey <fylh@succexy.spb.ru> + * @author Eugene <windy.wanderer@gmail.com> */ $lang['menu'] = 'Управление плагинами'; $lang['download'] = 'Скачать и установить новый плагин'; @@ -30,11 +32,11 @@ $lang['lastupdate'] = 'Последнее обновление:'; $lang['source'] = 'Источник:'; $lang['unknown'] = 'неизвестно'; $lang['updating'] = 'Обновление...'; -$lang['updated'] = 'Плагин %s успешно обновлен'; +$lang['updated'] = 'Плагин %s успешно обновлён'; $lang['updates'] = 'Следующие плагины были успешно обновлены'; $lang['update_none'] = 'Обновления не найдены.'; $lang['deleting'] = 'Удаление...'; -$lang['deleted'] = 'Плагин %s удален.'; +$lang['deleted'] = 'Плагин %s удалён.'; $lang['downloading'] = 'Скачивание...'; $lang['downloaded'] = 'Плагин %s успешно установлен'; $lang['downloads'] = 'Следующие плагины были успешно установлены:'; @@ -50,9 +52,9 @@ $lang['author'] = 'Автор:'; $lang['www'] = 'Странца:'; $lang['error'] = 'Произошла неизвестная ошибка.'; $lang['error_download'] = 'Не могу скачать файл плагина: %s'; -$lang['error_badurl'] = 'Возможно, неправильный адрес — не могу определить имя файла из адреса'; +$lang['error_badurl'] = 'Возможно неправильный адрес — не могу определить имя файла из адреса'; $lang['error_dircreate'] = 'Не могу создать временную директорию для скачивания'; -$lang['error_decompress'] = 'Менеджеру плагинов не удалось распаковать скачанный файл. Это может быть результатом ошибки при скачивании, в этом случае вы можете попробовать снова; или же плагин упакован неизвестным архиватором, тогда вам необходимо скачать и установить плагин вручную.'; +$lang['error_decompress'] = 'Менеджеру плагинов не удалось распаковать скачанный файл. Это может быть результатом ошибки при скачивании, в этом случае вы можете попробовать снова, или же плагин упакован неизвестным архиватором, тогда вам необходимо скачать и установить плагин вручную.'; $lang['error_copy'] = 'Произошла ошибка копирования при попытке установки файлов для плагина <em>%s</em>: переполнение диска или неправильные права доступа. Это могло привести к частичной установке плагина и неустойчивости вашей вики.'; $lang['error_delete'] = 'Произошла ошибка при попытке удалить плагин <em>%s</em>. Наиболее вероятно, что нет необходимых прав доступа к файлам или директориям'; $lang['enabled'] = 'Плагин %s включён.'; diff --git a/lib/plugins/plugin/lang/sk/lang.php b/lib/plugins/plugin/lang/sk/lang.php index a10bc0fe4..7a8f32a53 100644 --- a/lib/plugins/plugin/lang/sk/lang.php +++ b/lib/plugins/plugin/lang/sk/lang.php @@ -51,3 +51,4 @@ $lang['enabled'] = 'Plugin %s aktivovaný.'; $lang['notenabled'] = 'Plugin %s nemôže byť aktivovaný, skontrolujte prístupové práva.'; $lang['disabled'] = 'Plugin %s deaktivovaný.'; $lang['notdisabled'] = 'Plugin %s nemôže byť deaktivovaný, skontrolujte prístupové práva.'; +$lang['packageinstalled'] = 'Plugin package (%d plugin%s: %s) úspešne inštalovaný.'; diff --git a/lib/plugins/plugin/lang/sl/admin_plugin.txt b/lib/plugins/plugin/lang/sl/admin_plugin.txt new file mode 100644 index 000000000..2e99c6297 --- /dev/null +++ b/lib/plugins/plugin/lang/sl/admin_plugin.txt @@ -0,0 +1,3 @@ +====== Upravljanje vstavkov ====== + +Na tej strani je mogoe spreminjati in prilagajati nastavitve Dokuwiki [[doku>plugins|vstavkov]]. Za prejemanje in nameanje vstavkov v ustrezne mape, morajo imeti te doloena ustrezna dovoljenja za pisanje spletnega strenika. diff --git a/lib/plugins/plugin/lang/sl/lang.php b/lib/plugins/plugin/lang/sl/lang.php index 9423e4e75..39ba20139 100644 --- a/lib/plugins/plugin/lang/sl/lang.php +++ b/lib/plugins/plugin/lang/sl/lang.php @@ -4,19 +4,51 @@ * * @author Dejan Levec <webphp@gmail.com> * @author Boštjan Seničar <senicar@gmail.com> + * @author Gregor Skumavc (grega.skumavc@gmail.com) + * @author Matej Urbančič (mateju@svn.gnome.org) */ + +$lang['menu'] = 'Upravljanje vstavkov'; +$lang['download'] = 'Prejmi in namesti nov vstavek'; +$lang['manage'] = 'Nameščeni vstavki'; +$lang['btn_info'] = 'Podrobnosti'; +$lang['btn_update'] = 'Posodobi'; $lang['btn_delete'] = 'Izbriši'; $lang['btn_settings'] = 'Nastavitve'; +$lang['btn_download'] = 'Prejmi'; $lang['btn_enable'] = 'Shrani'; $lang['url'] = 'URL'; $lang['installed'] = 'Nameščeno:'; $lang['lastupdate'] = 'Nazadnje posodobljeno:'; $lang['source'] = 'Vir:'; +$lang['unknown'] = 'neznano'; $lang['updating'] = 'Posodabljanje ...'; +$lang['updated'] = 'Vstavek %s je uspešno posodobljen'; +$lang['updates'] = 'Navedeni vstavki so uspešno posodobljeni'; +$lang['update_none'] = 'Posodobitev ni mogoče najti.'; $lang['deleting'] = 'Brisanje ...'; +$lang['deleted'] = 'Vstavek %s je izbrisan.'; +$lang['downloading'] = 'Prejemanje ...'; +$lang['downloaded'] = 'Vstavek %s je uspešno nameščen'; +$lang['downloads'] = 'Navedeni vstavki so uspešno nameščeni:'; +$lang['download_none'] = 'Vstavkov ni mogoče najti ali pa je prišlo do napake med prejemanjem in nameščanjem.'; +$lang['plugin'] = 'Vstavek:'; +$lang['components'] = 'Sestavni deli'; +$lang['noinfo'] = 'Vstavek nima vpisanih podrobnih podatkov, kar pomeni, da je morda neveljaven.'; $lang['name'] = 'Ime:'; $lang['date'] = 'Datum:'; -$lang['type'] = 'Tip:'; +$lang['type'] = 'Vrsta:'; $lang['desc'] = 'Opis:'; $lang['author'] = 'Avtor:'; $lang['www'] = 'Spletna stran:'; +$lang['error'] = 'Prišlo je do neznane napake.'; +$lang['error_download'] = 'Ni mogoče prejeti datoteke vstavka: %s'; +$lang['error_badurl'] = 'Napaka naslova URL - ni mogoče določiti imena datoteke iz naslova URL'; +$lang['error_dircreate'] = 'Ni mogoče ustvariti začasne mape za prejemanje'; +$lang['error_decompress'] = 'Z upravljalnikom vstavkov ni mogoče razširiti prejetega arhiva vstavka. Najverjetneje je prišlo do napake med prejemanjem datoteke ali pa zapis arhiva ni znan. Poskusite znova ali pa napako odpravite z ročnim nameščanjem vstavka.'; +$lang['error_copy'] = 'Prišlo je do napake med nameščanjem datotek vstavka <em>%s</em>: najverjetneje so težave s prostorom za namestitev ali pa ni ustreznih dovoljenj za nameščanje. Zaradi nepopolne namestitve lahko nastopijo težave v delovanju sistema Wiki.'; +$lang['error_delete'] = 'Prišlo je do napake med brisanjem vstavka <em>%s</em>: najverjetneje ni ustreznih dovoljenj za dostop do datoteke ali mape'; +$lang['enabled'] = 'Vstavek %s je omogočen.'; +$lang['notenabled'] = 'Vstavka %s ni mogoče omogočiti zaradi neustreznih dovoljen.'; +$lang['disabled'] = 'Vstavek %s je onemogočen.'; +$lang['notdisabled'] = 'Vstavka %s ni mogoče onemogočiti zaradi neustreznih dovoljen.'; diff --git a/lib/plugins/plugin/lang/sv/lang.php b/lib/plugins/plugin/lang/sv/lang.php index 0fe03387b..5892e42b5 100644 --- a/lib/plugins/plugin/lang/sv/lang.php +++ b/lib/plugins/plugin/lang/sv/lang.php @@ -15,6 +15,7 @@ * @author Bogge Bogge <bogge@bogge.com> * @author Peter Åström <eaustreum@gmail.com> * @author Håkan Sandell <hakan.sandell@home.se> + * @author mikael@mallander.net */ $lang['menu'] = 'Hantera insticksmoduler'; $lang['download'] = 'Ladda ned och installera en ny insticksmodul'; diff --git a/lib/plugins/plugin/lang/uk/lang.php b/lib/plugins/plugin/lang/uk/lang.php index c5bab816f..69ee9ded1 100644 --- a/lib/plugins/plugin/lang/uk/lang.php +++ b/lib/plugins/plugin/lang/uk/lang.php @@ -9,13 +9,14 @@ * @author Oleksandr Kunytsia <okunia@gmail.com> * @author Uko uko@uar.net * @author Ulrikhe Lukoie <lukoie@gmail>.com + * @author Kate Arzamastseva pshns@ukr.net */ $lang['menu'] = 'Керування доданками'; $lang['download'] = 'Завантажити та встановити новий доданок'; $lang['manage'] = 'Встановлені доданки'; $lang['btn_info'] = 'дані'; $lang['btn_update'] = 'оновити'; -$lang['btn_delete'] = 'вилучити'; +$lang['btn_delete'] = 'видалити'; $lang['btn_settings'] = 'параметри'; $lang['btn_download'] = 'Завантажити'; $lang['btn_enable'] = 'Зберегти'; @@ -49,8 +50,9 @@ $lang['error_badurl'] = 'Можливо, невірна адреса - $lang['error_dircreate'] = 'Не можливо створити тимчасову папку для завантаження'; $lang['error_decompress'] = 'Менеджеру доданків не вдалося розпакувати завантажений файл. Це може бути результатом помилки при завантаженні, в цьому разі ви можете спробувати знову; або ж доданок упакований невідомим архіватором, тоді вам необхідно завантажити та встановити доданок вручну.'; $lang['error_copy'] = 'Виникла помилка копіювання при спробі установки файлів для доданка <em>%s</em>: переповнення диску або невірні права доступу. Це могло привести до часткової установки доданка и нестійкості вашої Вікі.'; -$lang['error_delete'] = 'При спробі вилучення доданка <em>%s</em> виникла помилка. Найбільш вірогідно, що немає необхідних прав доступу до файлів або тек'; +$lang['error_delete'] = 'При спробі вилучення доданка <em>%s</em> виникла помилка. Найбільш вірогідно, що немає необхідних прав доступу до файлів або директорії'; $lang['enabled'] = 'Доданок %s увімкнено.'; $lang['notenabled'] = 'Не вдається увімкнути доданок %s. Перевірте права доступу до файлу.'; $lang['disabled'] = 'Доданок %s вимкнено.'; $lang['notdisabled'] = 'Не вдається вимкнути доданок %s. Перевірте права доступу до файлу.'; +$lang['packageinstalled'] = 'Пакет плагінів (%d plugin%s: %s) успішно встановлений.'; diff --git a/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt b/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt index 41d630199..84d095f51 100644 --- a/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt +++ b/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt @@ -1,3 +1,3 @@ ====== 插件管理器 ====== -本頁中您可以管理與 Dokuwiki [[doku>plugins|插件]] 相關的選項。 要通過插件管理器正常下載並安裝插件，插件所在的文件夾必須可寫。 +您可以用本頁管理與 Dokuwiki [[doku>plugins|插件]] 相關的選項。若要正常下載及安裝插件，插件所在的資料夾必須允許網頁伺服器寫入。 diff --git a/lib/plugins/plugin/lang/zh-tw/lang.php b/lib/plugins/plugin/lang/zh-tw/lang.php index 2e480ee15..54234212d 100644 --- a/lib/plugins/plugin/lang/zh-tw/lang.php +++ b/lib/plugins/plugin/lang/zh-tw/lang.php @@ -7,10 +7,12 @@ * @author Wayne San <waynesan@zerozone.tw> * @author Li-Jiun Huang <ljhuang.tw@gmai.com> * @author Cheng-Wei Chien <e.cwchien@gmail.com> + * @author Danny Lin + * @author Shuo-Ting Jian <shoting@gmail.com> */ -$lang['menu'] = '管理外掛(Plugins)'; -$lang['download'] = '下載與安裝外掛'; -$lang['manage'] = '已安裝的外掛'; +$lang['menu'] = '管理插件 (Plugins)'; +$lang['download'] = '下載與安裝插件'; +$lang['manage'] = '已安裝的插件'; $lang['btn_info'] = '資訊'; $lang['btn_update'] = '更新'; $lang['btn_delete'] = '刪除'; @@ -20,21 +22,21 @@ $lang['btn_enable'] = '儲存'; $lang['url'] = 'URL'; $lang['installed'] = '安裝:'; $lang['lastupdate'] = '上次更新:'; -$lang['source'] = '来源：'; +$lang['source'] = '來源：'; $lang['unknown'] = '未知'; $lang['updating'] = '更新中 ...'; -$lang['updated'] = '外掛(Plugin) %s 成功地更新'; -$lang['updates'] = '以下的外掛(Plugin)已經成功地更新'; +$lang['updated'] = '插件 %s 成功地更新'; +$lang['updates'] = '以下的插件已經成功地更新'; $lang['update_none'] = '找不到更新'; $lang['deleting'] = '刪除中 ...'; -$lang['deleted'] = '外掛(Plugin) %s 已刪除。'; +$lang['deleted'] = '插件 %s 已刪除。'; $lang['downloading'] = '下載中 ...'; -$lang['downloaded'] = '外掛(Plugin) %s 已成功地安裝'; -$lang['downloads'] = '以下的外掛(Plugins)已成功地安裝:'; -$lang['download_none'] = '找不到外掛, 或是下載與安裝的期間發生了一些未知的問題'; -$lang['plugin'] = '外掛(Plugin):'; +$lang['downloaded'] = '插件 %s 已成功地安裝'; +$lang['downloads'] = '以下的插件已成功地安裝:'; +$lang['download_none'] = '找不到插件，或在下載與安裝時發生了未知的問題'; +$lang['plugin'] = '插件:'; $lang['components'] = '元件'; -$lang['noinfo'] = '此外掛沒有回傳任何資訊, 可能是無效的'; +$lang['noinfo'] = '此插件沒有回傳任何資訊，可能是無效的'; $lang['name'] = '名稱:'; $lang['date'] = '日期:'; $lang['type'] = '類型:'; @@ -42,13 +44,14 @@ $lang['desc'] = '描述:'; $lang['author'] = '作者:'; $lang['www'] = '網頁:'; $lang['error'] = '一個未知的錯誤發生。'; -$lang['error_download'] = '無法下載外掛檔案: %s'; +$lang['error_download'] = '無法下載插件檔案: %s'; $lang['error_badurl'] = 'URL 可能有問題 - 從 URL 中無法得知文件名'; $lang['error_dircreate'] = '無法建立暫存目錄來接收下載的內容'; $lang['error_decompress'] = '插件管理器無法解壓下載的文件。這可能是由於下載出現錯誤，遇到這種情況，請您再次嘗試;或者是壓縮格式無法識別，遇到這種情況，您需要手動下載並安裝該插件。'; -$lang['error_copy'] = '嘗試安裝插件 <em>%s</em> 的相關文件時產生一個復制錯誤：磁盤空間已滿或文件訪問權限錯誤。這可能是由於一個安裝了一部分的插件，並使得您的維基系統不穩定。'; -$lang['error_delete'] = '嘗試刪除插件 <em>%s</em> 時產生一個錯誤。最有可能的情況是文件或路徑的訪問權限不夠'; -$lang['enabled'] = '插件 %s 已啟動。'; -$lang['notenabled'] = '插件 %s 無法啟動，請檢查檔案權限。'; +$lang['error_copy'] = '嘗試安裝插件 <em>%s</em> 的相關文件時發生複製錯誤：可能是磁碟空間不足或檔案存取權限錯誤。這可能是由於未安裝完全的插件使維基系統不穩定導致。'; +$lang['error_delete'] = '嘗試刪除插件 <em>%s</em> 時發生錯誤。最可能原因是檔案或目錄存取權限不足'; +$lang['enabled'] = '插件 %s 已啟用。'; +$lang['notenabled'] = '插件 %s 無法啟用，請檢查檔案權限。'; $lang['disabled'] = '插件 %s 已停用。'; $lang['notdisabled'] = '插件 %s 無法停用，請檢查檔案權限。'; +$lang['packageinstalled'] = '插件 (%d 插件%s: %s) 已成功地安裝。'; diff --git a/lib/plugins/plugin/lang/zh/lang.php b/lib/plugins/plugin/lang/zh/lang.php index af2db4ee5..6fc1f4d7d 100644 --- a/lib/plugins/plugin/lang/zh/lang.php +++ b/lib/plugins/plugin/lang/zh/lang.php @@ -11,6 +11,8 @@ * @author ben <ben@livetom.com> * @author lainme <lainme993@gmail.com> * @author caii <zhoucaiqi@gmail.com> + * @author Hiphen Lee <jacob.b.leung@gmail.com> + * @author caii, patent agent in China <zhoucaiqi@gmail.com> */ $lang['menu'] = '插件管理器'; $lang['download'] = '下载并安装新的插件'; @@ -56,3 +58,4 @@ $lang['enabled'] = '%s 插件启用'; $lang['notenabled'] = '%s插件启用失败，请检查文件权限。'; $lang['disabled'] = '%s 插件禁用'; $lang['notdisabled'] = '%s插件禁用失败，请检查文件权限。'; +$lang['packageinstalled'] = '插件 (%d plugin%s: %s) 已成功安装。'; diff --git a/lib/plugins/popularity/action.php b/lib/plugins/popularity/action.php index ce10808b9..bf11efba6 100644 --- a/lib/plugins/popularity/action.php +++ b/lib/plugins/popularity/action.php @@ -48,10 +48,10 @@ class action_plugin_popularity extends Dokuwiki_Action_Plugin { /** * Check if it's time to send autosubmit data - * (we should have check the autosubmit is enabled first) + * (we should have check if autosubmit is enabled first) */ function _isTooEarlyToSubmit(){ - $lastSubmit = @filemtime($this->helper->autosubmitFile); + $lastSubmit = $this->helper->lastSentTime(); return $lastSubmit + 24*60*60*30 > time(); } } diff --git a/lib/plugins/popularity/admin.php b/lib/plugins/popularity/admin.php index 22ddb245b..a04e98a66 100644 --- a/lib/plugins/popularity/admin.php +++ b/lib/plugins/popularity/admin.php @@ -53,6 +53,10 @@ class admin_plugin_popularity extends DokuWiki_Admin_Plugin { //Send the data if ( isset($_REQUEST['data']) ){ $this->sentStatus = $this->helper->sendData( $_REQUEST['data'] ); + if ( $this->sentStatus === '' ){ + //Update the last time we sent the data + touch ( $this->helper->popularityLastSubmitFile ); + } //Deal with the autosubmit option $this->_enableAutosubmit( isset($_REQUEST['autosubmit']) ); } @@ -87,6 +91,12 @@ class admin_plugin_popularity extends DokuWiki_Admin_Plugin { flush(); echo $this->buildForm('server'); + + //Print the last time the data was sent + $lastSent = $this->helper->lastSentTime(); + if ( $lastSent !== 0 ){ + echo $this->getLang('lastSent') . ' ' . datetime_h($lastSent); + } } else { //If we just submitted the form if ( $this->sentStatus === '' ){ @@ -127,8 +137,8 @@ class admin_plugin_popularity extends DokuWiki_Admin_Plugin { .($this->helper->isAutosubmitEnabled() ? 'checked' : '' ) .'/>' . $this->getLang('autosubmit') .'<br />' .'</label>' - .'<input type="hidden" name="do" value="admin">' - .'<input type="hidden" name="page" value="popularity">'; + .'<input type="hidden" name="do" value="admin" />' + .'<input type="hidden" name="page" value="popularity" />'; } $form .= '<input type="submit" class="button" value="'.$this->getLang('submit').'"/>' .'</fieldset>' diff --git a/lib/plugins/popularity/helper.php b/lib/plugins/popularity/helper.php index 00a359cbd..af1e8a706 100644 --- a/lib/plugins/popularity/helper.php +++ b/lib/plugins/popularity/helper.php @@ -13,7 +13,7 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { /** * Name of the file which determine if the the autosubmit is enabled, - * and when it was submited for the las time + * and when it was submited for the last time */ var $autosubmitFile; @@ -22,10 +22,19 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { */ var $autosubmitErrorFile; + /** + * Name of the file which determine when the popularity data was manually + * submitted for the last time + * (If this file doesn't exist, the data has never been sent) + */ + var $popularityLastSubmitFile; + + function helper_plugin_popularity(){ global $conf; $this->autosubmitFile = $conf['cachedir'].'/autosubmit.txt'; $this->autosubmitErrorFile = $conf['cachedir'].'/autosubmitError.txt'; + $this->popularityLastSubmitFile = $conf['cachedir'].'/lastSubmitTime.txt'; } function getMethods(){ @@ -48,6 +57,12 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { 'params' => array(), 'return' => array('data' => 'string') ); + $result[] = array( + 'name' => 'lastSentTime', + 'desc' => 'Compute the last time popularity data was sent', + 'params' => array(), + 'return' => array('data' => 'int') + ); return $result; } @@ -76,6 +91,16 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { } /** + * Compute the last time the data was sent. If it has never been sent, we return 0. + */ + function lastSentTime(){ + $manualSubmission = @filemtime($this->popularityLastSubmitFile); + $autoSubmission = @filemtime($this->autosubmitFile); + + return max((int) $manualSubmission, (int) $autoSubmission); + } + + /** * Gather all information * @return The popularity data as a string */ @@ -109,6 +134,7 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { $data['popversion'] = $this->version; $data['language'] = $conf['lang']; $data['now'] = time(); + $data['popauto'] = (int) $this->isAutoSubmitEnabled(); // some config values $data['conf_useacl'] = $conf['useacl']; diff --git a/lib/plugins/popularity/lang/ar/intro.txt b/lib/plugins/popularity/lang/ar/intro.txt index e5710af36..a81fede51 100644 --- a/lib/plugins/popularity/lang/ar/intro.txt +++ b/lib/plugins/popularity/lang/ar/intro.txt @@ -1,9 +1,9 @@ ====== Popularity Feedback ====== -تجمع هذه الأداة بيانات مجهولة الاسم وتسمح لك بردها لمطوري لدوكي ويكي. يساعدهم ذلك على معرفة كيفية استخدام دوكي ويكي من المستخدمين والتأكد من أن التطويرات المستقبلية مدعومة بتقارير استخدام حقيقية. +تجمع هذه الأداة بيانات مجهولة الاسم وتسمح لك بردها لمطوري دوكو ويكي. يساعدهم ذلك على معرفة كيفية استخدام دوكو ويكي من المستخدمين والتأكد من أن التطويرات المستقبلية مدعومة بتقارير استخدام حقيقية. نشجعك على تكرار هذه الخطوة من وقت لآخر لابقاء المطورين على علم بنمو الويكي خاصتك. بياناتك المرسلة مكررا ستحتفظ ب ID بلا اسماء يميزها. -البيانات المرسلة تحتوي معلومات مثل اصدار دوكي ويكي، عدد وحجم صفحاتك وملفاتك، الاضافات المركبة و معلومات عن PHP عندك. +البيانات المرسلة تحتوي معلومات مثل اصدار دوكو ويكي، عدد وحجم صفحاتك وملفاتك، الاضافات المركبة و معلومات عن PHP عندك. البيانات التي سترسل معروضة صرفا أسفله. رجاء استخدم زر "أرسل البيانات" لنقل المعلومات.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/ar/lang.php b/lib/plugins/popularity/lang/ar/lang.php index c0e7dc6af..481668505 100644 --- a/lib/plugins/popularity/lang/ar/lang.php +++ b/lib/plugins/popularity/lang/ar/lang.php @@ -4,6 +4,12 @@ * * @author Yaman Hokan <always.smile.yh@hotmail.com> * @author Usama Akkad <uahello@gmail.com> + * @author uahello@gmail.com */ $lang['name'] = 'رد الشعبية (قد يأخذ بعض الوقت ليحمل)'; $lang['submit'] = 'أرسل البيانات'; +$lang['autosubmit'] = 'ارسل البيانات آليا كل شهر'; +$lang['submissionFailed'] = 'تعذر إرسال البيانات بسبب الخطأ التالي:'; +$lang['submitDirectly'] = 'يمكنك إرسال البيانات يدويا بارسال النموذج التالي.'; +$lang['autosubmitError'] = 'فشلت آخر محاولة للإرسال، بسبب الخطأ التالي:'; +$lang['lastSent'] = 'أرسلت البيانات'; diff --git a/lib/plugins/popularity/lang/ar/submitted.txt b/lib/plugins/popularity/lang/ar/submitted.txt new file mode 100644 index 000000000..085e3bd98 --- /dev/null +++ b/lib/plugins/popularity/lang/ar/submitted.txt @@ -0,0 +1,3 @@ +====== رد الشعبية ====== + +أرسلت البيانات بنجاح.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/bg/intro.txt b/lib/plugins/popularity/lang/bg/intro.txt index 06c338585..35023b897 100644 --- a/lib/plugins/popularity/lang/bg/intro.txt +++ b/lib/plugins/popularity/lang/bg/intro.txt @@ -1,9 +1,9 @@ -====== Обратна връзка за популярност ====== +====== Обратна връзка ====== -Този инструмент събира данни за потребителите на Вашето Wiki и ви позволява да ги изпратите анонимно на DokuWiki. Това ни помага да разберем как DokuWiki се използва от потребителите си и да разработваме бъдещи решения, съответно реалното използване. +Инструментът събира данни за вашето Wiki и ви позволява да ги изпратите да разработчиците на DokuWiki. Информацията ще им помогне да разберат как DokuWiki се ползва от потребителите и че статистиката е в подкрепа на поетата насока за развитие. -Моля изпозвайте тази опция, за да информирате разработчиците на този продукт. Вашите данни ще бъдат идентифицирани с анонимен номер. +Моля, ползвайте функцията, от време на време, когато уебстраницата ви се разраства, за да информирате разработчиците. Изпратените данни ще бъдат идентифицирани с анонимен идентификатор. -Събраните данни съдържат информация за вашата версия на DokuWiki, броя и размера на вашите страници и файлове, инсталирани плъгини и информация за вашата PHP инсталация. +Събираните данни съдържат информация като версията на DokuWiki, броя и размера на вашите страници и файлове, инсталирани приставки и информация за локалната инсталация на PHP. -Изходните данни са показано по-долу във вида, в който ще бъдат изпратени. Моля ползвайте сьответния бутон, за да изпратите тази информация.
\ No newline at end of file +Данните, които ще бъдат изпратени са изобразени отдолу. Моля, натиснете бутона "Изпращане на данните", за да бъдат изпратени.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/bg/lang.php b/lib/plugins/popularity/lang/bg/lang.php index adf99a9f5..ba731c0fc 100644 --- a/lib/plugins/popularity/lang/bg/lang.php +++ b/lib/plugins/popularity/lang/bg/lang.php @@ -3,6 +3,12 @@ * Bulgarian language file * * @author Viktor Usunov <usun0v@mail.bg> + * @author Kiril <neohidra@gmail.com> */ -$lang['name'] = 'Обратна връзка за популярност (може да отнеме известно време за зареждане)'; -$lang['submit'] = 'Прати данните'; +$lang['name'] = 'Обратна връзка (зареждането изисква време)'; +$lang['submit'] = 'Изпращане на данните'; +$lang['autosubmit'] = 'Автоматично изпращане на данните веднъж в месеца'; +$lang['submissionFailed'] = 'Данните не могат да бъдат изпратени поради следната грешка:'; +$lang['submitDirectly'] = 'Можете да изпратите данните ръчно чрез следния формуляр.'; +$lang['autosubmitError'] = 'Последното автоматично изпращане се провали, поради следната грешка:'; +$lang['lastSent'] = 'Данните са изпратени'; diff --git a/lib/plugins/popularity/lang/bg/submitted.txt b/lib/plugins/popularity/lang/bg/submitted.txt new file mode 100644 index 000000000..3ecd24f96 --- /dev/null +++ b/lib/plugins/popularity/lang/bg/submitted.txt @@ -0,0 +1,3 @@ +====== Обратна връзка ====== + +Данните са изпратени успешно.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/cs/lang.php b/lib/plugins/popularity/lang/cs/lang.php index c992ec4c6..b0dc4d1a8 100644 --- a/lib/plugins/popularity/lang/cs/lang.php +++ b/lib/plugins/popularity/lang/cs/lang.php @@ -6,6 +6,12 @@ * @author tomas@valenta.cz * @author Marek Sacha <sachamar@fel.cvut.cz> * @author Lefty <lefty@multihost.cz> + * @author Vojta Beran <xmamut@email.cz> */ $lang['name'] = 'Průzkum používání (může chviličku trvat, než se natáhne)'; $lang['submit'] = 'Odeslat data'; +$lang['autosubmit'] = 'Automaticky odesílat data jednou měsíčně'; +$lang['submissionFailed'] = 'Data nemohla být odeslána kvůli následující chybě:'; +$lang['submitDirectly'] = 'Data můžete odeslat ručně zasláním následujícího formuláře.'; +$lang['autosubmitError'] = 'Poslední automatické odeslání selhalo kvůli následující chybě:'; +$lang['lastSent'] = 'Data byla odeslána.'; diff --git a/lib/plugins/popularity/lang/cs/submitted.txt b/lib/plugins/popularity/lang/cs/submitted.txt new file mode 100644 index 000000000..ff1f41c9f --- /dev/null +++ b/lib/plugins/popularity/lang/cs/submitted.txt @@ -0,0 +1,3 @@ +===== Průzkum používání ===== + +Data byla úspěšně odeslána.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/de-informal/lang.php b/lib/plugins/popularity/lang/de-informal/lang.php index 076b37115..f884ed690 100644 --- a/lib/plugins/popularity/lang/de-informal/lang.php +++ b/lib/plugins/popularity/lang/de-informal/lang.php @@ -6,6 +6,12 @@ * @author Juergen Schwarzer <jschwarzer@freenet.de> * @author Marcel Metz <marcel_metz@gmx.de> * @author Matthias Schulte <post@lupo49.de> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['name'] = 'Popularitätsrückmeldung (kann eine Weile dauern, bis es fertig geladen wurde)'; $lang['submit'] = 'Sende Daten'; +$lang['autosubmit'] = 'Daten einmal im Monat automatisch senden'; +$lang['submissionFailed'] = 'Die Daten konnten aufgrund des folgenden Fehlers nicht gesendet werden: '; +$lang['submitDirectly'] = 'Du kannst die Daten durch Betätigung des Buttons manuell versenden.'; +$lang['autosubmitError'] = 'Beim letzten automatischen Versuch die Daten zu senden, ist folgender Fehler aufgetreten: '; +$lang['lastSent'] = 'Die Daten wurden gesendet'; diff --git a/lib/plugins/popularity/lang/de-informal/submitted.txt b/lib/plugins/popularity/lang/de-informal/submitted.txt new file mode 100644 index 000000000..e7b45b5b7 --- /dev/null +++ b/lib/plugins/popularity/lang/de-informal/submitted.txt @@ -0,0 +1,3 @@ +====== Popularitäts-Feedback ====== + +Die Daten wurden erfolgreich versandt.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/de/lang.php b/lib/plugins/popularity/lang/de/lang.php index 1372e9d8a..4649062f7 100644 --- a/lib/plugins/popularity/lang/de/lang.php +++ b/lib/plugins/popularity/lang/de/lang.php @@ -11,6 +11,13 @@ * @author Blitzi94@gmx.de * @author Robert Bogenschneider <robog@GMX.de> * @author Robert Bogenschneider <robog@gmx.de> + * @author Niels Lange <niels@boldencursief.nl> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['name'] = 'Popularitäts-Feedback (Eventuell längere Ladezeit)'; $lang['submit'] = 'Daten senden'; +$lang['autosubmit'] = 'Daten einmal im Monat automatisch senden'; +$lang['submissionFailed'] = 'Die Daten konnten aufgrund des folgenden Fehlers nicht gesendet werden: '; +$lang['submitDirectly'] = 'Sie können die Daten durch Betätigung des Buttons manuell versenden.'; +$lang['autosubmitError'] = 'Beim letzten automatischen Versuch die Daten zu senden, ist folgender Fehler aufgetreten: '; +$lang['lastSent'] = 'Die Daten wurden gesendet'; diff --git a/lib/plugins/popularity/lang/de/submitted.txt b/lib/plugins/popularity/lang/de/submitted.txt new file mode 100644 index 000000000..e7b45b5b7 --- /dev/null +++ b/lib/plugins/popularity/lang/de/submitted.txt @@ -0,0 +1,3 @@ +====== Popularitäts-Feedback ====== + +Die Daten wurden erfolgreich versandt.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/el/lang.php b/lib/plugins/popularity/lang/el/lang.php index 0d16bbf86..41704fa06 100644 --- a/lib/plugins/popularity/lang/el/lang.php +++ b/lib/plugins/popularity/lang/el/lang.php @@ -7,3 +7,8 @@ */ $lang['name'] = 'Αναφορά Δημοτικότητας (ίσως αργήσει λίγο να εμφανιστεί)'; $lang['submit'] = 'Αποστολή Δεδομένων'; +$lang['autosubmit'] = 'Να αποστέλονται τα δεδομένα αυτόματα μια φορά το μήνα.'; +$lang['submissionFailed'] = 'Τα δεδομένα δεν ήταν δυνατό να αποσταλλούν λόγω του παρακάτω σφάλματος:'; +$lang['submitDirectly'] = 'Μπορείτε να αποστείλλετε τα δεδομένα χειροκίνητα με την υποβολή της παρακάτω φόρμας.'; +$lang['autosubmitError'] = 'Η τελευταία αυτόματη υποβολή των δεδομένων απέτυχε με το παρακάτω μήνυμα σφάλματος:'; +$lang['lastSent'] = 'Τα δεδομένα έχουν σταλεί.'; diff --git a/lib/plugins/popularity/lang/el/submitted.txt b/lib/plugins/popularity/lang/el/submitted.txt new file mode 100644 index 000000000..8004f9997 --- /dev/null +++ b/lib/plugins/popularity/lang/el/submitted.txt @@ -0,0 +1,3 @@ +====== Αποτέλεσμα Υποβολής Δημοσιότητας ====== + +Τα δεδομένα στάλθηκαν επιτυχώς.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/en/lang.php b/lib/plugins/popularity/lang/en/lang.php index a94623718..af6797cb2 100644 --- a/lib/plugins/popularity/lang/en/lang.php +++ b/lib/plugins/popularity/lang/en/lang.php @@ -6,3 +6,4 @@ $lang['autosubmit'] = 'Automatically send data once a month'; $lang['submissionFailed'] = 'The data couldn\'t be sent due to the following error:'; $lang['submitDirectly'] = 'You can send the data manually by submitting the following form.'; $lang['autosubmitError'] = 'The last autosubmit failed, because of the following error: '; +$lang['lastSent'] = 'The data has been sent'; diff --git a/lib/plugins/popularity/lang/eo/lang.php b/lib/plugins/popularity/lang/eo/lang.php index 9326cc741..a7c124f51 100644 --- a/lib/plugins/popularity/lang/eo/lang.php +++ b/lib/plugins/popularity/lang/eo/lang.php @@ -12,3 +12,8 @@ */ $lang['name'] = 'Populareca enketo (eble la ŝargo prokrastos iomete)'; $lang['submit'] = 'Sendi datenaron'; +$lang['autosubmit'] = 'Aŭtomate sendi datumaron monate'; +$lang['submissionFailed'] = 'La datumaro ne povis esti sendata pro la jena eraro:'; +$lang['submitDirectly'] = 'Vi povas sendi vi mem la datumaron per la sekva informilo.'; +$lang['autosubmitError'] = 'La lasta aŭtomata sendo malsukcesis, pro la jena eraro:'; +$lang['lastSent'] = 'La datumaro estas sendita'; diff --git a/lib/plugins/popularity/lang/es/lang.php b/lib/plugins/popularity/lang/es/lang.php index c76190c2c..5e42cd45c 100644 --- a/lib/plugins/popularity/lang/es/lang.php +++ b/lib/plugins/popularity/lang/es/lang.php @@ -16,6 +16,12 @@ * @author Victor Castelan <victorcastelan@gmail.com> * @author Mauro Javier Giamberardino <mgiamberardino@gmail.com> * @author Oscar M. Lage <r0sk10@gmail.com> + * @author emezeta <emezeta@infoprimo.com> */ $lang['name'] = 'Retroinformación (Feedback) plugin Popularity'; $lang['submit'] = 'Enviar datos'; +$lang['autosubmit'] = 'Enviar automáticamente datos una vez al mes'; +$lang['submissionFailed'] = 'Los datos no se pudo enviar debido al error siguiente:'; +$lang['submitDirectly'] = 'Puede enviar los datos de forma manual mediante la presentación de la siguiente forma.'; +$lang['autosubmitError'] = 'El último auto no pudo presentar, debido al error siguiente:'; +$lang['lastSent'] = 'Los datos se han enviado'; diff --git a/lib/plugins/popularity/lang/es/submitted.txt b/lib/plugins/popularity/lang/es/submitted.txt new file mode 100644 index 000000000..bb1754cdd --- /dev/null +++ b/lib/plugins/popularity/lang/es/submitted.txt @@ -0,0 +1,3 @@ +====== Retroinformación Popularity ====== + +Los datos se han enviado con éxito.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/et/lang.php b/lib/plugins/popularity/lang/et/lang.php new file mode 100644 index 000000000..ca1410ab0 --- /dev/null +++ b/lib/plugins/popularity/lang/et/lang.php @@ -0,0 +1,7 @@ +<?php +/** + * Estonian language file + * + * @author kristian.kankainen@kuu.la + * @author Rivo Zängov <eraser@eraser.ee> + */ diff --git a/lib/plugins/popularity/lang/eu/lang.php b/lib/plugins/popularity/lang/eu/lang.php index a4d16c020..05e4262de 100644 --- a/lib/plugins/popularity/lang/eu/lang.php +++ b/lib/plugins/popularity/lang/eu/lang.php @@ -6,3 +6,8 @@ */ $lang['name'] = 'Popularitate Feedback-a (denbora dezente iraun dezake kargatzen)'; $lang['submit'] = 'Datuak Bidali'; +$lang['autosubmit'] = 'Automatikoki bidali informazioa hilabetean behin'; +$lang['submissionFailed'] = 'Informazioa ezin izan da bidali ondorengo errorea dela eta:'; +$lang['submitDirectly'] = 'Informazioa eskuz bidali dezakezu ondorengo formularioa bidaliz.'; +$lang['autosubmitError'] = 'Azken bidalketa automatikoak huts egin zuen ondorengo errorea dela eta:'; +$lang['lastSent'] = 'Informazioa bidalia izan da'; diff --git a/lib/plugins/popularity/lang/eu/submitted.txt b/lib/plugins/popularity/lang/eu/submitted.txt new file mode 100644 index 000000000..94c81a528 --- /dev/null +++ b/lib/plugins/popularity/lang/eu/submitted.txt @@ -0,0 +1,3 @@ +====== Popularitate Feedback-a ====== + +Informazioa arrakastaz bidalia izan da.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/fa/lang.php b/lib/plugins/popularity/lang/fa/lang.php index 05f8460b6..70c65f1b3 100644 --- a/lib/plugins/popularity/lang/fa/lang.php +++ b/lib/plugins/popularity/lang/fa/lang.php @@ -10,3 +10,8 @@ */ $lang['name'] = 'بازخورد محبوبیت (ممکن است اندکی زمان ببرد)'; $lang['submit'] = 'ارسال اطلاعات'; +$lang['autosubmit'] = 'ارسال خودکار اطلاعات به صورت ماهیانه'; +$lang['submissionFailed'] = 'اطلاعات به علت بروز خطای زیر قابل ارسال نیستند:'; +$lang['submitDirectly'] = 'شما میتوانید اطلاعات را با تکمیل این فرم به صورت دستی ارسال کنید.'; +$lang['autosubmitError'] = 'آخرین ارسال خودکار با خطای مواجه شد, به علت زیر:'; +$lang['lastSent'] = 'اطلاعات ارسال شد.'; diff --git a/lib/plugins/popularity/lang/fa/submitted.txt b/lib/plugins/popularity/lang/fa/submitted.txt new file mode 100644 index 000000000..63eec47ba --- /dev/null +++ b/lib/plugins/popularity/lang/fa/submitted.txt @@ -0,0 +1,2 @@ +====== بازخورد محبوبیت ====== +اطلاعات ارسال شد.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/fi/lang.php b/lib/plugins/popularity/lang/fi/lang.php index 3aa5dc23b..d7c230742 100644 --- a/lib/plugins/popularity/lang/fi/lang.php +++ b/lib/plugins/popularity/lang/fi/lang.php @@ -4,6 +4,12 @@ * * @author Otto Vainio <otto@valjakko.net> * @author Teemu Mattila <ghcsystems@gmail.com> + * @author Sami Olmari <sami@olmari.fi> */ $lang['name'] = 'Suosion palaute (voi kestää jonkun aikaa latautua)'; $lang['submit'] = 'Lähetä tiedot'; +$lang['autosubmit'] = 'Lähetä tiedot automaattisesti kerran kuussa'; +$lang['submissionFailed'] = 'Tietoja ei voitu lähettää seuraavan virheen vuoksi:'; +$lang['submitDirectly'] = 'Voit lähettää tiedot käsin seuraavan kaavakkeen avulla'; +$lang['autosubmitError'] = 'Edellinen automaattilähetys epäonnistui seuraavan virheen vuoksi:'; +$lang['lastSent'] = 'Tiedot on lähetetty'; diff --git a/lib/plugins/popularity/lang/fi/submitted.txt b/lib/plugins/popularity/lang/fi/submitted.txt new file mode 100644 index 000000000..31059c880 --- /dev/null +++ b/lib/plugins/popularity/lang/fi/submitted.txt @@ -0,0 +1,3 @@ +====== Suosion palaute ====== + +Tiedot lähetettiin onnistuneesti.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/fr/lang.php b/lib/plugins/popularity/lang/fr/lang.php index 5ddd074a7..3ccc4cb5f 100644 --- a/lib/plugins/popularity/lang/fr/lang.php +++ b/lib/plugins/popularity/lang/fr/lang.php @@ -12,6 +12,13 @@ * @author Philippe Bajoit <philippe.bajoit@gmail.com> * @author Florian Gaub <floriang@floriang.net> * @author Samuel Dorsaz samuel.dorsaz@novelion.net + * @author Johan Guilbaud <guilbaud.johan@gmail.com> + * @author schplurtz@laposte.net */ -$lang['name'] = 'Enquête de popularité (peut nécessiter un certain temps pour être chargé)'; +$lang['name'] = 'Enquête de popularité (peut nécessiter un certain temps pour être chargée)'; $lang['submit'] = 'Envoyer les données'; +$lang['autosubmit'] = 'Envoyer les données automatiquement chaque mois'; +$lang['submissionFailed'] = 'Les données ne peuvent pas être envoyées à cause des erreurs suivantes :'; +$lang['submitDirectly'] = 'Vous pouvez envoyer le données manuellement en soumettant ce formulaire.'; +$lang['autosubmitError'] = 'La dernière soumission automatique a échoué pour les raisons suivantes :'; +$lang['lastSent'] = 'Les données ont été envoyées'; diff --git a/lib/plugins/popularity/lang/fr/submitted.txt b/lib/plugins/popularity/lang/fr/submitted.txt new file mode 100644 index 000000000..0bc4cfe71 --- /dev/null +++ b/lib/plugins/popularity/lang/fr/submitted.txt @@ -0,0 +1,2 @@ +====== Enquête de popularité ====== +Les données ont été envoyées avec succès.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/he/lang.php b/lib/plugins/popularity/lang/he/lang.php index 024f94ae8..f619127cd 100644 --- a/lib/plugins/popularity/lang/he/lang.php +++ b/lib/plugins/popularity/lang/he/lang.php @@ -5,6 +5,7 @@ * @author Dotan Kamber <kamberd@yahoo.com> * @author Moshe Kaplan <mokplan@gmail.com> * @author Yaron Yogev <yaronyogev@gmail.com> + * @author Yaron Shahrabani <sh.yaron@gmail.com> */ $lang['name'] = 'משוב פופולריות (יתכן זמן טעינה ארוך)'; $lang['submit'] = 'שלח מידע'; diff --git a/lib/plugins/popularity/lang/hr/lang.php b/lib/plugins/popularity/lang/hr/lang.php index d2094b77b..96f1d6afe 100644 --- a/lib/plugins/popularity/lang/hr/lang.php +++ b/lib/plugins/popularity/lang/hr/lang.php @@ -4,4 +4,5 @@ * * @author Branko Rihtman <theney@gmail.com> * @author Dražen Odobašić <dodobasic@gmail.com> + * @author Dejan Igrec dejan.igrec@gmail.com */ diff --git a/lib/plugins/popularity/lang/hu/lang.php b/lib/plugins/popularity/lang/hu/lang.php index d1510ed75..5dcd1adf0 100644 --- a/lib/plugins/popularity/lang/hu/lang.php +++ b/lib/plugins/popularity/lang/hu/lang.php @@ -5,8 +5,14 @@ * @author Sandor TIHANYI <stihanyi+dw@gmail.com> * @author Siaynoq Mage <siaynoqmage@gmail.com> * @author schilling.janos@gmail.com - * @author Szabó Dávid (szabo.david@gyumolcstarhely.hu) * @author Szabó Dávid <szabo.david@gyumolcstarhely.hu> + * @author Sándor TIHANYI <stihanyi+dw@gmail.com> + * @author David Szabo <szabo.david@gyumolcstarhely.hu> */ $lang['name'] = 'Visszajelzés a DokuWiki használatáról (sok időt vehet igénybe a betöltése)'; $lang['submit'] = 'Adatok elküldése'; +$lang['autosubmit'] = 'Adatok havonkénti automatikus elküldése.'; +$lang['submissionFailed'] = 'Az adatok a következő hiba miatt nem kerültek elküldésre:'; +$lang['submitDirectly'] = 'Az adatokat a következő űrlap segítségével lehet elküldeni.'; +$lang['autosubmitError'] = 'Az adatok a következő hiba miatt nem kerültek automatikusan elküldésre:'; +$lang['lastSent'] = 'Az adatokat elküldtük.'; diff --git a/lib/plugins/popularity/lang/hu/submitted.txt b/lib/plugins/popularity/lang/hu/submitted.txt new file mode 100644 index 000000000..30ab8bd8e --- /dev/null +++ b/lib/plugins/popularity/lang/hu/submitted.txt @@ -0,0 +1,3 @@ +====== Visszajelzés a DokuWiki használatáról ====== + +Az adatokat sikeresen elküldtük.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/it/intro.txt b/lib/plugins/popularity/lang/it/intro.txt index 62303eca7..f65310a5a 100644 --- a/lib/plugins/popularity/lang/it/intro.txt +++ b/lib/plugins/popularity/lang/it/intro.txt @@ -2,8 +2,8 @@ Questo strumento raccoglie dati anonimi sul tuo wiki e ti permette di inviarli agli sviluppatori di Dokuwiki. Questo aiuta loro a capire come Dokuwiki viene utilizzato dagli utenti e prendere decisioni future sullo sviluppo in base a quelle che sono le reali statistiche di utilizzo da parte degli utenti. -Ti incoraggiamo a ripetere questa operazione al più spesso per mantenere informati gli sviluppatori sulla crescita del tuo wiki. L'insieme dei dati raccolti saranno identificati tramite un ID anonimo. +Ti incoraggiamo a ripetere ogni tanto questa operazione per mantenere informati gli sviluppatori sulla crescita del tuo wiki. L'insieme dei dati raccolti saranno identificati tramite un ID anonimo. -I dati raccolti contengono informazioni come la versione di DokuWiki, il numero e le dimensioni delle pagine e dei files, i plugins installati e qualche informazione sulla versione di PHP presente nel sistema. +I dati raccolti contengono informazioni come la versione di DokuWiki, il numero e le dimensioni delle pagine e dei file, i plugin installati e informazioni sulla versione di PHP presente nel sistema. -A continuazione puoi vedere un'anteprima dei dati che saranno inviati. Utilizza il tasto "Invia dati" per trasferire le informazioni.
\ No newline at end of file +A continuazione puoi vedere un'anteprima dei dati che saranno inviati. Utilizza il pulsante "Invia dati" per trasferire le informazioni.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/it/lang.php b/lib/plugins/popularity/lang/it/lang.php index 583dfae26..a7852f22c 100644 --- a/lib/plugins/popularity/lang/it/lang.php +++ b/lib/plugins/popularity/lang/it/lang.php @@ -8,6 +8,12 @@ * @author snarchio@alice.it * @author robocap <robocap1@gmail.com> * @author Osman Tekin osman.tekin93@hotmail.it + * @author Jacopo Corbetta <jacopo.corbetta@gmail.com> */ $lang['name'] = 'Raccolta dati sul wiki (può impiegare del tempo per caricarsi)'; $lang['submit'] = 'Invia dati'; +$lang['autosubmit'] = 'Invia automaticamente i dati una volta al mese'; +$lang['submissionFailed'] = 'È stato impossibile inviare i dati a causa del seguente errore:'; +$lang['submitDirectly'] = 'È possibile inviare i dati manualmente utilizzando il pulsante sottostante.'; +$lang['autosubmitError'] = 'L\'ultimo invio automatico non è andato a buon fine a causa del seguente errore:'; +$lang['lastSent'] = 'I dati sono stati inviati'; diff --git a/lib/plugins/popularity/lang/it/submitted.txt b/lib/plugins/popularity/lang/it/submitted.txt new file mode 100644 index 000000000..78247154e --- /dev/null +++ b/lib/plugins/popularity/lang/it/submitted.txt @@ -0,0 +1,3 @@ +====== Raccolta dati sul wiki ====== + +I dati sono stati inviati correttamente.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/ja/lang.php b/lib/plugins/popularity/lang/ja/lang.php index 1e0dbdc3f..736924bb1 100644 --- a/lib/plugins/popularity/lang/ja/lang.php +++ b/lib/plugins/popularity/lang/ja/lang.php @@ -9,3 +9,8 @@ */ $lang['name'] = '利用状況調査（ロードに少し時間が掛かります）'; $lang['submit'] = 'データ送信'; +$lang['autosubmit'] = '月に一度は自動的にデータを送付'; +$lang['submissionFailed'] = '次のエラーによりデータが送信できませんでした：'; +$lang['submitDirectly'] = '次のフォームを使ってデータを手動で送信することができます。'; +$lang['autosubmitError'] = '以下のエラーにより最後の自動送信に失敗しました：'; +$lang['lastSent'] = 'データを送信しました。'; diff --git a/lib/plugins/popularity/lang/ja/submitted.txt b/lib/plugins/popularity/lang/ja/submitted.txt new file mode 100644 index 000000000..604f8e55f --- /dev/null +++ b/lib/plugins/popularity/lang/ja/submitted.txt @@ -0,0 +1,3 @@ +====== 利用状況調査 ====== + +データの送信に成功しました。
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/kk/lang.php b/lib/plugins/popularity/lang/kk/lang.php new file mode 100644 index 000000000..dde5b9577 --- /dev/null +++ b/lib/plugins/popularity/lang/kk/lang.php @@ -0,0 +1,6 @@ +<?php +/** + * kazakh language file + * + * @author Nurgozha Kaliaskarov astana08@gmail.com + */ diff --git a/lib/plugins/popularity/lang/ko/lang.php b/lib/plugins/popularity/lang/ko/lang.php index 91d798a5f..0f1442d53 100644 --- a/lib/plugins/popularity/lang/ko/lang.php +++ b/lib/plugins/popularity/lang/ko/lang.php @@ -10,3 +10,8 @@ */ $lang['name'] = '인기도 조사 (불러오는데 시간이 걸릴 수 있습니다.)'; $lang['submit'] = '자료 보내기'; +$lang['autosubmit'] = '자료를 자동으로 매달 한번씩 보내기'; +$lang['submissionFailed'] = '다음과 같은 이유로 자료 전송에 실패했습니다 :'; +$lang['submitDirectly'] = '아래의 양식에 맞춰 수동으로 작성된 자료를 보낼 수 있습니다'; +$lang['autosubmitError'] = '다음과 같은 이유로 자동 자료 전송에 실패했습니다 :'; +$lang['lastSent'] = '자료가 전송되었습니다'; diff --git a/lib/plugins/popularity/lang/ko/submitted.txt b/lib/plugins/popularity/lang/ko/submitted.txt new file mode 100644 index 000000000..e8b434dc5 --- /dev/null +++ b/lib/plugins/popularity/lang/ko/submitted.txt @@ -0,0 +1,3 @@ +====== 인기도 조사 ====== + +자료 전송이 성공적으로 완료되었습니다
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/la/intro.txt b/lib/plugins/popularity/lang/la/intro.txt index 6f4ce8488..c3029caf4 100644 --- a/lib/plugins/popularity/lang/la/intro.txt +++ b/lib/plugins/popularity/lang/la/intro.txt @@ -1,5 +1,10 @@ ====== Index Fauoris Popularis ====== -Haec machina fauorem popularem mittis sic ut creatores uicis meliorem illum facere possint. +Haoc instrumentum fauorem popularem mittis sic ut creatores uicis meliorem illum facere possint. + +Rursum te fauorem mittere experamus sic ut si mutationes meliores uel peiores esse uidere possimus. + +Res mittendae tua forma in usu, numerus et pondus paginarum et aliarum rerum, addenda in usu et de PHP. + +Res rudes mittendae subter ostenduntur. "Res mittere" premas ut eas transferas. -Rursum te fauorem mittere experamus sic ut si mutationes meliores uel peiores esse uidere possimus.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/la/lang.php b/lib/plugins/popularity/lang/la/lang.php index e634f9d41..c7f307c29 100644 --- a/lib/plugins/popularity/lang/la/lang.php +++ b/lib/plugins/popularity/lang/la/lang.php @@ -2,6 +2,12 @@ /** * Latin language file * + * @author Massimiliano Vassalli <vassalli.max@gmail.com> */ $lang['name'] = 'Index fauoris popularis (multum tempus quaerere potest)'; $lang['submit'] = 'Missum die'; +$lang['autosubmit'] = 'Constanter res omni mense mittuntur'; +$lang['submissionFailed'] = 'Res non mittuntur ea causa:'; +$lang['submitDirectly'] = 'Res tu mittere potes cum hoc exemplar compleas.'; +$lang['autosubmitError'] = 'Extrema missio lapsa est ea causa:'; +$lang['lastSent'] = 'Res missae sunt'; diff --git a/lib/plugins/popularity/lang/la/submitted.txt b/lib/plugins/popularity/lang/la/submitted.txt new file mode 100644 index 000000000..2b2faf439 --- /dev/null +++ b/lib/plugins/popularity/lang/la/submitted.txt @@ -0,0 +1,3 @@ +====== Index fauoris popularis ====== + +Res feliciter missae sunt.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/lv/lang.php b/lib/plugins/popularity/lang/lv/lang.php index 7dba689e0..f0c940b6f 100644 --- a/lib/plugins/popularity/lang/lv/lang.php +++ b/lib/plugins/popularity/lang/lv/lang.php @@ -6,3 +6,8 @@ */ $lang['name'] = 'Popularitātes atsauksmes (ielāde var aizņemt kādu laiku)'; $lang['submit'] = 'Nosūtīt datus'; +$lang['autosubmit'] = 'Automātiski reizi mēnesī nosūtīt datus'; +$lang['submissionFailed'] = 'Datus nevar nosūtīt kļūdas dēļ:'; +$lang['submitDirectly'] = 'Jūs pats varat pats nosūtīt datus no šīs veidlapas.'; +$lang['autosubmitError'] = 'Pēdējā automātiskā nosūtīšana kļūdas dēļ:'; +$lang['lastSent'] = 'Dati nosūtīti'; diff --git a/lib/plugins/popularity/lang/lv/submitted.txt b/lib/plugins/popularity/lang/lv/submitted.txt new file mode 100644 index 000000000..c31338abf --- /dev/null +++ b/lib/plugins/popularity/lang/lv/submitted.txt @@ -0,0 +1,3 @@ +====== Popularitātes atsauksmes ====== + +Dati veiksmīgi nosūtīti
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/nl/intro.txt b/lib/plugins/popularity/lang/nl/intro.txt index 92962944b..3c045c427 100644 --- a/lib/plugins/popularity/lang/nl/intro.txt +++ b/lib/plugins/popularity/lang/nl/intro.txt @@ -1,9 +1,9 @@ ====== Populariteitsfeedback ====== -Dit onderdeel verzamelt anonieme gegevens over je wiki en stelt je in staat deze te versturen naar de ontwikkelaars van DokuWiki. Dit helpt hen te begrijpen hoe DokuWiki wordt gebruikt door de gebruikers en zorgt er ook voor dat toekomstige ontwikkelkeuzes kunnen worden gestaafd door echte gebruikersstatistieken. +Dit onderdeel verzamelt anonieme gegevens over uw wiki en stelt u in staat deze te versturen naar de ontwikkelaars van DokuWiki. Dit helpt hen te begrijpen hoe DokuWiki wordt gebruikt door de gebruikers en zorgt er ook voor dat toekomstige ontwikkelkeuzes kunnen worden gestaafd door echte gebruikersstatistieken. -U wordt verzocht deze stap van tijd tot tijd te herhalen om ontwikkelaars op de hoogte te houden terwijl je wiki groeit. De herhaalde data zal worden geïdentificeerd door een uniek, anoniem ID. +U wordt verzocht deze stap van tijd tot tijd te herhalen om ontwikkelaars op de hoogte te houden terwijl uw wiki groeit. De herhaalde data zal worden geïdentificeerd door een uniek, anoniem ID. -De verzamelde gegevens bevat onder andere gegevens over je versie van DokuWiki, het aantal- en de grootte van de pagina's en bestanden, geïnstalleerde plugins en informatie over PHP. +De verzamelde gegevens bevat onder andere gegevens over uw versie van DokuWiki, het aantal- en de grootte van de pagina's en bestanden, geïnstalleerde plugins en informatie over PHP. De ruwe data die verzonden worden staan hieronder. Gebruik de knop "Verstuur" om de informatie te verzenden. diff --git a/lib/plugins/popularity/lang/nl/lang.php b/lib/plugins/popularity/lang/nl/lang.php index 54e12ae91..0a8386f42 100644 --- a/lib/plugins/popularity/lang/nl/lang.php +++ b/lib/plugins/popularity/lang/nl/lang.php @@ -13,3 +13,8 @@ */ $lang['name'] = 'Populariteitsfeedback (kan even duren om in te laden)'; $lang['submit'] = 'Verstuur'; +$lang['autosubmit'] = 'Gegevens automatisch maandelijks verzenden'; +$lang['submissionFailed'] = 'De gegevens konden niet verstuurd worden vanwege de volgende fouten:'; +$lang['submitDirectly'] = 'Je kan de gegevens handmatig sturen door het onderstaande formulier te verzenden.'; +$lang['autosubmitError'] = 'De laatste automatische verzending is mislukt vanwege de volgende fout:'; +$lang['lastSent'] = 'De gegevens zijn verstuurd.'; diff --git a/lib/plugins/popularity/lang/nl/submitted.txt b/lib/plugins/popularity/lang/nl/submitted.txt new file mode 100644 index 000000000..219d80fb6 --- /dev/null +++ b/lib/plugins/popularity/lang/nl/submitted.txt @@ -0,0 +1,3 @@ +===== Populariteitsfeedback ===== + +Het versturen van de gegevens is gelukt.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/no/lang.php b/lib/plugins/popularity/lang/no/lang.php index 0f7c140ff..e80016f92 100644 --- a/lib/plugins/popularity/lang/no/lang.php +++ b/lib/plugins/popularity/lang/no/lang.php @@ -9,6 +9,7 @@ * @author Lisa Ditlefsen <lisa@vervesearch.com> * @author Erik Pedersen <erik.pedersen@shaw.ca> * @author Erik Bjørn Pedersen <erik.pedersen@shaw.ca> + * @author Rune Rasmussen syntaxerror.no@gmail.com */ $lang['name'] = 'Popularitetsfeedback (kan ta litt tid å laste)'; $lang['submit'] = 'Send data'; diff --git a/lib/plugins/popularity/lang/pt-br/lang.php b/lib/plugins/popularity/lang/pt-br/lang.php index 907b4db5d..67a3abd7e 100644 --- a/lib/plugins/popularity/lang/pt-br/lang.php +++ b/lib/plugins/popularity/lang/pt-br/lang.php @@ -17,3 +17,8 @@ */ $lang['name'] = 'Retorno de popularidade (pode demorar um pouco para carregar)'; $lang['submit'] = 'Enviar dados'; +$lang['autosubmit'] = 'Enviar os dados automaticamente uma vez por mês'; +$lang['submissionFailed'] = 'Os dados não puderam ser enviados devido ao seguinte erro:'; +$lang['submitDirectly'] = 'Você pode enviar os dados manualmente, submetendo o formulário baixo.'; +$lang['autosubmitError'] = 'Ocorreu uma falha na última submissão automática, devido ao seguinte erro:'; +$lang['lastSent'] = 'Os dados foram enviados'; diff --git a/lib/plugins/popularity/lang/pt-br/submitted.txt b/lib/plugins/popularity/lang/pt-br/submitted.txt new file mode 100644 index 000000000..7c0cea8c1 --- /dev/null +++ b/lib/plugins/popularity/lang/pt-br/submitted.txt @@ -0,0 +1,3 @@ +====== Retorno de popularidade ====== + +Os dados foram enviados com sucesso.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/pt/lang.php b/lib/plugins/popularity/lang/pt/lang.php index da92ee729..ac27dc8c0 100644 --- a/lib/plugins/popularity/lang/pt/lang.php +++ b/lib/plugins/popularity/lang/pt/lang.php @@ -5,6 +5,12 @@ * @author Enrico Nicoletto <liverig@gmail.com> * @author Fil <fil@meteopt.com> * @author André Neves <drakferion@gmail.com> + * @author José Campos zecarlosdecampos@gmail.com */ $lang['name'] = 'Retorno (feedback) de Popularidade (pode levar algum tempo a carregar)'; $lang['submit'] = 'Enviar Dados'; +$lang['autosubmit'] = 'Enviar dados automáticamente uma vez por mês'; +$lang['submissionFailed'] = 'Os dados não foram enviados devido ao seguinte erro:'; +$lang['submitDirectly'] = 'Pode enviar os dados manualmente, submetendo o seguinte formulário.'; +$lang['autosubmitError'] = 'A última auto-submissão falhou, por causa do seguinte erro:'; +$lang['lastSent'] = 'Os dados foram enviados'; diff --git a/lib/plugins/popularity/lang/pt/submitted.txt b/lib/plugins/popularity/lang/pt/submitted.txt new file mode 100644 index 000000000..d2bb2b7ae --- /dev/null +++ b/lib/plugins/popularity/lang/pt/submitted.txt @@ -0,0 +1,3 @@ +====== Retorno de Popularidade ====== + +Os dados foram enviados com sucesso.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/ro/lang.php b/lib/plugins/popularity/lang/ro/lang.php index 15da1cf3b..1644ea574 100644 --- a/lib/plugins/popularity/lang/ro/lang.php +++ b/lib/plugins/popularity/lang/ro/lang.php @@ -9,3 +9,8 @@ */ $lang['name'] = 'Feedback de popularitate (încărcarea poate dura mai mult)'; $lang['submit'] = 'Trimite datele'; +$lang['autosubmit'] = 'Trimite datele automat o dată pe lună'; +$lang['submissionFailed'] = 'Datele nu au fost trimise din cauza următoarei erori:'; +$lang['submitDirectly'] = 'Puteți trimite datele manual prin completarea următorului formular.'; +$lang['autosubmitError'] = 'Ultima trimitere automată a eșuat din cauza următoarei erori:'; +$lang['lastSent'] = 'Datele au fost trimise'; diff --git a/lib/plugins/popularity/lang/ro/submitted.txt b/lib/plugins/popularity/lang/ro/submitted.txt new file mode 100644 index 000000000..214ffb71f --- /dev/null +++ b/lib/plugins/popularity/lang/ro/submitted.txt @@ -0,0 +1,3 @@ +====== Feedback de popularitate ====== + +Datele au fost trimise cu succes.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/ru/intro.txt b/lib/plugins/popularity/lang/ru/intro.txt index 587a7ae85..e8118e4eb 100644 --- a/lib/plugins/popularity/lang/ru/intro.txt +++ b/lib/plugins/popularity/lang/ru/intro.txt @@ -1,10 +1,10 @@ ====== Сбор информации о популярности ====== -Этот инструмент собирает анонимные данные о вашей вики и позволяет вам отправить их разработчикам «ДокуВики». Эти данные помогут им понять то, как именно используется «ДокуВики», и удостовериться, что принимаемые проектные решения соответствуют жизненным реалиям. +Этот инструмент собирает анонимные данные о вашей вики и позволяет вам отправить их разработчикам «ДокуВики». Эти данные помогут им понять, как именно используется «ДокуВики», и удостовериться, что принимаемые проектные решения соответствуют жизненным реалиям. -Отправляйте данные время от времени для того, чтобы сообщить разработчикам о том, что ваша вики «подросла». Отправленные вами данные будут идентифицированы по анонимному ID. +Отправляйте данные время от времени для того, чтобы сообщать разработчикам о том, что ваша вики «подросла». Отправленные вами данные будут идентифицированы по анонимному ID. Собранные данные содержат такую информацию, как: версия «ДокуВики», количество и размер ваших страниц и файлов, установленные плагины, информацию об установленном PHP. -Данные, которые будут посланы, представлены ниже. Пожалуйста, используйте кнопку «Отправить данные», чтобы передать информацию. +Данные, которые будут отосланы, представлены ниже. Пожалуйста, используйте кнопку «Отправить данные», чтобы передать информацию. diff --git a/lib/plugins/popularity/lang/ru/lang.php b/lib/plugins/popularity/lang/ru/lang.php index df89c7022..79b3e224d 100644 --- a/lib/plugins/popularity/lang/ru/lang.php +++ b/lib/plugins/popularity/lang/ru/lang.php @@ -11,6 +11,13 @@ * @author Vlad Tsybenko <vlad.development@gmail.com> * @author Aleksey Osadchiy <rfc@nm.ru> * @author Aleksandr Selivanov <alexgearbox@gmail.com> + * @author Ladyko Andrey <fylh@succexy.spb.ru> + * @author Eugene <windy.wanderer@gmail.com> */ $lang['name'] = 'Сбор информации о популярности (для загрузки может потребоваться некоторое время)'; $lang['submit'] = 'Отправить данные'; +$lang['autosubmit'] = 'Автоматически отправлять данные один раз в месяц'; +$lang['submissionFailed'] = 'Данные не могут быть отправлены из-за ошибки:'; +$lang['submitDirectly'] = 'Вы можете отправлять данные вручную, заполнив форму:'; +$lang['autosubmitError'] = 'Последнее автоотправление данных не удалось из-за ошибки:'; +$lang['lastSent'] = 'Данные отправлены'; diff --git a/lib/plugins/popularity/lang/ru/submitted.txt b/lib/plugins/popularity/lang/ru/submitted.txt new file mode 100644 index 000000000..a239943a4 --- /dev/null +++ b/lib/plugins/popularity/lang/ru/submitted.txt @@ -0,0 +1,2 @@ +====== Общественная обратная связь ====== +Данные были успешно отправлены.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/sk/lang.php b/lib/plugins/popularity/lang/sk/lang.php index 2e414d835..bc46b03c5 100644 --- a/lib/plugins/popularity/lang/sk/lang.php +++ b/lib/plugins/popularity/lang/sk/lang.php @@ -8,3 +8,8 @@ */ $lang['name'] = 'Prieskum používania (môže chvíľu trvať)'; $lang['submit'] = 'Poslať dáta'; +$lang['autosubmit'] = 'Automaticky zaslať dáta raz mesačne'; +$lang['submissionFailed'] = 'Dáta nemohli byť odoslané z nasledujúceho dôdovu:'; +$lang['submitDirectly'] = 'Dáta môžu byť zaslané manuálne nasledujúcim formulárom:'; +$lang['autosubmitError'] = 'Posledné automatické odoslanie dát zlyhalo z nasledujúceho dôvodu:'; +$lang['lastSent'] = 'Dáta boli odoslané.'; diff --git a/lib/plugins/popularity/lang/sk/submitted.txt b/lib/plugins/popularity/lang/sk/submitted.txt new file mode 100644 index 000000000..f99fb9fa9 --- /dev/null +++ b/lib/plugins/popularity/lang/sk/submitted.txt @@ -0,0 +1,3 @@ +====== Prieskum používania ====== + +Dáta boli úspešne odoslané.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/sl/intro.txt b/lib/plugins/popularity/lang/sl/intro.txt new file mode 100644 index 000000000..ceb0e61e6 --- /dev/null +++ b/lib/plugins/popularity/lang/sl/intro.txt @@ -0,0 +1,9 @@ +====== Poroilo o uporabi ====== + +To orodje je namenjeno zbiranju brezimnih podatkov o postavljeni Dokuwiki strani in omogoa poiljanje nekaterih podatkov neposredno razvijalcem sistema. S temi podatki lahko razvijalci razumejo naine uporabe sistema, zahteve uporabnikov in pogostost uporabe, kar s statistinimi podatki vpliva tudi na nadaljnji razvoj sistema. + +Priporoeno je, da poroilo o uporabi poljete vsake toliko asa, saj lahko le tako razvijalci dobijo podatke o hitrosti rasti spletia in pogostosti uporabe. Vsi podatki so poslani oznaeni s posebno vpisno tevilko, ki omogoa brezimno sledenje. + +Zbrani podatki vsebujejo podrobnosti o razliici uporabljenega sistema DokuWiki, tevilo in velikost wiki strani, datotekah, ki so naloene na sistem in podatke o vstavkih ter PHP namestitvi in razliici. + +Surovi podatki, ki bodo poslani so prikazani spodaj. S pritiskom na gumb "Polji podatke", bodo ti poslani na strenik razvijalcev. diff --git a/lib/plugins/popularity/lang/sl/lang.php b/lib/plugins/popularity/lang/sl/lang.php index befb1eec0..5c92dd7c4 100644 --- a/lib/plugins/popularity/lang/sl/lang.php +++ b/lib/plugins/popularity/lang/sl/lang.php @@ -2,7 +2,12 @@ /** * Slovenian language file * - * @author Dejan Levec <webphp@gmail.com> - * @author Boštjan Seničar <senicar@gmail.com> + * @author Matej Urbančič (mateju@svn.gnome.org) */ -$lang['submit'] = 'Pošlji'; +$lang['name'] = 'Poročilo o uporabi (nalaganje strani je lahko dolgotrajno)'; +$lang['submit'] = 'Pošlji podatke'; +$lang['autosubmit'] = 'Samodejno pošlji podatke enkrat mesečno'; +$lang['submissionFailed'] = 'Podatkov zaradi napake ni mogoče poslati:'; +$lang['submitDirectly'] = 'Podatke je mogoče poslati ročno s pošiljanjem preko obrazca.'; +$lang['autosubmitError'] = 'Zadnji poskus samodejnega pošiljanja je spodletel zaradi napake:'; +$lang['lastSent'] = 'Podatki so bili uspešno poslani.'; diff --git a/lib/plugins/popularity/lang/sl/submitted.txt b/lib/plugins/popularity/lang/sl/submitted.txt new file mode 100644 index 000000000..988afd837 --- /dev/null +++ b/lib/plugins/popularity/lang/sl/submitted.txt @@ -0,0 +1,3 @@ +====== Poroilo o uporabi ====== + +Podatki so bili uspeno poslani. diff --git a/lib/plugins/popularity/lang/sv/lang.php b/lib/plugins/popularity/lang/sv/lang.php index 10e71b790..8be542e7f 100644 --- a/lib/plugins/popularity/lang/sv/lang.php +++ b/lib/plugins/popularity/lang/sv/lang.php @@ -12,6 +12,12 @@ * @author Bogge Bogge <bogge@bogge.com> * @author Peter Åström <eaustreum@gmail.com> * @author Håkan Sandell <hakan.sandell@home.se> + * @author mikael@mallander.net */ $lang['name'] = 'Popularitets-feedback (det kan ta en stund att ladda sidan)'; $lang['submit'] = 'Sänd data'; +$lang['autosubmit'] = 'Skicka data automatiskt varje månad'; +$lang['submissionFailed'] = 'Datan kunde inte skickas för att:'; +$lang['submitDirectly'] = 'Du kan skicka datan manuellt genom att fylla i följande formulär.'; +$lang['autosubmitError'] = 'Senaste automatiska sändning av datan misslyckades för att:'; +$lang['lastSent'] = 'Datan har skickats'; diff --git a/lib/plugins/popularity/lang/sv/submitted.txt b/lib/plugins/popularity/lang/sv/submitted.txt new file mode 100644 index 000000000..fb8eab773 --- /dev/null +++ b/lib/plugins/popularity/lang/sv/submitted.txt @@ -0,0 +1,3 @@ +====== Popularitetsfeedback ====== + +Datan har skickats utan problem.
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/uk/lang.php b/lib/plugins/popularity/lang/uk/lang.php index 157944fe4..584641482 100644 --- a/lib/plugins/popularity/lang/uk/lang.php +++ b/lib/plugins/popularity/lang/uk/lang.php @@ -7,6 +7,12 @@ * @author Oleksandr Kunytsia <okunia@gmail.com> * @author Uko uko@uar.net * @author Ulrikhe Lukoie <lukoie@gmail>.com + * @author Kate Arzamastseva pshns@ukr.net */ $lang['name'] = 'Відгук популярності (може зайняти деякий час)'; $lang['submit'] = 'Передати дані'; +$lang['autosubmit'] = 'Автоматично надсилати дані один раз на місяць'; +$lang['submissionFailed'] = 'Дані не можуть бути відправлені через таку помилку:'; +$lang['submitDirectly'] = 'Ви можете надіслати дані вручну, відправивши наступну форму.'; +$lang['autosubmitError'] = 'Останнє автоматичне відправлення не вдалося через таку помилку:'; +$lang['lastSent'] = 'Дані були відправлені'; diff --git a/lib/plugins/popularity/lang/zh-tw/intro.txt b/lib/plugins/popularity/lang/zh-tw/intro.txt index 54444afc0..37c63dced 100644 --- a/lib/plugins/popularity/lang/zh-tw/intro.txt +++ b/lib/plugins/popularity/lang/zh-tw/intro.txt @@ -1,9 +1,10 @@ -====== 人氣反饋 ====== +====== 人氣回饋 ====== -本工具收集關於您維基站點的匿名信息，並允許您將其發送給 DokuWiki 的開發者。這樣做有助於我們了解用戶是如何使用 DokuWiki 的，並能使我們未來的開發決策建立在現實使用數據上。 +本工具會從您的維基站台收集訊息，並以匿名的方式發送給 DokuWiki 的開發者。這有助於他們了解使用者們如何使用 DokuWiki ，並能基於實際統計資料對未來開發做出更準確的決策。 -我們鼓勵您不時重復該步驟，以便我們能了解您的維基站點發展進度。您的數據集將被匿名 ID 標識。 +我們鼓勵您經常重複這個步驟，讓開發者了解您的維基站台的成長情形。您的資料集將會被標識為一個匿名的識別碼 (ID)。 -收集的數據包括 DokuWiki 版本、您的頁面數量以及文件大小、已安裝的插件、服務器上的 PHP 相關信息。 +收集的資料包括 DokuWiki 版本、頁面數量、檔案大小、安裝的插件、伺服器的 PHP 資訊。 + +將被發送的原始資料顯示如下。請點擊「發送資料」按鈕進行傳輸。 -將被發送的原始數據如下所示。請點擊“發送數據”按扭進行傳輸。
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/zh-tw/lang.php b/lib/plugins/popularity/lang/zh-tw/lang.php index 4757ab84b..3ced0ee5a 100644 --- a/lib/plugins/popularity/lang/zh-tw/lang.php +++ b/lib/plugins/popularity/lang/zh-tw/lang.php @@ -7,6 +7,13 @@ * @author Wayne San <waynesan@zerozone.tw> * @author Li-Jiun Huang <ljhuang.tw@gmai.com> * @author Cheng-Wei Chien <e.cwchien@gmail.com> + * @author Danny Lin + * @author Shuo-Ting Jian <shoting@gmail.com> */ -$lang['name'] = '人氣反饋（載入可能需要一些時間）'; -$lang['submit'] = '發送數據'; +$lang['name'] = '人氣回饋（載入可能需要一些時間）'; +$lang['submit'] = '發送資料'; +$lang['autosubmit'] = '每月自動發送'; +$lang['submissionFailed'] = '由於以下原因，資料無法發送:'; +$lang['submitDirectly'] = '你可以利用以下的表單來發手動發送資料.'; +$lang['autosubmitError'] = '由於以下原因，上次自動發送失敗:'; +$lang['lastSent'] = '資料已發送'; diff --git a/lib/plugins/popularity/lang/zh-tw/submitted.txt b/lib/plugins/popularity/lang/zh-tw/submitted.txt new file mode 100644 index 000000000..6febcd5b8 --- /dev/null +++ b/lib/plugins/popularity/lang/zh-tw/submitted.txt @@ -0,0 +1,3 @@ +====== 人氣回饋 ====== + +資料已發送成功
\ No newline at end of file diff --git a/lib/plugins/popularity/lang/zh/lang.php b/lib/plugins/popularity/lang/zh/lang.php index 191b9c1af..a2464762d 100644 --- a/lib/plugins/popularity/lang/zh/lang.php +++ b/lib/plugins/popularity/lang/zh/lang.php @@ -10,6 +10,13 @@ * @author ben <ben@livetom.com> * @author lainme <lainme993@gmail.com> * @author caii <zhoucaiqi@gmail.com> + * @author Hiphen Lee <jacob.b.leung@gmail.com> + * @author caii, patent agent in China <zhoucaiqi@gmail.com> */ $lang['name'] = '人气反馈（载入可能需要一些时间）'; $lang['submit'] = '发送数据'; +$lang['autosubmit'] = '每月自动发送'; +$lang['submissionFailed'] = '数据由于以下原因不恩你给发送：'; +$lang['submitDirectly'] = '你可以手动提交下面的表单来发送数据。'; +$lang['autosubmitError'] = '印以下原因，上一次自动提交失败：'; +$lang['lastSent'] = '数据已发送'; diff --git a/lib/plugins/popularity/lang/zh/submitted.txt b/lib/plugins/popularity/lang/zh/submitted.txt new file mode 100644 index 000000000..6039b70e1 --- /dev/null +++ b/lib/plugins/popularity/lang/zh/submitted.txt @@ -0,0 +1,3 @@ +====== 人气反馈 ====== + +数据发送成功。
\ No newline at end of file diff --git a/lib/plugins/popularity/plugin.info.txt b/lib/plugins/popularity/plugin.info.txt index 2652bd669..16b148f41 100644 --- a/lib/plugins/popularity/plugin.info.txt +++ b/lib/plugins/popularity/plugin.info.txt @@ -1,7 +1,7 @@ base popularity author Andreas Gohr email andi@splitbrain.org -date 2010-12-09 +date 2011-08-18 name Popularity Feedback Plugin desc Send anonymous data about your wiki to the developers. url http://www.dokuwiki.org/plugin:popularity diff --git a/lib/plugins/revert/lang/ar/lang.php b/lib/plugins/revert/lang/ar/lang.php index 1e4e104fb..a073c336d 100644 --- a/lib/plugins/revert/lang/ar/lang.php +++ b/lib/plugins/revert/lang/ar/lang.php @@ -4,6 +4,7 @@ * * @author Yaman Hokan <always.smile.yh@hotmail.com> * @author Usama Akkad <uahello@gmail.com> + * @author uahello@gmail.com */ $lang['menu'] = 'مدير الاسترجاع'; $lang['filter'] = 'ابحث في الصفحات المتأذاة'; diff --git a/lib/plugins/revert/lang/bg/intro.txt b/lib/plugins/revert/lang/bg/intro.txt index ab7308d6d..44d5a0938 100644 --- a/lib/plugins/revert/lang/bg/intro.txt +++ b/lib/plugins/revert/lang/bg/intro.txt @@ -1,4 +1,4 @@ ====== Възстановяване ====== -Тази страница помага при автоматичното възстановяване от спам-атака. За да намерите списък със спамнати страници, въведете текст за търсене(пр. спам препратка), след това потвърдете, че намерените страници са наистина спам и възстановете редакциите. +Страницата помага за автоматично възстановяване след SPAM атака. За да намерите спамнатите страници, въведете текст за търсене (напр. линк от SPAM съобщението), след това потвърдете, че намерените страници са наистина SPAM и възстановете старите им версии. diff --git a/lib/plugins/revert/lang/bg/lang.php b/lib/plugins/revert/lang/bg/lang.php index 6f0ff0672..0819de01a 100644 --- a/lib/plugins/revert/lang/bg/lang.php +++ b/lib/plugins/revert/lang/bg/lang.php @@ -3,13 +3,14 @@ * bulgarian language file * @author Nikolay Vladimirov <nikolay@vladimiroff.com> * @author Viktor Usunov <usun0v@mail.bg> + * @author Kiril <neohidra@gmail.com> */ $lang['menu'] = 'Възстановяване'; -$lang['filter'] = 'Търсене на спамната страници'; -$lang['revert'] = 'Избрани страници за възстановяване'; -$lang['reverted'] = '%s върнат до версия %s'; -$lang['removed'] = '%s премахнат'; +$lang['filter'] = 'Търсене на спамнати страници'; +$lang['revert'] = 'Възстанови избраните страници'; +$lang['reverted'] = '%s върната до версия %s'; +$lang['removed'] = '%s премахната'; $lang['revstart'] = 'Процесът на възстановяване започна. Това може да отнеме много време. Ако скриптът се просрочи преди да завърши, трябва да възстановявате на по-малки парчета.'; $lang['revstop'] = 'Процесът на възстановяване завърши успешно.'; -$lang['note1'] = 'Забележка: за търсенето имат значение малки/големи букви'; -$lang['note2'] = 'Забележка: страницата ще бъде възвърната без да съдържа спам терминът <i>%s</i>.'; +$lang['note1'] = 'Бележка: при търсенето се различават малки от големи букви'; +$lang['note2'] = 'Бележка: страницата ще бъде върната към стара версия без SPAM терминa <i>%s</i>.'; diff --git a/lib/plugins/revert/lang/cs/lang.php b/lib/plugins/revert/lang/cs/lang.php index ca0474cba..5c8899200 100644 --- a/lib/plugins/revert/lang/cs/lang.php +++ b/lib/plugins/revert/lang/cs/lang.php @@ -9,6 +9,7 @@ * @author tomas@valenta.cz * @author Marek Sacha <sachamar@fel.cvut.cz> * @author Lefty <lefty@multihost.cz> + * @author Vojta Beran <xmamut@email.cz> */ $lang['menu'] = 'Obnova zaspamovaných stránek'; $lang['filter'] = 'Hledat zaspamované stránky'; diff --git a/lib/plugins/revert/lang/de-informal/lang.php b/lib/plugins/revert/lang/de-informal/lang.php index ac2f35e85..b6709d2fa 100644 --- a/lib/plugins/revert/lang/de-informal/lang.php +++ b/lib/plugins/revert/lang/de-informal/lang.php @@ -6,6 +6,7 @@ * @author Juergen Schwarzer <jschwarzer@freenet.de> * @author Marcel Metz <marcel_metz@gmx.de> * @author Matthias Schulte <post@lupo49.de> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Zurückstellungsmanager'; $lang['filter'] = 'Durchsuche als Spam markierte Seiten'; diff --git a/lib/plugins/revert/lang/de/lang.php b/lib/plugins/revert/lang/de/lang.php index 5dee8007b..0bc8e2ce0 100644 --- a/lib/plugins/revert/lang/de/lang.php +++ b/lib/plugins/revert/lang/de/lang.php @@ -12,6 +12,8 @@ * @author Blitzi94@gmx.de * @author Robert Bogenschneider <robog@GMX.de> * @author Robert Bogenschneider <robog@gmx.de> + * @author Niels Lange <niels@boldencursief.nl> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Seiten wieder herstellen'; $lang['filter'] = 'Nach betroffenen Seiten suchen'; diff --git a/lib/plugins/revert/lang/es/lang.php b/lib/plugins/revert/lang/es/lang.php index 420454d45..7e357e3db 100644 --- a/lib/plugins/revert/lang/es/lang.php +++ b/lib/plugins/revert/lang/es/lang.php @@ -17,6 +17,7 @@ * @author Fernando J. Gómez <fjgomez@gmail.com> * @author Victor Castelan <victorcastelan@gmail.com> * @author Mauro Javier Giamberardino <mgiamberardino@gmail.com> + * @author emezeta <emezeta@infoprimo.com> */ $lang['menu'] = 'Restaurador'; $lang['filter'] = 'Buscar páginas con spam'; diff --git a/lib/plugins/revert/lang/et/lang.php b/lib/plugins/revert/lang/et/lang.php new file mode 100644 index 000000000..ca1410ab0 --- /dev/null +++ b/lib/plugins/revert/lang/et/lang.php @@ -0,0 +1,7 @@ +<?php +/** + * Estonian language file + * + * @author kristian.kankainen@kuu.la + * @author Rivo Zängov <eraser@eraser.ee> + */ diff --git a/lib/plugins/revert/lang/fi/lang.php b/lib/plugins/revert/lang/fi/lang.php index 26bc6b76a..fdf9bb81c 100644 --- a/lib/plugins/revert/lang/fi/lang.php +++ b/lib/plugins/revert/lang/fi/lang.php @@ -5,6 +5,7 @@ * @author otto@valjakko.net * @author Otto Vainio <otto@valjakko.net> * @author Teemu Mattila <ghcsystems@gmail.com> + * @author Sami Olmari <sami@olmari.fi> */ $lang['menu'] = 'Palautuksenhallinta'; $lang['filter'] = 'Etsi spammattyjä sivuja'; diff --git a/lib/plugins/revert/lang/fr/lang.php b/lib/plugins/revert/lang/fr/lang.php index d80ece209..17a2c3a01 100644 --- a/lib/plugins/revert/lang/fr/lang.php +++ b/lib/plugins/revert/lang/fr/lang.php @@ -13,6 +13,8 @@ * @author Philippe Bajoit <philippe.bajoit@gmail.com> * @author Florian Gaub <floriang@floriang.net> * @author Samuel Dorsaz samuel.dorsaz@novelion.net + * @author Johan Guilbaud <guilbaud.johan@gmail.com> + * @author schplurtz@laposte.net */ $lang['menu'] = 'Gestionnaire de réversions'; $lang['filter'] = 'Trouver les pages spammées '; diff --git a/lib/plugins/revert/lang/he/lang.php b/lib/plugins/revert/lang/he/lang.php index 585487816..ac3c3412e 100644 --- a/lib/plugins/revert/lang/he/lang.php +++ b/lib/plugins/revert/lang/he/lang.php @@ -5,6 +5,7 @@ * @author Dotan Kamber <kamberd@yahoo.com> * @author Moshe Kaplan <mokplan@gmail.com> * @author Yaron Yogev <yaronyogev@gmail.com> + * @author Yaron Shahrabani <sh.yaron@gmail.com> */ $lang['menu'] = 'מנהל שחזור'; $lang['filter'] = 'חפש דפים עם ספאם'; diff --git a/lib/plugins/revert/lang/hr/lang.php b/lib/plugins/revert/lang/hr/lang.php index d2094b77b..96f1d6afe 100644 --- a/lib/plugins/revert/lang/hr/lang.php +++ b/lib/plugins/revert/lang/hr/lang.php @@ -4,4 +4,5 @@ * * @author Branko Rihtman <theney@gmail.com> * @author Dražen Odobašić <dodobasic@gmail.com> + * @author Dejan Igrec dejan.igrec@gmail.com */ diff --git a/lib/plugins/revert/lang/hu/lang.php b/lib/plugins/revert/lang/hu/lang.php index 6cbdf3643..058a63196 100644 --- a/lib/plugins/revert/lang/hu/lang.php +++ b/lib/plugins/revert/lang/hu/lang.php @@ -5,8 +5,9 @@ * @author Sandor TIHANYI <stihanyi+dw@gmail.com> * @author Siaynoq Mage <siaynoqmage@gmail.com> * @author schilling.janos@gmail.com - * @author Szabó Dávid (szabo.david@gyumolcstarhely.hu) * @author Szabó Dávid <szabo.david@gyumolcstarhely.hu> + * @author Sándor TIHANYI <stihanyi+dw@gmail.com> + * @author David Szabo <szabo.david@gyumolcstarhely.hu> */ $lang['menu'] = 'Visszaállítás kezelő (anti-SPAM)'; $lang['filter'] = 'SPAM tartalmú oldalak keresése'; diff --git a/lib/plugins/revert/lang/it/lang.php b/lib/plugins/revert/lang/it/lang.php index 319493acd..79565655b 100644 --- a/lib/plugins/revert/lang/it/lang.php +++ b/lib/plugins/revert/lang/it/lang.php @@ -9,6 +9,7 @@ * @author snarchio@alice.it * @author robocap <robocap1@gmail.com> * @author Osman Tekin osman.tekin93@hotmail.it + * @author Jacopo Corbetta <jacopo.corbetta@gmail.com> */ $lang['menu'] = 'Gestore di ripristini'; $lang['filter'] = 'Cerca pagine con spam'; diff --git a/lib/plugins/revert/lang/kk/lang.php b/lib/plugins/revert/lang/kk/lang.php new file mode 100644 index 000000000..dde5b9577 --- /dev/null +++ b/lib/plugins/revert/lang/kk/lang.php @@ -0,0 +1,6 @@ +<?php +/** + * kazakh language file + * + * @author Nurgozha Kaliaskarov astana08@gmail.com + */ diff --git a/lib/plugins/revert/lang/la/intro.txt b/lib/plugins/revert/lang/la/intro.txt index 35916f683..99a206f63 100644 --- a/lib/plugins/revert/lang/la/intro.txt +++ b/lib/plugins/revert/lang/la/intro.txt @@ -1,3 +1,3 @@ ====== Restituendi Administrator ====== -Haec pagina contra mala interretialia paginas restituta. Ut paginas aegras quaeras, malum VRL scribe, deinde paginas malas eligas.
\ No newline at end of file +Haec pagina contra mala interretialia paginas restituta. Vt paginas aegras quaeras, malum VRL scribe, deinde paginas malas eligas.
\ No newline at end of file diff --git a/lib/plugins/revert/lang/la/lang.php b/lib/plugins/revert/lang/la/lang.php index f742e63f2..af4203437 100644 --- a/lib/plugins/revert/lang/la/lang.php +++ b/lib/plugins/revert/lang/la/lang.php @@ -2,6 +2,7 @@ /** * Latin language file * + * @author Massimiliano Vassalli <vassalli.max@gmail.com> */ $lang['menu'] = 'Restituendi administrator'; $lang['filter'] = 'Malas paginas quaerere'; diff --git a/lib/plugins/revert/lang/no/lang.php b/lib/plugins/revert/lang/no/lang.php index 262ea3fe5..6f9ba2555 100644 --- a/lib/plugins/revert/lang/no/lang.php +++ b/lib/plugins/revert/lang/no/lang.php @@ -12,6 +12,7 @@ * @author Lisa Ditlefsen <lisa@vervesearch.com> * @author Erik Pedersen <erik.pedersen@shaw.ca> * @author Erik Bjørn Pedersen <erik.pedersen@shaw.ca> + * @author Rune Rasmussen syntaxerror.no@gmail.com */ $lang['menu'] = 'Tilbakestillingsbehandler'; $lang['filter'] = 'Søk etter søppelmeldinger'; diff --git a/lib/plugins/revert/lang/pt/lang.php b/lib/plugins/revert/lang/pt/lang.php index 4ad114efe..3b2850f41 100644 --- a/lib/plugins/revert/lang/pt/lang.php +++ b/lib/plugins/revert/lang/pt/lang.php @@ -6,6 +6,7 @@ * @author Enrico Nicoletto <liverig@gmail.com> * @author Fil <fil@meteopt.com> * @author André Neves <drakferion@gmail.com> + * @author José Campos zecarlosdecampos@gmail.com */ $lang['menu'] = 'Gestor de Reversões'; $lang['filter'] = 'Pesquisar por páginas "spammy"'; diff --git a/lib/plugins/revert/lang/ru/intro.txt b/lib/plugins/revert/lang/ru/intro.txt index 66c5af005..52d1f8d3d 100644 --- a/lib/plugins/revert/lang/ru/intro.txt +++ b/lib/plugins/revert/lang/ru/intro.txt @@ -1,3 +1,3 @@ ====== Менеджер откаток ====== -Эта страница поможет вам в автоматической откатке изменений после спам-атаки. Для того, чтобы найти спам-страницы, введите ключевые слова и произведите поиск (например, по URL спамера). Затем убедитесь, что найденные страницы действительно содержат спам, и сделайте откатку изменений. +Эта страница поможет вам в автоматической откатке изменений после спам-атаки. Для того, чтобы найти спам-страницы, введите ключевые слова и произведите поиск (например, по URL спамера). Затем убедитесь, что найденные страницы действительно содержат спам и сделайте откатку изменений. diff --git a/lib/plugins/revert/lang/ru/lang.php b/lib/plugins/revert/lang/ru/lang.php index 712a41f08..9624d8fd6 100644 --- a/lib/plugins/revert/lang/ru/lang.php +++ b/lib/plugins/revert/lang/ru/lang.php @@ -12,6 +12,8 @@ * @author Vlad Tsybenko <vlad.development@gmail.com> * @author Aleksey Osadchiy <rfc@nm.ru> * @author Aleksandr Selivanov <alexgearbox@gmail.com> + * @author Ladyko Andrey <fylh@succexy.spb.ru> + * @author Eugene <windy.wanderer@gmail.com> */ $lang['menu'] = 'Менеджер откаток'; $lang['filter'] = 'Поиск спам-страниц'; diff --git a/lib/plugins/revert/lang/sl/intro.txt b/lib/plugins/revert/lang/sl/intro.txt new file mode 100644 index 000000000..c63f281ed --- /dev/null +++ b/lib/plugins/revert/lang/sl/intro.txt @@ -0,0 +1,3 @@ +====== Povrnitev okvarjene vsebine ====== + +Na tej strani je mogoe povrniti vsebino wiki strani na izvorne vrednosti po napadu na stran in vpisu neelenih vsebin. Za iskanje strani z neeleno vsebino, uporabite iskalnik z ustreznim nizom (npr. naslov URL), potem pa potrdite, da so najdene strani res z neeleno vsebino in nato povrnite stanje na zadnjo pravo razliico. diff --git a/lib/plugins/revert/lang/sl/lang.php b/lib/plugins/revert/lang/sl/lang.php index 1fcf4ca36..92b0427ce 100644 --- a/lib/plugins/revert/lang/sl/lang.php +++ b/lib/plugins/revert/lang/sl/lang.php @@ -2,6 +2,14 @@ /** * Slovenian language file * - * @author Dejan Levec <webphp@gmail.com> - * @author Boštjan Seničar <senicar@gmail.com> + * @author Matej Urbančič (mateju@svn.gnome.org) */ +$lang['menu'] = 'Povrnitev okvarjene vsebine'; +$lang['filter'] = 'Iskanje strani z neželeno vsebino'; +$lang['revert'] = 'Povrni izbrane strani'; +$lang['reverted'] = 'stran %s je povrnjena na različico %s'; +$lang['removed'] = 'stran %s je odstranjena'; +$lang['revstart'] = 'Postopek povrnitve vsebine je začet. Opravilo je lahko dolgotrajno. V kolikor opravilo časovno poteče prek končanjem povrnitve, bo treba postopek ponoviti na manjših odsekih.'; +$lang['revstop'] = 'Postopek povrnitve vsebine je uspešno končan.'; +$lang['note1'] = 'Opomba: iskanje upošteva velikost črk'; +$lang['note2'] = 'Opomba: stran bo povrnjena na zadnjo različico brez neželenega pojma <i>%s</i>.'; diff --git a/lib/plugins/revert/lang/sv/lang.php b/lib/plugins/revert/lang/sv/lang.php index 1b6ca3374..29c6702eb 100644 --- a/lib/plugins/revert/lang/sv/lang.php +++ b/lib/plugins/revert/lang/sv/lang.php @@ -14,6 +14,7 @@ * @author Bogge Bogge <bogge@bogge.com> * @author Peter Åström <eaustreum@gmail.com> * @author Håkan Sandell <hakan.sandell@home.se> + * @author mikael@mallander.net */ $lang['menu'] = 'Hantera återställningar'; $lang['filter'] = 'Sök efter spamsidor'; diff --git a/lib/plugins/revert/lang/uk/lang.php b/lib/plugins/revert/lang/uk/lang.php index ffc394f43..310f8e8da 100644 --- a/lib/plugins/revert/lang/uk/lang.php +++ b/lib/plugins/revert/lang/uk/lang.php @@ -7,13 +7,14 @@ * @author Oleksandr Kunytsia <okunia@gmail.com> * @author Uko uko@uar.net * @author Ulrikhe Lukoie <lukoie@gmail>.com + * @author Kate Arzamastseva pshns@ukr.net */ $lang['menu'] = 'Менеджер відновлення'; $lang['filter'] = 'Пошук спамних сторінок'; $lang['revert'] = 'Відновити обрані сторінки'; $lang['reverted'] = '%s відновлено до версії %s'; $lang['removed'] = '%s вилучено'; -$lang['revstart'] = 'Розпочато процес відновлення. Це може зайняти багато часу. Якщо скрипт закінчує роботу по таймауту, необхідно відновлювати меншими частинами.'; +$lang['revstart'] = 'Розпочато процес відновлення. Це може зайняти багато часу. Якщо скрипт не закінчує роботу до таймауту, необхідно відновлювати меншими частинами.'; $lang['revstop'] = 'Процес відновлення успішно закінчено.'; $lang['note1'] = 'Увага: пошук залежить від регістру символів'; $lang['note2'] = 'Увага: сторінку буде відновлено до останньої версії, яка не містить спамерського терміну <i>%s</i>.'; diff --git a/lib/plugins/revert/lang/zh-tw/intro.txt b/lib/plugins/revert/lang/zh-tw/intro.txt index 2aad10206..17632b1dd 100644 --- a/lib/plugins/revert/lang/zh-tw/intro.txt +++ b/lib/plugins/revert/lang/zh-tw/intro.txt @@ -1,3 +1,3 @@ ====== 還原管理器 ====== -該頁面能幫助您的頁面從垃圾信息的攻擊中自動還原過來。 請先輸入關鍵詞搜索包含垃圾信息的頁面（如某個垃圾信息的 URL），然后請確定搜索結果的確包含垃圾信息，並將其還原至先前的修訂版。 +本頁面能幫助您自動還原被垃圾訊息攻擊的頁面過來。先輸入關鍵字詞搜尋包含垃圾訊息的頁面（如垃圾訊息的 URL），確認找到的頁面確實包含垃圾訊息，再將它們還原。 diff --git a/lib/plugins/revert/lang/zh-tw/lang.php b/lib/plugins/revert/lang/zh-tw/lang.php index 40a137dc0..a853ccd2e 100644 --- a/lib/plugins/revert/lang/zh-tw/lang.php +++ b/lib/plugins/revert/lang/zh-tw/lang.php @@ -7,13 +7,15 @@ * @author Wayne San <waynesan@zerozone.tw> * @author Li-Jiun Huang <ljhuang.tw@gmai.com> * @author Cheng-Wei Chien <e.cwchien@gmail.com> + * @author Danny Lin <danny0838@pchome.com.tw> + * @author Shuo-Ting Jian <shoting@gmail.com> */ $lang['menu'] = '還原管理'; -$lang['filter'] = '搜索包含垃圾信息的頁面'; -$lang['revert'] = '還原所選的頁面'; -$lang['reverted'] = '%s已還原到版本%s'; -$lang['removed'] = '%s已移除'; -$lang['revstart'] = '已開始還原操作。有可能需要很長時間。如果計時器在還原操作完成前停止了，請嘗試還原較少的內容。'; -$lang['revstop'] = '還原程序已成工的完成。'; -$lang['note1'] = '注意: 搜尋有分大小寫'; -$lang['note2'] = '注意: 此頁將會被還原到不包含給予的spam term <i>%s</i> 的最新版本.'; +$lang['filter'] = '搜索包含垃圾訊息的頁面'; +$lang['revert'] = '還原選取的頁面'; +$lang['reverted'] = '%s 已還原為版本 %s'; +$lang['removed'] = '%s 已移除'; +$lang['revstart'] = '已開始還原操作。有可能需要很長時間。如果程式執行逾時，請嘗試分次還原少量內容。'; +$lang['revstop'] = '還原程序已成功完成。'; +$lang['note1'] = '注意：搜尋區分大小寫'; +$lang['note2'] = '注意：此頁面將被還原為最後一個不含垃圾訊息 <i>%s</i> 的版本。'; diff --git a/lib/plugins/revert/lang/zh/lang.php b/lib/plugins/revert/lang/zh/lang.php index 5ff1ed426..eb8733618 100644 --- a/lib/plugins/revert/lang/zh/lang.php +++ b/lib/plugins/revert/lang/zh/lang.php @@ -11,6 +11,8 @@ * @author ben <ben@livetom.com> * @author lainme <lainme993@gmail.com> * @author caii <zhoucaiqi@gmail.com> + * @author Hiphen Lee <jacob.b.leung@gmail.com> + * @author caii, patent agent in China <zhoucaiqi@gmail.com> */ $lang['menu'] = '还原管理器'; $lang['filter'] = '搜索包含垃圾信息的页面'; diff --git a/lib/plugins/safefnrecode/action.php b/lib/plugins/safefnrecode/action.php new file mode 100644 index 000000000..5d3eaae3a --- /dev/null +++ b/lib/plugins/safefnrecode/action.php @@ -0,0 +1,68 @@ +<?php +/** + * DokuWiki Plugin safefnrecode (Action Component) + * + * @license GPL 2 http://www.gnu.org/licenses/gpl-2.0.html + * @author Andreas Gohr <andi@splitbrain.org> + */ + +// must be run within Dokuwiki +if (!defined('DOKU_INC')) die(); + +require_once DOKU_PLUGIN.'action.php'; + +class action_plugin_safefnrecode extends DokuWiki_Action_Plugin { + + public function register(Doku_Event_Handler &$controller) { + + $controller->register_hook('INDEXER_TASKS_RUN', 'BEFORE', $this, 'handle_indexer_tasks_run'); + + } + + public function handle_indexer_tasks_run(Doku_Event &$event, $param) { + global $conf; + if($conf['fnencode'] != 'safe') return; + + if(!file_exists($conf['datadir'].'_safefn.recoded')){ + $this->recode($conf['datadir']); + touch($conf['datadir'].'_safefn.recoded'); + } + + if(!file_exists($conf['olddir'].'_safefn.recoded')){ + $this->recode($conf['olddir']); + touch($conf['olddir'].'_safefn.recoded'); + } + + if(!file_exists($conf['metadir'].'_safefn.recoded')){ + $this->recode($conf['metadir']); + touch($conf['metadir'].'_safefn.recoded'); + } + + if(!file_exists($conf['mediadir'].'_safefn.recoded')){ + $this->recode($conf['mediadir']); + touch($conf['mediadir'].'_safefn.recoded'); + } + + } + + /** + * Recursive function to rename all safe encoded files to use the new + * square bracket post indicator + */ + private function recode($dir){ + $dh = opendir($dir); + if(!$dh) return; + while (($file = readdir($dh)) !== false) { + if($file == '.' || $file == '..') continue; # cur and upper dir + if(is_dir("$dir/$file")) $this->recode("$dir/$file"); #recurse + if(strpos($file,'%') === false) continue; # no encoding used + $new = preg_replace('/(%[^\]]*?)\./','\1]',$file); # new post indicator + if(preg_match('/%[^\]]+$/',$new)) $new .= ']'; # fix end FS#2122 + rename("$dir/$file","$dir/$new"); # rename it + } + closedir($dh); + } + +} + +// vim:ts=4:sw=4:et: diff --git a/lib/plugins/safefnrecode/plugin.info.txt b/lib/plugins/safefnrecode/plugin.info.txt new file mode 100644 index 000000000..b1600060c --- /dev/null +++ b/lib/plugins/safefnrecode/plugin.info.txt @@ -0,0 +1,7 @@ +base safefnrecode +author Andreas Gohr +email andi@splitbrain.org +date 2011-04-03 +name safefnrecode plugin +desc Changes existing page and foldernames for the change in the safe filename encoding +url http://www.dokuwiki.org/plugin:safefnrecode diff --git a/lib/plugins/syntax.php b/lib/plugins/syntax.php index 05b0dc466..12451f636 100644 --- a/lib/plugins/syntax.php +++ b/lib/plugins/syntax.php @@ -188,10 +188,13 @@ class DokuWiki_Syntax_Plugin extends Doku_Parser_Mode { function localFN($id) { global $conf; $plugin = $this->getPluginName(); - $file = DOKU_PLUGIN.$plugin.'/lang/'.$conf['lang'].'/'.$id.'.txt'; - if(!@file_exists($file)){ - //fall back to english - $file = DOKU_PLUGIN.$plugin.'/lang/en/'.$id.'.txt'; + $file = DOKU_CONF.'/plugin_lang/'.$plugin.'/'.$conf['lang'].'/'.$id.'.txt'; + if (!@file_exists($file)){ + $file = DOKU_PLUGIN.$plugin.'/lang/'.$conf['lang'].'/'.$id.'.txt'; + if(!@file_exists($file)){ + //fall back to english + $file = DOKU_PLUGIN.$plugin.'/lang/en/'.$id.'.txt'; + } } return $file; } diff --git a/lib/plugins/usermanager/admin.php b/lib/plugins/usermanager/admin.php index df13f65e3..e40ee9b7e 100644 --- a/lib/plugins/usermanager/admin.php +++ b/lib/plugins/usermanager/admin.php @@ -562,16 +562,19 @@ class admin_plugin_usermanager extends DokuWiki_Admin_Plugin { * @return array(user, password, full name, email, array(groups)) */ function _retrieveUser($clean=true) { + global $auth; - $user[0] = ($clean) ? cleanID(preg_replace('/.*:/','',$_REQUEST['userid'])) : $_REQUEST['userid']; + $user[0] = ($clean) ? $auth->cleanUser($_REQUEST['userid']) : $_REQUEST['userid']; $user[1] = $_REQUEST['userpass']; $user[2] = $_REQUEST['username']; $user[3] = $_REQUEST['usermail']; - $user[4] = preg_split('/\s*,\s*/',$_REQUEST['usergroups'],-1,PREG_SPLIT_NO_EMPTY); + $user[4] = explode(',',$_REQUEST['usergroups']); - if (empty($user[4]) || (is_array($user[4]) && (count($user[4]) == 1) && (trim($user[4][0]) == ''))) { - $user[4] = null; - } + $user[4] = array_map('trim',$user[4]); + if($clean) $user[4] = array_map(array($auth,'cleanGroup'),$user[4]); + $user[4] = array_filter($user[4]); + $user[4] = array_unique($user[4]); + if(!count($user[4])) $user[4] = null; return $user; } diff --git a/lib/plugins/usermanager/images/search.png b/lib/plugins/usermanager/images/search.png Binary files differindex 1aa445f03..e9dabc11e 100644 --- a/lib/plugins/usermanager/images/search.png +++ b/lib/plugins/usermanager/images/search.png diff --git a/lib/plugins/usermanager/lang/ar/lang.php b/lib/plugins/usermanager/lang/ar/lang.php index 6c1b2b840..d4b891320 100644 --- a/lib/plugins/usermanager/lang/ar/lang.php +++ b/lib/plugins/usermanager/lang/ar/lang.php @@ -4,6 +4,7 @@ * * @author Yaman Hokan <always.smile.yh@hotmail.com> * @author Usama Akkad <uahello@gmail.com> + * @author uahello@gmail.com */ $lang['menu'] = 'مدير المستخدمين'; $lang['noauth'] = '(مصادقة المستخدمين غير متوفرة)'; diff --git a/lib/plugins/usermanager/lang/bg/lang.php b/lib/plugins/usermanager/lang/bg/lang.php index 58c8453f2..9ed27f42a 100644 --- a/lib/plugins/usermanager/lang/bg/lang.php +++ b/lib/plugins/usermanager/lang/bg/lang.php @@ -4,11 +4,12 @@ * * @author Nikolay Vladimirov <nikolay@vladimiroff.com> * @author Viktor Usunov <usun0v@mail.bg> + * @author Kiril <neohidra@gmail.com> */ -$lang['menu'] = 'Управление на потребителите'; -$lang['noauth'] = '(идентифицирането на потребителите е недостъпно)'; -$lang['nosupport'] = '(не се поддържа управление на потребители)'; -$lang['badauth'] = 'невалиден механизъм при идентификация'; +$lang['menu'] = 'Диспечер на потребителите'; +$lang['noauth'] = '(удостоверяването на потребители не е налично)'; +$lang['nosupport'] = '(управлението на потребители не се поддържа)'; +$lang['badauth'] = 'невалиден механизъм за удостоверяване'; $lang['user_id'] = 'Потребител'; $lang['user_pass'] = 'Парола'; $lang['user_name'] = 'Истинско име'; @@ -16,33 +17,33 @@ $lang['user_mail'] = 'Електронна поща'; $lang['user_groups'] = 'Групи'; $lang['field'] = 'Поле'; $lang['value'] = 'Стойност'; -$lang['add'] = 'Добавяне'; -$lang['delete'] = 'Изтриване'; -$lang['delete_selected'] = 'Изтриване на избраните'; -$lang['edit'] = 'Редактиране'; +$lang['add'] = 'Добави'; +$lang['delete'] = 'Изтрий'; +$lang['delete_selected'] = 'Изтрий избраните'; +$lang['edit'] = 'Редактирай'; $lang['edit_prompt'] = 'Редактиране на потребителя'; -$lang['modify'] = 'Запис на промените'; +$lang['modify'] = 'Запиши промените'; $lang['search'] = 'Търсене'; -$lang['search_prompt'] = 'Търсене'; +$lang['search_prompt'] = 'Търси'; $lang['clear'] = 'Обновяване на търсенето'; $lang['filter'] = 'Филтър'; -$lang['summary'] = 'Показване на потребители %1$d-%2$d от %3$d намерени. %4$d потребители общо.'; -$lang['nonefound'] = 'Няма намерени потребители. Общо %d потребители.'; -$lang['delete_ok'] = '%d потребители изтрити'; -$lang['delete_fail'] = '%d не бяха изтрити'; -$lang['update_ok'] = 'Обновяването на потребителя бе успешно'; -$lang['update_fail'] = 'Обновяването на потребителя бе неуспешно'; -$lang['update_exists'] = 'Смяната на потребителското име бе невъзможна, оказаното потребителско име (%s) вече съществува (всякакви други промени ще бъдат приложени).'; +$lang['summary'] = 'Показване на потребители %1$d-%2$d от %3$d намерени. Общо %4$d потребителя.'; +$lang['nonefound'] = 'Не са намерени потребители. Общо %d потребителя.'; +$lang['delete_ok'] = '%d изтрити потребителя'; +$lang['delete_fail'] = 'изтриването на %d се провали.'; +$lang['update_ok'] = 'Обновяването на потребителя е успешно'; +$lang['update_fail'] = 'Обновяването на потребителя се провали'; +$lang['update_exists'] = 'Смяната на потребителското име се провали, въведеното потребителско име (%s) вече съществува (всички други промени ще бъдат приложени).'; $lang['start'] = 'начало'; -$lang['prev'] = 'предишно'; -$lang['next'] = 'следващо'; -$lang['last'] = 'последно'; -$lang['edit_usermissing'] = 'Избраният потребител не бе намерен, оказаното потребителско име може да е изтрито или променено другаде.'; -$lang['user_notify'] = 'Осведомяване на потребителя'; -$lang['note_notify'] = 'Осведомителната e-поща се праща само, ако на потребителя е дадена нова парола.'; -$lang['note_group'] = 'Новите потребители ще бъдат добавяни към групата (%s) ако не бъде посочена друга.'; -$lang['note_pass'] = 'Паролата ще бъде генерирана автоматично, ако полето е оставено празно и функцията за уведомяване на потребителя е включена.'; -$lang['add_ok'] = 'Добавянето на потребителя бе успешно'; -$lang['add_fail'] = 'Добавянето на потребителя бе неуспешно'; -$lang['notify_ok'] = 'Осведомително е-писмо бе изпратено'; -$lang['notify_fail'] = 'Пращането на осведомително е-писмо е невъзможно'; +$lang['prev'] = 'назад'; +$lang['next'] = 'напред'; +$lang['last'] = 'край'; +$lang['edit_usermissing'] = 'Избраният потребител не е намерен, въведеното потребителско име може да е изтрито или променено другаде.'; +$lang['user_notify'] = 'Уведомяване на потребителя'; +$lang['note_notify'] = 'Ел. писмо се изпраща само ако бъде променена паролата на потребителя.'; +$lang['note_group'] = 'Новите потребители биват добавяни към стандартната групата (%s) ако не е посочена друга.'; +$lang['note_pass'] = 'Паролата ще бъде генерирана автоматично, ако оставите полето празно и функцията за уведомяване на потребителя е включена.'; +$lang['add_ok'] = 'Добавянето на потребителя е успешно'; +$lang['add_fail'] = 'Добавянето на потребителя се провали'; +$lang['notify_ok'] = 'Изпратено е осведомително ел. писмо'; +$lang['notify_fail'] = 'Изпращането на осведомително ел. писмо не е възможно'; diff --git a/lib/plugins/usermanager/lang/bg/list.txt b/lib/plugins/usermanager/lang/bg/list.txt index e90205fe6..106856c0e 100644 --- a/lib/plugins/usermanager/lang/bg/list.txt +++ b/lib/plugins/usermanager/lang/bg/list.txt @@ -1 +1 @@ -===== Списък с потребителите ===== +===== Списък на потребителите ===== diff --git a/lib/plugins/usermanager/lang/cs/lang.php b/lib/plugins/usermanager/lang/cs/lang.php index 7d8e4599d..c805011d7 100644 --- a/lib/plugins/usermanager/lang/cs/lang.php +++ b/lib/plugins/usermanager/lang/cs/lang.php @@ -8,6 +8,7 @@ * @author tomas@valenta.cz * @author Marek Sacha <sachamar@fel.cvut.cz> * @author Lefty <lefty@multihost.cz> + * @author Vojta Beran <xmamut@email.cz> */ $lang['menu'] = 'Správa uživatelů'; $lang['noauth'] = '(autentizace uživatelů není k dispozici)'; diff --git a/lib/plugins/usermanager/lang/de-informal/lang.php b/lib/plugins/usermanager/lang/de-informal/lang.php index e906c0cf8..95b36c60f 100644 --- a/lib/plugins/usermanager/lang/de-informal/lang.php +++ b/lib/plugins/usermanager/lang/de-informal/lang.php @@ -6,6 +6,7 @@ * @author Juergen Schwarzer <jschwarzer@freenet.de> * @author Marcel Metz <marcel_metz@gmx.de> * @author Matthias Schulte <post@lupo49.de> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Benutzerverwalter'; $lang['noauth'] = '(Benutzeranmeldung ist nicht verfügbar)'; diff --git a/lib/plugins/usermanager/lang/de/lang.php b/lib/plugins/usermanager/lang/de/lang.php index 816aaebd7..090d1d1d9 100644 --- a/lib/plugins/usermanager/lang/de/lang.php +++ b/lib/plugins/usermanager/lang/de/lang.php @@ -13,6 +13,8 @@ * @author Blitzi94@gmx.de * @author Robert Bogenschneider <robog@GMX.de> * @author Robert Bogenschneider <robog@gmx.de> + * @author Niels Lange <niels@boldencursief.nl> + * @author Christian Wichmann <nospam@zone0.de> */ $lang['menu'] = 'Benutzerverwaltung'; $lang['noauth'] = '(Authentifizierungssystem nicht verfügbar)'; diff --git a/lib/plugins/usermanager/lang/es/lang.php b/lib/plugins/usermanager/lang/es/lang.php index a5b6bcbb8..1e79c6826 100644 --- a/lib/plugins/usermanager/lang/es/lang.php +++ b/lib/plugins/usermanager/lang/es/lang.php @@ -18,6 +18,7 @@ * @author Fernando J. Gómez <fjgomez@gmail.com> * @author Victor Castelan <victorcastelan@gmail.com> * @author Mauro Javier Giamberardino <mgiamberardino@gmail.com> + * @author emezeta <emezeta@infoprimo.com> */ $lang['menu'] = 'Administración de usuarios'; $lang['noauth'] = '(la autenticación de usuarios no está disponible)'; diff --git a/lib/plugins/usermanager/lang/et/lang.php b/lib/plugins/usermanager/lang/et/lang.php new file mode 100644 index 000000000..2161df918 --- /dev/null +++ b/lib/plugins/usermanager/lang/et/lang.php @@ -0,0 +1,30 @@ +<?php +/** + * Estonian language file + * + * @author kristian.kankainen@kuu.la + * @author Rivo Zängov <eraser@eraser.ee> + */ +$lang['menu'] = 'Kasutajate haldamine'; +$lang['user_id'] = 'Kasutaja'; +$lang['user_pass'] = 'Parool'; +$lang['user_name'] = 'Tegelik nimi'; +$lang['user_mail'] = 'E-post'; +$lang['user_groups'] = 'Grupid'; +$lang['field'] = 'Väli'; +$lang['value'] = 'Väärtus'; +$lang['add'] = 'Lisa'; +$lang['delete'] = 'Kustuta'; +$lang['delete_selected'] = 'Kustuta valitud'; +$lang['edit'] = 'Muuda'; +$lang['edit_prompt'] = 'Muuda seda kasutajat'; +$lang['modify'] = 'Salvesta muudatused'; +$lang['search'] = 'Otsi'; +$lang['search_prompt'] = 'Soorita otsing'; +$lang['filter'] = 'Filtreeri'; +$lang['update_fail'] = 'Kasutaja uuendamine ebaõnnestus'; +$lang['start'] = 'esimesed'; +$lang['prev'] = 'eelmine'; +$lang['next'] = 'järgmine'; +$lang['last'] = 'viimased'; +$lang['user_notify'] = 'Teavita kasutajat'; diff --git a/lib/plugins/usermanager/lang/fi/lang.php b/lib/plugins/usermanager/lang/fi/lang.php index 6eeb4c3e8..1db4bd7fb 100644 --- a/lib/plugins/usermanager/lang/fi/lang.php +++ b/lib/plugins/usermanager/lang/fi/lang.php @@ -5,6 +5,7 @@ * @author otto@valjakko.net * @author Otto Vainio <otto@valjakko.net> * @author Teemu Mattila <ghcsystems@gmail.com> + * @author Sami Olmari <sami@olmari.fi> */ $lang['menu'] = 'Käyttäjähallinta'; $lang['noauth'] = '(autentikointi ei ole käytössä)'; diff --git a/lib/plugins/usermanager/lang/fr/lang.php b/lib/plugins/usermanager/lang/fr/lang.php index 92bc127ed..b6910663c 100644 --- a/lib/plugins/usermanager/lang/fr/lang.php +++ b/lib/plugins/usermanager/lang/fr/lang.php @@ -14,6 +14,8 @@ * @author Philippe Bajoit <philippe.bajoit@gmail.com> * @author Florian Gaub <floriang@floriang.net> * @author Samuel Dorsaz samuel.dorsaz@novelion.net + * @author Johan Guilbaud <guilbaud.johan@gmail.com> + * @author schplurtz@laposte.net */ $lang['menu'] = 'Gestion des utilisateurs'; $lang['noauth'] = '(authentification utilisateur non disponible)'; diff --git a/lib/plugins/usermanager/lang/he/lang.php b/lib/plugins/usermanager/lang/he/lang.php index b2b55c3b4..601163013 100644 --- a/lib/plugins/usermanager/lang/he/lang.php +++ b/lib/plugins/usermanager/lang/he/lang.php @@ -6,6 +6,7 @@ * @author Dotan Kamber <kamberd@yahoo.com> * @author Moshe Kaplan <mokplan@gmail.com> * @author Yaron Yogev <yaronyogev@gmail.com> + * @author Yaron Shahrabani <sh.yaron@gmail.com> */ $lang['menu'] = 'מנהל משתמשים'; $lang['noauth'] = '(אימות משתמשים אינו זמין)'; diff --git a/lib/plugins/usermanager/lang/hr/lang.php b/lib/plugins/usermanager/lang/hr/lang.php index d2094b77b..96f1d6afe 100644 --- a/lib/plugins/usermanager/lang/hr/lang.php +++ b/lib/plugins/usermanager/lang/hr/lang.php @@ -4,4 +4,5 @@ * * @author Branko Rihtman <theney@gmail.com> * @author Dražen Odobašić <dodobasic@gmail.com> + * @author Dejan Igrec dejan.igrec@gmail.com */ diff --git a/lib/plugins/usermanager/lang/hu/lang.php b/lib/plugins/usermanager/lang/hu/lang.php index 7b22dfb48..9b9740cb0 100644 --- a/lib/plugins/usermanager/lang/hu/lang.php +++ b/lib/plugins/usermanager/lang/hu/lang.php @@ -5,8 +5,9 @@ * @author Sandor TIHANYI <stihanyi+dw@gmail.com> * @author Siaynoq Mage <siaynoqmage@gmail.com> * @author schilling.janos@gmail.com - * @author Szabó Dávid (szabo.david@gyumolcstarhely.hu) * @author Szabó Dávid <szabo.david@gyumolcstarhely.hu> + * @author Sándor TIHANYI <stihanyi+dw@gmail.com> + * @author David Szabo <szabo.david@gyumolcstarhely.hu> */ $lang['menu'] = 'Felhasználók kezelése'; $lang['noauth'] = '(A felhasználói azonosítás nem működik.)'; diff --git a/lib/plugins/usermanager/lang/it/lang.php b/lib/plugins/usermanager/lang/it/lang.php index a766e5d07..34c510def 100644 --- a/lib/plugins/usermanager/lang/it/lang.php +++ b/lib/plugins/usermanager/lang/it/lang.php @@ -11,6 +11,7 @@ * @author snarchio@alice.it * @author robocap <robocap1@gmail.com> * @author Osman Tekin osman.tekin93@hotmail.it + * @author Jacopo Corbetta <jacopo.corbetta@gmail.com> */ $lang['menu'] = 'Gestione Utenti'; $lang['noauth'] = '(autenticazione non disponibile)'; diff --git a/lib/plugins/usermanager/lang/kk/lang.php b/lib/plugins/usermanager/lang/kk/lang.php new file mode 100644 index 000000000..dde5b9577 --- /dev/null +++ b/lib/plugins/usermanager/lang/kk/lang.php @@ -0,0 +1,6 @@ +<?php +/** + * kazakh language file + * + * @author Nurgozha Kaliaskarov astana08@gmail.com + */ diff --git a/lib/plugins/usermanager/lang/la/lang.php b/lib/plugins/usermanager/lang/la/lang.php index 2646979bd..52c848754 100644 --- a/lib/plugins/usermanager/lang/la/lang.php +++ b/lib/plugins/usermanager/lang/la/lang.php @@ -2,6 +2,7 @@ /** * Latin language file * + * @author Massimiliano Vassalli <vassalli.max@gmail.com> */ $lang['menu'] = 'Sodalis Tabella'; $lang['noauth'] = '(Sodalis confirmatio deest)'; diff --git a/lib/plugins/usermanager/lang/no/lang.php b/lib/plugins/usermanager/lang/no/lang.php index df38de1b0..31e27747d 100644 --- a/lib/plugins/usermanager/lang/no/lang.php +++ b/lib/plugins/usermanager/lang/no/lang.php @@ -12,6 +12,7 @@ * @author Lisa Ditlefsen <lisa@vervesearch.com> * @author Erik Pedersen <erik.pedersen@shaw.ca> * @author Erik Bjørn Pedersen <erik.pedersen@shaw.ca> + * @author Rune Rasmussen syntaxerror.no@gmail.com */ $lang['menu'] = 'Behandle brukere'; $lang['noauth'] = '(autentisering av brukere ikke tilgjengelig)'; diff --git a/lib/plugins/usermanager/lang/pt/lang.php b/lib/plugins/usermanager/lang/pt/lang.php index 8c4607922..6d0d85e38 100644 --- a/lib/plugins/usermanager/lang/pt/lang.php +++ b/lib/plugins/usermanager/lang/pt/lang.php @@ -6,6 +6,7 @@ * @author Enrico Nicoletto <liverig@gmail.com> * @author Fil <fil@meteopt.com> * @author André Neves <drakferion@gmail.com> + * @author José Campos zecarlosdecampos@gmail.com */ $lang['menu'] = 'Gestor de Perfis'; $lang['noauth'] = '(autenticação indisponível)'; diff --git a/lib/plugins/usermanager/lang/ru/lang.php b/lib/plugins/usermanager/lang/ru/lang.php index 81d9a72a6..456ba5b29 100644 --- a/lib/plugins/usermanager/lang/ru/lang.php +++ b/lib/plugins/usermanager/lang/ru/lang.php @@ -14,6 +14,8 @@ * @author Vlad Tsybenko <vlad.development@gmail.com> * @author Aleksey Osadchiy <rfc@nm.ru> * @author Aleksandr Selivanov <alexgearbox@gmail.com> + * @author Ladyko Andrey <fylh@succexy.spb.ru> + * @author Eugene <windy.wanderer@gmail.com> */ $lang['menu'] = 'Управление пользователями'; $lang['noauth'] = '(авторизация пользователей недоступна)'; @@ -47,12 +49,12 @@ $lang['start'] = 'в начало'; $lang['prev'] = 'назад'; $lang['next'] = 'вперёд'; $lang['last'] = 'в конец'; -$lang['edit_usermissing'] = 'Выбранный пользователь не найден. Возможно, указанный логин был удалён или изменен извне.'; +$lang['edit_usermissing'] = 'Выбранный пользователь не найден. Возможно, указанный логин был удалён или изменён извне.'; $lang['user_notify'] = 'Сообщить пользователю'; $lang['note_notify'] = 'Письма с уведомлением высылаются только в случае получения нового пароля.'; $lang['note_group'] = 'Если группа не указана, новые пользователи будут добавлены в группу по умолчанию (%s).'; $lang['note_pass'] = 'Пароль будет сгенерирован автоматически, если поле оставлено пустым и включено уведомление пользователя.'; $lang['add_ok'] = 'Пользователь успешно добавлен'; $lang['add_fail'] = 'Не удалось добавить пользователя'; -$lang['notify_ok'] = 'Пиьмо с уведомлением отправлено'; +$lang['notify_ok'] = 'Письмо с уведомлением отправлено'; $lang['notify_fail'] = 'Не удалось отправить письмо с уведомлением'; diff --git a/lib/plugins/usermanager/lang/sl/add.txt b/lib/plugins/usermanager/lang/sl/add.txt index 985fa607e..c1d8913b4 100644 --- a/lib/plugins/usermanager/lang/sl/add.txt +++ b/lib/plugins/usermanager/lang/sl/add.txt @@ -1 +1 @@ -===== Dodaj uporabnika =====
\ No newline at end of file +===== Dodajanje uporabnika =====
\ No newline at end of file diff --git a/lib/plugins/usermanager/lang/sl/delete.txt b/lib/plugins/usermanager/lang/sl/delete.txt index 515b343e5..7d9de54e6 100644 --- a/lib/plugins/usermanager/lang/sl/delete.txt +++ b/lib/plugins/usermanager/lang/sl/delete.txt @@ -1 +1 @@ -===== Izbriši uporabnika =====
\ No newline at end of file +===== Izbrisanje uporabnika =====
\ No newline at end of file diff --git a/lib/plugins/usermanager/lang/sl/edit.txt b/lib/plugins/usermanager/lang/sl/edit.txt index 23aeb0c3b..e80bc8585 100644 --- a/lib/plugins/usermanager/lang/sl/edit.txt +++ b/lib/plugins/usermanager/lang/sl/edit.txt @@ -1 +1 @@ -===== Uredi uporabnika =====
\ No newline at end of file +===== Urejanje uporabnikov =====
\ No newline at end of file diff --git a/lib/plugins/usermanager/lang/sl/intro.txt b/lib/plugins/usermanager/lang/sl/intro.txt new file mode 100644 index 000000000..a4729a8a5 --- /dev/null +++ b/lib/plugins/usermanager/lang/sl/intro.txt @@ -0,0 +1 @@ +====== Upravljanje uporabnikov ====== diff --git a/lib/plugins/usermanager/lang/sl/lang.php b/lib/plugins/usermanager/lang/sl/lang.php index e31f8ff1a..96acfd0af 100644 --- a/lib/plugins/usermanager/lang/sl/lang.php +++ b/lib/plugins/usermanager/lang/sl/lang.php @@ -4,17 +4,47 @@ * * @author Dejan Levec <webphp@gmail.com> * @author Boštjan Seničar <senicar@gmail.com> + * @author Gregor Skumavc (grega.skumavc@gmail.com) + * @author Matej Urbančič (mateju@svn.gnome.org) */ +$lang['menu'] = 'Upravljanje uporabnikov'; +$lang['noauth'] = '(overjanje istovetnosti uporabnikov ni na voljo)'; +$lang['nosupport'] = '(upravljanje računov uporabnikov ni podprto)'; +$lang['badauth'] = 'neveljaven način overjanja'; $lang['user_id'] = 'Uporabnik'; $lang['user_pass'] = 'Geslo'; -$lang['user_mail'] = 'Email'; +$lang['user_name'] = 'Pravo ime'; +$lang['user_mail'] = 'Elektronski naslov'; $lang['user_groups'] = 'Skupine'; +$lang['field'] = 'Polje'; +$lang['value'] = 'Vrednost'; $lang['add'] = 'Dodaj'; $lang['delete'] = 'Izbriši'; $lang['delete_selected'] = 'Izbriši izbrano'; $lang['edit'] = 'Uredi'; +$lang['edit_prompt'] = 'Uredi tega uporabnika'; $lang['modify'] = 'Shrani spremembe'; $lang['search'] = 'Iskanje'; -$lang['prev'] = 'Prejšnji'; +$lang['search_prompt'] = 'Poišči'; +$lang['clear'] = 'Počisti filter iskanja'; +$lang['filter'] = 'Filter'; +$lang['summary'] = 'Izpisani so uporabniki %1$d-%2$d od skupno %3$d. Vseh uporabnikov je %4$d.'; +$lang['nonefound'] = 'Ni najdenih uporabnikov. Vseh uporabnikov je %d.'; +$lang['delete_ok'] = '%d uporabnikov je izbrisanih'; +$lang['delete_fail'] = '%d ni bilo mogoče izbrisati'; +$lang['update_ok'] = 'Uporabniški račun je uspešno posodobljen'; +$lang['update_fail'] = 'Posodobitev uporabniškega računa je spodletela'; +$lang['update_exists'] = 'Spreminjanje imena uporabnika je spodletelo. Navedeno uporabniško ime (%s) že obstaja (vse ostale spremembe bodo uveljavljene).'; +$lang['start'] = 'Začetni'; +$lang['prev'] = 'Predhodni'; $lang['next'] = 'Naslednji'; -$lang['last'] = 'Zadnji'; +$lang['last'] = 'Končni'; +$lang['edit_usermissing'] = 'Izbranega uporabnika ni mogoče najti. Navedeno uporabniško ime je morda izbrisano ali spremenjeno.'; +$lang['user_notify'] = 'Obvesti uporabnika'; +$lang['note_notify'] = 'Obvestilna sporočila so poslana le, če uporabnik prejme novo geslo za dostop do strani.'; +$lang['note_group'] = 'Nov uporabnik bo dodan k privzeti skupini (%s), v kolikor ni navedene druge skupine.'; +$lang['note_pass'] = 'Geslo bo ustvarjeno samodejno, v kolikor je polje izpuščeno in je omogočeno obveščanje uporabnika.'; +$lang['add_ok'] = 'Uporabnik je uspešno dodan'; +$lang['add_fail'] = 'Dodajanje uporabnika je spodletelo'; +$lang['notify_ok'] = 'Obvestilno sporočilo je poslano.'; +$lang['notify_fail'] = 'Obvestilnega sporočila ni mogoče poslati.'; diff --git a/lib/plugins/usermanager/lang/sv/lang.php b/lib/plugins/usermanager/lang/sv/lang.php index cedd30d1f..bd747927e 100644 --- a/lib/plugins/usermanager/lang/sv/lang.php +++ b/lib/plugins/usermanager/lang/sv/lang.php @@ -14,6 +14,7 @@ * @author Bogge Bogge <bogge@bogge.com> * @author Peter Åström <eaustreum@gmail.com> * @author Håkan Sandell <hakan.sandell@home.se> + * @author mikael@mallander.net */ $lang['menu'] = 'Hantera användare'; $lang['noauth'] = '(användarautentisering ej tillgänlig)'; diff --git a/lib/plugins/usermanager/lang/uk/edit.txt b/lib/plugins/usermanager/lang/uk/edit.txt index e359f748c..efc84be89 100644 --- a/lib/plugins/usermanager/lang/uk/edit.txt +++ b/lib/plugins/usermanager/lang/uk/edit.txt @@ -1 +1 @@ -===== Змінити користувача ===== +===== Редагувати користувача ===== diff --git a/lib/plugins/usermanager/lang/zh-tw/intro.txt b/lib/plugins/usermanager/lang/zh-tw/intro.txt index 9c499d862..8f9488d7d 100644 --- a/lib/plugins/usermanager/lang/zh-tw/intro.txt +++ b/lib/plugins/usermanager/lang/zh-tw/intro.txt @@ -1 +1 @@ -====== 帳號管理員(User Manager) ====== +====== 帳號管理員 ====== diff --git a/lib/plugins/usermanager/lang/zh-tw/lang.php b/lib/plugins/usermanager/lang/zh-tw/lang.php index 26c87205d..5cb20aae8 100644 --- a/lib/plugins/usermanager/lang/zh-tw/lang.php +++ b/lib/plugins/usermanager/lang/zh-tw/lang.php @@ -8,8 +8,10 @@ * @author Wayne San <waynesan@zerozone.tw> * @author Li-Jiun Huang <ljhuang.tw@gmai.com> * @author Cheng-Wei Chien <e.cwchien@gmail.com> + * @author Danny Lin <danny0838@pchome.com.tw> + * @author Shuo-Ting Jian <shoting@gmail.com> */ -$lang['menu'] = '帳號管理員(User Manager)'; +$lang['menu'] = '帳號管理員'; $lang['noauth'] = '(帳號認證尚未開放)'; $lang['nosupport'] = '(尚不支援帳號管理)'; $lang['badauth'] = '錯誤的認證機制'; @@ -28,25 +30,25 @@ $lang['edit_prompt'] = '修改該帳號'; $lang['modify'] = '儲存變更'; $lang['search'] = '搜尋'; $lang['search_prompt'] = '開始搜尋'; -$lang['clear'] = '重新設定搜尋的條件'; +$lang['clear'] = '重設篩選條件'; $lang['filter'] = '篩選條件(Filter)'; -$lang['summary'] = '顯示帳號 %1$d 至 %2$d 共 %3$d 筆符合. 總共有 %4$d 個帳號'; -$lang['nonefound'] = '找不到該用戶(共 %d 帳號)。'; +$lang['summary'] = '顯示帳號 %1$d-%2$d，共 %3$d 筆符合。共有 %4$d 個帳號。'; +$lang['nonefound'] = '找不到帳號。共有 %d 個帳號。'; $lang['delete_ok'] = '已刪除 %d 個帳號'; $lang['delete_fail'] = '%d 個帳號刪除失敗'; $lang['update_ok'] = '成功更新該帳號'; $lang['update_fail'] = '更新該帳號時失敗'; -$lang['update_exists'] = '變更帳號名稱 (%s) 時失敗，應該是已有同名的帳號，不過除了帳號名稱之外的其他修改仍會儲存。'; +$lang['update_exists'] = '變更帳號名稱 (%s) 失敗，因為有同名帳號存在（其他修改已套用）。'; $lang['start'] = '開始'; -$lang['prev'] = '上一步'; -$lang['next'] = '下一步'; -$lang['last'] = '最後步驟'; -$lang['edit_usermissing'] = '找不到所選的帳號，該帳號可能已經被刪除或是改為其他名稱喔。'; +$lang['prev'] = '上一頁'; +$lang['next'] = '下一頁'; +$lang['last'] = '最後一頁'; +$lang['edit_usermissing'] = '找不到選取的帳號，可能已被刪除或改為其他名稱。'; $lang['user_notify'] = '通知使用者'; -$lang['note_notify'] = '通知信只有在給予使用者新密碼時寄送。'; +$lang['note_notify'] = '通知信只會在指定使用者新密碼時寄送。'; $lang['note_group'] = '如果沒有指定群組，新使用者將會被加入到預設群組(%s)當中。'; $lang['note_pass'] = '如果沒有輸入這個欄位而且有勾選通知使用者，則會自動產生一組密碼。'; $lang['add_ok'] = '新增使用者成功'; $lang['add_fail'] = '新增使用者失敗'; $lang['notify_ok'] = '通知信已寄出'; -$lang['notify_fail'] = '通知信無法被寄出'; +$lang['notify_fail'] = '通知信無法寄出'; diff --git a/lib/plugins/usermanager/lang/zh/lang.php b/lib/plugins/usermanager/lang/zh/lang.php index 5836d3346..9bfa496c2 100644 --- a/lib/plugins/usermanager/lang/zh/lang.php +++ b/lib/plugins/usermanager/lang/zh/lang.php @@ -10,6 +10,8 @@ * @author ben <ben@livetom.com> * @author lainme <lainme993@gmail.com> * @author caii <zhoucaiqi@gmail.com> + * @author Hiphen Lee <jacob.b.leung@gmail.com> + * @author caii, patent agent in China <zhoucaiqi@gmail.com> */ $lang['menu'] = '用户管理器'; $lang['noauth'] = '（用户认证不可用）'; diff --git a/lib/plugins/usermanager/script.js b/lib/plugins/usermanager/script.js index 68d437129..de013242b 100644 --- a/lib/plugins/usermanager/script.js +++ b/lib/plugins/usermanager/script.js @@ -1,9 +1,8 @@ /** * Add JavaScript confirmation to the User Delete button */ -function usrmgr_delconfirm(){ - if($('usrmgr__del')){ - addEvent( $('usrmgr__del'),'click',function(){ return confirm(reallyDel); } ); - } -}; -addInitEvent(usrmgr_delconfirm); +jQuery(function(){ + jQuery('#usrmgr__del').click(function(){ + return confirm(LANG.del_confirm); + }); +}); diff --git a/lib/scripts/ajax.js b/lib/scripts/ajax.js deleted file mode 100644 index de009d448..000000000 --- a/lib/scripts/ajax.js +++ /dev/null @@ -1,48 +0,0 @@ -/** - * AJAX functions for the pagename quicksearch - * - * @license GPL2 (http://www.gnu.org/licenses/gpl.html) - * @author Andreas Gohr <andi@splitbrain.org> - * @author Adrian Lang <lang@cosmocode.de> - */ -addInitEvent(function () { - - var inID = 'qsearch__in'; - var outID = 'qsearch__out'; - - var inObj = document.getElementById(inID); - var outObj = document.getElementById(outID); - - // objects found? - if (inObj === null){ return; } - if (outObj === null){ return; } - - function clear_results(){ - outObj.style.display = 'none'; - outObj.innerHTML = ''; - } - - var sack_obj = new sack(DOKU_BASE + 'lib/exe/ajax.php'); - sack_obj.AjaxFailedAlert = ''; - sack_obj.encodeURIString = false; - sack_obj.onCompletion = function () { - var data = sack_obj.response; - if (data === '') { return; } - - outObj.innerHTML = data; - outObj.style.display = 'block'; - }; - - // attach eventhandler to search field - var delay = new Delay(function () { - clear_results(); - var value = inObj.value; - if(value === ''){ return; } - sack_obj.runAJAX('call=qsearch&q=' + encodeURI(value)); - }); - - addEvent(inObj, 'keyup', function () {clear_results(); delay.start(); }); - - // attach eventhandler to output field - addEvent(outObj, 'click', function () {outObj.style.display = 'none'; }); -}); diff --git a/lib/scripts/behaviour.js b/lib/scripts/behaviour.js new file mode 100644 index 000000000..0f69d5721 --- /dev/null +++ b/lib/scripts/behaviour.js @@ -0,0 +1,184 @@ +/*jslint sloppy: true */ +/*global jQuery, LANG, document, alert */ + +/** + * Automatic behaviours + * + * This class wraps various JavaScript functionalities that are triggered + * automatically whenever a certain object is in the DOM or a certain CSS + * class was found + */ +var dw_behaviour = { + + init: function(){ + dw_behaviour.focusMarker(); + dw_behaviour.scrollToMarker(); + dw_behaviour.removeHighlightOnClick(); + dw_behaviour.quickSelect(); + dw_behaviour.checkWindowsShares(); + dw_behaviour.initTocToggle(); + dw_behaviour.subscription(); + }, + + /** + * Looks for an element with the ID scroll__here at scrolls to it + */ + scrollToMarker: function(){ + var $obj = jQuery('#scroll__here'); + if($obj.length) { + $obj[0].scrollIntoView(); + } + }, + + /** + * Looks for an element with the ID focus__this at sets focus to it + */ + focusMarker: function(){ + jQuery('#focus__this').focus(); + }, + + /** + * Remove all search highlighting when clicking on a highlighted term + * + * @FIXME would be nice to have it fade out + */ + removeHighlightOnClick: function(){ + jQuery('span.search_hit').click( + function(e){ + jQuery(e.target).removeClass('search_hit'); + } + ); + }, + + /** + * Autosubmit quick select forms + * + * When a <select> tag has the class "quickselect", this script will + * automatically submit its parent form when the select value changes. + * It also hides the submit button of the form. + * + * @author Andreas Gohr <andi@splitbrain.org> + */ + quickSelect: function(){ + jQuery('select.quickselect') + .change(function(e){ e.target.form.submit(); }) + .parents('form').find('input[type=submit]').hide(); + }, + + /** + * Display error for Windows Shares on browsers other than IE + * + * @author Michael Klier <chi@chimeric.de> + */ + checkWindowsShares: function() { + if(!LANG.nosmblinks || document.all !== null) { + // No warning requested or none necessary + return; + } + + jQuery('a.windows').live('click', function(){ + alert(LANG.nosmblinks); + }); + }, + + /** + * Adds the toggle switch to the TOC + */ + initTocToggle: function() { + var $header = jQuery('#toc__header'); + if(!$header.length) return; + var $toc = jQuery('#toc__inside'); + + var $clicky = jQuery(document.createElement('span')) + .attr('id','toc__toggle') + .css('cursor','pointer') + .click(function(){ + $toc.slideToggle(200); + setClicky(); + }); + $header.prepend($clicky); + + var setClicky = function(){ + if($toc.css('display') == 'none'){ + $clicky.html('<span>+</span>'); + $clicky[0].className = 'toc_open'; + }else{ + $clicky.html('<span>−</span>'); + $clicky[0].className = 'toc_close'; + } + }; + + setClicky(); + }, + + /** + * Hide list subscription style if target is a page + * + * @author Adrian Lang <lang@cosmocode.de> + * @author Pierre Spring <pierre.spring@caillou.ch> + */ + subscription: function(){ + var $form, $list, $digest; + + $form = jQuery('#subscribe__form'); + if (0 === $form.length) return; + + $list = $form.find("input[name='sub_style'][value='list']"); + $digest = $form.find("input[name='sub_style'][value='digest']"); + + $form.find("input[name='sub_target']") + .click( + function () { + var $this = jQuery(this), show_list; + if (!$this.prop('checked')) { + return; + } + + show_list = $this.val().match(/:$/); + $list.parent().dw_toggle(show_list); + if (!show_list && $list.prop('checked')) { + $digest.prop('checked', 'checked'); + } + } + ) + .filter(':checked') + .click(); + } +}; + +/** + * Hides elements with a slide animation + * + * @param fn optional callback to run after hiding + * @author Adrian Lang <mail@adrianlang.de> + */ +jQuery.fn.dw_hide = function(fn) { + return this.slideUp('fast', fn); +}; + +/** + * Unhides elements with a slide animation + * + * @param fn optional callback to run after hiding + * @author Adrian Lang <mail@adrianlang.de> + */ +jQuery.fn.dw_show = function(fn) { + return this.slideDown('fast', fn); +}; + +/** + * Toggles visibility of an element using a slide element + * + * @param bool the current state of the element (optional) + */ +jQuery.fn.dw_toggle = function(bool) { + return this.each(function() { + var $this = jQuery(this); + if (typeof bool === 'undefined') { + bool = $this.is(':hidden'); + } + $this[bool ? "dw_show" : "dw_hide" ](); + }); +}; + +jQuery(dw_behaviour.init); diff --git a/lib/scripts/compatibility.js b/lib/scripts/compatibility.js new file mode 100644 index 000000000..a5cc87e58 --- /dev/null +++ b/lib/scripts/compatibility.js @@ -0,0 +1,125 @@ +/*jslint sloppy: true */ +/*global dw_index, dw_qsearch, DEPRECATED_WRAP */ + +var index = { + throbber_delay: dw_index.throbber_delay, + toggle: DEPRECATED_WRAP(dw_index.toggle, dw_index), + treeattach: DEPRECATED_WRAP(dw_index.treeattach, dw_index) +}; + +var ajax_quicksearch = { + init: DEPRECATED_WRAP(dw_qsearch.init, dw_qsearch), + clear_results: DEPRECATED_WRAP(dw_qsearch.clear_results, dw_qsearch), + onCompletion: DEPRECATED_WRAP(dw_qsearch.onCompletion, dw_qsearch) +}; + +var linkwiz = { + init: DEPRECATED_WRAP(dw_linkwiz.init, dw_linkwiz), + onEntry: DEPRECATED_WRAP(dw_linkwiz.onEntry, dw_linkwiz), + getResult: DEPRECATED_WRAP(dw_linkwiz.getResult, dw_linkwiz), + select: DEPRECATED_WRAP(dw_linkwiz.select, dw_linkwiz), + deselect: DEPRECATED_WRAP(dw_linkwiz.deselect, dw_linkwiz), + onResultClick: DEPRECATED_WRAP(dw_linkwiz.onResultClick, dw_linkwiz), + resultClick: DEPRECATED_WRAP(dw_linkwiz.resultClick, dw_linkwiz), + insertLink: DEPRECATED_WRAP(dw_linkwiz.insertLink, dw_linkwiz), + autocomplete: DEPRECATED_WRAP(dw_linkwiz.autocomplete, dw_linkwiz), + autocomplete_exec: DEPRECATED_WRAP(dw_linkwiz.autocomplete_exec, dw_linkwiz), + show: DEPRECATED_WRAP(dw_linkwiz.show, dw_linkwiz), + hide: DEPRECATED_WRAP(dw_linkwiz.hide, dw_linkwiz), + toggle: DEPRECATED_WRAP(dw_linkwiz.toggle, dw_linkwiz) +}; + +var media_manager = { + // treeattach, selectorattach, confirmattach are munched together into + // dw_mediamanager.init + attachoptions: DEPRECATED_WRAP(dw_mediamanager.attachoptions, dw_mediamanager), + togglekeepopen: function (event, cb) { + DEPRECATED('Use dw_mediamanager.toggleOption instead'); + return dw_mediamanager.toggleOption.call(cb, 'keepopen'); + }, + togglehide: function (event, cb) { + DEPRECATED('Use dw_mediamanager.toggleOption instead'); + return dw_mediamanager.toggleOption.call(cb, 'hide'); + }, + updatehide: DEPRECATED_WRAP(dw_mediamanager.updatehide, dw_mediamanager), + select: function (event, link) { + DEPRECATED('Use dw_mediamanager.select instead'); + return dw_mediamanager.select.call(link, event); + }, + initpopup: DEPRECATED_WRAP(dw_mediamanager.initpopup, dw_mediamanager), + insert: DEPRECATED_WRAP(dw_mediamanager.insert, dw_mediamanager), + list: function (event, link) { + DEPRECATED('Use dw_mediamanager.list instead'); + return dw_mediamanager.list.call(link, event); + }, + // toggle is handled by dw_tree + suggest: DEPRECATED_WRAP(dw_mediamanager.suggest, dw_mediamanager), + initFlashUpload: DEPRECATED_WRAP(dw_mediamanager.initFlashUpload, dw_mediamanager), + closePopup: function () { + DEPRECATED(); + dw_mediamanager.$popup.dialog('close'); + }, + setalign: function (event, cb) { + DEPRECATED('Use dw_mediamanager.setOpt instead'); + return dw_mediamanager.setOpt.call(this, 'align', event); + }, + setlink: function (event, cb) { + DEPRECATED('Use dw_mediamanager.setOpt instead'); + return dw_mediamanager.setOpt.call(this, 'link', event); + }, + setsize: function (event, cb) { + DEPRECATED('Use dw_mediamanager.setOpt instead'); + return dw_mediamanager.setOpt.call(this, 'size', event); + }, + outSet: function (id) { + DEPRECATED(); + return jQuery(id).removeClass('selected'); + }, + inSet: function (id) { + DEPRECATED(); + return jQuery(id).addClass('selected'); + } +}; + +initSizeCtl = DEPRECATED_WRAP(dw_editor.initSizeCtl); +sizeCtl = DEPRECATED_WRAP(dw_editor.sizeCtl); +toggleWrap = DEPRECATED_WRAP(dw_editor.toggleWrap); +setWrap = DEPRECATED_WRAP(dw_editor.setWrap); + +function findPosX(object){ + DEPRECATED('Use jQuery.position() instead'); + return jQuery(object).position().left; +} + +function findPosY(object){ + DEPRECATED('Use jQuery.position() instead'); + return jQuery(object).position().top; +} + +function getElementsByClass(searchClass,node,tag){ + DEPRECATED('Use jQuery() instead'); + if(node == null) node = document; + if(typeof tag === 'undefined') tag = ''; + return jQuery(node).find(tag+'.'+searchClass).toArray(); +} + +function prependChild(parent,element) { + DEPRECATED('Use jQuery.prepend() instead'); + jQuery(parent).prepend(element); +} + +function addEvent(element, type, handler) { + DEPRECATED('Use jQuery.bind() instead.'); + jQuery(element).bind(type,{},handler); +} + +function removeEvent(element, type, handler) { + DEPRECATED('Use jQuery.unbind() instead.'); + jQuery(element).unbind(type,handler); +} + +function addInitEvent(func) { + DEPRECATED('Use jQuery(<function>) instead'); + jQuery(func); +} + diff --git a/lib/scripts/cookie.js b/lib/scripts/cookie.js index d7e6b3550..f7d9b5ffb 100644 --- a/lib/scripts/cookie.js +++ b/lib/scripts/cookie.js @@ -1,13 +1,14 @@ /** - * Handles the cookie used by several JavaScript functions - * - * Only a single cookie is written and read. You may only save - * sime name-value pairs - no complex types! - * - * You should only use the getValue and setValue methods - * - * @author Andreas Gohr <andi@splitbrain.org> - */ +* Handles the cookie used by several JavaScript functions +* +* Only a single cookie is written and read. You may only save +* sime name-value pairs - no complex types! +* +* You should only use the getValue and setValue methods +* +* @author Andreas Gohr <andi@splitbrain.org> +* @author Michal Rezler <m.rezler@centrum.cz> +*/ DokuCookie = { data: Array(), name: 'DOKU_PREFS', @@ -18,21 +19,21 @@ DokuCookie = { * @author Andreas Gohr <andi@splitbrain.org> */ setValue: function(key,val){ - DokuCookie.init(); - DokuCookie.data[key] = val; + this.init(); + this.data[key] = val; // prepare expire date var now = new Date(); - DokuCookie.fixDate(now); + this.fixDate(now); now.setTime(now.getTime() + 365 * 24 * 60 * 60 * 1000); //expire in a year //save the whole data array var text = ''; - for(var key in DokuCookie.data){ - if (!DokuCookie.data.hasOwnProperty(key)) continue; - text += '#'+escape(key)+'#'+DokuCookie.data[key]; + for(var key in this.data){ + if (!this.data.hasOwnProperty(key)) continue; + text += '#'+escape(key)+'#'+this.data[key]; } - DokuCookie.setCookie(DokuCookie.name,text.substr(1),now,DOKU_BASE); + this.setCookie(this.name,text.substr(1),now,DOKU_BASE); }, /** @@ -41,8 +42,8 @@ DokuCookie = { * @author Andreas Gohr <andi@splitbrain.org> */ getValue: function(key){ - DokuCookie.init(); - return DokuCookie.data[key]; + this.init(); + return this.data[key]; }, /** @@ -51,12 +52,12 @@ DokuCookie = { * @author Andreas Gohr <andi@splitbrain.org> */ init: function(){ - if(DokuCookie.data.length) return; - var text = DokuCookie.getCookie(DokuCookie.name); + if(this.data.length) return; + var text = this.getCookie(this.name); if(text){ var parts = text.split('#'); for(var i=0; i<parts.length; i+=2){ - DokuCookie.data[unescape(parts[i])] = unescape(parts[i+1]); + this.data[unescape(parts[i])] = unescape(parts[i+1]); } } }, @@ -66,13 +67,15 @@ DokuCookie = { * * @link http://www.webreference.com/js/column8/functions.html */ - setCookie: function(name, value, expires, path, domain, secure) { - var curCookie = name + "=" + escape(value) + - ((expires) ? "; expires=" + expires.toGMTString() : "") + - ((path) ? "; path=" + path : "") + - ((domain) ? "; domain=" + domain : "") + - ((secure) ? "; secure" : ""); - document.cookie = curCookie; + setCookie: function(name, value, expires_, path_, domain_, secure_) { + var params = { + expires: expires_, + path: path_, + domain: domain_, + secure: secure_, + }; + + jQuery.cookie(name, value, params); }, /** @@ -81,20 +84,7 @@ DokuCookie = { * @link http://www.webreference.com/js/column8/functions.html */ getCookie: function(name) { - var dc = document.cookie; - var prefix = name + "="; - var begin = dc.indexOf("; " + prefix); - if (begin == -1) { - begin = dc.indexOf(prefix); - if (begin !== 0){ return null; } - } else { - begin += 2; - } - var end = document.cookie.indexOf(";", begin); - if (end == -1){ - end = dc.length; - } - return unescape(dc.substring(begin + prefix.length, end)); + return unescape(jQuery.cookie(name)); }, /** diff --git a/lib/scripts/drag.js b/lib/scripts/drag.js index 2212fb6c1..dd252d95d 100644 --- a/lib/scripts/drag.js +++ b/lib/scripts/drag.js @@ -5,6 +5,7 @@ * customization, drag can be used as a javascript prototype, it is * inheritance-aware. * + * @deprecated * @link http://nofunc.org/Drag_Drop/ */ var drag = { @@ -25,6 +26,7 @@ var drag = { * @param DOMObject handle A handle on which the obj can be dragged */ attach: function (obj,handle) { + DEPRECATED('Use jQuery.draggable() instead.'); if(handle){ handle.dragobject = obj; }else{ diff --git a/lib/scripts/edit.js b/lib/scripts/edit.js index 01262bcef..a9623e14d 100644 --- a/lib/scripts/edit.js +++ b/lib/scripts/edit.js @@ -11,37 +11,41 @@ * Style the buttons through the toolbutton class * * @author Andreas Gohr <andi@splitbrain.org> + * @author Michal Rezler <m.rezler@centrum.cz> */ function createToolButton(icon,label,key,id,classname){ - var btn = document.createElement('button'); - var ico = document.createElement('img'); + var $ = jQuery; + var btn = $('<button>'); + var ico = $('<img />'); // preapare the basic button stuff - btn.className = 'toolbutton'; + btn.attr('class', 'toolbutton'); if(classname){ - btn.className += ' '+classname; + btn.attr('class', 'toolbutton '+classname); } - btn.title = label; + + btn.attr('title', label); if(key){ - btn.title += ' ['+key.toUpperCase()+']'; - btn.accessKey = key; + btn.attr('title', label + ' ['+key.toUpperCase()+']') + .attr('accessKey', key); } // set IDs if given if(id){ - btn.id = id; - ico.id = id+'_ico'; + btn.attr('id', id); + ico.attr('id', id+'_ico'); } // create the icon and add it to the button if(icon.substr(0,1) == '/'){ - ico.src = icon; + ico.attr('src', icon); }else{ - ico.src = DOKU_BASE+'lib/images/toolbar/'+icon; + ico.attr('src', DOKU_BASE+'lib/images/toolbar/'+icon); } - btn.appendChild(ico); + btn.append(ico); - return btn; + // we have to return a javascript object (for compatibility reasons) + return btn[0]; } /** @@ -60,45 +64,56 @@ function createToolButton(icon,label,key,id,classname){ */ function createPicker(id,props,edid){ var icobase = props['icobase']; - var list = props['list']; + var list = props['list']; + var $ = jQuery; // create the wrapping div - var picker = document.createElement('div'); - picker.className = 'picker'; + var picker = $('<div></div>'); + + var className = 'picker'; if(props['class']){ - picker.className += ' '+props['class']; + className += ' '+props['class']; } - picker.id = id; - picker.style.position = 'absolute'; - picker.style.marginLeft = '-10000px'; // no display:none, to keep access keys working - picker.style.marginTop = '-10000px'; + + picker.attr('class', className) + .attr('id', id) + .css('position', 'absolute') + .css('marginLeft', '-10000px') // no display:none, to keep access keys working + .css('marginTop', '-10000px'); for(var key in list){ if (!list.hasOwnProperty(key)) continue; if(isNaN(key)){ // associative array -> treat as image/value pairs - var btn = document.createElement('button'); - btn.className = 'pickerbutton'; - var ico = document.createElement('img'); - if(list[key].substr(0,1) == '/'){ - ico.src = list[key]; - }else{ - ico.src = DOKU_BASE+'lib/images/'+icobase+'/'+list[key]; + var btn = $('<button>'); + btn.attr('class', 'pickerbutton') + .attr('title', key); + + var ico = $('<img>'); + if (list[key].substr(0,1) == '/') { + var src = list[key]; + } else { + var src = DOKU_BASE+'lib/images/'+icobase+'/'+list[key]; } - btn.title = key; - btn.appendChild(ico); - addEvent(btn,'click',bind(pickerInsert,key,edid)); - picker.appendChild(btn); - }else if(isString(list[key])){ + + ico.attr('src', src); + btn.append(ico); + + btn.bind('click', bind(pickerInsert, key, edid)); + picker.append(btn); + }else if (typeof (list[key]) == 'string'){ // a list of text -> treat as text picker - var btn = document.createElement('button'); - btn.className = 'pickerbutton'; - var txt = document.createTextNode(list[key]); - btn.title = list[key]; - btn.appendChild(txt); - addEvent(btn,'click',bind(pickerInsert,list[key],edid)); - picker.appendChild(btn); + var btn = $('<button>'); + btn.attr('class', 'pickerbutton') + .attr('title', list[key]); + + var txt = $(document.createTextNode(list[key])); + btn.append(txt); + + btn.bind('click', bind(pickerInsert, list[key], edid)); + + picker.append(btn); }else{ // a list of lists -> treat it as subtoolbar initToolbar(picker,edid,list); @@ -106,9 +121,11 @@ function createPicker(id,props,edid){ } } - var body = document.getElementsByTagName('body')[0]; - body.appendChild(picker); - return picker; + var body = $('body'); + body.append(picker); + + // we have to return a javascript object (for compatibility reasons) + return picker[0]; } /** @@ -132,7 +149,7 @@ function pickerInsert(text,edid){ */ function addBtnActionSignature(btn, props, edid) { if(typeof(SIG) != 'undefined' && SIG != ''){ - addEvent(btn,'click',bind(insertAtCarret,edid,SIG)); + btn.bind('click', bind(insertAtCarret,edid,SIG)); return true; } return false; @@ -218,19 +235,6 @@ function keyHandler(e){ } } -//FIXME consolidate somewhere else -addInitEvent(function(){ - var field = $('wiki__text'); - if(!field) return; - // in Firefox, keypress doesn't send the correct keycodes, - // in Opera, the default of keydown can't be prevented - if (is_opera) { - addEvent(field,'keypress',keyHandler); - } else { - addEvent(field,'keydown',keyHandler); - } -}); - /** * Determine the current section level while editing * @@ -261,27 +265,26 @@ function currentHeadlineLevel(textboxId){ /** * global var used for not saved yet warning */ -var textChanged = false; +window.textChanged = false; /** * Delete the draft before leaving the page */ function deleteDraft() { if (is_opera) return; + if (window.keepDraft) return; // remove a possibly saved draft using ajax - var dwform = $('dw__editform'); - if(dwform){ - var params = 'call=draftdel'; - params += '&id='+encodeURIComponent(dwform.elements.id.value); - - var sackobj = new sack(DOKU_BASE + 'lib/exe/ajax.php'); - // this needs to be synchronous and GET to not be aborted upon page unload - sackobj.asynchronous = false; - sackobj.method = 'GET'; - sackobj.AjaxFailedAlert = ''; - sackobj.encodeURIString = false; - sackobj.runAJAX(params); + var dwform = jQuery('#dw__editform'); + if(dwform.length != 0) { + + jQuery.post( + DOKU_BASE + 'lib/exe/ajax.php', + { + call: 'draftdel', + id: jQuery('#dw__editform input[name=id]').val() + } + ); } } @@ -291,39 +294,65 @@ function deleteDraft() { * * Sets focus to the editbox as well */ -addInitEvent(function (){ - var editform = $('dw__editform'); - if (!editform) return; - - var edit_text = $('wiki__text'); - if(edit_text) { - if(edit_text.readOnly) return; +addInitEvent(function () { + var $ = jQuery; + var editform = $('#dw__editform'); + if (editform.length == 0) return; + + var edit_text = $('#wiki__text'); + if (edit_text.length > 0) { + if(edit_text.attr('readOnly')) return; + + // in Firefox, keypress doesn't send the correct keycodes, + // in Opera, the default of keydown can't be prevented + if (is_opera) { + edit_text.keypress(keyHandler); + } else { + edit_text.keydown(keyHandler); + } - // set focus + // set focus and place cursor at the start + var sel = getSelection(edit_text.get(0)); + sel.start = 0; + sel.end = 0; + setSelection(sel); edit_text.focus(); } - var checkfunc = function(){ + var checkfunc = function() { textChanged = true; //global var summaryCheck(); }; - addEvent(editform, 'change', checkfunc); - addEvent(editform, 'keydown', checkfunc); + + editform.change(checkfunc); + editform.keydown(checkfunc); window.onbeforeunload = function(){ - if(textChanged) { + if(window.textChanged) { return LANG.notsavedyet; } }; window.onunload = deleteDraft; // reset change memory var on submit - addEvent($('edbtn__save'), 'click', function(){ textChanged = false; }); - addEvent($('edbtn__preview'), 'click', function(){ textChanged = false; }); + $('#edbtn__save').click( + function() { + window.onbeforeunload = ''; + textChanged = false; + } + ); + $('#edbtn__preview').click( + function() { + window.onbeforeunload = ''; + textChanged = false; + window.keepDraft = true; // needed to keep draft on page unload + } + ); + + var summary = $('#edit__summary'); + summary.change(summaryCheck); + summary.keyup(summaryCheck); - var summary = $('edit__summary'); - addEvent(summary, 'change', summaryCheck); - addEvent(summary, 'keyup', summaryCheck); if (textChanged) summaryCheck(); }); @@ -333,112 +362,11 @@ addInitEvent(function (){ * @author Andreas Gohr <andi@splitbrain.org> */ function summaryCheck(){ - var sum = document.getElementById('edit__summary'); - if(sum.value === ''){ - sum.className='missing'; - }else{ - sum.className='edit'; + var sum = jQuery('#edit__summary'); + + if (sum.val() === '') { + sum.attr('class', 'missing'); + } else{ + sum.attr('class', 'edit'); } } - - -/** - * Class managing the timer to display a warning on a expiring lock - */ -function locktimer_class(){ - this.sack = null; - this.timeout = 0; - this.timerID = null; - this.lasttime = null; - this.msg = ''; - this.pageid = ''; -}; -var locktimer = new locktimer_class(); - locktimer.init = function(timeout,msg,draft){ - // init values - locktimer.timeout = timeout*1000; - locktimer.msg = msg; - locktimer.draft = draft; - locktimer.lasttime = new Date(); - - if(!$('dw__editform')) return; - locktimer.pageid = $('dw__editform').elements.id.value; - if(!locktimer.pageid) return; - - // init ajax component - locktimer.sack = new sack(DOKU_BASE + 'lib/exe/ajax.php'); - locktimer.sack.AjaxFailedAlert = ''; - locktimer.sack.encodeURIString = false; - locktimer.sack.onCompletion = locktimer.refreshed; - - // register refresh event - addEvent($('dw__editform'),'keypress',function(){locktimer.refresh();}); - // start timer - locktimer.reset(); - }; - - /** - * (Re)start the warning timer - */ - locktimer.reset = function(){ - locktimer.clear(); - locktimer.timerID = window.setTimeout("locktimer.warning()", locktimer.timeout); - }; - - /** - * Display the warning about the expiring lock - */ - locktimer.warning = function(){ - locktimer.clear(); - alert(locktimer.msg); - }; - - /** - * Remove the current warning timer - */ - locktimer.clear = function(){ - if(locktimer.timerID !== null){ - window.clearTimeout(locktimer.timerID); - locktimer.timerID = null; - } - }; - - /** - * Refresh the lock via AJAX - * - * Called on keypresses in the edit area - */ - locktimer.refresh = function(){ - var now = new Date(); - // refresh every minute only - if(now.getTime() - locktimer.lasttime.getTime() > 30*1000){ //FIXME decide on time - var params = 'call=lock&id='+encodeURIComponent(locktimer.pageid); - var dwform = $('dw__editform'); - if(locktimer.draft && dwform.elements.wikitext){ - params += '&prefix='+encodeURIComponent(dwform.elements.prefix.value); - params += '&wikitext='+encodeURIComponent(dwform.elements.wikitext.value); - params += '&suffix='+encodeURIComponent(dwform.elements.suffix.value); - if(dwform.elements.date){ - params += '&date='+encodeURIComponent(dwform.elements.date.value); - } - } - locktimer.sack.runAJAX(params); - locktimer.lasttime = now; - } - }; - - - /** - * Callback. Resets the warning timer - */ - locktimer.refreshed = function(){ - var data = this.response; - var error = data.charAt(0); - data = data.substring(1); - - $('draft__status').innerHTML=data; - if(error != '1') return; // locking failed - locktimer.reset(); - }; -// end of locktimer class functions - diff --git a/lib/scripts/editor.js b/lib/scripts/editor.js new file mode 100644 index 000000000..fbdb1d79a --- /dev/null +++ b/lib/scripts/editor.js @@ -0,0 +1,116 @@ +/** + * The DokuWiki editor features + * + * These are the advanced features of the editor. It does NOT contain any + * code for the toolbar buttons and it functions. See toolbar.js for that. + */ + +var dw_editor = { + + /** + * initialize the default editor functionality + * + * All other functions can also be called separately for non-default + * textareas + */ + init: function(){ + var editor = jQuery('#wiki__text'); + if(!editor.length) return; + + dw_editor.initSizeCtl('#size__ctl',editor); + }, + + /** + * Add the edit window size and wrap controls + * + * Initial values are read from cookie if it exists + * + * @param selector ctlarea the div to place the controls + * @param selector editor the textarea to control + */ + initSizeCtl: function(ctlarea,editor){ + var ctl = jQuery(ctlarea); + var textarea = jQuery(editor); + if(!ctl.length || !textarea.length) return; + + var hgt = DokuCookie.getValue('sizeCtl'); + if(hgt){ + textarea.css('height', hgt); + }else{ + textarea.css('height', '300px'); + } + + var wrp = DokuCookie.getValue('wrapCtl'); + if(wrp){ + dw_editor.setWrap(textarea[0], wrp); + } // else use default value + + var l = document.createElement('img'); + var s = document.createElement('img'); + var w = document.createElement('img'); + l.src = DOKU_BASE+'lib/images/larger.gif'; + s.src = DOKU_BASE+'lib/images/smaller.gif'; + w.src = DOKU_BASE+'lib/images/wrap.gif'; + jQuery(l).click(function(){dw_editor.sizeCtl(editor,100);}); + jQuery(s).click(function(){dw_editor.sizeCtl(editor,-100);}); + jQuery(w).click(function(){dw_editor.toggleWrap(editor);}); + ctl.append(l); + ctl.append(s); + ctl.append(w); + }, + + /** + * This sets the vertical size of the editbox and adjusts the cookie + * + * @param selector editor the textarea to control + * @param int val the relative value to resize in pixel + */ + sizeCtl: function(editor,val){ + var textarea = jQuery(editor); + var height = parseInt(textarea.css('height')); + height += val; + textarea.css('height', height+'px'); + DokuCookie.setValue('sizeCtl',textarea.css('height')); + }, + + /** + * Toggle the wrapping mode of the editor textarea and adjusts the + * cookie + * + * @param selector editor the textarea to control + */ + toggleWrap: function(editor){ + var textarea = jQuery(editor); + var wrap = textarea.attr('wrap'); + if(wrap && wrap.toLowerCase() == 'off'){ + dw_editor.setWrap(textarea[0], 'soft'); + }else{ + dw_editor.setWrap(textarea[0], 'off'); + } + DokuCookie.setValue('wrapCtl',textarea.attr('wrap')); + }, + + /** + * Set the wrapping mode of a textarea + * + * @author Fluffy Convict <fluffyconvict@hotmail.com> + * @author <shutdown@flashmail.com> + * @link http://news.hping.org/comp.lang.javascript.archive/12265.html + * @link https://bugzilla.mozilla.org/show_bug.cgi?id=41464 + * @param DomObject textarea + * @param string wrapAttrValue + */ + setWrap: function(textarea, wrapAttrValue){ + textarea.setAttribute('wrap', wrapAttrValue); + + // Fix display for mozilla + var parNod = textarea.parentNode; + var nxtSib = textarea.nextSibling; + parNod.removeChild(textarea); + parNod.insertBefore(textarea, nxtSib); + } + + +}; + +jQuery(dw_editor.init); diff --git a/lib/scripts/events.js b/lib/scripts/events.js deleted file mode 100644 index a1fcac718..000000000 --- a/lib/scripts/events.js +++ /dev/null @@ -1,181 +0,0 @@ -// written by Dean Edwards, 2005 -// with input from Tino Zijdel - -// http://dean.edwards.name/weblog/2005/10/add-event/ - -function addEvent(element, type, handler) { - // assign each event handler a unique ID - if (!handler.$$guid) handler.$$guid = addEvent.guid++; - // create a hash table of event types for the element - if (!element.events) element.events = {}; - // create a hash table of event handlers for each element/event pair - var handlers = element.events[type]; - if (!handlers) { - handlers = element.events[type] = {}; - // store the existing event handler (if there is one) - if (element["on" + type]) { - handlers[0] = element["on" + type]; - } - } - // store the event handler in the hash table - handlers[handler.$$guid] = handler; - // assign a global event handler to do all the work - element["on" + type] = handleEvent; -}; -// a counter used to create unique IDs -addEvent.guid = 1; - -function removeEvent(element, type, handler) { - // delete the event handler from the hash table - if (element.events && element.events[type]) { - delete element.events[type][handler.$$guid]; - } -}; - -function handleEvent(event) { - var returnValue = true; - // grab the event object (IE uses a global event object) - event = event || fixEvent(window.event, this); - // get a reference to the hash table of event handlers - var handlers = this.events[event.type]; - // execute each event handler - for (var i in handlers) { - if (!handlers.hasOwnProperty(i)) continue; - if (handlers[i].call(this, event) === false) { - returnValue = false; - } - } - return returnValue; -}; - -function fixEvent(event, _this) { - // add W3C standard event methods - event.preventDefault = fixEvent.preventDefault; - event.stopPropagation = fixEvent.stopPropagation; - // fix target - event.target = event.srcElement; - event.currentTarget = _this; - // fix coords - var base = (document.documentElement.scrollTop?document.documentElement:document.body); - event.pageX = (typeof event.pageX !== 'undefined') ? event.pageX : event.clientX + base.scrollLeft; - event.pageY = (typeof event.pageY !== 'undefined') ? event.pageY : event.clientY + base.scrollTop; - - return event; -}; -fixEvent.preventDefault = function() { - this.returnValue = false; -}; -fixEvent.stopPropagation = function() { - this.cancelBubble = true; -}; - - -/** - * Pseudo event handler to be fired after the DOM was parsed or - * on window load at last. - * - * @author based upon some code by Dean Edwards - * @author Dean Edwards - * @link http://dean.edwards.name/weblog/2006/06/again/ - */ -window.fireoninit = function() { - // quit if this function has already been called - if (arguments.callee.done) return; - // flag this function so we don't do the same thing twice - arguments.callee.done = true; - // kill the timer - if (_timer) { - clearInterval(_timer); - _timer = null; - } - - if (typeof window.oninit == 'function') { - window.oninit(); - } -}; - -/** - * Run the fireoninit function as soon as possible after - * the DOM was loaded, using different methods for different - * Browsers - * - * @author Dean Edwards - * @link http://dean.edwards.name/weblog/2006/06/again/ - */ - // for Mozilla - if (document.addEventListener) { - document.addEventListener("DOMContentLoaded", window.fireoninit, null); - } - - // for Internet Explorer (using conditional comments) - /*@cc_on - @if (@_win32) - document.write("<scr" + "ipt id=\"__ie_init\" defer=\"true\" src=\"//:\"><\/script>"); - var script = document.getElementById("__ie_init"); - script.onreadystatechange = function() { - if (this.readyState == "complete") { - window.fireoninit(); // call the onload handler - } - }; - @end @*/ - - // for Safari - if (/WebKit/i.test(navigator.userAgent)) { // sniff - var _timer = setInterval(function() { - if (/loaded|complete/.test(document.readyState)) { - window.fireoninit(); // call the onload handler - } - }, 10); - } - - // for other browsers - window.onload = window.fireoninit; - - -/** - * This is a pseudo Event that will be fired by the fireoninit - * function above. - * - * Use addInitEvent to bind to this event! - * - * @author Andreas Gohr <andi@splitbrain.org> - * @see fireoninit() - */ -window.oninit = function(){}; - -/** - * Bind a function to the window.init pseudo event - * - * @author Simon Willison - * @see http://simon.incutio.com/archive/2004/05/26/addLoadEvent - */ -function addInitEvent(func) { - var oldoninit = window.oninit; - if (typeof window.oninit != 'function') { - window.oninit = func; - } else { - window.oninit = function() { - oldoninit(); - func(); - }; - } -} - -/** - * Bind variables to a function call creating a closure - * - * Use this to circumvent variable scope problems when creating closures - * inside a loop - * - * @author Adrian Lang <lang@cosmocode.de> - * @link http://www.cosmocode.de/en/blog/gohr/2009-10/15-javascript-fixing-the-closure-scope-in-loops - * @param functionref fnc - the function to be called - * @param mixed - any arguments to be passed to the function - * @returns functionref - */ -function bind (fnc) { - var args = Array.prototype.slice.call(arguments, 1); - return function() { - return fnc.apply(this, args); - }; -} diff --git a/lib/scripts/helpers.js b/lib/scripts/helpers.js index 129964d29..b286965cf 100644 --- a/lib/scripts/helpers.js +++ b/lib/scripts/helpers.js @@ -144,3 +144,51 @@ function hasFlash(version){ if(ver >= version) return true; return false; } + +/** + * A PHP-style substr_replace + * + * Supports negative start and length and omitting length, but not + * str and replace arrays. + * See http://php.net/substr-replace for further documentation. + */ +function substr_replace(str, replace, start, length) { + var a2, b1; + a2 = (start < 0 ? str.length : 0) + start; + if (typeof length === 'undefined') { + length = str.length - a2; + } else if (length < 0 && start < 0 && length <= start) { + length = 0; + } + b1 = (length < 0 ? str.length : a2) + length; + return str.substring(0, a2) + replace + str.substring(b1); +} + +/** + * Bind variables to a function call creating a closure + * + * Use this to circumvent variable scope problems when creating closures + * inside a loop + * + * @author Adrian Lang <lang@cosmocode.de> + * @link http://www.cosmocode.de/en/blog/gohr/2009-10/15-javascript-fixing-the-closure-scope-in-loops + * @param functionref fnc - the function to be called + * @param mixed - any arguments to be passed to the function + * @returns functionref + */ +function bind(fnc/*, ... */) { + var Aps = Array.prototype.slice; + // Store passed arguments in this scope. + // Since arguments is no Array nor has an own slice method, + // we have to apply the slice method from the Array.prototype + var static_args = Aps.call(arguments, 1); + + // Return a function evaluating the passed function with the + // given args and optional arguments passed on invocation. + return function (/* ... */) { + // Same here, but we use Array.prototype.slice solely for + // converting arguments to an Array. + return fnc.apply(this, + static_args.concat(Aps.call(arguments, 0))); + }; +} diff --git a/lib/scripts/index.js b/lib/scripts/index.js index 9c7943d0c..96d4e2fb9 100644 --- a/lib/scripts/index.js +++ b/lib/scripts/index.js @@ -1,115 +1,19 @@ -/** - * Javascript for index view - * - * @author Andreas Gohr <andi@splitbrain.org> - */ - -var index = { - - /** - * Delay in ms before showing the throbber. - * Used to skip the throbber for fast AJAX calls. - */ - throbber_delay: 500, - - /** - * Attach event handlers to all "folders" below the given element - * - * @author Andreas Gohr <andi@splitbrain.org> - */ - treeattach: function(obj){ - if(!obj) return; - - var items = getElementsByClass('idx_dir',obj,'a'); - for(var i=0; i<items.length; i++){ - var elem = items[i]; - - // attach action to make the link clickable by AJAX - addEvent(elem,'click',function(e){ return index.toggle(e,this); }); - - // get the listitem the elem belongs to - var listitem = elem.parentNode; - while (listitem.tagName != 'LI') { - listitem = listitem.parentNode; - } - //when there are uls under this listitem mark this listitem as opened - if (listitem.getElementsByTagName('ul').length) { - listitem.open = true; - } - } - }, - - /** - * Open or close a subtree using AJAX - * The contents of subtrees are "cached" untill the page is reloaded. - * A "loading" indicator is shown only when the AJAX call is slow. - * - * @author Andreas Gohr <andi@splitbrain.org> - * @author Ben Coburn <btcoburn@silicodon.net> - */ - toggle: function(e,clicky){ - var listitem = clicky.parentNode.parentNode; - - listitem.open = !listitem.open; - // listitem.open represents now the action to be done - - // if already open, close by removing the sublist - var sublists = listitem.getElementsByTagName('ul'); - if(!listitem.open){ - if (sublists.length) { - sublists[0].style.display='none'; - } - listitem.className='closed'; - e.preventDefault(); - return false; - } - - // just show if already loaded - if(sublists.length && listitem.open){ - sublists[0].style.display=''; - listitem.className='open'; - e.preventDefault(); - return false; - } - - // prepare an AJAX call to fetch the subtree - var ajax = new sack(DOKU_BASE + 'lib/exe/ajax.php'); - ajax.AjaxFailedAlert = ''; - ajax.encodeURIString = false; - if(ajax.failed) return true; - - //prepare the new ul - var ul = document.createElement('ul'); - ul.className = 'idx'; - timeout = window.setTimeout(function(){ - // show the throbber as needed - if (listitem.open) { - ul.innerHTML = '<li><img src="'+DOKU_BASE+'lib/images/throbber.gif" alt="loading..." title="loading..." /></li>'; - listitem.appendChild(ul); - listitem.className='open'; - } - }, this.throbber_delay); - ajax.elementObj = ul; - ajax.afterCompletion = function(){ - window.clearTimeout(timeout); - index.treeattach(ul); - if (listitem.className!='open') { - if (!listitem.open) { - ul.style.display='none'; - } - listitem.appendChild(ul); - if (listitem.open) { - listitem.className='open'; - } - } - }; - ajax.runAJAX(clicky.search.substr(1)+'&call=index'); - e.preventDefault(); - return false; +/*jslint white: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: false, newcap: true, immed: true */ +/*global jQuery, window, DOKU_BASE, DEPRECATED, bind*/ + +var dw_index = jQuery('#index__tree').dw_tree({deferInit: true, + load_data: function (show_sublist, $clicky) { + jQuery.post( + DOKU_BASE + 'lib/exe/ajax.php', + $clicky[0].search.substr(1) + '&call=index', + show_sublist, 'html' + ); } -}; +}); +jQuery(function () { + var $tree = jQuery('#index__tree'); + dw_index.$obj = $tree; -addInitEvent(function(){ - index.treeattach($('index__tree')); + dw_index.init(); }); diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png Binary files differnew file mode 100644 index 000000000..5b5dab2ab --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png Binary files differnew file mode 100644 index 000000000..ac8b229af --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png Binary files differnew file mode 100644 index 000000000..ad3d6346e --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png Binary files differnew file mode 100644 index 000000000..42ccba269 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png Binary files differnew file mode 100644 index 000000000..5a46b47cb --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png Binary files differnew file mode 100644 index 000000000..86c2baa65 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png Binary files differnew file mode 100644 index 000000000..4443fdc1a --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png Binary files differnew file mode 100644 index 000000000..7c9fa6c6e --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 000000000..b273ff111 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png Binary files differnew file mode 100644 index 000000000..09d1cdc85 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png Binary files differnew file mode 100644 index 000000000..59bd45b90 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png Binary files differnew file mode 100644 index 000000000..6d02426c1 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png Binary files differnew file mode 100644 index 000000000..2ab019b73 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png diff --git a/lib/scripts/jquery/jquery-ui-theme/smoothness.css b/lib/scripts/jquery/jquery-ui-theme/smoothness.css new file mode 100644 index 000000000..ad212daef --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/smoothness.css @@ -0,0 +1,568 @@ +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* + * jQuery UI Resizable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.14 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/lib/scripts/jquery/jquery-ui.js b/lib/scripts/jquery/jquery-ui.js new file mode 100644 index 000000000..bc11b0315 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui.js @@ -0,0 +1,11729 @@ +/*! + * jQuery UI 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.14", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + $( elem ).triggerHandler( "remove" ); + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + $( this ).triggerHandler( "remove" ); + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$(document).mousedown(function(e) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if(mouseHandled) {return}; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/* + * jQuery UI Draggable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue if helper is set to "original" + if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.14" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Droppable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.14" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); +/* + * jQuery UI Resizable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.14" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * jQuery UI Selectable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.14" +}); + +})(jQuery); +/* + * jQuery UI Sortable 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.14" +}); + +})(jQuery); +/* + * jQuery UI Effects 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.14", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }); + + element.wrap(wrapper); + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + if (element.parent().is('.ui-effects-wrapper')) + return element.parent().replaceWith(element); + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/* + * jQuery UI Effects Blind 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Bounce 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Clip 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Drop 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Explode 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Fade 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Fold 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Highlight 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Scale 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Shake 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Slide 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Transfer 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Accordion 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.14", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/* + * jQuery UI Autocomplete 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.attr( "readonly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + autocompleteRequest: ++requestIndex, + success: function( data, status ) { + if ( this.autocompleteRequest === requestIndex ) { + response( data ); + } + }, + error: function() { + if ( this.autocompleteRequest === requestIndex ) { + response( [] ); + } + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.pending--; + if ( !this.pending ) { + this.element.removeClass( "ui-autocomplete-loading" ); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + ul.width( "" ).outerWidth(), + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/* + * jQuery UI Button 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.attr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", true ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for=" + this.element.attr("id") + "]"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.attr( "disabled", true ); + } else { + this.element.removeAttr( "disabled" ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", true ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", false ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var ltr = this.element.css( "direction" ) === "ltr"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( ltr ? "ui-corner-left" : "ui-corner-right" ) + .end() + .filter( ":last" ) + .addClass( ltr ? "ui-corner-right" : "ui-corner-left" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/* + * jQuery UI Datepicker 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.14" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false // True to size the input for the date format, false to leave as is + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + inst.dpDiv.show(); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + if ( $.datepicker._datepickerShowing ) { + $.datepicker._triggerOnClose($.datepicker._curInst); + } + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {})); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Trigger custom callback of onClose. */ + _triggerOnClose: function(inst) { + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + $.datepicker._triggerOnClose(inst); + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst._selectingMonthYear = false; + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Restore input focus after not changing month/year. */ + _clickMonthYear: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (inst.input && inst._selectingMonthYear) { + setTimeout(function() { + inst.input.focus(); + }, 0); + } + inst._selectingMonthYear = !inst._selectingMonthYear; + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.14"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/* + * jQuery UI Dialog 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.14", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * jQuery UI Position 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * jQuery UI Progressbar 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.14" +}); + +})( jQuery ); +/* + * jQuery UI Slider 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "<div></div>" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.attr( "disabled", "disabled" ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.removeAttr( "disabled" ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step; + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.14" +}); + +}(jQuery)); +/* + * jQuery UI Tabs 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.14" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/lib/scripts/jquery/jquery-ui.min.js b/lib/scripts/jquery/jquery-ui.min.js new file mode 100644 index 000000000..882309218 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui.min.js @@ -0,0 +1,412 @@ +/*! + * jQuery UI 1.8.14 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(a,d){function c(h,g){var i=h.nodeName.toLowerCase();if("area"===i){g=h.parentNode;i=g.name;if(!h.href||!i||g.nodeName.toLowerCase()!=="map")return false;h=a("img[usemap=#"+i+"]")[0];return!!h&&e(h)}return(/input|select|textarea|button|object/.test(i)?!h.disabled:"a"==i?h.href||g:g)&&e(h)}function e(h){return!a(h).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(!a.ui.version){a.extend(a.ui,{version:"1.8.14", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({_focus:a.fn.focus,focus:function(h,g){return typeof h==="number"?this.each(function(){var i=this;setTimeout(function(){a(i).focus(); +g&&g.call(i)},h)}):this._focus.apply(this,arguments)},scrollParent:function(){var h;h=a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this, +"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!h.length?a(document):h},zIndex:function(h){if(h!==d)return this.css("zIndex",h);if(this.length){h=a(this[0]);for(var g;h.length&&h[0]!==document;){g=h.css("position");if(g==="absolute"||g==="relative"||g==="fixed"){g=parseInt(h.css("zIndex"),10);if(!isNaN(g)&&g!==0)return g}h=h.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection", +function(h){h.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(h,g){function i(l,o,n,k){a.each(b,function(){o-=parseFloat(a.curCSS(l,"padding"+this,true))||0;if(n)o-=parseFloat(a.curCSS(l,"border"+this+"Width",true))||0;if(k)o-=parseFloat(a.curCSS(l,"margin"+this,true))||0});return o}var b=g==="Width"?["Left","Right"]:["Top","Bottom"],f=g.toLowerCase(),j={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth, +outerHeight:a.fn.outerHeight};a.fn["inner"+g]=function(l){if(l===d)return j["inner"+g].call(this);return this.each(function(){a(this).css(f,i(this,l)+"px")})};a.fn["outer"+g]=function(l,o){if(typeof l!=="number")return j["outer"+g].call(this,l);return this.each(function(){a(this).css(f,i(this,l,true,o)+"px")})}});a.extend(a.expr[":"],{data:function(h,g,i){return!!a.data(h,i[3])},focusable:function(h){return c(h,!isNaN(a.attr(h,"tabindex")))},tabbable:function(h){var g=a.attr(h,"tabindex"),i=isNaN(g); +return(i||g>=0)&&c(h,!i)}});a(function(){var h=document.body,g=h.appendChild(g=document.createElement("div"));a.extend(g.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=g.offsetHeight===100;a.support.selectstart="onselectstart"in g;h.removeChild(g).style.display="none"});a.extend(a.ui,{plugin:{add:function(h,g,i){h=a.ui[h].prototype;for(var b in i){h.plugins[b]=h.plugins[b]||[];h.plugins[b].push([g,i[b]])}},call:function(h,g,i){if((g=h.plugins[g])&&h.element[0].parentNode)for(var b= +0;b<g.length;b++)h.options[g[b][0]]&&g[b][1].apply(h.element,i)}},contains:function(h,g){return document.compareDocumentPosition?h.compareDocumentPosition(g)&16:h!==g&&h.contains(g)},hasScroll:function(h,g){if(a(h).css("overflow")==="hidden")return false;g=g&&g==="left"?"scrollLeft":"scrollTop";var i=false;if(h[g]>0)return true;h[g]=1;i=h[g]>0;h[g]=0;return i},isOverAxis:function(h,g,i){return h>g&&h<g+i},isOver:function(h,g,i,b,f,j){return a.ui.isOverAxis(h,i,f)&&a.ui.isOverAxis(g,b,j)}})}})(jQuery); +(function(a,d){if(a.cleanData){var c=a.cleanData;a.cleanData=function(h){for(var g=0,i;(i=h[g])!=null;g++)a(i).triggerHandler("remove");c(h)}}else{var e=a.fn.remove;a.fn.remove=function(h,g){return this.each(function(){if(!g)if(!h||a.filter(h,[this]).length)a("*",this).add([this]).each(function(){a(this).triggerHandler("remove")});return e.call(a(this),h,g)})}}a.widget=function(h,g,i){var b=h.split(".")[0],f;h=h.split(".")[1];f=b+"-"+h;if(!i){i=g;g=a.Widget}a.expr[":"][f]=function(j){return!!a.data(j, +h)};a[b]=a[b]||{};a[b][h]=function(j,l){arguments.length&&this._createWidget(j,l)};g=new g;g.options=a.extend(true,{},g.options);a[b][h].prototype=a.extend(true,g,{namespace:b,widgetName:h,widgetEventPrefix:a[b][h].prototype.widgetEventPrefix||h,widgetBaseClass:f},i);a.widget.bridge(h,a[b][h])};a.widget.bridge=function(h,g){a.fn[h]=function(i){var b=typeof i==="string",f=Array.prototype.slice.call(arguments,1),j=this;i=!b&&f.length?a.extend.apply(null,[true,i].concat(f)):i;if(b&&i.charAt(0)==="_")return j; +b?this.each(function(){var l=a.data(this,h),o=l&&a.isFunction(l[i])?l[i].apply(l,f):l;if(o!==l&&o!==d){j=o;return false}}):this.each(function(){var l=a.data(this,h);l?l.option(i||{})._init():a.data(this,h,new g(i,this))});return j}};a.Widget=function(h,g){arguments.length&&this._createWidget(h,g)};a.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(h,g){a.data(g,this.widgetName,this);this.element=a(g);this.options=a.extend(true,{},this.options, +this._getCreateOptions(),h);var i=this;this.element.bind("remove."+this.widgetName,function(){i.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return a.metadata&&a.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(h,g){var i=h;if(arguments.length===0)return a.extend({},this.options);if(typeof h==="string"){if(g===d)return this.options[h];i={};i[h]=g}this._setOptions(i);return this},_setOptions:function(h){var g=this;a.each(h,function(i,b){g._setOption(i,b)});return this},_setOption:function(h,g){this.options[h]=g;if(h==="disabled")this.widget()[g?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",g);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(h,g,i){var b=this.options[h];g=a.Event(g);g.type=(h===this.widgetEventPrefix?h:this.widgetEventPrefix+h).toLowerCase();i=i||{};if(g.originalEvent){h=a.event.props.length;for(var f;h;){f=a.event.props[--h];g[f]=g.originalEvent[f]}}this.element.trigger(g,i);return!(a.isFunction(b)&&b.call(this.element[0],g,i)===false||g.isDefaultPrevented())}}})(jQuery); +(function(a){var d=false;a(document).mousedown(function(){d=false});a.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var c=this;this.element.bind("mousedown."+this.widgetName,function(e){return c._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===a.data(e.target,c.widgetName+".preventClickEvent")){a.removeData(e.target,c.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ +this.widgetName)},_mouseDown:function(c){if(!d){this._mouseStarted&&this._mouseUp(c);this._mouseDownEvent=c;var e=this,h=c.which==1,g=typeof this.options.cancel=="string"?a(c.target).closest(this.options.cancel).length:false;if(!h||g||!this._mouseCapture(c))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c)){this._mouseStarted=this._mouseStart(c)!== +false;if(!this._mouseStarted){c.preventDefault();return true}}true===a.data(c.target,this.widgetName+".preventClickEvent")&&a.removeData(c.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(i){return e._mouseMove(i)};this._mouseUpDelegate=function(i){return e._mouseUp(i)};a(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.preventDefault();return d=true}},_mouseMove:function(c){if(a.browser.msie&& +!(document.documentMode>=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c);return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;c.target==this._mouseDownEvent.target&&a.data(c.target,this.widgetName+".preventClickEvent",true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +(function(a){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(d){var c= +this.options;if(this.helper||c.disabled||a(d.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(d);if(!this.handle)return false;a(c.iframeFix===true?"iframe":c.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(a(this).offset()).appendTo("body")});return true},_mouseStart:function(d){var c=this.options;this.helper= +this._createHelper(d);this._cacheHelperProportions();if(a.ui.ddmanager)a.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);c.containment&&this._setContainment();if(this._trigger("start",d)===false){this._clear();return false}this._cacheHelperProportions();a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(d,true);a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,d);return true}, +_mouseDrag:function(d,c){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!c){c=this._uiHash();if(this._trigger("drag",d,c)===false){this._mouseUp({});return false}this.position=c.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);return false},_mouseStop:function(d){var c= +false;if(a.ui.ddmanager&&!this.options.dropBehaviour)c=a.ui.ddmanager.drop(this,d);if(this.dropped){c=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===true||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var e=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){e._trigger("stop",d)!==false&&e._clear()})}else this._trigger("stop",d)!==false&&this._clear();return false},_mouseUp:function(d){this.options.iframeFix===true&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,d);return a.ui.mouse.prototype._mouseUp.call(this,d)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(d){var c=!this.options.handle|| +!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==d.target)c=true});return c},_createHelper:function(d){var c=this.options;d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[d])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo);d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&& +d.css("position","absolute");return d},_adjustOffsetFromHelper:function(d){if(typeof d=="string")d=d.split(" ");if(a.isArray(d))d={left:+d[0],top:+d[1]||0};if("left"in d)this.offset.click.left=d.left+this.margins.left;if("right"in d)this.offset.click.left=this.helperProportions.width-d.right+this.margins.left;if("top"in d)this.offset.click.top=d.top+this.margins.top;if("bottom"in d)this.offset.click.top=this.helperProportions.height-d.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var d=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){d.left+=this.scrollParent.scrollLeft();d.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)d={top:0,left:0};return{top:d.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:d.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var d=this.element.position();return{top:d.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:d.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var d=this.options;if(d.containment=="parent")d.containment=this.helper[0].parentNode;if(d.containment=="document"||d.containment=="window")this.containment=[d.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,d.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(d.containment=="document"?0:a(window).scrollLeft())+a(d.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d.containment=="document"?0:a(window).scrollTop())+(a(d.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(d.containment)&&d.containment.constructor!=Array){d=a(d.containment);var c=d[0];if(c){d.offset();var e=a(c).css("overflow")!= +"hidden";this.containment=[(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0),(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0),(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"), +10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=d}}else if(d.containment.constructor==Array)this.containment=d.containment},_convertPositionTo:function(d,c){if(!c)c=this.position;d=d=="absolute"?1:-1;var e=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName);return{top:c.top+ +this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():h?0:e.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:e.scrollLeft())*d)}},_generatePosition:function(d){var c=this.options,e=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName),g=d.pageX,i=d.pageY;if(this.originalPosition){var b;if(this.containment){if(this.relative_container){b=this.relative_container.offset();b=[this.containment[0]+b.left,this.containment[1]+b.top,this.containment[2]+b.left,this.containment[3]+b.top]}else b=this.containment;if(d.pageX-this.offset.click.left<b[0])g=b[0]+this.offset.click.left; +if(d.pageY-this.offset.click.top<b[1])i=b[1]+this.offset.click.top;if(d.pageX-this.offset.click.left>b[2])g=b[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>b[3])i=b[3]+this.offset.click.top}if(c.grid){i=c.grid[1]?this.originalPageY+Math.round((i-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;i=b?!(i-this.offset.click.top<b[1]||i-this.offset.click.top>b[3])?i:!(i-this.offset.click.top<b[1])?i-c.grid[1]:i+c.grid[1]:i;g=c.grid[0]?this.originalPageX+Math.round((g-this.originalPageX)/ +c.grid[0])*c.grid[0]:this.originalPageX;g=b?!(g-this.offset.click.left<b[0]||g-this.offset.click.left>b[2])?g:!(g-this.offset.click.left<b[0])?g-c.grid[0]:g+c.grid[0]:g}}return{top:i-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():h?0:e.scrollTop()),left:g-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&a.browser.version< +526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:e.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(d,c,e){e=e||this._uiHash();a.ui.plugin.call(this,d,[c,e]);if(d=="drag")this.positionAbs=this._convertPositionTo("absolute");return a.Widget.prototype._trigger.call(this,d,c, +e)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});a.extend(a.ui.draggable,{version:"1.8.14"});a.ui.plugin.add("draggable","connectToSortable",{start:function(d,c){var e=a(this).data("draggable"),h=e.options,g=a.extend({},c,{item:e.element});e.sortables=[];a(h.connectToSortable).each(function(){var i=a.data(this,"sortable");if(i&&!i.options.disabled){e.sortables.push({instance:i,shouldRevert:i.options.revert}); +i.refreshPositions();i._trigger("activate",d,g)}})},stop:function(d,c){var e=a(this).data("draggable"),h=a.extend({},c,{item:e.element});a.each(e.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;e.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(d);this.instance.options.helper=this.instance.options._helper;e.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval= +false;this.instance._trigger("deactivate",d,h)}})},drag:function(d,c){var e=a(this).data("draggable"),h=this;a.each(e.sortables,function(){this.instance.positionAbs=e.positionAbs;this.instance.helperProportions=e.helperProportions;this.instance.offset.click=e.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(h).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true); +this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return c.helper[0]};d.target=this.instance.currentItem[0];this.instance._mouseCapture(d,true);this.instance._mouseStart(d,true,true);this.instance.offset.click.top=e.offset.click.top;this.instance.offset.click.left=e.offset.click.left;this.instance.offset.parent.left-=e.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=e.offset.parent.top-this.instance.offset.parent.top; +e._trigger("toSortable",d);e.dropped=this.instance.element;e.currentItem=e.element;this.instance.fromOutside=e}this.instance.currentItem&&this.instance._mouseDrag(d)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",d,this.instance._uiHash(this.instance));this.instance._mouseStop(d,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&& +this.instance.placeholder.remove();e._trigger("fromSortable",d);e.dropped=false}})}});a.ui.plugin.add("draggable","cursor",{start:function(){var d=a("body"),c=a(this).data("draggable").options;if(d.css("cursor"))c._cursor=d.css("cursor");d.css("cursor",c.cursor)},stop:function(){var d=a(this).data("draggable").options;d._cursor&&a("body").css("cursor",d._cursor)}});a.ui.plugin.add("draggable","opacity",{start:function(d,c){d=a(c.helper);c=a(this).data("draggable").options;if(d.css("opacity"))c._opacity= +d.css("opacity");d.css("opacity",c.opacity)},stop:function(d,c){d=a(this).data("draggable").options;d._opacity&&a(c.helper).css("opacity",d._opacity)}});a.ui.plugin.add("draggable","scroll",{start:function(){var d=a(this).data("draggable");if(d.scrollParent[0]!=document&&d.scrollParent[0].tagName!="HTML")d.overflowOffset=d.scrollParent.offset()},drag:function(d){var c=a(this).data("draggable"),e=c.options,h=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!e.axis||e.axis!= +"x")if(c.overflowOffset.top+c.scrollParent[0].offsetHeight-d.pageY<e.scrollSensitivity)c.scrollParent[0].scrollTop=h=c.scrollParent[0].scrollTop+e.scrollSpeed;else if(d.pageY-c.overflowOffset.top<e.scrollSensitivity)c.scrollParent[0].scrollTop=h=c.scrollParent[0].scrollTop-e.scrollSpeed;if(!e.axis||e.axis!="y")if(c.overflowOffset.left+c.scrollParent[0].offsetWidth-d.pageX<e.scrollSensitivity)c.scrollParent[0].scrollLeft=h=c.scrollParent[0].scrollLeft+e.scrollSpeed;else if(d.pageX-c.overflowOffset.left< +e.scrollSensitivity)c.scrollParent[0].scrollLeft=h=c.scrollParent[0].scrollLeft-e.scrollSpeed}else{if(!e.axis||e.axis!="x")if(d.pageY-a(document).scrollTop()<e.scrollSensitivity)h=a(document).scrollTop(a(document).scrollTop()-e.scrollSpeed);else if(a(window).height()-(d.pageY-a(document).scrollTop())<e.scrollSensitivity)h=a(document).scrollTop(a(document).scrollTop()+e.scrollSpeed);if(!e.axis||e.axis!="y")if(d.pageX-a(document).scrollLeft()<e.scrollSensitivity)h=a(document).scrollLeft(a(document).scrollLeft()- +e.scrollSpeed);else if(a(window).width()-(d.pageX-a(document).scrollLeft())<e.scrollSensitivity)h=a(document).scrollLeft(a(document).scrollLeft()+e.scrollSpeed)}h!==false&&a.ui.ddmanager&&!e.dropBehaviour&&a.ui.ddmanager.prepareOffsets(c,d)}});a.ui.plugin.add("draggable","snap",{start:function(){var d=a(this).data("draggable"),c=d.options;d.snapElements=[];a(c.snap.constructor!=String?c.snap.items||":data(draggable)":c.snap).each(function(){var e=a(this),h=e.offset();this!=d.element[0]&&d.snapElements.push({item:this, +width:e.outerWidth(),height:e.outerHeight(),top:h.top,left:h.left})})},drag:function(d,c){for(var e=a(this).data("draggable"),h=e.options,g=h.snapTolerance,i=c.offset.left,b=i+e.helperProportions.width,f=c.offset.top,j=f+e.helperProportions.height,l=e.snapElements.length-1;l>=0;l--){var o=e.snapElements[l].left,n=o+e.snapElements[l].width,k=e.snapElements[l].top,m=k+e.snapElements[l].height;if(o-g<i&&i<n+g&&k-g<f&&f<m+g||o-g<i&&i<n+g&&k-g<j&&j<m+g||o-g<b&&b<n+g&&k-g<f&&f<m+g||o-g<b&&b<n+g&&k-g<j&& +j<m+g){if(h.snapMode!="inner"){var p=Math.abs(k-j)<=g,q=Math.abs(m-f)<=g,s=Math.abs(o-b)<=g,r=Math.abs(n-i)<=g;if(p)c.position.top=e._convertPositionTo("relative",{top:k-e.helperProportions.height,left:0}).top-e.margins.top;if(q)c.position.top=e._convertPositionTo("relative",{top:m,left:0}).top-e.margins.top;if(s)c.position.left=e._convertPositionTo("relative",{top:0,left:o-e.helperProportions.width}).left-e.margins.left;if(r)c.position.left=e._convertPositionTo("relative",{top:0,left:n}).left-e.margins.left}var u= +p||q||s||r;if(h.snapMode!="outer"){p=Math.abs(k-f)<=g;q=Math.abs(m-j)<=g;s=Math.abs(o-i)<=g;r=Math.abs(n-b)<=g;if(p)c.position.top=e._convertPositionTo("relative",{top:k,left:0}).top-e.margins.top;if(q)c.position.top=e._convertPositionTo("relative",{top:m-e.helperProportions.height,left:0}).top-e.margins.top;if(s)c.position.left=e._convertPositionTo("relative",{top:0,left:o}).left-e.margins.left;if(r)c.position.left=e._convertPositionTo("relative",{top:0,left:n-e.helperProportions.width}).left-e.margins.left}if(!e.snapElements[l].snapping&& +(p||q||s||r||u))e.options.snap.snap&&e.options.snap.snap.call(e.element,d,a.extend(e._uiHash(),{snapItem:e.snapElements[l].item}));e.snapElements[l].snapping=p||q||s||r||u}else{e.snapElements[l].snapping&&e.options.snap.release&&e.options.snap.release.call(e.element,d,a.extend(e._uiHash(),{snapItem:e.snapElements[l].item}));e.snapElements[l].snapping=false}}}});a.ui.plugin.add("draggable","stack",{start:function(){var d=a(this).data("draggable").options;d=a.makeArray(a(d.stack)).sort(function(e,h){return(parseInt(a(e).css("zIndex"), +10)||0)-(parseInt(a(h).css("zIndex"),10)||0)});if(d.length){var c=parseInt(d[0].style.zIndex)||0;a(d).each(function(e){this.style.zIndex=c+e});this[0].style.zIndex=c+d.length}}});a.ui.plugin.add("draggable","zIndex",{start:function(d,c){d=a(c.helper);c=a(this).data("draggable").options;if(d.css("zIndex"))c._zIndex=d.css("zIndex");d.css("zIndex",c.zIndex)},stop:function(d,c){d=a(this).data("draggable").options;d._zIndex&&a(c.helper).css("zIndex",d._zIndex)}})})(jQuery); +(function(a){a.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var d=this.options,c=d.accept;this.isover=0;this.isout=1;this.accept=a.isFunction(c)?c:function(e){return e.is(c)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};a.ui.ddmanager.droppables[d.scope]=a.ui.ddmanager.droppables[d.scope]||[];a.ui.ddmanager.droppables[d.scope].push(this); +d.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var d=a.ui.ddmanager.droppables[this.options.scope],c=0;c<d.length;c++)d[c]==this&&d.splice(c,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(d,c){if(d=="accept")this.accept=a.isFunction(c)?c:function(e){return e.is(c)};a.Widget.prototype._setOption.apply(this,arguments)},_activate:function(d){var c=a.ui.ddmanager.current;this.options.activeClass&& +this.element.addClass(this.options.activeClass);c&&this._trigger("activate",d,this.ui(c))},_deactivate:function(d){var c=a.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);c&&this._trigger("deactivate",d,this.ui(c))},_over:function(d){var c=a.ui.ddmanager.current;if(!(!c||(c.currentItem||c.element)[0]==this.element[0]))if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); +this._trigger("over",d,this.ui(c))}},_out:function(d){var c=a.ui.ddmanager.current;if(!(!c||(c.currentItem||c.element)[0]==this.element[0]))if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",d,this.ui(c))}},_drop:function(d,c){var e=c||a.ui.ddmanager.current;if(!e||(e.currentItem||e.element)[0]==this.element[0])return false;var h=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= +a.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==e.options.scope&&g.accept.call(g.element[0],e.currentItem||e.element)&&a.ui.intersect(e,a.extend(g,{offset:g.element.offset()}),g.options.tolerance)){h=true;return false}});if(h)return false;if(this.accept.call(this.element[0],e.currentItem||e.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", +d,this.ui(e));return this.element}return false},ui:function(d){return{draggable:d.currentItem||d.element,helper:d.helper,position:d.position,offset:d.positionAbs}}});a.extend(a.ui.droppable,{version:"1.8.14"});a.ui.intersect=function(d,c,e){if(!c.offset)return false;var h=(d.positionAbs||d.position.absolute).left,g=h+d.helperProportions.width,i=(d.positionAbs||d.position.absolute).top,b=i+d.helperProportions.height,f=c.offset.left,j=f+c.proportions.width,l=c.offset.top,o=l+c.proportions.height; +switch(e){case "fit":return f<=h&&g<=j&&l<=i&&b<=o;case "intersect":return f<h+d.helperProportions.width/2&&g-d.helperProportions.width/2<j&&l<i+d.helperProportions.height/2&&b-d.helperProportions.height/2<o;case "pointer":return a.ui.isOver((d.positionAbs||d.position.absolute).top+(d.clickOffset||d.offset.click).top,(d.positionAbs||d.position.absolute).left+(d.clickOffset||d.offset.click).left,l,f,c.proportions.height,c.proportions.width);case "touch":return(i>=l&&i<=o||b>=l&&b<=o||i<l&&b>o)&&(h>= +f&&h<=j||g>=f&&g<=j||h<f&&g>j);default:return false}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(d,c){var e=a.ui.ddmanager.droppables[d.options.scope]||[],h=c?c.type:null,g=(d.currentItem||d.element).find(":data(droppable)").andSelf(),i=0;a:for(;i<e.length;i++)if(!(e[i].options.disabled||d&&!e[i].accept.call(e[i].element[0],d.currentItem||d.element))){for(var b=0;b<g.length;b++)if(g[b]==e[i].element[0]){e[i].proportions.height=0;continue a}e[i].visible=e[i].element.css("display")!= +"none";if(e[i].visible){h=="mousedown"&&e[i]._activate.call(e[i],c);e[i].offset=e[i].element.offset();e[i].proportions={width:e[i].element[0].offsetWidth,height:e[i].element[0].offsetHeight}}}},drop:function(d,c){var e=false;a.each(a.ui.ddmanager.droppables[d.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&a.ui.intersect(d,this,this.options.tolerance))e=e||this._drop.call(this,c);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],d.currentItem|| +d.element)){this.isout=1;this.isover=0;this._deactivate.call(this,c)}}});return e},dragStart:function(d,c){d.element.parentsUntil("body").bind("scroll.droppable",function(){d.options.refreshPositions||a.ui.ddmanager.prepareOffsets(d,c)})},drag:function(d,c){d.options.refreshPositions&&a.ui.ddmanager.prepareOffsets(d,c);a.each(a.ui.ddmanager.droppables[d.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var e=a.ui.intersect(d,this,this.options.tolerance);if(e= +!e&&this.isover==1?"isout":e&&this.isover==0?"isover":null){var h;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){h=a.data(g[0],"droppable");h.greedyChild=e=="isover"?1:0}}if(h&&e=="isover"){h.isover=0;h.isout=1;h._out.call(h,c)}this[e]=1;this[e=="isout"?"isover":"isout"]=0;this[e=="isover"?"_over":"_out"].call(this,c);if(h&&e=="isout"){h.isout=0;h.isover=1;h._over.call(h,c)}}}})},dragStop:function(d,c){d.element.parentsUntil("body").unbind("scroll.droppable"); +d.options.refreshPositions||a.ui.ddmanager.prepareOffsets(d,c)}}})(jQuery); +(function(a){a.widget("ui.resizable",a.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var e=this,h=this.options;this.element.addClass("ui-resizable");a.extend(this,{_aspectRatio:!!h.aspectRatio,aspectRatio:h.aspectRatio,originalElement:this.element, +_proportionallyResizeElements:[],_helper:h.helper||h.ghost||h.animate?h.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&a.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(a('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=h.handles||(!a(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var g=this.handles.split(",");this.handles={};for(var i=0;i<g.length;i++){var b=a.trim(g[i]),f=a('<div class="ui-resizable-handle '+("ui-resizable-"+b)+'"></div>');/sw|se|ne|nw/.test(b)&&f.css({zIndex:++h.zIndex});"se"==b&&f.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[b]=".ui-resizable-"+b;this.element.append(f)}}this._renderAxis=function(j){j=j||this.element;for(var l in this.handles){if(this.handles[l].constructor== +String)this.handles[l]=a(this.handles[l],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=a(this.handles[l],this.element),n=0;n=/sw|ne|nw|se|n|s/.test(l)?o.outerHeight():o.outerWidth();o=["padding",/ne|nw|n/.test(l)?"Top":/se|sw|s/.test(l)?"Bottom":/^e$/.test(l)?"Right":"Left"].join("");j.css(o,n);this._proportionallyResize()}a(this.handles[l])}};this._renderAxis(this.element);this._handles=a(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!e.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);e.axis=j&&j[1]?j[1]:"se"}});if(h.autoHide){this._handles.hide();a(this.element).addClass("ui-resizable-autohide").hover(function(){if(!h.disabled){a(this).removeClass("ui-resizable-autohide");e._handles.show()}},function(){if(!h.disabled)if(!e.resizing){a(this).addClass("ui-resizable-autohide");e._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var e=function(g){a(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var h=this.element;h.after(this.originalElement.css({position:h.css("position"),width:h.outerWidth(),height:h.outerHeight(),top:h.css("top"),left:h.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(e){var h= +false;for(var g in this.handles)if(a(this.handles[g])[0]==e.target)h=true;return!this.options.disabled&&h},_mouseStart:function(e){var h=this.options,g=this.element.position(),i=this.element;this.resizing=true;this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()};if(i.is(".ui-draggable")||/absolute/.test(i.css("position")))i.css({position:"absolute",top:g.top,left:g.left});a.browser.opera&&/relative/.test(i.css("position"))&&i.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();g=d(this.helper.css("left"));var b=d(this.helper.css("top"));if(h.containment){g+=a(h.containment).scrollLeft()||0;b+=a(h.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:g,top:b};this.size=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalSize=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalPosition={left:g,top:b};this.sizeDiff= +{width:i.outerWidth()-i.width(),height:i.outerHeight()-i.height()};this.originalMousePosition={left:e.pageX,top:e.pageY};this.aspectRatio=typeof h.aspectRatio=="number"?h.aspectRatio:this.originalSize.width/this.originalSize.height||1;h=a(".ui-resizable-"+this.axis).css("cursor");a("body").css("cursor",h=="auto"?this.axis+"-resize":h);i.addClass("ui-resizable-resizing");this._propagate("start",e);return true},_mouseDrag:function(e){var h=this.helper,g=this.originalMousePosition,i=this._change[this.axis]; +if(!i)return false;g=i.apply(this,[e,e.pageX-g.left||0,e.pageY-g.top||0]);this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey)g=this._updateRatio(g,e);g=this._respectSize(g,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(g);this._trigger("resize",e,this.ui());return false}, +_mouseStop:function(e){this.resizing=false;var h=this.options,g=this;if(this._helper){var i=this._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName);i=b&&a.ui.hasScroll(i[0],"left")?0:g.sizeDiff.height;b=b?0:g.sizeDiff.width;b={width:g.helper.width()-b,height:g.helper.height()-i};i=parseInt(g.element.css("left"),10)+(g.position.left-g.originalPosition.left)||null;var f=parseInt(g.element.css("top"),10)+(g.position.top-g.originalPosition.top)||null;h.animate||this.element.css(a.extend(b, +{top:f,left:i}));g.helper.height(g.size.height);g.helper.width(g.size.width);this._helper&&!h.animate&&this._proportionallyResize()}a("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",e);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(e){var h=this.options,g,i,b;h={minWidth:c(h.minWidth)?h.minWidth:0,maxWidth:c(h.maxWidth)?h.maxWidth:Infinity,minHeight:c(h.minHeight)?h.minHeight:0,maxHeight:c(h.maxHeight)?h.maxHeight: +Infinity};if(this._aspectRatio||e){e=h.minHeight*this.aspectRatio;i=h.minWidth/this.aspectRatio;g=h.maxHeight*this.aspectRatio;b=h.maxWidth/this.aspectRatio;if(e>h.minWidth)h.minWidth=e;if(i>h.minHeight)h.minHeight=i;if(g<h.maxWidth)h.maxWidth=g;if(b<h.maxHeight)h.maxHeight=b}this._vBoundaries=h},_updateCache:function(e){this.offset=this.helper.offset();if(c(e.left))this.position.left=e.left;if(c(e.top))this.position.top=e.top;if(c(e.height))this.size.height=e.height;if(c(e.width))this.size.width= +e.width},_updateRatio:function(e){var h=this.position,g=this.size,i=this.axis;if(c(e.height))e.width=e.height*this.aspectRatio;else if(c(e.width))e.height=e.width/this.aspectRatio;if(i=="sw"){e.left=h.left+(g.width-e.width);e.top=null}if(i=="nw"){e.top=h.top+(g.height-e.height);e.left=h.left+(g.width-e.width)}return e},_respectSize:function(e){var h=this._vBoundaries,g=this.axis,i=c(e.width)&&h.maxWidth&&h.maxWidth<e.width,b=c(e.height)&&h.maxHeight&&h.maxHeight<e.height,f=c(e.width)&&h.minWidth&& +h.minWidth>e.width,j=c(e.height)&&h.minHeight&&h.minHeight>e.height;if(f)e.width=h.minWidth;if(j)e.height=h.minHeight;if(i)e.width=h.maxWidth;if(b)e.height=h.maxHeight;var l=this.originalPosition.left+this.originalSize.width,o=this.position.top+this.size.height,n=/sw|nw|w/.test(g);g=/nw|ne|n/.test(g);if(f&&n)e.left=l-h.minWidth;if(i&&n)e.left=l-h.maxWidth;if(j&&g)e.top=o-h.minHeight;if(b&&g)e.top=o-h.maxHeight;if((h=!e.width&&!e.height)&&!e.left&&e.top)e.top=null;else if(h&&!e.top&&e.left)e.left= +null;return e},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var e=this.helper||this.element,h=0;h<this._proportionallyResizeElements.length;h++){var g=this._proportionallyResizeElements[h];if(!this.borderDif){var i=[g.css("borderTopWidth"),g.css("borderRightWidth"),g.css("borderBottomWidth"),g.css("borderLeftWidth")],b=[g.css("paddingTop"),g.css("paddingRight"),g.css("paddingBottom"),g.css("paddingLeft")];this.borderDif=a.map(i,function(f,j){f=parseInt(f,10)|| +0;j=parseInt(b[j],10)||0;return f+j})}a.browser.msie&&(a(e).is(":hidden")||a(e).parents(":hidden").length)||g.css({height:e.height()-this.borderDif[0]-this.borderDif[2]||0,width:e.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var e=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||a('<div style="overflow:hidden;"></div>');var h=a.browser.msie&&a.browser.version<7,g=h?1:0;h=h?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++e.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(e,h){return{width:this.originalSize.width+h}},w:function(e,h){return{left:this.originalPosition.left+h,width:this.originalSize.width-h}},n:function(e,h,g){return{top:this.originalPosition.top+g,height:this.originalSize.height-g}},s:function(e,h,g){return{height:this.originalSize.height+ +g}},se:function(e,h,g){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[e,h,g]))},sw:function(e,h,g){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[e,h,g]))},ne:function(e,h,g){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[e,h,g]))},nw:function(e,h,g){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[e,h,g]))}},_propagate:function(e,h){a.ui.plugin.call(this,e,[h,this.ui()]); +e!="resize"&&this._trigger(e,h,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});a.extend(a.ui.resizable,{version:"1.8.14"});a.ui.plugin.add("resizable","alsoResize",{start:function(){var e=a(this).data("resizable").options,h=function(g){a(g).each(function(){var i=a(this);i.data("resizable-alsoresize",{width:parseInt(i.width(), +10),height:parseInt(i.height(),10),left:parseInt(i.css("left"),10),top:parseInt(i.css("top"),10),position:i.css("position")})})};if(typeof e.alsoResize=="object"&&!e.alsoResize.parentNode)if(e.alsoResize.length){e.alsoResize=e.alsoResize[0];h(e.alsoResize)}else a.each(e.alsoResize,function(g){h(g)});else h(e.alsoResize)},resize:function(e,h){var g=a(this).data("resizable");e=g.options;var i=g.originalSize,b=g.originalPosition,f={height:g.size.height-i.height||0,width:g.size.width-i.width||0,top:g.position.top- +b.top||0,left:g.position.left-b.left||0},j=function(l,o){a(l).each(function(){var n=a(this),k=a(this).data("resizable-alsoresize"),m={},p=o&&o.length?o:n.parents(h.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(p,function(q,s){if((q=(k[s]||0)+(f[s]||0))&&q>=0)m[s]=q||null});if(a.browser.opera&&/relative/.test(n.css("position"))){g._revertToRelativePosition=true;n.css({position:"absolute",top:"auto",left:"auto"})}n.css(m)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType? +a.each(e.alsoResize,function(l,o){j(l,o)}):j(e.alsoResize)},stop:function(){var e=a(this).data("resizable"),h=e.options,g=function(i){a(i).each(function(){var b=a(this);b.css({position:b.data("resizable-alsoresize").position})})};if(e._revertToRelativePosition){e._revertToRelativePosition=false;typeof h.alsoResize=="object"&&!h.alsoResize.nodeType?a.each(h.alsoResize,function(i){g(i)}):g(h.alsoResize)}a(this).removeData("resizable-alsoresize")}});a.ui.plugin.add("resizable","animate",{stop:function(e){var h= +a(this).data("resizable"),g=h.options,i=h._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName),f=b&&a.ui.hasScroll(i[0],"left")?0:h.sizeDiff.height;b={width:h.size.width-(b?0:h.sizeDiff.width),height:h.size.height-f};f=parseInt(h.element.css("left"),10)+(h.position.left-h.originalPosition.left)||null;var j=parseInt(h.element.css("top"),10)+(h.position.top-h.originalPosition.top)||null;h.element.animate(a.extend(b,j&&f?{top:j,left:f}:{}),{duration:g.animateDuration,easing:g.animateEasing, +step:function(){var l={width:parseInt(h.element.css("width"),10),height:parseInt(h.element.css("height"),10),top:parseInt(h.element.css("top"),10),left:parseInt(h.element.css("left"),10)};i&&i.length&&a(i[0]).css({width:l.width,height:l.height});h._updateCache(l);h._propagate("resize",e)}})}});a.ui.plugin.add("resizable","containment",{start:function(){var e=a(this).data("resizable"),h=e.element,g=e.options.containment;if(h=g instanceof a?g.get(0):/parent/.test(g)?h.parent().get(0):g){e.containerElement= +a(h);if(/document/.test(g)||g==document){e.containerOffset={left:0,top:0};e.containerPosition={left:0,top:0};e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight}}else{var i=a(h),b=[];a(["Top","Right","Left","Bottom"]).each(function(l,o){b[l]=d(i.css("padding"+o))});e.containerOffset=i.offset();e.containerPosition=i.position();e.containerSize={height:i.innerHeight()-b[3],width:i.innerWidth()-b[1]};g=e.containerOffset; +var f=e.containerSize.height,j=e.containerSize.width;j=a.ui.hasScroll(h,"left")?h.scrollWidth:j;f=a.ui.hasScroll(h)?h.scrollHeight:f;e.parentData={element:h,left:g.left,top:g.top,width:j,height:f}}}},resize:function(e){var h=a(this).data("resizable"),g=h.options,i=h.containerOffset,b=h.position;e=h._aspectRatio||e.shiftKey;var f={top:0,left:0},j=h.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))f=i;if(b.left<(h._helper?i.left:0)){h.size.width+=h._helper?h.position.left-i.left: +h.position.left-f.left;if(e)h.size.height=h.size.width/g.aspectRatio;h.position.left=g.helper?i.left:0}if(b.top<(h._helper?i.top:0)){h.size.height+=h._helper?h.position.top-i.top:h.position.top;if(e)h.size.width=h.size.height*g.aspectRatio;h.position.top=h._helper?i.top:0}h.offset.left=h.parentData.left+h.position.left;h.offset.top=h.parentData.top+h.position.top;g=Math.abs((h._helper?h.offset.left-f.left:h.offset.left-f.left)+h.sizeDiff.width);i=Math.abs((h._helper?h.offset.top-f.top:h.offset.top- +i.top)+h.sizeDiff.height);b=h.containerElement.get(0)==h.element.parent().get(0);f=/relative|absolute/.test(h.containerElement.css("position"));if(b&&f)g-=h.parentData.left;if(g+h.size.width>=h.parentData.width){h.size.width=h.parentData.width-g;if(e)h.size.height=h.size.width/h.aspectRatio}if(i+h.size.height>=h.parentData.height){h.size.height=h.parentData.height-i;if(e)h.size.width=h.size.height*h.aspectRatio}},stop:function(){var e=a(this).data("resizable"),h=e.options,g=e.containerOffset,i=e.containerPosition, +b=e.containerElement,f=a(e.helper),j=f.offset(),l=f.outerWidth()-e.sizeDiff.width;f=f.outerHeight()-e.sizeDiff.height;e._helper&&!h.animate&&/relative/.test(b.css("position"))&&a(this).css({left:j.left-i.left-g.left,width:l,height:f});e._helper&&!h.animate&&/static/.test(b.css("position"))&&a(this).css({left:j.left-i.left-g.left,width:l,height:f})}});a.ui.plugin.add("resizable","ghost",{start:function(){var e=a(this).data("resizable"),h=e.options,g=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25, +display:"block",position:"relative",height:g.height,width:g.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof h.ghost=="string"?h.ghost:"");e.ghost.appendTo(e.helper)},resize:function(){var e=a(this).data("resizable");e.ghost&&e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})},stop:function(){var e=a(this).data("resizable");e.ghost&&e.helper&&e.helper.get(0).removeChild(e.ghost.get(0))}});a.ui.plugin.add("resizable","grid",{resize:function(){var e= +a(this).data("resizable"),h=e.options,g=e.size,i=e.originalSize,b=e.originalPosition,f=e.axis;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var j=Math.round((g.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1);h=Math.round((g.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(f)){e.size.width=i.width+j;e.size.height=i.height+h}else if(/^(ne)$/.test(f)){e.size.width=i.width+j;e.size.height=i.height+h;e.position.top=b.top-h}else{if(/^(sw)$/.test(f)){e.size.width=i.width+j;e.size.height= +i.height+h}else{e.size.width=i.width+j;e.size.height=i.height+h;e.position.top=b.top-h}e.position.left=b.left-j}}});var d=function(e){return parseInt(e,10)||0},c=function(e){return!isNaN(parseInt(e,10))}})(jQuery); +(function(a){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var d=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(d.options.filter,d.element[0]);c.each(function(){var e=a(this),h=e.offset();a.data(this,"selectable-item",{element:this,$element:e,left:h.left,top:h.top,right:h.left+e.outerWidth(),bottom:h.top+e.outerHeight(),startselected:false,selected:e.hasClass("ui-selected"), +selecting:e.hasClass("ui-selecting"),unselecting:e.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(d){var c=this;this.opos=[d.pageX, +d.pageY];if(!this.options.disabled){var e=this.options;this.selectees=a(e.filter,this.element[0]);this._trigger("start",d);a(e.appendTo).append(this.helper);this.helper.css({left:d.clientX,top:d.clientY,width:0,height:0});e.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var h=a.data(this,"selectable-item");h.startselected=true;if(!d.metaKey){h.$element.removeClass("ui-selected");h.selected=false;h.$element.addClass("ui-unselecting");h.unselecting=true;c._trigger("unselecting", +d,{unselecting:h.element})}});a(d.target).parents().andSelf().each(function(){var h=a.data(this,"selectable-item");if(h){var g=!d.metaKey||!h.$element.hasClass("ui-selected");h.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");h.unselecting=!g;h.selecting=g;(h.selected=g)?c._trigger("selecting",d,{selecting:h.element}):c._trigger("unselecting",d,{unselecting:h.element});return false}})}},_mouseDrag:function(d){var c=this;this.dragged=true;if(!this.options.disabled){var e= +this.options,h=this.opos[0],g=this.opos[1],i=d.pageX,b=d.pageY;if(h>i){var f=i;i=h;h=f}if(g>b){f=b;b=g;g=f}this.helper.css({left:h,top:g,width:i-h,height:b-g});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!(!j||j.element==c.element[0])){var l=false;if(e.tolerance=="touch")l=!(j.left>i||j.right<h||j.top>b||j.bottom<g);else if(e.tolerance=="fit")l=j.left>h&&j.right<i&&j.top>g&&j.bottom<b;if(l){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting"); +j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;c._trigger("selecting",d,{selecting:j.element})}}else{if(j.selecting)if(d.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}c._trigger("unselecting",d,{unselecting:j.element})}if(j.selected)if(!d.metaKey&& +!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;c._trigger("unselecting",d,{unselecting:j.element})}}}});return false}},_mouseStop:function(d){var c=this;this.dragged=false;a(".ui-unselecting",this.element[0]).each(function(){var e=a.data(this,"selectable-item");e.$element.removeClass("ui-unselecting");e.unselecting=false;e.startselected=false;c._trigger("unselected",d,{unselected:e.element})});a(".ui-selecting",this.element[0]).each(function(){var e= +a.data(this,"selectable-item");e.$element.removeClass("ui-selecting").addClass("ui-selected");e.selecting=false;e.selected=true;e.startselected=true;c._trigger("selected",d,{selected:e.element})});this._trigger("stop",d);this.helper.remove();return false}});a.extend(a.ui.selectable,{version:"1.8.14"})})(jQuery); +(function(a){a.widget("ui.sortable",a.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var d=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?d.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var d=this.items.length-1;d>=0;d--)this.items[d].item.removeData("sortable-item");return this},_setOption:function(d,c){if(d=== +"disabled"){this.options[d]=c;this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")}else a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(d,c){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(d);var e=null,h=this;a(d.target).parents().each(function(){if(a.data(this,"sortable-item")==h){e=a(this);return false}});if(a.data(d.target,"sortable-item")==h)e=a(d.target);if(!e)return false;if(this.options.handle&& +!c){var g=false;a(this.options.handle,e).find("*").andSelf().each(function(){if(this==d.target)g=true});if(!g)return false}this.currentItem=e;this._removeCurrentsFromItems();return true},_mouseStart:function(d,c,e){c=this.options;var h=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(d);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();c.containment&&this._setContainment();if(c.cursor){if(a("body").css("cursor"))this._storedCursor=a("body").css("cursor");a("body").css("cursor",c.cursor)}if(c.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",c.opacity)}if(c.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",c.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",d,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!e)for(e=this.containers.length-1;e>=0;e--)this.containers[e]._trigger("activate",d,h._uiHash(this));if(a.ui.ddmanager)a.ui.ddmanager.current=this;a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(d); +return true},_mouseDrag:function(d){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var c=this.options,e=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-d.pageY<c.scrollSensitivity)this.scrollParent[0].scrollTop=e=this.scrollParent[0].scrollTop+c.scrollSpeed;else if(d.pageY-this.overflowOffset.top< +c.scrollSensitivity)this.scrollParent[0].scrollTop=e=this.scrollParent[0].scrollTop-c.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-d.pageX<c.scrollSensitivity)this.scrollParent[0].scrollLeft=e=this.scrollParent[0].scrollLeft+c.scrollSpeed;else if(d.pageX-this.overflowOffset.left<c.scrollSensitivity)this.scrollParent[0].scrollLeft=e=this.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(d.pageY-a(document).scrollTop()<c.scrollSensitivity)e=a(document).scrollTop(a(document).scrollTop()- +c.scrollSpeed);else if(a(window).height()-(d.pageY-a(document).scrollTop())<c.scrollSensitivity)e=a(document).scrollTop(a(document).scrollTop()+c.scrollSpeed);if(d.pageX-a(document).scrollLeft()<c.scrollSensitivity)e=a(document).scrollLeft(a(document).scrollLeft()-c.scrollSpeed);else if(a(window).width()-(d.pageX-a(document).scrollLeft())<c.scrollSensitivity)e=a(document).scrollLeft(a(document).scrollLeft()+c.scrollSpeed)}e!==false&&a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this, +d)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(c=this.items.length-1;c>=0;c--){e=this.items[c];var h=e.item[0],g=this._intersectsWithPointer(e);if(g)if(h!=this.currentItem[0]&&this.placeholder[g==1?"next":"prev"]()[0]!=h&&!a.ui.contains(this.placeholder[0],h)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0], +h):true)){this.direction=g==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e))this._rearrange(d,e);else break;this._trigger("change",d,this._uiHash());break}}this._contactContainers(d);a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);this._trigger("sort",d,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(d,c){if(d){a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,d);if(this.options.revert){var e=this;c=e.placeholder.offset(); +e.reverting=true;a(this.helper).animate({left:c.left-this.offset.parent.left-e.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:c.top-this.offset.parent.top-e.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){e._clear(d)})}else this._clear(d,c);return false}},cancel:function(){var d=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,d._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,d._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();a.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(d){var c=this._getItemsAsjQuery(d&&d.connected),e=[];d=d||{};a(c).each(function(){var h=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||/(.+)[-=_](.+)/);if(h)e.push((d.key||h[1]+"[]")+"="+(d.key&&d.expression?h[1]:h[2]))});!e.length&&d.key&&e.push(d.key+"=");return e.join("&")}, +toArray:function(d){var c=this._getItemsAsjQuery(d&&d.connected),e=[];d=d||{};c.each(function(){e.push(a(d.item||this).attr(d.attribute||"id")||"")});return e},_intersectsWith:function(d){var c=this.positionAbs.left,e=c+this.helperProportions.width,h=this.positionAbs.top,g=h+this.helperProportions.height,i=d.left,b=i+d.width,f=d.top,j=f+d.height,l=this.offset.click.top,o=this.offset.click.left;l=h+l>f&&h+l<j&&c+o>i&&c+o<b;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers|| +this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>d[this.floating?"width":"height"]?l:i<c+this.helperProportions.width/2&&e-this.helperProportions.width/2<b&&f<h+this.helperProportions.height/2&&g-this.helperProportions.height/2<j},_intersectsWithPointer:function(d){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,d.top,d.height);d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,d.left,d.width);c=c&&d;d=this._getDragVerticalDirection(); +var e=this._getDragHorizontalDirection();if(!c)return false;return this.floating?e&&e=="right"||d=="down"?2:1:d&&(d=="down"?2:1)},_intersectsWithSides:function(d){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,d.top+d.height/2,d.height);d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,d.left+d.width/2,d.width);var e=this._getDragVerticalDirection(),h=this._getDragHorizontalDirection();return this.floating&&h?h=="right"&&d||h=="left"&&!d:e&&(e=="down"&&c||e=="up"&&!c)}, +_getDragVerticalDirection:function(){var d=this.positionAbs.top-this.lastPositionAbs.top;return d!=0&&(d>0?"down":"up")},_getDragHorizontalDirection:function(){var d=this.positionAbs.left-this.lastPositionAbs.left;return d!=0&&(d>0?"right":"left")},refresh:function(d){this._refreshItems(d);this.refreshPositions();return this},_connectWith:function(){var d=this.options;return d.connectWith.constructor==String?[d.connectWith]:d.connectWith},_getItemsAsjQuery:function(d){var c=[],e=[],h=this._connectWith(); +if(h&&d)for(d=h.length-1;d>=0;d--)for(var g=a(h[d]),i=g.length-1;i>=0;i--){var b=a.data(g[i],"sortable");if(b&&b!=this&&!b.options.disabled)e.push([a.isFunction(b.options.items)?b.options.items.call(b.element):a(b.options.items,b.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),b])}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(d=e.length-1;d>=0;d--)e[d][0].each(function(){c.push(this)});return a(c)},_removeCurrentsFromItems:function(){for(var d=this.currentItem.find(":data(sortable-item)"),c=0;c<this.items.length;c++)for(var e=0;e<d.length;e++)d[e]==this.items[c].item[0]&&this.items.splice(c,1)},_refreshItems:function(d){this.items=[];this.containers=[this];var c=this.items,e=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],d,{item:this.currentItem}):a(this.options.items,this.element), +this]],h=this._connectWith();if(h)for(var g=h.length-1;g>=0;g--)for(var i=a(h[g]),b=i.length-1;b>=0;b--){var f=a.data(i[b],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element[0],d,{item:this.currentItem}):a(f.options.items,f.element),f]);this.containers.push(f)}}for(g=e.length-1;g>=0;g--){d=e[g][1];h=e[g][0];b=0;for(i=h.length;b<i;b++){f=a(h[b]);f.data("sortable-item",d);c.push({item:f,instance:d,width:0,height:0,left:0,top:0})}}},refreshPositions:function(d){if(this.offsetParent&& +this.helper)this.offset.parent=this._getParentOffset();for(var c=this.items.length-1;c>=0;c--){var e=this.items[c];if(!(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0])){var h=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!d){e.width=h.outerWidth();e.height=h.outerHeight()}h=h.offset();e.left=h.left;e.top=h.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(c= +this.containers.length-1;c>=0;c--){h=this.containers[c].element.offset();this.containers[c].containerCache.left=h.left;this.containers[c].containerCache.top=h.top;this.containers[c].containerCache.width=this.containers[c].element.outerWidth();this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(d){var c=d||this,e=c.options;if(!e.placeholder||e.placeholder.constructor==String){var h=e.placeholder;e.placeholder={element:function(){var g= +a(document.createElement(c.currentItem[0].nodeName)).addClass(h||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!h)g.style.visibility="hidden";return g},update:function(g,i){if(!(h&&!e.forcePlaceholderSize)){i.height()||i.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10));i.width()||i.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")|| +0,10))}}}}c.placeholder=a(e.placeholder.element.call(c.element,c.currentItem));c.currentItem.after(c.placeholder);e.placeholder.update(c,c.placeholder)},_contactContainers:function(d){for(var c=null,e=null,h=this.containers.length-1;h>=0;h--)if(!a.ui.contains(this.currentItem[0],this.containers[h].element[0]))if(this._intersectsWith(this.containers[h].containerCache)){if(!(c&&a.ui.contains(this.containers[h].element[0],c.element[0]))){c=this.containers[h];e=h}}else if(this.containers[h].containerCache.over){this.containers[h]._trigger("out", +d,this._uiHash(this));this.containers[h].containerCache.over=0}if(c)if(this.containers.length===1){this.containers[e]._trigger("over",d,this._uiHash(this));this.containers[e].containerCache.over=1}else if(this.currentContainer!=this.containers[e]){c=1E4;h=null;for(var g=this.positionAbs[this.containers[e].floating?"left":"top"],i=this.items.length-1;i>=0;i--)if(a.ui.contains(this.containers[e].element[0],this.items[i].item[0])){var b=this.items[i][this.containers[e].floating?"left":"top"];if(Math.abs(b- +g)<c){c=Math.abs(b-g);h=this.items[i]}}if(h||this.options.dropOnEmpty){this.currentContainer=this.containers[e];h?this._rearrange(d,h,null,true):this._rearrange(d,null,this.containers[e].element,true);this._trigger("change",d,this._uiHash());this.containers[e]._trigger("change",d,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[e]._trigger("over",d,this._uiHash(this));this.containers[e].containerCache.over=1}}},_createHelper:function(d){var c= +this.options;d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[d,this.currentItem])):c.helper=="clone"?this.currentItem.clone():this.currentItem;d.parents("body").length||a(c.appendTo!="parent"?c.appendTo:this.currentItem[0].parentNode)[0].appendChild(d[0]);if(d[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(d[0].style.width== +""||c.forceHelperSize)d.width(this.currentItem.width());if(d[0].style.height==""||c.forceHelperSize)d.height(this.currentItem.height());return d},_adjustOffsetFromHelper:function(d){if(typeof d=="string")d=d.split(" ");if(a.isArray(d))d={left:+d[0],top:+d[1]||0};if("left"in d)this.offset.click.left=d.left+this.margins.left;if("right"in d)this.offset.click.left=this.helperProportions.width-d.right+this.margins.left;if("top"in d)this.offset.click.top=d.top+this.margins.top;if("bottom"in d)this.offset.click.top= +this.helperProportions.height-d.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var d=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){d.left+=this.scrollParent.scrollLeft();d.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)d= +{top:0,left:0};return{top:d.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:d.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var d=this.currentItem.position();return{top:d.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:d.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"), +10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var d=this.options;if(d.containment=="parent")d.containment=this.helper[0].parentNode;if(d.containment=="document"||d.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(d.containment=="document"? +document:window).width()-this.helperProportions.width-this.margins.left,(a(d.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(d.containment)){var c=a(d.containment)[0];d=a(d.containment).offset();var e=a(c).css("overflow")!="hidden";this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"), +10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(d,c){if(!c)c= +this.position;d=d=="absolute"?1:-1;var e=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName);return{top:c.top+this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():h?0:e.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&& +this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:e.scrollLeft())*d)}},_generatePosition:function(d){var c=this.options,e=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset(); +var g=d.pageX,i=d.pageY;if(this.originalPosition){if(this.containment){if(d.pageX-this.offset.click.left<this.containment[0])g=this.containment[0]+this.offset.click.left;if(d.pageY-this.offset.click.top<this.containment[1])i=this.containment[1]+this.offset.click.top;if(d.pageX-this.offset.click.left>this.containment[2])g=this.containment[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>this.containment[3])i=this.containment[3]+this.offset.click.top}if(c.grid){i=this.originalPageY+Math.round((i- +this.originalPageY)/c.grid[1])*c.grid[1];i=this.containment?!(i-this.offset.click.top<this.containment[1]||i-this.offset.click.top>this.containment[3])?i:!(i-this.offset.click.top<this.containment[1])?i-c.grid[1]:i+c.grid[1]:i;g=this.originalPageX+Math.round((g-this.originalPageX)/c.grid[0])*c.grid[0];g=this.containment?!(g-this.offset.click.left<this.containment[0]||g-this.offset.click.left>this.containment[2])?g:!(g-this.offset.click.left<this.containment[0])?g-c.grid[0]:g+c.grid[0]:g}}return{top:i- +this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():h?0:e.scrollTop()),left:g-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:e.scrollLeft())}},_rearrange:function(d,c,e,h){e?e[0].appendChild(this.placeholder[0]):c.item[0].parentNode.insertBefore(this.placeholder[0], +this.direction=="down"?c.item[0]:c.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var g=this,i=this.counter;window.setTimeout(function(){i==g.counter&&g.refreshPositions(!h)},0)},_clear:function(d,c){this.reverting=false;var e=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var h in this._storedCSS)if(this._storedCSS[h]=="auto"||this._storedCSS[h]=="static")this._storedCSS[h]= +"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!c&&e.push(function(g){this._trigger("receive",g,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!c)e.push(function(g){this._trigger("update",g,this._uiHash())});if(!a.ui.contains(this.element[0],this.currentItem[0])){c||e.push(function(g){this._trigger("remove", +g,this._uiHash())});for(h=this.containers.length-1;h>=0;h--)if(a.ui.contains(this.containers[h].element[0],this.currentItem[0])&&!c){e.push(function(g){return function(i){g._trigger("receive",i,this._uiHash(this))}}.call(this,this.containers[h]));e.push(function(g){return function(i){g._trigger("update",i,this._uiHash(this))}}.call(this,this.containers[h]))}}for(h=this.containers.length-1;h>=0;h--){c||e.push(function(g){return function(i){g._trigger("deactivate",i,this._uiHash(this))}}.call(this, +this.containers[h]));if(this.containers[h].containerCache.over){e.push(function(g){return function(i){g._trigger("out",i,this._uiHash(this))}}.call(this,this.containers[h]));this.containers[h].containerCache.over=0}}this._storedCursor&&a("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop", +d,this._uiHash());for(h=0;h<e.length;h++)e[h].call(this,d);this._trigger("stop",d,this._uiHash())}return false}c||this._trigger("beforeStop",d,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!c){for(h=0;h<e.length;h++)e[h].call(this,d);this._trigger("stop",d,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){a.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()}, +_uiHash:function(d){var c=d||this;return{helper:c.helper,placeholder:c.placeholder||a([]),position:c.position,originalPosition:c.originalPosition,offset:c.positionAbs,item:c.currentItem,sender:d?d.element:null}}});a.extend(a.ui.sortable,{version:"1.8.14"})})(jQuery); +jQuery.effects||function(a,d){function c(n){var k;if(n&&n.constructor==Array&&n.length==3)return n;if(k=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(n))return[parseInt(k[1],10),parseInt(k[2],10),parseInt(k[3],10)];if(k=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(n))return[parseFloat(k[1])*2.55,parseFloat(k[2])*2.55,parseFloat(k[3])*2.55];if(k=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(n))return[parseInt(k[1], +16),parseInt(k[2],16),parseInt(k[3],16)];if(k=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(n))return[parseInt(k[1]+k[1],16),parseInt(k[2]+k[2],16),parseInt(k[3]+k[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(n))return j.transparent;return j[a.trim(n).toLowerCase()]}function e(n,k){var m;do{m=a.curCSS(n,k);if(m!=""&&m!="transparent"||a.nodeName(n,"body"))break;k="backgroundColor"}while(n=n.parentNode);return c(m)}function h(){var n=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +k={},m,p;if(n&&n.length&&n[0]&&n[n[0]])for(var q=n.length;q--;){m=n[q];if(typeof n[m]=="string"){p=m.replace(/\-(\w)/g,function(s,r){return r.toUpperCase()});k[p]=n[m]}}else for(m in n)if(typeof n[m]==="string")k[m]=n[m];return k}function g(n){var k,m;for(k in n){m=n[k];if(m==null||a.isFunction(m)||k in o||/scrollbar/.test(k)||!/color/i.test(k)&&isNaN(parseFloat(m)))delete n[k]}return n}function i(n,k){var m={_:0},p;for(p in k)if(n[p]!=k[p])m[p]=k[p];return m}function b(n,k,m,p){if(typeof n=="object"){p= +k;m=null;k=n;n=k.effect}if(a.isFunction(k)){p=k;m=null;k={}}if(typeof k=="number"||a.fx.speeds[k]){p=m;m=k;k={}}if(a.isFunction(m)){p=m;m=null}k=k||{};m=m||k.duration;m=a.fx.off?0:typeof m=="number"?m:m in a.fx.speeds?a.fx.speeds[m]:a.fx.speeds._default;p=p||k.complete;return[n,k,m,p]}function f(n){if(!n||typeof n==="number"||a.fx.speeds[n])return true;if(typeof n==="string"&&!a.effects[n])return true;return false}a.effects={};a.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(n,k){a.fx.step[k]=function(m){if(!m.colorInit){m.start=e(m.elem,k);m.end=c(m.end);m.colorInit=true}m.elem.style[k]="rgb("+Math.max(Math.min(parseInt(m.pos*(m.end[0]-m.start[0])+m.start[0],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[1]-m.start[1])+m.start[1],10),255),0)+","+Math.max(Math.min(parseInt(m.pos*(m.end[2]-m.start[2])+m.start[2],10),255),0)+")"}});var j={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},l=["add","remove","toggle"],o={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};a.effects.animateClass=function(n,k,m, +p){if(a.isFunction(m)){p=m;m=null}return this.queue(function(){var q=a(this),s=q.attr("style")||" ",r=g(h.call(this)),u,v=q.attr("class");a.each(l,function(w,x){n[x]&&q[x+"Class"](n[x])});u=g(h.call(this));q.attr("class",v);q.animate(i(r,u),{queue:false,duration:k,easing:m,complete:function(){a.each(l,function(w,x){n[x]&&q[x+"Class"](n[x])});if(typeof q.attr("style")=="object"){q.attr("style").cssText="";q.attr("style").cssText=s}else q.attr("style",s);p&&p.apply(this,arguments);a.dequeue(this)}})})}; +a.fn.extend({_addClass:a.fn.addClass,addClass:function(n,k,m,p){return k?a.effects.animateClass.apply(this,[{add:n},k,m,p]):this._addClass(n)},_removeClass:a.fn.removeClass,removeClass:function(n,k,m,p){return k?a.effects.animateClass.apply(this,[{remove:n},k,m,p]):this._removeClass(n)},_toggleClass:a.fn.toggleClass,toggleClass:function(n,k,m,p,q){return typeof k=="boolean"||k===d?m?a.effects.animateClass.apply(this,[k?{add:n}:{remove:n},m,p,q]):this._toggleClass(n,k):a.effects.animateClass.apply(this, +[{toggle:n},k,m,p])},switchClass:function(n,k,m,p,q){return a.effects.animateClass.apply(this,[{add:k,remove:n},m,p,q])}});a.extend(a.effects,{version:"1.8.14",save:function(n,k){for(var m=0;m<k.length;m++)k[m]!==null&&n.data("ec.storage."+k[m],n[0].style[k[m]])},restore:function(n,k){for(var m=0;m<k.length;m++)k[m]!==null&&n.css(k[m],n.data("ec.storage."+k[m]))},setMode:function(n,k){if(k=="toggle")k=n.is(":hidden")?"show":"hide";return k},getBaseline:function(n,k){var m;switch(n[0]){case "top":m= +0;break;case "middle":m=0.5;break;case "bottom":m=1;break;default:m=n[0]/k.height}switch(n[1]){case "left":n=0;break;case "center":n=0.5;break;case "right":n=1;break;default:n=n[1]/k.width}return{x:n,y:m}},createWrapper:function(n){if(n.parent().is(".ui-effects-wrapper"))return n.parent();var k={width:n.outerWidth(true),height:n.outerHeight(true),"float":n.css("float")},m=a("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}); +n.wrap(m);m=n.parent();if(n.css("position")=="static"){m.css({position:"relative"});n.css({position:"relative"})}else{a.extend(k,{position:n.css("position"),zIndex:n.css("z-index")});a.each(["top","left","bottom","right"],function(p,q){k[q]=n.css(q);if(isNaN(parseInt(k[q],10)))k[q]="auto"});n.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return m.css(k).show()},removeWrapper:function(n){if(n.parent().is(".ui-effects-wrapper"))return n.parent().replaceWith(n);return n},setTransition:function(n, +k,m,p){p=p||{};a.each(k,function(q,s){unit=n.cssUnit(s);if(unit[0]>0)p[s]=unit[0]*m+unit[1]});return p}});a.fn.extend({effect:function(n){var k=b.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var p=a.effects[n];if(a.fx.off||!p)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)});return p.call(this,m)},_show:a.fn.show,show:function(n){if(f(n))return this._show.apply(this,arguments);else{var k=b.apply(this,arguments); +k[1].mode="show";return this.effect.apply(this,k)}},_hide:a.fn.hide,hide:function(n){if(f(n))return this._hide.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:a.fn.toggle,toggle:function(n){if(f(n)||typeof n==="boolean"||a.isFunction(n))return this.__toggle.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(n){var k=this.css(n),m=[];a.each(["em","px","%", +"pt"],function(p,q){if(k.indexOf(q)>0)m=[parseFloat(k),q]});return m}});a.easing.jswing=a.easing.swing;a.extend(a.easing,{def:"easeOutQuad",swing:function(n,k,m,p,q){return a.easing[a.easing.def](n,k,m,p,q)},easeInQuad:function(n,k,m,p,q){return p*(k/=q)*k+m},easeOutQuad:function(n,k,m,p,q){return-p*(k/=q)*(k-2)+m},easeInOutQuad:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k+m;return-p/2*(--k*(k-2)-1)+m},easeInCubic:function(n,k,m,p,q){return p*(k/=q)*k*k+m},easeOutCubic:function(n,k,m,p,q){return p* +((k=k/q-1)*k*k+1)+m},easeInOutCubic:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k+m;return p/2*((k-=2)*k*k+2)+m},easeInQuart:function(n,k,m,p,q){return p*(k/=q)*k*k*k+m},easeOutQuart:function(n,k,m,p,q){return-p*((k=k/q-1)*k*k*k-1)+m},easeInOutQuart:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k+m;return-p/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(n,k,m,p,q){return p*(k/=q)*k*k*k*k+m},easeOutQuint:function(n,k,m,p,q){return p*((k=k/q-1)*k*k*k*k+1)+m},easeInOutQuint:function(n,k,m,p,q){if((k/= +q/2)<1)return p/2*k*k*k*k*k+m;return p/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(n,k,m,p,q){return-p*Math.cos(k/q*(Math.PI/2))+p+m},easeOutSine:function(n,k,m,p,q){return p*Math.sin(k/q*(Math.PI/2))+m},easeInOutSine:function(n,k,m,p,q){return-p/2*(Math.cos(Math.PI*k/q)-1)+m},easeInExpo:function(n,k,m,p,q){return k==0?m:p*Math.pow(2,10*(k/q-1))+m},easeOutExpo:function(n,k,m,p,q){return k==q?m+p:p*(-Math.pow(2,-10*k/q)+1)+m},easeInOutExpo:function(n,k,m,p,q){if(k==0)return m;if(k==q)return m+p;if((k/= +q/2)<1)return p/2*Math.pow(2,10*(k-1))+m;return p/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(n,k,m,p,q){return-p*(Math.sqrt(1-(k/=q)*k)-1)+m},easeOutCirc:function(n,k,m,p,q){return p*Math.sqrt(1-(k=k/q-1)*k)+m},easeInOutCirc:function(n,k,m,p,q){if((k/=q/2)<1)return-p/2*(Math.sqrt(1-k*k)-1)+m;return p/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(n,k,m,p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q)==1)return m+p;s||(s=q*0.3);if(r<Math.abs(p)){r=p;n=s/4}else n=s/(2*Math.PI)*Math.asin(p/ +r);return-(r*Math.pow(2,10*(k-=1))*Math.sin((k*q-n)*2*Math.PI/s))+m},easeOutElastic:function(n,k,m,p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q)==1)return m+p;s||(s=q*0.3);if(r<Math.abs(p)){r=p;n=s/4}else n=s/(2*Math.PI)*Math.asin(p/r);return r*Math.pow(2,-10*k)*Math.sin((k*q-n)*2*Math.PI/s)+p+m},easeInOutElastic:function(n,k,m,p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q/2)==2)return m+p;s||(s=q*0.3*1.5);if(r<Math.abs(p)){r=p;n=s/4}else n=s/(2*Math.PI)*Math.asin(p/r);if(k<1)return-0.5* +r*Math.pow(2,10*(k-=1))*Math.sin((k*q-n)*2*Math.PI/s)+m;return r*Math.pow(2,-10*(k-=1))*Math.sin((k*q-n)*2*Math.PI/s)*0.5+p+m},easeInBack:function(n,k,m,p,q,s){if(s==d)s=1.70158;return p*(k/=q)*k*((s+1)*k-s)+m},easeOutBack:function(n,k,m,p,q,s){if(s==d)s=1.70158;return p*((k=k/q-1)*k*((s+1)*k+s)+1)+m},easeInOutBack:function(n,k,m,p,q,s){if(s==d)s=1.70158;if((k/=q/2)<1)return p/2*k*k*(((s*=1.525)+1)*k-s)+m;return p/2*((k-=2)*k*(((s*=1.525)+1)*k+s)+2)+m},easeInBounce:function(n,k,m,p,q){return p-a.easing.easeOutBounce(n, +q-k,0,p,q)+m},easeOutBounce:function(n,k,m,p,q){return(k/=q)<1/2.75?p*7.5625*k*k+m:k<2/2.75?p*(7.5625*(k-=1.5/2.75)*k+0.75)+m:k<2.5/2.75?p*(7.5625*(k-=2.25/2.75)*k+0.9375)+m:p*(7.5625*(k-=2.625/2.75)*k+0.984375)+m},easeInOutBounce:function(n,k,m,p,q){if(k<q/2)return a.easing.easeInBounce(n,k*2,0,p,q)*0.5+m;return a.easing.easeOutBounce(n,k*2-q,0,p,q)*0.5+p*0.5+m}})}(jQuery); +(function(a){a.effects.blind=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right"],h=a.effects.setMode(c,d.options.mode||"hide"),g=d.options.direction||"vertical";a.effects.save(c,e);c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"}),b=g=="vertical"?"height":"width";g=g=="vertical"?i.height():i.width();h=="show"&&i.css(b,0);var f={};f[b]=h=="show"?g:0;i.animate(f,d.duration,d.options.easing,function(){h=="hide"&&c.hide();a.effects.restore(c, +e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()})})}})(jQuery); +(function(a){a.effects.bounce=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right"],h=a.effects.setMode(c,d.options.mode||"effect"),g=d.options.direction||"up",i=d.options.distance||20,b=d.options.times||5,f=d.duration||250;/show|hide/.test(h)&&e.push("opacity");a.effects.save(c,e);c.show();a.effects.createWrapper(c);var j=g=="up"||g=="down"?"top":"left";g=g=="up"||g=="left"?"pos":"neg";i=d.options.distance||(j=="top"?c.outerHeight({margin:true})/3:c.outerWidth({margin:true})/ +3);if(h=="show")c.css("opacity",0).css(j,g=="pos"?-i:i);if(h=="hide")i/=b*2;h!="hide"&&b--;if(h=="show"){var l={opacity:1};l[j]=(g=="pos"?"+=":"-=")+i;c.animate(l,f/2,d.options.easing);i/=2;b--}for(l=0;l<b;l++){var o={},n={};o[j]=(g=="pos"?"-=":"+=")+i;n[j]=(g=="pos"?"+=":"-=")+i;c.animate(o,f/2,d.options.easing).animate(n,f/2,d.options.easing);i=h=="hide"?i*2:i/2}if(h=="hide"){l={opacity:0};l[j]=(g=="pos"?"-=":"+=")+i;c.animate(l,f/2,d.options.easing,function(){c.hide();a.effects.restore(c,e);a.effects.removeWrapper(c); +d.callback&&d.callback.apply(this,arguments)})}else{o={};n={};o[j]=(g=="pos"?"-=":"+=")+i;n[j]=(g=="pos"?"+=":"-=")+i;c.animate(o,f/2,d.options.easing).animate(n,f/2,d.options.easing,function(){a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments)})}c.queue("fx",function(){c.dequeue()});c.dequeue()})}})(jQuery); +(function(a){a.effects.clip=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right","height","width"],h=a.effects.setMode(c,d.options.mode||"hide"),g=d.options.direction||"vertical";a.effects.save(c,e);c.show();var i=a.effects.createWrapper(c).css({overflow:"hidden"});i=c[0].tagName=="IMG"?i:c;var b={size:g=="vertical"?"height":"width",position:g=="vertical"?"top":"left"};g=g=="vertical"?i.height():i.width();if(h=="show"){i.css(b.size,0);i.css(b.position, +g/2)}var f={};f[b.size]=h=="show"?g:0;f[b.position]=h=="show"?0:g/2;i.animate(f,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){h=="hide"&&c.hide();a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()}})})}})(jQuery); +(function(a){a.effects.drop=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right","opacity"],h=a.effects.setMode(c,d.options.mode||"hide"),g=d.options.direction||"left";a.effects.save(c,e);c.show();a.effects.createWrapper(c);var i=g=="up"||g=="down"?"top":"left";g=g=="up"||g=="left"?"pos":"neg";var b=d.options.distance||(i=="top"?c.outerHeight({margin:true})/2:c.outerWidth({margin:true})/2);if(h=="show")c.css("opacity",0).css(i,g=="pos"?-b:b);var f={opacity:h== +"show"?1:0};f[i]=(h=="show"?g=="pos"?"+=":"-=":g=="pos"?"-=":"+=")+b;c.animate(f,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){h=="hide"&&c.hide();a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +(function(a){a.effects.explode=function(d){return this.queue(function(){var c=d.options.pieces?Math.round(Math.sqrt(d.options.pieces)):3,e=d.options.pieces?Math.round(Math.sqrt(d.options.pieces)):3;d.options.mode=d.options.mode=="toggle"?a(this).is(":visible")?"hide":"show":d.options.mode;var h=a(this).show().css("visibility","hidden"),g=h.offset();g.top-=parseInt(h.css("marginTop"),10)||0;g.left-=parseInt(h.css("marginLeft"),10)||0;for(var i=h.outerWidth(true),b=h.outerHeight(true),f=0;f<c;f++)for(var j= +0;j<e;j++)h.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-j*(i/e),top:-f*(b/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:i/e,height:b/c,left:g.left+j*(i/e)+(d.options.mode=="show"?(j-Math.floor(e/2))*(i/e):0),top:g.top+f*(b/c)+(d.options.mode=="show"?(f-Math.floor(c/2))*(b/c):0),opacity:d.options.mode=="show"?0:1}).animate({left:g.left+j*(i/e)+(d.options.mode=="show"?0:(j-Math.floor(e/2))*(i/e)),top:g.top+ +f*(b/c)+(d.options.mode=="show"?0:(f-Math.floor(c/2))*(b/c)),opacity:d.options.mode=="show"?1:0},d.duration||500);setTimeout(function(){d.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();d.callback&&d.callback.apply(h[0]);h.dequeue();a("div.ui-effects-explode").remove()},d.duration||500)})}})(jQuery); +(function(a){a.effects.fade=function(d){return this.queue(function(){var c=a(this),e=a.effects.setMode(c,d.options.mode||"hide");c.animate({opacity:e},{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +(function(a){a.effects.fold=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right"],h=a.effects.setMode(c,d.options.mode||"hide"),g=d.options.size||15,i=!!d.options.horizFirst,b=d.duration?d.duration/2:a.fx.speeds._default/2;a.effects.save(c,e);c.show();var f=a.effects.createWrapper(c).css({overflow:"hidden"}),j=h=="show"!=i,l=j?["width","height"]:["height","width"];j=j?[f.width(),f.height()]:[f.height(),f.width()];var o=/([0-9]+)%/.exec(g);if(o)g=parseInt(o[1], +10)/100*j[h=="hide"?0:1];if(h=="show")f.css(i?{height:0,width:g}:{height:g,width:0});i={};o={};i[l[0]]=h=="show"?j[0]:g;o[l[1]]=h=="show"?j[1]:0;f.animate(i,b,d.options.easing).animate(o,b,d.options.easing,function(){h=="hide"&&c.hide();a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()})})}})(jQuery); +(function(a){a.effects.highlight=function(d){return this.queue(function(){var c=a(this),e=["backgroundImage","backgroundColor","opacity"],h=a.effects.setMode(c,d.options.mode||"show"),g={backgroundColor:c.css("backgroundColor")};if(h=="hide")g.opacity=0;a.effects.save(c,e);c.show().css({backgroundImage:"none",backgroundColor:d.options.color||"#ffff99"}).animate(g,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){h=="hide"&&c.hide();a.effects.restore(c,e);h=="show"&&!a.support.opacity&& +this.style.removeAttribute("filter");d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +(function(a){a.effects.pulsate=function(d){return this.queue(function(){var c=a(this),e=a.effects.setMode(c,d.options.mode||"show");times=(d.options.times||5)*2-1;duration=d.duration?d.duration/2:a.fx.speeds._default/2;isVisible=c.is(":visible");animateTo=0;if(!isVisible){c.css("opacity",0).show();animateTo=1}if(e=="hide"&&isVisible||e=="show"&&!isVisible)times--;for(e=0;e<times;e++){c.animate({opacity:animateTo},duration,d.options.easing);animateTo=(animateTo+1)%2}c.animate({opacity:animateTo},duration, +d.options.easing,function(){animateTo==0&&c.hide();d.callback&&d.callback.apply(this,arguments)});c.queue("fx",function(){c.dequeue()}).dequeue()})}})(jQuery); +(function(a){a.effects.puff=function(d){return this.queue(function(){var c=a(this),e=a.effects.setMode(c,d.options.mode||"hide"),h=parseInt(d.options.percent,10)||150,g=h/100,i={height:c.height(),width:c.width()};a.extend(d.options,{fade:true,mode:e,percent:e=="hide"?h:100,from:e=="hide"?i:{height:i.height*g,width:i.width*g}});c.effect("scale",d.options,d.duration,d.callback);c.dequeue()})};a.effects.scale=function(d){return this.queue(function(){var c=a(this),e=a.extend(true,{},d.options),h=a.effects.setMode(c, +d.options.mode||"effect"),g=parseInt(d.options.percent,10)||(parseInt(d.options.percent,10)==0?0:h=="hide"?0:100),i=d.options.direction||"both",b=d.options.origin;if(h!="effect"){e.origin=b||["middle","center"];e.restore=true}b={height:c.height(),width:c.width()};c.from=d.options.from||(h=="show"?{height:0,width:0}:b);g={y:i!="horizontal"?g/100:1,x:i!="vertical"?g/100:1};c.to={height:b.height*g.y,width:b.width*g.x};if(d.options.fade){if(h=="show"){c.from.opacity=0;c.to.opacity=1}if(h=="hide"){c.from.opacity= +1;c.to.opacity=0}}e.from=c.from;e.to=c.to;e.mode=h;c.effect("size",e,d.duration,d.callback);c.dequeue()})};a.effects.size=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],h=["position","top","bottom","left","right","overflow","opacity"],g=["width","height","overflow"],i=["fontSize"],b=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],f=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], +j=a.effects.setMode(c,d.options.mode||"effect"),l=d.options.restore||false,o=d.options.scale||"both",n=d.options.origin,k={height:c.height(),width:c.width()};c.from=d.options.from||k;c.to=d.options.to||k;if(n){n=a.effects.getBaseline(n,k);c.from.top=(k.height-c.from.height)*n.y;c.from.left=(k.width-c.from.width)*n.x;c.to.top=(k.height-c.to.height)*n.y;c.to.left=(k.width-c.to.width)*n.x}var m={from:{y:c.from.height/k.height,x:c.from.width/k.width},to:{y:c.to.height/k.height,x:c.to.width/k.width}}; +if(o=="box"||o=="both"){if(m.from.y!=m.to.y){e=e.concat(b);c.from=a.effects.setTransition(c,b,m.from.y,c.from);c.to=a.effects.setTransition(c,b,m.to.y,c.to)}if(m.from.x!=m.to.x){e=e.concat(f);c.from=a.effects.setTransition(c,f,m.from.x,c.from);c.to=a.effects.setTransition(c,f,m.to.x,c.to)}}if(o=="content"||o=="both")if(m.from.y!=m.to.y){e=e.concat(i);c.from=a.effects.setTransition(c,i,m.from.y,c.from);c.to=a.effects.setTransition(c,i,m.to.y,c.to)}a.effects.save(c,l?e:h);c.show();a.effects.createWrapper(c); +c.css("overflow","hidden").css(c.from);if(o=="content"||o=="both"){b=b.concat(["marginTop","marginBottom"]).concat(i);f=f.concat(["marginLeft","marginRight"]);g=e.concat(b).concat(f);c.find("*[width]").each(function(){child=a(this);l&&a.effects.save(child,g);var p={height:child.height(),width:child.width()};child.from={height:p.height*m.from.y,width:p.width*m.from.x};child.to={height:p.height*m.to.y,width:p.width*m.to.x};if(m.from.y!=m.to.y){child.from=a.effects.setTransition(child,b,m.from.y,child.from); +child.to=a.effects.setTransition(child,b,m.to.y,child.to)}if(m.from.x!=m.to.x){child.from=a.effects.setTransition(child,f,m.from.x,child.from);child.to=a.effects.setTransition(child,f,m.to.x,child.to)}child.css(child.from);child.animate(child.to,d.duration,d.options.easing,function(){l&&a.effects.restore(child,g)})})}c.animate(c.to,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){c.to.opacity===0&&c.css("opacity",c.from.opacity);j=="hide"&&c.hide();a.effects.restore(c, +l?e:h);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +(function(a){a.effects.shake=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right"];a.effects.setMode(c,d.options.mode||"effect");var h=d.options.direction||"left",g=d.options.distance||20,i=d.options.times||3,b=d.duration||d.options.duration||140;a.effects.save(c,e);c.show();a.effects.createWrapper(c);var f=h=="up"||h=="down"?"top":"left",j=h=="up"||h=="left"?"pos":"neg";h={};var l={},o={};h[f]=(j=="pos"?"-=":"+=")+g;l[f]=(j=="pos"?"+=":"-=")+g*2;o[f]= +(j=="pos"?"-=":"+=")+g*2;c.animate(h,b,d.options.easing);for(g=1;g<i;g++)c.animate(l,b,d.options.easing).animate(o,b,d.options.easing);c.animate(l,b,d.options.easing).animate(h,b/2,d.options.easing,function(){a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments)});c.queue("fx",function(){c.dequeue()});c.dequeue()})}})(jQuery); +(function(a){a.effects.slide=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right"],h=a.effects.setMode(c,d.options.mode||"show"),g=d.options.direction||"left";a.effects.save(c,e);c.show();a.effects.createWrapper(c).css({overflow:"hidden"});var i=g=="up"||g=="down"?"top":"left";g=g=="up"||g=="left"?"pos":"neg";var b=d.options.distance||(i=="top"?c.outerHeight({margin:true}):c.outerWidth({margin:true}));if(h=="show")c.css(i,g=="pos"?isNaN(b)?"-"+b:-b:b); +var f={};f[i]=(h=="show"?g=="pos"?"+=":"-=":g=="pos"?"-=":"+=")+b;c.animate(f,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){h=="hide"&&c.hide();a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +(function(a){a.effects.transfer=function(d){return this.queue(function(){var c=a(this),e=a(d.options.to),h=e.offset();e={top:h.top,left:h.left,height:e.innerHeight(),width:e.innerWidth()};h=c.offset();var g=a('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(d.options.className).css({top:h.top,left:h.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(e,d.duration,d.options.easing,function(){g.remove();d.callback&&d.callback.apply(c[0],arguments); +c.dequeue()})})}})(jQuery); +(function(a){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var d=this,c=d.options;d.running=0;d.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");d.headers= +d.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){c.disabled||a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){c.disabled||a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){c.disabled||a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){c.disabled||a(this).removeClass("ui-state-focus")});d.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(c.navigation){var e=d.element.find("a").filter(c.navigationFilter).eq(0);if(e.length){var h=e.closest(".ui-accordion-header");d.active=h.length?h:e.closest(".ui-accordion-content").prev()}}d.active=d._findActive(d.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");d.active.next().addClass("ui-accordion-content-active");d._createIcons();d.resize();d.element.attr("role","tablist");d.headers.attr("role","tab").bind("keydown.accordion", +function(g){return d._keydown(g)}).next().attr("role","tabpanel");d.headers.not(d.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();d.active.length?d.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):d.headers.eq(0).attr("tabIndex",0);a.browser.safari||d.headers.find("a").attr("tabIndex",-1);c.event&&d.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(g){d._clickHandler.call(d,g,this);g.preventDefault()})},_createIcons:function(){var d= +this.options;if(d.icons){a("<span></span>").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var d=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(d.autoHeight||d.fillHeight)c.css("height","");return a.Widget.prototype.destroy.call(this)},_setOption:function(d,c){a.Widget.prototype._setOption.apply(this,arguments);d=="active"&&this.activate(c);if(d=="icons"){this._destroyIcons(); +c&&this._createIcons()}if(d=="disabled")this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(d){if(!(this.options.disabled||d.altKey||d.ctrlKey)){var c=a.ui.keyCode,e=this.headers.length,h=this.headers.index(d.target),g=false;switch(d.keyCode){case c.RIGHT:case c.DOWN:g=this.headers[(h+1)%e];break;case c.LEFT:case c.UP:g=this.headers[(h-1+e)%e];break;case c.SPACE:case c.ENTER:this._clickHandler({target:d.target},d.target); +d.preventDefault()}if(g){a(d.target).attr("tabIndex",-1);a(g).attr("tabIndex",0);g.focus();return false}return true}},resize:function(){var d=this.options,c;if(d.fillSpace){if(a.browser.msie){var e=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height();a.browser.msie&&this.element.parent().css("overflow",e);this.headers.each(function(){c-=a(this).outerHeight(true)});this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+ +a(this).height()))}).css("overflow","auto")}else if(d.autoHeight){c=0;this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c)}return this},activate:function(d){this.options.active=d;d=this._findActive(d)[0];this._clickHandler({target:d},d);return this},_findActive:function(d){return d?typeof d==="number"?this.headers.filter(":eq("+d+")"):this.headers.not(this.headers.not(d)):d===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(d,c){var e=this.options; +if(!e.disabled)if(d.target){d=a(d.currentTarget||c);c=d[0]===this.active[0];e.active=e.collapsible&&c?false:this.headers.index(d);if(!(this.running||!e.collapsible&&c)){var h=this.active;f=d.next();i=this.active.next();b={options:e,newHeader:c&&e.collapsible?a([]):d,oldHeader:this.active,newContent:c&&e.collapsible?a([]):f,oldContent:i};var g=this.headers.index(this.active[0])>this.headers.index(d[0]);this.active=c?a([]):d;this._toggle(f,i,b,c,g);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(e.icons.headerSelected).addClass(e.icons.header); +if(!c){d.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(e.icons.header).addClass(e.icons.headerSelected);d.next().addClass("ui-accordion-content-active")}}}else if(e.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(e.icons.headerSelected).addClass(e.icons.header);this.active.next().addClass("ui-accordion-content-active");var i=this.active.next(), +b={options:e,newHeader:a([]),oldHeader:e.active,newContent:a([]),oldContent:i},f=this.active=a([]);this._toggle(f,i,b)}},_toggle:function(d,c,e,h,g){var i=this,b=i.options;i.toShow=d;i.toHide=c;i.data=e;var f=function(){if(i)return i._completed.apply(i,arguments)};i._trigger("changestart",null,i.data);i.running=c.size()===0?d.size():c.size();if(b.animated){e={};e=b.collapsible&&h?{toShow:a([]),toHide:c,complete:f,down:g,autoHeight:b.autoHeight||b.fillSpace}:{toShow:d,toHide:c,complete:f,down:g,autoHeight:b.autoHeight|| +b.fillSpace};if(!b.proxied)b.proxied=b.animated;if(!b.proxiedDuration)b.proxiedDuration=b.duration;b.animated=a.isFunction(b.proxied)?b.proxied(e):b.proxied;b.duration=a.isFunction(b.proxiedDuration)?b.proxiedDuration(e):b.proxiedDuration;h=a.ui.accordion.animations;var j=b.duration,l=b.animated;if(l&&!h[l]&&!a.easing[l])l="slide";h[l]||(h[l]=function(o){this.slide(o,{easing:l,duration:j||700})});h[l](e)}else{if(b.collapsible&&h)d.toggle();else{c.hide();d.show()}f(true)}c.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();d.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(d){this.running=d?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});a.extend(a.ui.accordion,{version:"1.8.14", +animations:{slide:function(d,c){d=a.extend({easing:"swing",duration:300},d,c);if(d.toHide.size())if(d.toShow.size()){var e=d.toShow.css("overflow"),h=0,g={},i={},b;c=d.toShow;b=c[0].style.width;c.width(parseInt(c.parent().width(),10)-parseInt(c.css("paddingLeft"),10)-parseInt(c.css("paddingRight"),10)-(parseInt(c.css("borderLeftWidth"),10)||0)-(parseInt(c.css("borderRightWidth"),10)||0));a.each(["height","paddingTop","paddingBottom"],function(f,j){i[j]="hide";f=(""+a.css(d.toShow[0],j)).match(/^([\d+-.]+)(.*)$/); +g[j]={value:f[1],unit:f[2]||"px"}});d.toShow.css({height:0,overflow:"hidden"}).show();d.toHide.filter(":hidden").each(d.complete).end().filter(":visible").animate(i,{step:function(f,j){if(j.prop=="height")h=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);d.toShow[0].style[j.prop]=h*g[j.prop].value+g[j.prop].unit},duration:d.duration,easing:d.easing,complete:function(){d.autoHeight||d.toShow.css("height","");d.toShow.css({width:b,overflow:e});d.complete()}})}else d.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},d);else d.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},d)},bounceslide:function(d){this.slide(d,{easing:d.down?"easeOutBounce":"swing",duration:d.down?1E3:200})}}})})(jQuery); +(function(a){var d=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var c=this,e=this.element[0].ownerDocument,h;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(g){if(!(c.options.disabled||c.element.attr("readonly"))){h= +false;var i=a.ui.keyCode;switch(g.keyCode){case i.PAGE_UP:c._move("previousPage",g);break;case i.PAGE_DOWN:c._move("nextPage",g);break;case i.UP:c._move("previous",g);g.preventDefault();break;case i.DOWN:c._move("next",g);g.preventDefault();break;case i.ENTER:case i.NUMPAD_ENTER:if(c.menu.active){h=true;g.preventDefault()}case i.TAB:if(!c.menu.active)return;c.menu.select(g);break;case i.ESCAPE:c.element.val(c.term);c.close(g);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!= +c.element.val()){c.selectedItem=null;c.search(null,g)}},c.options.delay);break}}}).bind("keypress.autocomplete",function(g){if(h){h=false;g.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(g){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(g);c._change(g)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)}; +this.menu=a("<ul></ul>").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",e)[0]).mousedown(function(g){var i=c.menu.element[0];a(g.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(b){b.target!==c.element[0]&&b.target!==i&&!a.ui.contains(i,b.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(g,i){i=i.item.data("item.autocomplete");false!==c._trigger("focus",g,{item:i})&&/^key/.test(g.originalEvent.type)&& +c.element.val(i.value)},selected:function(g,i){var b=i.item.data("item.autocomplete"),f=c.previous;if(c.element[0]!==e.activeElement){c.element.focus();c.previous=f;setTimeout(function(){c.previous=f;c.selectedItem=b},1)}false!==c._trigger("select",g,{item:b})&&c.element.val(b.value);c.term=c.element.val();c.close(g);c.selectedItem=b},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +a.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();a.Widget.prototype.destroy.call(this)},_setOption:function(c,e){a.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(a(e||"body",this.element[0].ownerDocument)[0]);c==="disabled"&& +e&&this.xhr&&this.xhr.abort()},_initSource:function(){var c=this,e,h;if(a.isArray(this.options.source)){e=this.options.source;this.source=function(g,i){i(a.ui.autocomplete.filter(e,g.term))}}else if(typeof this.options.source==="string"){h=this.options.source;this.source=function(g,i){c.xhr&&c.xhr.abort();c.xhr=a.ajax({url:h,data:g,dataType:"json",autocompleteRequest:++d,success:function(b){this.autocompleteRequest===d&&i(b)},error:function(){this.autocompleteRequest===d&&i([])}})}}else this.source= +this.options.source},search:function(c,e){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length<this.options.minLength)return this.close(e);clearTimeout(this.closing);if(this._trigger("search",e)!==false)return this._search(c)},_search:function(c){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:c},this.response)},_response:function(c){if(!this.options.disabled&&c&&c.length){c=this._normalize(c);this._suggest(c);this._trigger("open")}else this.close(); +this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(c){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",c)}},_change:function(c){this.previous!==this.element.val()&&this._trigger("change",c,{item:this.selectedItem})},_normalize:function(c){if(c.length&&c[0].label&&c[0].value)return c;return a.map(c,function(e){if(typeof e==="string")return{label:e,value:e};return a.extend({label:e.label|| +e.value,value:e.value||e.label},e)})},_suggest:function(c){var e=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(e,c);this.menu.deactivate();this.menu.refresh();e.show();this._resizeMenu();e.position(a.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new a.Event("mouseover"))},_resizeMenu:function(){var c=this.menu.element;c.outerWidth(Math.max(c.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(c,e){var h=this; +a.each(e,function(g,i){h._renderItem(c,i)})},_renderItem:function(c,e){return a("<li></li>").data("item.autocomplete",e).append(a("<a></a>").text(e.label)).appendTo(c)},_move:function(c,e){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](e);else this.search(null,e)},widget:function(){return this.menu.element}});a.extend(a.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(c,e){var h=new RegExp(a.ui.autocomplete.escapeRegex(e),"i");return a.grep(c,function(g){return h.test(g.label||g.value||g)})}})})(jQuery); +(function(a){a.widget("ui.menu",{_create:function(){var d=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(a(c.target).closest(".ui-menu-item a").length){c.preventDefault();d.select(c)}});this.refresh()},refresh:function(){var d=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(c){d.activate(c,a(this).parent())}).mouseleave(function(){d.deactivate()})},activate:function(d,c){this.deactivate();if(this.hasScroll()){var e=c.offset().top-this.element.offset().top,h=this.element.scrollTop(),g=this.element.height();if(e<0)this.element.scrollTop(h+e);else e>=g&&this.element.scrollTop(h+e-g+c.height())}this.active=c.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",d,{item:c})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(d){this.move("next",".ui-menu-item:first",d)},previous:function(d){this.move("prev",".ui-menu-item:last",d)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(d,c,e){if(this.active){d=this.active[d+"All"](".ui-menu-item").eq(0);d.length?this.activate(e,d):this.activate(e,this.element.children(c))}else this.activate(e, +this.element.children(c))},nextPage:function(d){if(this.hasScroll())if(!this.active||this.last())this.activate(d,this.element.children(".ui-menu-item:first"));else{var c=this.active.offset().top,e=this.element.height(),h=this.element.children(".ui-menu-item").filter(function(){var g=a(this).offset().top-c-e+a(this).height();return g<10&&g>-10});h.length||(h=this.element.children(".ui-menu-item:last"));this.activate(d,h)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(d){if(this.hasScroll())if(!this.active||this.first())this.activate(d,this.element.children(".ui-menu-item:last"));else{var c=this.active.offset().top,e=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var h=a(this).offset().top-c+e-a(this).height();return h<10&&h>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(d,result)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[a.fn.prop?"prop":"attr"]("scrollHeight")},select:function(d){this._trigger("selected",d,{item:this.active})}})})(jQuery); +(function(a){var d,c,e,h,g=function(){var b=a(this).find(":ui-button");setTimeout(function(){b.button("refresh")},1)},i=function(b){var f=b.name,j=b.form,l=a([]);if(f)l=j?a(j).find("[name='"+f+"']"):a("[name='"+f+"']",b.ownerDocument).filter(function(){return!this.form});return l};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",g);if(typeof this.options.disabled!== +"boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,f=this.options,j=this.type==="checkbox"||this.type==="radio",l="ui-state-hover"+(!j?" ui-state-active":"");if(f.label===null)f.label=this.buttonElement.html();if(this.element.is(":disabled"))f.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!f.disabled){a(this).addClass("ui-state-hover"); +this===d&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){f.disabled||a(this).removeClass(l)}).bind("click.button",function(o){if(f.disabled){o.preventDefault();o.stopImmediatePropagation()}});this.element.bind("focus.button",function(){b.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){b.buttonElement.removeClass("ui-state-focus")});if(j){this.element.bind("change.button",function(){h||b.refresh()});this.buttonElement.bind("mousedown.button",function(o){if(!f.disabled){h= +false;c=o.pageX;e=o.pageY}}).bind("mouseup.button",function(o){if(!f.disabled)if(c!==o.pageX||e!==o.pageY)h=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(f.disabled||h)return false;a(this).toggleClass("ui-state-active");b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(f.disabled||h)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true); +var o=b.element[0];i(o).not(o).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(f.disabled)return false;a(this).addClass("ui-state-active");d=this;a(document).one("mouseup",function(){d=null})}).bind("mouseup.button",function(){if(f.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(o){if(f.disabled)return false;if(o.keyCode==a.ui.keyCode.SPACE|| +o.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(o){o.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",f.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type=== +"radio"){var b=this.element.parents().filter(":last"),f="label[for="+this.element.attr("id")+"]";this.buttonElement=b.find(f);if(!this.buttonElement.length){b=b.length?b.siblings():this.element.siblings();this.buttonElement=b.filter(f);if(!this.buttonElement.length)this.buttonElement=b.find(f)}this.element.addClass("ui-helper-hidden-accessible");(b=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=this.element}, +widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title"); +a.Widget.prototype.destroy.call(this)},_setOption:function(b,f){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")f?this.element.attr("disabled",true):this.element.removeAttr("disabled");else this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")i(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",true): +a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), +f=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),j=this.options.icons,l=j.primary&&j.secondary,o=[];if(j.primary||j.secondary){if(this.options.text)o.push("ui-button-text-icon"+(l?"s":j.primary?"-primary":"-secondary"));j.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+j.primary+"'></span>");j.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+j.secondary+"'></span>");if(!this.options.text){o.push(l?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||b.attr("title",f)}}else o.push("ui-button-text-only");b.addClass(o.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,f){b==="disabled"&&this.buttons.button("option",b,f);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(b?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +a.Widget.prototype.destroy.call(this)}})})(jQuery); +(function(a,d){function c(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};a.extend(this._defaults,this.regional[""]);this.dpDiv=e(a('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function e(b){return b.bind("mouseout",function(f){f= +a(f.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");f.length&&f.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(f){f=a(f.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(a.datepicker._isDisabledDatepicker(i.inline?b.parent()[0]:i.input[0])||!f.length)){f.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");f.addClass("ui-state-hover"); +f.hasClass("ui-datepicker-prev")&&f.addClass("ui-datepicker-prev-hover");f.hasClass("ui-datepicker-next")&&f.addClass("ui-datepicker-next-hover")}})}function h(b,f){a.extend(b,f);for(var j in f)if(f[j]==null||f[j]==d)b[j]=f[j];return b}a.extend(a.ui,{datepicker:{version:"1.8.14"}});var g=(new Date).getTime(),i;a.extend(c.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(b){h(this._defaults, +b||{});return this},_attachDatepicker:function(b,f){var j=null;for(var l in this._defaults){var o=b.getAttribute("date:"+l);if(o){j=j||{};try{j[l]=eval(o)}catch(n){j[l]=o}}}l=b.nodeName.toLowerCase();o=l=="div"||l=="span";if(!b.id){this.uuid+=1;b.id="dp"+this.uuid}var k=this._newInst(a(b),o);k.settings=a.extend({},f||{},j||{});if(l=="input")this._connectDatepicker(b,k);else o&&this._inlineDatepicker(b,k)},_newInst:function(b,f){return{id:b[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:b,selectedDay:0, +selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:f,dpDiv:!f?this.dpDiv:e(a('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(b,f){var j=a(b);f.append=a([]);f.trigger=a([]);if(!j.hasClass(this.markerClassName)){this._attachments(j,f);j.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(l,o,n){f.settings[o]= +n}).bind("getData.datepicker",function(l,o){return this._get(f,o)});this._autoSize(f);a.data(b,"datepicker",f)}},_attachments:function(b,f){var j=this._get(f,"appendText"),l=this._get(f,"isRTL");f.append&&f.append.remove();if(j){f.append=a('<span class="'+this._appendClass+'">'+j+"</span>");b[l?"before":"after"](f.append)}b.unbind("focus",this._showDatepicker);f.trigger&&f.trigger.remove();j=this._get(f,"showOn");if(j=="focus"||j=="both")b.focus(this._showDatepicker);if(j=="button"||j=="both"){j= +this._get(f,"buttonText");var o=this._get(f,"buttonImage");f.trigger=a(this._get(f,"buttonImageOnly")?a("<img/>").addClass(this._triggerClass).attr({src:o,alt:j,title:j}):a('<button type="button"></button>').addClass(this._triggerClass).html(o==""?j:a("<img/>").attr({src:o,alt:j,title:j})));b[l?"before":"after"](f.trigger);f.trigger.click(function(){a.datepicker._datepickerShowing&&a.datepicker._lastInput==b[0]?a.datepicker._hideDatepicker():a.datepicker._showDatepicker(b[0]);return false})}},_autoSize:function(b){if(this._get(b, +"autoSize")&&!b.inline){var f=new Date(2009,11,20),j=this._get(b,"dateFormat");if(j.match(/[DM]/)){var l=function(o){for(var n=0,k=0,m=0;m<o.length;m++)if(o[m].length>n){n=o[m].length;k=m}return k};f.setMonth(l(this._get(b,j.match(/MM/)?"monthNames":"monthNamesShort")));f.setDate(l(this._get(b,j.match(/DD/)?"dayNames":"dayNamesShort"))+20-f.getDay())}b.input.attr("size",this._formatDate(b,f).length)}},_inlineDatepicker:function(b,f){var j=a(b);if(!j.hasClass(this.markerClassName)){j.addClass(this.markerClassName).append(f.dpDiv).bind("setData.datepicker", +function(l,o,n){f.settings[o]=n}).bind("getData.datepicker",function(l,o){return this._get(f,o)});a.data(b,"datepicker",f);this._setDate(f,this._getDefaultDate(f),true);this._updateDatepicker(f);this._updateAlternate(f);f.dpDiv.show()}},_dialogDatepicker:function(b,f,j,l,o){b=this._dialogInst;if(!b){this.uuid+=1;this._dialogInput=a('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);a("body").append(this._dialogInput); +b=this._dialogInst=this._newInst(this._dialogInput,false);b.settings={};a.data(this._dialogInput[0],"datepicker",b)}h(b.settings,l||{});f=f&&f.constructor==Date?this._formatDate(b,f):f;this._dialogInput.val(f);this._pos=o?o.length?o:[o.pageX,o.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left", +this._pos[0]+20+"px").css("top",this._pos[1]+"px");b.settings.onSelect=j;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);a.blockUI&&a.blockUI(this.dpDiv);a.data(this._dialogInput[0],"datepicker",b);return this},_destroyDatepicker:function(b){var f=a(b),j=a.data(b,"datepicker");if(f.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();a.removeData(b,"datepicker");if(l=="input"){j.append.remove();j.trigger.remove();f.removeClass(this.markerClassName).unbind("focus", +this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(l=="div"||l=="span")f.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(b){var f=a(b),j=a.data(b,"datepicker");if(f.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();if(l=="input"){b.disabled=false;j.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(l=="div"||l=="span"){f= +f.children("."+this._inlineClass);f.children().removeClass("ui-state-disabled");f.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o==b?null:o})}},_disableDatepicker:function(b){var f=a(b),j=a.data(b,"datepicker");if(f.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();if(l=="input"){b.disabled=true;j.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5", +cursor:"default"})}else if(l=="div"||l=="span"){f=f.children("."+this._inlineClass);f.children().addClass("ui-state-disabled");f.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o==b?null:o});this._disabledInputs[this._disabledInputs.length]=b}},_isDisabledDatepicker:function(b){if(!b)return false;for(var f=0;f<this._disabledInputs.length;f++)if(this._disabledInputs[f]==b)return true;return false}, +_getInst:function(b){try{return a.data(b,"datepicker")}catch(f){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(b,f,j){var l=this._getInst(b);if(arguments.length==2&&typeof f=="string")return f=="defaults"?a.extend({},a.datepicker._defaults):l?f=="all"?a.extend({},l.settings):this._get(l,f):null;var o=f||{};if(typeof f=="string"){o={};o[f]=j}if(l){this._curInst==l&&this._hideDatepicker();var n=this._getDateDatepicker(b,true),k=this._getMinMaxDate(l,"min"),m=this._getMinMaxDate(l, +"max");h(l.settings,o);if(k!==null&&o.dateFormat!==d&&o.minDate===d)l.settings.minDate=this._formatDate(l,k);if(m!==null&&o.dateFormat!==d&&o.maxDate===d)l.settings.maxDate=this._formatDate(l,m);this._attachments(a(b),l);this._autoSize(l);this._setDate(l,n);this._updateAlternate(l);this._updateDatepicker(l)}},_changeDatepicker:function(b,f,j){this._optionDatepicker(b,f,j)},_refreshDatepicker:function(b){(b=this._getInst(b))&&this._updateDatepicker(b)},_setDateDatepicker:function(b,f){if(b=this._getInst(b)){this._setDate(b, +f);this._updateDatepicker(b);this._updateAlternate(b)}},_getDateDatepicker:function(b,f){(b=this._getInst(b))&&!b.inline&&this._setDateFromField(b,f);return b?this._getDate(b):null},_doKeyDown:function(b){var f=a.datepicker._getInst(b.target),j=true,l=f.dpDiv.is(".ui-datepicker-rtl");f._keyEvent=true;if(a.datepicker._datepickerShowing)switch(b.keyCode){case 9:a.datepicker._hideDatepicker();j=false;break;case 13:j=a("td."+a.datepicker._dayOverClass+":not(."+a.datepicker._currentClass+")",f.dpDiv); +j[0]?a.datepicker._selectDay(b.target,f.selectedMonth,f.selectedYear,j[0]):a.datepicker._hideDatepicker();return false;case 27:a.datepicker._hideDatepicker();break;case 33:a.datepicker._adjustDate(b.target,b.ctrlKey?-a.datepicker._get(f,"stepBigMonths"):-a.datepicker._get(f,"stepMonths"),"M");break;case 34:a.datepicker._adjustDate(b.target,b.ctrlKey?+a.datepicker._get(f,"stepBigMonths"):+a.datepicker._get(f,"stepMonths"),"M");break;case 35:if(b.ctrlKey||b.metaKey)a.datepicker._clearDate(b.target); +j=b.ctrlKey||b.metaKey;break;case 36:if(b.ctrlKey||b.metaKey)a.datepicker._gotoToday(b.target);j=b.ctrlKey||b.metaKey;break;case 37:if(b.ctrlKey||b.metaKey)a.datepicker._adjustDate(b.target,l?+1:-1,"D");j=b.ctrlKey||b.metaKey;if(b.originalEvent.altKey)a.datepicker._adjustDate(b.target,b.ctrlKey?-a.datepicker._get(f,"stepBigMonths"):-a.datepicker._get(f,"stepMonths"),"M");break;case 38:if(b.ctrlKey||b.metaKey)a.datepicker._adjustDate(b.target,-7,"D");j=b.ctrlKey||b.metaKey;break;case 39:if(b.ctrlKey|| +b.metaKey)a.datepicker._adjustDate(b.target,l?-1:+1,"D");j=b.ctrlKey||b.metaKey;if(b.originalEvent.altKey)a.datepicker._adjustDate(b.target,b.ctrlKey?+a.datepicker._get(f,"stepBigMonths"):+a.datepicker._get(f,"stepMonths"),"M");break;case 40:if(b.ctrlKey||b.metaKey)a.datepicker._adjustDate(b.target,+7,"D");j=b.ctrlKey||b.metaKey;break;default:j=false}else if(b.keyCode==36&&b.ctrlKey)a.datepicker._showDatepicker(this);else j=false;if(j){b.preventDefault();b.stopPropagation()}},_doKeyPress:function(b){var f= +a.datepicker._getInst(b.target);if(a.datepicker._get(f,"constrainInput")){f=a.datepicker._possibleChars(a.datepicker._get(f,"dateFormat"));var j=String.fromCharCode(b.charCode==d?b.keyCode:b.charCode);return b.ctrlKey||b.metaKey||j<" "||!f||f.indexOf(j)>-1}},_doKeyUp:function(b){b=a.datepicker._getInst(b.target);if(b.input.val()!=b.lastVal)try{if(a.datepicker.parseDate(a.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,a.datepicker._getFormatConfig(b))){a.datepicker._setDateFromField(b); +a.datepicker._updateAlternate(b);a.datepicker._updateDatepicker(b)}}catch(f){a.datepicker.log(f)}return true},_showDatepicker:function(b){b=b.target||b;if(b.nodeName.toLowerCase()!="input")b=a("input",b.parentNode)[0];if(!(a.datepicker._isDisabledDatepicker(b)||a.datepicker._lastInput==b)){var f=a.datepicker._getInst(b);if(a.datepicker._curInst&&a.datepicker._curInst!=f){a.datepicker._datepickerShowing&&a.datepicker._triggerOnClose(a.datepicker._curInst);a.datepicker._curInst.dpDiv.stop(true,true)}var j= +a.datepicker._get(f,"beforeShow");h(f.settings,j?j.apply(b,[b,f]):{});f.lastVal=null;a.datepicker._lastInput=b;a.datepicker._setDateFromField(f);if(a.datepicker._inDialog)b.value="";if(!a.datepicker._pos){a.datepicker._pos=a.datepicker._findPos(b);a.datepicker._pos[1]+=b.offsetHeight}var l=false;a(b).parents().each(function(){l|=a(this).css("position")=="fixed";return!l});if(l&&a.browser.opera){a.datepicker._pos[0]-=document.documentElement.scrollLeft;a.datepicker._pos[1]-=document.documentElement.scrollTop}j= +{left:a.datepicker._pos[0],top:a.datepicker._pos[1]};a.datepicker._pos=null;f.dpDiv.empty();f.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});a.datepicker._updateDatepicker(f);j=a.datepicker._checkOffset(f,j,l);f.dpDiv.css({position:a.datepicker._inDialog&&a.blockUI?"static":l?"fixed":"absolute",display:"none",left:j.left+"px",top:j.top+"px"});if(!f.inline){j=a.datepicker._get(f,"showAnim");var o=a.datepicker._get(f,"duration"),n=function(){var k=f.dpDiv.find("iframe.ui-datepicker-cover"); +if(k.length){var m=a.datepicker._getBorders(f.dpDiv);k.css({left:-m[0],top:-m[1],width:f.dpDiv.outerWidth(),height:f.dpDiv.outerHeight()})}};f.dpDiv.zIndex(a(b).zIndex()+1);a.datepicker._datepickerShowing=true;a.effects&&a.effects[j]?f.dpDiv.show(j,a.datepicker._get(f,"showOptions"),o,n):f.dpDiv[j||"show"](j?o:null,n);if(!j||!o)n();f.input.is(":visible")&&!f.input.is(":disabled")&&f.input.focus();a.datepicker._curInst=f}}},_updateDatepicker:function(b){this.maxRows=4;var f=a.datepicker._getBorders(b.dpDiv); +i=b;b.dpDiv.empty().append(this._generateHTML(b));var j=b.dpDiv.find("iframe.ui-datepicker-cover");j.length&&j.css({left:-f[0],top:-f[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()});b.dpDiv.find("."+this._dayOverClass+" a").mouseover();f=this._getNumberOfMonths(b);j=f[1];b.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");j>1&&b.dpDiv.addClass("ui-datepicker-multi-"+j).css("width",17*j+"em");b.dpDiv[(f[0]!=1||f[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi"); +b.dpDiv[(this._get(b,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");b==a.datepicker._curInst&&a.datepicker._datepickerShowing&&b.input&&b.input.is(":visible")&&!b.input.is(":disabled")&&b.input[0]!=document.activeElement&&b.input.focus();if(b.yearshtml){var l=b.yearshtml;setTimeout(function(){l===b.yearshtml&&b.yearshtml&&b.dpDiv.find("select.ui-datepicker-year:first").replaceWith(b.yearshtml);l=b.yearshtml=null},0)}},_getBorders:function(b){var f=function(j){return{thin:1,medium:2,thick:3}[j]|| +j};return[parseFloat(f(b.css("border-left-width"))),parseFloat(f(b.css("border-top-width")))]},_checkOffset:function(b,f,j){var l=b.dpDiv.outerWidth(),o=b.dpDiv.outerHeight(),n=b.input?b.input.outerWidth():0,k=b.input?b.input.outerHeight():0,m=document.documentElement.clientWidth+a(document).scrollLeft(),p=document.documentElement.clientHeight+a(document).scrollTop();f.left-=this._get(b,"isRTL")?l-n:0;f.left-=j&&f.left==b.input.offset().left?a(document).scrollLeft():0;f.top-=j&&f.top==b.input.offset().top+ +k?a(document).scrollTop():0;f.left-=Math.min(f.left,f.left+l>m&&m>l?Math.abs(f.left+l-m):0);f.top-=Math.min(f.top,f.top+o>p&&p>o?Math.abs(o+k):0);return f},_findPos:function(b){for(var f=this._get(this._getInst(b),"isRTL");b&&(b.type=="hidden"||b.nodeType!=1||a.expr.filters.hidden(b));)b=b[f?"previousSibling":"nextSibling"];b=a(b).offset();return[b.left,b.top]},_triggerOnClose:function(b){var f=this._get(b,"onClose");if(f)f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b])},_hideDatepicker:function(b){var f= +this._curInst;if(!(!f||b&&f!=a.data(b,"datepicker")))if(this._datepickerShowing){b=this._get(f,"showAnim");var j=this._get(f,"duration"),l=function(){a.datepicker._tidyDialog(f);this._curInst=null};a.effects&&a.effects[b]?f.dpDiv.hide(b,a.datepicker._get(f,"showOptions"),j,l):f.dpDiv[b=="slideDown"?"slideUp":b=="fadeIn"?"fadeOut":"hide"](b?j:null,l);b||l();a.datepicker._triggerOnClose(f);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute", +left:"0",top:"-100px"});if(a.blockUI){a.unblockUI();a("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(b){b.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(b){if(a.datepicker._curInst){b=a(b.target);b[0].id!=a.datepicker._mainDivId&&b.parents("#"+a.datepicker._mainDivId).length==0&&!b.hasClass(a.datepicker.markerClassName)&&!b.hasClass(a.datepicker._triggerClass)&&a.datepicker._datepickerShowing&&!(a.datepicker._inDialog&& +a.blockUI)&&a.datepicker._hideDatepicker()}},_adjustDate:function(b,f,j){b=a(b);var l=this._getInst(b[0]);if(!this._isDisabledDatepicker(b[0])){this._adjustInstDate(l,f+(j=="M"?this._get(l,"showCurrentAtPos"):0),j);this._updateDatepicker(l)}},_gotoToday:function(b){b=a(b);var f=this._getInst(b[0]);if(this._get(f,"gotoCurrent")&&f.currentDay){f.selectedDay=f.currentDay;f.drawMonth=f.selectedMonth=f.currentMonth;f.drawYear=f.selectedYear=f.currentYear}else{var j=new Date;f.selectedDay=j.getDate();f.drawMonth= +f.selectedMonth=j.getMonth();f.drawYear=f.selectedYear=j.getFullYear()}this._notifyChange(f);this._adjustDate(b)},_selectMonthYear:function(b,f,j){b=a(b);var l=this._getInst(b[0]);l._selectingMonthYear=false;l["selected"+(j=="M"?"Month":"Year")]=l["draw"+(j=="M"?"Month":"Year")]=parseInt(f.options[f.selectedIndex].value,10);this._notifyChange(l);this._adjustDate(b)},_clickMonthYear:function(b){var f=this._getInst(a(b)[0]);f.input&&f._selectingMonthYear&&setTimeout(function(){f.input.focus()},0);f._selectingMonthYear= +!f._selectingMonthYear},_selectDay:function(b,f,j,l){var o=a(b);if(!(a(l).hasClass(this._unselectableClass)||this._isDisabledDatepicker(o[0]))){o=this._getInst(o[0]);o.selectedDay=o.currentDay=a("a",l).html();o.selectedMonth=o.currentMonth=f;o.selectedYear=o.currentYear=j;this._selectDate(b,this._formatDate(o,o.currentDay,o.currentMonth,o.currentYear))}},_clearDate:function(b){b=a(b);this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(b,f){b=this._getInst(a(b)[0]);f=f!=null?f:this._formatDate(b); +b.input&&b.input.val(f);this._updateAlternate(b);var j=this._get(b,"onSelect");if(j)j.apply(b.input?b.input[0]:null,[f,b]);else b.input&&b.input.trigger("change");if(b.inline)this._updateDatepicker(b);else{this._hideDatepicker();this._lastInput=b.input[0];typeof b.input[0]!="object"&&b.input.focus();this._lastInput=null}},_updateAlternate:function(b){var f=this._get(b,"altField");if(f){var j=this._get(b,"altFormat")||this._get(b,"dateFormat"),l=this._getDate(b),o=this.formatDate(j,l,this._getFormatConfig(b)); +a(f).each(function(){a(this).val(o)})}},noWeekends:function(b){b=b.getDay();return[b>0&&b<6,""]},iso8601Week:function(b){b=new Date(b.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var f=b.getTime();b.setMonth(0);b.setDate(1);return Math.floor(Math.round((f-b)/864E5)/7)+1},parseDate:function(b,f,j){if(b==null||f==null)throw"Invalid arguments";f=typeof f=="object"?f.toString():f+"";if(f=="")return null;var l=(j?j.shortYearCutoff:null)||this._defaults.shortYearCutoff;l=typeof l!="string"?l:(new Date).getFullYear()% +100+parseInt(l,10);for(var o=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,n=(j?j.dayNames:null)||this._defaults.dayNames,k=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort,m=(j?j.monthNames:null)||this._defaults.monthNames,p=j=-1,q=-1,s=-1,r=false,u=function(z){(z=H+1<b.length&&b.charAt(H+1)==z)&&H++;return z},v=function(z){var I=u(z);z=new RegExp("^\\d{1,"+(z=="@"?14:z=="!"?20:z=="y"&&I?4:z=="o"?3:2)+"}");z=f.substring(y).match(z);if(!z)throw"Missing number at position "+y;y+= +z[0].length;return parseInt(z[0],10)},w=function(z,I,N){z=a.map(u(z)?N:I,function(D,E){return[[E,D]]}).sort(function(D,E){return-(D[1].length-E[1].length)});var J=-1;a.each(z,function(D,E){D=E[1];if(f.substr(y,D.length).toLowerCase()==D.toLowerCase()){J=E[0];y+=D.length;return false}});if(J!=-1)return J+1;else throw"Unknown name at position "+y;},x=function(){if(f.charAt(y)!=b.charAt(H))throw"Unexpected literal at position "+y;y++},y=0,H=0;H<b.length;H++)if(r)if(b.charAt(H)=="'"&&!u("'"))r=false; +else x();else switch(b.charAt(H)){case "d":q=v("d");break;case "D":w("D",o,n);break;case "o":s=v("o");break;case "m":p=v("m");break;case "M":p=w("M",k,m);break;case "y":j=v("y");break;case "@":var C=new Date(v("@"));j=C.getFullYear();p=C.getMonth()+1;q=C.getDate();break;case "!":C=new Date((v("!")-this._ticksTo1970)/1E4);j=C.getFullYear();p=C.getMonth()+1;q=C.getDate();break;case "'":if(u("'"))x();else r=true;break;default:x()}if(y<f.length)throw"Extra/unparsed characters found in date: "+f.substring(y); +if(j==-1)j=(new Date).getFullYear();else if(j<100)j+=(new Date).getFullYear()-(new Date).getFullYear()%100+(j<=l?0:-100);if(s>-1){p=1;q=s;do{l=this._getDaysInMonth(j,p-1);if(q<=l)break;p++;q-=l}while(1)}C=this._daylightSavingAdjust(new Date(j,p-1,q));if(C.getFullYear()!=j||C.getMonth()+1!=p||C.getDate()!=q)throw"Invalid date";return C},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y", +TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(b,f,j){if(!f)return"";var l=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,o=(j?j.dayNames:null)||this._defaults.dayNames,n=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort;j=(j?j.monthNames:null)||this._defaults.monthNames;var k=function(u){(u=r+1<b.length&&b.charAt(r+1)==u)&&r++;return u},m=function(u,v,w){v=""+v;if(k(u))for(;v.length< +w;)v="0"+v;return v},p=function(u,v,w,x){return k(u)?x[v]:w[v]},q="",s=false;if(f)for(var r=0;r<b.length;r++)if(s)if(b.charAt(r)=="'"&&!k("'"))s=false;else q+=b.charAt(r);else switch(b.charAt(r)){case "d":q+=m("d",f.getDate(),2);break;case "D":q+=p("D",f.getDay(),l,o);break;case "o":q+=m("o",Math.round(((new Date(f.getFullYear(),f.getMonth(),f.getDate())).getTime()-(new Date(f.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":q+=m("m",f.getMonth()+1,2);break;case "M":q+=p("M",f.getMonth(),n, +j);break;case "y":q+=k("y")?f.getFullYear():(f.getYear()%100<10?"0":"")+f.getYear()%100;break;case "@":q+=f.getTime();break;case "!":q+=f.getTime()*1E4+this._ticksTo1970;break;case "'":if(k("'"))q+="'";else s=true;break;default:q+=b.charAt(r)}return q},_possibleChars:function(b){for(var f="",j=false,l=function(n){(n=o+1<b.length&&b.charAt(o+1)==n)&&o++;return n},o=0;o<b.length;o++)if(j)if(b.charAt(o)=="'"&&!l("'"))j=false;else f+=b.charAt(o);else switch(b.charAt(o)){case "d":case "m":case "y":case "@":f+= +"0123456789";break;case "D":case "M":return null;case "'":if(l("'"))f+="'";else j=true;break;default:f+=b.charAt(o)}return f},_get:function(b,f){return b.settings[f]!==d?b.settings[f]:this._defaults[f]},_setDateFromField:function(b,f){if(b.input.val()!=b.lastVal){var j=this._get(b,"dateFormat"),l=b.lastVal=b.input?b.input.val():null,o,n;o=n=this._getDefaultDate(b);var k=this._getFormatConfig(b);try{o=this.parseDate(j,l,k)||n}catch(m){this.log(m);l=f?"":l}b.selectedDay=o.getDate();b.drawMonth=b.selectedMonth= +o.getMonth();b.drawYear=b.selectedYear=o.getFullYear();b.currentDay=l?o.getDate():0;b.currentMonth=l?o.getMonth():0;b.currentYear=l?o.getFullYear():0;this._adjustInstDate(b)}},_getDefaultDate:function(b){return this._restrictMinMax(b,this._determineDate(b,this._get(b,"defaultDate"),new Date))},_determineDate:function(b,f,j){var l=function(n){var k=new Date;k.setDate(k.getDate()+n);return k},o=function(n){try{return a.datepicker.parseDate(a.datepicker._get(b,"dateFormat"),n,a.datepicker._getFormatConfig(b))}catch(k){}var m= +(n.toLowerCase().match(/^c/)?a.datepicker._getDate(b):null)||new Date,p=m.getFullYear(),q=m.getMonth();m=m.getDate();for(var s=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,r=s.exec(n);r;){switch(r[2]||"d"){case "d":case "D":m+=parseInt(r[1],10);break;case "w":case "W":m+=parseInt(r[1],10)*7;break;case "m":case "M":q+=parseInt(r[1],10);m=Math.min(m,a.datepicker._getDaysInMonth(p,q));break;case "y":case "Y":p+=parseInt(r[1],10);m=Math.min(m,a.datepicker._getDaysInMonth(p,q));break}r=s.exec(n)}return new Date(p, +q,m)};if(f=(f=f==null||f===""?j:typeof f=="string"?o(f):typeof f=="number"?isNaN(f)?j:l(f):new Date(f.getTime()))&&f.toString()=="Invalid Date"?j:f){f.setHours(0);f.setMinutes(0);f.setSeconds(0);f.setMilliseconds(0)}return this._daylightSavingAdjust(f)},_daylightSavingAdjust:function(b){if(!b)return null;b.setHours(b.getHours()>12?b.getHours()+2:0);return b},_setDate:function(b,f,j){var l=!f,o=b.selectedMonth,n=b.selectedYear;f=this._restrictMinMax(b,this._determineDate(b,f,new Date));b.selectedDay= +b.currentDay=f.getDate();b.drawMonth=b.selectedMonth=b.currentMonth=f.getMonth();b.drawYear=b.selectedYear=b.currentYear=f.getFullYear();if((o!=b.selectedMonth||n!=b.selectedYear)&&!j)this._notifyChange(b);this._adjustInstDate(b);if(b.input)b.input.val(l?"":this._formatDate(b))},_getDate:function(b){return!b.currentYear||b.input&&b.input.val()==""?null:this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay))},_generateHTML:function(b){var f=new Date;f=this._daylightSavingAdjust(new Date(f.getFullYear(), +f.getMonth(),f.getDate()));var j=this._get(b,"isRTL"),l=this._get(b,"showButtonPanel"),o=this._get(b,"hideIfNoPrevNext"),n=this._get(b,"navigationAsDateFormat"),k=this._getNumberOfMonths(b),m=this._get(b,"showCurrentAtPos"),p=this._get(b,"stepMonths"),q=k[0]!=1||k[1]!=1,s=this._daylightSavingAdjust(!b.currentDay?new Date(9999,9,9):new Date(b.currentYear,b.currentMonth,b.currentDay)),r=this._getMinMaxDate(b,"min"),u=this._getMinMaxDate(b,"max");m=b.drawMonth-m;var v=b.drawYear;if(m<0){m+=12;v--}if(u){var w= +this._daylightSavingAdjust(new Date(u.getFullYear(),u.getMonth()-k[0]*k[1]+1,u.getDate()));for(w=r&&w<r?r:w;this._daylightSavingAdjust(new Date(v,m,1))>w;){m--;if(m<0){m=11;v--}}}b.drawMonth=m;b.drawYear=v;w=this._get(b,"prevText");w=!n?w:this.formatDate(w,this._daylightSavingAdjust(new Date(v,m-p,1)),this._getFormatConfig(b));w=this._canAdjustMonth(b,-1,v,m)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+g+".datepicker._adjustDate('#"+b.id+"', -"+p+", 'M');\" title=\""+w+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(j?"e":"w")+'">'+w+"</span></a>":o?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+w+'"><span class="ui-icon ui-icon-circle-triangle-'+(j?"e":"w")+'">'+w+"</span></a>";var x=this._get(b,"nextText");x=!n?x:this.formatDate(x,this._daylightSavingAdjust(new Date(v,m+p,1)),this._getFormatConfig(b));o=this._canAdjustMonth(b,+1,v,m)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+g+".datepicker._adjustDate('#"+b.id+"', +"+p+", 'M');\" title=\""+x+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(j?"w":"e")+'">'+x+"</span></a>":o?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+x+'"><span class="ui-icon ui-icon-circle-triangle-'+(j?"w":"e")+'">'+x+"</span></a>";p=this._get(b,"currentText");x=this._get(b,"gotoCurrent")&&b.currentDay?s:f;p=!n?p:this.formatDate(p,x,this._getFormatConfig(b));n=!b.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+g+'.datepicker._hideDatepicker();">'+this._get(b, +"closeText")+"</button>":"";l=l?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(j?n:"")+(this._isInRange(b,x)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+g+".datepicker._gotoToday('#"+b.id+"');\">"+p+"</button>":"")+(j?"":n)+"</div>":"";n=parseInt(this._get(b,"firstDay"),10);n=isNaN(n)?0:n;p=this._get(b,"showWeek");x=this._get(b,"dayNames");this._get(b,"dayNamesShort");var y=this._get(b,"dayNamesMin"),H= +this._get(b,"monthNames"),C=this._get(b,"monthNamesShort"),z=this._get(b,"beforeShowDay"),I=this._get(b,"showOtherMonths"),N=this._get(b,"selectOtherMonths");this._get(b,"calculateWeek");for(var J=this._getDefaultDate(b),D="",E=0;E<k[0];E++){var P="";this.maxRows=4;for(var L=0;L<k[1];L++){var Q=this._daylightSavingAdjust(new Date(v,m,b.selectedDay)),B=" ui-corner-all",F="";if(q){F+='<div class="ui-datepicker-group';if(k[1]>1)switch(L){case 0:F+=" ui-datepicker-group-first";B=" ui-corner-"+(j?"right": +"left");break;case k[1]-1:F+=" ui-datepicker-group-last";B=" ui-corner-"+(j?"left":"right");break;default:F+=" ui-datepicker-group-middle";B="";break}F+='">'}F+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+B+'">'+(/all|left/.test(B)&&E==0?j?o:w:"")+(/all|right/.test(B)&&E==0?j?w:o:"")+this._generateMonthYearHeader(b,m,v,r,u,E>0||L>0,H,C)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var G=p?'<th class="ui-datepicker-week-col">'+this._get(b,"weekHeader")+"</th>": +"";for(B=0;B<7;B++){var A=(B+n)%7;G+="<th"+((B+n+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+x[A]+'">'+y[A]+"</span></th>"}F+=G+"</tr></thead><tbody>";G=this._getDaysInMonth(v,m);if(v==b.selectedYear&&m==b.selectedMonth)b.selectedDay=Math.min(b.selectedDay,G);B=(this._getFirstDayOfMonth(v,m)-n+7)%7;G=Math.ceil((B+G)/7);this.maxRows=G=q?this.maxRows>G?this.maxRows:G:G;A=this._daylightSavingAdjust(new Date(v,m,1-B));for(var R=0;R<G;R++){F+="<tr>";var S=!p?"":'<td class="ui-datepicker-week-col">'+ +this._get(b,"calculateWeek")(A)+"</td>";for(B=0;B<7;B++){var M=z?z.apply(b.input?b.input[0]:null,[A]):[true,""],K=A.getMonth()!=m,O=K&&!N||!M[0]||r&&A<r||u&&A>u;S+='<td class="'+((B+n+6)%7>=5?" ui-datepicker-week-end":"")+(K?" ui-datepicker-other-month":"")+(A.getTime()==Q.getTime()&&m==b.selectedMonth&&b._keyEvent||J.getTime()==A.getTime()&&J.getTime()==Q.getTime()?" "+this._dayOverClass:"")+(O?" "+this._unselectableClass+" ui-state-disabled":"")+(K&&!I?"":" "+M[1]+(A.getTime()==s.getTime()?" "+ +this._currentClass:"")+(A.getTime()==f.getTime()?" ui-datepicker-today":""))+'"'+((!K||I)&&M[2]?' title="'+M[2]+'"':"")+(O?"":' onclick="DP_jQuery_'+g+".datepicker._selectDay('#"+b.id+"',"+A.getMonth()+","+A.getFullYear()+', this);return false;"')+">"+(K&&!I?" ":O?'<span class="ui-state-default">'+A.getDate()+"</span>":'<a class="ui-state-default'+(A.getTime()==f.getTime()?" ui-state-highlight":"")+(A.getTime()==s.getTime()?" ui-state-active":"")+(K?" ui-priority-secondary":"")+'" href="#">'+ +A.getDate()+"</a>")+"</td>";A.setDate(A.getDate()+1);A=this._daylightSavingAdjust(A)}F+=S+"</tr>"}m++;if(m>11){m=0;v++}F+="</tbody></table>"+(q?"</div>"+(k[0]>0&&L==k[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");P+=F}D+=P}D+=l+(a.browser.msie&&parseInt(a.browser.version,10)<7&&!b.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");b._keyEvent=false;return D},_generateMonthYearHeader:function(b,f,j,l,o,n,k,m){var p=this._get(b,"changeMonth"), +q=this._get(b,"changeYear"),s=this._get(b,"showMonthAfterYear"),r='<div class="ui-datepicker-title">',u="";if(n||!p)u+='<span class="ui-datepicker-month">'+k[f]+"</span>";else{k=l&&l.getFullYear()==j;var v=o&&o.getFullYear()==j;u+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+g+".datepicker._selectMonthYear('#"+b.id+"', this, 'M');\" onclick=\"DP_jQuery_"+g+".datepicker._clickMonthYear('#"+b.id+"');\">";for(var w=0;w<12;w++)if((!k||w>=l.getMonth())&&(!v||w<=o.getMonth()))u+='<option value="'+ +w+'"'+(w==f?' selected="selected"':"")+">"+m[w]+"</option>";u+="</select>"}s||(r+=u+(n||!(p&&q)?" ":""));if(!b.yearshtml){b.yearshtml="";if(n||!q)r+='<span class="ui-datepicker-year">'+j+"</span>";else{m=this._get(b,"yearRange").split(":");var x=(new Date).getFullYear();k=function(y){y=y.match(/c[+-].*/)?j+parseInt(y.substring(1),10):y.match(/[+-].*/)?x+parseInt(y,10):parseInt(y,10);return isNaN(y)?x:y};f=k(m[0]);m=Math.max(f,k(m[1]||""));f=l?Math.max(f,l.getFullYear()):f;m=o?Math.min(m,o.getFullYear()): +m;for(b.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+g+".datepicker._selectMonthYear('#"+b.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+g+".datepicker._clickMonthYear('#"+b.id+"');\">";f<=m;f++)b.yearshtml+='<option value="'+f+'"'+(f==j?' selected="selected"':"")+">"+f+"</option>";b.yearshtml+="</select>";r+=b.yearshtml;b.yearshtml=null}}r+=this._get(b,"yearSuffix");if(s)r+=(n||!(p&&q)?" ":"")+u;r+="</div>";return r},_adjustInstDate:function(b,f,j){var l=b.drawYear+(j== +"Y"?f:0),o=b.drawMonth+(j=="M"?f:0);f=Math.min(b.selectedDay,this._getDaysInMonth(l,o))+(j=="D"?f:0);l=this._restrictMinMax(b,this._daylightSavingAdjust(new Date(l,o,f)));b.selectedDay=l.getDate();b.drawMonth=b.selectedMonth=l.getMonth();b.drawYear=b.selectedYear=l.getFullYear();if(j=="M"||j=="Y")this._notifyChange(b)},_restrictMinMax:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");f=j&&f<j?j:f;return f=b&&f>b?b:f},_notifyChange:function(b){var f=this._get(b,"onChangeMonthYear"); +if(f)f.apply(b.input?b.input[0]:null,[b.selectedYear,b.selectedMonth+1,b])},_getNumberOfMonths:function(b){b=this._get(b,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(b,f){return this._determineDate(b,this._get(b,f+"Date"),null)},_getDaysInMonth:function(b,f){return 32-this._daylightSavingAdjust(new Date(b,f,32)).getDate()},_getFirstDayOfMonth:function(b,f){return(new Date(b,f,1)).getDay()},_canAdjustMonth:function(b,f,j,l){var o=this._getNumberOfMonths(b); +j=this._daylightSavingAdjust(new Date(j,l+(f<0?f:o[0]*o[1]),1));f<0&&j.setDate(this._getDaysInMonth(j.getFullYear(),j.getMonth()));return this._isInRange(b,j)},_isInRange:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");return(!j||f.getTime()>=j.getTime())&&(!b||f.getTime()<=b.getTime())},_getFormatConfig:function(b){var f=this._get(b,"shortYearCutoff");f=typeof f!="string"?f:(new Date).getFullYear()%100+parseInt(f,10);return{shortYearCutoff:f,dayNamesShort:this._get(b, +"dayNamesShort"),dayNames:this._get(b,"dayNames"),monthNamesShort:this._get(b,"monthNamesShort"),monthNames:this._get(b,"monthNames")}},_formatDate:function(b,f,j,l){if(!f){b.currentDay=b.selectedDay;b.currentMonth=b.selectedMonth;b.currentYear=b.selectedYear}f=f?typeof f=="object"?f:this._daylightSavingAdjust(new Date(l,j,f)):this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay));return this.formatDate(this._get(b,"dateFormat"),f,this._getFormatConfig(b))}});a.fn.datepicker= +function(b){if(!this.length)return this;if(!a.datepicker.initialized){a(document).mousedown(a.datepicker._checkExternalClick).find("body").append(a.datepicker.dpDiv);a.datepicker.initialized=true}var f=Array.prototype.slice.call(arguments,1);if(typeof b=="string"&&(b=="isDisabled"||b=="getDate"||b=="widget"))return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(f));if(b=="option"&&arguments.length==2&&typeof arguments[1]=="string")return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker, +[this[0]].concat(f));return this.each(function(){typeof b=="string"?a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this].concat(f)):a.datepicker._attachDatepicker(this,b)})};a.datepicker=new c;a.datepicker.initialized=false;a.datepicker.uuid=(new Date).getTime();a.datepicker.version="1.8.14";window["DP_jQuery_"+g]=a})(jQuery); +(function(a,d){var c={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},e={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},h=a.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};a.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(g){var i=a(this).css(g).offset().top;i<0&&a(this).css("top",g.top-i)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var g=this,i=g.options,b=i.title||" ",f=a.ui.dialog.getTitleId(g.element),j=(g.uiDialog=a("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +i.dialogClass).css({zIndex:i.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){if(i.closeOnEscape&&n.keyCode&&n.keyCode===a.ui.keyCode.ESCAPE){g.close(n);n.preventDefault()}}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(n){g.moveToTop(false,n)});g.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j);var l=(g.uiDialogTitlebar=a("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j), +o=a('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){o.addClass("ui-state-hover")},function(){o.removeClass("ui-state-hover")}).focus(function(){o.addClass("ui-state-focus")}).blur(function(){o.removeClass("ui-state-focus")}).click(function(n){g.close(n);return false}).appendTo(l);(g.uiDialogTitlebarCloseText=a("<span></span>")).addClass("ui-icon ui-icon-closethick").text(i.closeText).appendTo(o);a("<span></span>").addClass("ui-dialog-title").attr("id", +f).html(b).prependTo(l);if(a.isFunction(i.beforeclose)&&!a.isFunction(i.beforeClose))i.beforeClose=i.beforeclose;l.find("*").add(l).disableSelection();i.draggable&&a.fn.draggable&&g._makeDraggable();i.resizable&&a.fn.resizable&&g._makeResizable();g._createButtons(i.buttons);g._isOpen=false;a.fn.bgiframe&&j.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var g=this;g.overlay&&g.overlay.destroy();g.uiDialog.hide();g.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +g.uiDialog.remove();g.originalTitle&&g.element.attr("title",g.originalTitle);return g},widget:function(){return this.uiDialog},close:function(g){var i=this,b,f;if(false!==i._trigger("beforeClose",g)){i.overlay&&i.overlay.destroy();i.uiDialog.unbind("keypress.ui-dialog");i._isOpen=false;if(i.options.hide)i.uiDialog.hide(i.options.hide,function(){i._trigger("close",g)});else{i.uiDialog.hide();i._trigger("close",g)}a.ui.dialog.overlay.resize();if(i.options.modal){b=0;a(".ui-dialog").each(function(){if(this!== +i.uiDialog[0]){f=a(this).css("z-index");isNaN(f)||(b=Math.max(b,f))}});a.ui.dialog.maxZ=b}return i}},isOpen:function(){return this._isOpen},moveToTop:function(g,i){var b=this,f=b.options;if(f.modal&&!g||!f.stack&&!f.modal)return b._trigger("focus",i);if(f.zIndex>a.ui.dialog.maxZ)a.ui.dialog.maxZ=f.zIndex;if(b.overlay){a.ui.dialog.maxZ+=1;b.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)}g={scrollTop:b.element.attr("scrollTop"),scrollLeft:b.element.attr("scrollLeft")};a.ui.dialog.maxZ+= +1;b.uiDialog.css("z-index",a.ui.dialog.maxZ);b.element.attr(g);b._trigger("focus",i);return b},open:function(){if(!this._isOpen){var g=this,i=g.options,b=g.uiDialog;g.overlay=i.modal?new a.ui.dialog.overlay(g):null;g._size();g._position(i.position);b.show(i.show);g.moveToTop(true);i.modal&&b.bind("keypress.ui-dialog",function(f){if(f.keyCode===a.ui.keyCode.TAB){var j=a(":tabbable",this),l=j.filter(":first");j=j.filter(":last");if(f.target===j[0]&&!f.shiftKey){l.focus(1);return false}else if(f.target=== +l[0]&&f.shiftKey){j.focus(1);return false}}});a(g.element.find(":tabbable").get().concat(b.find(".ui-dialog-buttonpane :tabbable").get().concat(b.get()))).eq(0).focus();g._isOpen=true;g._trigger("open");return g}},_createButtons:function(g){var i=this,b=false,f=a("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),j=a("<div></div>").addClass("ui-dialog-buttonset").appendTo(f);i.uiDialog.find(".ui-dialog-buttonpane").remove();typeof g==="object"&&g!==null&&a.each(g, +function(){return!(b=true)});if(b){a.each(g,function(l,o){o=a.isFunction(o)?{click:o,text:l}:o;var n=a('<button type="button"></button>').click(function(){o.click.apply(i.element[0],arguments)}).appendTo(j);a.each(o,function(k,m){if(k!=="click")k in h?n[k](m):n.attr(k,m)});a.fn.button&&n.button()});f.appendTo(i.uiDialog)}},_makeDraggable:function(){function g(l){return{position:l.position,offset:l.offset}}var i=this,b=i.options,f=a(document),j;i.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(l,o){j=b.height==="auto"?"auto":a(this).height();a(this).height(a(this).height()).addClass("ui-dialog-dragging");i._trigger("dragStart",l,g(o))},drag:function(l,o){i._trigger("drag",l,g(o))},stop:function(l,o){b.position=[o.position.left-f.scrollLeft(),o.position.top-f.scrollTop()];a(this).removeClass("ui-dialog-dragging").height(j);i._trigger("dragStop",l,g(o));a.ui.dialog.overlay.resize()}})},_makeResizable:function(g){function i(l){return{originalPosition:l.originalPosition, +originalSize:l.originalSize,position:l.position,size:l.size}}g=g===d?this.options.resizable:g;var b=this,f=b.options,j=b.uiDialog.css("position");g=typeof g==="string"?g:"n,e,s,w,se,sw,ne,nw";b.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:b.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:b._minHeight(),handles:g,start:function(l,o){a(this).addClass("ui-dialog-resizing");b._trigger("resizeStart",l,i(o))},resize:function(l,o){b._trigger("resize", +l,i(o))},stop:function(l,o){a(this).removeClass("ui-dialog-resizing");f.height=a(this).height();f.width=a(this).width();b._trigger("resizeStop",l,i(o));a.ui.dialog.overlay.resize()}}).css("position",j).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var g=this.options;return g.height==="auto"?g.minHeight:Math.min(g.minHeight,g.height)},_position:function(g){var i=[],b=[0,0],f;if(g){if(typeof g==="string"||typeof g==="object"&&"0"in g){i=g.split?g.split(" "): +[g[0],g[1]];if(i.length===1)i[1]=i[0];a.each(["left","top"],function(j,l){if(+i[j]===i[j]){b[j]=i[j];i[j]=l}});g={my:i.join(" "),at:i.join(" "),offset:b.join(" ")}}g=a.extend({},a.ui.dialog.prototype.options.position,g)}else g=a.ui.dialog.prototype.options.position;(f=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},g));f||this.uiDialog.hide()},_setOptions:function(g){var i=this,b={},f=false;a.each(g,function(j,l){i._setOption(j,l); +if(j in c)f=true;if(j in e)b[j]=l});f&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",b)},_setOption:function(g,i){var b=this,f=b.uiDialog;switch(g){case "beforeclose":g="beforeClose";break;case "buttons":b._createButtons(i);break;case "closeText":b.uiDialogTitlebarCloseText.text(""+i);break;case "dialogClass":f.removeClass(b.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+i);break;case "disabled":i?f.addClass("ui-dialog-disabled"): +f.removeClass("ui-dialog-disabled");break;case "draggable":var j=f.is(":data(draggable)");j&&!i&&f.draggable("destroy");!j&&i&&b._makeDraggable();break;case "position":b._position(i);break;case "resizable":(j=f.is(":data(resizable)"))&&!i&&f.resizable("destroy");j&&typeof i==="string"&&f.resizable("option","handles",i);!j&&i!==false&&b._makeResizable(i);break;case "title":a(".ui-dialog-title",b.uiDialogTitlebar).html(""+(i||" "));break}a.Widget.prototype._setOption.apply(b,arguments)},_size:function(){var g= +this.options,i,b,f=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(g.minWidth>g.width)g.width=g.minWidth;i=this.uiDialog.css({height:"auto",width:g.width}).height();b=Math.max(0,g.minHeight-i);if(g.height==="auto")if(a.support.minHeight)this.element.css({minHeight:b,height:"auto"});else{this.uiDialog.show();g=this.element.css("height","auto").height();f||this.uiDialog.hide();this.element.height(Math.max(g,b))}else this.element.height(Math.max(g.height- +i,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});a.extend(a.ui.dialog,{version:"1.8.14",uuid:0,maxZ:0,getTitleId:function(g){g=g.attr("id");if(!g){this.uuid+=1;g=this.uuid}return"ui-dialog-title-"+g},overlay:function(g){this.$el=a.ui.dialog.overlay.create(g)}});a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(g){return g+".dialog-overlay"}).join(" "), +create:function(g){if(this.instances.length===0){setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()<a.ui.dialog.overlay.maxZ)return false})},1);a(document).bind("keydown.dialog-overlay",function(b){if(g.options.closeOnEscape&&b.keyCode&&b.keyCode===a.ui.keyCode.ESCAPE){g.close(b);b.preventDefault()}});a(window).bind("resize.dialog-overlay",a.ui.dialog.overlay.resize)}var i=(this.oldInstances.pop()||a("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});a.fn.bgiframe&&i.bgiframe();this.instances.push(i);return i},destroy:function(g){var i=a.inArray(g,this.instances);i!=-1&&this.oldInstances.push(this.instances.splice(i,1)[0]);this.instances.length===0&&a([document,window]).unbind(".dialog-overlay");g.remove();var b=0;a.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var g,i;if(a.browser.msie&&a.browser.version<7){g=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +i=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return g<i?a(window).height()+"px":g+"px"}else return a(document).height()+"px"},width:function(){var g,i;if(a.browser.msie){g=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);i=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return g<i?a(window).width()+"px":g+"px"}else return a(document).width()+"px"},resize:function(){var g=a([]);a.each(a.ui.dialog.overlay.instances,function(){g= +g.add(this)});g.css({width:0,height:0}).css({width:a.ui.dialog.overlay.width(),height:a.ui.dialog.overlay.height()})}});a.extend(a.ui.dialog.overlay.prototype,{destroy:function(){a.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +(function(a){a.ui=a.ui||{};var d=/left|center|right/,c=/top|center|bottom/,e=a.fn.position,h=a.fn.offset;a.fn.position=function(g){if(!g||!g.of)return e.apply(this,arguments);g=a.extend({},g);var i=a(g.of),b=i[0],f=(g.collision||"flip").split(" "),j=g.offset?g.offset.split(" "):[0,0],l,o,n;if(b.nodeType===9){l=i.width();o=i.height();n={top:0,left:0}}else if(b.setTimeout){l=i.width();o=i.height();n={top:i.scrollTop(),left:i.scrollLeft()}}else if(b.preventDefault){g.at="left top";l=o=0;n={top:g.of.pageY, +left:g.of.pageX}}else{l=i.outerWidth();o=i.outerHeight();n=i.offset()}a.each(["my","at"],function(){var k=(g[this]||"").split(" ");if(k.length===1)k=d.test(k[0])?k.concat(["center"]):c.test(k[0])?["center"].concat(k):["center","center"];k[0]=d.test(k[0])?k[0]:"center";k[1]=c.test(k[1])?k[1]:"center";g[this]=k});if(f.length===1)f[1]=f[0];j[0]=parseInt(j[0],10)||0;if(j.length===1)j[1]=j[0];j[1]=parseInt(j[1],10)||0;if(g.at[0]==="right")n.left+=l;else if(g.at[0]==="center")n.left+=l/2;if(g.at[1]==="bottom")n.top+= +o;else if(g.at[1]==="center")n.top+=o/2;n.left+=j[0];n.top+=j[1];return this.each(function(){var k=a(this),m=k.outerWidth(),p=k.outerHeight(),q=parseInt(a.curCSS(this,"marginLeft",true))||0,s=parseInt(a.curCSS(this,"marginTop",true))||0,r=m+q+(parseInt(a.curCSS(this,"marginRight",true))||0),u=p+s+(parseInt(a.curCSS(this,"marginBottom",true))||0),v=a.extend({},n),w;if(g.my[0]==="right")v.left-=m;else if(g.my[0]==="center")v.left-=m/2;if(g.my[1]==="bottom")v.top-=p;else if(g.my[1]==="center")v.top-= +p/2;v.left=Math.round(v.left);v.top=Math.round(v.top);w={left:v.left-q,top:v.top-s};a.each(["left","top"],function(x,y){a.ui.position[f[x]]&&a.ui.position[f[x]][y](v,{targetWidth:l,targetHeight:o,elemWidth:m,elemHeight:p,collisionPosition:w,collisionWidth:r,collisionHeight:u,offset:j,my:g.my,at:g.at})});a.fn.bgiframe&&k.bgiframe();k.offset(a.extend(v,{using:g.using}))})};a.ui.position={fit:{left:function(g,i){var b=a(window);b=i.collisionPosition.left+i.collisionWidth-b.width()-b.scrollLeft();g.left= +b>0?g.left-b:Math.max(g.left-i.collisionPosition.left,g.left)},top:function(g,i){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();g.top=b>0?g.top-b:Math.max(g.top-i.collisionPosition.top,g.top)}},flip:{left:function(g,i){if(i.at[0]!=="center"){var b=a(window);b=i.collisionPosition.left+i.collisionWidth-b.width()-b.scrollLeft();var f=i.my[0]==="left"?-i.elemWidth:i.my[0]==="right"?i.elemWidth:0,j=i.at[0]==="left"?i.targetWidth:-i.targetWidth,l=-2*i.offset[0];g.left+= +i.collisionPosition.left<0?f+j+l:b>0?f+j+l:0}},top:function(g,i){if(i.at[1]!=="center"){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();var f=i.my[1]==="top"?-i.elemHeight:i.my[1]==="bottom"?i.elemHeight:0,j=i.at[1]==="top"?i.targetHeight:-i.targetHeight,l=-2*i.offset[1];g.top+=i.collisionPosition.top<0?f+j+l:b>0?f+j+l:0}}}};if(!a.offset.setOffset){a.offset.setOffset=function(g,i){if(/static/.test(a.curCSS(g,"position")))g.style.position="relative";var b=a(g), +f=b.offset(),j=parseInt(a.curCSS(g,"top",true),10)||0,l=parseInt(a.curCSS(g,"left",true),10)||0;f={top:i.top-f.top+j,left:i.left-f.left+l};"using"in i?i.using.call(g,f):b.css(f)};a.fn.offset=function(g){var i=this[0];if(!i||!i.ownerDocument)return null;if(g)return this.each(function(){a.offset.setOffset(this,g)});return h.call(this)}}})(jQuery); +(function(a,d){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=a("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();a.Widget.prototype.destroy.apply(this,arguments)},value:function(c){if(c===d)return this._value();this._setOption("value",c);return this},_setOption:function(c,e){if(c==="value"){this.options.value=e;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var c=this.options.value;if(typeof c!=="number")c=0;return Math.min(this.options.max,Math.max(this.min,c))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var c=this.value(),e=this._percentage();if(this.oldValue!==c){this.oldValue=c;this._trigger("change")}this.valueDiv.toggle(c>this.min).toggleClass("ui-corner-right",c===this.options.max).width(e.toFixed(0)+"%");this.element.attr("aria-valuenow",c)}});a.extend(a.ui.progressbar,{version:"1.8.14"})})(jQuery); +(function(a){a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var d=this,c=this.options,e=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),h=c.values&&c.values.length||1,g=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ +this.orientation+" ui-widget ui-widget-content ui-corner-all"+(c.disabled?" ui-slider-disabled ui-disabled":""));this.range=a([]);if(c.range){if(c.range===true){if(!c.values)c.values=[this._valueMin(),this._valueMin()];if(c.values.length&&c.values.length!==2)c.values=[c.values[0],c.values[0]]}this.range=a("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(c.range==="min"||c.range==="max"?" ui-slider-range-"+c.range:""))}for(var i=e.length;i<h;i+=1)g.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>"); +this.handles=e.add(a(g.join("")).appendTo(d.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(b){b.preventDefault()}).hover(function(){c.disabled||a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){if(c.disabled)a(this).blur();else{a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(b){a(this).data("index.ui-slider-handle", +b)});this.handles.keydown(function(b){var f=true,j=a(this).data("index.ui-slider-handle"),l,o,n;if(!d.options.disabled){switch(b.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.PAGE_UP:case a.ui.keyCode.PAGE_DOWN:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!d._keySliding){d._keySliding=true;a(this).addClass("ui-state-active");l=d._start(b,j);if(l===false)return}break}n=d.options.step;l=d.options.values&&d.options.values.length? +(o=d.values(j)):(o=d.value());switch(b.keyCode){case a.ui.keyCode.HOME:o=d._valueMin();break;case a.ui.keyCode.END:o=d._valueMax();break;case a.ui.keyCode.PAGE_UP:o=d._trimAlignValue(l+(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.PAGE_DOWN:o=d._trimAlignValue(l-(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(l===d._valueMax())return;o=d._trimAlignValue(l+n);break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(l===d._valueMin())return;o=d._trimAlignValue(l- +n);break}d._slide(b,j,o);return f}}).keyup(function(b){var f=a(this).data("index.ui-slider-handle");if(d._keySliding){d._keySliding=false;d._stop(b,f);d._change(b,f);a(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(d){var c=this.options,e,h,g,i,b;if(c.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();e=this._normValueFromMouse({x:d.pageX,y:d.pageY});h=this._valueMax()-this._valueMin()+1;i=this;this.handles.each(function(f){var j=Math.abs(e-i.values(f));if(h>j){h=j;g=a(this);b=f}});if(c.range===true&&this.values(1)===c.min){b+=1;g=a(this.handles[b])}if(this._start(d,b)===false)return false; +this._mouseSliding=true;i._handleIndex=b;g.addClass("ui-state-active").focus();c=g.offset();this._clickOffset=!a(d.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:d.pageX-c.left-g.width()/2,top:d.pageY-c.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(d,b,e);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(d){var c= +this._normValueFromMouse({x:d.pageX,y:d.pageY});this._slide(d,this._handleIndex,c);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c;if(this.orientation==="horizontal"){c= +this.elementSize.width;d=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;d=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}c=d/c;if(c>1)c=1;if(c<0)c=0;if(this.orientation==="vertical")c=1-c;d=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+c*d)},_start:function(d,c){var e={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){e.value=this.values(c); +e.values=this.values()}return this._trigger("start",d,e)},_slide:function(d,c,e){var h;if(this.options.values&&this.options.values.length){h=this.values(c?0:1);if(this.options.values.length===2&&this.options.range===true&&(c===0&&e>h||c===1&&e<h))e=h;if(e!==this.values(c)){h=this.values();h[c]=e;d=this._trigger("slide",d,{handle:this.handles[c],value:e,values:h});this.values(c?0:1);d!==false&&this.values(c,e,true)}}else if(e!==this.value()){d=this._trigger("slide",d,{handle:this.handles[c],value:e}); +d!==false&&this.value(e)}},_stop:function(d,c){var e={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){e.value=this.values(c);e.values=this.values()}this._trigger("stop",d,e)},_change:function(d,c){if(!this._keySliding&&!this._mouseSliding){var e={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){e.value=this.values(c);e.values=this.values()}this._trigger("change",d,e)}},value:function(d){if(arguments.length){this.options.value= +this._trimAlignValue(d);this._refreshValue();this._change(null,0)}else return this._value()},values:function(d,c){var e,h,g;if(arguments.length>1){this.options.values[d]=this._trimAlignValue(c);this._refreshValue();this._change(null,d)}else if(arguments.length)if(a.isArray(arguments[0])){e=this.options.values;h=arguments[0];for(g=0;g<e.length;g+=1){e[g]=this._trimAlignValue(h[g]);this._change(null,g)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(d): +this.value();else return this._values()},_setOption:function(d,c){var e,h=0;if(a.isArray(this.options.values))h=this.options.values.length;a.Widget.prototype._setOption.apply(this,arguments);switch(d){case "disabled":if(c){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(e=0;e<h;e+=1)this._change(null,e);this._animateOff=false;break}},_value:function(){var d=this.options.value;return d=this._trimAlignValue(d)},_values:function(d){var c,e;if(arguments.length){c=this.options.values[d]; +return c=this._trimAlignValue(c)}else{c=this.options.values.slice();for(e=0;e<c.length;e+=1)c[e]=this._trimAlignValue(c[e]);return c}},_trimAlignValue:function(d){if(d<=this._valueMin())return this._valueMin();if(d>=this._valueMax())return this._valueMax();var c=this.options.step>0?this.options.step:1,e=(d-this._valueMin())%c;alignValue=d-e;if(Math.abs(e)*2>=c)alignValue+=e>0?c:-c;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var d=this.options.range,c=this.options,e=this,h=!this._animateOff?c.animate:false,g,i={},b,f,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(o){g=(e.values(o)-e._valueMin())/(e._valueMax()-e._valueMin())*100;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";a(this).stop(1,1)[h?"animate":"css"](i,c.animate);if(e.options.range===true)if(e.orientation==="horizontal"){if(o===0)e.range.stop(1,1)[h?"animate":"css"]({left:g+"%"},c.animate); +if(o===1)e.range[h?"animate":"css"]({width:g-b+"%"},{queue:false,duration:c.animate})}else{if(o===0)e.range.stop(1,1)[h?"animate":"css"]({bottom:g+"%"},c.animate);if(o===1)e.range[h?"animate":"css"]({height:g-b+"%"},{queue:false,duration:c.animate})}b=g});else{f=this.value();j=this._valueMin();l=this._valueMax();g=l!==j?(f-j)/(l-j)*100:0;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";this.handle.stop(1,1)[h?"animate":"css"](i,c.animate);if(d==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[h?"animate":"css"]({width:g+"%"},c.animate);if(d==="max"&&this.orientation==="horizontal")this.range[h?"animate":"css"]({width:100-g+"%"},{queue:false,duration:c.animate});if(d==="min"&&this.orientation==="vertical")this.range.stop(1,1)[h?"animate":"css"]({height:g+"%"},c.animate);if(d==="max"&&this.orientation==="vertical")this.range[h?"animate":"css"]({height:100-g+"%"},{queue:false,duration:c.animate})}}});a.extend(a.ui.slider,{version:"1.8.14"})})(jQuery); +(function(a,d){function c(){return++h}function e(){return++g}var h=0,g=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(i,b){if(i=="selected")this.options.collapsible&& +b==this.options.selected||this.select(b);else{this.options[i]=b;this._tabify()}},_tabId:function(i){return i.title&&i.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+c()},_sanitizeSelector:function(i){return i.replace(/:/g,"\\:")},_cookie:function(){var i=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+e());return a.cookie.apply(null,[i].concat(a.makeArray(arguments)))},_ui:function(i,b){return{tab:i,panel:b,index:this.anchors.index(i)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var i= +a(this);i.html(i.data("label.tabs")).removeData("label.tabs")})},_tabify:function(i){function b(r,u){r.css("display","");!a.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var f=this,j=this.options,l=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=a(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);this.anchors.each(function(r,u){var v=a(u).attr("href"),w=v.split("#")[0],x;if(w&&(w===location.toString().split("#")[0]|| +(x=a("base")[0])&&w===x.href)){v=u.hash;u.href=v}if(l.test(v))f.panels=f.panels.add(f.element.find(f._sanitizeSelector(v)));else if(v&&v!=="#"){a.data(u,"href.tabs",v);a.data(u,"load.tabs",v.replace(/#.*$/,""));v=f._tabId(u);u.href="#"+v;u=f.element.find("#"+v);if(!u.length){u=a(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(f.panels[r-1]||f.list);u.data("destroy.tabs",true)}f.panels=f.panels.add(u)}else j.disabled.push(r)});if(i){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===d){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(f._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=a.unique(j.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(r){return f.lis.index(r)}))).sort();a.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(a.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(j.selected>=0&&this.anchors.length){f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");f.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[j.selected],f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash))[0]))});this.load(j.selected)}a(window).bind("unload",function(){f.lis.add(f.anchors).unbind(".tabs");f.lis=f.anchors=f.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);i=0;for(var o;o=this.lis[i];i++)a(o)[a.inArray(i,j.disabled)!=-1&&!a(o).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var n=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ +r)};this.lis.bind("mouseover.tabs",function(){n("hover",a(this))});this.lis.bind("mouseout.tabs",function(){k("hover",a(this))});this.anchors.bind("focus.tabs",function(){n("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",a(this).closest("li"))})}var m,p;if(j.fx)if(a.isArray(j.fx)){m=j.fx[0];p=j.fx[1]}else m=p=j.fx;var q=p?function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(p,p.duration||"normal", +function(){b(u,p);f._trigger("show",null,f._ui(r,u[0]))})}:function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");f._trigger("show",null,f._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");b(u,m);f.element.dequeue("tabs")})}:function(r,u){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");f.element.dequeue("tabs")}; +this.anchors.bind(j.event+".tabs",function(){var r=this,u=a(r).closest("li"),v=f.panels.filter(":not(.ui-tabs-hide)"),w=f.element.find(f._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||f.panels.filter(":animated").length||f._trigger("select",null,f._ui(this,w[0]))===false){this.blur();return false}j.selected=f.anchors.index(this);f.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= +-1;j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this));this.blur();return false}j.cookie&&f._cookie(j.selected,j.cookie);if(w.length){v.length&&f.element.queue("tabs",function(){s(r,v)});f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +a.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(i){if(typeof i=="string")i=this.anchors.index(this.anchors.filter("[href$="+i+"]"));return i},destroy:function(){var i=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var b= +a.data(this,"href.tabs");if(b)this.href=b;var f=a(this).unbind(".tabs");a.each(["href","load","cache"],function(j,l){f.removeData(l+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});i.cookie&&this._cookie(null,i.cookie);return this},add:function(i, +b,f){if(f===d)f=this.anchors.length;var j=this,l=this.options;b=a(l.tabTemplate.replace(/#\{href\}/g,i).replace(/#\{label\}/g,b));i=!i.indexOf("#")?i.replace("#",""):this._tabId(a("a",b)[0]);b.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var o=j.element.find("#"+i);o.length||(o=a(l.panelTemplate).attr("id",i).data("destroy.tabs",true));o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(f>=this.lis.length){b.appendTo(this.list);o.appendTo(this.list[0].parentNode)}else{b.insertBefore(this.lis[f]); +o.insertBefore(this.panels[f])}l.disabled=a.map(l.disabled,function(n){return n>=f?++n:n});this._tabify();if(this.anchors.length==1){l.selected=0;b.addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[f],this.panels[f]));return this},remove:function(i){i=this._getIndex(i);var b=this.options,f=this.lis.eq(i).remove(),j=this.panels.eq(i).remove(); +if(f.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(i+(i+1<this.anchors.length?1:-1));b.disabled=a.map(a.grep(b.disabled,function(l){return l!=i}),function(l){return l>=i?--l:l});this._tabify();this._trigger("remove",null,this._ui(f.find("a")[0],j[0]));return this},enable:function(i){i=this._getIndex(i);var b=this.options;if(a.inArray(i,b.disabled)!=-1){this.lis.eq(i).removeClass("ui-state-disabled");b.disabled=a.grep(b.disabled,function(f){return f!=i});this._trigger("enable",null, +this._ui(this.anchors[i],this.panels[i]));return this}},disable:function(i){i=this._getIndex(i);var b=this.options;if(i!=b.selected){this.lis.eq(i).addClass("ui-state-disabled");b.disabled.push(i);b.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[i],this.panels[i]))}return this},select:function(i){i=this._getIndex(i);if(i==-1)if(this.options.collapsible&&this.options.selected!=-1)i=this.options.selected;else return this;this.anchors.eq(i).trigger(this.options.event+".tabs");return this}, +load:function(i){i=this._getIndex(i);var b=this,f=this.options,j=this.anchors.eq(i)[0],l=a.data(j,"load.tabs");this.abort();if(!l||this.element.queue("tabs").length!==0&&a.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(i).addClass("ui-state-processing");if(f.spinner){var o=a("span",j);o.data("label.tabs",o.html()).html(f.spinner)}this.xhr=a.ajax(a.extend({},f.ajaxOptions,{url:l,success:function(n,k){b.element.find(b._sanitizeSelector(j.hash)).html(n);b._cleanup();f.cache&&a.data(j, +"cache.tabs",true);b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.success(n,k)}catch(m){}},error:function(n,k){b._cleanup();b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.error(n,k,i,j)}catch(m){}}}));b.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(i,b){this.anchors.eq(i).removeData("cache.tabs").data("load.tabs",b);return this},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.8.14"});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(i,b){var f=this,j=this.options,l=f._rotate||(f._rotate=function(o){clearTimeout(f.rotation);f.rotation=setTimeout(function(){var n=j.selected;f.select(++n<f.anchors.length?n:0)},i);o&&o.stopPropagation()});b=f._unrotate||(f._unrotate=!b?function(o){o.clientX&& +f.rotate(null)}:function(){t=j.selected;l()});if(i){this.element.bind("tabsshow",l);this.anchors.bind(j.event+".tabs",b);l()}else{clearTimeout(f.rotation);this.element.unbind("tabsshow",l);this.anchors.unbind(j.event+".tabs",b);delete this._rotate;delete this._unrotate}return this}})})(jQuery); diff --git a/lib/scripts/jquery/jquery.cookie.js b/lib/scripts/jquery/jquery.cookie.js new file mode 100644 index 000000000..6df1faca2 --- /dev/null +++ b/lib/scripts/jquery/jquery.cookie.js @@ -0,0 +1,96 @@ +/** + * Cookie plugin + * + * Copyright (c) 2006 Klaus Hartl (stilbuero.de) + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + * + */ + +/** + * Create a cookie with the given name and value and other optional parameters. + * + * @example $.cookie('the_cookie', 'the_value'); + * @desc Set the value of a cookie. + * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true }); + * @desc Create a cookie with all available options. + * @example $.cookie('the_cookie', 'the_value'); + * @desc Create a session cookie. + * @example $.cookie('the_cookie', null); + * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain + * used when the cookie was set. + * + * @param String name The name of the cookie. + * @param String value The value of the cookie. + * @param Object options An object literal containing key/value pairs to provide optional cookie attributes. + * @option Number|Date expires Either an integer specifying the expiration date from now on in days or a Date object. + * If a negative value is specified (e.g. a date in the past), the cookie will be deleted. + * If set to null or omitted, the cookie will be a session cookie and will not be retained + * when the the browser exits. + * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie). + * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie). + * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will + * require a secure protocol (like HTTPS). + * @type undefined + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ + +/** + * Get the value of a cookie with the given name. + * + * @example $.cookie('the_cookie'); + * @desc Get the value of a cookie. + * + * @param String name The name of the cookie. + * @return The value of the cookie. + * @type String + * + * @name $.cookie + * @cat Plugins/Cookie + * @author Klaus Hartl/klaus.hartl@stilbuero.de + */ +jQuery.cookie = function(name, value, options) { + if (typeof value != 'undefined') { // name and value given, set cookie + options = options || {}; + if (value === null) { + value = ''; + options.expires = -1; + } + var expires = ''; + if (options.expires && (typeof options.expires == 'number' || options.expires.toUTCString)) { + var date; + if (typeof options.expires == 'number') { + date = new Date(); + date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000)); + } else { + date = options.expires; + } + expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE + } + // CAUTION: Needed to parenthesize options.path and options.domain + // in the following expressions, otherwise they evaluate to undefined + // in the packed version for some reason... + var path = options.path ? '; path=' + (options.path) : ''; + var domain = options.domain ? '; domain=' + (options.domain) : ''; + var secure = options.secure ? '; secure' : ''; + document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join(''); + } else { // only name given, get cookie + var cookieValue = null; + if (document.cookie && document.cookie != '') { + var cookies = document.cookie.split(';'); + for (var i = 0; i < cookies.length; i++) { + var cookie = jQuery.trim(cookies[i]); + // Does this cookie string begin with the name we want? + if (cookie.substring(0, name.length + 1) == (name + '=')) { + cookieValue = decodeURIComponent(cookie.substring(name.length + 1)); + break; + } + } + } + return cookieValue; + } +};
\ No newline at end of file diff --git a/lib/scripts/jquery/jquery.js b/lib/scripts/jquery/jquery.js new file mode 100644 index 000000000..f3201aacb --- /dev/null +++ b/lib/scripts/jquery/jquery.js @@ -0,0 +1,8981 @@ +/*! + * jQuery JavaScript Library v1.6.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Jun 30 14:16:56 2011 -0400 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z])/ig, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = (context ? context.ownerDocument || context : document); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return (context || rootjQuery).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if (selector.selector !== undefined) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.6.2", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + (this.selector ? " " : "") + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.done( fn ); + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery._Deferred(); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNaN: function( obj ) { + return obj == null || !rdigit.test( obj ) || isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return (new Function( "return " + data ))(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + // (xml & tmp used internally) + parseXML: function( data , xml , tmp ) { + + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + + tmp = xml.documentElement; + + if ( ! tmp || ! tmp.nodeName || tmp.nodeName === "parsererror" ) { + jQuery.error( "Invalid XML: " + data ); + } + + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Converts a dashed string to camelCased string; + // Used by both the css and data modules + camelCase: function( string ) { + return string.replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array ) { + + if ( indexOf ) { + return indexOf.call( array, elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return (new Date()).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +return jQuery; + +})(); + + +var // Promise methods + promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ), + // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + // Create a simple deferred (one callbacks list) + _Deferred: function() { + var // callbacks list + callbacks = [], + // stored [ context , args ] + fired, + // to avoid firing when already doing so + firing, + // flag to know if the deferred has been cancelled + cancelled, + // the deferred itself + deferred = { + + // done( f1, f2, ...) + done: function() { + if ( !cancelled ) { + var args = arguments, + i, + length, + elem, + type, + _fired; + if ( fired ) { + _fired = fired; + fired = 0; + } + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + deferred.done.apply( deferred, elem ); + } else if ( type === "function" ) { + callbacks.push( elem ); + } + } + if ( _fired ) { + deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); + } + } + return this; + }, + + // resolve with given context and args + resolveWith: function( context, args ) { + if ( !cancelled && !fired && !firing ) { + // make sure args are available (#8421) + args = args || []; + firing = 1; + try { + while( callbacks[ 0 ] ) { + callbacks.shift().apply( context, args ); + } + } + finally { + fired = [ context, args ]; + firing = 0; + } + } + return this; + }, + + // resolve with this as context and given arguments + resolve: function() { + deferred.resolveWith( this, arguments ); + return this; + }, + + // Has this deferred been resolved? + isResolved: function() { + return !!( firing || fired ); + }, + + // Cancel + cancel: function() { + cancelled = 1; + callbacks = []; + return this; + } + }; + + return deferred; + }, + + // Full fledged deferred (two callbacks list) + Deferred: function( func ) { + var deferred = jQuery._Deferred(), + failDeferred = jQuery._Deferred(), + promise; + // Add errorDeferred methods, then and promise + jQuery.extend( deferred, { + then: function( doneCallbacks, failCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ); + return this; + }, + always: function() { + return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments ); + }, + fail: failDeferred.done, + rejectWith: failDeferred.resolveWith, + reject: failDeferred.resolve, + isRejected: failDeferred.isResolved, + pipe: function( fnDone, fnFail ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject ); + } else { + newDefer[ action ]( returned ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + if ( promise ) { + return promise; + } + promise = obj = {}; + } + var i = promiseMethods.length; + while( i-- ) { + obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; + } + return obj; + } + }); + // Make sure only one callback list will be used + deferred.done( failDeferred.cancel ).fail( deferred.cancel ); + // Unexpose cancel + delete deferred.cancel; + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = arguments, + i = 0, + length = args.length, + count = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + // Strange bug in FF4: + // Values changed onto the arguments object sometimes end up as undefined values + // outside the $.when method. Cloning the object into a fresh array solves the issue + deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) ); + } + }; + } + if ( length > 1 ) { + for( ; i < length; i++ ) { + if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return deferred.promise(); + } +}); + + + +jQuery.support = (function() { + + var div = document.createElement( "div" ), + documentElement = document.documentElement, + all, + a, + select, + opt, + input, + marginDiv, + support, + fragment, + body, + testElementParent, + testElement, + testElementStyle, + tds, + events, + eventName, + i, + isSupported; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName( "tbody" ).length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName( "link" ).length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55$/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains it's value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.firstChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + div.innerHTML = ""; + + // Figure out if the W3C box model works as expected + div.style.width = div.style.paddingLeft = "1px"; + + body = document.getElementsByTagName( "body" )[ 0 ]; + // We use our own, invisible, body unless the body is already present + // in which case we use a div (#9239) + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0 + }; + if ( body ) { + jQuery.extend( testElementStyle, { + position: "absolute", + left: -1000, + top: -1000 + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; + tds = div.getElementsByTagName( "td" ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( document.defaultView && document.defaultView.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Remove the body element we added + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + // Technique from Juriy Zaytsev + // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + } ) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Null connected elements to avoid leaks in IE + testElement = fragment = select = opt = body = marginDiv = div = input = null; + + return support; +})(); + +// Keep track of boxModel +jQuery.boxModel = jQuery.support.boxModel; + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([a-z])([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, getByName = typeof name === "string", thisCache, + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || (pvt && id && !cache[ id ][ internalKey ])) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } else { + id = jQuery.expando; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); + } else { + cache[ id ] = jQuery.extend(cache[ id ], name); + } + } + + thisCache = cache[ id ]; + + // Internal jQuery data is stored in a separate object inside the object's data + // cache in order to avoid key collisions between internal data and user-defined + // data + if ( pvt ) { + if ( !thisCache[ internalKey ] ) { + thisCache[ internalKey ] = {}; + } + + thisCache = thisCache[ internalKey ]; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should + // not attempt to inspect the internal events object using jQuery.data, as this + // internal data object is undocumented and subject to change. + if ( name === "events" && !thisCache[name] ) { + return thisCache[ internalKey ] && thisCache[ internalKey ].events; + } + + return getByName ? + // Check for both converted-to-camel and non-converted data property names + thisCache[ jQuery.camelCase( name ) ] || thisCache[ name ] : + thisCache; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var internalKey = jQuery.expando, isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + var thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; + + if ( thisCache ) { + delete thisCache[ name ]; + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !isEmptyDataObject(thisCache) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( pvt ) { + delete cache[ id ][ internalKey ]; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + var internalCache = cache[ id ][ internalKey ]; + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + if ( jQuery.support.deleteExpando || cache != window ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the entire user cache at once because it's faster than + // iterating through each key, but we need to continue to persist internal + // data if it existed + if ( internalCache ) { + cache[ id ] = {}; + // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery + // metadata on plain JS objects when the object is serialized using + // JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + + cache[ id ][ internalKey ] = internalCache; + + // Otherwise, we need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + } else if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } else { + elem[ jQuery.expando ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 ) { + var attr = this[0].attributes, name; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + var name = "data-" + key.replace( rmultiDash, "$1-$2" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + !jQuery.isNaN( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON +// property to be considered empty objects; this property always exists in +// order to make sure JSON.stringify does not expose internal metadata +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery.data( elem, deferDataKey, undefined, true ); + if ( defer && + ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) && + ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery.data( elem, queueDataKey, undefined, true ) && + !jQuery.data( elem, markDataKey, undefined, true ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.resolve(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = (type || "fx") + "mark"; + jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); + if ( count ) { + jQuery.data( elem, key, count, true ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + if ( elem ) { + type = (type || "fx") + "queue"; + var q = jQuery.data( elem, type, undefined, true ); + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery.data( elem, type, jQuery.makeArray(data), true ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + defer; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift("inprogress"); + } + + fn.call(elem, function() { + jQuery.dequeue(elem, type); + }); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; + type = type || "fx"; + + return this.queue( type, function() { + var elem = this; + setTimeout(function() { + jQuery.dequeue( elem, type ); + }, time ); + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { + count++; + tmp.done( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + rinvalidChar = /\:|^on/, + formHook, boolHook; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = (value || "").split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " "; + for ( var i = 0, l = this.length; i < l; i++ ) { + if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return undefined; + } + + var isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attrFix: { + // Always normalize to ensure hook usage + tabindex: "tabIndex" + }, + + attr: function( elem, name, value, pass ) { + var nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( !("getAttribute" in elem) ) { + return jQuery.prop( elem, name, value ); + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // Normalize the name if needed + if ( notxml ) { + name = jQuery.attrFix[ name ] || name; + + hooks = jQuery.attrHooks[ name ]; + + if ( !hooks ) { + // Use boolHook for boolean attributes + if ( rboolean.test( name ) ) { + + hooks = boolHook; + + // Use formHook for forms and if the name contains certain characters + } else if ( formHook && name !== "className" && + (jQuery.nodeName( elem, "form" ) || rinvalidChar.test( name )) ) { + + hooks = formHook; + } + } + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return undefined; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, name ) { + var propName; + if ( elem.nodeType === 1 ) { + name = jQuery.attrFix[ name ] || name; + + if ( jQuery.support.getSetAttribute ) { + // Use removeAttribute in browsers that support it + elem.removeAttribute( name ); + } else { + jQuery.attr( elem, name, "" ); + elem.removeAttributeNode( elem.getAttributeNode( name ) ); + } + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) { + elem[ propName ] = false; + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabIndex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + }, + // Use the value property for back compat + // Use the formHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( formHook && jQuery.nodeName( elem, "button" ) ) { + return formHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( formHook && jQuery.nodeName( elem, "button" ) ) { + return formHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + var ret, hooks, + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return (elem[ name ] = value); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== undefined ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: {} +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + return jQuery.prop( elem, name ) ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !jQuery.support.getSetAttribute ) { + + // propFix is more comprehensive and contains all fixes + jQuery.attrFix = jQuery.propFix; + + // Use this for any attribute on a form in IE6/7 + formHook = jQuery.attrHooks.name = jQuery.attrHooks.title = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + // Return undefined if nodeValue is empty string + return ret && ret.nodeValue !== "" ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Check form objects in IE (multiple bugs related) + // Only use nodeValue if the attribute node exists on the form + var ret = elem.getAttributeNode( name ); + if ( ret ) { + ret.nodeValue = value; + return value; + } + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return (elem.style.cssText = "" + value); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }); +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0); + } + } + }); +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspaces = / /g, + rescape = /[^\w\s.|`]/g, + fcleanup = function( nm ) { + return nm.replace(rescape, "\\$&"); + }; + +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function( elem, types, handler, data ) { + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } else if ( !handler ) { + // Fixes bug #7229. Fix recommended by jdalton + return; + } + + var handleObjIn, handleObj; + + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure + var elemData = jQuery._data( elem ); + + // If no elemData is found then we must be trying to bind to one of the + // banned noData elements + if ( !elemData ) { + return; + } + + var events = elemData.events, + eventHandle = elemData.handle; + + if ( !events ) { + elemData.events = events = {}; + } + + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.handle.apply( eventHandle.elem, arguments ) : + undefined; + }; + } + + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native events in IE. + eventHandle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = types.split(" "); + + var type, i = 0, namespaces; + + while ( (type = types[ i++ ]) ) { + handleObj = handleObjIn ? + jQuery.extend({}, handleObjIn) : + { handler: handler, data: data }; + + // Namespaced event handlers + if ( type.indexOf(".") > -1 ) { + namespaces = type.split("."); + type = namespaces.shift(); + handleObj.namespace = namespaces.slice(0).sort().join("."); + + } else { + namespaces = []; + handleObj.namespace = ""; + } + + handleObj.type = type; + if ( !handleObj.guid ) { + handleObj.guid = handler.guid; + } + + // Get the current list of functions bound to this event + var handlers = events[ type ], + special = jQuery.event.special[ type ] || {}; + + // Init the event handler queue + if ( !handlers ) { + handlers = events[ type ] = []; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add the function to the element's handler list + handlers.push( handleObj ); + + // Keep track of which events have been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, pos ) { + // don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + if ( handler === false ) { + handler = returnFalse; + } + + var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + events = elemData && elemData.events; + + if ( !elemData || !events ) { + return; + } + + // types is actually an event object here + if ( types && types.type ) { + handler = types.handler; + types = types.type; + } + + // Unbind all events for the element + if ( !types || typeof types === "string" && types.charAt(0) === "." ) { + types = types || ""; + + for ( type in events ) { + jQuery.event.remove( elem, type + types ); + } + + return; + } + + // Handle multiple events separated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + types = types.split(" "); + + while ( (type = types[ i++ ]) ) { + origType = type; + handleObj = null; + all = type.indexOf(".") < 0; + namespaces = []; + + if ( !all ) { + // Namespaced event handlers + namespaces = type.split("."); + type = namespaces.shift(); + + namespace = new RegExp("(^|\\.)" + + jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + eventType = events[ type ]; + + if ( !eventType ) { + continue; + } + + if ( !handler ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( all || namespace.test( handleObj.namespace ) ) { + jQuery.event.remove( elem, origType, handleObj.handler, j ); + eventType.splice( j--, 1 ); + } + } + + continue; + } + + special = jQuery.event.special[ type ] || {}; + + for ( j = pos || 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( handler.guid === handleObj.guid ) { + // remove the given handler for the given type + if ( all || namespace.test( handleObj.namespace ) ) { + if ( pos == null ) { + eventType.splice( j--, 1 ); + } + + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + + if ( pos != null ) { + break; + } + } + } + + // remove generic event handler if no more handlers exist + if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + ret = null; + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + var handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + delete elemData.events; + delete elemData.handle; + + if ( jQuery.isEmptyObject( elemData ) ) { + jQuery.removeData( elem, undefined, true ); + } + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Event object or event type + var type = event.type || event, + namespaces = [], + exclusive; + + if ( type.indexOf("!") >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.exclusive = exclusive; + event.namespace = namespaces.join("."); + event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)"); + + // triggerHandler() and global events don't bubble or run the default action + if ( onlyHandlers || !elem ) { + event.preventDefault(); + event.stopPropagation(); + } + + // Handle a global trigger + if ( !elem ) { + // TODO: Stop taunting the data cache; remove global events and always attach to document + jQuery.each( jQuery.cache, function() { + // internalKey variable is just used to make it easier to find + // and potentially change this stuff later; currently it just + // points to jQuery.expando + var internalKey = jQuery.expando, + internalCache = this[ internalKey ]; + if ( internalCache && internalCache.events && internalCache.events[ type ] ) { + jQuery.event.trigger( event, data, internalCache.handle.elem ); + } + }); + return; + } + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + event.target = elem; + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + var cur = elem, + // IE doesn't like method names with a colon (#3533, #8272) + ontype = type.indexOf(":") < 0 ? "on" + type : ""; + + // Fire event on the current element, then bubble up the DOM tree + do { + var handle = jQuery._data( cur, "handle" ); + + event.currentTarget = cur; + if ( handle ) { + handle.apply( cur, data ); + } + + // Trigger an inline bound script + if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) { + event.result = false; + event.preventDefault(); + } + + // Bubble up to document, then to window + cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window; + } while ( cur && !event.isPropagationStopped() ); + + // If nobody prevented the default action, do it now + if ( !event.isDefaultPrevented() ) { + var old, + special = jQuery.event.special[ type ] || {}; + + if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction)() check here because IE6/7 fails that test. + // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch. + try { + if ( ontype && elem[ type ] ) { + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + jQuery.event.triggered = type; + elem[ type ](); + } + } catch ( ieError ) {} + + if ( old ) { + elem[ ontype ] = old; + } + + jQuery.event.triggered = undefined; + } + } + + return event.result; + }, + + handle: function( event ) { + event = jQuery.event.fix( event || window.event ); + // Snapshot the handlers list since a called handler may add/remove events. + var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0), + run_all = !event.exclusive && !event.namespace, + args = Array.prototype.slice.call( arguments, 0 ); + + // Use the fix-ed Event rather than the (read-only) native event + args[0] = event; + event.currentTarget = this; + + for ( var j = 0, l = handlers.length; j < l; j++ ) { + var handleObj = handlers[ j ]; + + // Triggered event must 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event. + if ( run_all || event.namespace_re.test( handleObj.namespace ) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handleObj.handler; + event.data = handleObj.data; + event.handleObj = handleObj; + + var ret = handleObj.handler.apply( this, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + return event.result; + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ) { + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) { + // Fixes #1925 where srcElement might not be defined either + event.target = event.srcElement || document; + } + + // check if target is a textnode (safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) { + event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; + } + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var eventDocument = event.target.ownerDocument || document, + doc = eventDocument.documentElement, + body = eventDocument.body; + + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); + } + + // Add which for key events + if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { + event.which = event.charCode != null ? event.charCode : event.keyCode; + } + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) { + event.metaKey = event.ctrlKey; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button !== undefined ) { + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + } + + return event; + }, + + // Deprecated, use jQuery.guid instead + guid: 1E8, + + // Deprecated, use jQuery.proxy instead + proxy: jQuery.proxy, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady, + teardown: jQuery.noop + }, + + live: { + add: function( handleObj ) { + jQuery.event.add( this, + liveConvert( handleObj.origType, handleObj.selector ), + jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); + }, + + remove: function( handleObj ) { + jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); + } + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + } +}; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !this.preventDefault ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function( event ) { + + // Check if mouse(over|out) are still within the same parent element + var related = event.relatedTarget, + inside = false, + eventType = event.type; + + event.type = event.data; + + if ( related !== this ) { + + if ( related ) { + inside = jQuery.contains( this, related ); + } + + if ( !inside ) { + + jQuery.event.handle.apply( this, arguments ); + + event.type = eventType; + } + } +}, + +// In case of event delegation, we only need to rename the event.type, +// liveHandler will take care of the rest. +delegate = function( event ) { + event.type = event.data; + jQuery.event.handle.apply( this, arguments ); +}; + +// Create mouseenter and mouseleave events +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + setup: function( data ) { + jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); + }, + teardown: function( data ) { + jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); + } + }; +}); + +// submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function( data, namespaces ) { + if ( !jQuery.nodeName( this, "form" ) ) { + jQuery.event.add(this, "click.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { + trigger( "submit", this, arguments ); + } + }); + + jQuery.event.add(this, "keypress.specialSubmit", function( e ) { + var elem = e.target, + type = elem.type; + + if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { + trigger( "submit", this, arguments ); + } + }); + + } else { + return false; + } + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialSubmit" ); + } + }; + +} + +// change delegation, happens here so we have bind. +if ( !jQuery.support.changeBubbles ) { + + var changeFilters, + + getVal = function( elem ) { + var type = elem.type, val = elem.value; + + if ( type === "radio" || type === "checkbox" ) { + val = elem.checked; + + } else if ( type === "select-multiple" ) { + val = elem.selectedIndex > -1 ? + jQuery.map( elem.options, function( elem ) { + return elem.selected; + }).join("-") : + ""; + + } else if ( jQuery.nodeName( elem, "select" ) ) { + val = elem.selectedIndex; + } + + return val; + }, + + testChange = function testChange( e ) { + var elem = e.target, data, val; + + if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { + return; + } + + data = jQuery._data( elem, "_change_data" ); + val = getVal(elem); + + // the current data will be also retrieved by beforeactivate + if ( e.type !== "focusout" || elem.type !== "radio" ) { + jQuery._data( elem, "_change_data", val ); + } + + if ( data === undefined || val === data ) { + return; + } + + if ( data != null || val ) { + e.type = "change"; + e.liveFired = undefined; + jQuery.event.trigger( e, arguments[1], elem ); + } + }; + + jQuery.event.special.change = { + filters: { + focusout: testChange, + + beforedeactivate: testChange, + + click: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) { + testChange.call( this, e ); + } + }, + + // Change has to be called before submit + // Keydown will be called before keypress, which is used in submit-event delegation + keydown: function( e ) { + var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; + + if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) || + (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || + type === "select-multiple" ) { + testChange.call( this, e ); + } + }, + + // Beforeactivate happens also before the previous element is blurred + // with this event you can't trigger a change event, but you can store + // information + beforeactivate: function( e ) { + var elem = e.target; + jQuery._data( elem, "_change_data", getVal(elem) ); + } + }, + + setup: function( data, namespaces ) { + if ( this.type === "file" ) { + return false; + } + + for ( var type in changeFilters ) { + jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); + } + + return rformElems.test( this.nodeName ); + }, + + teardown: function( namespaces ) { + jQuery.event.remove( this, ".specialChange" ); + + return rformElems.test( this.nodeName ); + } + }; + + changeFilters = jQuery.event.special.change.filters; + + // Handle when the input is .focus()'d + changeFilters.focus = changeFilters.beforeactivate; +} + +function trigger( type, elem, args ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + // Don't pass args or remember liveFired; they apply to the donor event. + var event = jQuery.extend( {}, args[ 0 ] ); + event.type = type; + event.originalEvent = {}; + event.liveFired = undefined; + jQuery.event.handle.call( elem, event ); + if ( event.isDefaultPrevented() ) { + args[ 0 ].preventDefault(); + } +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + + function handler( donor ) { + // Donor event is always a native one; fix it and switch its type. + // Let focusin/out handler cancel the donor focus/blur event. + var e = jQuery.event.fix( donor ); + e.type = fix; + e.originalEvent = {}; + jQuery.event.trigger( e, null, e.target ); + if ( e.isDefaultPrevented() ) { + donor.preventDefault(); + } + } + }); +} + +jQuery.each(["bind", "one"], function( i, name ) { + jQuery.fn[ name ] = function( type, data, fn ) { + var handler; + + // Handle object literals + if ( typeof type === "object" ) { + for ( var key in type ) { + this[ name ](key, data, type[key], fn); + } + return this; + } + + if ( arguments.length === 2 || data === false ) { + fn = data; + data = undefined; + } + + if ( name === "one" ) { + handler = function( event ) { + jQuery( this ).unbind( event, handler ); + return fn.apply( this, arguments ); + }; + handler.guid = fn.guid || jQuery.guid++; + } else { + handler = fn; + } + + if ( type === "unload" && name !== "one" ) { + this.one( type, data, fn ); + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.add( this[i], type, handler, data ); + } + } + + return this; + }; +}); + +jQuery.fn.extend({ + unbind: function( type, fn ) { + // Handle object literals + if ( typeof type === "object" && !type.preventDefault ) { + for ( var key in type ) { + this.unbind(key, type[key]); + } + + } else { + for ( var i = 0, l = this.length; i < l; i++ ) { + jQuery.event.remove( this[i], type, fn ); + } + } + + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.live( types, data, fn, selector ); + }, + + undelegate: function( selector, types, fn ) { + if ( arguments.length === 0 ) { + return this.unbind( "live" ); + + } else { + return this.die( types, null, fn, selector ); + } + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +var liveMap = { + focus: "focusin", + blur: "focusout", + mouseenter: "mouseover", + mouseleave: "mouseout" +}; + +jQuery.each(["live", "die"], function( i, name ) { + jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { + var type, i = 0, match, namespaces, preType, + selector = origSelector || this.selector, + context = origSelector ? this : jQuery( this.context ); + + if ( typeof types === "object" && !types.preventDefault ) { + for ( var key in types ) { + context[ name ]( key, data, types[key], selector ); + } + + return this; + } + + if ( name === "die" && !types && + origSelector && origSelector.charAt(0) === "." ) { + + context.unbind( origSelector ); + + return this; + } + + if ( data === false || jQuery.isFunction( data ) ) { + fn = data || returnFalse; + data = undefined; + } + + types = (types || "").split(" "); + + while ( (type = types[ i++ ]) != null ) { + match = rnamespaces.exec( type ); + namespaces = ""; + + if ( match ) { + namespaces = match[0]; + type = type.replace( rnamespaces, "" ); + } + + if ( type === "hover" ) { + types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); + continue; + } + + preType = type; + + if ( liveMap[ type ] ) { + types.push( liveMap[ type ] + namespaces ); + type = type + namespaces; + + } else { + type = (liveMap[ type ] || type) + namespaces; + } + + if ( name === "live" ) { + // bind live handler + for ( var j = 0, l = context.length; j < l; j++ ) { + jQuery.event.add( context[j], "live." + liveConvert( type, selector ), + { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); + } + + } else { + // unbind live handler + context.unbind( "live." + liveConvert( type, selector ), fn ); + } + } + + return this; + }; +}); + +function liveHandler( event ) { + var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, + elems = [], + selectors = [], + events = jQuery._data( this, "events" ); + + // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) + if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { + return; + } + + if ( event.namespace ) { + namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); + } + + event.liveFired = this; + + var live = events.live.slice(0); + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { + selectors.push( handleObj.selector ); + + } else { + live.splice( j--, 1 ); + } + } + + match = jQuery( event.target ).closest( selectors, event.currentTarget ); + + for ( i = 0, l = match.length; i < l; i++ ) { + close = match[i]; + + for ( j = 0; j < live.length; j++ ) { + handleObj = live[j]; + + if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { + elem = close.elem; + related = null; + + // Those two events require additional checking + if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { + event.type = handleObj.preType; + related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; + + // Make sure not to accidentally match a child element with the same selector + if ( related && jQuery.contains( elem, related ) ) { + related = elem; + } + } + + if ( !related || related !== elem ) { + elems.push({ elem: elem, handleObj: handleObj, level: close.level }); + } + } + } + } + + for ( i = 0, l = elems.length; i < l; i++ ) { + match = elems[i]; + + if ( maxLevel && match.level > maxLevel ) { + break; + } + + event.currentTarget = match.elem; + event.data = match.handleObj.data; + event.handleObj = match.handleObj; + + ret = match.handleObj.origHandler.apply( match.elem, arguments ); + + if ( ret === false || event.isPropagationStopped() ) { + maxLevel = match.level; + + if ( ret === false ) { + stop = false; + } + if ( event.isImmediatePropagationStopped() ) { + break; + } + } + } + + return stop; +} + +function liveConvert( type, selector ) { + return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&"); +} + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var match, + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + var left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + var found, item, + filter = Expr.filter[ type ], + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + var first = match[2], + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Utility function for retreiving the text value of an array of DOM nodes +Sizzle.getText = function( elems ) { + var ret = "", elem; + + for ( var i = 0; elems[i]; i++ ) { + elem = elems[i]; + + // Get the text from text nodes and CDATA nodes + if ( elem.nodeType === 3 || elem.nodeType === 4 ) { + ret += elem.nodeValue; + + // Traverse everything else, except comment nodes + } else if ( elem.nodeType !== 8 ) { + ret += Sizzle.getText( elem.childNodes ); + } + } + + return ret; +}; + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( typeof selector === "string" ? + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array + if ( jQuery.isArray( selectors ) ) { + var match, selector, + matches = {}, + level = 1; + + if ( cur && selectors.length ) { + for ( i = 0, l = selectors.length; i < l; i++ ) { + selector = selectors[i]; + + if ( !matches[ selector ] ) { + matches[ selector ] = POS.test( selector ) ? + jQuery( selector, context || this.context ) : + selector; + } + } + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( selector in matches ) { + match = matches[ selector ]; + + if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) { + ret.push({ selector: selector, elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + if ( !elem || typeof elem === "string" ) { + return jQuery.inArray( this[0], + // If it receives a string, the selector is used + // If it receives nothing, the siblings are used + elem ? jQuery( elem ) : this.parent().children() ); + } + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ), + // The variable 'args' was introduced in + // https://github.com/jquery/jquery/commit/52a0238 + // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. + // http://code.google.com/p/v8/issues/detail?id=1050 + args = slice.call(arguments); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, args.join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return (elem === qualifier) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return (jQuery.inArray( elem, qualifier ) >= 0) === keep; + }); +} + + + + +var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnocache = /<(?:script|object|embed|option|style)/i, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }; + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnocache.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + // Make sure that we do not leak memory by inadvertently discarding + // the original fragment (which might have attached data) instead of + // using it; in addition, use the original fragment object for the last + // item instead of first because it can end up being emptied incorrectly + // in certain situations (Bug #8070). + // Fragments from the fragment cache must always be cloned and never used + // in place. + results.cacheable || (l > 1 && i < lastIndex) ? + jQuery.clone( fragment, true, true ) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var internalKey = jQuery.expando, + oldData = jQuery.data( src ), + curData = jQuery.data( dest, oldData ); + + // Switch to use the internal data object, if it exists, for the next + // stage of data copying + if ( (oldData = oldData[ internalKey ]) ) { + var events = oldData.events; + curData = curData[ internalKey ] = jQuery.extend({}, oldData); + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( var type in events ) { + for ( var i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); + } + } + } + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 fail to clone children inside object elements that use + // the proprietary classid attribute value (rather than the type + // attribute) to identify the type of content to display + if ( nodeName === "object" ) { + dest.outerHTML = src.outerHTML; + + } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + if ( src.checked ) { + dest.defaultChecked = dest.checked = src.checked; + } + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, doc; + + // nodes may contain either an explicit document object, + // a jQuery collection or context object. + // If nodes[0] contains a valid object to assign to doc + if ( nodes && nodes[0] ) { + doc = nodes[0].ownerDocument || nodes[0]; + } + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( !doc.createDocumentFragment ) { + doc = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document && + args[0].charAt(0) === "<" && !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) { + + cacheable = true; + + cacheresults = jQuery.fragments[ args[0] ]; + if ( cacheresults && cacheresults !== 1 ) { + fragment = cacheresults; + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( "getElementsByTagName" in elem ) { + return elem.getElementsByTagName( "*" ); + + } else if ( "querySelectorAll" in elem ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( elem.type === "checkbox" || elem.type === "radio" ) { + elem.defaultChecked = elem.checked; + } +} +// Finds all inputs and passes them to fixDefaultChecked +function findInputs( elem ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( "getElementsByTagName" in elem ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var clone = elem.cloneNode(true), + srcElements, + destElements, + i; + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName + // instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var checkScriptType; + + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = [], j; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + } + + // Resets defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + var len; + if ( !jQuery.support.appendChecked ) { + if ( elem[0] && typeof (len = elem.length) === "number" ) { + for ( j = 0; j < len; j++ ) { + findInputs( elem[j] ); + } + } else { + findInputs( elem ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + checkScriptType = function( elem ) { + return !elem.type || rscriptType.test( elem.type ); + }; + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType ); + + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, cache = jQuery.cache, internalKey = jQuery.expando, special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ] && cache[ id ][ internalKey ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + + // Null the DOM reference to avoid IE6/7/8 leak (#7054) + if ( data.handle ) { + data.handle.elem = null; + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + // fixed for IE9, see #8346 + rupper = /([A-Z]|^ms)/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + rrelNum = /^[+\-]=/, + rrelNumFilter = /[^+\-\.\de]+/g, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Make sure that NaN and null values aren't set. See: #7116 + if ( type === "number" && isNaN( value ) || value == null ) { + return; + } + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && rrelNum.test( value ) ) { + value = +value.replace( rrelNumFilter, "" ) + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + var ret, hooks; + + // Make sure that we're working with the right name + name = jQuery.camelCase( name ); + hooks = jQuery.cssHooks[ name ]; + name = jQuery.cssProps[ name ] || name; + + // cssFloat needs a special treatment + if ( name === "cssFloat" ) { + name = "float"; + } + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + return getWH( elem, name, extra ); + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + return val; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat( value ); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( parseFloat( RegExp.$1 ) / 100 ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // Set the alpha filter to set the opacity + var opacity = jQuery.isNaN( value ) ? + "" : + "alpha(opacity=" + value * 100 + ")", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +jQuery(function() { + // This hook cannot be added until DOM ready because the support test + // for it is not run until after DOM ready + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + var ret; + jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + ret = curCSS( elem, "margin-right", "marginRight" ); + } else { + ret = elem.style.marginRight; + } + }); + return ret; + } + }; + } +}); + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, + ret = elem.currentStyle && elem.currentStyle[ name ], + rsLeft = elem.runtimeStyle && elem.runtimeStyle[ name ], + style = elem.style; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + // Remember the original values + left = style.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : (ret || 0); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + + // Start with offset property + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + which = name === "width" ? cssWidth : cssHeight; + + if ( val > 0 ) { + if ( extra !== "border" ) { + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } else { + val -= parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + }); + } + + return val + "px"; + } + + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ] || 0; + } + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + + // Add padding, border, margin + if ( extra ) { + jQuery.each( which, function() { + val += parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + if ( extra !== "padding" ) { + val += parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } + }); + } + + return val + "px"; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return (width === 0 && height === 0) || (!jQuery.support.reliableHiddenOffsets && (elem.style.display || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + rinput = /^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rspacesAjax = /\s+/, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Document location + ajaxLocation, + + // Document location segments + ajaxLocParts; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + if ( jQuery.isFunction( func ) ) { + var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), + i = 0, + length = dataTypes.length, + dataType, + list, + placeBefore; + + // For each dataType in the dataTypeExpression + for(; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ), + selection; + + for(; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf( " " ); + if ( off >= 0 ) { + var selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + // Complete callback (responseText is used internally) + complete: function( jqXHR, status, responseText ) { + // Store the response as specified by the jqXHR object + responseText = jqXHR.responseText; + // If successful, inject the HTML into all the matched elements + if ( jqXHR.isResolved() ) { + // #4825: Get the actual response in case + // a dataFilter is present in ajaxSettings + jqXHR.done(function( r ) { + responseText = r; + }); + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + responseText ); + } + + if ( callback ) { + self.each( callback, [ responseText, status, jqXHR ] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.bind( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function ( target, settings ) { + if ( !settings ) { + // Only one parameter, we extend ajaxSettings + settings = target; + target = jQuery.extend( true, jQuery.ajaxSettings, settings ); + } else { + // target was provided, we extend into it + jQuery.extend( true, target, jQuery.ajaxSettings, settings ); + } + // Flatten fields we don't want deep extended + for( var field in { context: 1, url: 1 } ) { + if ( field in settings ) { + target[ field ] = settings[ field ]; + } else if( field in jQuery.ajaxSettings ) { + target[ field ] = jQuery.ajaxSettings[ field ]; + } + } + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": "*/*" + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery._Deferred(), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // ifModified key + ifModifiedKey, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // The jqXHR state + state = 0, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || "abort"; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, statusText, responses, headers ) { + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status ? 4 : 0; + + var isSuccess, + success, + error, + response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, + lastModified, + etag; + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { + jQuery.lastModified[ ifModifiedKey ] = lastModified; + } + if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { + jQuery.etag[ ifModifiedKey ] = etag; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + try { + success = ajaxConvert( s, response ); + statusText = "success"; + isSuccess = true; + } catch(e) { + // We have a parsererror + statusText = "parsererror"; + error = e; + } + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = statusText; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.resolveWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.done; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.then( tmp, tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefiler, stop there + if ( state === 2 ) { + return false; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( (ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", */*; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already + jqXHR.abort(); + return false; + + } + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( status < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + jQuery.error( e ); + } + } + } + + return jqXHR; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : value; + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + // Serialize object item. + for ( var name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields, + ct, + type, + finalDataType, + firstDataType; + + // Fill responseXXX fields + for( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + var dataTypes = s.dataTypes, + converters = {}, + i, + key, + length = dataTypes.length, + tmp, + // Current and previous dataTypes + current = dataTypes[ 0 ], + prev, + // Conversion expression + conversion, + // Conversion function + conv, + // Conversion functions (transitive conversion) + conv1, + conv2; + + // For each dataType in the chain + for( i = 1; i < length; i++ ) { + + // Create converters map + // with lowercased keys + if ( i === 1 ) { + for( key in s.converters ) { + if( typeof key === "string" ) { + converters[ key.toLowerCase() ] = s.converters[ key ]; + } + } + } + + // Get the dataTypes + prev = current; + current = dataTypes[ i ]; + + // If current is auto dataType, update it to prev + if( current === "*" ) { + current = prev; + // If no auto and dataTypes are actually different + } else if ( prev !== "*" && prev !== current ) { + + // Get the converter + conversion = prev + " " + current; + conv = converters[ conversion ] || converters[ "* " + current ]; + + // If there is no direct converter, search transitively + if ( !conv ) { + conv2 = undefined; + for( conv1 in converters ) { + tmp = conv1.split( " " ); + if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { + conv2 = converters[ tmp[1] + " " + current ]; + if ( conv2 ) { + conv1 = converters[ conv1 ]; + if ( conv1 === true ) { + conv = conv2; + } else if ( conv2 === true ) { + conv = conv1; + } + break; + } + } + } + } + // If we found no converter, dispatch an error + if ( !( conv || conv2 ) ) { + jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); + } + // If found converter is not an equivalence + if ( conv !== true ) { + // Convert with 1 or 2 converters accordingly + response = conv ? conv( response ) : conv2( conv1(response) ); + } + } + } + return response; +} + + + + +var jsc = jQuery.now(), + jsre = /(\=)\?(&|$)|\?\?/i; + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + return jQuery.expando + "_" + ( jsc++ ); + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var inspectData = s.contentType === "application/x-www-form-urlencoded" && + ( typeof s.data === "string" ); + + if ( s.dataTypes[ 0 ] === "jsonp" || + s.jsonp !== false && ( jsre.test( s.url ) || + inspectData && jsre.test( s.data ) ) ) { + + var responseContainer, + jsonpCallback = s.jsonpCallback = + jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, + previous = window[ jsonpCallback ], + url = s.url, + data = s.data, + replace = "$1" + jsonpCallback + "$2"; + + if ( s.jsonp !== false ) { + url = url.replace( jsre, replace ); + if ( s.url === url ) { + if ( inspectData ) { + data = data.replace( jsre, replace ); + } + if ( s.data === data ) { + // Add callback manually + url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; + } + } + } + + s.url = url; + s.data = data; + + // Install callback + window[ jsonpCallback ] = function( response ) { + responseContainer = [ response ]; + }; + + // Clean-up function + jqXHR.always(function() { + // Set callback back to previous value + window[ jsonpCallback ] = previous; + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( previous ) ) { + window[ jsonpCallback ]( responseContainer[ 0 ] ); + } + }); + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( jsonpCallback + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Delegate to script + return "script"; + } +}); + + + + +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); + + + + +var // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0, + xhrCallbacks; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var xhr = s.xhr(), + handle, + i; + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occured + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + responses.text = xhr.responseText; + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + // if we're in sync mode or it's in cache + // and has been retrieved directly (IE6 & IE7) + // we need to manually fire the callback + if ( !s.async || xhr.readyState === 4 ) { + callback(); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} + + + + +var elemdisplay = {}, + iframe, iframeDoc, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ], + fxNow, + requestAnimationFrame = window.webkitRequestAnimationFrame || + window.mozRequestAnimationFrame || + window.oRequestAnimationFrame; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[i]; + + if ( elem.style ) { + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css( elem, "display" ) === "none" ) { + jQuery._data(elem, "olddisplay", defaultDisplay(elem.nodeName)); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[i]; + + if ( elem.style ) { + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery._data(elem, "olddisplay") || ""; + } + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + if ( this[i].style ) { + var display = jQuery.css( this[i], "display" ); + + if ( display !== "none" && !jQuery._data( this[i], "olddisplay" ) ) { + jQuery._data( this[i], "olddisplay", display ); + } + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + if ( this[i].style ) { + this[i].style.display = "none"; + } + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete, [ false ] ); + } + + // Do not change referenced properties as per-property easing will be lost + prop = jQuery.extend( {}, prop ); + + return this[ optall.queue === false ? "each" : "queue" ](function() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + if ( optall.queue === false ) { + jQuery._mark( this ); + } + + var opt = jQuery.extend( {}, optall ), + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + name, val, p, + display, e, + parts, start, end, unit; + + // will store per property easing and be used to determine when an animation is complete + opt.animatedProperties = {}; + + for ( p in prop ) { + + // property name normalization + name = jQuery.camelCase( p ); + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + } + + val = prop[ name ]; + + // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) + if ( jQuery.isArray( val ) ) { + opt.animatedProperties[ name ] = val[ 1 ]; + val = prop[ name ] = val[ 0 ]; + } else { + opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; + } + + if ( val === "hide" && hidden || val === "show" && !hidden ) { + return opt.complete.call( this ); + } + + if ( isElement && ( name === "height" || name === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height + // animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + if ( !jQuery.support.inlineBlockNeedsLayout ) { + this.style.display = "inline-block"; + + } else { + display = defaultDisplay( this.nodeName ); + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( display === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.display = "inline"; + this.style.zoom = 1; + } + } + } + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + for ( p in prop ) { + e = new jQuery.fx( this, opt, p ); + val = prop[ p ]; + + if ( rfxtypes.test(val) ) { + e[ val === "toggle" ? hidden ? "show" : "hide" : val ](); + + } else { + parts = rfxnum.exec( val ); + start = e.cur(); + + if ( parts ) { + end = parseFloat( parts[2] ); + unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( this, p, (end || 1) + unit); + start = ((end || 1) / e.cur()) * start; + jQuery.style( this, p, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + } + + // For JS strict compliance + return true; + }); + }, + + stop: function( clearQueue, gotoEnd ) { + if ( clearQueue ) { + this.queue([]); + } + + this.each(function() { + var timers = jQuery.timers, + i = timers.length; + // clear marker counters if we know they won't be + if ( !gotoEnd ) { + jQuery._unmark( true, this ); + } + while ( i-- ) { + if ( timers[i].elem === this ) { + if (gotoEnd) { + // force the next step to be the last + timers[i](true); + } + + timers.splice(i, 1); + } + } + }); + + // start the next in the queue if the last step wasn't forced + if ( !gotoEnd ) { + this.dequeue(); + } + + return this; + } + +}); + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout( clearFxNow, 0 ); + return ( fxNow = jQuery.now() ); +} + +function clearFxNow() { + fxNow = undefined; +} + +// Generate parameters to create a standard animation +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend({}, speed) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[opt.duration] : jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function( noUnmark ) { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue !== false ) { + jQuery.dequeue( this ); + } else if ( noUnmark !== false ) { + jQuery._unmark( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + options.orig = options.orig || {}; + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) { + return this.elem[ this.prop ]; + } + + var parsed, + r = jQuery.css( this.elem, this.prop ); + // Empty strings, null, undefined and "auto" are converted to 0, + // complex values such as "rotate(1rad)" are returned as is, + // simple values such as "10px" are parsed to Float. + return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx, + raf; + + this.startTime = fxNow || createFxNow(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + this.now = this.start; + this.pos = this.state = 0; + + function t( gotoEnd ) { + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + // Use requestAnimationFrame instead of setInterval if available + if ( requestAnimationFrame ) { + timerId = true; + raf = function() { + // When timerId gets set to null at any point, this stops + if ( timerId ) { + requestAnimationFrame( raf ); + fx.tick(); + } + }; + requestAnimationFrame( raf ); + } else { + timerId = setInterval( fx.tick, fx.interval ); + } + } + }, + + // Simple 'show' function + show: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var t = fxNow || createFxNow(), + done = true, + elem = this.elem, + options = this.options, + i, n; + + if ( gotoEnd || t >= options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + options.animatedProperties[ this.prop ] = true; + + for ( i in options.animatedProperties ) { + if ( options.animatedProperties[i] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + + jQuery.each( [ "", "X", "Y" ], function (index, value) { + elem.style[ "overflow" + value ] = options.overflow[index]; + }); + } + + // Hide the element if the "hide" operation was done + if ( options.hide ) { + jQuery(elem).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( options.hide || options.show ) { + for ( var p in options.animatedProperties ) { + jQuery.style( elem, p, options.orig[p] ); + } + } + + // Execute the complete function + options.complete.call( elem ); + } + + return false; + + } else { + // classical easing cannot be used with an Infinity duration + if ( options.duration == Infinity ) { + this.now = t; + } else { + n = t - this.startTime; + this.state = n / options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[ options.animatedProperties[ this.prop ] ]( this.state, n, 0, 1, options.duration ); + this.now = this.start + ((this.end - this.start) * this.pos); + } + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + for ( var timers = jQuery.timers, i = 0 ; i < timers.length ; ++i ) { + if ( !timers[i]() ) { + timers.splice(i--, 1); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +// Try to restore the default display value of an element +function defaultDisplay( nodeName ) { + + if ( !elemdisplay[ nodeName ] ) { + + var body = document.body, + elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), + display = elem.css( "display" ); + + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // No iframe to use yet, so create it + if ( !iframe ) { + iframe = document.createElement( "iframe" ); + iframe.frameBorder = iframe.width = iframe.height = 0; + } + + body.appendChild( iframe ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" ); + iframeDoc.close(); + } + + elem = iframeDoc.createElement( nodeName ); + + iframeDoc.body.appendChild( elem ); + + display = jQuery.css( elem, "display" ); + + body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, + scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + jQuery.offset.initialize(); + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + initialize: function() { + var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.css(body, "marginTop") ) || 0, + html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>"; + + jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } ); + + container.innerHTML = html; + body.insertBefore( container, body.firstChild ); + innerDiv = container.firstChild; + checkDiv = innerDiv.firstChild; + td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + checkDiv.style.position = "fixed"; + checkDiv.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15); + checkDiv.style.position = checkDiv.style.top = ""; + + innerDiv.style.overflow = "hidden"; + innerDiv.style.position = "relative"; + + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop); + + body.removeChild( container ); + jQuery.offset.initialize = jQuery.noop; + }, + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + jQuery.offset.initialize(); + + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = (position === "absolute" || position === "fixed") && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if (options.top != null) { + props.top = (options.top - curOffset.top) + curTop; + } + if (options.left != null) { + props.left = (options.left - curOffset.left) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function( val ) { + var elem, win; + + if ( val === undefined ) { + elem = this[ 0 ]; + + if ( !elem ) { + return null; + } + + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery( win ).scrollLeft(), + i ? val : jQuery( win ).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn[ "inner" + name ] = function() { + var elem = this[0]; + return elem && elem.style ? + parseFloat( jQuery.css( elem, type, "padding" ) ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn[ "outer" + name ] = function( margin ) { + var elem = this[0]; + return elem && elem.style ? + parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat + var docElemProp = elem.document.documentElement[ "client" + name ]; + return elem.document.compatMode === "CSS1Compat" && docElemProp || + elem.document.body[ "client" + name ] || docElemProp; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNaN( ret ) ? orig : ret; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; +})(window); diff --git a/lib/scripts/jquery/jquery.min.js b/lib/scripts/jquery/jquery.min.js new file mode 100644 index 000000000..48590ecb9 --- /dev/null +++ b/lib/scripts/jquery/jquery.min.js @@ -0,0 +1,18 @@ +/*! + * jQuery JavaScript Library v1.6.2 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Jun 30 14:16:56 2011 -0400 + */ +(function(a,b){function cv(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cs(a){if(!cg[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){ch||(ch=c.createElement("iframe"),ch.frameBorder=ch.width=ch.height=0),b.appendChild(ch);if(!ci||!ch.createElement)ci=(ch.contentWindow||ch.contentDocument).document,ci.write((c.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>"),ci.close();d=ci.createElement(a),ci.body.appendChild(d),e=f.css(d,"display"),b.removeChild(ch)}cg[a]=e}return cg[a]}function cr(a,b){var c={};f.each(cm.concat.apply([],cm.slice(0,b)),function(){c[this]=a});return c}function cq(){cn=b}function cp(){setTimeout(cq,0);return cn=f.now()}function cf(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ce(){try{return new a.XMLHttpRequest}catch(b){}}function b$(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g<i;g++){if(g===1)for(h in a.converters)typeof h=="string"&&(e[h.toLowerCase()]=a.converters[h]);l=k,k=d[g];if(k==="*")k=l;else if(l!=="*"&&l!==k){m=l+" "+k,n=e[m]||e["* "+k];if(!n){p=b;for(o in e){j=o.split(" ");if(j[0]===l||j[0]==="*"){p=e[j[1]+" "+k];if(p){o=e[o],o===!0?n=p:p===!0&&(n=o);break}}}}!n&&!p&&f.error("No conversion from "+m.replace(" "," to ")),n!==!0&&(c=n?n(c):p(o(c)))}}return c}function bZ(a,c,d){var e=a.contents,f=a.dataTypes,g=a.responseFields,h,i,j,k;for(i in g)i in d&&(c[g[i]]=d[i]);while(f[0]==="*")f.shift(),h===b&&(h=a.mimeType||c.getResponseHeader("content-type"));if(h)for(i in e)if(e[i]&&e[i].test(h)){f.unshift(i);break}if(f[0]in d)j=f[0];else{for(i in d){if(!f[0]||a.converters[i+" "+f[0]]){j=i;break}k||(k=i)}j=j||k}if(j){j!==f[0]&&f.unshift(j);return d[j]}}function bY(a,b,c,d){if(f.isArray(b))f.each(b,function(b,e){c||bC.test(a)?d(a,e):bY(a+"["+(typeof e=="object"||f.isArray(e)?b:"")+"]",e,c,d)});else if(!c&&b!=null&&typeof b=="object")for(var e in b)bY(a+"["+e+"]",b[e],c,d);else d(a,b)}function bX(a,c,d,e,f,g){f=f||c.dataTypes[0],g=g||{},g[f]=!0;var h=a[f],i=0,j=h?h.length:0,k=a===bR,l;for(;i<j&&(k||!l);i++)l=h[i](c,d,e),typeof l=="string"&&(!k||g[l]?l=b:(c.dataTypes.unshift(l),l=bX(a,c,d,e,l,g)));(k||!l)&&!g["*"]&&(l=bX(a,c,d,e,"*",g));return l}function bW(a){return function(b,c){typeof b!="string"&&(c=b,b="*");if(f.isFunction(c)){var d=b.toLowerCase().split(bN),e=0,g=d.length,h,i,j;for(;e<g;e++)h=d[e],j=/^\+/.test(h),j&&(h=h.substr(1)||"*"),i=a[h]=a[h]||[],i[j?"unshift":"push"](c)}}}function bA(a,b,c){var d=b==="width"?a.offsetWidth:a.offsetHeight,e=b==="width"?bv:bw;if(d>0){c!=="border"&&f.each(e,function(){c||(d-=parseFloat(f.css(a,"padding"+this))||0),c==="margin"?d+=parseFloat(f.css(a,c+this))||0:d-=parseFloat(f.css(a,"border"+this+"Width"))||0});return d+"px"}d=bx(a,b,b);if(d<0||d==null)d=a.style[b]||0;d=parseFloat(d)||0,c&&f.each(e,function(){d+=parseFloat(f.css(a,"padding"+this))||0,c!=="padding"&&(d+=parseFloat(f.css(a,"border"+this+"Width"))||0),c==="margin"&&(d+=parseFloat(f.css(a,c+this))||0)});return d+"px"}function bm(a,b){b.src?f.ajax({url:b.src,async:!1,dataType:"script"}):f.globalEval((b.text||b.textContent||b.innerHTML||"").replace(be,"/*$0*/")),b.parentNode&&b.parentNode.removeChild(b)}function bl(a){f.nodeName(a,"input")?bk(a):"getElementsByTagName"in a&&f.grep(a.getElementsByTagName("input"),bk)}function bk(a){if(a.type==="checkbox"||a.type==="radio")a.defaultChecked=a.checked}function bj(a){return"getElementsByTagName"in a?a.getElementsByTagName("*"):"querySelectorAll"in a?a.querySelectorAll("*"):[]}function bi(a,b){var c;if(b.nodeType===1){b.clearAttributes&&b.clearAttributes(),b.mergeAttributes&&b.mergeAttributes(a),c=b.nodeName.toLowerCase();if(c==="object")b.outerHTML=a.outerHTML;else if(c!=="input"||a.type!=="checkbox"&&a.type!=="radio"){if(c==="option")b.selected=a.defaultSelected;else if(c==="input"||c==="textarea")b.defaultValue=a.defaultValue}else a.checked&&(b.defaultChecked=b.checked=a.checked),b.value!==a.value&&(b.value=a.value);b.removeAttribute(f.expando)}}function bh(a,b){if(b.nodeType===1&&!!f.hasData(a)){var c=f.expando,d=f.data(a),e=f.data(b,d);if(d=d[c]){var g=d.events;e=e[c]=f.extend({},d);if(g){delete e.handle,e.events={};for(var h in g)for(var i=0,j=g[h].length;i<j;i++)f.event.add(b,h+(g[h][i].namespace?".":"")+g[h][i].namespace,g[h][i],g[h][i].data)}}}}function bg(a,b){return f.nodeName(a,"table")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function W(a,b,c){b=b||0;if(f.isFunction(b))return f.grep(a,function(a,d){var e=!!b.call(a,d,a);return e===c});if(b.nodeType)return f.grep(a,function(a,d){return a===b===c});if(typeof b=="string"){var d=f.grep(a,function(a){return a.nodeType===1});if(R.test(b))return f.filter(b,d,!c);b=f.filter(b,d)}return f.grep(a,function(a,d){return f.inArray(a,b)>=0===c})}function V(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function N(a,b){return(a&&a!=="*"?a+".":"")+b.replace(z,"`").replace(A,"&")}function M(a){var b,c,d,e,g,h,i,j,k,l,m,n,o,p=[],q=[],r=f._data(this,"events");if(!(a.liveFired===this||!r||!r.live||a.target.disabled||a.button&&a.type==="click")){a.namespace&&(n=new RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)")),a.liveFired=this;var s=r.live.slice(0);for(i=0;i<s.length;i++)g=s[i],g.origType.replace(x,"")===a.type?q.push(g.selector):s.splice(i--,1);e=f(a.target).closest(q,a.currentTarget);for(j=0,k=e.length;j<k;j++){m=e[j];for(i=0;i<s.length;i++){g=s[i];if(m.selector===g.selector&&(!n||n.test(g.namespace))&&!m.elem.disabled){h=m.elem,d=null;if(g.preType==="mouseenter"||g.preType==="mouseleave")a.type=g.preType,d=f(a.relatedTarget).closest(g.selector)[0],d&&f.contains(h,d)&&(d=h);(!d||d!==h)&&p.push({elem:h,handleObj:g,level:m.level})}}}for(j=0,k=p.length;j<k;j++){e=p[j];if(c&&e.level>c)break;a.currentTarget=e.elem,a.data=e.handleObj.data,a.handleObj=e.handleObj,o=e.handleObj.origHandler.apply(e.elem,arguments);if(o===!1||a.isPropagationStopped()){c=e.level,o===!1&&(b=!1);if(a.isImmediatePropagationStopped())break}}return b}}function K(a,c,d){var e=f.extend({},d[0]);e.type=a,e.originalEvent={},e.liveFired=b,f.event.handle.call(c,e),e.isDefaultPrevented()&&d[0].preventDefault()}function E(){return!0}function D(){return!1}function m(a,c,d){var e=c+"defer",g=c+"queue",h=c+"mark",i=f.data(a,e,b,!0);i&&(d==="queue"||!f.data(a,g,b,!0))&&(d==="mark"||!f.data(a,h,b,!0))&&setTimeout(function(){!f.data(a,g,b,!0)&&!f.data(a,h,b,!0)&&(f.removeData(a,e,!0),i.resolve())},0)}function l(a){for(var b in a)if(b!=="toJSON")return!1;return!0}function k(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(j,"$1-$2").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNaN(d)?i.test(d)?f.parseJSON(d):d:parseFloat(d)}catch(g){}f.data(a,c,d)}else d=b}return d}var c=a.document,d=a.navigator,e=a.location,f=function(){function J(){if(!e.isReady){try{c.documentElement.doScroll("left")}catch(a){setTimeout(J,1);return}e.ready()}}var e=function(a,b){return new e.fn.init(a,b,h)},f=a.jQuery,g=a.$,h,i=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/\d/,n=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,o=/^[\],:{}\s]*$/,p=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,q=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,r=/(?:^|:|,)(?:\s*\[)+/g,s=/(webkit)[ \/]([\w.]+)/,t=/(opera)(?:.*version)?[ \/]([\w.]+)/,u=/(msie) ([\w.]+)/,v=/(mozilla)(?:.*? rv:([\w.]+))?/,w=/-([a-z])/ig,x=function(a,b){return b.toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=n.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.6.2",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.done(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j<k;j++)if((a=arguments[j])!=null)for(c in a){d=i[c],f=a[c];if(i===f)continue;l&&f&&(e.isPlainObject(f)||(g=e.isArray(f)))?(g?(g=!1,h=d&&e.isArray(d)?d:[]):h=d&&e.isPlainObject(d)?d:{},i[c]=e.extend(l,h,f)):f!==b&&(i[c]=f)}return i},e.extend({noConflict:function(b){a.$===e&&(a.$=g),b&&a.jQuery===e&&(a.jQuery=f);return e},isReady:!1,readyWait:1,holdReady:function(a){a?e.readyWait++:e.ready(!0)},ready:function(a){if(a===!0&&!--e.readyWait||a!==!0&&!e.isReady){if(!c.body)return setTimeout(e.ready,1);e.isReady=!0;if(a!==!0&&--e.readyWait>0)return;A.resolveWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").unbind("ready")}},bindReady:function(){if(!A){A=e._Deferred();if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNaN:function(a){return a==null||!m.test(a)||isNaN(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1;var c;for(c in a);return c===b||D.call(a,c)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw a},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(o.test(b.replace(p,"@").replace(q,"]").replace(r,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(b,c,d){a.DOMParser?(d=new DOMParser,c=d.parseFromString(b,"text/xml")):(c=new ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b)),d=c.documentElement,(!d||!d.nodeName||d.nodeName==="parsererror")&&e.error("Invalid XML: "+b);return c},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g<h;)if(c.apply(a[g++],d)===!1)break}else if(i){for(f in a)if(c.call(a[f],f,a[f])===!1)break}else for(;g<h;)if(c.call(a[g],g,a[g++])===!1)break;return a},trim:G?function(a){return a==null?"":G.call(a)}:function(a){return a==null?"":(a+"").replace(k,"").replace(l,"")},makeArray:function(a,b){var c=b||[];if(a!=null){var d=e.type(a);a.length==null||d==="string"||d==="function"||d==="regexp"||e.isWindow(a)?E.call(c,a):e.merge(c,a)}return c},inArray:function(a,b){if(H)return H.call(b,a);for(var c=0,d=b.length;c<d;c++)if(b[c]===a)return c;return-1},merge:function(a,c){var d=a.length,e=0;if(typeof c.length=="number")for(var f=c.length;e<f;e++)a[d++]=c[e];else while(c[e]!==b)a[d++]=c[e++];a.length=d;return a},grep:function(a,b,c){var d=[],e;c=!!c;for(var f=0,g=a.length;f<g;f++)e=!!b(a[f],f),c!==e&&d.push(a[f]);return d},map:function(a,c,d){var f,g,h=[],i=0,j=a.length,k=a instanceof e||j!==b&&typeof j=="number"&&(j>0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i<j;i++)f=c(a[i],i,d),f!=null&&(h[h.length]=f);else for(g in a)f=c(a[g],g,d),f!=null&&(h[h.length]=f);return h.concat.apply([],h)},guid:1,proxy:function(a,c){if(typeof c=="string"){var d=a[c];c=a,a=d}if(!e.isFunction(a))return b;var f=F.call(arguments,2),g=function(){return a.apply(c,f.concat(F.call(arguments)))};g.guid=a.guid=a.guid||g.guid||e.guid++;return g},access:function(a,c,d,f,g,h){var i=a.length;if(typeof c=="object"){for(var j in c)e.access(a,j,c[j],f,g,d);return a}if(d!==b){f=!h&&f&&e.isFunction(d);for(var k=0;k<i;k++)g(a[k],c,f?d.call(a[k],k,g(a[k],c)):d,h);return a}return i?g(a[0],c):b},now:function(){return(new Date).getTime()},uaMatch:function(a){a=a.toLowerCase();var b=s.exec(a)||t.exec(a)||u.exec(a)||a.indexOf("compatible")<0&&v.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},sub:function(){function a(b,c){return new a.fn.init(b,c)}e.extend(!0,a,this),a.superclass=this,a.fn=a.prototype=this(),a.fn.constructor=a,a.sub=this.sub,a.fn.init=function(d,f){f&&f instanceof e&&!(f instanceof a)&&(f=a(f));return e.fn.init.call(this,d,f,b)},a.fn.init.prototype=a.fn;var b=a(c);return a},browser:{}}),e.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(a,b){I["[object "+b+"]"]=b.toLowerCase()}),z=e.uaMatch(y),z.browser&&(e.browser[z.browser]=!0,e.browser.version=z.version),e.browser.webkit&&(e.browser.safari=!0),j.test(" ")&&(k=/^[\s\xA0]+/,l=/[\s\xA0]+$/),h=e(c),c.addEventListener?B=function(){c.removeEventListener("DOMContentLoaded",B,!1),e.ready()}:c.attachEvent&&(B=function(){c.readyState==="complete"&&(c.detachEvent("onreadystatechange",B),e.ready())});return e}(),g="done fail isResolved isRejected promise then always pipe".split(" "),h=[].slice;f.extend({_Deferred:function(){var a=[],b,c,d,e={done:function(){if(!d){var c=arguments,g,h,i,j,k;b&&(k=b,b=0);for(g=0,h=c.length;g<h;g++)i=c[g],j=f.type(i),j==="array"?e.done.apply(e,i):j==="function"&&a.push(i);k&&e.resolveWith(k[0],k[1])}return this},resolveWith:function(e,f){if(!d&&!b&&!c){f=f||[],c=1;try{while(a[0])a.shift().apply(e,f)}finally{b=[e,f],c=0}}return this},resolve:function(){e.resolveWith(this,arguments);return this},isResolved:function(){return!!c||!!b},cancel:function(){d=1,a=[];return this}};return e},Deferred:function(a){var b=f._Deferred(),c=f._Deferred(),d;f.extend(b,{then:function(a,c){b.done(a).fail(c);return this},always:function(){return b.done.apply(b,arguments).fail.apply(this,arguments)},fail:c.done,rejectWith:c.resolveWith,reject:c.resolve,isRejected:c.isResolved,pipe:function(a,c){return f.Deferred(function(d){f.each({done:[a,"resolve"],fail:[c,"reject"]},function(a,c){var e=c[0],g=c[1],h;f.isFunction(e)?b[a](function(){h=e.apply(this,arguments),h&&f.isFunction(h.promise)?h.promise().then(d.resolve,d.reject):d[g](h)}):b[a](d[g])})}).promise()},promise:function(a){if(a==null){if(d)return d;d=a={}}var c=g.length;while(c--)a[g[c]]=b[g[c]];return a}}),b.done(c.cancel).fail(b.cancel),delete b.cancel,a&&a.call(b,b);return b},when:function(a){function i(a){return function(c){b[a]=arguments.length>1?h.call(arguments,0):c,--e||g.resolveWith(g,h.call(b,0))}}var b=arguments,c=0,d=b.length,e=d,g=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred();if(d>1){for(;c<d;c++)b[c]&&f.isFunction(b[c].promise)?b[c].promise().then(i(c),g.reject):--e;e||g.resolveWith(g,b)}else g!==a&&g.resolveWith(g,d?[a]:[]);return g.promise()}}),f.support=function(){var a=c.createElement("div"),b=c.documentElement,d,e,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u;a.setAttribute("className","t"),a.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>",d=a.getElementsByTagName("*"),e=a.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=a.getElementsByTagName("input")[0],k={leadingWhitespace:a.firstChild.nodeType===3,tbody:!a.getElementsByTagName("tbody").length,htmlSerialize:!!a.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55$/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:a.className!=="t",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,k.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,k.optDisabled=!h.disabled;try{delete a.test}catch(v){k.deleteExpando=!1}!a.addEventListener&&a.attachEvent&&a.fireEvent&&(a.attachEvent("onclick",function(){k.noCloneEvent=!1}),a.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),k.radioValue=i.value==="t",i.setAttribute("checked","checked"),a.appendChild(i),l=c.createDocumentFragment(),l.appendChild(a.firstChild),k.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,a.innerHTML="",a.style.width=a.style.paddingLeft="1px",m=c.getElementsByTagName("body")[0],o=c.createElement(m?"div":"body"),p={visibility:"hidden",width:0,height:0,border:0,margin:0},m&&f.extend(p,{position:"absolute",left:-1e3,top:-1e3});for(t in p)o.style[t]=p[t];o.appendChild(a),n=m||b,n.insertBefore(o,n.firstChild),k.appendChecked=i.checked,k.boxModel=a.offsetWidth===2,"zoom"in a.style&&(a.style.display="inline",a.style.zoom=1,k.inlineBlockNeedsLayout=a.offsetWidth===2,a.style.display="",a.innerHTML="<div style='width:4px;'></div>",k.shrinkWrapBlocks=a.offsetWidth!==2),a.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>",q=a.getElementsByTagName("td"),u=q[0].offsetHeight===0,q[0].style.display="",q[1].style.display="none",k.reliableHiddenOffsets=u&&q[0].offsetHeight===0,a.innerHTML="",c.defaultView&&c.defaultView.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",a.appendChild(j),k.reliableMarginRight=(parseInt((c.defaultView.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0),o.innerHTML="",n.removeChild(o);if(a.attachEvent)for(t in{submit:1,change:1,focusin:1})s="on"+t,u=s in a,u||(a.setAttribute(s,"return;"),u=typeof a[s]=="function"),k[t+"Bubbles"]=u;o=l=g=h=m=j=a=i=null;return k}(),f.boxModel=f.support.boxModel;var i=/^(?:\{.*\}|\[.*\])$/,j=/([a-z])([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!l(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g=f.expando,h=typeof c=="string",i,j=a.nodeType,k=j?f.cache:a,l=j?a[f.expando]:a[f.expando]&&f.expando;if((!l||e&&l&&!k[l][g])&&h&&d===b)return;l||(j?a[f.expando]=l=++f.uuid:l=f.expando),k[l]||(k[l]={},j||(k[l].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?k[l][g]=f.extend(k[l][g],c):k[l]=f.extend(k[l],c);i=k[l],e&&(i[g]||(i[g]={}),i=i[g]),d!==b&&(i[f.camelCase(c)]=d);if(c==="events"&&!i[c])return i[g]&&i[g].events;return h?i[f.camelCase(c)]||i[c]:i}},removeData:function(b,c,d){if(!!f.acceptData(b)){var e=f.expando,g=b.nodeType,h=g?f.cache:b,i=g?b[f.expando]:f.expando;if(!h[i])return;if(c){var j=d?h[i][e]:h[i];if(j){delete j[c];if(!l(j))return}}if(d){delete h[i][e];if(!l(h[i]))return}var k=h[i][e];f.support.deleteExpando||h!=a?delete h[i]:h[i]=null,k?(h[i]={},g||(h[i].toJSON=f.noop),h[i][e]=k):g&&(f.support.deleteExpando?delete b[f.expando]:b.removeAttribute?b.removeAttribute(f.expando):b[f.expando]=null)}},_data:function(a,b,c){return f.data(a,b,c,!0)},acceptData:function(a){if(a.nodeName){var b=f.noData[a.nodeName.toLowerCase()];if(b)return b!==!0&&a.getAttribute("classid")===b}return!0}}),f.fn.extend({data:function(a,c){var d=null;if(typeof a=="undefined"){if(this.length){d=f.data(this[0]);if(this[0].nodeType===1){var e=this[0].attributes,g;for(var h=0,i=e.length;h<i;h++)g=e[h].name,g.indexOf("data-")===0&&(g=f.camelCase(g.substring(5)),k(this[0],g,d[g]))}}return d}if(typeof a=="object")return this.each(function(){f.data(this,a)});var j=a.split(".");j[1]=j[1]?"."+j[1]:"";if(c===b){d=this.triggerHandler("getData"+j[1]+"!",[j[0]]),d===b&&this.length&&(d=f.data(this[0],a),d=k(this[0],a,d));return d===b&&j[1]?this.data(j[0]):d}return this.each(function(){var b=f(this),d=[j[0],c];b.triggerHandler("setData"+j[1]+"!",d),f.data(this,a,c),b.triggerHandler("changeData"+j[1]+"!",d)})},removeData:function(a){return this.each(function(){f.removeData(this,a)})}}),f.extend({_mark:function(a,c){a&&(c=(c||"fx")+"mark",f.data(a,c,(f.data(a,c,b,!0)||0)+1,!0))},_unmark:function(a,c,d){a!==!0&&(d=c,c=a,a=!1);if(c){d=d||"fx";var e=d+"mark",g=a?0:(f.data(c,e,b,!0)||1)-1;g?f.data(c,e,g,!0):(f.removeData(c,e,!0),m(c,d,"mark"))}},queue:function(a,c,d){if(a){c=(c||"fx")+"queue";var e=f.data(a,c,b,!0);d&&(!e||f.isArray(d)?e=f.data(a,c,f.makeArray(d),!0):e.push(d));return e||[]}},dequeue:function(a,b){b=b||"fx";var c=f.queue(a,b),d=c.shift(),e;d==="inprogress"&&(d=c.shift()),d&&(b==="fx"&&c.unshift("inprogress"),d.call(a,function(){f.dequeue(a,b)})),c.length||(f.removeData(a,b+"queue",!0),m(a,b,"queue"))}}),f.fn.extend({queue:function(a,c){typeof a!="string"&&(c=a,a="fx");if(c===b)return f.queue(this[0],a);return this.each(function(){var b=f.queue(this,a,c);a==="fx"&&b[0]!=="inprogress"&&f.dequeue(this,a)})},dequeue:function(a){return this.each(function(){f.dequeue(this,a)})},delay:function(a,b){a=f.fx?f.fx.speeds[a]||a:a,b=b||"fx";return this.queue(b,function(){var c=this;setTimeout(function(){f.dequeue(c,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,c){function m(){--h||d.resolveWith(e,[e])}typeof a!="string"&&(c=a,a=b),a=a||"fx";var d=f.Deferred(),e=this,g=e.length,h=1,i=a+"defer",j=a+"queue",k=a+"mark",l;while(g--)if(l=f.data(e[g],i,b,!0)||(f.data(e[g],j,b,!0)||f.data(e[g],k,b,!0))&&f.data(e[g],i,f._Deferred(),!0))h++,l.done(m);m();return d.promise()}});var n=/[\n\t\r]/g,o=/\s+/,p=/\r/g,q=/^(?:button|input)$/i,r=/^(?:button|input|object|select|textarea)$/i,s=/^a(?:rea)?$/i,t=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,u=/\:|^on/,v,w;f.fn.extend({attr:function(a,b){return f.access(this,a,b,!0,f.attr)},removeAttr:function(a){return this.each(function(){f.removeAttr(this,a)})},prop:function(a,b){return f.access(this,a,b,!0,f.prop)},removeProp:function(a){a=f.propFix[a]||a;return this.each(function(){try{this[a]=b,delete this[a]}catch(c){}})},addClass:function(a){var b,c,d,e,g,h,i;if(f.isFunction(a))return this.each(function(b){f(this).addClass(a.call(this,b,this.className))});if(a&&typeof a=="string"){b=a.split(o);for(c=0,d=this.length;c<d;c++){e=this[c];if(e.nodeType===1)if(!e.className&&b.length===1)e.className=a;else{g=" "+e.className+" ";for(h=0,i=b.length;h<i;h++)~g.indexOf(" "+b[h]+" ")||(g+=b[h]+" ");e.className=f.trim(g)}}}return this},removeClass:function(a){var c,d,e,g,h,i,j;if(f.isFunction(a))return this.each(function(b){f(this).removeClass(a.call(this,b,this.className))});if(a&&typeof a=="string"||a===b){c=(a||"").split(o);for(d=0,e=this.length;d<e;d++){g=this[d];if(g.nodeType===1&&g.className)if(a){h=(" "+g.className+" ").replace(n," ");for(i=0,j=c.length;i<j;i++)h=h.replace(" "+c[i]+" "," ");g.className=f.trim(h)}else g.className=""}}return this},toggleClass:function(a,b){var c=typeof a,d=typeof b=="boolean";if(f.isFunction(a))return this.each(function(c){f(this).toggleClass(a.call(this,c,this.className,b),b)});return this.each(function(){if(c==="string"){var e,g=0,h=f(this),i=b,j=a.split(o);while(e=j[g++])i=d?i:!h.hasClass(e),h[i?"addClass":"removeClass"](e)}else if(c==="undefined"||c==="boolean")this.className&&f._data(this,"__className__",this.className),this.className=this.className||a===!1?"":f._data(this,"__className__")||""})},hasClass:function(a){var b=" "+a+" ";for(var c=0,d=this.length;c<d;c++)if((" "+this[c].className+" ").replace(n," ").indexOf(b)>-1)return!0;return!1},val:function(a){var c,d,e=this[0];if(!arguments.length){if(e){c=f.valHooks[e.nodeName.toLowerCase()]||f.valHooks[e.type];if(c&&"get"in c&&(d=c.get(e,"value"))!==b)return d;d=e.value;return typeof d=="string"?d.replace(p,""):d==null?"":d}return b}var g=f.isFunction(a);return this.each(function(d){var e=f(this),h;if(this.nodeType===1){g?h=a.call(this,d,e.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c=a.selectedIndex,d=[],e=a.options,g=a.type==="select-one";if(c<0)return null;for(var h=g?c:0,i=g?c+1:e.length;h<i;h++){var j=e[h];if(j.selected&&(f.support.optDisabled?!j.disabled:j.getAttribute("disabled")===null)&&(!j.parentNode.disabled||!f.nodeName(j.parentNode,"optgroup"))){b=f(j).val();if(g)return b;d.push(b)}}if(g&&!d.length&&e.length)return f(e[c]).val();return d},set:function(a,b){var c=f.makeArray(b);f(a).find("option").each(function(){this.selected=f.inArray(f(this).val(),c)>=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attrFix:{tabindex:"tabIndex"},attr:function(a,c,d,e){var g=a.nodeType;if(!a||g===3||g===8||g===2)return b;if(e&&c in f.attrFn)return f(a)[c](d);if(!("getAttribute"in a))return f.prop(a,c,d);var h,i,j=g!==1||!f.isXMLDoc(a);j&&(c=f.attrFix[c]||c,i=f.attrHooks[c],i||(t.test(c)?i=w:v&&c!=="className"&&(f.nodeName(a,"form")||u.test(c))&&(i=v)));if(d!==b){if(d===null){f.removeAttr(a,c);return b}if(i&&"set"in i&&j&&(h=i.set(a,d,c))!==b)return h;a.setAttribute(c,""+d);return d}if(i&&"get"in i&&j&&(h=i.get(a,c))!==null)return h;h=a.getAttribute(c);return h===null?b:h},removeAttr:function(a,b){var c;a.nodeType===1&&(b=f.attrFix[b]||b,f.support.getSetAttribute?a.removeAttribute(b):(f.attr(a,b,""),a.removeAttributeNode(a.getAttributeNode(b))),t.test(b)&&(c=f.propFix[b]||b)in a&&(a[c]=!1))},attrHooks:{type:{set:function(a,b){if(q.test(a.nodeName)&&a.parentNode)f.error("type property can't be changed");else if(!f.support.radioValue&&b==="radio"&&f.nodeName(a,"input")){var c=a.value;a.setAttribute("type",b),c&&(a.value=c);return b}}},tabIndex:{get:function(a){var c=a.getAttributeNode("tabIndex");return c&&c.specified?parseInt(c.value,10):r.test(a.nodeName)||s.test(a.nodeName)&&a.href?0:b}},value:{get:function(a,b){if(v&&f.nodeName(a,"button"))return v.get(a,b);return b in a?a.value:null},set:function(a,b,c){if(v&&f.nodeName(a,"button"))return v.set(a,b,c);a.value=b}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(a,c,d){var e=a.nodeType;if(!a||e===3||e===8||e===2)return b;var g,h,i=e!==1||!f.isXMLDoc(a);i&&(c=f.propFix[c]||c,h=f.propHooks[c]);return d!==b?h&&"set"in h&&(g=h.set(a,d,c))!==b?g:a[c]=d:h&&"get"in h&&(g=h.get(a,c))!==b?g:a[c]},propHooks:{}}),w={get:function(a,c){return f.prop(a,c)?c.toLowerCase():b},set:function(a,b,c){var d;b===!1?f.removeAttr(a,c):(d=f.propFix[c]||c,d in a&&(a[d]=!0),a.setAttribute(c,c.toLowerCase()));return c}},f.support.getSetAttribute||(f.attrFix=f.propFix,v=f.attrHooks.name=f.attrHooks.title=f.valHooks.button={get:function(a,c){var d;d=a.getAttributeNode(c);return d&&d.nodeValue!==""?d.nodeValue:b},set:function(a,b,c){var d=a.getAttributeNode(c);if(d){d.nodeValue=b;return b}}},f.each(["width","height"],function(a,b){f.attrHooks[b]=f.extend(f.attrHooks[b],{set:function(a,c){if(c===""){a.setAttribute(b,"auto");return c}}})})),f.support.hrefNormalized||f.each(["href","src","width","height"],function(a,c){f.attrHooks[c]=f.extend(f.attrHooks[c],{get:function(a){var d=a.getAttribute(c,2);return d===null?b:d}})}),f.support.style||(f.attrHooks.style={get:function(a){return a.style.cssText.toLowerCase()||b},set:function(a,b){return a.style.cssText=""+b}}),f.support.optSelected||(f.propHooks.selected=f.extend(f.propHooks.selected,{get:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}})),f.support.checkOn||f.each(["radio","checkbox"],function(){f.valHooks[this]={get:function(a){return a.getAttribute("value")===null?"on":a.value}}}),f.each(["radio","checkbox"],function(){f.valHooks[this]=f.extend(f.valHooks[this],{set:function(a,b){if(f.isArray(b))return a.checked=f.inArray(f(a).val(),b)>=0}})});var x=/\.(.*)$/,y=/^(?:textarea|input|select)$/i,z=/\./g,A=/ /g,B=/[^\w\s.|`]/g,C=function(a){return a.replace(B,"\\$&")};f.event={add:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){if(d===!1)d=D;else if(!d)return;var g,h;d.handler&&(g=d,d=g.handler),d.guid||(d.guid=f.guid++);var i=f._data(a);if(!i)return;var j=i.events,k=i.handle;j||(i.events=j={}),k||(i.handle=k=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.handle.apply(k.elem,arguments):b}),k.elem=a,c=c.split(" ");var l,m=0,n;while(l=c[m++]){h=g?f.extend({},g):{handler:d,data:e},l.indexOf(".")>-1?(n=l.split("."),l=n.shift(),h.namespace=n.slice(0).sort().join(".")):(n=[],h.namespace=""),h.type=l,h.guid||(h.guid=d.guid);var o=j[l],p=f.event.special[l]||{};if(!o){o=j[l]=[];if(!p.setup||p.setup.call(a,e,n,k)===!1)a.addEventListener?a.addEventListener(l,k,!1):a.attachEvent&&a.attachEvent("on"+l,k)}p.add&&(p.add.call(a,h),h.handler.guid||(h.handler.guid=d.guid)),o.push(h),f.event.global[l]=!0}a=null}},global:{},remove:function(a,c,d,e){if(a.nodeType!==3&&a.nodeType!==8){d===!1&&(d=D);var g,h,i,j,k=0,l,m,n,o,p,q,r,s=f.hasData(a)&&f._data(a),t=s&&s.events;if(!s||!t)return;c&&c.type&&(d=c.handler,c=c.type);if(!c||typeof c=="string"&&c.charAt(0)==="."){c=c||"";for(h in t)f.event.remove(a,h+c);return}c=c.split(" ");while(h=c[k++]){r=h,q=null,l=h.indexOf(".")<0,m=[],l||(m=h.split("."),h=m.shift(),n=new RegExp("(^|\\.)"+f.map(m.slice(0).sort(),C).join("\\.(?:.*\\.)?")+"(\\.|$)")),p=t[h];if(!p)continue;if(!d){for(j=0;j<p.length;j++){q=p[j];if(l||n.test(q.namespace))f.event.remove(a,r,q.handler,j),p.splice(j--,1)}continue}o=f.event.special[h]||{};for(j=e||0;j<p.length;j++){q=p[j];if(d.guid===q.guid){if(l||n.test(q.namespace))e==null&&p.splice(j--,1),o.remove&&o.remove.call(a,q);if(e!=null)break}}if(p.length===0||e!=null&&p.length===1)(!o.teardown||o.teardown.call(a,m)===!1)&&f.removeEvent(a,h,s.handle),g=null,delete t[h]}if(f.isEmptyObject(t)){var u=s.handle;u&&(u.elem=null),delete s.events,delete s.handle,f.isEmptyObject(s)&&f.removeData(a,b,!0)}}},customEvent:{getData:!0,setData:!0,changeData:!0},trigger:function(c,d,e,g){var h=c.type||c,i=[],j;h.indexOf("!")>=0&&(h=h.slice(0,-1),j=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i. +shift(),i.sort());if(!!e&&!f.event.customEvent[h]||!!f.event.global[h]){c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.exclusive=j,c.namespace=i.join("."),c.namespace_re=new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)");if(g||!e)c.preventDefault(),c.stopPropagation();if(!e){f.each(f.cache,function(){var a=f.expando,b=this[a];b&&b.events&&b.events[h]&&f.event.trigger(c,d,b.handle.elem)});return}if(e.nodeType===3||e.nodeType===8)return;c.result=b,c.target=e,d=d!=null?f.makeArray(d):[],d.unshift(c);var k=e,l=h.indexOf(":")<0?"on"+h:"";do{var m=f._data(k,"handle");c.currentTarget=k,m&&m.apply(k,d),l&&f.acceptData(k)&&k[l]&&k[l].apply(k,d)===!1&&(c.result=!1,c.preventDefault()),k=k.parentNode||k.ownerDocument||k===c.target.ownerDocument&&a}while(k&&!c.isPropagationStopped());if(!c.isDefaultPrevented()){var n,o=f.event.special[h]||{};if((!o._default||o._default.call(e.ownerDocument,c)===!1)&&(h!=="click"||!f.nodeName(e,"a"))&&f.acceptData(e)){try{l&&e[h]&&(n=e[l],n&&(e[l]=null),f.event.triggered=h,e[h]())}catch(p){}n&&(e[l]=n),f.event.triggered=b}}return c.result}},handle:function(c){c=f.event.fix(c||a.event);var d=((f._data(this,"events")||{})[c.type]||[]).slice(0),e=!c.exclusive&&!c.namespace,g=Array.prototype.slice.call(arguments,0);g[0]=c,c.currentTarget=this;for(var h=0,i=d.length;h<i;h++){var j=d[h];if(e||c.namespace_re.test(j.namespace)){c.handler=j.handler,c.data=j.data,c.handleObj=j;var k=j.handler.apply(this,g);k!==b&&(c.result=k,k===!1&&(c.preventDefault(),c.stopPropagation()));if(c.isImmediatePropagationStopped())break}}return c.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(a){if(a[f.expando])return a;var d=a;a=f.Event(d);for(var e=this.props.length,g;e;)g=this.props[--e],a[g]=d[g];a.target||(a.target=a.srcElement||c),a.target.nodeType===3&&(a.target=a.target.parentNode),!a.relatedTarget&&a.fromElement&&(a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement);if(a.pageX==null&&a.clientX!=null){var h=a.target.ownerDocument||c,i=h.documentElement,j=h.body;a.pageX=a.clientX+(i&&i.scrollLeft||j&&j.scrollLeft||0)-(i&&i.clientLeft||j&&j.clientLeft||0),a.pageY=a.clientY+(i&&i.scrollTop||j&&j.scrollTop||0)-(i&&i.clientTop||j&&j.clientTop||0)}a.which==null&&(a.charCode!=null||a.keyCode!=null)&&(a.which=a.charCode!=null?a.charCode:a.keyCode),!a.metaKey&&a.ctrlKey&&(a.metaKey=a.ctrlKey),!a.which&&a.button!==b&&(a.which=a.button&1?1:a.button&2?3:a.button&4?2:0);return a},guid:1e8,proxy:f.proxy,special:{ready:{setup:f.bindReady,teardown:f.noop},live:{add:function(a){f.event.add(this,N(a.origType,a.selector),f.extend({},a,{handler:M,guid:a.handler.guid}))},remove:function(a){f.event.remove(this,N(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,c){f.isWindow(this)&&(this.onbeforeunload=c)},teardown:function(a,b){this.onbeforeunload===b&&(this.onbeforeunload=null)}}}},f.removeEvent=c.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)}:function(a,b,c){a.detachEvent&&a.detachEvent("on"+b,c)},f.Event=function(a,b){if(!this.preventDefault)return new f.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||a.returnValue===!1||a.getPreventDefault&&a.getPreventDefault()?E:D):this.type=a,b&&f.extend(this,b),this.timeStamp=f.now(),this[f.expando]=!0},f.Event.prototype={preventDefault:function(){this.isDefaultPrevented=E;var a=this.originalEvent;!a||(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){this.isPropagationStopped=E;var a=this.originalEvent;!a||(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=E,this.stopPropagation()},isDefaultPrevented:D,isPropagationStopped:D,isImmediatePropagationStopped:D};var F=function(a){var b=a.relatedTarget,c=!1,d=a.type;a.type=a.data,b!==this&&(b&&(c=f.contains(this,b)),c||(f.event.handle.apply(this,arguments),a.type=d))},G=function(a){a.type=a.data,f.event.handle.apply(this,arguments)};f.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){f.event.special[a]={setup:function(c){f.event.add(this,b,c&&c.selector?G:F,a)},teardown:function(a){f.event.remove(this,b,a&&a.selector?G:F)}}}),f.support.submitBubbles||(f.event.special.submit={setup:function(a,b){if(!f.nodeName(this,"form"))f.event.add(this,"click.specialSubmit",function(a){var b=a.target,c=b.type;(c==="submit"||c==="image")&&f(b).closest("form").length&&K("submit",this,arguments)}),f.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,c=b.type;(c==="text"||c==="password")&&f(b).closest("form").length&&a.keyCode===13&&K("submit",this,arguments)});else return!1},teardown:function(a){f.event.remove(this,".specialSubmit")}});if(!f.support.changeBubbles){var H,I=function(a){var b=a.type,c=a.value;b==="radio"||b==="checkbox"?c=a.checked:b==="select-multiple"?c=a.selectedIndex>-1?f.map(a.options,function(a){return a.selected}).join("-"):"":f.nodeName(a,"select")&&(c=a.selectedIndex);return c},J=function(c){var d=c.target,e,g;if(!!y.test(d.nodeName)&&!d.readOnly){e=f._data(d,"_change_data"),g=I(d),(c.type!=="focusout"||d.type!=="radio")&&f._data(d,"_change_data",g);if(e===b||g===e)return;if(e!=null||g)c.type="change",c.liveFired=b,f.event.trigger(c,arguments[1],d)}};f.event.special.change={filters:{focusout:J,beforedeactivate:J,click:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(c==="radio"||c==="checkbox"||f.nodeName(b,"select"))&&J.call(this,a)},keydown:function(a){var b=a.target,c=f.nodeName(b,"input")?b.type:"";(a.keyCode===13&&!f.nodeName(b,"textarea")||a.keyCode===32&&(c==="checkbox"||c==="radio")||c==="select-multiple")&&J.call(this,a)},beforeactivate:function(a){var b=a.target;f._data(b,"_change_data",I(b))}},setup:function(a,b){if(this.type==="file")return!1;for(var c in H)f.event.add(this,c+".specialChange",H[c]);return y.test(this.nodeName)},teardown:function(a){f.event.remove(this,".specialChange");return y.test(this.nodeName)}},H=f.event.special.change.filters,H.focus=H.beforeactivate}f.support.focusinBubbles||f.each({focus:"focusin",blur:"focusout"},function(a,b){function e(a){var c=f.event.fix(a);c.type=b,c.originalEvent={},f.event.trigger(c,null,c.target),c.isDefaultPrevented()&&a.preventDefault()}var d=0;f.event.special[b]={setup:function(){d++===0&&c.addEventListener(a,e,!0)},teardown:function(){--d===0&&c.removeEventListener(a,e,!0)}}}),f.each(["bind","one"],function(a,c){f.fn[c]=function(a,d,e){var g;if(typeof a=="object"){for(var h in a)this[c](h,d,a[h],e);return this}if(arguments.length===2||d===!1)e=d,d=b;c==="one"?(g=function(a){f(this).unbind(a,g);return e.apply(this,arguments)},g.guid=e.guid||f.guid++):g=e;if(a==="unload"&&c!=="one")this.one(a,d,e);else for(var i=0,j=this.length;i<j;i++)f.event.add(this[i],a,g,d);return this}}),f.fn.extend({unbind:function(a,b){if(typeof a=="object"&&!a.preventDefault)for(var c in a)this.unbind(c,a[c]);else for(var d=0,e=this.length;d<e;d++)f.event.remove(this[d],a,b);return this},delegate:function(a,b,c,d){return this.live(b,c,d,a)},undelegate:function(a,b,c){return arguments.length===0?this.unbind("live"):this.die(b,null,c,a)},trigger:function(a,b){return this.each(function(){f.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0])return f.event.trigger(a,b,this[0],!0)},toggle:function(a){var b=arguments,c=a.guid||f.guid++,d=0,e=function(c){var e=(f.data(this,"lastToggle"+a.guid)||0)%d;f.data(this,"lastToggle"+a.guid,e+1),c.preventDefault();return b[e].apply(this,arguments)||!1};e.guid=c;while(d<b.length)b[d++].guid=c;return this.click(e)},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var L={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};f.each(["live","die"],function(a,c){f.fn[c]=function(a,d,e,g){var h,i=0,j,k,l,m=g||this.selector,n=g?this:f(this.context);if(typeof a=="object"&&!a.preventDefault){for(var o in a)n[c](o,d,a[o],m);return this}if(c==="die"&&!a&&g&&g.charAt(0)==="."){n.unbind(g);return this}if(d===!1||f.isFunction(d))e=d||D,d=b;a=(a||"").split(" ");while((h=a[i++])!=null){j=x.exec(h),k="",j&&(k=j[0],h=h.replace(x,""));if(h==="hover"){a.push("mouseenter"+k,"mouseleave"+k);continue}l=h,L[h]?(a.push(L[h]+k),h=h+k):h=(L[h]||h)+k;if(c==="live")for(var p=0,q=n.length;p<q;p++)f.event.add(n[p],"live."+N(h,m),{data:d,selector:m,handler:e,origType:h,origHandler:e,preType:l});else n.unbind("live."+N(h,m),e)}return this}}),f.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){f.fn[b]=function(a,c){c==null&&(c=a,a=null);return arguments.length>0?this.bind(b,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0)}),function(){function u(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}if(i.nodeType===1){f||(i.sizcache=c,i.sizset=g);if(typeof b!="string"){if(i===b){j=!0;break}}else if(k.filter(b,[i]).length>0){j=i;break}}i=i[a]}d[g]=j}}}function t(a,b,c,d,e,f){for(var g=0,h=d.length;g<h;g++){var i=d[g];if(i){var j=!1;i=i[a];while(i){if(i.sizcache===c){j=d[i.sizset];break}i.nodeType===1&&!f&&(i.sizcache=c,i.sizset=g);if(i.nodeName.toLowerCase()===b){j=i;break}i=i[a]}d[g]=j}}}var a=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d=0,e=Object.prototype.toString,g=!1,h=!0,i=/\\/g,j=/\W/;[0,0].sort(function(){h=!1;return 0});var k=function(b,d,f,g){f=f||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return f;var i,j,n,o,q,r,s,t,u=!0,w=k.isXML(d),x=[],y=b;do{a.exec(""),i=a.exec(y);if(i){y=i[3],x.push(i[1]);if(i[2]){o=i[3];break}}}while(i);if(x.length>1&&m.exec(b))if(x.length===2&&l.relative[x[0]])j=v(x[0]+x[1],d);else{j=l.relative[x[0]]?[d]:k(x.shift(),d);while(x.length)b=x.shift(),l.relative[b]&&(b+=x.shift()),j=v(b,j)}else{!g&&x.length>1&&d.nodeType===9&&!w&&l.match.ID.test(x[0])&&!l.match.ID.test(x[x.length-1])&&(q=k.find(x.shift(),d,w),d=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]);if(d){q=g?{expr:x.pop(),set:p(g)}:k.find(x.pop(),x.length===1&&(x[0]==="~"||x[0]==="+")&&d.parentNode?d.parentNode:d,w),j=q.expr?k.filter(q.expr,q.set):q.set,x.length>0?n=p(j):u=!1;while(x.length)r=x.pop(),s=r,l.relative[r]?s=x.pop():r="",s==null&&(s=d),l.relative[r](n,s,w)}else n=x=[]}n||(n=j),n||k.error(r||b);if(e.call(n)==="[object Array]")if(!u)f.push.apply(f,n);else if(d&&d.nodeType===1)for(t=0;n[t]!=null;t++)n[t]&&(n[t]===!0||n[t].nodeType===1&&k.contains(d,n[t]))&&f.push(j[t]);else for(t=0;n[t]!=null;t++)n[t]&&n[t].nodeType===1&&f.push(j[t]);else p(n,f);o&&(k(o,h,f,g),k.uniqueSort(f));return f};k.uniqueSort=function(a){if(r){g=h,a.sort(r);if(g)for(var b=1;b<a.length;b++)a[b]===a[b-1]&&a.splice(b--,1)}return a},k.matches=function(a,b){return k(a,null,null,b)},k.matchesSelector=function(a,b){return k(b,null,null,[a]).length>0},k.find=function(a,b,c){var d;if(!a)return[];for(var e=0,f=l.order.length;e<f;e++){var g,h=l.order[e];if(g=l.leftMatch[h].exec(a)){var j=g[1];g.splice(1,1);if(j.substr(j.length-1)!=="\\"){g[1]=(g[1]||"").replace(i,""),d=l.find[h](g,b,c);if(d!=null){a=a.replace(l.match[h],"");break}}}}d||(d=typeof b.getElementsByTagName!="undefined"?b.getElementsByTagName("*"):[]);return{set:d,expr:a}},k.filter=function(a,c,d,e){var f,g,h=a,i=[],j=c,m=c&&c[0]&&k.isXML(c[0]);while(a&&c.length){for(var n in l.filter)if((f=l.leftMatch[n].exec(a))!=null&&f[2]){var o,p,q=l.filter[n],r=f[1];g=!1,f.splice(1,1);if(r.substr(r.length-1)==="\\")continue;j===i&&(i=[]);if(l.preFilter[n]){f=l.preFilter[n](f,j,d,i,e,m);if(!f)g=o=!0;else if(f===!0)continue}if(f)for(var s=0;(p=j[s])!=null;s++)if(p){o=q(p,f,s,j);var t=e^!!o;d&&o!=null?t?g=!0:j[s]=!1:t&&(i.push(p),g=!0)}if(o!==b){d||(j=i),a=a.replace(l.match[n],"");if(!g)return[];break}}if(a===h)if(g==null)k.error(a);else break;h=a}return j},k.error=function(a){throw"Syntax error, unrecognized expression: "+a};var l=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(a){return a.getAttribute("href")},type:function(a){return a.getAttribute("type")}},relative:{"+":function(a,b){var c=typeof b=="string",d=c&&!j.test(b),e=c&&!d;d&&(b=b.toLowerCase());for(var f=0,g=a.length,h;f<g;f++)if(h=a[f]){while((h=h.previousSibling)&&h.nodeType!==1);a[f]=e||h&&h.nodeName.toLowerCase()===b?h||!1:h===b}e&&k.filter(b,a,!0)},">":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!j.test(b)){b=b.toLowerCase();for(;e<f;e++){c=a[e];if(c){var g=c.parentNode;a[e]=g.nodeName.toLowerCase()===b?g:!1}}}else{for(;e<f;e++)c=a[e],c&&(a[e]=d?c.parentNode:c.parentNode===b);d&&k.filter(b,a,!0)}},"":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("parentNode",b,f,a,e,c)},"~":function(a,b,c){var e,f=d++,g=u;typeof b=="string"&&!j.test(b)&&(b=b.toLowerCase(),e=b,g=t),g("previousSibling",b,f,a,e,c)}},find:{ID:function(a,b,c){if(typeof b.getElementById!="undefined"&&!c){var d=b.getElementById(a[1]);return d&&d.parentNode?[d]:[]}},NAME:function(a,b){if(typeof b.getElementsByName!="undefined"){var c=[],d=b.getElementsByName(a[1]);for(var e=0,f=d.length;e<f;e++)d[e].getAttribute("name")===a[1]&&c.push(d[e]);return c.length===0?null:c}},TAG:function(a,b){if(typeof b.getElementsByTagName!="undefined")return b.getElementsByTagName(a[1])}},preFilter:{CLASS:function(a,b,c,d,e,f){a=" "+a[1].replace(i,"")+" ";if(f)return a;for(var g=0,h;(h=b[g])!=null;g++)h&&(e^(h.className&&(" "+h.className+" ").replace(/[\t\n\r]/g," ").indexOf(a)>=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(i,"")},TAG:function(a,b){return a[1].replace(i,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||k.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&k.error(a[0]);a[0]=d++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(i,"");!f&&l.attrMap[g]&&(a[1]=l.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(i,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=k(b[3],null,null,c);else{var g=k.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(l.match.POS.test(b[0])||l.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!k(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return b<c[3]-0},gt:function(a,b,c){return b>c[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=l.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||k.getText([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h<i;h++)if(g[h]===a)return!1;return!0}k.error(e)},CHILD:function(a,b){var c=b[1],d=a;switch(c){case"only":case"first":while(d=d.previousSibling)if(d.nodeType===1)return!1;if(c==="first")return!0;d=a;case"last":while(d=d.nextSibling)if(d.nodeType===1)return!1;return!0;case"nth":var e=b[2],f=b[3];if(e===1&&f===0)return!0;var g=b[0],h=a.parentNode;if(h&&(h.sizcache!==g||!a.nodeIndex)){var i=0;for(d=h.firstChild;d;d=d.nextSibling)d.nodeType===1&&(d.nodeIndex=++i);h.sizcache=g}var j=a.nodeIndex-f;return e===0?j===0:j%e===0&&j/e>=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=l.attrHandle[c]?l.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=l.setFilters[e];if(f)return f(a,c,b,d)}}},m=l.match.POS,n=function(a,b){return"\\"+(b-0+1)};for(var o in l.match)l.match[o]=new RegExp(l.match[o].source+/(?![^\[]*\])(?![^\(]*\))/.source),l.leftMatch[o]=new RegExp(/(^(?:.|\r|\n)*?)/.source+l.match[o].source.replace(/\\(\d+)/g,n));var p=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(q){p=function(a,b){var c=0,d=b||[];if(e.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var f=a.length;c<f;c++)d.push(a[c]);else for(;a[c];c++)d.push(a[c]);return d}}var r,s;c.documentElement.compareDocumentPosition?r=function(a,b){if(a===b){g=!0;return 0}if(!a.compareDocumentPosition||!b.compareDocumentPosition)return a.compareDocumentPosition?-1:1;return a.compareDocumentPosition(b)&4?-1:1}:(r=function(a,b){if(a===b){g=!0;return 0}if(a.sourceIndex&&b.sourceIndex)return a.sourceIndex-b.sourceIndex;var c,d,e=[],f=[],h=a.parentNode,i=b.parentNode,j=h;if(h===i)return s(a,b);if(!h)return-1;if(!i)return 1;while(j)e.unshift(j),j=j.parentNode;j=i;while(j)f.unshift(j),j=j.parentNode;c=e.length,d=f.length;for(var k=0;k<c&&k<d;k++)if(e[k]!==f[k])return s(e[k],f[k]);return k===c?s(a,f[k],-1):s(e[k],b,1)},s=function(a,b,c){if(a===b)return c;var d=a.nextSibling;while(d){if(d===b)return-1;d=d.nextSibling}return 1}),k.getText=function(a){var b="",c;for(var d=0;a[d];d++)c=a[d],c.nodeType===3||c.nodeType===4?b+=c.nodeValue:c.nodeType!==8&&(b+=k.getText(c.childNodes));return b},function(){var a=c.createElement("div"),d="script"+(new Date).getTime(),e=c.documentElement;a.innerHTML="<a name='"+d+"'/>",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(l.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},l.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(l.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="<a href='#'></a>",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(l.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=k,b=c.createElement("div"),d="__sizzle__";b.innerHTML="<p class='TEST'></p>";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){k=function(b,e,f,g){e=e||c;if(!g&&!k.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return p(e.getElementsByTagName(b),f);if(h[2]&&l.find.CLASS&&e.getElementsByClassName)return p(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return p([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return p([],f);if(i.id===h[3])return p([i],f)}try{return p(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var m=e,n=e.getAttribute("id"),o=n||d,q=e.parentNode,r=/^\s*[+~]/.test(b);n?o=o.replace(/'/g,"\\$&"):e.setAttribute("id",o),r&&q&&(e=e.parentNode);try{if(!r||q)return p(e.querySelectorAll("[id='"+o+"'] "+b),f)}catch(s){}finally{n||m.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)k[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}k.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(a))try{if(e||!l.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return k(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="<div class='test e'></div><div class='test'></div>";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;l.order.splice(1,0,"CLASS"),l.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?k.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?k.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:k.contains=function(){return!1},k.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var v=function(a,b){var c,d=[],e="",f=b.nodeType?[b]:b;while(c=l.match.PSEUDO.exec(a))e+=c[0],a=a.replace(l.match.PSEUDO,"");a=l.relative[a]?a+"*":a;for(var g=0,h=f.length;g<h;g++)k(a,f[g],d);return k.filter(e,d)};f.find=k,f.expr=k.selectors,f.expr[":"]=f.expr.filters,f.unique=k.uniqueSort,f.text=k.getText,f.isXMLDoc=k.isXML,f.contains=k.contains}();var O=/Until$/,P=/^(?:parents|prevUntil|prevAll)/,Q=/,/,R=/^.[^:#\[\.,]*$/,S=Array.prototype.slice,T=f.expr.match.POS,U={children:!0,contents:!0,next:!0,prev:!0};f.fn.extend({find:function(a){var b=this,c,d;if(typeof a!="string")return f(a).filter(function(){for(c=0,d=b.length;c<d;c++)if(f.contains(b[c],this))return!0});var e=this.pushStack("","find",a),g,h,i;for(c=0,d=this.length;c<d;c++){g=e.length,f.find(a,this[c],e);if(c>0)for(h=g;h<e.length;h++)for(i=0;i<g;i++)if(e[i]===e[h]){e.splice(h--,1);break}}return e},has:function(a){var b=f(a);return this.filter(function(){for(var a=0,c=b.length;a<c;a++)if(f.contains(this,b[a]))return!0})},not:function(a){return this.pushStack(W(this,a,!1),"not",a)},filter:function(a){return this.pushStack(W(this,a,!0),"filter",a)},is:function(a){return!!a&&(typeof a=="string"?f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h,i,j={},k=1;if(g&&a.length){for(d=0,e=a.length;d<e;d++)i=a[d],j[i]||(j[i]=T.test(i)?f(i,b||this.context):i);while(g&&g.ownerDocument&&g!==b){for(i in j)h=j[i],(h.jquery?h.index(g)>-1:f(g).is(h))&&c.push({selector:i,elem:g,level:k});g=g.parentNode,k++}}return c}var l=T.test(a)||typeof a!="string"?f(a,b||this.context):0;for(d=0,e=this.length;d<e;d++){g=this[d];while(g){if(l?l.index(g)>-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a||typeof a=="string")return f.inArray(this[0],a?f(a):this.parent().children());return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(V(c[0])||V(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c),g=S.call(arguments);O.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!U[a]?f.unique(e):e,(this.length>1||Q.test(d))&&P.test(a)&&(e=e.reverse());return this.pushStack(e,a,g.join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var X=/ jQuery\d+="(?:\d+|null)"/g,Y=/^\s+/,Z=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,$=/<([\w:]+)/,_=/<tbody/i,ba=/<|&#?\w+;/,bb=/<(?:script|object|embed|option|style)/i,bc=/checked\s*(?:[^=]|=\s*.checked.)/i,bd=/\/(java|ecma)script/i,be=/^\s*<!(?:\[CDATA\[|\-\-)/,bf={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};bf.optgroup=bf.option,bf.tbody=bf.tfoot=bf.colgroup=bf.caption=bf.thead,bf.th=bf.td,f.support.htmlSerialize||(bf._default=[1,"div<div>","</div>"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){f(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f(arguments[0]).toArray());return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(X,""):null;if(typeof a=="string"&&!bb.test(a)&&(f.support.leadingWhitespace||!Y.test(a))&&!bf[($.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Z,"<$1></$2>");try{for(var c=0,d=this.length;c<d;c++)this[c].nodeType===1&&(f.cleanData(this[c].getElementsByTagName("*")),this[c].innerHTML=a)}catch(e){this.empty().append(a)}}else f.isFunction(a)?this.each(function(b){var c=f(this);c.html(a.call(this,b,c.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(f.isFunction(a))return this.each(function(b){var c=f(this),d=c.html();c.replaceWith(a.call(this,b,d))});typeof a!="string"&&(a=f(a).detach());return this.each(function(){var b=this.nextSibling,c=this.parentNode;f(this).remove(),b?f(b).before(a):f(c).append(a)})}return this.length?this.pushStack(f(f.isFunction(a)?a():a),"replaceWith",a):this},detach:function(a){return this.remove(a,!0)},domManip:function(a,c,d){var e,g,h,i,j=a[0],k=[];if(!f.support.checkClone&&arguments.length===3&&typeof j=="string"&&bc.test(j))return this.each(function(){f(this).domManip(a,c,d,!0)});if(f.isFunction(j))return this.each(function(e){var g=f(this);a[0]=j.call(this,e,c?g.html():b),g.domManip(a,c,d)});if(this[0]){i=j&&j.parentNode,f.support.parentNode&&i&&i.nodeType===11&&i.childNodes.length===this.length?e={fragment:i}:e=f.buildFragment(a,this,k),h=e.fragment,h.childNodes.length===1?g=h=h.firstChild:g=h.firstChild;if(g){c=c&&f.nodeName(g,"tr");for(var l=0,m=this.length,n=m-1;l<m;l++)d.call(c?bg(this[l],g):this[l],e.cacheable||m>1&&l<n?f.clone(h,!0,!0):h)}k.length&&f.each(k,bm)}return this}}),f.buildFragment=function(a,b,d){var e,g,h,i;b&&b[0]&&(i=b[0].ownerDocument||b[0]),i.createDocumentFragment||(i=c),a.length===1&&typeof a[0]=="string"&&a[0].length<512&&i===c&&a[0].charAt(0)==="<"&&!bb.test(a[0])&&(f.support.checkClone||!bc.test(a[0]))&&(g=!0,h=f.fragments[a[0]],h&&h!==1&&(e=h)),e||(e=i.createDocumentFragment(),f.clean(a,i,e,d)),g&&(f.fragments[a[0]]=h?e:1);return{fragment:e,cacheable:g}},f.fragments={},f.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){f.fn[a]=function(c){var d=[],e=f(c),g=this.length===1&&this[0].parentNode;if(g&&g.nodeType===11&&g.childNodes.length===1&&e.length===1){e[b](this[0]);return this}for(var h=0,i=e.length;h<i;h++){var j=(h>0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j +)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d=a.cloneNode(!0),e,g,h;if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bi(a,d),e=bj(a),g=bj(d);for(h=0;e[h];++h)bi(e[h],g[h])}if(b){bh(a,d);if(c){e=bj(a),g=bj(d);for(h=0;e[h];++h)bh(e[h],g[h])}}e=g=null;return d},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!ba.test(k))k=b.createTextNode(k);else{k=k.replace(Z,"<$1></$2>");var l=($.exec(k)||["",""])[1].toLowerCase(),m=bf[l]||bf._default,n=m[0],o=b.createElement("div");o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=_.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]==="<table>"&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&Y.test(k)&&o.insertBefore(b.createTextNode(Y.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i<r;i++)bl(k[i]);else bl(k);k.nodeType?h.push(k):h=f.merge(h,k)}if(d){g=function(a){return!a.type||bd.test(a.type)};for(j=0;h[j];j++)if(e&&f.nodeName(h[j],"script")&&(!h[j].type||h[j].type.toLowerCase()==="text/javascript"))e.push(h[j].parentNode?h[j].parentNode.removeChild(h[j]):h[j]);else{if(h[j].nodeType===1){var s=f.grep(h[j].getElementsByTagName("script"),g);h.splice.apply(h,[j+1,0].concat(s))}d.appendChild(h[j])}}return h},cleanData:function(a){var b,c,d=f.cache,e=f.expando,g=f.event.special,h=f.support.deleteExpando;for(var i=0,j;(j=a[i])!=null;i++){if(j.nodeName&&f.noData[j.nodeName.toLowerCase()])continue;c=j[f.expando];if(c){b=d[c]&&d[c][e];if(b&&b.events){for(var k in b.events)g[k]?f.event.remove(j,k):f.removeEvent(j,k,b.handle);b.handle&&(b.handle.elem=null)}h?delete j[f.expando]:j.removeAttribute&&j.removeAttribute(f.expando),delete d[c]}}}});var bn=/alpha\([^)]*\)/i,bo=/opacity=([^)]*)/,bp=/([A-Z]|^ms)/g,bq=/^-?\d+(?:px)?$/i,br=/^-?\d/,bs=/^[+\-]=/,bt=/[^+\-\.\de]+/g,bu={position:"absolute",visibility:"hidden",display:"block"},bv=["Left","Right"],bw=["Top","Bottom"],bx,by,bz;f.fn.css=function(a,c){if(arguments.length===2&&c===b)return this;return f.access(this,a,c,!0,function(a,c,d){return d!==b?f.style(a,c,d):f.css(a,c)})},f.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=bx(a,"opacity","opacity");return c===""?"1":c}return a.style.opacity}}},cssNumber:{fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":f.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,c,d,e){if(!!a&&a.nodeType!==3&&a.nodeType!==8&&!!a.style){var g,h,i=f.camelCase(c),j=a.style,k=f.cssHooks[i];c=f.cssProps[i]||i;if(d===b){if(k&&"get"in k&&(g=k.get(a,!1,e))!==b)return g;return j[c]}h=typeof d;if(h==="number"&&isNaN(d)||d==null)return;h==="string"&&bs.test(d)&&(d=+d.replace(bt,"")+parseFloat(f.css(a,c)),h="number"),h==="number"&&!f.cssNumber[i]&&(d+="px");if(!k||!("set"in k)||(d=k.set(a,d))!==b)try{j[c]=d}catch(l){}}},css:function(a,c,d){var e,g;c=f.camelCase(c),g=f.cssHooks[c],c=f.cssProps[c]||c,c==="cssFloat"&&(c="float");if(g&&"get"in g&&(e=g.get(a,!0,d))!==b)return e;if(bx)return bx(a,c)},swap:function(a,b,c){var d={};for(var e in b)d[e]=a.style[e],a.style[e]=b[e];c.call(a);for(e in b)a.style[e]=d[e]}}),f.curCSS=f.css,f.each(["height","width"],function(a,b){f.cssHooks[b]={get:function(a,c,d){var e;if(c){if(a.offsetWidth!==0)return bA(a,b,d);f.swap(a,bu,function(){e=bA(a,b,d)});return e}},set:function(a,b){if(!bq.test(b))return b;b=parseFloat(b);if(b>=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return bo.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle;c.zoom=1;var e=f.isNaN(b)?"":"alpha(opacity="+b*100+")",g=d&&d.filter||c.filter||"";c.filter=bn.test(g)?g.replace(bn,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bx(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(by=function(a,c){var d,e,g;c=c.replace(bp,"-$1").toLowerCase();if(!(e=a.ownerDocument.defaultView))return b;if(g=e.getComputedStyle(a,null))d=g.getPropertyValue(c),d===""&&!f.contains(a.ownerDocument.documentElement,a)&&(d=f.style(a,c));return d}),c.documentElement.currentStyle&&(bz=function(a,b){var c,d=a.currentStyle&&a.currentStyle[b],e=a.runtimeStyle&&a.runtimeStyle[b],f=a.style;!bq.test(d)&&br.test(d)&&(c=f.left,e&&(a.runtimeStyle.left=a.currentStyle.left),f.left=b==="fontSize"?"1em":d||0,d=f.pixelLeft+"px",f.left=c,e&&(a.runtimeStyle.left=e));return d===""?"auto":d}),bx=by||bz,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bB=/%20/g,bC=/\[\]$/,bD=/\r?\n/g,bE=/#.*$/,bF=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bG=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bH=/^(?:about|app|app\-storage|.+\-extension|file|widget):$/,bI=/^(?:GET|HEAD)$/,bJ=/^\/\//,bK=/\?/,bL=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,bM=/^(?:select|textarea)/i,bN=/\s+/,bO=/([?&])_=[^&]*/,bP=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bQ=f.fn.load,bR={},bS={},bT,bU;try{bT=e.href}catch(bV){bT=c.createElement("a"),bT.href="",bT=bT.href}bU=bP.exec(bT.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bQ)return bQ.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("<div>").append(c.replace(bL,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bM.test(this.nodeName)||bG.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bD,"\r\n")}}):{name:b.name,value:c.replace(bD,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.bind(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?f.extend(!0,a,f.ajaxSettings,b):(b=a,a=f.extend(!0,f.ajaxSettings,b));for(var c in{context:1,url:1})c in b?a[c]=b[c]:c in f.ajaxSettings&&(a[c]=f.ajaxSettings[c]);return a},ajaxSettings:{url:bT,isLocal:bH.test(bU[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":"*/*"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML}},ajaxPrefilter:bW(bR),ajaxTransport:bW(bS),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a?4:0;var o,r,u,w=l?bZ(d,v,l):b,x,y;if(a>=200&&a<300||a===304){if(d.ifModified){if(x=v.getResponseHeader("Last-Modified"))f.lastModified[k]=x;if(y=v.getResponseHeader("Etag"))f.etag[k]=y}if(a===304)c="notmodified",o=!0;else try{r=b$(d,w),c="success",o=!0}catch(z){c="parsererror",u=z}}else{u=c;if(!c||a)c="error",a<0&&(a=0)}v.status=a,v.statusText=c,o?h.resolveWith(e,[r,c,v]):h.rejectWith(e,[v,c,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.resolveWith(e,[v,c]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f._Deferred(),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bF.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.done,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bE,"").replace(bJ,bU[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bN),d.crossDomain==null&&(r=bP.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bU[1]&&r[2]==bU[2]&&(r[3]||(r[1]==="http:"?80:443))==(bU[3]||(bU[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),bX(bR,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bI.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bK.test(d.url)?"&":"?")+d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bO,"$1_="+x);d.url=y+(y===d.url?(bK.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", */*; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=bX(bS,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){status<2?w(-1,z):f.error(z)}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)bY(g,a[g],c,e);return d.join("&").replace(bB,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var b_=f.now(),ca=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+b_++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ca.test(b.url)||e&&ca.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ca,l),b.url===j&&(e&&(k=k.replace(ca,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cb=a.ActiveXObject?function(){for(var a in cd)cd[a](0,1)}:!1,cc=0,cd;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ce()||cf()}:ce,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cb&&delete cd[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cc,cb&&(cd||(cd={},f(a).unload(cb)),cd[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var cg={},ch,ci,cj=/^(?:toggle|show|hide)$/,ck=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cl,cm=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cn,co=a.webkitRequestAnimationFrame||a.mozRequestAnimationFrame||a.oRequestAnimationFrame;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cr("show",3),a,b,c);for(var g=0,h=this.length;g<h;g++)d=this[g],d.style&&(e=d.style.display,!f._data(d,"olddisplay")&&e==="none"&&(e=d.style.display=""),e===""&&f.css(d,"display")==="none"&&f._data(d,"olddisplay",cs(d.nodeName)));for(g=0;g<h;g++){d=this[g];if(d.style){e=d.style.display;if(e===""||e==="none")d.style.display=f._data(d,"olddisplay")||""}}return this},hide:function(a,b,c){if(a||a===0)return this.animate(cr("hide",3),a,b,c);for(var d=0,e=this.length;d<e;d++)if(this[d].style){var g=f.css(this[d],"display");g!=="none"&&!f._data(this[d],"olddisplay")&&f._data(this[d],"olddisplay",g)}for(d=0;d<e;d++)this[d].style&&(this[d].style.display="none");return this},_toggle:f.fn.toggle,toggle:function(a,b,c){var d=typeof a=="boolean";f.isFunction(a)&&f.isFunction(b)?this._toggle.apply(this,arguments):a==null||d?this.each(function(){var b=d?a:f(this).is(":hidden");f(this)[b?"show":"hide"]()}):this.animate(cr("toggle",3),a,b,c);return this},fadeTo:function(a,b,c,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=f.speed(b,c,d);if(f.isEmptyObject(a))return this.each(e.complete,[!1]);a=f.extend({},a);return this[e.queue===!1?"each":"queue"](function(){e.queue===!1&&f._mark(this);var b=f.extend({},e),c=this.nodeType===1,d=c&&f(this).is(":hidden"),g,h,i,j,k,l,m,n,o;b.animatedProperties={};for(i in a){g=f.camelCase(i),i!==g&&(a[g]=a[i],delete a[i]),h=a[g],f.isArray(h)?(b.animatedProperties[g]=h[1],h=a[g]=h[0]):b.animatedProperties[g]=b.specialEasing&&b.specialEasing[g]||b.easing||"swing";if(h==="hide"&&d||h==="show"&&!d)return b.complete.call(this);c&&(g==="height"||g==="width")&&(b.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY],f.css(this,"display")==="inline"&&f.css(this,"float")==="none"&&(f.support.inlineBlockNeedsLayout?(j=cs(this.nodeName),j==="inline"?this.style.display="inline-block":(this.style.display="inline",this.style.zoom=1)):this.style.display="inline-block"))}b.overflow!=null&&(this.style.overflow="hidden");for(i in a)k=new f.fx(this,b,i),h=a[i],cj.test(h)?k[h==="toggle"?d?"show":"hide":h]():(l=ck.exec(h),m=k.cur(),l?(n=parseFloat(l[2]),o=l[3]||(f.cssNumber[i]?"":"px"),o!=="px"&&(f.style(this,i,(n||1)+o),m=(n||1)/k.cur()*m,f.style(this,i,m+o)),l[1]&&(n=(l[1]==="-="?-1:1)*n+m),k.custom(m,n,o)):k.custom(m,h,""));return!0})},stop:function(a,b){a&&this.queue([]),this.each(function(){var a=f.timers,c=a.length;b||f._unmark(!0,this);while(c--)a[c].elem===this&&(b&&a[c](!0),a.splice(c,1))}),b||this.dequeue();return this}}),f.each({slideDown:cr("show",1),slideUp:cr("hide",1),slideToggle:cr("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){f.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),f.extend({speed:function(a,b,c){var d=a&&typeof a=="object"?f.extend({},a):{complete:c||!c&&b||f.isFunction(a)&&a,duration:a,easing:c&&b||b&&!f.isFunction(b)&&b};d.duration=f.fx.off?0:typeof d.duration=="number"?d.duration:d.duration in f.fx.speeds?f.fx.speeds[d.duration]:f.fx.speeds._default,d.old=d.complete,d.complete=function(a){f.isFunction(d.old)&&d.old.call(this),d.queue!==!1?f.dequeue(this):a!==!1&&f._unmark(this)};return d},easing:{linear:function(a,b,c,d){return c+d*a},swing:function(a,b,c,d){return(-Math.cos(a*Math.PI)/2+.5)*d+c}},timers:[],fx:function(a,b,c){this.options=b,this.elem=a,this.prop=c,b.orig=b.orig||{}}}),f.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this),(f.fx.step[this.prop]||f.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a,b=f.css(this.elem,this.prop);return isNaN(a=parseFloat(b))?!b||b==="auto"?0:b:a},custom:function(a,b,c){function h(a){return d.step(a)}var d=this,e=f.fx,g;this.startTime=cn||cp(),this.start=a,this.end=b,this.unit=c||this.unit||(f.cssNumber[this.prop]?"":"px"),this.now=this.start,this.pos=this.state=0,h.elem=this.elem,h()&&f.timers.push(h)&&!cl&&(co?(cl=!0,g=function(){cl&&(co(g),e.tick())},co(g)):cl=setInterval(e.tick,e.interval))},show:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.show=!0,this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur()),f(this.elem).show()},hide:function(){this.options.orig[this.prop]=f.style(this.elem,this.prop),this.options.hide=!0,this.custom(this.cur(),0)},step:function(a){var b=cn||cp(),c=!0,d=this.elem,e=this.options,g,h;if(a||b>=e.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),e.animatedProperties[this.prop]=!0;for(g in e.animatedProperties)e.animatedProperties[g]!==!0&&(c=!1);if(c){e.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){d.style["overflow"+b]=e.overflow[a]}),e.hide&&f(d).hide();if(e.hide||e.show)for(var i in e.animatedProperties)f.style(d,i,e.orig[i]);e.complete.call(d)}return!1}e.duration==Infinity?this.now=b:(h=b-this.startTime,this.state=h/e.duration,this.pos=f.easing[e.animatedProperties[this.prop]](this.state,h,0,1,e.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){for(var a=f.timers,b=0;b<a.length;++b)a[b]()||a.splice(b--,1);a.length||f.fx.stop()},interval:13,stop:function(){clearInterval(cl),cl=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){f.style(a.elem,"opacity",a.now)},_default:function(a){a.elem.style&&a.elem.style[a.prop]!=null?a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit:a.elem[a.prop]=a.now}}}),f.expr&&f.expr.filters&&(f.expr.filters.animated=function(a){return f.grep(f.timers,function(b){return a===b.elem}).length});var ct=/^t(?:able|d|h)$/i,cu=/^(?:body|html)$/i;"getBoundingClientRect"in c.documentElement?f.fn.offset=function(a){var b=this[0],c;if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);try{c=b.getBoundingClientRect()}catch(d){}var e=b.ownerDocument,g=e.documentElement;if(!c||!f.contains(g,b))return c?{top:c.top,left:c.left}:{top:0,left:0};var h=e.body,i=cv(e),j=g.clientTop||h.clientTop||0,k=g.clientLeft||h.clientLeft||0,l=i.pageYOffset||f.support.boxModel&&g.scrollTop||h.scrollTop,m=i.pageXOffset||f.support.boxModel&&g.scrollLeft||h.scrollLeft,n=c.top+l-j,o=c.left+m-k;return{top:n,left:o}}:f.fn.offset=function(a){var b=this[0];if(a)return this.each(function(b){f.offset.setOffset(this,a,b)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return f.offset.bodyOffset(b);f.offset.initialize();var c,d=b.offsetParent,e=b,g=b.ownerDocument,h=g.documentElement,i=g.body,j=g.defaultView,k=j?j.getComputedStyle(b,null):b.currentStyle,l=b.offsetTop,m=b.offsetLeft;while((b=b.parentNode)&&b!==i&&b!==h){if(f.offset.supportsFixedPosition&&k.position==="fixed")break;c=j?j.getComputedStyle(b,null):b.currentStyle,l-=b.scrollTop,m-=b.scrollLeft,b===d&&(l+=b.offsetTop,m+=b.offsetLeft,f.offset.doesNotAddBorder&&(!f.offset.doesAddBorderForTableAndCells||!ct.test(b.nodeName))&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),e=d,d=b.offsetParent),f.offset.subtractsBorderForOverflowNotVisible&&c.overflow!=="visible"&&(l+=parseFloat(c.borderTopWidth)||0,m+=parseFloat(c.borderLeftWidth)||0),k=c}if(k.position==="relative"||k.position==="static")l+=i.offsetTop,m+=i.offsetLeft;f.offset.supportsFixedPosition&&k.position==="fixed"&&(l+=Math.max(h.scrollTop,i.scrollTop),m+=Math.max(h.scrollLeft,i.scrollLeft));return{top:l,left:m}},f.offset={initialize:function(){var a=c.body,b=c.createElement("div"),d,e,g,h,i=parseFloat(f.css(a,"marginTop"))||0,j="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";f.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"}),b.innerHTML=j,a.insertBefore(b,a.firstChild),d=b.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,this.doesNotAddBorder=e.offsetTop!==5,this.doesAddBorderForTableAndCells=h.offsetTop===5,e.style.position="fixed",e.style.top="20px",this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i,a.removeChild(b),f.offset.initialize=f.noop},bodyOffset:function(a){var b=a.offsetTop,c=a.offsetLeft;f.offset.initialize(),f.offset.doesNotIncludeMarginInBodyOffset&&(b+=parseFloat(f.css(a,"marginTop"))||0,c+=parseFloat(f.css(a,"marginLeft"))||0);return{top:b,left:c}},setOffset:function(a,b,c){var d=f.css(a,"position");d==="static"&&(a.style.position="relative");var e=f(a),g=e.offset(),h=f.css(a,"top"),i=f.css(a,"left"),j=(d==="absolute"||d==="fixed")&&f.inArray("auto",[h,i])>-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cu.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cu.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cv(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cv(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a&&a.style?parseFloat(f.css(a,d,"padding")):null},f.fn["outer"+c]=function(a){var b=this[0];return b&&b.style?parseFloat(f.css(b,d,a?"margin":"border")):null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c];return e.document.compatMode==="CSS1Compat"&&g||e.document.body["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var h=f.css(e,d),i=parseFloat(h);return f.isNaN(i)?h:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f})(window);
\ No newline at end of file diff --git a/lib/scripts/jquery/update.sh b/lib/scripts/jquery/update.sh new file mode 100755 index 000000000..38f38bece --- /dev/null +++ b/lib/scripts/jquery/update.sh @@ -0,0 +1,25 @@ +#!/bin/sh +# +# This script loads the latest jQuery and jQuery-UI 1.* versions from Google's CDN +# +# It also loads the 'smoothness' jQuery-UI theme and all referenced images. +# +# @author Andreas Gohr <andi@splitbrain.org> +# @link https://code.google.com/apis/libraries/devguide.html#jquery + +# load jQuery +wget -nv https://ajax.googleapis.com/ajax/libs/jquery/1/jquery.min.js -O jquery.min.js +wget -nv https://ajax.googleapis.com/ajax/libs/jquery/1/jquery.js -O jquery.js + +# load jQuery-UI +wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/jquery-ui.min.js -O jquery-ui.min.js +wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/jquery-ui.js -O jquery-ui.js + +# load the smoothness theme +mkdir -p jquery-ui-theme/images +wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/themes/smoothness/jquery-ui.css -O jquery-ui-theme/smoothness.css +images=`gawk 'match($0, /url\((images\/[^\)]+)\)/, m) { print m[1] }' jquery-ui-theme/smoothness.css` +for img in $images +do + wget -nv https://ajax.googleapis.com/ajax/libs/jqueryui/1/themes/smoothness/$img -O jquery-ui-theme/$img +done diff --git a/lib/scripts/linkwiz.js b/lib/scripts/linkwiz.js index fec43ad5e..83653c9bb 100644 --- a/lib/scripts/linkwiz.js +++ b/lib/scripts/linkwiz.js @@ -1,58 +1,60 @@ +/*jslint sloppy: true, indent: 4, white: true, browser: true, eqeq: true */ +/*global jQuery, DOKU_BASE, LANG, DOKU_UHC, getSelection, pasteText */ + + /** * The Link Wizard * * @author Andreas Gohr <gohr@cosmocode.de> + * @author Pierre Spring <pierre.spring@caillou.ch> */ -var linkwiz = { - wiz: null, - entry: null, +var dw_linkwiz = { + $wiz: null, + entry: null, result: null, - timer: null, - sack: null, + timer: null, textArea: null, - selected: -1, + selected: null, selection: null, /** - * Initialize the linkwizard by creating the needed HTML + * Initialize the dw_linkwizard by creating the needed HTML * and attaching the eventhandlers */ - init: function(textArea){ - // prepare AJAX object - linkwiz.sack = new sack(DOKU_BASE + 'lib/exe/ajax.php'); - linkwiz.sack.AjaxFailedAlert = ''; - linkwiz.sack.encodeURIString = false; + init: function($editor){ + // position relative to the text area + var pos = $editor.position(); // create HTML Structure - linkwiz.wiz = document.createElement('div'); - linkwiz.wiz.id = 'link__wiz'; - linkwiz.wiz.className = 'picker'; - linkwiz.wiz.style.top = (findPosY(textArea)+20)+'px'; - linkwiz.wiz.style.left = (findPosX(textArea)+80)+'px'; - linkwiz.wiz.style.marginLeft = '-10000px'; - linkwiz.wiz.style.marginTop = '-10000px'; - linkwiz.wiz.style.position = 'absolute'; - - linkwiz.wiz.innerHTML = - '<div id="link__wiz_header">'+ - '<img src="'+DOKU_BASE+'lib/images/close.png" width="16" height="16" align="right" alt="" id="link__wiz_close" />'+ - LANG['linkwiz']+'</div>'+ - '<div>'+LANG['linkto']+' <input type="text" class="edit" id="link__wiz_entry" autocomplete="off" /></div>'+ - '<div id="link__wiz_result"></div>'; - $('dw__editform').parentNode.appendChild(linkwiz.wiz); - linkwiz.textArea = textArea; - linkwiz.result = $('link__wiz_result'); - linkwiz.entry = $('link__wiz_entry'); + dw_linkwiz.$wiz = jQuery(document.createElement('div')) + .attr('id','link__wiz') + .css({ + 'position': 'absolute', + 'top': (pos.top+20)+'px', + 'left': (pos.left+80)+'px', + 'margin-left': '-10000px', + 'margin-top': '-10000px' + }) + .html( + '<div id="link__wiz_header">'+ + '<img src="'+DOKU_BASE+'lib/images/close.png" width="16" height="16" align="right" alt="" id="link__wiz_close" />'+ + LANG.linkwiz+'</div>'+ + '<div>'+LANG.linkto+' <input type="text" class="edit" id="link__wiz_entry" autocomplete="off" /></div>'+ + '<div id="link__wiz_result"></div>' + ) + .addClass('picker'); + + $editor[0].form.parentNode.appendChild(dw_linkwiz.$wiz[0]); + dw_linkwiz.textArea = $editor[0]; + dw_linkwiz.result = jQuery('#link__wiz_result')[0]; + dw_linkwiz.entry = jQuery('#link__wiz_entry')[0]; // attach event handlers - var obj; - obj = $('link__wiz_close'); - obj.onclick = linkwiz.hide; - - linkwiz.sack.elementObj = linkwiz.result; - addEvent(linkwiz.entry,'keyup',linkwiz.onEntry); - addEvent(linkwiz.result,'click',linkwiz.onResultClick); - drag.attach(linkwiz.wiz,$('link__wiz_header')); + jQuery('#link__wiz_close').click(dw_linkwiz.hide); + jQuery(dw_linkwiz.entry).keyup(dw_linkwiz.onEntry); + jQuery(dw_linkwiz.result).click(dw_linkwiz.onResultClick); + + dw_linkwiz.$wiz.draggable({handle: '#link__wiz_header'}); }, /** @@ -63,51 +65,50 @@ var linkwiz = { return true; //ignore } if(e.keyCode == 27){ - linkwiz.hide(); + dw_linkwiz.hide(); e.preventDefault(); e.stopPropagation(); return false; } if(e.keyCode == 38){ //Up - linkwiz.select(linkwiz.selected -1); + dw_linkwiz.select(dw_linkwiz.selected -1); e.preventDefault(); e.stopPropagation(); return false; } if(e.keyCode == 40){ //Down - linkwiz.select(linkwiz.selected +1); + dw_linkwiz.select(dw_linkwiz.selected +1); e.preventDefault(); e.stopPropagation(); return false; } if(e.keyCode == 13){ //Enter - if(linkwiz.selected > -1){ - var obj = linkwiz.getResult(linkwiz.selected); + if(dw_linkwiz.selected > -1){ + var obj = dw_linkwiz.getResult(dw_linkwiz.selected); if(obj){ - var a = obj.getElementsByTagName('A')[0]; - linkwiz.resultClick(a); + var a = jQuery(obj).find('a')[0]; + dw_linkwiz.resultClick(a); } - }else if(linkwiz.entry.value){ - linkwiz.insertLink(linkwiz.entry.value); + }else if(dw_linkwiz.entry.value){ + dw_linkwiz.insertLink(dw_linkwiz.entry.value); } e.preventDefault(); e.stopPropagation(); return false; } - linkwiz.autocomplete(); + dw_linkwiz.autocomplete(); }, /** - * Get one of the result by index + * Get one of the results by index * * @param int result div to return * @returns DOMObject or null */ getResult: function(num){ - var obj; - var childs = linkwiz.result.getElementsByTagName('DIV'); - obj = childs[num]; + var childs = jQuery(dw_linkwiz.result).find('div'); + var obj = childs[num]; if(obj){ return obj; }else{ @@ -120,29 +121,29 @@ var linkwiz = { */ select: function(num){ if(num < 0){ - linkwiz.deselect(); + dw_linkwiz.deselect(); return; } - var obj = linkwiz.getResult(num); + var obj = dw_linkwiz.getResult(num); if(obj){ - linkwiz.deselect(); + dw_linkwiz.deselect(); obj.className += ' selected'; // make sure the item is viewable in the scroll view // FIXME check IE compatibility - if(obj.offsetTop > linkwiz.result.scrollTop + linkwiz.result.clientHeight){ - linkwiz.result.scrollTop += obj.clientHeight; - }else if(obj.offsetTop - linkwiz.result.clientHeight < linkwiz.result.scrollTop){ // this works but isn't quite right, fixes welcome - linkwiz.result.scrollTop -= obj.clientHeight; + if(obj.offsetTop > dw_linkwiz.result.scrollTop + dw_linkwiz.result.clientHeight){ + dw_linkwiz.result.scrollTop += obj.clientHeight; + }else if(obj.offsetTop - dw_linkwiz.result.clientHeight < dw_linkwiz.result.scrollTop){ // this works but isn't quite right, fixes welcome + dw_linkwiz.result.scrollTop -= obj.clientHeight; } // now recheck - if still not in view, the user used the mouse to scroll - if( (obj.offsetTop > linkwiz.result.scrollTop + linkwiz.result.clientHeight) || - (obj.offsetTop < linkwiz.result.scrollTop) ){ + if( (obj.offsetTop > dw_linkwiz.result.scrollTop + dw_linkwiz.result.clientHeight) || + (obj.offsetTop < dw_linkwiz.result.scrollTop) ){ obj.scrollIntoView(); } - linkwiz.selected = num; + dw_linkwiz.selected = num; } }, @@ -150,13 +151,13 @@ var linkwiz = { * deselect a result if any is selected */ deselect: function(){ - if(linkwiz.selected > -1){ - var obj = linkwiz.getResult(linkwiz.selected); + if(dw_linkwiz.selected > -1){ + var obj = dw_linkwiz.getResult(dw_linkwiz.selected); if(obj){ obj.className = obj.className.replace(/ ?selected/,''); } } - linkwiz.selected = -1; + dw_linkwiz.selected = -1; }, /** @@ -167,7 +168,7 @@ var linkwiz = { if(e.target.tagName != 'A') return; e.stopPropagation(); e.preventDefault(); - linkwiz.resultClick(e.target); + dw_linkwiz.resultClick(e.target); return false; }, @@ -175,31 +176,34 @@ var linkwiz = { * Handles the "click" on a given result anchor */ resultClick: function(a){ + var L = dw_linkwiz; var id = a.title; if(id == '' || id.substr(id.length-1) == ':'){ - linkwiz.entry.value = id; - linkwiz.autocomplete_exec(); + L.entry.value = id; + L.autocomplete_exec(); }else{ - linkwiz.entry.value = id; + L.entry.value = id; if(a.nextSibling && a.nextSibling.tagName == 'SPAN'){ - linkwiz.insertLink(a.nextSibling.innerHTML); + L.insertLink(a.nextSibling.innerHTML); }else{ - linkwiz.insertLink(''); + L.insertLink(''); } } }, /** * Insert the id currently in the entry box to the textarea, - * replacing the current selection or at the curso postion. + * replacing the current selection or at the cursor position. * When no selection is available the given title will be used * as link title instead */ insertLink: function(title){ - if(!linkwiz.entry.value) return; + var L = dw_linkwiz; + var E = L.entry; + if(!E.value) return; - var sel = getSelection(linkwiz.textArea); - if(sel.start == 0 && sel.end == 0) sel = linkwiz.selection; + var sel = getSelection(L.textArea); + if(sel.start == 0 && sel.end == 0) sel = L.selection; var stxt = sel.getText(); @@ -212,22 +216,22 @@ var linkwiz = { if(!stxt && !DOKU_UHC) stxt=title; // prepend colon inside namespaces for non namespace pages - if(linkwiz.textArea.form['id'].value.indexOf(':') != -1 && - linkwiz.entry.value.indexOf(':') == -1){ - linkwiz.entry.value = ':'+linkwiz.entry.value; + if(L.textArea.form['id'].value.indexOf(':') != -1 && + E.value.indexOf(':') == -1){ + E.value = ':'+E.value; } - var link = '[['+linkwiz.entry.value+'|'; + var link = '[['+E.value+'|'; if(stxt) link += stxt; link += ']]'; - var so = linkwiz.entry.value.length+3; + var so = E.value.length+3; var eo = 2; pasteText(sel,link,{startofs: so, endofs: eo}); - linkwiz.hide(); + L.hide(); // reset the entry to the parent namespace and remove : at the beginning - linkwiz.entry.value = linkwiz.entry.value.replace(/(^:)?[^:]*$/, ''); + E.value = E.value.replace(/(^:)?[^:]*$/, ''); }, /** @@ -236,60 +240,67 @@ var linkwiz = { * Calls autocomplete_exec when the timer runs out */ autocomplete: function(){ - if(linkwiz.timer !== null){ - window.clearTimeout(linkwiz.timer); - linkwiz.timer = null; + if(dw_linkwiz.timer !== null){ + window.clearTimeout(dw_linkwiz.timer); + dw_linkwiz.timer = null; } - linkwiz.timer = window.setTimeout(linkwiz.autocomplete_exec,350); + dw_linkwiz.timer = window.setTimeout(dw_linkwiz.autocomplete_exec,350); }, /** * Executes the AJAX call for the page/namespace lookup */ autocomplete_exec: function(){ - linkwiz.deselect(); - linkwiz.result.innerHTML = '<img src="'+DOKU_BASE+'lib/images/throbber.gif" alt="" width="16" height="16" />'; - linkwiz.sack.runAJAX('call=linkwiz&q='+encodeURI(linkwiz.entry.value)); + dw_linkwiz.deselect(); + dw_linkwiz.result.innerHTML = '<img src="'+DOKU_BASE+'lib/images/throbber.gif" alt="" width="16" height="16" />'; + + // because we need to use POST, we + // can not use the .load() function. + jQuery.post( + DOKU_BASE + 'lib/exe/ajax.php', + { + call: 'linkwiz', + q: dw_linkwiz.entry.value + }, + function (data) { + dw_linkwiz.result.innerHTML = data; + }, + 'html' + ); }, /** - * Clears the result area - */ - clear: function(){ - linkwiz.result.innerHTML = 'Search for a matching page name above, or browse through the pages on the right'; - linkwiz.entry.value = ''; - }, - - /** - * Show the linkwizard + * Show the link wizard */ show: function(){ - linkwiz.selection = getSelection(linkwiz.textArea); - linkwiz.wiz.style.marginLeft = '0px'; - linkwiz.wiz.style.marginTop = '0px'; - linkwiz.entry.focus(); - linkwiz.autocomplete(); + var L = dw_linkwiz; + L.selection = getSelection(dw_linkwiz.textArea); + L.$wiz.css('marginLeft', '0'); + L.$wiz.css('marginTop', '0'); + L.entry.focus(); + L.autocomplete(); }, /** * Hide the link wizard */ hide: function(){ - linkwiz.wiz.style.marginLeft = '-10000px'; - linkwiz.wiz.style.marginTop = '-10000px'; - linkwiz.textArea.focus(); + var L = dw_linkwiz; + L.$wiz.css('marginLeft', '-10000px'); + L.$wiz.css('marginTop', '-10000px'); + L.textArea.focus(); }, /** * Toggle the link wizard */ toggle: function(){ - if(linkwiz.wiz.style.marginLeft == '-10000px'){ - linkwiz.show(); + if(dw_linkwiz.$wiz.css('marginLeft') == '-10000px'){ + dw_linkwiz.show(); }else{ - linkwiz.hide(); + dw_linkwiz.hide(); } } -}; +}; diff --git a/lib/scripts/locktimer.js b/lib/scripts/locktimer.js new file mode 100644 index 000000000..60508a8e7 --- /dev/null +++ b/lib/scripts/locktimer.js @@ -0,0 +1,110 @@ +/** +* Class managing the timer to display a warning on a expiring lock +*/ +var locktimer = { + sack: null, + timeout: 0, + timerID: null, + lasttime: null, + msg: '', + pageid: '', + + init: function(timeout,msg,draft,edid){ + var edit = $(edid); + if(!edit) return; + if(edit.readOnly) return; + + // init values + this.timeout = timeout*1000; + this.msg = msg; + this.draft = draft; + this.lasttime = new Date(); + + if(jQuery('#dw__editform').length == 0) return; + this.pageid = jQuery('#dw__editform input[name=id]').val(); + if(!this.pageid) return; + + if(jQuery('#wiki__text').attr('readonly')) return; + + // register refresh event + jQuery('#dw__editform').keypress( + function() { + locktimer.refresh(); + } + ); + // start timer + this.reset(); + }, + + /** + * (Re)start the warning timer + */ + reset: function(){ + this.clear(); + this.timerID = window.setTimeout("locktimer.warning()", this.timeout); + }, + + /** + * Display the warning about the expiring lock + */ + warning: function(){ + this.clear(); + alert(this.msg); + }, + + /** + * Remove the current warning timer + */ + clear: function(){ + if(this.timerID !== null){ + window.clearTimeout(this.timerID); + this.timerID = null; + } + }, + + /** + * Refresh the lock via AJAX + * + * Called on keypresses in the edit area + */ + refresh: function(){ + var now = new Date(); + var params = {}; + // refresh every minute only + if(now.getTime() - this.lasttime.getTime() > 30*1000){ + params['call'] = 'lock'; + params['id'] = locktimer.pageid; + + if(locktimer.draft && jQuery('#dw__editform textarea[name=wikitext]').length > 0){ + params['prefix'] = jQuery('#dw__editform input[name=prefix]').val(); + params['wikitext'] = jQuery('#dw__editform textarea[name=wikitext]').val(); + params['suffix'] = jQuery('#dw__editform input[name=suffix]').val(); + if(jQuery('#dw__editform input[name=date]').length > 0) { + params['date'] = jQuery('#dw__editform input[name=id]').val(); + } + } + + jQuery.post( + DOKU_BASE + 'lib/exe/ajax.php', + params, + function (data) { + locktimer.refreshed(data); + }, + 'html' + ); + this.lasttime = now; + } + }, + + /** + * Callback. Resets the warning timer + */ + refreshed: function(data){ + var error = data.charAt(0); + data = data.substring(1); + + jQuery('#draft__status').html(data); + if(error != '1') return; // locking failed + this.reset(); + } +}; diff --git a/lib/scripts/media.js b/lib/scripts/media.js index b90f7047b..1402ad4bf 100644 --- a/lib/scripts/media.js +++ b/lib/scripts/media.js @@ -1,777 +1,524 @@ +/*jslint white: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: false, strict: true, newcap: true, immed: true, sloppy: true, browser: true */ +/*global jQuery, DOKU_BASE, LANG, bind, DokuCookie, opener, confirm*/ + /** * JavaScript functionality for the media management popup * * @author Andreas Gohr <andi@splitbrain.org> + * @author Pierre Spring <pierre.spring@caillou.ch> */ -var media_manager = { + +var dw_mediamanager = { keepopen: false, hide: false, - align: false, popup: false, - id: false, display: false, - link: false, - size: false, ext: false, + $popup: null, - /** - * Attach event handlers to all "folders" below the given element - * - * @author Andreas Gohr <andi@splitbrain.org> - */ - treeattach: function(obj){ - if(!obj) return; - - var items = obj.getElementsByTagName('li'); - for(var i=0; i<items.length; i++){ - var elem = items[i]; - - // attach action to make the +/- clickable - var clicky = elem.getElementsByTagName('img')[0]; - clicky.style.cursor = 'pointer'; - addEvent(clicky,'click',function(event){ return media_manager.toggle(event,this); }); - - // attach action load folder list via AJAX - var link = elem.getElementsByTagName('a')[0]; - link.style.cursor = 'pointer'; - addEvent(link,'click',function(event){ return media_manager.list(event,this); }); - } + // Image insertion opts + align: false, + link: false, + size: false, + forbidden_opts: {}, + + init: function () { + var $content, $tree; + $content = jQuery('#media__content'); + $tree = jQuery('#media__tree'); + + dw_mediamanager.prepare_content($content); + + dw_mediamanager.attachoptions(); + dw_mediamanager.initpopup(); + + // add the action to autofill the "upload as" field + $content.delegate('#upload__file', 'change', dw_mediamanager.suggest) + // Attach the image selector action to all links + .delegate('a.select', 'click', dw_mediamanager.select) + // Attach deletion confirmation dialog to the delete buttons + .delegate('#media__content a.btn_media_delete', 'click', + dw_mediamanager.confirmattach); + + $tree.dw_tree({toggle_selector: 'img', + load_data: function (show_sublist, $clicky) { + // get the enclosed link (is always the first one) + var $link = $clicky.parent().find('div.li a.idx_dir'); + + jQuery.post( + DOKU_BASE + 'lib/exe/ajax.php', + $link[0].search.substr(1) + '&call=medians', + show_sublist, + 'html' + ); + }, + + toggle_display: function ($clicky, opening) { + $clicky.attr('src', + DOKU_BASE + 'lib/images/' + + (opening ? 'minus' : 'plus') + '.gif'); + }}); + $tree.delegate('a', 'click', dw_mediamanager.list); }, /** - * Attach the image selector action to all links below the given element - * also add the action to autofill the "upload as" field + * build the popup window * - * @author Andreas Gohr <andi@splitbrain.org> + * @author Dominik Eckelmann <eckelmann@cosmocode.de> */ - selectorattach: function(obj){ - if(!obj) return; - - var items = getElementsByClass('select',obj,'a'); - for(var i=0; i<items.length; i++){ - var elem = items[i]; - elem.style.cursor = 'pointer'; - addEvent(elem,'click',function(event){ return media_manager.select(event,this); }); - } + initpopup: function () { + var opts, $insp, $insbtn; + + dw_mediamanager.$popup = jQuery(document.createElement('div')) + .attr('id', 'media__popup_content') + .dialog({autoOpen: false, width: 280, modal: true, + draggable: true, title: LANG.mediatitle, + resizable: false}); + + opts = [{id: 'link', label: LANG.mediatarget, + btns: ['lnk', 'direct', 'nolnk', 'displaylnk']}, + {id: 'align', label: LANG.mediaalign, + btns: ['noalign', 'left', 'center', 'right']}, + {id: 'size', label: LANG.mediasize, + btns: ['small', 'medium', 'large', 'original']} + ]; + + jQuery.each(opts, function (_, opt) { + var $p, $l; + $p = jQuery(document.createElement('p')) + .attr('id', 'media__' + opt.id); + + if (dw_mediamanager.display === "2") { + $p.hide(); + } - // hide syntax example - items = getElementsByClass('example',obj,'div'); - for(var i=0; i<items.length; i++){ - elem = items[i]; - elem.style.display = 'none'; - } + $l = jQuery(document.createElement('label')) + .text(opt.label); + $p.append($l); - var file = $('upload__file'); - if(!file) return; - addEvent(file,'change',media_manager.suggest); - }, + jQuery.each(opt.btns, function (i, text) { + var $btn, $img; + $btn = jQuery(document.createElement('button')) + .addClass('button') + .attr('id', "media__" + opt.id + "btn" + (i + 1)) + .attr('title', LANG['media' + text]) + .click(bind(dw_mediamanager.setOpt, opt.id)); - /** - * Attach deletion confirmation dialog to the delete buttons. - * - * Michael Klier <chi@chimeric.de> - */ - confirmattach: function(obj){ - if(!obj) return; - - items = getElementsByClass('btn_media_delete',obj,'a'); - for(var i=0; i<items.length; i++){ - var elem = items[i]; - addEvent(elem,'click',function(e){ - if(e.target.tagName == 'IMG'){ - var name = e.target.parentNode.title; - }else{ - var name = e.target.title; - } - if(!confirm(LANG['del_confirm'] + "\n" + name)) { - e.preventDefault(); - return false; - } else { - return true; - } + $img = jQuery(document.createElement('img')) + .attr('src', DOKU_BASE + 'lib/images/media_' + + opt.id + '_' + text + '.png'); + + $btn.append($img); + $p.append($btn); }); - } + + dw_mediamanager.$popup.append($p); + }); + + // insert button + $insp = jQuery(document.createElement('p')) + .addClass('btnlbl'); + dw_mediamanager.$popup.append($insp); + + $insbtn = jQuery(document.createElement('input')) + .attr('id', 'media__sendbtn') + .attr('type', 'button') + .addClass('button') + .val(LANG.mediainsert); + $insp.append($insbtn); }, /** - * Creates checkboxes for additional options + * Insert the clicked image into the opener's textarea * * @author Andreas Gohr <andi@splitbrain.org> + * @author Dominik Eckelmann <eckelmann@cosmocode.de> + * @author Pierre Spring <pierre.spring@caillou.ch> */ - attachoptions: function(obj){ - if(!obj) return; + insert: function (id) { + var opts, alignleft, alignright, edid, s; - // keep open - if(opener){ - var kobox = document.createElement('input'); - kobox.type = 'checkbox'; - kobox.id = 'media__keepopen'; - if(DokuCookie.getValue('keepopen')){ - kobox.checked = true; - kobox.defaultChecked = true; //IE wants this - media_manager.keepopen = true; - } - addEvent(kobox,'click',function(event){ return media_manager.togglekeepopen(event,this); }); + // set syntax options + dw_mediamanager.$popup.dialog('close'); - var kolbl = document.createElement('label'); - kolbl.htmlFor = 'media__keepopen'; - kolbl.innerHTML = LANG['keepopen']; + opts = ''; + alignleft = ''; + alignright = ''; - var kobr = document.createElement('br'); + if ({img: 1, swf: 1}[dw_mediamanager.ext] === 1) { - obj.appendChild(kobox); - obj.appendChild(kolbl); - obj.appendChild(kobr); - } + if (dw_mediamanager.link === '4') { + opts = '?linkonly'; + } else { - // hide details - var hdbox = document.createElement('input'); - hdbox.type = 'checkbox'; - hdbox.id = 'media__hide'; - if(DokuCookie.getValue('hide')){ - hdbox.checked = true; - hdbox.defaultChecked = true; //IE wants this - media_manager.hide = true; - } - addEvent(hdbox,'click',function(event){ return media_manager.togglehide(event,this); }); + if (dw_mediamanager.link === "3" && dw_mediamanager.ext === 'img') { + opts = '?nolink'; + } else if (dw_mediamanager.link === "2" && dw_mediamanager.ext === 'img') { + opts = '?direct'; + } - var hdlbl = document.createElement('label'); - hdlbl.htmlFor = 'media__hide'; - hdlbl.innerHTML = LANG['hidedetails']; + s = parseInt(dw_mediamanager.size, 10); - var hdbr = document.createElement('br'); + if (s && s >= 1 && s < 4) { + opts += (opts.length)?'&':'?'; + opts += dw_mediamanager.size + '00'; + if (dw_mediamanager.ext === 'swf') { + switch (s) { + case 1: + opts += 'x62'; + break; + case 2: + opts += 'x123'; + break; + case 3: + opts += 'x185'; + break; + } + } + } + alignleft = dw_mediamanager.align === '2' ? '' : ' '; + alignright = dw_mediamanager.align === '4' ? '' : ' '; + } + } + edid = String.prototype.match.call(document.location, /&edid=([^&]+)/); + opener.insertTags(edid ? edid[1] : 'wiki__text', + '{{'+alignleft+id+opts+alignright+'|','}}',''); - obj.appendChild(hdbox); - obj.appendChild(hdlbl); - obj.appendChild(hdbr); - media_manager.updatehide(); + if(!dw_mediamanager.keepopen) { + window.close(); + } + opener.focus(); + return false; }, /** - * Toggles the keep open state + * Prefills the wikiname. * * @author Andreas Gohr <andi@splitbrain.org> */ - togglekeepopen: function(event,cb){ - if(cb.checked){ - DokuCookie.setValue('keepopen',1); - media_manager.keepopen = true; - }else{ - DokuCookie.setValue('keepopen',''); - media_manager.keepopen = false; + suggest: function(){ + var $file, $name, text; + + $file = jQuery(this); + $name = jQuery('#upload__name'); + if(!$file.length || !$name.length) { + return; } + + text = $file.val(); + text = text.substr(text.lastIndexOf('/')+1); + text = text.substr(text.lastIndexOf('\\')+1); + $name.val(text); }, /** - * Toggles the hide details state + * list the content of a namespace using AJAX * * @author Andreas Gohr <andi@splitbrain.org> + * @author Pierre Spring <pierre.spring@caillou.ch> */ - togglehide: function(event,cb){ - if(cb.checked){ - DokuCookie.setValue('hide',1); - media_manager.hide = true; - }else{ - DokuCookie.setValue('hide',''); - media_manager.hide = false; - } - media_manager.updatehide(); + list: function (event) { + var $link, $content; + + event.preventDefault(); + + jQuery('div.success, div.info, div.error, div.notify').remove(); + + $link = jQuery(this); + $content = jQuery('#media__content'); + $content.html('<img src="' + DOKU_BASE + 'lib/images/loading.gif" alt="..." class="load" />'); + + // fetch the subtree + jQuery.post( + DOKU_BASE + 'lib/exe/ajax.php', + $link[0].search.substr(1)+'&call=medialist', + function (data) { + $content.html(data); + dw_mediamanager.prepare_content($content); + dw_mediamanager.updatehide(); + }, + 'html' + ); }, - /** - * Sets the visibility of the image details accordingly to the - * chosen hide state - * - * @author Andreas Gohr <andi@splitbrain.org> - */ - updatehide: function(){ - var obj = $('media__content'); - if(!obj) return; - var details = getElementsByClass('detail',obj,'div'); - for(var i=0; i<details.length; i++){ - if(media_manager.hide){ - details[i].style.display = 'none'; - }else{ - details[i].style.display = ''; - } - } + prepare_content: function ($content) { + // hide syntax example + $content.find('div.example:visible').hide(); + dw_mediamanager.initFlashUpload(); }, /** * shows the popup for a image link */ - select: function(event,link){ - var id = link.name.substr(2); + select: function(event){ + var $link, id, dot, ext; + + event.preventDefault(); + + $link = jQuery(this); + id = $link.attr('name').substr(2); - media_manager.id = id; if(!opener){ // if we don't run in popup display example - var ex = $('ex'+id.replace(/:/g,'_')); - if(ex.style.display == ''){ - ex.style.display = 'none'; - } else { - ex.style.display = ''; - } - return false; + // the id's are a bit wierd and jQuery('#ex_wiki_dokuwiki-128.png') + // will not be found by Sizzle (the CSS Selector Engine + // used by jQuery), hence the document.getElementById() call + jQuery(document.getElementById('ex_'+id.replace(/:/g,'_').replace(/^_/,''))).dw_toggle(); + return; } - media_manager.ext = false; - var dot = id.lastIndexOf("."); - if (dot != -1) { - var ext = id.substr(dot,id.length); + dw_mediamanager.ext = false; + dot = id.lastIndexOf("."); - if (ext != '.jpg' && ext != '.jpeg' && ext != '.png' && ext != '.gif' && ext != '.swf') { - media_manager.insert(null); - return false; - } - } else { - media_manager.insert(null); - return false; + if (-1 === dot) { + dw_mediamanager.insert(id); + return; } - media_manager.popup.style.display = 'inline'; - media_manager.popup.style.left = event.pageX + 'px'; - media_manager.popup.style.top = event.pageY + 'px'; + ext = id.substr(dot); - // set all buttons to outset - for (var i = 1; i < 5; i++) { - media_manager.outSet('media__linkbtn' + i); - media_manager.outSet('media__alignbtn' + i); - media_manager.outSet('media__sizebtn' + i); + if ({'.jpg':1, '.jpeg':1, '.png':1, '.gif':1, '.swf':1}[ext] !== 1) { + dw_mediamanager.insert(id); + return; } - if (ext == '.swf') { - media_manager.ext = 'swf'; - - // disable display buttons for detail and linked image - $('media__linkbtn1').style.display = 'none'; - $('media__linkbtn2').style.display = 'none'; - - // set the link button to default - if (media_manager.link !== false) { - if ( media_manager.link == '2' || media_manager.link == '1') { - media_manager.inSet('media__linkbtn3'); - media_manager.link = '3'; - DokuCookie.setValue('link','3'); - } else { - media_manager.inSet('media__linkbtn'+media_manager.link); - } - } else if (DokuCookie.getValue('link')) { - if ( DokuCookie.getValue('link') == '2' || DokuCookie.getValue('link') == '1') { - // this options are not availible - media_manager.inSet('media__linkbtn3'); - media_manager.link = '3'; - DokuCookie.setValue('link','3'); - } else { - media_manager.inSet('media__linkbtn'+DokuCookie.getValue('link')); - media_manager.link = DokuCookie.getValue('link'); - } - } else { - // default case - media_manager.link = '3'; - media_manager.inSet('media__linkbtn3'); - DokuCookie.setValue('link','3'); - } - - // disable button for original size - $('media__sizebtn4').style.display = 'none'; - if (media_manager.size == 4) { - media_manager.size = 2; - DokuCookie.setValue('size', '2'); - media_manager.inSet('media__sizebtn2'); - } + // remove old callback from the insert button and set the new one. + jQuery('#media__sendbtn').unbind().click(bind(dw_mediamanager.insert, id)); + dw_mediamanager.unforbid('ext'); + if (ext === '.swf') { + dw_mediamanager.ext = 'swf'; + dw_mediamanager.forbid('ext', {link: ['1', '2'], + size: ['4']}); } else { - media_manager.ext = 'img'; - - // ensure that the display buttons are there - $('media__linkbtn1').style.display = 'inline'; - $('media__linkbtn2').style.display = 'inline'; - $('media__sizebtn4').style.display = 'inline'; - - // set the link button to default - if (DokuCookie.getValue('link')) { - media_manager.link = DokuCookie.getValue('link'); - } - if (!media_manager.link) { - // default case - media_manager.link = '1'; - DokuCookie.setValue('link','1'); - } - media_manager.inSet('media__linkbtn'+media_manager.link); + dw_mediamanager.ext = 'img'; } - if (media_manager.link == '4') { - media_manager.align = false; - media_manager.size = false; - $('media__align').style.display = 'none'; - $('media__size').style.display = 'none'; - } else { - $('media__align').style.display = 'block'; - $('media__size').style.display = 'block'; - - // set the align button to default - if (media_manager.align !== false) { - media_manager.inSet('media__alignbtn'+media_manager.align); - } else if (DokuCookie.getValue('align')) { - media_manager.inSet('media__alignbtn'+DokuCookie.getValue('align')); - media_manager.align = DokuCookie.getValue('align'); - } else { - // default case - media_manager.align = '1'; - media_manager.inSet('media__alignbtn1'); - DokuCookie.setValue('align','1'); - } + // Set to defaults + dw_mediamanager.setOpt('link'); + dw_mediamanager.setOpt('align'); + dw_mediamanager.setOpt('size'); - // set the size button to default - if (DokuCookie.getValue('size')) { - media_manager.size = DokuCookie.getValue('size'); - } - if (!media_manager.size || (media_manager.size === '4' && ext === '.swf')) { - // default case - media_manager.size = '2'; - DokuCookie.setValue('size','2'); - } - media_manager.inSet('media__sizebtn'+media_manager.size); + // toggle buttons for detail and linked image, original size + jQuery('#media__linkbtn1, #media__linkbtn2, #media__sizebtn4') + .toggle(dw_mediamanager.ext === 'img'); - $('media__sendbtn').focus(); - } + dw_mediamanager.$popup.dialog('open'); - return false; + jQuery('#media__sendbtn').focus(); }, /** - * build the popup window + * Deletion confirmation dialog to the delete buttons. * - * @author Dominik Eckelmann <eckelmann@cosmocode.de> + * @author Michael Klier <chi@chimeric.de> + * @author Pierre Spring <pierre.spring@caillou.ch> */ - initpopup: function() { - - media_manager.popup = document.createElement('div'); - media_manager.popup.setAttribute('id','media__popup'); - media_manager.popup.style.display = 'none'; - - var root = document.getElementById('media__manager'); - if (root === null) return; - root.appendChild(media_manager.popup); - - var headline = document.createElement('h1'); - headline.innerHTML = LANG.mediatitle; - var headlineimg = document.createElement('img'); - headlineimg.src = DOKU_BASE + 'lib/images/close.png'; - headlineimg.id = 'media__closeimg'; - addEvent(headlineimg,'click',function(event){ return media_manager.closePopup(event,this); }); - headline.insertBefore(headlineimg, headline.firstChild); - media_manager.popup.appendChild(headline); - drag.attach(media_manager.popup,headline); - - // link - - var linkp = document.createElement('p'); - - linkp.id = "media__linkstyle"; - if (media_manager.display == "2") { - linkp.style.display = "none"; - } - - var linkl = document.createElement('label'); - linkl.innerHTML = LANG.mediatarget; - linkp.appendChild(linkl); - - var linkbtns = ['lnk', 'direct', 'nolnk', 'displaylnk']; - for (var i = 0 ; i < linkbtns.length ; ++i) { - var linkbtn = document.createElement('button'); - linkbtn.className = 'button'; - linkbtn.id = "media__linkbtn" + (i+1); - linkbtn.title = LANG['media' + linkbtns[i]]; - linkbtn.style.borderStyle = 'outset'; - addEvent(linkbtn,'click',function(event){ return media_manager.setlink(event,this); }); - - var linkimg = document.createElement('img'); - linkimg.src = DOKU_BASE + 'lib/images/media_link_' + linkbtns[i] + '.png'; - - linkbtn.appendChild(linkimg); - linkp.appendChild(linkbtn); + confirmattach: function(e){ + if(!confirm(LANG.del_confirm + "\n" + jQuery(this).attr('title'))) { + e.preventDefault(); } + }, - media_manager.popup.appendChild(linkp); - - // align - - var alignp = document.createElement('p'); - var alignl = document.createElement('label'); + /** + * Creates checkboxes for additional options + * + * @author Andreas Gohr <andi@splitbrain.org> + * @author Pierre Spring <pierre.spring@caillou.ch> + */ + attachoptions: function(){ + var $obj, opts; - alignp.appendChild(alignl); - alignp.id = 'media__align'; - if (media_manager.display == "2") { - alignp.style.display = "none"; + $obj = jQuery('#media__opts'); + if($obj.length === 0) { + return; } - alignl.innerHTML = LANG['mediaalign']; - - var alignbtns = ['noalign', 'left', 'center', 'right']; - for (var n = 0 ; n < alignbtns.length ; ++n) { - var alignbtn = document.createElement('button'); - var alignimg = document.createElement('img'); - alignimg.src = DOKU_BASE + 'lib/images/media_align_' + alignbtns[n] + '.png'; - - alignbtn.id = "media__alignbtn" + (n+1); - alignbtn.title = LANG['media' + alignbtns[n]]; - alignbtn.className = 'button'; - alignbtn.appendChild(alignimg); - alignbtn.style.borderStyle = 'outset'; - addEvent(alignbtn,'click',function(event){ return media_manager.setalign(event,this); }); - - alignp.appendChild(alignbtn); - } - - media_manager.popup.appendChild(alignp); - - // size - - var sizep = document.createElement('p'); - var sizel = document.createElement('label'); - sizep.id = 'media__size'; - if (media_manager.display == "2") { - sizep.style.display = "none"; - } - sizep.appendChild(sizel); - sizel.innerHTML = LANG['mediasize']; - - var sizebtns = ['small', 'medium', 'large', 'original']; - for (var size = 0 ; size < sizebtns.length ; ++size) { - var sizebtn = document.createElement('button'); - var sizeimg = document.createElement('img'); - - sizep.appendChild(sizebtn); - sizeimg.src = DOKU_BASE + 'lib/images/media_size_' + sizebtns[size] + '.png'; - - sizebtn.className = 'button'; - sizebtn.appendChild(sizeimg); - sizebtn.id = 'media__sizebtn' + (size + 1); - sizebtn.title = LANG['media' + sizebtns[size]]; - sizebtn.style.borderStyle = 'outset'; - addEvent(sizebtn,'click',function(event){ return media_manager.setsize(event,this); }); + opts = []; + // keep open + if(opener){ + opts.push(['keepopen', 'keepopen']); } + opts.push(['hide', 'hidedetails']); + + jQuery.each(opts, + function(_, opt) { + var $box, $lbl; + $box = jQuery(document.createElement('input')) + .attr('type', 'checkbox') + .attr('id', 'media__' + opt[0]) + .click(bind(dw_mediamanager.toggleOption, + opt[0])); + + if(DokuCookie.getValue(opt[0])){ + $box.prop('checked', true); + dw_mediamanager[opt[0]] = true; + } - media_manager.popup.appendChild(sizep); - - // send and close button + $lbl = jQuery(document.createElement('label')) + .attr('for', 'media__' + opt[0]) + .text(LANG[opt[1]]); - var btnp = document.createElement('p'); - media_manager.popup.appendChild(btnp); - btnp.setAttribute('class','btnlbl'); + $obj.append($box, $lbl, document.createElement('br')); + }); - var btn = document.createElement('input'); - btn.type = 'button'; - btn.id = 'media__sendbtn'; - btn.setAttribute('class','button'); - btn.value = LANG['mediainsert']; - btnp.appendChild(btn); - addEvent(btn,'click',function(event){ return media_manager.insert(event); }); + dw_mediamanager.updatehide(); }, /** - * Insert the clicked image into the opener's textarea + * Generalized toggler * - * @author Andreas Gohr <andi@splitbrain.org> - * @author Dominik Eckelmann <eckelmann@cosmocode.de> + * @author Pierre Spring <pierre.spring@caillou.ch> */ - insert: function(event){ - var id = media_manager.id; - // set syntax options - $('media__popup').style.display = 'none'; - - var opts = ''; - var optsstart = ''; - var alignleft = ''; - var alignright = ''; - - if (media_manager.ext == 'img' || media_manager.ext == 'swf') { - - if (media_manager.link == '4') { - opts = '?linkonly'; - } else { + toggleOption: function (variable) { + if (jQuery(this).prop('checked')) { + DokuCookie.setValue(variable, 1); + dw_mediamanager[variable] = true; + } else { + DokuCookie.setValue(variable, ''); + dw_mediamanager[variable] = false; + } + if (variable === 'hide') { + dw_mediamanager.updatehide(); + } + }, - if (media_manager.link == "3" && media_manager.ext == 'img') { - opts = '?nolink'; - optsstart = true; - } else if (media_manager.link == "2" && media_manager.ext == 'img') { - opts = '?direct'; - optsstart = true; - } + initFlashUpload: function () { + var $oform, $oflash; + if(!hasFlash(8)) { + return; + } - var s = parseInt(media_manager.size, 10); + $oform = jQuery('#dw__upload'); + $oflash = jQuery('#dw__flashupload'); - if (s && s >= 1) { - opts += (optsstart)?'&':'?'; - if (s=="1") { - opts += '100'; - if (media_manager.ext == 'swf') { - opts += 'x62'; - } - } else if (s=="2") { - opts += '200'; - if (media_manager.ext == 'swf') { - opts += 'x123'; - } - } else if (s=="3"){ - opts += '300'; - if (media_manager.ext == 'swf') { - opts += 'x185'; - } - } - } - if (media_manager.align == '2') { - alignleft = ''; - alignright = ' '; - } - if (media_manager.align == '3') { - alignleft = ' '; - alignright = ' '; - } - if (media_manager.align == '4') { - alignleft = ' '; - alignright = ''; - } - } + if(!$oform.length || !$oflash.length) { + return; } - opener.insertTags('wiki__text','{{'+alignleft+id+opts+alignright+'|','}}',''); - if(!media_manager.keepopen) window.close(); - opener.focus(); - return false; + jQuery(document.createElement('img')) + .attr('src', DOKU_BASE+'lib/images/multiupload.png') + .attr('title', LANG.mu_btn) + .attr('alt', LANG.mu_btn) + .css('cursor', 'pointer') + .click( + function () { + $oform.hide(); + $oflash.show(); + } + ) + .appendTo($oform); }, /** - * list the content of a namespace using AJAX + * Sets the visibility of the image details accordingly to the + * chosen hide state * * @author Andreas Gohr <andi@splitbrain.org> */ - list: function(event,link){ - // prepare an AJAX call to fetch the subtree - var ajax = new sack(DOKU_BASE + 'lib/exe/ajax.php'); - ajax.AjaxFailedAlert = ''; - ajax.encodeURIString = false; - if(ajax.failed) return true; - - cleanMsgArea(); - - var content = $('media__content'); - content.innerHTML = '<img src="'+DOKU_BASE+'lib/images/loading.gif" alt="..." class="load" />'; - - ajax.elementObj = content; - ajax.afterCompletion = function(){ - media_manager.selectorattach(content); - media_manager.confirmattach(content); - media_manager.updatehide(); - media_manager.initFlashUpload(); - }; - ajax.runAJAX(link.search.substr(1)+'&call=medialist'); - return false; + updatehide: function(){ + jQuery('#media__content div.detail').dw_toggle(!dw_mediamanager.hide); }, - /** - * Open or close a subtree using AJAX + * set media insertion option * - * @author Andreas Gohr <andi@splitbrain.org> + * @author Dominik Eckelmann <eckelmann@cosmocode.de> */ - toggle: function(event,clicky){ - var listitem = clicky.parentNode; - - // if already open, close by removing the sublist - var sublists = listitem.getElementsByTagName('ul'); - if(sublists.length){ - listitem.removeChild(sublists[0]); - clicky.src = DOKU_BASE+'lib/images/plus.gif'; - return false; + setOpt: function(opt, e){ + var val, i; + if (typeof e !== 'undefined') { + val = this.id.substring(this.id.length - 1); + } else { + val = dw_mediamanager.getOpt(opt); } - // get the enclosed link (is always the first one) - var link = listitem.getElementsByTagName('a')[0]; - - // prepare an AJAX call to fetch the subtree - var ajax = new sack(DOKU_BASE + 'lib/exe/ajax.php'); - ajax.AjaxFailedAlert = ''; - ajax.encodeURIString = false; - if(ajax.failed) return true; - - //prepare the new ul - var ul = document.createElement('ul'); - //fixme add classname here - listitem.appendChild(ul); - ajax.elementObj = ul; - ajax.afterCompletion = function(){ media_manager.treeattach(ul); }; - ajax.runAJAX(link.search.substr(1)+'&call=medians'); - clicky.src = DOKU_BASE+'lib/images/minus.gif'; - return false; - }, + if (val === false) { + DokuCookie.setValue(opt,''); + dw_mediamanager[opt] = false; + return; + } - /** - * Prefills the wikiname. - * - * @author Andreas Gohr <andi@splitbrain.org> - */ - suggest: function(){ - var file = $('upload__file'); - var name = $('upload__name'); - if(!file || !name) return; + if (opt === 'link') { + if (val !== '4' && dw_mediamanager.link === '4') { + dw_mediamanager.unforbid('linkonly'); + dw_mediamanager.setOpt('align'); + dw_mediamanager.setOpt('size'); + } else if (val === '4') { + dw_mediamanager.forbid('linkonly', {align: false, size: false}); + } - var text = file.value; - text = text.substr(text.lastIndexOf('/')+1); - text = text.substr(text.lastIndexOf('\\')+1); - name.value = text; - }, + jQuery("#media__size, #media__align").dw_toggle(val !== '4'); + } + DokuCookie.setValue(opt, val); + dw_mediamanager[opt] = val; - initFlashUpload: function(){ - if(!hasFlash(8)) return; - var oform = $('dw__upload'); - var oflash = $('dw__flashupload'); - if(!oform || !oflash) return; - - var clicky = document.createElement('img'); - clicky.src = DOKU_BASE+'lib/images/multiupload.png'; - clicky.title = LANG['mu_btn']; - clicky.alt = LANG['mu_btn']; - clicky.style.cursor = 'pointer'; - clicky.onclick = function(){ - oform.style.display = 'none'; - oflash.style.display = ''; - }; - oform.appendChild(clicky); + for (i = 1; i <= 4; i++) { + jQuery("#media__" + opt + "btn" + i).removeClass('selected'); + } + jQuery('#media__' + opt + 'btn' + val).addClass('selected'); }, - /** - * closes the link type popup - */ - closePopup: function(event) { - $('media__popup').style.display = 'none'; + unforbid: function (group) { + delete dw_mediamanager.forbidden_opts[group]; }, - /** - * set the align - * - * @author Dominik Eckelmann <eckelmann@cosmocode.de> - */ - setalign: function(event,cb){ - - var id = cb.id.substring(cb.id.length -1); - if(id){ - DokuCookie.setValue('align',id); - media_manager.align = id; - for (var i = 1; i<=4; i++) { - media_manager.outSet("media__alignbtn" + i); - } - media_manager.inSet("media__alignbtn"+id); - }else{ - DokuCookie.setValue('align',''); - media_manager.align = false; - } + forbid: function (group, forbids) { + dw_mediamanager.forbidden_opts[group] = forbids; }, - /** - * set the link type - * - * @author Dominik Eckelmann <eckelmann@cosmocode.de> - */ - setlink: function(event,cb){ - var id = cb.id.substring(cb.id.length -1); - if(id){ - DokuCookie.setValue('link',id); - for (var i = 1; i<=4; i++) { - media_manager.outSet("media__linkbtn"+i); - } - media_manager.inSet("media__linkbtn"+id); - - var size = document.getElementById("media__size"); - var align = document.getElementById("media__align"); - if (id != '4') { - size.style.display = "block"; - align.style.display = "block"; - if (media_manager.link == '4') { - media_manager.align = '1'; - DokuCookie.setValue('align', '1'); - media_manager.inSet('media__alignbtn1'); - - media_manager.size = '2'; - DokuCookie.setValue('size', '2'); - media_manager.inSet('media__sizebtn2'); - } - } else { - size.style.display = "none"; - align.style.display = "none"; - } - media_manager.link = id; - }else{ - DokuCookie.setValue('link',''); - media_manager.link = false; - } + allowedOpt: function (opt, val) { + var ret = true; + jQuery.each(dw_mediamanager.forbidden_opts, + function (_, forbids) { + ret = forbids[opt] !== false && + jQuery.inArray(val, forbids[opt]) === -1; + return ret; + }); + return ret; }, - /** - * set the display type - * - * @author Dominik Eckelmann <eckelmann@cosmocode.de> - */ - setdisplay: function(event,cb){ - if(cb.value){ - DokuCookie.setValue('display',cb.value); - media_manager.display = cb.value; - media_manager.outSet("media__displaybtn1"); - media_manager.outSet("media__displaybtn2"); - media_manager.inSet("media__displaybtn"+cb.value); + getOpt: function (opt) { + var allowed = bind(dw_mediamanager.allowedOpt, opt); - }else{ - DokuCookie.setValue('display',''); - media_manager.align = false; + // Current value + if (dw_mediamanager[opt] !== false && allowed(dw_mediamanager[opt])) { + return dw_mediamanager[opt]; } - }, - /** - * sets the border to outset - */ - outSet: function(id) { - var ele = document.getElementById(id); - if (ele == null) return; - ele.style.borderStyle = "outset"; - }, - /** - * sets the border to inset - */ - inSet: function(id) { - var ele = document.getElementById(id); - if (ele == null) return; - ele.style.borderStyle = "inset"; - }, + // From cookie + if (DokuCookie.getValue(opt) && allowed(DokuCookie.getValue(opt))) { + return DokuCookie.getValue(opt); + } - /** - * set the image size - * - * @author Dominik Eckelmann <eckelmann@cosmocode.de> - */ - setsize: function(event,cb){ - var id = cb.id.substring(cb.id.length -1); - if (id) { - DokuCookie.setValue('size',id); - media_manager.size = id; - for (var i = 1 ; i <=4 ; ++i) { - media_manager.outSet("media__sizebtn" + i); - } - media_manager.inSet("media__sizebtn"+id); - } else { - DokuCookie.setValue('size',''); - media_manager.width = false; + // size default + if (opt === 'size' && allowed('2')) { + return '2'; } + + // Whatever is allowed, and be it false + return jQuery.grep(['1', '2', '3', '4'], allowed)[0] || false; } }; -addInitEvent(function(){ - media_manager.treeattach($('media__tree')); - media_manager.selectorattach($('media__content')); - media_manager.confirmattach($('media__content')); - media_manager.attachoptions($('media__opts')); - media_manager.initpopup(); - media_manager.initFlashUpload(); -}); +// moved from helpers.js temporarily here +/** + * Very simplistic Flash plugin check, probably works for Flash 8 and higher only + * + */ +function hasFlash(version){ + var ver = 0, axo; + try{ + if(navigator.plugins !== null && navigator.plugins.length > 0){ + ver = navigator.plugins["Shockwave Flash"].description.split(' ')[2].split('.')[0]; + }else{ + axo = new ActiveXObject("ShockwaveFlash.ShockwaveFlash"); + ver = axo.GetVariable("$version").split(' ')[1].split(',')[0]; + } + }catch(e){ } + + return ver >= version; +} + +jQuery(dw_mediamanager.init); diff --git a/lib/scripts/qsearch.js b/lib/scripts/qsearch.js new file mode 100644 index 000000000..f83b7a5a1 --- /dev/null +++ b/lib/scripts/qsearch.js @@ -0,0 +1,149 @@ +/*jslint sloppy: true, plusplus: true, continue: true */ +/*global jQuery, DOKU_BASE, window, document, substr_replace */ + +/** + * AJAX functions for the pagename quicksearch + * + * @license GPL2 (http://www.gnu.org/licenses/gpl.html) + * @author Andreas Gohr <andi@splitbrain.org> + * @author Adrian Lang <lang@cosmocode.de> + * @author Michal Rezler <m.rezler@centrum.cz> + */ + +var dw_qsearch = { + + $inObj: null, + $outObj: null, + timer: null, + + /** + * initialize the quick search + * + * Attaches the event handlers + * + * @param input element (JQuery selector/DOM obj) + * @param output element (JQuery selector/DOM obj) + */ + init: function (input, output) { + var do_qsearch; + + dw_qsearch.$inObj = jQuery(input); + dw_qsearch.$outObj = jQuery(output); + + // objects found? + if (dw_qsearch.$inObj.length === 0 || + dw_qsearch.$outObj.length === 0) { + return; + } + + // attach eventhandler to search field + do_qsearch = function () { + dw_qsearch.clear_results(); + var value = dw_qsearch.$inObj.val(); + if (value === '') { + return; + } + jQuery.post( + DOKU_BASE + 'lib/exe/ajax.php', + { + call: 'qsearch', + q: encodeURI(value) + }, + dw_qsearch.onCompletion, + 'html' + ); + }; + + dw_qsearch.$inObj.keyup( + function() { + if(dw_qsearch.timer){ + window.clearTimeout(dw_qsearch.timer); + dw_qsearch.timer = null; + } + dw_qsearch.clear_results(); + dw_qsearch.timer = window.setTimeout(do_qsearch, 500); + } + ); + + // attach eventhandler to output field + dw_qsearch.$outObj.click(dw_qsearch.clear_results); + }, + + /** + * Empty and hide the output div + */ + clear_results: function(){ + dw_qsearch.$outObj.hide(); + dw_qsearch.$outObj.text(''); + }, + + /** + * Callback. Reformat and display the results. + * + * Namespaces are shortened here to keep the results from overflowing + * or wrapping + * + * @param data The result HTML + */ + onCompletion: function(data) { + var max, $links, too_big; + + if (data === '') { return; } + + dw_qsearch.$outObj + .html(data) + .show() + .css('white-space', 'nowrap'); + + // shorten namespaces if too long + max = dw_qsearch.$outObj[0].clientWidth; + $links = dw_qsearch.$outObj.find('a'); + too_big = (document.documentElement.dir === 'rtl') + ? function (l) { return l.offsetLeft < 0; } + : function (l) { return l.offsetWidth + l.offsetLeft > max; }; + + $links.each(function () { + var start, length, replace, nsL, nsR, eli, runaway; + + if (!too_big(this)) { + return; + } + + nsL = this.innerText.indexOf('('); + nsR = this.innerText.indexOf(')'); + eli = 0; + runaway = 0; + + while((nsR - nsL > 3) && too_big(this) && runaway++ < 500) { + if(eli !== 0){ + // elipsis already inserted + if( (eli - nsL) > (nsR - eli) ){ + // cut left + start = eli - 2; + length = 2; + }else{ + // cut right + start = eli + 1; + length = 1; + } + replace = ''; + }else{ + // replace middle with ellipsis + start = Math.floor( nsL + ((nsR-nsL)/2) ); + length = 1; + replace = '…'; + } + this.innerText = substr_replace(this.innerText, + replace, start, length); + + eli = this.innerText.indexOf('…'); + nsL = this.innerText.indexOf('('); + nsR = this.innerText.indexOf(')'); + } + }); + } +}; + +jQuery(function () { + dw_qsearch.init('#qsearch__in','#qsearch__out'); +}); diff --git a/lib/scripts/script.js b/lib/scripts/script.js index c79c9b683..b44d95d6f 100644 --- a/lib/scripts/script.js +++ b/lib/scripts/script.js @@ -1,3 +1,51 @@ +// if jQuery was loaded, let's make it noConflict here. +if ('function' === typeof jQuery && 'function' === typeof jQuery.noConflict) { + jQuery.noConflict(); +} + +/** + * Mark a JavaScript function as deprecated + * + * This will print a warning to the JavaScript console (if available) in + * Firebug and Chrome and a stack trace (if available) to easily locate the + * problematic function call. + * + * @param msg optional message to print + */ +function DEPRECATED(msg){ + if(!window.console) return; + if(!msg) msg = ''; + + var func; + if(arguments.callee) func = arguments.callee.caller.name; + if(func) func = ' '+func+'()'; + var line = 'DEPRECATED function call'+func+'. '+msg; + + if(console.warn){ + console.warn(line); + }else{ + console.log(line); + } + + if(console.trace) console.trace(); +} + +/** + * Construct a wrapper function for deprecated function names + * + * This function returns a wrapper function which just calls DEPRECATED + * and the new function. + * + * @param func The new function + * @param context Optional; The context (`this`) of the call + */ +function DEPRECATED_WRAP(func, context) { + return function () { + DEPRECATED(); + return func.apply(context || this, arguments); + } +} + /** * Some of these scripts were taken from wikipedia.org and were modified for DokuWiki */ @@ -25,6 +73,8 @@ if (clientPC.indexOf('opera')!=-1) { * @link http://prototype.conio.net/ */ function $() { + DEPRECATED('Please use the JQuery() function instead.'); + var elements = new Array(); for (var i = 0; i < arguments.length; i++) { @@ -52,68 +102,20 @@ function isset(varname){ } /** - * Select elements by their class name + * Get the computed style of a node. * - * @author Dustin Diaz <dustin [at] dustindiaz [dot] com> - * @link http://www.dustindiaz.com/getelementsbyclass/ + * @link https://acidmartin.wordpress.com/2008/08/26/style-get-any-css-property-value-of-an-object/ + * @link http://svn.dojotoolkit.org/src/dojo/trunk/_base/html.js */ -function getElementsByClass(searchClass,node,tag) { - var classElements = new Array(); - if ( node == null ) - node = document; - if ( tag == null ) - tag = '*'; - var els = node.getElementsByTagName(tag); - var elsLen = els.length; - var pattern = new RegExp("(^|\\s)"+searchClass+"(\\s|$)"); - for (var i = 0, j = 0; i < elsLen; i++) { - if ( pattern.test(els[i].className) ) { - classElements[j] = els[i]; - j++; - } +function gcs(node){ + if(node.currentStyle){ + return node.currentStyle; + }else{ + return node.ownerDocument.defaultView.getComputedStyle(node, null); } - return classElements; } /** - * Get the X offset of the top left corner of the given object - * - * @link http://www.quirksmode.org/js/findpos.html - */ -function findPosX(object){ - var curleft = 0; - var obj = $(object); - if (obj.offsetParent){ - do { - curleft += obj.offsetLeft; - } while (obj = obj.offsetParent); - } - else if (obj.x){ - curleft += obj.x; - } - return curleft; -} //end findPosX function - -/** - * Get the Y offset of the top left corner of the given object - * - * @link http://www.quirksmode.org/js/findpos.html - */ -function findPosY(object){ - var curtop = 0; - var obj = $(object); - if (obj.offsetParent){ - do { - curtop += obj.offsetTop; - } while (obj = obj.offsetParent); - } - else if (obj.y){ - curtop += obj.y; - } - return curtop; -} //end findPosY function - -/** * Escape special chars in JavaScript * * @author Andreas Gohr <andi@splitbrain.org> @@ -145,19 +147,6 @@ function escapeQuotes(text) { } /** - * Adds a node as the first childenode to the given parent - * - * @see appendChild() - */ -function prependChild(parent,element) { - if(!parent.firstChild){ - parent.appendChild(element); - }else{ - parent.insertBefore(element,parent.firstChild); - } -} - -/** * Prints a animated gif to show the search is performed * * Because we need to modify the DOM here before the document is loaded @@ -191,47 +180,6 @@ function hideLoadBar(id){ if(obj) obj.style.display="none"; } -/** - * Adds the toggle switch to the TOC - */ -function addTocToggle() { - if(!document.getElementById) return; - var header = $('toc__header'); - if(!header) return; - var toc = $('toc__inside'); - - var obj = document.createElement('span'); - obj.id = 'toc__toggle'; - obj.style.cursor = 'pointer'; - if (toc && toc.style.display == 'none') { - obj.innerHTML = '<span>+</span>'; - obj.className = 'toc_open'; - } else { - obj.innerHTML = '<span>−</span>'; - obj.className = 'toc_close'; - } - - prependChild(header,obj); - obj.parentNode.onclick = toggleToc; - obj.parentNode.style.cursor = 'pointer'; -} - -/** - * This toggles the visibility of the Table of Contents - */ -function toggleToc() { - var toc = $('toc__inside'); - var obj = $('toc__toggle'); - if(toc.style.display == 'none') { - toc.style.display = ''; - obj.innerHTML = '<span>−</span>'; - obj.className = 'toc_close'; - } else { - toc.style.display = 'none'; - obj.innerHTML = '<span>+</span>'; - obj.className = 'toc_open'; - } -} /** * Create JavaScript mouseover popup @@ -260,10 +208,32 @@ function insitu_popup(target, popup_id) { getElementsByClass('dokuwiki', document.body, 'div')[0].appendChild(fndiv); } + var non_static_parent = fndiv.parentNode; + while (non_static_parent != document && gcs(non_static_parent)['position'] == 'static') { + non_static_parent = non_static_parent.parentNode; + } + + var fixed_target_parent = target; + while (fixed_target_parent != document && gcs(fixed_target_parent)['position'] != 'fixed') { + fixed_target_parent = fixed_target_parent.parentNode; + } + // position the div and make it visible - fndiv.style.position = 'absolute'; - fndiv.style.left = findPosX(target)+'px'; - fndiv.style.top = (findPosY(target)+target.offsetHeight * 1.5) + 'px'; + if (fixed_target_parent != document) { + // the target has position fixed, that means the footnote needs to be fixed, too + fndiv.style.position = 'fixed'; + } else { + fndiv.style.position = 'absolute'; + } + + if (fixed_target_parent != document || non_static_parent == document) { + fndiv.style.left = findPosX(target)+'px'; + fndiv.style.top = (findPosY(target)+target.offsetHeight * 1.5) + 'px'; + } else { + fndiv.style.left = (findPosX(target) - findPosX(non_static_parent)) +'px'; + fndiv.style.top = (findPosY(target)+target.offsetHeight * 1.5 - findPosY(non_static_parent)) + 'px'; + } + fndiv.style.display = ''; return fndiv; } @@ -307,127 +277,12 @@ addInitEvent(function(){ } }); -/** - * Add the edit window size controls - */ -function initSizeCtl(ctlid,edid){ - if(!document.getElementById){ return; } - - var ctl = $(ctlid); - var textarea = $(edid); - if(!ctl || !textarea) return; - - var hgt = DokuCookie.getValue('sizeCtl'); - if(hgt){ - textarea.style.height = hgt; - }else{ - textarea.style.height = '300px'; - } - - var wrp = DokuCookie.getValue('wrapCtl'); - if(wrp){ - setWrap(textarea, wrp); - } // else use default value - - var l = document.createElement('img'); - var s = document.createElement('img'); - var w = document.createElement('img'); - l.src = DOKU_BASE+'lib/images/larger.gif'; - s.src = DOKU_BASE+'lib/images/smaller.gif'; - w.src = DOKU_BASE+'lib/images/wrap.gif'; - addEvent(l,'click',function(){sizeCtl(edid,100);}); - addEvent(s,'click',function(){sizeCtl(edid,-100);}); - addEvent(w,'click',function(){toggleWrap(edid);}); - ctl.appendChild(l); - ctl.appendChild(s); - ctl.appendChild(w); -} - -/** - * This sets the vertical size of the editbox - */ -function sizeCtl(edid,val){ - var textarea = $(edid); - var height = parseInt(textarea.style.height.substr(0,textarea.style.height.length-2)); - height += val; - textarea.style.height = height+'px'; - - DokuCookie.setValue('sizeCtl',textarea.style.height); -} - -/** - * Toggle the wrapping mode of a textarea - */ -function toggleWrap(edid){ - var textarea = $(edid); - var wrap = textarea.getAttribute('wrap'); - if(wrap && wrap.toLowerCase() == 'off'){ - setWrap(textarea, 'soft'); - }else{ - setWrap(textarea, 'off'); - } - - DokuCookie.setValue('wrapCtl',textarea.getAttribute('wrap')); -} - -/** - * Set the wrapping mode of a textarea - * - * @author Fluffy Convict <fluffyconvict@hotmail.com> - * @author <shutdown@flashmail.com> - * @link http://news.hping.org/comp.lang.javascript.archive/12265.html - * @link https://bugzilla.mozilla.org/show_bug.cgi?id=41464 - */ -function setWrap(textarea, wrapAttrValue){ - textarea.setAttribute('wrap', wrapAttrValue); - - // Fix display for mozilla - var parNod = textarea.parentNode; - var nxtSib = textarea.nextSibling; - parNod.removeChild(textarea); - parNod.insertBefore(textarea, nxtSib); -} /** * Handler to close all open Popups */ function closePopups(){ - if(!document.getElementById){ return; } - - var divs = document.getElementsByTagName('div'); - for(var i=0; i < divs.length; i++){ - if(divs[i].className.indexOf('JSpopup') != -1){ - divs[i].style.display = 'none'; - } - } -} - -/** - * Looks for an element with the ID scroll__here at scrolls to it - */ -function scrollToMarker(){ - var obj = $('scroll__here'); - if(obj) obj.scrollIntoView(); -} - -/** - * Looks for an element with the ID focus__this at sets focus to it - */ -function focusMarker(){ - var obj = $('focus__this'); - if(obj) obj.focus(); -} - -/** - * Remove messages - */ -function cleanMsgArea(){ - var elems = getElementsByClass('(success|info|error)',document,'div'); - if(elems){ - for(var i=0; i<elems.length; i++){ - elems[i].style.display = 'none'; - } - } + jQuery('div.JSpopup').hide(); } /** @@ -459,50 +314,6 @@ addInitEvent(function(){ } }); -/** - * Add the event handler to the actiondropdown - * - * @author Andreas Gohr <andi@splitbrain.org> - */ -addInitEvent(function(){ - var selector = $('action__selector'); - if(!selector) return; - - addEvent(selector,'change',function(e){ - this.form.submit(); - }); - - $('action__selectorbtn').style.display = 'none'; -}); - -/** - * Display error for Windows Shares on browsers other than IE - * - * @author Michael Klier <chi@chimeric.de> - */ -function checkWindowsShares() { - if(!LANG['nosmblinks']) return true; - if(document.all != null) return true; - - var elems = getElementsByClass('windows',document,'a'); - if(elems){ - for(var i=0; i<elems.length; i++){ - var share = elems[i]; - addEvent(share,'click',function(){ - alert(LANG['nosmblinks']); - }); - } - } -} - -/** - * Add the event handler for the Windows Shares check - * - * @author Michael Klier <chi@chimeric.de> - */ -addInitEvent(function(){ - checkWindowsShares(); -}); /** * Highlight the section when hovering over the appropriate section edit button diff --git a/lib/scripts/subscriptions.js b/lib/scripts/subscriptions.js deleted file mode 100644 index d701f258f..000000000 --- a/lib/scripts/subscriptions.js +++ /dev/null @@ -1,46 +0,0 @@ -/** - * Hide list subscription style if target is a page - * - * @author Adrian Lang <lang@cosmocode.de> - */ - -addInitEvent(function () { - var form = $('subscribe__form'); - if (!form) { - return; - } - - var styleradios = {}; - - function update_state() { - if (!this.checked) { - return; - } - if (this.value.match(/:$/)) { - styleradios.list.parentNode.style.display = ''; - } else { - styleradios.list.parentNode.style.display = 'none'; - if (styleradios.list.checked) { - styleradios.digest.checked = 'checked'; - } - } - } - - var cur_sel = null; - - var inputs = form.getElementsByTagName('input'); - for (var i = 0; i < inputs.length ; ++i) { - switch (inputs[i].name) { - case 'sub_target': - addEvent(inputs[i], 'click', update_state); - if (inputs[i].checked) { - cur_sel = inputs[i]; - } - break; - case 'sub_style': - styleradios[inputs[i].value] = inputs[i]; - break; - } - } - update_state.call(cur_sel); -}); diff --git a/lib/scripts/toolbar.js b/lib/scripts/toolbar.js index 3f967448c..2306ef5db 100644 --- a/lib/scripts/toolbar.js +++ b/lib/scripts/toolbar.js @@ -12,47 +12,55 @@ var pickercounter=0; * @author Andreas Gohr <andi@splitbrain.org> */ function initToolbar(tbid,edid,tb, allowblock){ - var toolbar = $(tbid); - if(!toolbar) return; - var edit = $(edid); - if(!edit) return; - if(edit.readOnly) return; + var $ = jQuery; + if (typeof tbid == 'string') { + var toolbar = $('#' + tbid); + } else { + var toolbar = $(tbid); + } + + if(toolbar.length == 0) return; + + var edit = $('#' + edid); + if(edit.length == 0) return; + + if(edit.attr('readOnly')) return; if (typeof allowblock === 'undefined') { allowblock = true; } //empty the toolbar area: - toolbar.innerHTML=''; + toolbar.html(''); var cnt = tb.length; + for(var i=0; i<cnt; i++){ if (!allowblock && tb[i].block === true) { continue; } var actionFunc; - // create new button - var btn = createToolButton(tb[i]['icon'], + // create new button (jQuery object) + var btn = $(createToolButton(tb[i]['icon'], tb[i]['title'], tb[i]['key'], tb[i]['id'], - tb[i]['class']); - + tb[i]['class'])); // type is a tb function -> assign it as onclick actionFunc = 'tb_'+tb[i]['type']; - if( isFunction(window[actionFunc]) ){ - addEvent(btn,'click', bind(window[actionFunc],btn,tb[i],edid)); - toolbar.appendChild(btn); + if( $.isFunction(window[actionFunc]) ){ + btn.bind('click', bind(window[actionFunc],btn,tb[i],edid) ); + toolbar.append(btn); continue; } // type is a init function -> execute it actionFunc = 'addBtnAction'+tb[i]['type'].charAt(0).toUpperCase()+tb[i]['type'].substring(1); - if( isFunction(window[actionFunc]) ){ + if( $.isFunction(window[actionFunc]) ){ if(window[actionFunc](btn, tb[i], edid)){ - toolbar.appendChild(btn); + toolbar.append(btn); } continue; } @@ -153,7 +161,7 @@ function tb_insert(btn, props, edid) { */ function tb_mediapopup(btn, props, edid) { window.open( - DOKU_BASE+props['url']+encodeURIComponent(NS), + DOKU_BASE+props['url']+encodeURIComponent(NS)+'&edid='+encodeURIComponent(edid), props['name'], props['options']); return false; @@ -197,10 +205,14 @@ function tb_autohead(btn, props, edid){ function addBtnActionPicker(btn, props, edid) { var pickerid = 'picker'+(pickercounter++); createPicker(pickerid, props, edid); - addEvent(btn,'click',function(){ - pickerToggle(pickerid,btn); - return false; - }); + + btn.click( + function() { + pickerToggle(pickerid,btn); + return false; + } + ); + return true; } @@ -214,31 +226,33 @@ function addBtnActionPicker(btn, props, edid) { * @author Andreas Gohr <gohr@cosmocode.de> */ function addBtnActionLinkwiz(btn, props, edid) { - linkwiz.init($(edid)); - addEvent(btn,'click',function(){ - linkwiz.toggle(); + dw_linkwiz.init(jQuery('#'+edid)); + jQuery(btn).click(function(){ + dw_linkwiz.toggle(); return false; }); return true; } + /** * Show/Hide a previosly created picker window * * @author Andreas Gohr <andi@splitbrain.org> */ function pickerToggle(pickerid,btn){ - var picker = $(pickerid); - if(picker.style.marginLeft == '-10000px'){ - var x = findPosX(btn); - var y = findPosY(btn); - picker.style.left = (x+3)+'px'; - picker.style.top = (y+btn.offsetHeight+3)+'px'; - picker.style.marginLeft = '0px'; - picker.style.marginTop = '0px'; - }else{ - picker.style.marginLeft = '-10000px'; - picker.style.marginTop = '-10000px'; + var picker = jQuery('#' + pickerid); + if (picker.css('marginLeft') == '-10000px'){ + var x = findPosX(btn[0]); + var y = findPosY(btn[0]); + + picker.css('left',(x+3)+'px') + .css('top', (y+btn[0].offsetHeight+3)+'px') + .css('marginLeft', '0px') + .css('marginTop', '0px'); + } else { + picker.css('marginLeft', '-10000px') + .css('marginTop', '-10000px'); } } @@ -248,10 +262,10 @@ function pickerToggle(pickerid,btn){ * @author Andreas Gohr <andi@splitbrain.org> */ function pickerClose(){ - var pobjs = getElementsByClass('picker'); + var pobjs = jQuery('#picker'); for(var i=0; i<pobjs.length; i++){ - pobjs[i].style.marginLeft = '-10000px'; - pobjs[i].style.marginTop = '-10000px'; + pobjs[i].css('marginLeft', '-10000px') + .css('marginTop', '-10000px'); } } diff --git a/lib/scripts/tree.js b/lib/scripts/tree.js new file mode 100644 index 000000000..98d3f55d4 --- /dev/null +++ b/lib/scripts/tree.js @@ -0,0 +1,96 @@ +/*jslint white: true, onevar: true, undef: true, nomen: true, eqeqeq: true, plusplus: true, bitwise: true, regexp: false, newcap: true, immed: true, sloppy: true */ +/*global jQuery, window, DOKU_BASE, DEPRECATED, bind*/ + +jQuery.fn.dw_tree = function(overrides) { + var dw_tree = { + + /** + * Delay in ms before showing the throbber. + * Used to skip the throbber for fast AJAX calls. + */ + throbber_delay: 500, + + $obj: this, + + toggle_selector: 'a.idx_dir', + + init: function () { + this.$obj.delegate(this.toggle_selector, 'click', this, + this.toggle); + }, + + /** + * Open or close a subtree using AJAX + * The contents of subtrees are "cached" until the page is reloaded. + * A "loading" indicator is shown only when the AJAX call is slow. + * + * @author Andreas Gohr <andi@splitbrain.org> + * @author Ben Coburn <btcoburn@silicodon.net> + * @author Pierre Spring <pierre.spring@caillou.ch> + */ + toggle: function (e) { + var $listitem, $sublist, timeout, $clicky, show_sublist, dw_tree, opening; + + e.preventDefault(); + + dw_tree = e.data; + $clicky = jQuery(this); + $listitem = $clicky.closest('li'); + $sublist = $listitem.find('ul').first(); + opening = $listitem.hasClass('closed'); + $listitem.toggleClass('open closed'); + dw_tree.toggle_display($clicky, opening); + + // if already open, close by hiding the sublist + if (!opening) { + $sublist.dw_hide(); + return; + } + + show_sublist = function (data) { + $sublist.hide(); + if (typeof data !== 'undefined') { + $sublist.html(data); + } + if ($listitem.hasClass('open')) { + // Only show if user didn’t close the list since starting + // to load the content + $sublist.dw_show(); + } + }; + + // just show if already loaded + if ($sublist.length > 0) { + show_sublist(); + return; + } + + //prepare the new ul + $sublist = jQuery('<ul class="idx"/>'); + $listitem.append($sublist); + + timeout = window.setTimeout( + bind(show_sublist, '<li><img src="' + DOKU_BASE + 'lib/images/throbber.gif" alt="loading..." title="loading..." /></li>'), dw_tree.throbber_delay); + + dw_tree.load_data(function (data) { + window.clearTimeout(timeout); + show_sublist(data); + }, $clicky); + }, + + toggle_display: function ($clicky, opening) { + }, + + load_data: function (show_data, $clicky) { + show_data(); + } + }; + + jQuery.extend(dw_tree, overrides); + + if (!overrides.deferInit) { + dw_tree.init(); + } + + return dw_tree; +}; diff --git a/lib/scripts/tw-sack.js b/lib/scripts/tw-sack.js index b5a5c8861..cc988f5be 100644 --- a/lib/scripts/tw-sack.js +++ b/lib/scripts/tw-sack.js @@ -66,6 +66,8 @@ function sack(file){ }; this.runAJAX = function(urlstring){ + DEPRECATED('Please use jQuery.post() or any other of jQuery\'s AJAX methods.'); + this.responseStatus = new Array(2); if(this.failed && this.AjaxFailedAlert){ alert(this.AjaxFailedAlert); diff --git a/lib/styles/all.css b/lib/styles/all.css new file mode 100644 index 000000000..915ced5d6 --- /dev/null +++ b/lib/styles/all.css @@ -0,0 +1,49 @@ +/** + * Basic styles. These styles are needed for basic DokuWiki functions + * regardless of the used template. Templates can override them of course + */ + +div.clearer { + clear: both; + font-size: 0; + line-height: 0; + height: 0; + overflow: hidden; +} + +div.no { + display: inline; + margin: 0; + padding: 0; +} + +.hidden { + display: none; +} + +/* image alignment */ +.medialeft { + float: left; +} +.mediaright { + float: right; +} +.mediacenter { + display: block; + margin-left: auto; + margin-right: auto; +} + +/* table cell alignment */ +.leftalign { text-align: left; } +.centeralign { text-align: center; } +.rightalign { text-align: right; } + +/* underline */ +em.u { + font-style: normal; + text-decoration: underline; +} +em em.u { + font-style: italic; +} diff --git a/lib/styles/print.css b/lib/styles/print.css new file mode 100644 index 000000000..76bc6d3bc --- /dev/null +++ b/lib/styles/print.css @@ -0,0 +1,23 @@ +/** + * Basic styles. These styles are needed for basic DokuWiki functions + * regardless of the used template. Templates can override them of course + */ + +/* messages with msg() */ +div.error, +div.info, +div.success, +div.notify { + display: none; +} + +/* section edit button */ +.secedit { + display: none; +} + +/* modal windows */ +.JSpopup, +#link__wiz { + display: none; +} diff --git a/lib/styles/style.css b/lib/styles/screen.css index 395f82b78..80a161f19 100644 --- a/lib/styles/style.css +++ b/lib/styles/screen.css @@ -3,23 +3,6 @@ * regardless of the used template. Templates can override them of course */ -div.clearer { - clear: both; - line-height: 0; - height: 0; - overflow: hidden; -} - -div.no { - display: inline; - margin: 0; - padding: 0; -} - -.hidden { - display: none; -} - /* messages with msg() */ div.error, div.info, @@ -59,38 +42,9 @@ div.notify { border-bottom-color: #ffa; } - -/* image alignment */ -.medialeft { - float: left; -} -.mediaright { - float: right; -} -.mediacenter { - display: block; - margin-left: auto; - margin-right: auto; -} - -/* table cell alignment */ -.leftalign { text-align: left; } -.centeralign { text-align: center; } -.rightalign { text-align: right; } - -/* underline */ -em.u { - font-style: normal; - text-decoration: underline; -} -em em.u { - font-style: italic; -} - /* modal windows */ .JSpopup, -#link__wiz, -#media__popup { +#link__wiz { position: absolute; background-color: #fff; color: #000; @@ -98,6 +52,16 @@ em em.u { overflow: hidden; } +/* media manager popup toggle buttons */ + +#media__popup_content button.button { + border-style: outset; +} + +#media__popup_content button.selected { + border-style: inset; +} + /* syntax highlighting code */ .code .br0 { color: #66cc66; } diff --git a/lib/tpl/default/_linkwiz.css b/lib/tpl/default/_linkwiz.css index 060707377..fd40a0019 100644 --- a/lib/tpl/default/_linkwiz.css +++ b/lib/tpl/default/_linkwiz.css @@ -16,6 +16,7 @@ background-color: __background_alt__; height: 16px; margin-bottom: 5px; + cursor: move; } #link__wiz_close { diff --git a/lib/tpl/default/_mediaoptions.css b/lib/tpl/default/_mediaoptions.css index 19e2c4853..68a5b9fa7 100644 --- a/lib/tpl/default/_mediaoptions.css +++ b/lib/tpl/default/_mediaoptions.css @@ -1,24 +1,6 @@ /* --- popup --- */ -#media__popup { - background-color:__background__; - display:none; - border: 1px solid __border__; - position: absolute; - width:280px; -} - -#media__popup h1 { - text-align:center; - font-weight:normal; - background-color: __background_alt__; - height: 16px; - margin-bottom: 5px; - font-size:12px; - border-bottom: 0; -} - -#media__popup p { +#media__popup_content p { display:block; line-height:14pt; margin:0.5em; @@ -28,28 +10,24 @@ padding:4px 0; } -#media__popup label { +#media__popup_content label { float:left; width:9em; } -#media__popup .button { +#media__popup_content .button { margin-left:auto; margin-right:auto; } -#media__popup .btnlbl { +#media__popup_content .btnlbl { text-align:center; } -#media__popup .btnlbl input { +#media__popup_content .btnlbl input { margin:0 1em; } -#media__closeimg { - float:right; -} - /* --- display options --- */ #media__linkopts label, diff --git a/lib/tpl/default/design.css b/lib/tpl/default/design.css index 09a9ecf01..1fdf2bfac 100644 --- a/lib/tpl/default/design.css +++ b/lib/tpl/default/design.css @@ -85,8 +85,10 @@ div.dokuwiki fieldset { } div.dokuwiki textarea.edit { - font-family: monospace; - font-size: 14px; + font-family: monospace, serif; + /* second generic font fixes problem with font-size, see + http://meyerweb.com/eric/thoughts/2010/02/12/fixed-monospace-sizing/ */ + font-size: 100%; color: __text__; background-color: __background__; border: 1px solid __border__; @@ -464,9 +466,14 @@ div.dokuwiki blockquote { padding-left: 3px; } +div.dokuwiki pre, +div.dokuwiki code { + font-family: monospace, serif; + /* second generic font fixes problem with font-size, see + http://meyerweb.com/eric/thoughts/2010/02/12/fixed-monospace-sizing/ */ + font-size: 100%; +} div.dokuwiki pre { - font-family: monospace; - font-size: 120%; padding: 0.5em; border: 1px dashed __border__; color: __text__; @@ -519,11 +526,6 @@ div.dokuwiki dl.file dt { } -/* inline code words */ -div.dokuwiki code { - font-size: 120%; -} - /* inline tables */ div.dokuwiki table.inline { background-color: __background__; @@ -652,10 +654,12 @@ div.dokuwiki table.diff td { font-family: monospace; font-size: 100%; } -div.dokuwiki td.diff-addedline { +div.dokuwiki td.diff-addedline, +div.dokuwiki span.diff-addedline { background-color: #ddffdd; } -div.dokuwiki td.diff-deletedline { +div.dokuwiki td.diff-deletedline, +div.dokuwiki span.diff-deletedline { background-color: #ffffbb; } div.dokuwiki td.diff-context { diff --git a/lib/tpl/default/images/UWEB.png b/lib/tpl/default/images/UWEB.png Binary files differindex ea03aec94..292ade4ed 100644 --- a/lib/tpl/default/images/UWEB.png +++ b/lib/tpl/default/images/UWEB.png diff --git a/lib/tpl/default/images/UWEBshadow.png b/lib/tpl/default/images/UWEBshadow.png Binary files differindex 212444f0e..8c4e5f829 100644 --- a/lib/tpl/default/images/UWEBshadow.png +++ b/lib/tpl/default/images/UWEBshadow.png diff --git a/lib/tpl/default/images/apple-touch-icon.png b/lib/tpl/default/images/apple-touch-icon.png Binary files differnew file mode 100644 index 000000000..45fa4e7b0 --- /dev/null +++ b/lib/tpl/default/images/apple-touch-icon.png diff --git a/lib/tpl/default/images/button-cc.gif b/lib/tpl/default/images/button-cc.gif Binary files differindex 5861d637f..c7a403a9e 100644 --- a/lib/tpl/default/images/button-cc.gif +++ b/lib/tpl/default/images/button-cc.gif diff --git a/lib/tpl/default/images/button-dw.png b/lib/tpl/default/images/button-dw.png Binary files differindex 39d5f56a9..97272d968 100644 --- a/lib/tpl/default/images/button-dw.png +++ b/lib/tpl/default/images/button-dw.png diff --git a/lib/tpl/default/images/button-rss.png b/lib/tpl/default/images/button-rss.png Binary files differindex b036f7152..f2438043f 100644 --- a/lib/tpl/default/images/button-rss.png +++ b/lib/tpl/default/images/button-rss.png diff --git a/lib/tpl/default/images/buttonshadow.png b/lib/tpl/default/images/buttonshadow.png Binary files differindex f60be309f..b96ebf759 100644 --- a/lib/tpl/default/images/buttonshadow.png +++ b/lib/tpl/default/images/buttonshadow.png diff --git a/lib/tpl/default/images/inputshadow.png b/lib/tpl/default/images/inputshadow.png Binary files differindex d286beb22..480044986 100644 --- a/lib/tpl/default/images/inputshadow.png +++ b/lib/tpl/default/images/inputshadow.png diff --git a/lib/tpl/default/images/link_icon.gif b/lib/tpl/default/images/link_icon.gif Binary files differindex 815ccb1b1..d0a92f2fa 100644 --- a/lib/tpl/default/images/link_icon.gif +++ b/lib/tpl/default/images/link_icon.gif diff --git a/lib/tpl/default/images/mail_icon.gif b/lib/tpl/default/images/mail_icon.gif Binary files differindex 50a87a9a0..437d28fe1 100644 --- a/lib/tpl/default/images/mail_icon.gif +++ b/lib/tpl/default/images/mail_icon.gif diff --git a/lib/tpl/default/images/tocdot2.gif b/lib/tpl/default/images/tocdot2.gif Binary files differindex 3d39c2e73..e2b5f15cb 100644 --- a/lib/tpl/default/images/tocdot2.gif +++ b/lib/tpl/default/images/tocdot2.gif diff --git a/lib/tpl/default/images/windows.gif b/lib/tpl/default/images/windows.gif Binary files differindex 4f12acce1..64dfeb6fb 100644 --- a/lib/tpl/default/images/windows.gif +++ b/lib/tpl/default/images/windows.gif diff --git a/lib/tpl/default/main.php b/lib/tpl/default/main.php index 754a6e482..26e84fde6 100644 --- a/lib/tpl/default/main.php +++ b/lib/tpl/default/main.php @@ -28,8 +28,7 @@ if (!defined('DOKU_INC')) die(); </title> <?php tpl_metaheaders()?> - - <link rel="shortcut icon" href="<?php echo tpl_getFavicon() ?>" /> + <?php echo tpl_favicon(array('favicon', 'mobile')) ?> <?php /*old includehook*/ @include(dirname(__FILE__).'/meta.html')?> </head> @@ -92,7 +91,7 @@ if (!defined('DOKU_INC')) die(); <!-- wikipage stop --> </div> - <div class="clearer"> </div> + <div class="clearer"></div> <?php tpl_flush()?> diff --git a/lib/tpl/default/media.css b/lib/tpl/default/media.css index d412fd9cf..7b558a80b 100644 --- a/lib/tpl/default/media.css +++ b/lib/tpl/default/media.css @@ -32,6 +32,10 @@ margin-bottom: 0.5em; } +#media__manager a.select { + cursor: pointer; +} + /* --- Tree formatting --- */ #media__tree img { diff --git a/lib/tpl/default/print.css b/lib/tpl/default/print.css index 15c6dad29..45b60aad2 100644 --- a/lib/tpl/default/print.css +++ b/lib/tpl/default/print.css @@ -33,23 +33,10 @@ div.meta { text-align: right; } - -div.notify, -div.info, -div.success, -div.error, -div.breadcrumbs, -div.secedit { +div.breadcrumbs { display: none; } -div.clearer { - clear: both; - line-height: 0; - height: 0; - overflow: hidden; -} - /* --------------------- Text formating -------------------------------- */ @@ -110,31 +97,15 @@ img.media { margin: 3px; } +/* the styles for media images are already in + lib/styles/all.css, these are additional styles */ img.medialeft { - border: 0; - float: left; margin: 0 1.5em 0 0; } - img.mediaright { - border: 0; - float: right; margin: 0 0 0 1.5em; } - img.mediacenter { - display: block; - margin-left: auto; - margin-right: auto; -} - -/* underline */ -em.u { - font-style: normal; - text-decoration: underline; -} -em em.u { - font-style: italic; } /* unordered lists */ @@ -253,17 +224,5 @@ table.inline td { border: 1px solid #000000; } -.leftalign { - text-align: left; -} - -.centeralign { - text-align: center; -} - -.rightalign { - text-align: right; -} - .toc, .footerinc, .header, .bar, .user { display: none; } diff --git a/lib/tpl/default/rtl.css b/lib/tpl/default/rtl.css index e40dd966d..82c85839b 100644 --- a/lib/tpl/default/rtl.css +++ b/lib/tpl/default/rtl.css @@ -55,8 +55,7 @@ div.dokuwiki li ol { div.dokuwiki a.urlextern, div.dokuwiki a.interwiki, div.dokuwiki a.windows, -div.dokuwiki a.mail, -div.dokuwiki a.mail.JSnocheck { +div.dokuwiki a.mail { /* should work but doesn't - so we just disable icons here*/ /* background-position: right 1px; diff --git a/lib/tpl/index.php b/lib/tpl/index.php index a55081738..0273e5678 100644 --- a/lib/tpl/index.php +++ b/lib/tpl/index.php @@ -8,6 +8,9 @@ * @author Andreas Gohr <andi@splitbrain.org> * @author Anika Henke <anika@selfthinker.org> */ +if(!defined('DOKU_INC')) define('DOKU_INC',dirname(__FILE__).'/../../'); +if(!defined('NOSESSION')) define('NOSESSION',1); +require_once(DOKU_INC.'inc/init.php'); ?> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> @@ -41,9 +44,6 @@ </head> <body> <?php -if(!defined('DOKU_INC')) define('DOKU_INC',dirname(__FILE__).'/../../'); -require_once(DOKU_INC.'inc/init.php'); - $ini = @parse_ini_file($conf['template'].'/style.ini',true); if ($ini) { echo '<table>'; |
