From 4ae475af3d062ad634677a93371703eadbfdf256 Mon Sep 17 00:00:00 2001 From: Jan Schumann Date: Tue, 3 Jan 2012 02:45:43 +0100 Subject: Added prototype for Auth-Plugins --- lib/plugins/auth.php | 25 +++++++++++++++++++++++++ 1 file changed, 25 insertions(+) create mode 100644 lib/plugins/auth.php (limited to 'lib') diff --git a/lib/plugins/auth.php b/lib/plugins/auth.php new file mode 100644 index 000000000..3ec64018c --- /dev/null +++ b/lib/plugins/auth.php @@ -0,0 +1,25 @@ + + */ +// must be run within Dokuwiki +if(!defined('DOKU_INC')) die(); + +/** + * All plugins that provide Authentication should inherit from this class and implement + * the getAuth() method to make its Auth-System available. + * + * @author Jan Schumann + */ +class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { + + /** + * Retrieves the authentication system + */ + function getAuth() { + trigger_error('getAuth() not implemented in '.get_class($this), E_USER_WARNING); + } +} -- cgit v1.2.3 From b4245126d64b378a4cb90821718983e27e943ebc Mon Sep 17 00:00:00 2001 From: Jan Schumann Date: Tue, 3 Jan 2012 02:46:36 +0100 Subject: Load auth types from plugins in settings_authtype class --- lib/plugins/config/settings/extra.class.php | 9 ++++++++- 1 file changed, 8 insertions(+), 1 deletion(-) (limited to 'lib') diff --git a/lib/plugins/config/settings/extra.class.php b/lib/plugins/config/settings/extra.class.php index b4e35b1cc..72b9755be 100644 --- a/lib/plugins/config/settings/extra.class.php +++ b/lib/plugins/config/settings/extra.class.php @@ -43,12 +43,19 @@ if (!class_exists('setting_authtype')) { class setting_authtype extends setting_multichoice { function initialize($default,$local,$protected) { + global $plugin_controller; // populate $this->_choices with a list of available auth mechanisms $authtypes = glob(DOKU_INC.'inc/auth/*.class.php'); $authtypes = preg_replace('#^.*/([^/]*)\.class\.php$#i','$1', $authtypes); $authtypes = array_diff($authtypes, array('basic')); - sort($authtypes); + + // retrive auth types provided by plugins + foreach ($plugin_controller->getList('auth') as $plugin) { + $authtypes = $plugin; + } + + $authtypes = array_unique($authtypes); $this->_choices = $authtypes; -- cgit v1.2.3 From 396b87bebcb14765849b43a259a2b6cf2aff98f3 Mon Sep 17 00:00:00 2001 From: Jan Schumann Date: Tue, 3 Jan 2012 03:31:54 +0100 Subject: Bugfix: auth types are now correcty added --- lib/plugins/config/settings/extra.class.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'lib') diff --git a/lib/plugins/config/settings/extra.class.php b/lib/plugins/config/settings/extra.class.php index 72b9755be..cee3c6b20 100644 --- a/lib/plugins/config/settings/extra.class.php +++ b/lib/plugins/config/settings/extra.class.php @@ -52,7 +52,7 @@ if (!class_exists('setting_authtype')) { // retrive auth types provided by plugins foreach ($plugin_controller->getList('auth') as $plugin) { - $authtypes = $plugin; + $authtypes[] = $plugin; } $authtypes = array_unique($authtypes); -- cgit v1.2.3 From f4476bd9b5badd36cd0617d76538e47d9649986b Mon Sep 17 00:00:00 2001 From: Jan Schumann Date: Mon, 20 Feb 2012 19:51:26 +0100 Subject: Refactored auth system: All auth methods are now introduced as plugins. --- lib/plugins/auth.php | 420 +++++++++++- lib/plugins/authad/auth.php | 359 +++++++++++ lib/plugins/authad/plugin.info.txt | 7 + lib/plugins/authldap/auth.php | 471 ++++++++++++++ lib/plugins/authldap/plugin.info.txt | 7 + lib/plugins/authmysql/auth.php | 946 ++++++++++++++++++++++++++++ lib/plugins/authmysql/plugin.info.txt | 7 + lib/plugins/authpgsql/auth.php | 331 ++++++++++ lib/plugins/authpgsql/plugin.info.txt | 7 + lib/plugins/authplain/auth.php | 335 ++++++++++ lib/plugins/authplain/plugin.info.txt | 7 + lib/plugins/config/settings/extra.class.php | 50 +- 12 files changed, 2929 insertions(+), 18 deletions(-) create mode 100644 lib/plugins/authad/auth.php create mode 100644 lib/plugins/authad/plugin.info.txt create mode 100644 lib/plugins/authldap/auth.php create mode 100644 lib/plugins/authldap/plugin.info.txt create mode 100644 lib/plugins/authmysql/auth.php create mode 100644 lib/plugins/authmysql/plugin.info.txt create mode 100644 lib/plugins/authpgsql/auth.php create mode 100644 lib/plugins/authpgsql/plugin.info.txt create mode 100644 lib/plugins/authplain/auth.php create mode 100644 lib/plugins/authplain/plugin.info.txt (limited to 'lib') diff --git a/lib/plugins/auth.php b/lib/plugins/auth.php index 3ec64018c..59631143f 100644 --- a/lib/plugins/auth.php +++ b/lib/plugins/auth.php @@ -9,17 +9,421 @@ if(!defined('DOKU_INC')) die(); /** - * All plugins that provide Authentication should inherit from this class and implement - * the getAuth() method to make its Auth-System available. + * auth/basic.class.php * - * @author Jan Schumann + * foundation authorisation class + * all auth classes should inherit from this class + * + * @author Chris Smith + * @author Jan Schumann */ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { - /** - * Retrieves the authentication system - */ - function getAuth() { - trigger_error('getAuth() not implemented in '.get_class($this), E_USER_WARNING); + var $success = true; + + + /** + * Posible things an auth backend module may be able to + * do. The things a backend can do need to be set to true + * in the constructor. + */ + var $cando = array ( + 'addUser' => false, // can Users be created? + 'delUser' => false, // can Users be deleted? + 'modLogin' => false, // can login names be changed? + 'modPass' => false, // can passwords be changed? + 'modName' => false, // can real names be changed? + 'modMail' => false, // can emails be changed? + 'modGroups' => false, // can groups be changed? + 'getUsers' => false, // can a (filtered) list of users be retrieved? + 'getUserCount'=> false, // can the number of users be retrieved? + 'getGroups' => false, // can a list of available groups be retrieved? + 'external' => false, // does the module do external auth checking? + 'logout' => true, // can the user logout again? (eg. not possible with HTTP auth) + ); + + + /** + * Constructor. + * + * Carry out sanity checks to ensure the object is + * able to operate. Set capabilities in $this->cando + * array here + * + * Set $this->success to false if checks fail + * + * @author Christopher Smith + */ + function auth_basic() { + // the base class constructor does nothing, derived class + // constructors do the real work + } + + /** + * Capability check. [ DO NOT OVERRIDE ] + * + * Checks the capabilities set in the $this->cando array and + * some pseudo capabilities (shortcutting access to multiple + * ones) + * + * ususal capabilities start with lowercase letter + * shortcut capabilities start with uppercase letter + * + * @author Andreas Gohr + * @return bool + */ + function canDo($cap) { + switch($cap){ + case 'Profile': + // can at least one of the user's properties be changed? + return ( $this->cando['modPass'] || + $this->cando['modName'] || + $this->cando['modMail'] ); + break; + case 'UserMod': + // can at least anything be changed? + return ( $this->cando['modPass'] || + $this->cando['modName'] || + $this->cando['modMail'] || + $this->cando['modLogin'] || + $this->cando['modGroups'] || + $this->cando['modMail'] ); + break; + default: + // print a helping message for developers + if(!isset($this->cando[$cap])){ + msg("Check for unknown capability '$cap' - Do you use an outdated Plugin?",-1); + } + return $this->cando[$cap]; + } + } + + /** + * Trigger the AUTH_USERDATA_CHANGE event and call the modification function. [ DO NOT OVERRIDE ] + * + * You should use this function instead of calling createUser, modifyUser or + * deleteUsers directly. The event handlers can prevent the modification, for + * example for enforcing a user name schema. + * + * @author Gabriel Birke + * @param string $type Modification type ('create', 'modify', 'delete') + * @param array $params Parameters for the createUser, modifyUser or deleteUsers method. The content of this array depends on the modification type + * @return mixed Result from the modification function or false if an event handler has canceled the action + */ + function triggerUserMod($type, $params) + { + $validTypes = array( + 'create' => 'createUser', + 'modify' => 'modifyUser', + 'delete' => 'deleteUsers' + ); + if(empty($validTypes[$type])) + return false; + $eventdata = array('type' => $type, 'params' => $params, 'modification_result' => null); + $evt = new Doku_Event('AUTH_USER_CHANGE', $eventdata); + if ($evt->advise_before(true)) { + $result = call_user_func_array(array($this, $validTypes[$type]), $params); + $evt->data['modification_result'] = $result; } + $evt->advise_after(); + unset($evt); + return $result; + } + + /** + * Log off the current user [ OPTIONAL ] + * + * Is run in addition to the ususal logoff method. Should + * only be needed when trustExternal is implemented. + * + * @see auth_logoff() + * @author Andreas Gohr + */ + function logOff(){ + } + + /** + * Do all authentication [ OPTIONAL ] + * + * Set $this->cando['external'] = true when implemented + * + * If this function is implemented it will be used to + * authenticate a user - all other DokuWiki internals + * will not be used for authenticating, thus + * implementing the checkPass() function is not needed + * anymore. + * + * The function can be used to authenticate against third + * party cookies or Apache auth mechanisms and replaces + * the auth_login() function + * + * The function will be called with or without a set + * username. If the Username is given it was called + * from the login form and the given credentials might + * need to be checked. If no username was given it + * the function needs to check if the user is logged in + * by other means (cookie, environment). + * + * The function needs to set some globals needed by + * DokuWiki like auth_login() does. + * + * @see auth_login() + * @author Andreas Gohr + * + * @param string $user Username + * @param string $pass Cleartext Password + * @param bool $sticky Cookie should not expire + * @return bool true on successful auth + */ + function trustExternal($user,$pass,$sticky=false){ +# // some example: +# +# global $USERINFO; +# global $conf; +# $sticky ? $sticky = true : $sticky = false; //sanity check +# +# // do the checking here +# +# // set the globals if authed +# $USERINFO['name'] = 'FIXME'; +# $USERINFO['mail'] = 'FIXME'; +# $USERINFO['grps'] = array('FIXME'); +# $_SERVER['REMOTE_USER'] = $user; +# $_SESSION[DOKU_COOKIE]['auth']['user'] = $user; +# $_SESSION[DOKU_COOKIE]['auth']['pass'] = $pass; +# $_SESSION[DOKU_COOKIE]['auth']['info'] = $USERINFO; +# return true; + } + + /** + * Check user+password [ MUST BE OVERRIDDEN ] + * + * Checks if the given user exists and the given + * plaintext password is correct + * + * May be ommited if trustExternal is used. + * + * @author Andreas Gohr + * @return bool + */ + function checkPass($user,$pass){ + msg("no valid authorisation system in use", -1); + return false; + } + + /** + * Return user info [ MUST BE OVERRIDDEN ] + * + * Returns info about the given user needs to contain + * at least these fields: + * + * name string full name of the user + * mail string email addres of the user + * grps array list of groups the user is in + * + * @author Andreas Gohr + * @return array containing user data or false + */ + function getUserData($user) { + if(!$this->cando['external']) msg("no valid authorisation system in use", -1); + return false; + } + + /** + * Create a new User [implement only where required/possible] + * + * Returns false if the user already exists, null when an error + * occurred and true if everything went well. + * + * The new user HAS TO be added to the default group by this + * function! + * + * Set addUser capability when implemented + * + * @author Andreas Gohr + */ + function createUser($user,$pass,$name,$mail,$grps=null){ + msg("authorisation method does not allow creation of new users", -1); + return null; + } + + /** + * Modify user data [implement only where required/possible] + * + * Set the mod* capabilities according to the implemented features + * + * @author Chris Smith + * @param $user nick of the user to be changed + * @param $changes array of field/value pairs to be changed (password will be clear text) + * @return bool + */ + function modifyUser($user, $changes) { + msg("authorisation method does not allow modifying of user data", -1); + return false; + } + + /** + * Delete one or more users [implement only where required/possible] + * + * Set delUser capability when implemented + * + * @author Chris Smith + * @param array $users + * @return int number of users deleted + */ + function deleteUsers($users) { + msg("authorisation method does not allow deleting of users", -1); + return false; + } + + /** + * Return a count of the number of user which meet $filter criteria + * [should be implemented whenever retrieveUsers is implemented] + * + * Set getUserCount capability when implemented + * + * @author Chris Smith + */ + function getUserCount($filter=array()) { + msg("authorisation method does not provide user counts", -1); + return 0; + } + + /** + * Bulk retrieval of user data [implement only where required/possible] + * + * Set getUsers capability when implemented + * + * @author Chris Smith + * @param start index of first user to be returned + * @param limit max number of users to be returned + * @param filter array of field/pattern pairs, null for no filter + * @return array of userinfo (refer getUserData for internal userinfo details) + */ + function retrieveUsers($start=0,$limit=-1,$filter=null) { + msg("authorisation method does not support mass retrieval of user data", -1); + return array(); + } + + /** + * Define a group [implement only where required/possible] + * + * Set addGroup capability when implemented + * + * @author Chris Smith + * @return bool + */ + function addGroup($group) { + msg("authorisation method does not support independent group creation", -1); + return false; + } + + /** + * Retrieve groups [implement only where required/possible] + * + * Set getGroups capability when implemented + * + * @author Chris Smith + * @return array + */ + function retrieveGroups($start=0,$limit=0) { + msg("authorisation method does not support group list retrieval", -1); + return array(); + } + + /** + * Return case sensitivity of the backend [OPTIONAL] + * + * When your backend is caseinsensitive (eg. you can login with USER and + * user) then you need to overwrite this method and return false + */ + function isCaseSensitive(){ + return true; + } + + /** + * Sanitize a given username [OPTIONAL] + * + * This function is applied to any user name that is given to + * the backend and should also be applied to any user name within + * the backend before returning it somewhere. + * + * This should be used to enforce username restrictions. + * + * @author Andreas Gohr + * @param string $user - username + * @param string - the cleaned username + */ + function cleanUser($user){ + return $user; + } + + /** + * Sanitize a given groupname [OPTIONAL] + * + * This function is applied to any groupname that is given to + * the backend and should also be applied to any groupname within + * the backend before returning it somewhere. + * + * This should be used to enforce groupname restrictions. + * + * Groupnames are to be passed without a leading '@' here. + * + * @author Andreas Gohr + * @param string $group - groupname + * @param string - the cleaned groupname + */ + function cleanGroup($group){ + return $group; + } + + + /** + * Check Session Cache validity [implement only where required/possible] + * + * DokuWiki caches user info in the user's session for the timespan defined + * in $conf['auth_security_timeout']. + * + * This makes sure slow authentication backends do not slow down DokuWiki. + * This also means that changes to the user database will not be reflected + * on currently logged in users. + * + * To accommodate for this, the user manager plugin will touch a reference + * file whenever a change is submitted. This function compares the filetime + * of this reference file with the time stored in the session. + * + * This reference file mechanism does not reflect changes done directly in + * the backend's database through other means than the user manager plugin. + * + * Fast backends might want to return always false, to force rechecks on + * each page load. Others might want to use their own checking here. If + * unsure, do not override. + * + * @param string $user - The username + * @author Andreas Gohr + * @return bool + */ + function useSessionCache($user){ + global $conf; + return ($_SESSION[DOKU_COOKIE]['auth']['time'] >= @filemtime($conf['cachedir'].'/sessionpurge')); + } + + + /** + * loadConfig() + * merges the plugin's default settings with any local settings + * this function is automatically called through getConf() + */ + function loadConfig(){ + global $conf; + + parent::loadConfig(); + + $this->conf['debug'] = $conf['debug']; + $this->conf['useacl'] = $conf['useacl']; + $this->conf['disableactions'] = $conf['disableactions']; + $this->conf['autopasswd'] = $conf['autopasswd']; + $this->conf['passcrypt'] = $conf['ssha']; + } + } diff --git a/lib/plugins/authad/auth.php b/lib/plugins/authad/auth.php new file mode 100644 index 000000000..70d3cfb8c --- /dev/null +++ b/lib/plugins/authad/auth.php @@ -0,0 +1,359 @@ + + */ +// must be run within Dokuwiki +if(!defined('DOKU_INC')) die(); + +require_once(DOKU_INC.'inc/adLDAP.php'); + +/** + * Active Directory authentication backend for DokuWiki + * + * This makes authentication with a Active Directory server much easier + * than when using the normal LDAP backend by utilizing the adLDAP library + * + * Usage: + * Set DokuWiki's local.protected.php auth setting to read + * + * $conf['useacl'] = 1; + * $conf['disableactions'] = 'register'; + * $conf['autopasswd'] = 0; + * $conf['authtype'] = 'authad'; + * $conf['passcrypt'] = 'ssha'; + * + * $conf['plugin']['authad']['account_suffix'] = '@my.domain.org'; + * $conf['plugin']['authad']['base_dn'] = 'DC=my,DC=domain,DC=org'; + * $conf['plugin']['authad']['domain_controllers'] = 'srv1.domain.org,srv2.domain.org'; + * + * //optional: + * $conf['plugin']['authad']['sso'] = 1; + * $conf['plugin']['authad']['ad_username'] = 'root'; + * $conf['plugin']['authad']['ad_password'] = 'pass'; + * $conf['plugin']['authad']['real_primarygroup'] = 1; + * $conf['plugin']['authad']['use_ssl'] = 1; + * $conf['plugin']['authad']['use_tls'] = 1; + * $conf['plugin']['authad']['debug'] = 1; + * + * // get additional information to the userinfo array + * // add a list of comma separated ldap contact fields. + * $conf['plugin']['authad']['additional'] = 'field1,field2'; + * + * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) + * @author James Van Lommel + * @link http://www.nosq.com/blog/2005/08/ldap-activedirectory-and-dokuwiki/ + * @author Andreas Gohr + * @author Jan Schumann + */ +class auth_plugin_authad extends DokuWiki_Auth_Plugin +{ + var $cnf = null; + var $opts = null; + var $adldap = null; + var $users = null; + + /** + * Constructor + */ + function auth_plugin_authad() { + global $conf; + $this->cnf = $conf['auth']['ad']; + + + // additional information fields + if (isset($this->cnf['additional'])) { + $this->cnf['additional'] = str_replace(' ', '', $this->cnf['additional']); + $this->cnf['additional'] = explode(',', $this->cnf['additional']); + } else $this->cnf['additional'] = array(); + + // ldap extension is needed + if (!function_exists('ldap_connect')) { + if ($this->cnf['debug']) + msg("AD Auth: PHP LDAP extension not found.",-1); + $this->success = false; + return; + } + + // Prepare SSO + if($_SERVER['REMOTE_USER'] && $this->cnf['sso']){ + // remove possible NTLM domain + list($dom,$usr) = explode('\\',$_SERVER['REMOTE_USER'],2); + if(!$usr) $usr = $dom; + + // remove possible Kerberos domain + list($usr,$dom) = explode('@',$usr); + + $dom = strtolower($dom); + $_SERVER['REMOTE_USER'] = $usr; + + // we need to simulate a login + if(empty($_COOKIE[DOKU_COOKIE])){ + $_REQUEST['u'] = $_SERVER['REMOTE_USER']; + $_REQUEST['p'] = 'sso_only'; + } + } + + // prepare adLDAP standard configuration + $this->opts = $this->cnf; + + // add possible domain specific configuration + if($dom && is_array($this->cnf[$dom])) foreach($this->cnf[$dom] as $key => $val){ + $this->opts[$key] = $val; + } + + // handle multiple AD servers + $this->opts['domain_controllers'] = explode(',',$this->opts['domain_controllers']); + $this->opts['domain_controllers'] = array_map('trim',$this->opts['domain_controllers']); + $this->opts['domain_controllers'] = array_filter($this->opts['domain_controllers']); + + // we can change the password if SSL is set + if($this->opts['use_ssl'] || $this->opts['use_tls']){ + $this->cando['modPass'] = true; + } + $this->cando['modName'] = true; + $this->cando['modMail'] = true; + } + + /** + * Check user+password [required auth function] + * + * Checks if the given user exists and the given + * plaintext password is correct by trying to bind + * to the LDAP server + * + * @author James Van Lommel + * @return bool + */ + function checkPass($user, $pass){ + if($_SERVER['REMOTE_USER'] && + $_SERVER['REMOTE_USER'] == $user && + $this->cnf['sso']) return true; + + if(!$this->_init()) return false; + return $this->adldap->authenticate($user, $pass); + } + + /** + * Return user info [required auth function] + * + * Returns info about the given user needs to contain + * at least these fields: + * + * name string full name of the user + * mail string email address of the user + * grps array list of groups the user is in + * + * This LDAP specific function returns the following + * addional fields: + * + * dn string distinguished name (DN) + * uid string Posix User ID + * + * @author James Van Lommel + */ + function getUserData($user){ + global $conf; + if(!$this->_init()) return false; + + $fields = array('mail','displayname','samaccountname'); + + // add additional fields to read + $fields = array_merge($fields, $this->cnf['additional']); + $fields = array_unique($fields); + + //get info for given user + $result = $this->adldap->user_info($user, $fields); + //general user info + $info['name'] = $result[0]['displayname'][0]; + $info['mail'] = $result[0]['mail'][0]; + $info['uid'] = $result[0]['samaccountname'][0]; + $info['dn'] = $result[0]['dn']; + + // additional information + foreach ($this->cnf['additional'] as $field) { + if (isset($result[0][strtolower($field)])) { + $info[$field] = $result[0][strtolower($field)][0]; + } + } + + // handle ActiveDirectory memberOf + $info['grps'] = $this->adldap->user_groups($user,(bool) $this->opts['recursive_groups']); + + if (is_array($info['grps'])) { + foreach ($info['grps'] as $ndx => $group) { + $info['grps'][$ndx] = $this->cleanGroup($group); + } + } + + // always add the default group to the list of groups + if(!is_array($info['grps']) || !in_array($conf['defaultgroup'],$info['grps'])){ + $info['grps'][] = $conf['defaultgroup']; + } + + return $info; + } + + /** + * Make AD group names usable by DokuWiki. + * + * Removes backslashes ('\'), pound signs ('#'), and converts spaces to underscores. + * + * @author James Van Lommel (jamesvl@gmail.com) + */ + function cleanGroup($name) { + $sName = str_replace('\\', '', $name); + $sName = str_replace('#', '', $sName); + $sName = preg_replace('[\s]', '_', $sName); + return $sName; + } + + /** + * Sanitize user names + */ + function cleanUser($name) { + return $this->cleanGroup($name); + } + + /** + * Most values in LDAP are case-insensitive + */ + function isCaseSensitive(){ + return false; + } + + /** + * Bulk retrieval of user data + * + * @author Dominik Eckelmann + * @param start index of first user to be returned + * @param limit max number of users to be returned + * @param filter array of field/pattern pairs, null for no filter + * @return array of userinfo (refer getUserData for internal userinfo details) + */ + function retrieveUsers($start=0,$limit=-1,$filter=array()) { + if(!$this->_init()) return false; + + if ($this->users === null) { + //get info for given user + $result = $this->adldap->all_users(); + if (!$result) return array(); + $this->users = array_fill_keys($result, false); + } + + $i = 0; + $count = 0; + $this->_constructPattern($filter); + $result = array(); + + foreach ($this->users as $user => &$info) { + if ($i++ < $start) { + continue; + } + if ($info === false) { + $info = $this->getUserData($user); + } + if ($this->_filter($user, $info)) { + $result[$user] = $info; + if (($limit >= 0) && (++$count >= $limit)) break; + } + } + return $result; + } + + /** + * Modify user data + * + * @param $user nick of the user to be changed + * @param $changes array of field/value pairs to be changed + * @return bool + */ + function modifyUser($user, $changes) { + $return = true; + + // password changing + if(isset($changes['pass'])){ + try { + $return = $this->adldap->user_password($user,$changes['pass']); + } catch (adLDAPException $e) { + if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1); + $return = false; + } + if(!$return) msg('AD Auth: failed to change the password. Maybe the password policy was not met?',-1); + } + + // changing user data + $adchanges = array(); + if(isset($changes['name'])){ + // get first and last name + $parts = explode(' ',$changes['name']); + $adchanges['surname'] = array_pop($parts); + $adchanges['firstname'] = join(' ',$parts); + $adchanges['display_name'] = $changes['name']; + } + if(isset($changes['mail'])){ + $adchanges['email'] = $changes['mail']; + } + if(count($adchanges)){ + try { + $return = $return & $this->adldap->user_modify($user,$adchanges); + } catch (adLDAPException $e) { + if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1); + $return = false; + } + } + + return $return; + } + + /** + * Initialize the AdLDAP library and connect to the server + */ + function _init(){ + if(!is_null($this->adldap)) return true; + + // connect + try { + $this->adldap = new adLDAP($this->opts); + if (isset($this->opts['ad_username']) && isset($this->opts['ad_password'])) { + $this->canDo['getUsers'] = true; + } + return true; + } catch (adLDAPException $e) { + if ($this->cnf['debug']) { + msg('AD Auth: '.$e->getMessage(), -1); + } + $this->success = false; + $this->adldap = null; + } + return false; + } + + /** + * return 1 if $user + $info match $filter criteria, 0 otherwise + * + * @author Chris Smith + */ + function _filter($user, $info) { + foreach ($this->_pattern as $item => $pattern) { + if ($item == 'user') { + if (!preg_match($pattern, $user)) return 0; + } else if ($item == 'grps') { + if (!count(preg_grep($pattern, $info['grps']))) return 0; + } else { + if (!preg_match($pattern, $info[$item])) return 0; + } + } + return 1; + } + + function _constructPattern($filter) { + $this->_pattern = array(); + foreach ($filter as $item => $pattern) { +// $this->_pattern[$item] = '/'.preg_quote($pattern,"/").'/i'; // don't allow regex characters + $this->_pattern[$item] = '/'.str_replace('/','\/',$pattern).'/i'; // allow regex characters + } + } +} \ No newline at end of file diff --git a/lib/plugins/authad/plugin.info.txt b/lib/plugins/authad/plugin.info.txt new file mode 100644 index 000000000..ad565b853 --- /dev/null +++ b/lib/plugins/authad/plugin.info.txt @@ -0,0 +1,7 @@ +base authad +author +email +date +name active directory auth plugin +desc Provides authentication against a Microsoft Active Directory +url diff --git a/lib/plugins/authldap/auth.php b/lib/plugins/authldap/auth.php new file mode 100644 index 000000000..723685f94 --- /dev/null +++ b/lib/plugins/authldap/auth.php @@ -0,0 +1,471 @@ + + */ +// must be run within Dokuwiki +if(!defined('DOKU_INC')) die(); + +/** + * LDAP authentication backend + * + * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) + * @author Andreas Gohr + * @author Chris Smith + * @author Jan Schumann + */ +class auth_plugin_authldap extends DokuWiki_Auth_Plugin +{ + var $cnf = null; + var $con = null; + var $bound = 0; // 0: anonymous, 1: user, 2: superuser + + /** + * Constructor + */ + function auth_plugin_authldap(){ + global $conf; + $this->cnf = $conf['auth']['ldap']; + + // ldap extension is needed + if(!function_exists('ldap_connect')) { + if ($this->cnf['debug']) + msg("LDAP err: PHP LDAP extension not found.",-1,__LINE__,__FILE__); + $this->success = false; + return; + } + + if(empty($this->cnf['groupkey'])) $this->cnf['groupkey'] = 'cn'; + if(empty($this->cnf['userscope'])) $this->cnf['userscope'] = 'sub'; + if(empty($this->cnf['groupscope'])) $this->cnf['groupscope'] = 'sub'; + + // auth_ldap currently just handles authentication, so no + // capabilities are set + } + + /** + * Check user+password + * + * Checks if the given user exists and the given + * plaintext password is correct by trying to bind + * to the LDAP server + * + * @author Andreas Gohr + * @return bool + */ + function checkPass($user,$pass){ + // reject empty password + if(empty($pass)) return false; + if(!$this->_openLDAP()) return false; + + // indirect user bind + if($this->cnf['binddn'] && $this->cnf['bindpw']){ + // use superuser credentials + if(!@ldap_bind($this->con,$this->cnf['binddn'],$this->cnf['bindpw'])){ + if($this->cnf['debug']) + msg('LDAP bind as superuser: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + return false; + } + $this->bound = 2; + }else if($this->cnf['binddn'] && + $this->cnf['usertree'] && + $this->cnf['userfilter']) { + // special bind string + $dn = $this->_makeFilter($this->cnf['binddn'], + array('user'=>$user,'server'=>$this->cnf['server'])); + + }else if(strpos($this->cnf['usertree'], '%{user}')) { + // direct user bind + $dn = $this->_makeFilter($this->cnf['usertree'], + array('user'=>$user,'server'=>$this->cnf['server'])); + + }else{ + // Anonymous bind + if(!@ldap_bind($this->con)){ + msg("LDAP: can not bind anonymously",-1); + if($this->cnf['debug']) + msg('LDAP anonymous bind: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + return false; + } + } + + // Try to bind to with the dn if we have one. + if(!empty($dn)) { + // User/Password bind + if(!@ldap_bind($this->con,$dn,$pass)){ + if($this->cnf['debug']){ + msg("LDAP: bind with $dn failed", -1,__LINE__,__FILE__); + msg('LDAP user dn bind: '.htmlspecialchars(ldap_error($this->con)),0); + } + return false; + } + $this->bound = 1; + return true; + }else{ + // See if we can find the user + $info = $this->getUserData($user,true); + if(empty($info['dn'])) { + return false; + } else { + $dn = $info['dn']; + } + + // Try to bind with the dn provided + if(!@ldap_bind($this->con,$dn,$pass)){ + if($this->cnf['debug']){ + msg("LDAP: bind with $dn failed", -1,__LINE__,__FILE__); + msg('LDAP user bind: '.htmlspecialchars(ldap_error($this->con)),0); + } + return false; + } + $this->bound = 1; + return true; + } + + return false; + } + + /** + * Return user info + * + * Returns info about the given user needs to contain + * at least these fields: + * + * name string full name of the user + * mail string email addres of the user + * grps array list of groups the user is in + * + * This LDAP specific function returns the following + * addional fields: + * + * dn string distinguished name (DN) + * uid string Posix User ID + * inbind bool for internal use - avoid loop in binding + * + * @author Andreas Gohr + * @author Trouble + * @author Dan Allen + * @author + * @author Stephane Chazelas + * @return array containing user data or false + */ + function getUserData($user,$inbind=false) { + global $conf; + if(!$this->_openLDAP()) return false; + + // force superuser bind if wanted and not bound as superuser yet + if($this->cnf['binddn'] && $this->cnf['bindpw'] && $this->bound < 2){ + // use superuser credentials + if(!@ldap_bind($this->con,$this->cnf['binddn'],$this->cnf['bindpw'])){ + if($this->cnf['debug']) + msg('LDAP bind as superuser: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + return false; + } + $this->bound = 2; + }elseif($this->bound == 0 && !$inbind) { + // in some cases getUserData is called outside the authentication workflow + // eg. for sending email notification on subscribed pages. This data might not + // be accessible anonymously, so we try to rebind the current user here + list($loginuser,$loginsticky,$loginpass) = auth_getCookie(); + if($loginuser && $loginpass){ + $loginpass = PMA_blowfish_decrypt($loginpass, auth_cookiesalt(!$loginsticky)); + $this->checkPass($loginuser, $loginpass); + } + } + + $info['user'] = $user; + $info['server'] = $this->cnf['server']; + + //get info for given user + $base = $this->_makeFilter($this->cnf['usertree'], $info); + if(!empty($this->cnf['userfilter'])) { + $filter = $this->_makeFilter($this->cnf['userfilter'], $info); + } else { + $filter = "(ObjectClass=*)"; + } + + $sr = $this->_ldapsearch($this->con, $base, $filter, $this->cnf['userscope']); + $result = @ldap_get_entries($this->con, $sr); + if($this->cnf['debug']){ + msg('LDAP user search: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + msg('LDAP search at: '.htmlspecialchars($base.' '.$filter),0,__LINE__,__FILE__); + } + + // Don't accept more or less than one response + if(!is_array($result) || $result['count'] != 1){ + return false; //user not found + } + + $user_result = $result[0]; + ldap_free_result($sr); + + // general user info + $info['dn'] = $user_result['dn']; + $info['gid'] = $user_result['gidnumber'][0]; + $info['mail'] = $user_result['mail'][0]; + $info['name'] = $user_result['cn'][0]; + $info['grps'] = array(); + + // overwrite if other attribs are specified. + if(is_array($this->cnf['mapping'])){ + foreach($this->cnf['mapping'] as $localkey => $key) { + if(is_array($key)) { + // use regexp to clean up user_result + list($key, $regexp) = each($key); + if($user_result[$key]) foreach($user_result[$key] as $grp){ + if (preg_match($regexp,$grp,$match)) { + if($localkey == 'grps') { + $info[$localkey][] = $match[1]; + } else { + $info[$localkey] = $match[1]; + } + } + } + } else { + $info[$localkey] = $user_result[$key][0]; + } + } + } + $user_result = array_merge($info,$user_result); + + //get groups for given user if grouptree is given + if ($this->cnf['grouptree'] || $this->cnf['groupfilter']) { + $base = $this->_makeFilter($this->cnf['grouptree'], $user_result); + $filter = $this->_makeFilter($this->cnf['groupfilter'], $user_result); + $sr = $this->_ldapsearch($this->con, $base, $filter, $this->cnf['groupscope'], array($this->cnf['groupkey'])); + if($this->cnf['debug']){ + msg('LDAP group search: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + msg('LDAP search at: '.htmlspecialchars($base.' '.$filter),0,__LINE__,__FILE__); + } + if(!$sr){ + msg("LDAP: Reading group memberships failed",-1); + return false; + } + $result = ldap_get_entries($this->con, $sr); + ldap_free_result($sr); + + if(is_array($result)) foreach($result as $grp){ + if(!empty($grp[$this->cnf['groupkey']][0])){ + if($this->cnf['debug']) + msg('LDAP usergroup: '.htmlspecialchars($grp[$this->cnf['groupkey']][0]),0,__LINE__,__FILE__); + $info['grps'][] = $grp[$this->cnf['groupkey']][0]; + } + } + } + + // always add the default group to the list of groups + if(!in_array($conf['defaultgroup'],$info['grps'])){ + $info['grps'][] = $conf['defaultgroup']; + } + return $info; + } + + /** + * Most values in LDAP are case-insensitive + */ + function isCaseSensitive(){ + return false; + } + + /** + * Bulk retrieval of user data + * + * @author Dominik Eckelmann + * @param start index of first user to be returned + * @param limit max number of users to be returned + * @param filter array of field/pattern pairs, null for no filter + * @return array of userinfo (refer getUserData for internal userinfo details) + */ + function retrieveUsers($start=0,$limit=-1,$filter=array()) { + if(!$this->_openLDAP()) return false; + + if (!isset($this->users)) { + // Perform the search and grab all their details + if(!empty($this->cnf['userfilter'])) { + $all_filter = str_replace('%{user}', '*', $this->cnf['userfilter']); + } else { + $all_filter = "(ObjectClass=*)"; + } + $sr=ldap_search($this->con,$this->cnf['usertree'],$all_filter); + $entries = ldap_get_entries($this->con, $sr); + $users_array = array(); + for ($i=0; $i<$entries["count"]; $i++){ + array_push($users_array, $entries[$i]["uid"][0]); + } + asort($users_array); + $result = $users_array; + if (!$result) return array(); + $this->users = array_fill_keys($result, false); + } + $i = 0; + $count = 0; + $this->_constructPattern($filter); + $result = array(); + + foreach ($this->users as $user => &$info) { + if ($i++ < $start) { + continue; + } + if ($info === false) { + $info = $this->getUserData($user); + } + if ($this->_filter($user, $info)) { + $result[$user] = $info; + if (($limit >= 0) && (++$count >= $limit)) break; + } + } + return $result; + + + } + + /** + * Make LDAP filter strings. + * + * Used by auth_getUserData to make the filter + * strings for grouptree and groupfilter + * + * filter string ldap search filter with placeholders + * placeholders array array with the placeholders + * + * @author Troels Liebe Bentsen + * @return string + */ + function _makeFilter($filter, $placeholders) { + preg_match_all("/%{([^}]+)/", $filter, $matches, PREG_PATTERN_ORDER); + //replace each match + foreach ($matches[1] as $match) { + //take first element if array + if(is_array($placeholders[$match])) { + $value = $placeholders[$match][0]; + } else { + $value = $placeholders[$match]; + } + $value = $this->_filterEscape($value); + $filter = str_replace('%{'.$match.'}', $value, $filter); + } + return $filter; + } + + /** + * return 1 if $user + $info match $filter criteria, 0 otherwise + * + * @author Chris Smith + */ + function _filter($user, $info) { + foreach ($this->_pattern as $item => $pattern) { + if ($item == 'user') { + if (!preg_match($pattern, $user)) return 0; + } else if ($item == 'grps') { + if (!count(preg_grep($pattern, $info['grps']))) return 0; + } else { + if (!preg_match($pattern, $info[$item])) return 0; + } + } + return 1; + } + + function _constructPattern($filter) { + $this->_pattern = array(); + foreach ($filter as $item => $pattern) { +// $this->_pattern[$item] = '/'.preg_quote($pattern,"/").'/i'; // don't allow regex characters + $this->_pattern[$item] = '/'.str_replace('/','\/',$pattern).'/i'; // allow regex characters + } + } + + /** + * Escape a string to be used in a LDAP filter + * + * Ported from Perl's Net::LDAP::Util escape_filter_value + * + * @author Andreas Gohr + */ + function _filterEscape($string){ + return preg_replace('/([\x00-\x1F\*\(\)\\\\])/e', + '"\\\\\".join("",unpack("H2","$1"))', + $string); + } + + /** + * Opens a connection to the configured LDAP server and sets the wanted + * option on the connection + * + * @author Andreas Gohr + */ + function _openLDAP(){ + if($this->con) return true; // connection already established + + $this->bound = 0; + + $port = ($this->cnf['port']) ? $this->cnf['port'] : 389; + $this->con = @ldap_connect($this->cnf['server'],$port); + if(!$this->con){ + msg("LDAP: couldn't connect to LDAP server",-1); + return false; + } + + //set protocol version and dependend options + if($this->cnf['version']){ + if(!@ldap_set_option($this->con, LDAP_OPT_PROTOCOL_VERSION, + $this->cnf['version'])){ + msg('Setting LDAP Protocol version '.$this->cnf['version'].' failed',-1); + if($this->cnf['debug']) + msg('LDAP version set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + }else{ + //use TLS (needs version 3) + if($this->cnf['starttls']) { + if (!@ldap_start_tls($this->con)){ + msg('Starting TLS failed',-1); + if($this->cnf['debug']) + msg('LDAP TLS set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + } + } + // needs version 3 + if(isset($this->cnf['referrals'])) { + if(!@ldap_set_option($this->con, LDAP_OPT_REFERRALS, + $this->cnf['referrals'])){ + msg('Setting LDAP referrals to off failed',-1); + if($this->cnf['debug']) + msg('LDAP referal set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + } + } + } + } + + //set deref mode + if($this->cnf['deref']){ + if(!@ldap_set_option($this->con, LDAP_OPT_DEREF, $this->cnf['deref'])){ + msg('Setting LDAP Deref mode '.$this->cnf['deref'].' failed',-1); + if($this->cnf['debug']) + msg('LDAP deref set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__); + } + } + + $this->canDo['getUsers'] = true; + return true; + } + + /** + * Wraps around ldap_search, ldap_list or ldap_read depending on $scope + * + * @param $scope string - can be 'base', 'one' or 'sub' + * @author Andreas Gohr + */ + function _ldapsearch($link_identifier, $base_dn, $filter, $scope='sub', $attributes=null, + $attrsonly=0, $sizelimit=0, $timelimit=0, $deref=LDAP_DEREF_NEVER){ + if(is_null($attributes)) $attributes = array(); + + if($scope == 'base'){ + return @ldap_read($link_identifier, $base_dn, $filter, $attributes, + $attrsonly, $sizelimit, $timelimit, $deref); + }elseif($scope == 'one'){ + return @ldap_list($link_identifier, $base_dn, $filter, $attributes, + $attrsonly, $sizelimit, $timelimit, $deref); + }else{ + return @ldap_search($link_identifier, $base_dn, $filter, $attributes, + $attrsonly, $sizelimit, $timelimit, $deref); + } + } +} \ No newline at end of file diff --git a/lib/plugins/authldap/plugin.info.txt b/lib/plugins/authldap/plugin.info.txt new file mode 100644 index 000000000..c36385224 --- /dev/null +++ b/lib/plugins/authldap/plugin.info.txt @@ -0,0 +1,7 @@ +base authldap +author +email +date +name ldap auth plugin +desc Provides authentication against am LDAP server +url diff --git a/lib/plugins/authmysql/auth.php b/lib/plugins/authmysql/auth.php new file mode 100644 index 000000000..9150d3939 --- /dev/null +++ b/lib/plugins/authmysql/auth.php @@ -0,0 +1,946 @@ + + */ +// must be run within Dokuwiki +if(!defined('DOKU_INC')) die(); + +/** + * MySQLP authentication backend + * + * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) + * @author Andreas Gohr + * @author Chris Smith + * @author Matthias Grimm + * @author Jan Schumann + */ +class auth_plugin_authmysql extends DokuWiki_Auth_Plugin +{ + var $dbcon = 0; + var $dbver = 0; // database version + var $dbrev = 0; // database revision + var $dbsub = 0; // database subrevision + var $cnf = null; + var $defaultgroup = ""; + + /** + * Constructor + * + * checks if the mysql interface is available, otherwise it will + * set the variable $success of the basis class to false + * + * @author Matthias Grimm + */ + function auth_plugin_authmysql() { + global $conf; + $this->cnf = $conf['auth']['mysql']; + + if (method_exists($this, 'auth_basic')) + parent::auth_basic(); + + if(!function_exists('mysql_connect')) { + if ($this->cnf['debug']) + msg("MySQL err: PHP MySQL extension not found.",-1,__LINE__,__FILE__); + $this->success = false; + return; + } + + // default to UTF-8, you rarely want something else + if(!isset($this->cnf['charset'])) $this->cnf['charset'] = 'utf8'; + + $this->defaultgroup = $conf['defaultgroup']; + + // set capabilities based upon config strings set + if (empty($this->cnf['server']) || empty($this->cnf['user']) || + !isset($this->cnf['password']) || empty($this->cnf['database'])){ + if ($this->cnf['debug']) + msg("MySQL err: insufficient configuration.",-1,__LINE__,__FILE__); + $this->success = false; + return; + } + + $this->cando['addUser'] = $this->_chkcnf(array('getUserInfo', + 'getGroups', + 'addUser', + 'getUserID', + 'getGroupID', + 'addGroup', + 'addUserGroup'),true); + $this->cando['delUser'] = $this->_chkcnf(array('getUserID', + 'delUser', + 'delUserRefs'),true); + $this->cando['modLogin'] = $this->_chkcnf(array('getUserID', + 'updateUser', + 'UpdateTarget'),true); + $this->cando['modPass'] = $this->cando['modLogin']; + $this->cando['modName'] = $this->cando['modLogin']; + $this->cando['modMail'] = $this->cando['modLogin']; + $this->cando['modGroups'] = $this->_chkcnf(array('getUserID', + 'getGroups', + 'getGroupID', + 'addGroup', + 'addUserGroup', + 'delGroup', + 'getGroupID', + 'delUserGroup'),true); + /* getGroups is not yet supported + $this->cando['getGroups'] = $this->_chkcnf(array('getGroups', + 'getGroupID'),false); */ + $this->cando['getUsers'] = $this->_chkcnf(array('getUsers', + 'getUserInfo', + 'getGroups'),false); + $this->cando['getUserCount'] = $this->_chkcnf(array('getUsers'),false); + } + + /** + * Check if the given config strings are set + * + * @author Matthias Grimm + * @return bool + */ + function _chkcnf($keys, $wop=false){ + foreach ($keys as $key){ + if (empty($this->cnf[$key])) return false; + } + + /* write operation and lock array filled with tables names? */ + if ($wop && (!is_array($this->cnf['TablesToLock']) || + !count($this->cnf['TablesToLock']))){ + return false; + } + + return true; + } + + /** + * Checks if the given user exists and the given plaintext password + * is correct. Furtheron it might be checked wether the user is + * member of the right group + * + * Depending on which SQL string is defined in the config, password + * checking is done here (getpass) or by the database (passcheck) + * + * @param $user user who would like access + * @param $pass user's clear text password to check + * @return bool + * + * @author Andreas Gohr + * @author Matthias Grimm + */ + function checkPass($user,$pass){ + $rc = false; + + if($this->_openDB()) { + $sql = str_replace('%{user}',$this->_escape($user),$this->cnf['checkPass']); + $sql = str_replace('%{pass}',$this->_escape($pass),$sql); + $sql = str_replace('%{dgroup}',$this->_escape($this->defaultgroup),$sql); + $result = $this->_queryDB($sql); + + if($result !== false && count($result) == 1) { + if($this->cnf['forwardClearPass'] == 1) + $rc = true; + else + $rc = auth_verifyPassword($pass,$result[0]['pass']); + } + $this->_closeDB(); + } + return $rc; + } + + /** + * [public function] + * + * Returns info about the given user needs to contain + * at least these fields: + * name string full name of the user + * mail string email addres of the user + * grps array list of groups the user is in + * + * @param $user user's nick to get data for + * + * @author Andreas Gohr + * @author Matthias Grimm + */ + function getUserData($user){ + if($this->_openDB()) { + $this->_lockTables("READ"); + $info = $this->_getUserInfo($user); + $this->_unlockTables(); + $this->_closeDB(); + } else + $info = false; + return $info; + } + + /** + * [public function] + * + * Create a new User. Returns false if the user already exists, + * null when an error occurred and true if everything went well. + * + * The new user will be added to the default group by this + * function if grps are not specified (default behaviour). + * + * @param $user nick of the user + * @param $pwd clear text password + * @param $name full name of the user + * @param $mail email address + * @param $grps array of groups the user should become member of + * + * @author Andreas Gohr + * @author Chris Smith + * @author Matthias Grimm + */ + function createUser($user,$pwd,$name,$mail,$grps=null){ + if($this->_openDB()) { + if (($info = $this->_getUserInfo($user)) !== false) + return false; // user already exists + + // set defaultgroup if no groups were given + if ($grps == null) + $grps = array($this->defaultgroup); + + $this->_lockTables("WRITE"); + $pwd = $this->cnf['forwardClearPass'] ? $pwd : auth_cryptPassword($pwd); + $rc = $this->_addUser($user,$pwd,$name,$mail,$grps); + $this->_unlockTables(); + $this->_closeDB(); + if ($rc) return true; + } + return null; // return error + } + + /** + * Modify user data [public function] + * + * An existing user dataset will be modified. Changes are given in an array. + * + * The dataset update will be rejected if the user name should be changed + * to an already existing one. + * + * The password must be provides unencrypted. Pasword cryption is done + * automatically if configured. + * + * If one or more groups could't be updated, an error would be set. In + * this case the dataset might already be changed and we can't rollback + * the changes. Transactions would be really usefull here. + * + * modifyUser() may be called without SQL statements defined that are + * needed to change group membership (for example if only the user profile + * should be modified). In this case we asure that we don't touch groups + * even $changes['grps'] is set by mistake. + * + * @param $user nick of the user to be changed + * @param $changes array of field/value pairs to be changed (password + * will be clear text) + * @return bool true on success, false on error + * + * @author Chris Smith + * @author Matthias Grimm + */ + function modifyUser($user, $changes) { + $rc = false; + + if (!is_array($changes) || !count($changes)) + return true; // nothing to change + + if($this->_openDB()) { + $this->_lockTables("WRITE"); + + if (($uid = $this->_getUserID($user))) { + $rc = $this->_updateUserInfo($changes, $uid); + + if ($rc && isset($changes['grps']) && $this->cando['modGroups']) { + $groups = $this->_getGroups($user); + $grpadd = array_diff($changes['grps'], $groups); + $grpdel = array_diff($groups, $changes['grps']); + + foreach($grpadd as $group) + if (($this->_addUserToGroup($user, $group, 1)) == false) + $rc = false; + + foreach($grpdel as $group) + if (($this->_delUserFromGroup($user, $group)) == false) + $rc = false; + } + } + + $this->_unlockTables(); + $this->_closeDB(); + } + return $rc; + } + + /** + * [public function] + * + * Remove one or more users from the list of registered users + * + * @param array $users array of users to be deleted + * @return int the number of users deleted + * + * @author Christopher Smith + * @author Matthias Grimm + */ + function deleteUsers($users) { + $count = 0; + + if($this->_openDB()) { + if (is_array($users) && count($users)) { + $this->_lockTables("WRITE"); + foreach ($users as $user) { + if ($this->_delUser($user)) + $count++; + } + $this->_unlockTables(); + } + $this->_closeDB(); + } + return $count; + } + + /** + * [public function] + * + * Counts users which meet certain $filter criteria. + * + * @param array $filter filter criteria in item/pattern pairs + * @return count of found users. + * + * @author Matthias Grimm + */ + function getUserCount($filter=array()) { + $rc = 0; + + if($this->_openDB()) { + $sql = $this->_createSQLFilter($this->cnf['getUsers'], $filter); + + if ($this->dbver >= 4) { + $sql = substr($sql, 6); /* remove 'SELECT' or 'select' */ + $sql = "SELECT SQL_CALC_FOUND_ROWS".$sql." LIMIT 1"; + $this->_queryDB($sql); + $result = $this->_queryDB("SELECT FOUND_ROWS()"); + $rc = $result[0]['FOUND_ROWS()']; + } else if (($result = $this->_queryDB($sql))) + $rc = count($result); + + $this->_closeDB(); + } + return $rc; + } + + /** + * Bulk retrieval of user data. [public function] + * + * @param first index of first user to be returned + * @param limit max number of users to be returned + * @param filter array of field/pattern pairs + * @return array of userinfo (refer getUserData for internal userinfo details) + * + * @author Matthias Grimm + */ + function retrieveUsers($first=0,$limit=10,$filter=array()) { + $out = array(); + + if($this->_openDB()) { + $this->_lockTables("READ"); + $sql = $this->_createSQLFilter($this->cnf['getUsers'], $filter); + $sql .= " ".$this->cnf['SortOrder']." LIMIT $first, $limit"; + $result = $this->_queryDB($sql); + + if (!empty($result)) { + foreach ($result as $user) + if (($info = $this->_getUserInfo($user['user']))) + $out[$user['user']] = $info; + } + + $this->_unlockTables(); + $this->_closeDB(); + } + return $out; + } + + /** + * Give user membership of a group [public function] + * + * @param $user + * @param $group + * @return bool true on success, false on error + * + * @author Matthias Grimm + */ + function joinGroup($user, $group) { + $rc = false; + + if ($this->_openDB()) { + $this->_lockTables("WRITE"); + $rc = $this->_addUserToGroup($user, $group); + $this->_unlockTables(); + $this->_closeDB(); + } + return $rc; + } + + /** + * Remove user from a group [public function] + * + * @param $user user that leaves a group + * @param $group group to leave + * @return bool + * + * @author Matthias Grimm + */ + function leaveGroup($user, $group) { + $rc = false; + + if ($this->_openDB()) { + $this->_lockTables("WRITE"); + $uid = $this->_getUserID($user); + $rc = $this->_delUserFromGroup($user, $group); + $this->_unlockTables(); + $this->_closeDB(); + } + return $rc; + } + + /** + * MySQL is case-insensitive + */ + function isCaseSensitive(){ + return false; + } + + /** + * Adds a user to a group. + * + * If $force is set to '1' non existing groups would be created. + * + * The database connection must already be established. Otherwise + * this function does nothing and returns 'false'. It is strongly + * recommended to call this function only after all participating + * tables (group and usergroup) have been locked. + * + * @param $user user to add to a group + * @param $group name of the group + * @param $force '1' create missing groups + * @return bool 'true' on success, 'false' on error + * + * @author Matthias Grimm + */ + function _addUserToGroup($user, $group, $force=0) { + $newgroup = 0; + + if (($this->dbcon) && ($user)) { + $gid = $this->_getGroupID($group); + if (!$gid) { + if ($force) { // create missing groups + $sql = str_replace('%{group}',$this->_escape($group),$this->cnf['addGroup']); + $gid = $this->_modifyDB($sql); + $newgroup = 1; // group newly created + } + if (!$gid) return false; // group didn't exist and can't be created + } + + $sql = $this->cnf['addUserGroup']; + if(strpos($sql,'%{uid}') !== false){ + $uid = $this->_getUserID($user); + $sql = str_replace('%{uid}', $this->_escape($uid),$sql); + } + $sql = str_replace('%{user}', $this->_escape($user),$sql); + $sql = str_replace('%{gid}', $this->_escape($gid),$sql); + $sql = str_replace('%{group}',$this->_escape($group),$sql); + if ($this->_modifyDB($sql) !== false) return true; + + if ($newgroup) { // remove previously created group on error + $sql = str_replace('%{gid}', $this->_escape($gid),$this->cnf['delGroup']); + $sql = str_replace('%{group}',$this->_escape($group),$sql); + $this->_modifyDB($sql); + } + } + return false; + } + + /** + * Remove user from a group + * + * @param $user user that leaves a group + * @param $group group to leave + * @return bool true on success, false on error + * + * @author Matthias Grimm + */ + function _delUserFromGroup($user, $group) { + $rc = false; + + + if (($this->dbcon) && ($user)) { + $sql = $this->cnf['delUserGroup']; + if(strpos($sql,'%{uid}') !== false){ + $uid = $this->_getUserID($user); + $sql = str_replace('%{uid}', $this->_escape($uid),$sql); + } + $gid = $this->_getGroupID($group); + if ($gid) { + $sql = str_replace('%{user}', $this->_escape($user),$sql); + $sql = str_replace('%{gid}', $this->_escape($gid),$sql); + $sql = str_replace('%{group}',$this->_escape($group),$sql); + $rc = $this->_modifyDB($sql) == 0 ? true : false; + } + } + return $rc; + } + + /** + * Retrieves a list of groups the user is a member off. + * + * The database connection must already be established + * for this function to work. Otherwise it will return + * 'false'. + * + * @param $user user whose groups should be listed + * @return bool false on error + * @return array array containing all groups on success + * + * @author Matthias Grimm + */ + function _getGroups($user) { + $groups = array(); + + if($this->dbcon) { + $sql = str_replace('%{user}',$this->_escape($user),$this->cnf['getGroups']); + $result = $this->_queryDB($sql); + + if($result !== false && count($result)) { + foreach($result as $row) + $groups[] = $row['group']; + } + return $groups; + } + return false; + } + + /** + * Retrieves the user id of a given user name + * + * The database connection must already be established + * for this function to work. Otherwise it will return + * 'false'. + * + * @param $user user whose id is desired + * @return user id + * + * @author Matthias Grimm + */ + function _getUserID($user) { + if($this->dbcon) { + $sql = str_replace('%{user}',$this->_escape($user),$this->cnf['getUserID']); + $result = $this->_queryDB($sql); + return $result === false ? false : $result[0]['id']; + } + return false; + } + + /** + * Adds a new User to the database. + * + * The database connection must already be established + * for this function to work. Otherwise it will return + * 'false'. + * + * @param $user login of the user + * @param $pwd encrypted password + * @param $name full name of the user + * @param $mail email address + * @param $grps array of groups the user should become member of + * @return bool + * + * @author Andreas Gohr + * @author Chris Smith + * @author Matthias Grimm + */ + function _addUser($user,$pwd,$name,$mail,$grps){ + if($this->dbcon && is_array($grps)) { + $sql = str_replace('%{user}', $this->_escape($user),$this->cnf['addUser']); + $sql = str_replace('%{pass}', $this->_escape($pwd),$sql); + $sql = str_replace('%{name}', $this->_escape($name),$sql); + $sql = str_replace('%{email}',$this->_escape($mail),$sql); + $uid = $this->_modifyDB($sql); + + if ($uid) { + foreach($grps as $group) { + $gid = $this->_addUserToGroup($user, $group, 1); + if ($gid === false) break; + } + + if ($gid) return true; + else { + /* remove the new user and all group relations if a group can't + * be assigned. Newly created groups will remain in the database + * and won't be removed. This might create orphaned groups but + * is not a big issue so we ignore this problem here. + */ + $this->_delUser($user); + if ($this->cnf['debug']) + msg ("MySQL err: Adding user '$user' to group '$group' failed.",-1,__LINE__,__FILE__); + } + } + } + return false; + } + + /** + * Deletes a given user and all his group references. + * + * The database connection must already be established + * for this function to work. Otherwise it will return + * 'false'. + * + * @param $user user whose id is desired + * @return bool + * + * @author Matthias Grimm + */ + function _delUser($user) { + if($this->dbcon) { + $uid = $this->_getUserID($user); + if ($uid) { + $sql = str_replace('%{uid}',$this->_escape($uid),$this->cnf['delUserRefs']); + $this->_modifyDB($sql); + $sql = str_replace('%{uid}',$this->_escape($uid),$this->cnf['delUser']); + $sql = str_replace('%{user}', $this->_escape($user),$sql); + $this->_modifyDB($sql); + return true; + } + } + return false; + } + + /** + * getUserInfo + * + * Gets the data for a specific user The database connection + * must already be established for this function to work. + * Otherwise it will return 'false'. + * + * @param $user user's nick to get data for + * @return bool false on error + * @return array user info on success + * + * @author Matthias Grimm + */ + function _getUserInfo($user){ + $sql = str_replace('%{user}',$this->_escape($user),$this->cnf['getUserInfo']); + $result = $this->_queryDB($sql); + if($result !== false && count($result)) { + $info = $result[0]; + $info['grps'] = $this->_getGroups($user); + return $info; + } + return false; + } + + /** + * Updates the user info in the database + * + * Update a user data structure in the database according changes + * given in an array. The user name can only be changes if it didn't + * exists already. If the new user name exists the update procedure + * will be aborted. The database keeps unchanged. + * + * The database connection has already to be established for this + * function to work. Otherwise it will return 'false'. + * + * The password will be crypted if necessary. + * + * @param $changes array of items to change as pairs of item and value + * @param $uid user id of dataset to change, must be unique in DB + * @return true on success or false on error + * + * @author Matthias Grimm + */ + function _updateUserInfo($changes, $uid) { + $sql = $this->cnf['updateUser']." "; + $cnt = 0; + $err = 0; + + if($this->dbcon) { + foreach ($changes as $item => $value) { + if ($item == 'user') { + if (($this->_getUserID($changes['user']))) { + $err = 1; /* new username already exists */ + break; /* abort update */ + } + if ($cnt++ > 0) $sql .= ", "; + $sql .= str_replace('%{user}',$value,$this->cnf['UpdateLogin']); + } else if ($item == 'name') { + if ($cnt++ > 0) $sql .= ", "; + $sql .= str_replace('%{name}',$value,$this->cnf['UpdateName']); + } else if ($item == 'pass') { + if (!$this->cnf['forwardClearPass']) + $value = auth_cryptPassword($value); + if ($cnt++ > 0) $sql .= ", "; + $sql .= str_replace('%{pass}',$value,$this->cnf['UpdatePass']); + } else if ($item == 'mail') { + if ($cnt++ > 0) $sql .= ", "; + $sql .= str_replace('%{email}',$value,$this->cnf['UpdateEmail']); + } + } + + if ($err == 0) { + if ($cnt > 0) { + $sql .= " ".str_replace('%{uid}', $uid, $this->cnf['UpdateTarget']); + if(get_class($this) == 'auth_mysql') $sql .= " LIMIT 1"; //some PgSQL inheritance comp. + $this->_modifyDB($sql); + } + return true; + } + } + return false; + } + + /** + * Retrieves the group id of a given group name + * + * The database connection must already be established + * for this function to work. Otherwise it will return + * 'false'. + * + * @param $group group name which id is desired + * @return group id + * + * @author Matthias Grimm + */ + function _getGroupID($group) { + if($this->dbcon) { + $sql = str_replace('%{group}',$this->_escape($group),$this->cnf['getGroupID']); + $result = $this->_queryDB($sql); + return $result === false ? false : $result[0]['id']; + } + return false; + } + + /** + * Opens a connection to a database and saves the handle for further + * usage in the object. The successful call to this functions is + * essential for most functions in this object. + * + * @return bool + * + * @author Matthias Grimm + */ + function _openDB() { + if (!$this->dbcon) { + $con = @mysql_connect ($this->cnf['server'], $this->cnf['user'], $this->cnf['password']); + if ($con) { + if ((mysql_select_db($this->cnf['database'], $con))) { + if ((preg_match("/^(\d+)\.(\d+)\.(\d+).*/", mysql_get_server_info ($con), $result)) == 1) { + $this->dbver = $result[1]; + $this->dbrev = $result[2]; + $this->dbsub = $result[3]; + } + $this->dbcon = $con; + if(!empty($this->cnf['charset'])){ + mysql_query('SET CHARACTER SET "' . $this->cnf['charset'] . '"', $con); + } + return true; // connection and database successfully opened + } else { + mysql_close ($con); + if ($this->cnf['debug']) + msg("MySQL err: No access to database {$this->cnf['database']}.",-1,__LINE__,__FILE__); + } + } else if ($this->cnf['debug']) + msg ("MySQL err: Connection to {$this->cnf['user']}@{$this->cnf['server']} not possible.", + -1,__LINE__,__FILE__); + + return false; // connection failed + } + return true; // connection already open + } + + /** + * Closes a database connection. + * + * @author Matthias Grimm + */ + function _closeDB() { + if ($this->dbcon) { + mysql_close ($this->dbcon); + $this->dbcon = 0; + } + } + + /** + * Sends a SQL query to the database and transforms the result into + * an associative array. + * + * This function is only able to handle queries that returns a + * table such as SELECT. + * + * @param $query SQL string that contains the query + * @return array with the result table + * + * @author Matthias Grimm + */ + function _queryDB($query) { + if($this->cnf['debug'] >= 2){ + msg('MySQL query: '.hsc($query),0,__LINE__,__FILE__); + } + + $resultarray = array(); + if ($this->dbcon) { + $result = @mysql_query($query,$this->dbcon); + if ($result) { + while (($t = mysql_fetch_assoc($result)) !== false) + $resultarray[]=$t; + mysql_free_result ($result); + return $resultarray; + } + if ($this->cnf['debug']) + msg('MySQL err: '.mysql_error($this->dbcon),-1,__LINE__,__FILE__); + } + return false; + } + + /** + * Sends a SQL query to the database + * + * This function is only able to handle queries that returns + * either nothing or an id value such as INPUT, DELETE, UPDATE, etc. + * + * @param $query SQL string that contains the query + * @return insert id or 0, false on error + * + * @author Matthias Grimm + */ + function _modifyDB($query) { + if ($this->dbcon) { + $result = @mysql_query($query,$this->dbcon); + if ($result) { + $rc = mysql_insert_id($this->dbcon); //give back ID on insert + if ($rc !== false) return $rc; + } + if ($this->cnf['debug']) + msg('MySQL err: '.mysql_error($this->dbcon),-1,__LINE__,__FILE__); + } + return false; + } + + /** + * Locked a list of tables for exclusive access so that modifications + * to the database can't be disturbed by other threads. The list + * could be set with $conf['auth']['mysql']['TablesToLock'] = array() + * + * If aliases for tables are used in SQL statements, also this aliases + * must be locked. For eg. you use a table 'user' and the alias 'u' in + * some sql queries, the array must looks like this (order is important): + * array("user", "user AS u"); + * + * MySQL V3 is not able to handle transactions with COMMIT/ROLLBACK + * so that this functionality is simulated by this function. Nevertheless + * it is not as powerful as transactions, it is a good compromise in safty. + * + * @param $mode could be 'READ' or 'WRITE' + * + * @author Matthias Grimm + */ + function _lockTables($mode) { + if ($this->dbcon) { + if (is_array($this->cnf['TablesToLock']) && !empty($this->cnf['TablesToLock'])) { + if ($mode == "READ" || $mode == "WRITE") { + $sql = "LOCK TABLES "; + $cnt = 0; + foreach ($this->cnf['TablesToLock'] as $table) { + if ($cnt++ != 0) $sql .= ", "; + $sql .= "$table $mode"; + } + $this->_modifyDB($sql); + return true; + } + } + } + return false; + } + + /** + * Unlock locked tables. All existing locks of this thread will be + * abrogated. + * + * @author Matthias Grimm + */ + function _unlockTables() { + if ($this->dbcon) { + $this->_modifyDB("UNLOCK TABLES"); + return true; + } + return false; + } + + /** + * Transforms the filter settings in an filter string for a SQL database + * The database connection must already be established, otherwise the + * original SQL string without filter criteria will be returned. + * + * @param $sql SQL string to which the $filter criteria should be added + * @param $filter array of filter criteria as pairs of item and pattern + * @return SQL string with attached $filter criteria on success + * @return the original SQL string on error. + * + * @author Matthias Grimm + */ + function _createSQLFilter($sql, $filter) { + $SQLfilter = ""; + $cnt = 0; + + if ($this->dbcon) { + foreach ($filter as $item => $pattern) { + $tmp = '%'.$this->_escape($pattern).'%'; + if ($item == 'user') { + if ($cnt++ > 0) $SQLfilter .= " AND "; + $SQLfilter .= str_replace('%{user}',$tmp,$this->cnf['FilterLogin']); + } else if ($item == 'name') { + if ($cnt++ > 0) $SQLfilter .= " AND "; + $SQLfilter .= str_replace('%{name}',$tmp,$this->cnf['FilterName']); + } else if ($item == 'mail') { + if ($cnt++ > 0) $SQLfilter .= " AND "; + $SQLfilter .= str_replace('%{email}',$tmp,$this->cnf['FilterEmail']); + } else if ($item == 'grps') { + if ($cnt++ > 0) $SQLfilter .= " AND "; + $SQLfilter .= str_replace('%{group}',$tmp,$this->cnf['FilterGroup']); + } + } + + // we have to check SQLfilter here and must not use $cnt because if + // any of cnf['Filter????'] is not defined, a malformed SQL string + // would be generated. + + if (strlen($SQLfilter)) { + $glue = strpos(strtolower($sql),"where") ? " AND " : " WHERE "; + $sql = $sql.$glue.$SQLfilter; + } + } + + return $sql; + } + + /** + * Escape a string for insertion into the database + * + * @author Andreas Gohr + * @param string $string The string to escape + * @param boolean $like Escape wildcard chars as well? + */ + function _escape($string,$like=false){ + if($this->dbcon){ + $string = mysql_real_escape_string($string, $this->dbcon); + }else{ + $string = addslashes($string); + } + if($like){ + $string = addcslashes($string,'%_'); + } + return $string; + } +} \ No newline at end of file diff --git a/lib/plugins/authmysql/plugin.info.txt b/lib/plugins/authmysql/plugin.info.txt new file mode 100644 index 000000000..d08d4a7ef --- /dev/null +++ b/lib/plugins/authmysql/plugin.info.txt @@ -0,0 +1,7 @@ +base authmysql +author +email +date +name mysql auth plugin +desc Provides authentication against a MySQL Server +url diff --git a/lib/plugins/authpgsql/auth.php b/lib/plugins/authpgsql/auth.php new file mode 100644 index 000000000..824a77882 --- /dev/null +++ b/lib/plugins/authpgsql/auth.php @@ -0,0 +1,331 @@ + + */ +// must be run within Dokuwiki +if(!defined('DOKU_INC')) die(); + +/** + * PgSQL authentication backend + * + * This class inherits much functionality from the MySQL class + * and just reimplements the Postgres specific parts. + * + * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) + * @author Andreas Gohr + * @author Chris Smith + * @author Matthias Grimm + * @author Jan Schumann +*/ +class auth_plugin_authpgsql extends auth_plugin_authmysql +{ + var $cnf = null; + var $opts = null; + var $adldap = null; + var $users = null; + + /** + * Constructor + */ + function auth_plugin_authpgsql() { + global $conf; + $this->cnf = $conf['auth']['ad']; + + + // additional information fields + if (isset($this->cnf['additional'])) { + $this->cnf['additional'] = str_replace(' ', '', $this->cnf['additional']); + $this->cnf['additional'] = explode(',', $this->cnf['additional']); + } else $this->cnf['additional'] = array(); + + // ldap extension is needed + if (!function_exists('ldap_connect')) { + if ($this->cnf['debug']) + msg("AD Auth: PHP LDAP extension not found.",-1); + $this->success = false; + return; + } + + // Prepare SSO + if($_SERVER['REMOTE_USER'] && $this->cnf['sso']){ + // remove possible NTLM domain + list($dom,$usr) = explode('\\',$_SERVER['REMOTE_USER'],2); + if(!$usr) $usr = $dom; + + // remove possible Kerberos domain + list($usr,$dom) = explode('@',$usr); + + $dom = strtolower($dom); + $_SERVER['REMOTE_USER'] = $usr; + + // we need to simulate a login + if(empty($_COOKIE[DOKU_COOKIE])){ + $_REQUEST['u'] = $_SERVER['REMOTE_USER']; + $_REQUEST['p'] = 'sso_only'; + } + } + + // prepare adLDAP standard configuration + $this->opts = $this->cnf; + + // add possible domain specific configuration + if($dom && is_array($this->cnf[$dom])) foreach($this->cnf[$dom] as $key => $val){ + $this->opts[$key] = $val; + } + + // handle multiple AD servers + $this->opts['domain_controllers'] = explode(',',$this->opts['domain_controllers']); + $this->opts['domain_controllers'] = array_map('trim',$this->opts['domain_controllers']); + $this->opts['domain_controllers'] = array_filter($this->opts['domain_controllers']); + + // we can change the password if SSL is set + if($this->opts['use_ssl'] || $this->opts['use_tls']){ + $this->cando['modPass'] = true; + } + $this->cando['modName'] = true; + $this->cando['modMail'] = true; + } + + /** + * Check user+password [required auth function] + * + * Checks if the given user exists and the given + * plaintext password is correct by trying to bind + * to the LDAP server + * + * @author James Van Lommel + * @return bool + */ + function checkPass($user, $pass){ + if($_SERVER['REMOTE_USER'] && + $_SERVER['REMOTE_USER'] == $user && + $this->cnf['sso']) return true; + + if(!$this->_init()) return false; + return $this->adldap->authenticate($user, $pass); + } + + /** + * Return user info [required auth function] + * + * Returns info about the given user needs to contain + * at least these fields: + * + * name string full name of the user + * mail string email address of the user + * grps array list of groups the user is in + * + * This LDAP specific function returns the following + * addional fields: + * + * dn string distinguished name (DN) + * uid string Posix User ID + * + * @author James Van Lommel + */ + function getUserData($user){ + global $conf; + if(!$this->_init()) return false; + + $fields = array('mail','displayname','samaccountname'); + + // add additional fields to read + $fields = array_merge($fields, $this->cnf['additional']); + $fields = array_unique($fields); + + //get info for given user + $result = $this->adldap->user_info($user, $fields); + //general user info + $info['name'] = $result[0]['displayname'][0]; + $info['mail'] = $result[0]['mail'][0]; + $info['uid'] = $result[0]['samaccountname'][0]; + $info['dn'] = $result[0]['dn']; + + // additional information + foreach ($this->cnf['additional'] as $field) { + if (isset($result[0][strtolower($field)])) { + $info[$field] = $result[0][strtolower($field)][0]; + } + } + + // handle ActiveDirectory memberOf + $info['grps'] = $this->adldap->user_groups($user,(bool) $this->opts['recursive_groups']); + + if (is_array($info['grps'])) { + foreach ($info['grps'] as $ndx => $group) { + $info['grps'][$ndx] = $this->cleanGroup($group); + } + } + + // always add the default group to the list of groups + if(!is_array($info['grps']) || !in_array($conf['defaultgroup'],$info['grps'])){ + $info['grps'][] = $conf['defaultgroup']; + } + + return $info; + } + + /** + * Make AD group names usable by DokuWiki. + * + * Removes backslashes ('\'), pound signs ('#'), and converts spaces to underscores. + * + * @author James Van Lommel (jamesvl@gmail.com) + */ + function cleanGroup($name) { + $sName = str_replace('\\', '', $name); + $sName = str_replace('#', '', $sName); + $sName = preg_replace('[\s]', '_', $sName); + return $sName; + } + + /** + * Sanitize user names + */ + function cleanUser($name) { + return $this->cleanGroup($name); + } + + /** + * Most values in LDAP are case-insensitive + */ + function isCaseSensitive(){ + return false; + } + + /** + * Bulk retrieval of user data + * + * @author Dominik Eckelmann + * @param start index of first user to be returned + * @param limit max number of users to be returned + * @param filter array of field/pattern pairs, null for no filter + * @return array of userinfo (refer getUserData for internal userinfo details) + */ + function retrieveUsers($start=0,$limit=-1,$filter=array()) { + if(!$this->_init()) return false; + + if ($this->users === null) { + //get info for given user + $result = $this->adldap->all_users(); + if (!$result) return array(); + $this->users = array_fill_keys($result, false); + } + + $i = 0; + $count = 0; + $this->_constructPattern($filter); + $result = array(); + + foreach ($this->users as $user => &$info) { + if ($i++ < $start) { + continue; + } + if ($info === false) { + $info = $this->getUserData($user); + } + if ($this->_filter($user, $info)) { + $result[$user] = $info; + if (($limit >= 0) && (++$count >= $limit)) break; + } + } + return $result; + } + + /** + * Modify user data + * + * @param $user nick of the user to be changed + * @param $changes array of field/value pairs to be changed + * @return bool + */ + function modifyUser($user, $changes) { + $return = true; + + // password changing + if(isset($changes['pass'])){ + try { + $return = $this->adldap->user_password($user,$changes['pass']); + } catch (adLDAPException $e) { + if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1); + $return = false; + } + if(!$return) msg('AD Auth: failed to change the password. Maybe the password policy was not met?',-1); + } + + // changing user data + $adchanges = array(); + if(isset($changes['name'])){ + // get first and last name + $parts = explode(' ',$changes['name']); + $adchanges['surname'] = array_pop($parts); + $adchanges['firstname'] = join(' ',$parts); + $adchanges['display_name'] = $changes['name']; + } + if(isset($changes['mail'])){ + $adchanges['email'] = $changes['mail']; + } + if(count($adchanges)){ + try { + $return = $return & $this->adldap->user_modify($user,$adchanges); + } catch (adLDAPException $e) { + if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1); + $return = false; + } + } + + return $return; + } + + /** + * Initialize the AdLDAP library and connect to the server + */ + function _init(){ + if(!is_null($this->adldap)) return true; + + // connect + try { + $this->adldap = new adLDAP($this->opts); + if (isset($this->opts['ad_username']) && isset($this->opts['ad_password'])) { + $this->canDo['getUsers'] = true; + } + return true; + } catch (adLDAPException $e) { + if ($this->cnf['debug']) { + msg('AD Auth: '.$e->getMessage(), -1); + } + $this->success = false; + $this->adldap = null; + } + return false; + } + + /** + * return 1 if $user + $info match $filter criteria, 0 otherwise + * + * @author Chris Smith + */ + function _filter($user, $info) { + foreach ($this->_pattern as $item => $pattern) { + if ($item == 'user') { + if (!preg_match($pattern, $user)) return 0; + } else if ($item == 'grps') { + if (!count(preg_grep($pattern, $info['grps']))) return 0; + } else { + if (!preg_match($pattern, $info[$item])) return 0; + } + } + return 1; + } + + function _constructPattern($filter) { + $this->_pattern = array(); + foreach ($filter as $item => $pattern) { +// $this->_pattern[$item] = '/'.preg_quote($pattern,"/").'/i'; // don't allow regex characters + $this->_pattern[$item] = '/'.str_replace('/','\/',$pattern).'/i'; // allow regex characters + } + } +} \ No newline at end of file diff --git a/lib/plugins/authpgsql/plugin.info.txt b/lib/plugins/authpgsql/plugin.info.txt new file mode 100644 index 000000000..ad565b853 --- /dev/null +++ b/lib/plugins/authpgsql/plugin.info.txt @@ -0,0 +1,7 @@ +base authad +author +email +date +name active directory auth plugin +desc Provides authentication against a Microsoft Active Directory +url diff --git a/lib/plugins/authplain/auth.php b/lib/plugins/authplain/auth.php new file mode 100644 index 000000000..4be0e0c19 --- /dev/null +++ b/lib/plugins/authplain/auth.php @@ -0,0 +1,335 @@ + + */ +// must be run within Dokuwiki +if(!defined('DOKU_INC')) die(); + +/** + * Plaintext authentication backend + * + * @license GPL 2 (http://www.gnu.org/licenses/gpl.html) + * @author Andreas Gohr + * @author Chris Smith + * @author Jan Schumann + */ +class auth_plugin_authplain extends DokuWiki_Auth_Plugin +{ + var $users = null; + var $_pattern = array(); + + /** + * Constructor + * + * Carry out sanity checks to ensure the object is + * able to operate. Set capabilities. + * + * @author Christopher Smith + */ + function auth_plugin_authplain() { + global $config_cascade; + + if (!@is_readable($config_cascade['plainauth.users']['default'])){ + $this->success = false; + }else{ + if(@is_writable($config_cascade['plainauth.users']['default'])){ + $this->cando['addUser'] = true; + $this->cando['delUser'] = true; + $this->cando['modLogin'] = true; + $this->cando['modPass'] = true; + $this->cando['modName'] = true; + $this->cando['modMail'] = true; + $this->cando['modGroups'] = true; + } + $this->cando['getUsers'] = true; + $this->cando['getUserCount'] = true; + } + } + + /** + * Check user+password [required auth function] + * + * Checks if the given user exists and the given + * plaintext password is correct + * + * @author Andreas Gohr + * @return bool + */ + function checkPass($user,$pass){ + + $userinfo = $this->getUserData($user); + if ($userinfo === false) return false; + + return auth_verifyPassword($pass,$this->users[$user]['pass']); + } + + /** + * Return user info + * + * Returns info about the given user needs to contain + * at least these fields: + * + * name string full name of the user + * mail string email addres of the user + * grps array list of groups the user is in + * + * @author Andreas Gohr + */ + function getUserData($user){ + + if($this->users === null) $this->_loadUserData(); + return isset($this->users[$user]) ? $this->users[$user] : false; + } + + /** + * Create a new User + * + * Returns false if the user already exists, null when an error + * occurred and true if everything went well. + * + * The new user will be added to the default group by this + * function if grps are not specified (default behaviour). + * + * @author Andreas Gohr + * @author Chris Smith + */ + function createUser($user,$pwd,$name,$mail,$grps=null){ + global $conf; + global $config_cascade; + + // user mustn't already exist + if ($this->getUserData($user) !== false) return false; + + $pass = auth_cryptPassword($pwd); + + // set default group if no groups specified + if (!is_array($grps)) $grps = array($conf['defaultgroup']); + + // prepare user line + $groups = join(',',$grps); + $userline = join(':',array($user,$pass,$name,$mail,$groups))."\n"; + + if (io_saveFile($config_cascade['plainauth.users']['default'],$userline,true)) { + $this->users[$user] = compact('pass','name','mail','grps'); + return $pwd; + } + + msg('The '.$config_cascade['plainauth.users']['default']. + ' file is not writable. Please inform the Wiki-Admin',-1); + return null; + } + + /** + * Modify user data + * + * @author Chris Smith + * @param $user nick of the user to be changed + * @param $changes array of field/value pairs to be changed (password will be clear text) + * @return bool + */ + function modifyUser($user, $changes) { + global $conf; + global $ACT; + global $INFO; + global $config_cascade; + + // sanity checks, user must already exist and there must be something to change + if (($userinfo = $this->getUserData($user)) === false) return false; + if (!is_array($changes) || !count($changes)) return true; + + // update userinfo with new data, remembering to encrypt any password + $newuser = $user; + foreach ($changes as $field => $value) { + if ($field == 'user') { + $newuser = $value; + continue; + } + if ($field == 'pass') $value = auth_cryptPassword($value); + $userinfo[$field] = $value; + } + + $groups = join(',',$userinfo['grps']); + $userline = join(':',array($newuser, $userinfo['pass'], $userinfo['name'], $userinfo['mail'], $groups))."\n"; + + if (!$this->deleteUsers(array($user))) { + msg('Unable to modify user data. Please inform the Wiki-Admin',-1); + return false; + } + + if (!io_saveFile($config_cascade['plainauth.users']['default'],$userline,true)) { + msg('There was an error modifying your user data. You should register again.',-1); + // FIXME, user has been deleted but not recreated, should force a logout and redirect to login page + $ACT == 'register'; + return false; + } + + $this->users[$newuser] = $userinfo; + return true; + } + + /** + * Remove one or more users from the list of registered users + * + * @author Christopher Smith + * @param array $users array of users to be deleted + * @return int the number of users deleted + */ + function deleteUsers($users) { + global $config_cascade; + + if (!is_array($users) || empty($users)) return 0; + + if ($this->users === null) $this->_loadUserData(); + + $deleted = array(); + foreach ($users as $user) { + if (isset($this->users[$user])) $deleted[] = preg_quote($user,'/'); + } + + if (empty($deleted)) return 0; + + $pattern = '/^('.join('|',$deleted).'):/'; + + if (io_deleteFromFile($config_cascade['plainauth.users']['default'],$pattern,true)) { + foreach ($deleted as $user) unset($this->users[$user]); + return count($deleted); + } + + // problem deleting, reload the user list and count the difference + $count = count($this->users); + $this->_loadUserData(); + $count -= count($this->users); + return $count; + } + + /** + * Return a count of the number of user which meet $filter criteria + * + * @author Chris Smith + */ + function getUserCount($filter=array()) { + + if($this->users === null) $this->_loadUserData(); + + if (!count($filter)) return count($this->users); + + $count = 0; + $this->_constructPattern($filter); + + foreach ($this->users as $user => $info) { + $count += $this->_filter($user, $info); + } + + return $count; + } + + /** + * Bulk retrieval of user data + * + * @author Chris Smith + * @param start index of first user to be returned + * @param limit max number of users to be returned + * @param filter array of field/pattern pairs + * @return array of userinfo (refer getUserData for internal userinfo details) + */ + function retrieveUsers($start=0,$limit=0,$filter=array()) { + + if ($this->users === null) $this->_loadUserData(); + + ksort($this->users); + + $i = 0; + $count = 0; + $out = array(); + $this->_constructPattern($filter); + + foreach ($this->users as $user => $info) { + if ($this->_filter($user, $info)) { + if ($i >= $start) { + $out[$user] = $info; + $count++; + if (($limit > 0) && ($count >= $limit)) break; + } + $i++; + } + } + + return $out; + } + + /** + * Only valid pageid's (no namespaces) for usernames + */ + function cleanUser($user){ + global $conf; + return cleanID(str_replace(':',$conf['sepchar'],$user)); + } + + /** + * Only valid pageid's (no namespaces) for groupnames + */ + function cleanGroup($group){ + global $conf; + return cleanID(str_replace(':',$conf['sepchar'],$group)); + } + + /** + * Load all user data + * + * loads the user file into a datastructure + * + * @author Andreas Gohr + */ + function _loadUserData(){ + global $config_cascade; + + $this->users = array(); + + if(!@file_exists($config_cascade['plainauth.users']['default'])) return; + + $lines = file($config_cascade['plainauth.users']['default']); + foreach($lines as $line){ + $line = preg_replace('/#.*$/','',$line); //ignore comments + $line = trim($line); + if(empty($line)) continue; + + $row = explode(":",$line,5); + $groups = array_values(array_filter(explode(",",$row[4]))); + + $this->users[$row[0]]['pass'] = $row[1]; + $this->users[$row[0]]['name'] = urldecode($row[2]); + $this->users[$row[0]]['mail'] = $row[3]; + $this->users[$row[0]]['grps'] = $groups; + } + } + + /** + * return 1 if $user + $info match $filter criteria, 0 otherwise + * + * @author Chris Smith + */ + function _filter($user, $info) { + // FIXME + foreach ($this->_pattern as $item => $pattern) { + if ($item == 'user') { + if (!preg_match($pattern, $user)) return 0; + } else if ($item == 'grps') { + if (!count(preg_grep($pattern, $info['grps']))) return 0; + } else { + if (!preg_match($pattern, $info[$item])) return 0; + } + } + return 1; + } + + function _constructPattern($filter) { + $this->_pattern = array(); + foreach ($filter as $item => $pattern) { +// $this->_pattern[$item] = '/'.preg_quote($pattern,"/").'/i'; // don't allow regex characters + $this->_pattern[$item] = '/'.str_replace('/','\/',$pattern).'/i'; // allow regex characters + } + } +} \ No newline at end of file diff --git a/lib/plugins/authplain/plugin.info.txt b/lib/plugins/authplain/plugin.info.txt new file mode 100644 index 000000000..3273e21d7 --- /dev/null +++ b/lib/plugins/authplain/plugin.info.txt @@ -0,0 +1,7 @@ +base authplain +author +email +date +name auth plugin +desc Provides authentication against local password storage +url diff --git a/lib/plugins/config/settings/extra.class.php b/lib/plugins/config/settings/extra.class.php index cee3c6b20..f6adf1c18 100644 --- a/lib/plugins/config/settings/extra.class.php +++ b/lib/plugins/config/settings/extra.class.php @@ -45,22 +45,52 @@ if (!class_exists('setting_authtype')) { function initialize($default,$local,$protected) { global $plugin_controller; - // populate $this->_choices with a list of available auth mechanisms - $authtypes = glob(DOKU_INC.'inc/auth/*.class.php'); - $authtypes = preg_replace('#^.*/([^/]*)\.class\.php$#i','$1', $authtypes); - $authtypes = array_diff($authtypes, array('basic')); - // retrive auth types provided by plugins foreach ($plugin_controller->getList('auth') as $plugin) { - $authtypes[] = $plugin; + $this->_choices[] = $plugin; } - $authtypes = array_unique($authtypes); - - $this->_choices = $authtypes; - parent::initialize($default,$local,$protected); } + + function update($input) { + global $plugin_controller; + + // is an update posible? + $mayUpdate = parent::update($input); + + // is it an auth plugin? + if (in_array($input, $plugin_controller->getList('auth'))) { + // reject disabled plugins + if ($plugin_controller->isdisabled($input)) { + $this->_error = true; + msg('Auth type ' . $input . ' is disabled.'); + return false; + } + + // load the plugin + $auth_plugin = $plugin_controller->load('auth', $input); + + // @TODO: throw an error in plugin controller instead of returning null + if (is_null($auth_plugin)) { + $this->_error = true; + msg('Cannot load Auth Plugin "' . $input . '"'); + return false; + } + + // verify proper instanciation (is this really a plugin?) @TODO use instanceof? impement interface? + if (is_object($auth_plugin) && !method_exists($auth_plugin, 'getPluginName')) { + $this->_error = true; + msg('Cannot create Auth Plugin "' . $input . '"'); + return false; + } + } + + msg('Successfully changed auth system. Please re-login.'); + auth_logoff(); + + return true; + } } } -- cgit v1.2.3 From e8b5a4f91c8a6e230a6cfe13c43dc9ddce31e253 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Sat, 28 Jul 2012 12:02:06 +0200 Subject: fix E_STRICT errors FS#2427 This commit fixes all E_STRICT messages shown when running the test suite. There might be more problems not covered by tests, yet. For compatibility reasons with plugins, E_STRICT errors are still supressed. --- lib/plugins/action.php | 2 +- lib/plugins/popularity/action.php | 2 +- lib/plugins/safefnrecode/action.php | 2 +- lib/plugins/testing/action.php | 3 ++- 4 files changed, 5 insertions(+), 4 deletions(-) (limited to 'lib') diff --git a/lib/plugins/action.php b/lib/plugins/action.php index 885bd7c96..a2ad969d7 100644 --- a/lib/plugins/action.php +++ b/lib/plugins/action.php @@ -17,7 +17,7 @@ class DokuWiki_Action_Plugin extends DokuWiki_Plugin { /** * Registers a callback function for a given event */ - function register($controller) { + function register(Doku_Event_Handler $controller) { trigger_error('register() not implemented in '.get_class($this), E_USER_WARNING); } } diff --git a/lib/plugins/popularity/action.php b/lib/plugins/popularity/action.php index bf11efba6..1c7a2f65d 100644 --- a/lib/plugins/popularity/action.php +++ b/lib/plugins/popularity/action.php @@ -18,7 +18,7 @@ class action_plugin_popularity extends Dokuwiki_Action_Plugin { /** * Register its handlers with the dokuwiki's event controller */ - function register(&$controller) { + function register(Doku_Event_Handler $controller) { $controller->register_hook('INDEXER_TASKS_RUN', 'AFTER', $this, '_autosubmit', array()); } diff --git a/lib/plugins/safefnrecode/action.php b/lib/plugins/safefnrecode/action.php index 5d3eaae3a..aae11c437 100644 --- a/lib/plugins/safefnrecode/action.php +++ b/lib/plugins/safefnrecode/action.php @@ -13,7 +13,7 @@ require_once DOKU_PLUGIN.'action.php'; class action_plugin_safefnrecode extends DokuWiki_Action_Plugin { - public function register(Doku_Event_Handler &$controller) { + public function register(Doku_Event_Handler $controller) { $controller->register_hook('INDEXER_TASKS_RUN', 'BEFORE', $this, 'handle_indexer_tasks_run'); diff --git a/lib/plugins/testing/action.php b/lib/plugins/testing/action.php index e829847b6..a242ab0b7 100644 --- a/lib/plugins/testing/action.php +++ b/lib/plugins/testing/action.php @@ -7,7 +7,8 @@ * @author Tobias Sarnowski */ class action_plugin_testing extends DokuWiki_Action_Plugin { - function register(&$controller) { + + function register(Doku_Event_Handler $controller) { $controller->register_hook('DOKUWIKI_STARTED', 'AFTER', $this, 'dokuwikiStarted'); } -- cgit v1.2.3 From adec979fd5453cf213b776d7dceaaaac4eb05713 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Sun, 12 Aug 2012 15:07:03 +0200 Subject: more subscription refactoring BROKEN now the actual sending of bulk messages (digest, list) is reimplemented and partially tested. Still not complete --- lib/exe/indexer.php | 86 +++++------------------------------------------------ 1 file changed, 7 insertions(+), 79 deletions(-) (limited to 'lib') diff --git a/lib/exe/indexer.php b/lib/exe/indexer.php index e149770c0..270341fe6 100644 --- a/lib/exe/indexer.php +++ b/lib/exe/indexer.php @@ -166,92 +166,20 @@ function runSitemapper(){ * @author Adrian Lang */ function sendDigest() { - echo 'sendDigest(): started'.NL; - global $ID; global $conf; + global $ID; + + echo 'sendDigest(): started'.NL; if (!$conf['subscribers']) { echo 'sendDigest(): disabled'.NL; return false; } - $subscriptions = subscription_find($ID, array('style' => '(digest|list)', - 'escaped' => true)); - global $auth; - global $lang; - global $conf; - global $USERINFO; - - // remember current user info - $olduinfo = $USERINFO; - $olduser = $_SERVER['REMOTE_USER']; - - foreach($subscriptions as $id => $users) { - if (!subscription_lock($id)) { - continue; - } - foreach($users as $data) { - list($user, $style, $lastupdate) = $data; - $lastupdate = (int) $lastupdate; - if ($lastupdate + $conf['subscribe_time'] > time()) { - // Less than the configured time period passed since last - // update. - continue; - } - - // Work as the user to make sure ACLs apply correctly - $USERINFO = $auth->getUserData($user); - $_SERVER['REMOTE_USER'] = $user; - if ($USERINFO === false) { - continue; - } - - if (substr($id, -1, 1) === ':') { - // The subscription target is a namespace - $changes = getRecentsSince($lastupdate, null, getNS($id)); - } else { - if(auth_quickaclcheck($id) < AUTH_READ) continue; - - $meta = p_get_metadata($id); - $changes = array($meta['last_change']); - } - - // Filter out pages only changed in small and own edits - $change_ids = array(); - foreach($changes as $rev) { - $n = 0; - while (!is_null($rev) && $rev['date'] >= $lastupdate && - ($_SERVER['REMOTE_USER'] === $rev['user'] || - $rev['type'] === DOKU_CHANGE_TYPE_MINOR_EDIT)) { - $rev = getRevisions($rev['id'], $n++, 1); - $rev = (count($rev) > 0) ? $rev[0] : null; - } - - if (!is_null($rev) && $rev['date'] >= $lastupdate) { - // Some change was not a minor one and not by myself - $change_ids[] = $rev['id']; - } - } - - if ($style === 'digest') { - foreach($change_ids as $change_id) { - subscription_send_digest($USERINFO['mail'], $change_id, - $lastupdate); - } - } elseif ($style === 'list') { - subscription_send_list($USERINFO['mail'], $change_ids, $id); - } - // TODO: Handle duplicate subscriptions. - - // Update notification time. - subscription_set($user, $id, $style, time(), true); - } - subscription_unlock($id); - } + $sub = new Subscription(); + $sent = $sub->send_bulk($ID); - // restore current user info - $USERINFO = $olduinfo; - $_SERVER['REMOTE_USER'] = $olduser; + echo "sendDigest(): sent $sent mails".NL; echo 'sendDigest(): finished'.NL; - return true; + return (bool) $sent; } /** -- cgit v1.2.3 From 84c1127cc070777c8cbcf488f5422bc4b71470a8 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Sun, 12 Aug 2012 17:30:01 +0200 Subject: correctly check if subscriptions are enabled --- lib/exe/indexer.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'lib') diff --git a/lib/exe/indexer.php b/lib/exe/indexer.php index 270341fe6..bbfd51b39 100644 --- a/lib/exe/indexer.php +++ b/lib/exe/indexer.php @@ -170,7 +170,7 @@ function sendDigest() { global $ID; echo 'sendDigest(): started'.NL; - if (!$conf['subscribers']) { + if(!actionOK('subscribe')) { echo 'sendDigest(): disabled'.NL; return false; } -- cgit v1.2.3 From a0df75e62c09594d1d1ed11be9a911badab0699e Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Elan=20Ruusam=C3=A4e?= Date: Mon, 17 Sep 2012 11:08:34 +0300 Subject: add index file similar to fileicons to show active smileys --- lib/images/smileys/index.php | 48 ++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 48 insertions(+) create mode 100644 lib/images/smileys/index.php (limited to 'lib') diff --git a/lib/images/smileys/index.php b/lib/images/smileys/index.php new file mode 100644 index 000000000..9a2905b33 --- /dev/null +++ b/lib/images/smileys/index.php @@ -0,0 +1,48 @@ + + + + simleys + + + + + + +
+ '; +} +?> +
+ +
+ '; +} +?> +
+ + + -- cgit v1.2.3 From 94c0297d119ce52ad794c18f26220311e3c0ed8c Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Sat, 6 Oct 2012 11:31:26 +0200 Subject: completed plugin.info.txt files --- lib/plugins/auth.php | 7 +++---- lib/plugins/authad/plugin.info.txt | 8 ++++---- lib/plugins/authldap/plugin.info.txt | 8 ++++---- lib/plugins/authmysql/plugin.info.txt | 8 ++++---- lib/plugins/authpgsql/plugin.info.txt | 8 ++++---- lib/plugins/authplain/plugin.info.txt | 8 ++++---- 6 files changed, 23 insertions(+), 24 deletions(-) (limited to 'lib') diff --git a/lib/plugins/auth.php b/lib/plugins/auth.php index 637435252..39d63d8a1 100644 --- a/lib/plugins/auth.php +++ b/lib/plugins/auth.php @@ -1,4 +1,7 @@ * @author Jan Schumann - */ -// must be run within Dokuwiki -if(!defined('DOKU_INC')) die(); - class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { var $success = true; diff --git a/lib/plugins/authad/plugin.info.txt b/lib/plugins/authad/plugin.info.txt index ad565b853..598eb848b 100644 --- a/lib/plugins/authad/plugin.info.txt +++ b/lib/plugins/authad/plugin.info.txt @@ -1,7 +1,7 @@ base authad -author -email -date +author Andreas Gohr +email andi@splitbrain.org +date 2012-10-06 name active directory auth plugin desc Provides authentication against a Microsoft Active Directory -url +url http://www.dokuwiki.org/plugin:authad diff --git a/lib/plugins/authldap/plugin.info.txt b/lib/plugins/authldap/plugin.info.txt index c36385224..2af8cf00a 100644 --- a/lib/plugins/authldap/plugin.info.txt +++ b/lib/plugins/authldap/plugin.info.txt @@ -1,7 +1,7 @@ base authldap -author -email -date +author Andreas Gohr +email andi@splitbrain.org +date 2012-10-06 name ldap auth plugin desc Provides authentication against am LDAP server -url +url http://www.dokuwiki.org/plugin:authldap diff --git a/lib/plugins/authmysql/plugin.info.txt b/lib/plugins/authmysql/plugin.info.txt index d08d4a7ef..c1e118427 100644 --- a/lib/plugins/authmysql/plugin.info.txt +++ b/lib/plugins/authmysql/plugin.info.txt @@ -1,7 +1,7 @@ base authmysql -author -email -date +author Andreas Gohr +email andi@splitbrain.org +date 2012-10-06 name mysql auth plugin desc Provides authentication against a MySQL Server -url +url http://www.dokuwiki.org/plugin:authmysql diff --git a/lib/plugins/authpgsql/plugin.info.txt b/lib/plugins/authpgsql/plugin.info.txt index ad565b853..598eb848b 100644 --- a/lib/plugins/authpgsql/plugin.info.txt +++ b/lib/plugins/authpgsql/plugin.info.txt @@ -1,7 +1,7 @@ base authad -author -email -date +author Andreas Gohr +email andi@splitbrain.org +date 2012-10-06 name active directory auth plugin desc Provides authentication against a Microsoft Active Directory -url +url http://www.dokuwiki.org/plugin:authad diff --git a/lib/plugins/authplain/plugin.info.txt b/lib/plugins/authplain/plugin.info.txt index 3273e21d7..cde38eaac 100644 --- a/lib/plugins/authplain/plugin.info.txt +++ b/lib/plugins/authplain/plugin.info.txt @@ -1,7 +1,7 @@ base authplain -author -email -date +author Andreas Gohr +email andi@splitbrain.org +date 2012-10-06 name auth plugin desc Provides authentication against local password storage -url +url http://www.dokuwiki.org/plugin:authplain -- cgit v1.2.3 From ecd445c000e4e54bf7228890848222312cffd3e3 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Sun, 7 Oct 2012 09:43:34 +0200 Subject: PHP5ized the auth plugin base --- lib/plugins/auth.php | 146 ++++++++++++++++++++++++++++----------------------- 1 file changed, 80 insertions(+), 66 deletions(-) (limited to 'lib') diff --git a/lib/plugins/auth.php b/lib/plugins/auth.php index 39d63d8a1..4c3c585cf 100644 --- a/lib/plugins/auth.php +++ b/lib/plugins/auth.php @@ -13,14 +13,14 @@ if(!defined('DOKU_INC')) die(); * @author Jan Schumann */ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { - var $success = true; + public $success = true; /** - * Posible things an auth backend module may be able to + * Possible things an auth backend module may be able to * do. The things a backend can do need to be set to true * in the constructor. */ - var $cando = array ( + protected $cando = array( 'addUser' => false, // can Users be created? 'delUser' => false, // can Users be deleted? 'modLogin' => false, // can login names be changed? @@ -32,7 +32,7 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { 'getUserCount'=> false, // can the number of users be retrieved? 'getGroups' => false, // can a list of available groups be retrieved? 'external' => false, // does the module do external auth checking? - 'logout' => true, // can the user logout again? (eg. not possible with HTTP auth) + 'logout' => true, // can the user logout again? (eg. not possible with HTTP auth) ); /** @@ -46,7 +46,7 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * * @author Christopher Smith */ - function __construct() { + public function __construct() { // the base class constructor does nothing, derived class // constructors do the real work } @@ -62,29 +62,30 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * shortcut capabilities start with uppercase letter * * @author Andreas Gohr + * @param string $cap the capability to check * @return bool */ - function canDo($cap) { - switch($cap){ + public function canDo($cap) { + switch($cap) { case 'Profile': // can at least one of the user's properties be changed? - return ( $this->cando['modPass'] || - $this->cando['modName'] || - $this->cando['modMail'] ); + return ($this->cando['modPass'] || + $this->cando['modName'] || + $this->cando['modMail']); break; case 'UserMod': // can at least anything be changed? - return ( $this->cando['modPass'] || - $this->cando['modName'] || - $this->cando['modMail'] || - $this->cando['modLogin'] || - $this->cando['modGroups'] || - $this->cando['modMail'] ); + return ($this->cando['modPass'] || + $this->cando['modName'] || + $this->cando['modMail'] || + $this->cando['modLogin'] || + $this->cando['modGroups'] || + $this->cando['modMail']); break; default: // print a helping message for developers - if(!isset($this->cando[$cap])){ - msg("Check for unknown capability '$cap' - Do you use an outdated Plugin?",-1); + if(!isset($this->cando[$cap])) { + msg("Check for unknown capability '$cap' - Do you use an outdated Plugin?", -1); } return $this->cando[$cap]; } @@ -99,10 +100,10 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * * @author Gabriel Birke * @param string $type Modification type ('create', 'modify', 'delete') - * @param array $params Parameters for the createUser, modifyUser or deleteUsers method. The content of this array depends on the modification type + * @param array $params Parameters for the createUser, modifyUser or deleteUsers method. The content of this array depends on the modification type * @return mixed Result from the modification function or false if an event handler has canceled the action */ - function triggerUserMod($type, $params) { + public function triggerUserMod($type, $params) { $validTypes = array( 'create' => 'createUser', 'modify' => 'modifyUser', @@ -111,9 +112,9 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { if(empty($validTypes[$type])) return false; $eventdata = array('type' => $type, 'params' => $params, 'modification_result' => null); - $evt = new Doku_Event('AUTH_USER_CHANGE', $eventdata); - if ($evt->advise_before(true)) { - $result = call_user_func_array(array($this, $validTypes[$type]), $params); + $evt = new Doku_Event('AUTH_USER_CHANGE', $eventdata); + if($evt->advise_before(true)) { + $result = call_user_func_array(array($this, $validTypes[$type]), $params); $evt->data['modification_result'] = $result; } $evt->advise_after(); @@ -130,7 +131,7 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * @see auth_logoff() * @author Andreas Gohr */ - function logOff(){ + public function logOff() { } /** @@ -166,7 +167,7 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * @param bool $sticky Cookie should not expire * @return bool true on successful auth */ - function trustExternal($user,$pass,$sticky=false){ + public function trustExternal($user, $pass, $sticky = false) { /* some example: global $USERINFO; @@ -197,9 +198,11 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * May be ommited if trustExternal is used. * * @author Andreas Gohr + * @param string $user the user name + * @param string $pass the clear text password * @return bool */ - function checkPass($user,$pass){ + public function checkPass($user, $pass) { msg("no valid authorisation system in use", -1); return false; } @@ -215,9 +218,10 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * grps array list of groups the user is in * * @author Andreas Gohr + * @param string $user the user name * @return array containing user data or false */ - function getUserData($user) { + public function getUserData($user) { if(!$this->cando['external']) msg("no valid authorisation system in use", -1); return false; } @@ -234,8 +238,14 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * Set addUser capability when implemented * * @author Andreas Gohr + * @param string $user + * @param string $pass + * @param string $name + * @param string $mail + * @param null|array $grps + * @return bool|null */ - function createUser($user,$pass,$name,$mail,$grps=null){ + public function createUser($user, $pass, $name, $mail, $grps = null) { msg("authorisation method does not allow creation of new users", -1); return null; } @@ -246,11 +256,11 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * Set the mod* capabilities according to the implemented features * * @author Chris Smith - * @param $user nick of the user to be changed - * @param $changes array of field/value pairs to be changed (password will be clear text) + * @param string $user nick of the user to be changed + * @param array $changes array of field/value pairs to be changed (password will be clear text) * @return bool */ - function modifyUser($user, $changes) { + public function modifyUser($user, $changes) { msg("authorisation method does not allow modifying of user data", -1); return false; } @@ -264,7 +274,7 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * @param array $users * @return int number of users deleted */ - function deleteUsers($users) { + public function deleteUsers($users) { msg("authorisation method does not allow deleting of users", -1); return false; } @@ -275,9 +285,11 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * * Set getUserCount capability when implemented * - * @author Chris Smith + * @author Chris Smith + * @param array $filter array of field/pattern pairs, empty array for no filter + * @return int */ - function getUserCount($filter=array()) { + public function getUserCount($filter = array()) { msg("authorisation method does not provide user counts", -1); return 0; } @@ -288,12 +300,12 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * Set getUsers capability when implemented * * @author Chris Smith - * @param start index of first user to be returned - * @param limit max number of users to be returned - * @param filter array of field/pattern pairs, null for no filter - * @return array of userinfo (refer getUserData for internal userinfo details) + * @param int $start index of first user to be returned + * @param int $limit max number of users to be returned + * @param array $filter array of field/pattern pairs, null for no filter + * @return array list of userinfo (refer getUserData for internal userinfo details) */ - function retrieveUsers($start=0,$limit=-1,$filter=null) { + public function retrieveUsers($start = 0, $limit = -1, $filter = null) { msg("authorisation method does not support mass retrieval of user data", -1); return array(); } @@ -304,9 +316,10 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * Set addGroup capability when implemented * * @author Chris Smith + * @param string $group * @return bool */ - function addGroup($group) { + public function addGroup($group) { msg("authorisation method does not support independent group creation", -1); return false; } @@ -317,9 +330,11 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * Set getGroups capability when implemented * * @author Chris Smith + * @param int $start + * @param int $limit * @return array */ - function retrieveGroups($start=0,$limit=0) { + public function retrieveGroups($start = 0, $limit = 0) { msg("authorisation method does not support group list retrieval", -1); return array(); } @@ -329,8 +344,10 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * * When your backend is caseinsensitive (eg. you can login with USER and * user) then you need to overwrite this method and return false + * + * @return bool */ - function isCaseSensitive(){ + public function isCaseSensitive() { return true; } @@ -344,10 +361,10 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * This should be used to enforce username restrictions. * * @author Andreas Gohr - * @param string $user - username - * @param string - the cleaned username + * @param string $user username + * @return string the cleaned username */ - function cleanUser($user){ + public function cleanUser($user) { return $user; } @@ -363,14 +380,13 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * Groupnames are to be passed without a leading '@' here. * * @author Andreas Gohr - * @param string $group - groupname - * @param string - the cleaned groupname + * @param string $group groupname + * @return string the cleaned groupname */ - function cleanGroup($group){ + public function cleanGroup($group) { return $group; } - /** * Check Session Cache validity [implement only where required/possible] * @@ -396,27 +412,25 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * @author Andreas Gohr * @return bool */ - function useSessionCache($user){ + public function useSessionCache($user) { global $conf; return ($_SESSION[DOKU_COOKIE]['auth']['time'] >= @filemtime($conf['cachedir'].'/sessionpurge')); } + /** + * loadConfig() + * merges the plugin's default settings with any local settings + * this function is automatically called through getConf() + */ + function loadConfig() { + global $conf; - /** - * loadConfig() - * merges the plugin's default settings with any local settings - * this function is automatically called through getConf() - */ - function loadConfig(){ - global $conf; - - parent::loadConfig(); - - $this->conf['debug'] = $conf['debug']; - $this->conf['useacl'] = $conf['useacl']; - $this->conf['disableactions'] = $conf['disableactions']; - $this->conf['autopasswd'] = $conf['autopasswd']; - $this->conf['passcrypt'] = $conf['ssha']; - } + parent::loadConfig(); + $this->conf['debug'] = $conf['debug']; + $this->conf['useacl'] = $conf['useacl']; + $this->conf['disableactions'] = $conf['disableactions']; + $this->conf['autopasswd'] = $conf['autopasswd']; + $this->conf['passcrypt'] = $conf['ssha']; + } } -- cgit v1.2.3 From 58789954a7642c133920f37a51fd3dbb5d76cbde Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Tue, 23 Oct 2012 18:08:57 +0200 Subject: correctly check hash parameter in media dispatcher FS#2648 --- lib/exe/fetch.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'lib') diff --git a/lib/exe/fetch.php b/lib/exe/fetch.php index e8f189256..52e7ebe1e 100644 --- a/lib/exe/fetch.php +++ b/lib/exe/fetch.php @@ -157,7 +157,7 @@ function checkFileStatus(&$media, &$file, $rev='') { //media to local file if(preg_match('#^(https?)://#i',$media)){ //check hash - if(substr(md5(auth_cookiesalt().$media),0,6) != $INPUT->str('hash')){ + if(substr(md5(auth_cookiesalt().$media),0,6) !== $INPUT->str('hash')){ return array( 412, 'Precondition Failed'); } //handle external images -- cgit v1.2.3 From b8faabb62f51d6a99c5a49b03d969db5f53d594a Mon Sep 17 00:00:00 2001 From: "sh.khmit" Date: Tue, 23 Oct 2012 18:16:42 +0200 Subject: Kazach language update --- lib/plugins/acl/lang/kk/lang.php | 4 ++++ lib/plugins/usermanager/lang/kk/lang.php | 3 +++ 2 files changed, 7 insertions(+) (limited to 'lib') diff --git a/lib/plugins/acl/lang/kk/lang.php b/lib/plugins/acl/lang/kk/lang.php index dde5b9577..f21b93132 100644 --- a/lib/plugins/acl/lang/kk/lang.php +++ b/lib/plugins/acl/lang/kk/lang.php @@ -4,3 +4,7 @@ * * @author Nurgozha Kaliaskarov astana08@gmail.com */ +$lang['acl_group'] = 'Группа'; +$lang['acl_user'] = 'Пайдаланушы'; +$lang['page'] = 'Бет'; +$lang['acl_perm1'] = 'Оқу'; diff --git a/lib/plugins/usermanager/lang/kk/lang.php b/lib/plugins/usermanager/lang/kk/lang.php index dde5b9577..b1bbd39ec 100644 --- a/lib/plugins/usermanager/lang/kk/lang.php +++ b/lib/plugins/usermanager/lang/kk/lang.php @@ -4,3 +4,6 @@ * * @author Nurgozha Kaliaskarov astana08@gmail.com */ +$lang['user_id'] = 'Пайдаланушы'; +$lang['user_pass'] = 'Шартты белгi'; +$lang['user_mail'] = 'E-mail'; -- cgit v1.2.3 From 39e0d5142d842ff9fcba090a320cc1cddcc4d919 Mon Sep 17 00:00:00 2001 From: "sh.khmit" Date: Tue, 23 Oct 2012 18:17:17 +0200 Subject: russian language update --- lib/plugins/config/lang/ru/lang.php | 4 ++++ 1 file changed, 4 insertions(+) (limited to 'lib') diff --git a/lib/plugins/config/lang/ru/lang.php b/lib/plugins/config/lang/ru/lang.php index 84dce4a67..36e04686d 100644 --- a/lib/plugins/config/lang/ru/lang.php +++ b/lib/plugins/config/lang/ru/lang.php @@ -39,6 +39,7 @@ $lang['_editing'] = 'Параметры правки'; $lang['_links'] = 'Параметры ссылок'; $lang['_media'] = 'Параметры медиафайлов'; $lang['_notifications'] = 'Параметры уведомлений'; +$lang['_syndication'] = 'Настройки синдикаций'; $lang['_advanced'] = 'Тонкая настройка'; $lang['_network'] = 'Параметры сети'; $lang['_plugin_sufix'] = 'Параметры плагина'; @@ -95,6 +96,7 @@ $lang['disableactions_other'] = 'Другие операции (через за $lang['auth_security_timeout'] = 'Интервал для безопасности авторизации (сек.)'; $lang['securecookie'] = 'Должны ли куки (cookies), выставленные через HTTPS, отправляться браузером только через HTTPS. Отключите эту опцию в случае, когда только логин вашей вики передаётся через SSL, а обычный просмотр осуществляется в небезопасном режиме.'; $lang['remote'] = 'Включить систему API для подключений. Это позволит другим приложениям получить доступ к вики через XML-RPC или другие механизмы.'; +$lang['remoteuser'] = 'Дать права для удаленного API доступа пользователям указанным тут (разделять запятыми). Оставьте это поле пустым что бы открыть доступ всем.'; $lang['usewordblock'] = 'Блокировать спам по ключевым словам'; $lang['relnofollow'] = 'rel="nofollow" для внешних ссылок'; $lang['indexdelay'] = 'Задержка перед индексированием'; @@ -129,6 +131,7 @@ $lang['rss_linkto'] = 'Ссылки в RSS'; $lang['rss_content'] = 'Что отображать в строках XML-ленты?'; $lang['rss_update'] = 'Интервал обновления XML-ленты (сек.)'; $lang['rss_show_summary'] = 'Показывать краткую выдержку в заголовках XML-ленты'; +$lang['rss_media'] = 'Какие изменения должны быть отображены в XML?'; $lang['updatecheck'] = 'Проверять наличие обновлений и предупреждений о безопасности? Для этого «ДокуВики» потребуется связываться с сайтом splitbrain.org.'; $lang['userewrite'] = 'Удобочитаемые адреса (URL)'; $lang['useslash'] = 'Использовать слэш'; @@ -146,6 +149,7 @@ $lang['xsendfile'] = 'Используете заголовок X-Se $lang['renderer_xhtml'] = 'Обработчик основного (xhtml) вывода вики'; $lang['renderer__core'] = '%s (ядро dokuwiki)'; $lang['renderer__plugin'] = '%s (плагин)'; +$lang['dnslookups'] = 'DokuWiki ищет DNS имена пользователей редактирующих страницы. Если у вас нет DNS сервера или он работает медленно, рекомендуем отключить эту опцию.'; $lang['proxy____host'] = 'proxy-адрес'; $lang['proxy____port'] = 'proxy-порт'; $lang['proxy____user'] = 'proxy-имя пользователя'; -- cgit v1.2.3 From 8036aaf2ed03c0233579841311fc9835e032e4dc Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Merc=C3=A8=20L=C3=B3pez?= Date: Tue, 23 Oct 2012 18:18:31 +0200 Subject: Spanish language update --- lib/plugins/acl/lang/es/lang.php | 1 + lib/plugins/config/lang/es/lang.php | 1 + lib/plugins/plugin/lang/es/lang.php | 5 +++-- lib/plugins/popularity/lang/es/lang.php | 1 + lib/plugins/revert/lang/es/lang.php | 1 + lib/plugins/usermanager/lang/es/lang.php | 1 + 6 files changed, 8 insertions(+), 2 deletions(-) (limited to 'lib') diff --git a/lib/plugins/acl/lang/es/lang.php b/lib/plugins/acl/lang/es/lang.php index 8aed3c504..b60033e0f 100644 --- a/lib/plugins/acl/lang/es/lang.php +++ b/lib/plugins/acl/lang/es/lang.php @@ -23,6 +23,7 @@ * @author Oscar Ciudad * @author Ruben Figols * @author Gerardo Zamudio + * @author Mercè López mercelz@gmail.com */ $lang['admin_acl'] = 'Administración de lista de control de acceso'; $lang['acl_group'] = 'Grupo'; diff --git a/lib/plugins/config/lang/es/lang.php b/lib/plugins/config/lang/es/lang.php index b940f13cd..5d03efb60 100644 --- a/lib/plugins/config/lang/es/lang.php +++ b/lib/plugins/config/lang/es/lang.php @@ -23,6 +23,7 @@ * @author Oscar Ciudad * @author Ruben Figols * @author Gerardo Zamudio + * @author Mercè López mercelz@gmail.com */ $lang['menu'] = 'Parámetros de configuración'; $lang['error'] = 'Los parámetros no han sido actualizados a causa de un valor inválido, por favor revise los cambios y re-envíe el formulario.
Los valores incorrectos se mostrarán con un marco rojo alrededor.'; diff --git a/lib/plugins/plugin/lang/es/lang.php b/lib/plugins/plugin/lang/es/lang.php index db91b73c6..ded7d7369 100644 --- a/lib/plugins/plugin/lang/es/lang.php +++ b/lib/plugins/plugin/lang/es/lang.php @@ -23,6 +23,7 @@ * @author Oscar Ciudad * @author Ruben Figols * @author Gerardo Zamudio + * @author Mercè López mercelz@gmail.com */ $lang['menu'] = 'Administración de Plugins'; $lang['download'] = 'Descargar e instalar un nuevo plugin'; @@ -66,6 +67,6 @@ $lang['error_copy'] = 'Hubo un error al copiar el fichero mientras se $lang['error_delete'] = 'Hubo un error al intentar eliminar el plugin %s. La causa más probable es que no se cuente con los permisos necesarios en el fichero o en el directorio'; $lang['enabled'] = 'Plugin %s habilitado.'; $lang['notenabled'] = 'Plugin %s no puede ser habilitado, verifica los permisos del archivo.'; -$lang['disabled'] = 'Plugin %s desabilitado.'; -$lang['notdisabled'] = 'Plugin %s no puede ser desabilitado, verifica los permisos de archivo.'; +$lang['disabled'] = 'Plugin %s deshabilitado.'; +$lang['notdisabled'] = 'Plugin %s no puede ser deshabilitado, verifica los permisos de archivo.'; $lang['packageinstalled'] = 'Plugin (%d plugin(s): %s) instalado exitosamente.'; diff --git a/lib/plugins/popularity/lang/es/lang.php b/lib/plugins/popularity/lang/es/lang.php index 2be2d4a04..e46735782 100644 --- a/lib/plugins/popularity/lang/es/lang.php +++ b/lib/plugins/popularity/lang/es/lang.php @@ -20,6 +20,7 @@ * @author Oscar Ciudad * @author Ruben Figols * @author Gerardo Zamudio + * @author Mercè López mercelz@gmail.com */ $lang['name'] = 'Retroinformación (Feedback) plugin Popularity'; $lang['submit'] = 'Enviar datos'; diff --git a/lib/plugins/revert/lang/es/lang.php b/lib/plugins/revert/lang/es/lang.php index 3fb02be8e..129d71574 100644 --- a/lib/plugins/revert/lang/es/lang.php +++ b/lib/plugins/revert/lang/es/lang.php @@ -21,6 +21,7 @@ * @author Oscar Ciudad * @author Ruben Figols * @author Gerardo Zamudio + * @author Mercè López mercelz@gmail.com */ $lang['menu'] = 'Restaurador'; $lang['filter'] = 'Buscar páginas con spam'; diff --git a/lib/plugins/usermanager/lang/es/lang.php b/lib/plugins/usermanager/lang/es/lang.php index b616857a2..521191701 100644 --- a/lib/plugins/usermanager/lang/es/lang.php +++ b/lib/plugins/usermanager/lang/es/lang.php @@ -22,6 +22,7 @@ * @author Oscar Ciudad * @author Ruben Figols * @author Gerardo Zamudio + * @author Mercè López mercelz@gmail.com */ $lang['menu'] = 'Administración de usuarios'; $lang['noauth'] = '(la autenticación de usuarios no está disponible)'; -- cgit v1.2.3 From 990578f7e4f53f6b079ceaf02dee9bd72aab1b77 Mon Sep 17 00:00:00 2001 From: AmirH Hassaneini Date: Tue, 23 Oct 2012 18:19:56 +0200 Subject: Persian language update --- lib/plugins/acl/lang/fa/lang.php | 1 + lib/plugins/config/lang/fa/lang.php | 1 + lib/plugins/plugin/lang/fa/lang.php | 1 + lib/plugins/popularity/lang/fa/lang.php | 1 + lib/plugins/revert/lang/fa/lang.php | 1 + lib/plugins/usermanager/lang/fa/lang.php | 1 + 6 files changed, 6 insertions(+) (limited to 'lib') diff --git a/lib/plugins/acl/lang/fa/lang.php b/lib/plugins/acl/lang/fa/lang.php index 8b7d72f51..7fe0f2c43 100644 --- a/lib/plugins/acl/lang/fa/lang.php +++ b/lib/plugins/acl/lang/fa/lang.php @@ -8,6 +8,7 @@ * @author Omid Mottaghi * @author Mohammad Reza Shoaei * @author Milad DZand + * @author AmirH Hassaneini */ $lang['admin_acl'] = 'مدیریت کنترل دسترسی‌ها'; $lang['acl_group'] = 'گروه'; diff --git a/lib/plugins/config/lang/fa/lang.php b/lib/plugins/config/lang/fa/lang.php index ba00d5a2d..34c76780c 100644 --- a/lib/plugins/config/lang/fa/lang.php +++ b/lib/plugins/config/lang/fa/lang.php @@ -8,6 +8,7 @@ * @author Omid Mottaghi * @author Mohammad Reza Shoaei * @author Milad DZand + * @author AmirH Hassaneini */ $lang['menu'] = 'تنظیمات پیکر‌بندی'; $lang['error'] = 'به دلیل ایراد در مقادیر وارد شده، تنظیمات اعمال نشد، خواهشمندیم تغییرات را مجددن کنترل نمایید و دوباره ارسال کنید.
مقادیر مشکل‌دار با کادر قرمز مشخص شده‌اند.'; diff --git a/lib/plugins/plugin/lang/fa/lang.php b/lib/plugins/plugin/lang/fa/lang.php index dbfe9ef9a..bc43ee3ef 100644 --- a/lib/plugins/plugin/lang/fa/lang.php +++ b/lib/plugins/plugin/lang/fa/lang.php @@ -8,6 +8,7 @@ * @author Omid Mottaghi * @author Mohammad Reza Shoaei * @author Milad DZand + * @author AmirH Hassaneini */ $lang['menu'] = 'مدیریت افزونه‌ها'; $lang['download'] = 'دریافت و نصب افزونه'; diff --git a/lib/plugins/popularity/lang/fa/lang.php b/lib/plugins/popularity/lang/fa/lang.php index 600e68077..6a0529891 100644 --- a/lib/plugins/popularity/lang/fa/lang.php +++ b/lib/plugins/popularity/lang/fa/lang.php @@ -8,6 +8,7 @@ * @author Omid Mottaghi * @author Mohammad Reza Shoaei * @author Milad DZand + * @author AmirH Hassaneini */ $lang['name'] = 'بازخورد محبوبیت (ممکن است اندکی زمان ببرد)'; $lang['submit'] = 'ارسال اطلاعات'; diff --git a/lib/plugins/revert/lang/fa/lang.php b/lib/plugins/revert/lang/fa/lang.php index 34a5c430e..ba20313a3 100644 --- a/lib/plugins/revert/lang/fa/lang.php +++ b/lib/plugins/revert/lang/fa/lang.php @@ -8,6 +8,7 @@ * @author Omid Mottaghi * @author Mohammad Reza Shoaei * @author Milad DZand + * @author AmirH Hassaneini */ $lang['menu'] = 'مدیریت برگشت‌ها'; $lang['filter'] = 'جستجوی صفحات اسپم شده'; diff --git a/lib/plugins/usermanager/lang/fa/lang.php b/lib/plugins/usermanager/lang/fa/lang.php index 674013474..8176b776b 100644 --- a/lib/plugins/usermanager/lang/fa/lang.php +++ b/lib/plugins/usermanager/lang/fa/lang.php @@ -8,6 +8,7 @@ * @author Omid Mottaghi * @author Mohammad Reza Shoaei * @author Milad DZand + * @author AmirH Hassaneini */ $lang['menu'] = 'مدیریت کاربر'; $lang['noauth'] = '(معتبرسازی کاربر ممکن نیست)'; -- cgit v1.2.3 From ac628d80ed1fc2003b4f4ef6e6897d9c9235ae83 Mon Sep 17 00:00:00 2001 From: Anika Henke Date: Fri, 26 Oct 2012 00:09:31 +0100 Subject: added cut off points for mobile devices as parameters to style.ini --- lib/tpl/dokuwiki/css/mobile.css | 8 ++++---- lib/tpl/dokuwiki/style.ini | 3 +++ lib/tpl/dokuwiki/template.info.txt | 2 +- 3 files changed, 8 insertions(+), 5 deletions(-) (limited to 'lib') diff --git a/lib/tpl/dokuwiki/css/mobile.css b/lib/tpl/dokuwiki/css/mobile.css index 501e53a54..88333c012 100644 --- a/lib/tpl/dokuwiki/css/mobile.css +++ b/lib/tpl/dokuwiki/css/mobile.css @@ -11,9 +11,9 @@ z-index: 0; } -/* up to 979px screen widths +/* for screen widths in the tablet range ********************************************************************/ -@media only screen and (max-width: 979px) { +@media only screen and (max-width: __tablet_width__) { #screen__mode { z-index: 1; /* for detecting media queries in JavaScript (see script.js) */ @@ -113,9 +113,9 @@ } /* /@media */ -/* up to 480px screen widths +/* for screen widths in the smartphone range ********************************************************************/ -@media only screen and (max-width: 480px) { +@media only screen and (max-width: __phone_width__) { #screen__mode { z-index: 2; /* for detecting media queries in JavaScript (see script.js) */ diff --git a/lib/tpl/dokuwiki/style.ini b/lib/tpl/dokuwiki/style.ini index d5cc68852..67fbb3065 100644 --- a/lib/tpl/dokuwiki/style.ini +++ b/lib/tpl/dokuwiki/style.ini @@ -74,3 +74,6 @@ __missing__ = "#d30" ; site and sidebar widths __site_width__ = "75em" __sidebar_width__ = "16em" +; cut off points for mobile devices +__tablet_width__ = "979px" +__phone_width__ = "480px" diff --git a/lib/tpl/dokuwiki/template.info.txt b/lib/tpl/dokuwiki/template.info.txt index a9a55865e..d32e94d39 100644 --- a/lib/tpl/dokuwiki/template.info.txt +++ b/lib/tpl/dokuwiki/template.info.txt @@ -1,7 +1,7 @@ base dokuwiki author Anika Henke email anika@selfthinker.org -date 2012-10-12 +date 2012-10-26 name DokuWiki Template desc DokuWiki's default template since 2012 url http://www.dokuwiki.org/template:dokuwiki -- cgit v1.2.3 From a7e9a2b1d273a7dec13225a7059539640d0b63f8 Mon Sep 17 00:00:00 2001 From: Aivars Miska Date: Fri, 2 Nov 2012 15:21:45 +0100 Subject: Latvian language update --- lib/plugins/config/lang/lv/lang.php | 94 ++++++++++++++++++------------------- lib/plugins/plugin/lang/lv/lang.php | 1 + 2 files changed, 48 insertions(+), 47 deletions(-) (limited to 'lib') diff --git a/lib/plugins/config/lang/lv/lang.php b/lib/plugins/config/lang/lv/lang.php index f95697c46..50031d5e5 100644 --- a/lib/plugins/config/lang/lv/lang.php +++ b/lib/plugins/config/lang/lv/lang.php @@ -33,25 +33,26 @@ $lang['_template_sufix'] = 'šablona iestatījumi'; $lang['_msg_setting_undefined'] = 'Nav atrodami iestatījumu metadati'; $lang['_msg_setting_no_class'] = 'Nav iestatījumu klases'; $lang['_msg_setting_no_default'] = 'Nav noklusētās vērtības'; -$lang['fmode'] = 'Tiesības izveidotajiem failiem'; -$lang['dmode'] = 'Tiesības izveidotajām direktorijām'; -$lang['lang'] = 'Valoda'; -$lang['basedir'] = 'Saknes direktorija'; -$lang['baseurl'] = 'Saknes adrese (URL)'; -$lang['savedir'] = 'Direktorija datu glabāšanai'; -$lang['start'] = 'Sākumlapas vārds'; $lang['title'] = 'Wiki virsraksts'; +$lang['start'] = 'Sākumlapas vārds'; +$lang['lang'] = 'Valoda'; $lang['template'] = 'Šablons'; $lang['license'] = 'Ar kādu licenci saturs tiks publicēts?'; -$lang['fullpath'] = 'Norādīt kājenē pilnu lapas ceļu'; +$lang['savedir'] = 'Direktorija datu glabāšanai'; +$lang['basedir'] = 'Saknes direktorija'; +$lang['baseurl'] = 'Saknes adrese (URL)'; +$lang['dmode'] = 'Tiesības izveidotajām direktorijām'; +$lang['fmode'] = 'Tiesības izveidotajiem failiem'; +$lang['allowdebug'] = 'Ieslēgt atkļūdošanu. Izslēdz!'; $lang['recent'] = 'Jaunākie grozījumi'; +$lang['recent_days'] = 'Cik dienas glabāt jaunākās izmaiņas'; $lang['breadcrumbs'] = 'Apmeklējumu vēstures garums'; $lang['youarehere'] = 'Rādīt "tu atrodies šeit"'; +$lang['fullpath'] = 'Norādīt kājenē pilnu lapas ceļu'; $lang['typography'] = 'Veikt tipogrāfijas aizvietošanu'; -$lang['htmlok'] = 'Atļaut iekļautu HTTP'; -$lang['phpok'] = 'Atļaut iekļautu PHP'; $lang['dformat'] = 'Datuma formāts (sk. PHP strftime funkciju)'; $lang['signature'] = 'Paraksts'; +$lang['showuseras'] = 'Kā rādīt pēdējo lietotāju, ka labojis lapu'; $lang['toptoclevel'] = 'Satura rādītāja pirmais līmenis'; $lang['tocminheads'] = 'Mazākais virsrakstu skaits, no kuriem jāveido satura rādītājs.'; $lang['maxtoclevel'] = 'Satura rādītāja dziļākais līmenis'; @@ -59,15 +60,8 @@ $lang['maxseclevel'] = 'Dziļākais sekciju labošanas līmenis'; $lang['camelcase'] = 'Lietot saitēm CamelCase'; $lang['deaccent'] = 'Lapu nosaukumu transliterācija'; $lang['useheading'] = 'Izmantot pirmo virsrakstu lapu nosaukumiem'; -$lang['refcheck'] = 'Pārbaudīt saites uz mēdiju failiem'; -$lang['refshow'] = 'Cik saites uz mēdiju failiem rādīt'; -$lang['allowdebug'] = 'Ieslēgt atkļūdošanu. Izslēdz!'; -$lang['usewordblock'] = 'Bloķēt spamu pēc slikto vārdu saraksta.'; -$lang['indexdelay'] = 'Laika aizture pirms indeksācijas (sekundēs)'; -$lang['relnofollow'] = 'rel="nofollow" ārējām saitēm'; -$lang['mailguard'] = 'Slēpt epasta adreses'; -$lang['iexssprotect'] = 'Pārbaudīt, vai augšupielādētajā failā nav nav potenciāli bīstamā JavaScript vai HTML koda.'; -$lang['showuseras'] = 'Kā rādīt pēdējo lietotāju, ka labojis lapu'; +$lang['sneaky_index'] = 'Pēc noklusētā DokuWiki lapu sarakstā parāda visu nodaļu lapas. Ieslēdzot šo parametru, noslēps tās nodaļas, kuras apmeklētājam nav tiesības lasīt. Bet tad tiks arī paslēptas dziļākas, bet atļautas nodaļas. Atsevišķos pieejas tiesību konfigurācijas gadījumos lapu saraksts var nedarboties.'; +$lang['hidepages'] = 'Slēpt lapas (regulāras izteiksmes)'; $lang['useacl'] = 'Izmantot piekļuves tiesības'; $lang['autopasswd'] = 'Automātiski ģenerēt paroles'; $lang['authtype'] = 'Autentifikācijas mehānisms'; @@ -76,57 +70,63 @@ $lang['defaultgroup'] = 'Noklusētā grupa'; $lang['superuser'] = 'Administrators - grupa, lietotājs vai to saraksts ( piem.: user1,@group1,user2), kam ir pilnas tiesības.'; $lang['manager'] = 'Pārziņi - grupa, lietotājs vai to saraksts ( piem.: user1,@group1,user2), kam ir pieeja pie dažām administrēšanas funkcijām.'; $lang['profileconfirm'] = 'Profila labošanai vajag paroli'; +$lang['rememberme'] = 'Atļaut pastāvīgas ielogošanās sīkdatnes ("atceries mani")'; $lang['disableactions'] = 'Bloķēt Dokuwiki darbības'; $lang['disableactions_check'] = 'atzīmēt'; $lang['disableactions_subscription'] = 'abonēt/atteikties'; $lang['disableactions_wikicode'] = 'skatīt/eksportēt izejtekstu'; $lang['disableactions_other'] = 'citas darbības (atdalīt ar komatiem)'; -$lang['sneaky_index'] = 'Pēc noklusētā DokuWiki lapu sarakstā parāda visu nodaļu lapas. Ieslēdzot šo parametru, noslēps tās nodaļas, kuras apmeklētājam nav tiesības lasīt. Bet tad tiks arī paslēptas dziļākas, bet atļautas nodaļas. Atsevišķos pieejas tiesību konfigurācijas gadījumos lapu saraksts var nedarboties.'; $lang['auth_security_timeout'] = 'Autorizācijas drošības intervāls (sekundēs)'; $lang['securecookie'] = 'Vai pa HTTPS sūtāmās sīkdatnes sūtīt tikai pa HTTPS? Atslēdz šo iespēju, kad tikai pieteikšanās wiki sistēmā notiek pa SSL šifrētu savienojumu, bet skatīšana - pa nešifrētu.'; +$lang['usewordblock'] = 'Bloķēt spamu pēc slikto vārdu saraksta.'; +$lang['relnofollow'] = 'rel="nofollow" ārējām saitēm'; +$lang['indexdelay'] = 'Laika aizture pirms indeksācijas (sekundēs)'; +$lang['mailguard'] = 'Slēpt epasta adreses'; +$lang['iexssprotect'] = 'Pārbaudīt, vai augšupielādētajā failā nav nav potenciāli bīstamā JavaScript vai HTML koda.'; +$lang['usedraft'] = 'Labojot automātiski saglabāt melnrakstu'; +$lang['htmlok'] = 'Atļaut iekļautu HTTP'; +$lang['phpok'] = 'Atļaut iekļautu PHP'; +$lang['locktime'] = 'Bloķēšanas failu maksimālais vecums'; +$lang['cachetime'] = 'Bufera maksimālais vecums (sek)'; +$lang['target____wiki'] = 'Kur atvērt iekšējās saites'; +$lang['target____interwiki'] = 'Kur atvērt saites strap wiki'; +$lang['target____extern'] = 'Kur atvērt ārējās saites'; +$lang['target____media'] = 'Kur atvērt mēdiju saites'; +$lang['target____windows'] = 'Kur atvērt saites uz tīkla mapēm'; +$lang['refcheck'] = 'Pārbaudīt saites uz mēdiju failiem'; +$lang['refshow'] = 'Cik saites uz mēdiju failiem rādīt'; +$lang['gdlib'] = 'GD Lib versija'; +$lang['im_convert'] = 'Ceļš uz ImageMagick convert rīku'; +$lang['jpg_quality'] = 'JPG saspiešanas kvalitāte'; +$lang['fetchsize'] = 'Maksimālais faila apjoms baitos, ko fetch.php var ielādēt no interneta.'; +$lang['subscribers'] = 'Atļaut abonēt izmaiņas'; +$lang['subscribe_time'] = 'Pēc cik ilga laika izsūtīt abonētos sarakstus un kopsavilkumus (sekundes); jābūt mazākam par laiku, kas norādīts "recent_days".'; +$lang['notify'] = 'Nosūtīt izmaiņu paziņojumu uz epasta adresi'; +$lang['registernotify'] = 'Nosūtīt paziņojumu par jauniem lietotājiem uz epasta adresi'; +$lang['mailfrom'] = 'Epasta adrese automātiskajiem paziņojumiem'; +$lang['mailprefix'] = 'E-pasta temata prefikss automātiskajiem paziņojumiem'; +$lang['sitemap'] = 'Lapas karte priekš Google (dienas)'; +$lang['rss_type'] = 'XML barotnes veids'; +$lang['rss_linkto'] = 'XML barotnes uz '; +$lang['rss_content'] = 'Ko attēlot XML barotnē?'; +$lang['rss_update'] = 'XML barotnes atjaunošanas intervāls (sec)'; +$lang['rss_show_summary'] = 'Rādīt visrakstos XML barotnes kopsavilkumu '; $lang['updatecheck'] = 'Pārbaudīt, vai pieejami atjauninājumi un drošības brīdinājumi? Dokuwiki sazināsies ar update.dokuwiki.org'; $lang['userewrite'] = 'Ērti lasāmas adreses (URL)'; $lang['useslash'] = 'Lietot slīpiņu par URL atdalītāju'; -$lang['usedraft'] = 'Labojot automātiski saglabāt melnrakstu'; $lang['sepchar'] = 'Lapas nosaukuma vārdu atdalītājs'; $lang['canonical'] = 'Lietot kanoniskus URL'; $lang['fnencode'] = 'Ne ASCII failvārdu kodēšanas metode:'; $lang['autoplural'] = 'Automātisks daudzskaitlis'; $lang['compression'] = 'Saspiešanas metode vecajiem failiem'; -$lang['cachetime'] = 'Bufera maksimālais vecums (sek)'; -$lang['locktime'] = 'Bloķēšanas failu maksimālais vecums'; -$lang['fetchsize'] = 'Maksimālais faila apjoms baitos, ko fetch.php var ielādēt no interneta.'; -$lang['notify'] = 'Nosūtīt izmaiņu paziņojumu uz epasta adresi'; -$lang['registernotify'] = 'Nosūtīt paziņojumu par jauniem lietotājiem uz epasta adresi'; -$lang['mailfrom'] = 'Epasta adrese automātiskajiem paziņojumiem'; -$lang['mailprefix'] = 'E-pasta temata prefikss automātiskajiem paziņojumiem'; $lang['gzip_output'] = 'Lietot gzip Content-Encoding priekš xhtml'; -$lang['gdlib'] = 'GD Lib versija'; -$lang['im_convert'] = 'Ceļš uz ImageMagick convert rīku'; -$lang['jpg_quality'] = 'JPG saspiešanas kvalitāte'; -$lang['subscribers'] = 'Atļaut abonēt izmaiņas'; -$lang['subscribe_time'] = 'Pēc cik ilga laika izsūtīt abonētos sarakstus un kopsavilkumus (sekundes); jābūt mazākam par laiku, kas norādīts "recent_days".'; $lang['compress'] = 'Saspiest CSS un javascript failus'; -$lang['hidepages'] = 'Slēpt lapas (regulāras izteiksmes)'; $lang['send404'] = 'Par neesošām lapām atbildēt "HTTP 404/Page Not Found" '; -$lang['sitemap'] = 'Lapas karte priekš Google (dienas)'; $lang['broken_iua'] = 'Varbūt tavā serverī nedarbojas funkcija ignore_user_abort? Tā dēļ var nestādāt meklēšanas indeksācija. Šī problēma sastopama, piemēram, IIS ar PHP/CGI. Papildus informāciju skatīt Kļūdā Nr.852.'; $lang['xsendfile'] = 'Lietot X-Sendfile virsrakstu, augšupielādējot failu serverī? '; $lang['renderer_xhtml'] = 'Galveno (xhtml) wiki saturu renderēt ar '; $lang['renderer__core'] = '%s (dokuwiki kodols)'; $lang['renderer__plugin'] = '%s (modulis)'; -$lang['rememberme'] = 'Atļaut pastāvīgas ielogošanās sīkdatnes ("atceries mani")'; -$lang['rss_type'] = 'XML barotnes veids'; -$lang['rss_linkto'] = 'XML barotnes uz '; -$lang['rss_content'] = 'Ko attēlot XML barotnē?'; -$lang['rss_update'] = 'XML barotnes atjaunošanas intervāls (sec)'; -$lang['recent_days'] = 'Cik dienas glabāt jaunākās izmaiņas'; -$lang['rss_show_summary'] = 'Rādīt visrakstos XML barotnes kopsavilkumu '; -$lang['target____wiki'] = 'Kur atvērt iekšējās saites'; -$lang['target____interwiki'] = 'Kur atvērt saites strap wiki'; -$lang['target____extern'] = 'Kur atvērt ārējās saites'; -$lang['target____media'] = 'Kur atvērt mēdiju saites'; -$lang['target____windows'] = 'Kur atvērt saites uz tīkla mapēm'; $lang['proxy____host'] = 'Proxy servera vārds'; $lang['proxy____port'] = 'Proxy ports'; $lang['proxy____user'] = 'Proxy lietotāja vārds'; diff --git a/lib/plugins/plugin/lang/lv/lang.php b/lib/plugins/plugin/lang/lv/lang.php index 0f6103899..9a8727875 100644 --- a/lib/plugins/plugin/lang/lv/lang.php +++ b/lib/plugins/plugin/lang/lv/lang.php @@ -48,3 +48,4 @@ $lang['enabled'] = 'Modulis %s pieslēgts.'; $lang['notenabled'] = 'Moduli %s nevar pieslēgt, pārbaudi failu tiesības.'; $lang['disabled'] = 'Modulis %s atslēgts.'; $lang['notdisabled'] = 'Moduli %s nevar atslēgt, pārbaudi failu tiesības.'; +$lang['packageinstalled'] = 'Moduļu paka (pavisam kopā %d: %s) veiksmīgi uzstādīti.'; -- cgit v1.2.3 From d4b178ac520c38efe17d50446b8159a32ca8800c Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?=EC=9D=B4=EB=AA=85=EC=A7=84?= Date: Fri, 2 Nov 2012 15:22:45 +0100 Subject: Korean language update --- lib/plugins/acl/lang/ko/help.txt | 2 +- lib/plugins/acl/lang/ko/lang.php | 2 +- lib/plugins/config/lang/ko/intro.txt | 4 ++-- lib/plugins/config/lang/ko/lang.php | 39 ++++++++++++++++---------------- lib/plugins/popularity/lang/ko/intro.txt | 2 +- lib/plugins/usermanager/lang/ko/edit.txt | 2 +- lib/plugins/usermanager/lang/ko/lang.php | 8 +++---- 7 files changed, 29 insertions(+), 30 deletions(-) (limited to 'lib') diff --git a/lib/plugins/acl/lang/ko/help.txt b/lib/plugins/acl/lang/ko/help.txt index 377636682..6a15b7a2e 100644 --- a/lib/plugins/acl/lang/ko/help.txt +++ b/lib/plugins/acl/lang/ko/help.txt @@ -1,4 +1,4 @@ -=== 도움말: === +=== 빠른 도움말: === 현재 문서에서 위키 이름공간과 문서에 대한 접근 권한을 추가하거나 삭제할 수 있습니다. diff --git a/lib/plugins/acl/lang/ko/lang.php b/lib/plugins/acl/lang/ko/lang.php index c8e1ce5cc..5d2662ef8 100644 --- a/lib/plugins/acl/lang/ko/lang.php +++ b/lib/plugins/acl/lang/ko/lang.php @@ -41,4 +41,4 @@ $lang['acl_perm4'] = '만들기'; $lang['acl_perm8'] = '올리기'; $lang['acl_perm16'] = '삭제'; $lang['acl_new'] = '새 항목 추가'; -$lang['acl_mod'] = '선택 항목 변경'; +$lang['acl_mod'] = '선택 항목 수정'; diff --git a/lib/plugins/config/lang/ko/intro.txt b/lib/plugins/config/lang/ko/intro.txt index f6b76ecfc..5ef34df64 100644 --- a/lib/plugins/config/lang/ko/intro.txt +++ b/lib/plugins/config/lang/ko/intro.txt @@ -1,7 +1,7 @@ ====== 환경 설정 관리 ====== -DokuWiki 설치할 때 설정을 변경하기 위해 사용하는 페이지입니다. 각 설정에 대한 자세한 도움말이 필요하다면 [[doku>ko:config|설정 문서 (한국어)]]와 [[doku>config|설정 문서 (영어)]]를 참고하세요. +DokuWiki 설치할 때 설정을 바꾸기 위해 사용하는 페이지입니다. 각 설정에 대한 자세한 도움말이 필요하다면 [[doku>ko:config|설정 문서 (한국어)]]와 [[doku>config|설정 문서 (영어)]]를 참고하세요. -플러그인에 대한 자세한 정보가 필요하다면 [[doku>plugin:config|플러그인 설정]] 문서를 참고하세요. 빨간 배경색으로 보이는 설정은 이 플러그인에서 변경하지 못하도록 되어있습니다. 파란 배경색으로 보이는 설정은 기본 설정값을 가지고 있습니다. 하얀 배경색으로 보이는 설정은 특별한 설치를 위해 설정되어 있습니다. 파란색과 하얀색 배경으로 된 설정은 수정이 가능합니다. +플러그인에 대한 자세한 정보가 필요하다면 [[doku>plugin:config|플러그인 설정]] 문서를 참고하세요. 빨간 배경색으로 보이는 설정은 이 플러그인에서 바꾸지 못하도록 되어있습니다. 파란 배경색으로 보이는 설정은 기본 설정값을 가지고 있습니다. 하얀 배경색으로 보이는 설정은 특별한 설치를 위해 설정되어 있습니다. 파란색과 하얀색 배경으로 된 설정은 수정이 가능합니다. 이 페이지를 끝내기 전에 **저장** 버튼을 누르지 않으면 설정값은 적용되지 않습니다. diff --git a/lib/plugins/config/lang/ko/lang.php b/lib/plugins/config/lang/ko/lang.php index 5f90044e4..cd2cc6d6c 100644 --- a/lib/plugins/config/lang/ko/lang.php +++ b/lib/plugins/config/lang/ko/lang.php @@ -12,9 +12,9 @@ * @author Myeongjin */ $lang['menu'] = '환경 설정'; -$lang['error'] = '잘못된 값 때문에 설정을 변경할 수 없습니다. 수정한 값을 검토하고 확인을 누르세요. +$lang['error'] = '잘못된 값 때문에 설정을 바꿀 수 없습니다. 수정한 값을 검토하고 확인을 누르세요.
잘못된 값은 빨간 선으로 둘러싸여 있습니다.'; -$lang['updated'] = '설정이 성공적으로 변경되었습니다.'; +$lang['updated'] = '설정이 성공적으로 바뀌었습니다.'; $lang['nochoice'] = '(다른 선택이 불가능합니다.)'; $lang['locked'] = '환경 설정 파일을 수정할 수 없습니다. 의도한 행동이 아니라면,
파일 이름과 권한이 맞는지 확인하기 바랍니다. '; @@ -39,9 +39,9 @@ $lang['_advanced'] = '고급 설정'; $lang['_network'] = '네트워크 설정'; $lang['_plugin_sufix'] = '플러그인 설정'; $lang['_template_sufix'] = '템플릿 설정'; -$lang['_msg_setting_undefined'] = '설정되지 않은 메타데이터.'; -$lang['_msg_setting_no_class'] = '설정되지 않은 클래스.'; -$lang['_msg_setting_no_default'] = '기본값 없음.'; +$lang['_msg_setting_undefined'] = '설정된 메타데이터가 없습니다.'; +$lang['_msg_setting_no_class'] = '설정된 클래스가 없습니다.'; +$lang['_msg_setting_no_default'] = '기본값이 없습니다.'; $lang['title'] = '위키 제목 (위키 이름)'; $lang['start'] = '각 이름공간에서 사용할 시작 문서 이름'; $lang['lang'] = '인터페이스 언어'; @@ -53,12 +53,12 @@ $lang['savedir'] = '데이타 저장 디렉토리'; $lang['basedir'] = '서버 경로 (예를 들어 /dokuwiki/). 자동 감지를 하려면 비우세요.'; $lang['baseurl'] = '서버 URL (예를 들어 http://www.yourserver.com). 자동 감지를 하려면 비우세요.'; $lang['cookiedir'] = '쿠키 위치. 비워두면 기본 URL 위치로 지정됩니다.'; -$lang['dmode'] = '디렉토리 생성 모드'; -$lang['fmode'] = '파일 생성 모드'; +$lang['dmode'] = '디렉토리 만들기 모드'; +$lang['fmode'] = '파일 만들기 모드'; $lang['allowdebug'] = '디버그 허용 필요하지 않으면 금지!'; $lang['recent'] = '최근 바뀐 문서당 항목 수'; $lang['recent_days'] = '최근 바뀐 문서 기준 시간 (날짜)'; -$lang['breadcrumbs'] = '위치 "추적" 수. 0으로 설정하면 비활성화함.'; +$lang['breadcrumbs'] = '위치 "추적" 수. 0으로 설정하면 비활성화합니다.'; $lang['youarehere'] = '계층형 위치 추적 (다음 위의 옵션을 비활성화하고 싶습니다)'; $lang['fullpath'] = '문서 하단에 전체 경로 보여주기'; $lang['typography'] = '기호 대체'; @@ -80,21 +80,21 @@ $lang['autopasswd'] = '자동으로 만들어진 비밀번호'; $lang['authtype'] = '인증 백-엔드'; $lang['passcrypt'] = '비밀번호 암호화 방법'; $lang['defaultgroup'] = '기본 그룹, 모든 새 사용자는 이 그룹에 속합니다'; -$lang['superuser'] = '슈퍼 유저 - ACL 설정과 상관없이 모든 문서와 기능에 대한 전체 접근 권한을 가진 그룹이나 사용자. 사용자1,@그룹1,사용자2 쉼표로 구분한 목록'; -$lang['manager'] = '관리자 - 관리 기능을 사용할 수 있는 그룹이나 사용자. 사용자1,@그룹1,사용자2 쉼표로 구분한 목록'; +$lang['superuser'] = '슈퍼 유저 - ACL 설정과 상관없이 모든 문서와 기능에 대한 전체 접근 권한을 가진 그룹이나 사용자 또는 사용자1,@그룹1,사용자2 쉼표로 구분한 목록'; +$lang['manager'] = '관리자 - 관리 기능을 사용할 수 있는 그룹이나 사용자 또는 사용자1,@그룹1,사용자2 쉼표로 구분한 목록'; $lang['profileconfirm'] = '개인 정보를 바꿀 때 비밀번호 다시 확인'; $lang['rememberme'] = '항상 로그인 정보 저장 허용 (기억하기)'; $lang['disableactions'] = 'DokuWiki 활동 비활성화'; $lang['disableactions_check'] = '검사'; $lang['disableactions_subscription'] = '구독 신청/해지'; -$lang['disableactions_wikicode'] = '내용 보기/원시 내보대기'; +$lang['disableactions_wikicode'] = '내용 보기/원본 내보대기'; $lang['disableactions_other'] = '다른 활동 (쉼표로 구분)'; $lang['auth_security_timeout'] = '인증 보안 초과 시간 (초)'; $lang['securecookie'] = 'HTTPS로 보내진 쿠키는 HTTPS에만 적용 할까요? 위키의 로그인 페이지만 SSL로 암호화하고 위키 문서는 그렇지 않은 경우 비활성화 합니다.'; -$lang['remote'] = '원격 API를 활성화 합니다. 이 항목을 허용하면 XML-RPC 및 기타 메카니즘을 통해 다른 어플리케이션으로 접근가능합니다.'; +$lang['remote'] = '원격 API를 활성화 합니다. 이 항목을 허용하면 XML-RPC 및 기타 메카니즘을 통해 다른 어플리케이션으로 접근 가능합니다.'; $lang['remoteuser'] = '이 항목에 입력된 쉼표로 나눠진 그룹이나 사용자에게 원격 API 접근을 제한합니다. 빈칸으로 두면 모두에게 허용합니다.'; $lang['usewordblock'] = '금지 단어를 사용해 스팸 막기'; -$lang['relnofollow'] = '외부 링크에 rel="nofollow" 사용'; +$lang['relnofollow'] = '바깥 링크에 rel="nofollow" 사용'; $lang['indexdelay'] = '색인 연기 시간 (초)'; $lang['mailguard'] = '이메일 주소를 알아볼 수 없게 하기'; $lang['iexssprotect'] = '올린 파일의 악성 자바스크립트, HTML 코드 가능성 여부를 검사'; @@ -105,7 +105,7 @@ $lang['locktime'] = '최대 파일 잠금 시간(초)'; $lang['cachetime'] = '최대 캐시 생존 시간 (초)'; $lang['target____wiki'] = '내부 링크에 대한 타겟 창'; $lang['target____interwiki'] = '인터위키 링크에 대한 타겟 창'; -$lang['target____extern'] = '외부 링크에 대한 타겟 창'; +$lang['target____extern'] = '바깥 링크에 대한 타겟 창'; $lang['target____media'] = '미디어 링크에 대한 타겟 창'; $lang['target____windows'] = '창 링크에 대한 타겟 창'; $lang['mediarevisions'] = '미디어 버전 관리를 사용하겠습니까?'; @@ -114,9 +114,9 @@ $lang['refshow'] = '위의 설정이 활성화되었을 때 보여 $lang['gdlib'] = 'GD 라이브러리 버전'; $lang['im_convert'] = 'ImageMagick 변환 도구 위치'; $lang['jpg_quality'] = 'JPG 압축 품질 (0-100)'; -$lang['fetchsize'] = 'fetch.php가 외부에서 다운로드할 수도 있는 최대 크기 (바이트)'; +$lang['fetchsize'] = 'fetch.php가 바깥에서 다운로드할 수도 있는 최대 크기 (바이트)'; $lang['subscribers'] = '사용자가 이메일로 문서 바뀜에 구독하도록 허용'; -$lang['subscribe_time'] = '구독 목록과 요약이 보내질 경과 시간 (초); 이 것은 recent_days에서 설정된 시간보다 작아야 합니다.'; +$lang['subscribe_time'] = '구독 목록과 요약이 보내질 경과 시간 (초); recent_days에서 설정된 시간보다 작아야 합니다.'; $lang['notify'] = '항상 이 이메일 주소로 바뀜 알림을 보냄'; $lang['registernotify'] = '항상 새 사용자한테 이 이메일 주소로 정보를 보냄'; $lang['mailfrom'] = '자동으로 보내지는 메일 발신자'; @@ -127,7 +127,7 @@ $lang['rss_type'] = 'XML 피드 타입'; $lang['rss_linkto'] = 'XML 피드 링크 정보'; $lang['rss_content'] = 'XML 피드 항목에 표시되는 내용은?'; $lang['rss_update'] = 'XML 피드 업데이트 주기 (초)'; -$lang['rss_show_summary'] = 'XML 피드 제목에서 요약정보 보여주기'; +$lang['rss_show_summary'] = 'XML 피드 제목에서 요약 보여주기'; $lang['rss_media'] = '어떤 규격으로 XML 피드를 받아보시겠습니까?'; $lang['updatecheck'] = '업데이트와 보안 문제를 검사할까요? 이 기능을 사용하려면 DokuWiki를 update.dokuwiki.org에 연결해야 합니다.'; $lang['userewrite'] = '멋진 URL 사용'; @@ -141,9 +141,8 @@ $lang['gzip_output'] = 'xhml 내용 gzip 압축 사용'; $lang['compress'] = '최적화된 CSS, 자바스크립트 출력'; $lang['cssdatauri'] = '그림이 렌더링될 최대 용량 크기를 CSS에 규정해야 HTTP 요청 헤더 오버헤드 크기를 감소시킬 수 있습니다. 이 기술은 IE 7 이하에서는 작동하지 않습니다! 400에서 600 정도면 좋은 효율을 가져옵니다. 0로 지정할 경우 비활성화 됩니다.'; $lang['send404'] = '존재하지 않는 페이지에 대해 "HTTP 404/Page Not Found" 응답'; -$lang['broken_iua'] = '설치된 시스템에서 ignore_user_abort 기능에 문제가 있으면 색인이 정상적으로 동작하지 않습니다. 이 기능이 IIS+PHP/CGI에서 문제가 있는 것으로 알려졌습니다. 자세한 정보는 Bug 852를 참고하기 바랍니다.'; -$lang['xsendfile'] = '웹 서버 static 파일 전송 지원을 위해 X-Sendfile 헤더를 사용한다면 이 옵션을 사용합니다. -웹 서버가 이 기능을 지원해야 합니다.'; +$lang['broken_iua'] = '설치된 시스템에서 ignore_user_abort 기능에 문제가 있습니까? 문제가 있다면 색인이 정상적으로 동작하지 않습니다. 이 기능이 IIS+PHP/CGI에서 문제가 있는 것으로 알려졌습니다. 자세한 정보는 버그 852를 참고하기 바랍니다.'; +$lang['xsendfile'] = '웹 서버가 정적 파일을 제공하도록 X-Sendfile 헤더를 사용하겠습니까? 웹 서버가 이 기능을 지원해야 합니다.'; $lang['renderer_xhtml'] = '주 (xhtml) 위키 출력 처리기'; $lang['renderer__core'] = '%s (DokuWiki 내부 기능)'; $lang['renderer__plugin'] = '%s (플러그인)'; diff --git a/lib/plugins/popularity/lang/ko/intro.txt b/lib/plugins/popularity/lang/ko/intro.txt index 0af7ee2cc..b9e66094e 100644 --- a/lib/plugins/popularity/lang/ko/intro.txt +++ b/lib/plugins/popularity/lang/ko/intro.txt @@ -1,6 +1,6 @@ ====== 인기도 조사 ====== -설치된 위키의 익명 정보를 DokuWiki 개발자에게 보냅니다. 이 [[doku>popularity|기능]]은 DokuWiki가 실제 사용자에게 어떻게 사용되는지 DokuWiki 개발자에게 알려줌으로써 이 후 개발 시 참고가 됩니다. +설치된 위키의 익명 정보를 DokuWiki 개발자에게 보냅니다. 이 [[doku>popularity|도구]]는 DokuWiki가 실제 사용자에게 어떻게 사용되는지 DokuWiki 개발자에게 알려줌으로써 이 후 개발 시 참고가 됩니다. 설치된 위키가 커짐에 따라서 이 과정을 반복할 필요가 있습니다. 반복된 데이타는 익명 ID로 구별되어집니다. diff --git a/lib/plugins/usermanager/lang/ko/edit.txt b/lib/plugins/usermanager/lang/ko/edit.txt index b8b13c5c8..ebb5bb002 100644 --- a/lib/plugins/usermanager/lang/ko/edit.txt +++ b/lib/plugins/usermanager/lang/ko/edit.txt @@ -1 +1 @@ -===== 사용자 정보 수정 ===== +===== 사용자 정보 편집 ===== diff --git a/lib/plugins/usermanager/lang/ko/lang.php b/lib/plugins/usermanager/lang/ko/lang.php index 3754fea90..58f9bf14a 100644 --- a/lib/plugins/usermanager/lang/ko/lang.php +++ b/lib/plugins/usermanager/lang/ko/lang.php @@ -35,14 +35,14 @@ $lang['summary'] = '찾은 사용자 %3$d 중 %1$d-%2$d 보기. $lang['nonefound'] = '찾은 사용자가 없습니다. 전체 사용자 %d명.'; $lang['delete_ok'] = '사용자 %d명이 삭제되었습니다'; $lang['delete_fail'] = '사용자 %d명의 삭제가 실패했습니다.'; -$lang['update_ok'] = '사용자 변경을 성공했습니다.'; -$lang['update_fail'] = '사용자 변경을 실패했습니다.'; -$lang['update_exists'] = '사용자 이름 변경이 실패했습니다. 사용자 이름(%s)이 이미 존재합니다. (다른 항목의 바뀜은 적용됩니다.)'; +$lang['update_ok'] = '사용자 정보를 성공적으로 바꾸었습니다.'; +$lang['update_fail'] = '사용자 정보를 바꾸는 데 실패했습니다.'; +$lang['update_exists'] = '사용자 이름을 바꾸기는 데 실패했습니다. 사용자 이름(%s)이 이미 존재합니다. (다른 항목의 바뀜은 적용됩니다.)'; $lang['start'] = '시작'; $lang['prev'] = '이전'; $lang['next'] = '다음'; $lang['last'] = '마지막'; -$lang['edit_usermissing'] = '선택된 사용자를 찾을 수 없습니다. 사용자 이름이 삭제되거나 변경됐을 수도 있습니다.'; +$lang['edit_usermissing'] = '선택된 사용자를 찾을 수 없습니다. 사용자 이름이 삭제되거나 바뀌었을 수도 있습니다.'; $lang['user_notify'] = '사용자에게 알림'; $lang['note_notify'] = '사용자에게 새로운 비밀번호를 준 경우에만 알림 이메일이 보내집니다.'; $lang['note_group'] = '새로운 사용자는 어떤 그룹도 설정하지 않은 경우에 기본 그룹(%s)에 추가됩니다.'; -- cgit v1.2.3 From fba11f64c26a8dde5f64c57233b0da84fae35959 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Sat, 3 Nov 2012 18:42:57 +0100 Subject: removed old TarLib and changed plugin manager to use new one --- lib/plugins/plugin/classes/ap_download.class.php | 25 ++++++++++-------------- 1 file changed, 10 insertions(+), 15 deletions(-) (limited to 'lib') diff --git a/lib/plugins/plugin/classes/ap_download.class.php b/lib/plugins/plugin/classes/ap_download.class.php index d1b518d9d..0eb567c80 100644 --- a/lib/plugins/plugin/classes/ap_download.class.php +++ b/lib/plugins/plugin/classes/ap_download.class.php @@ -200,31 +200,26 @@ class ap_download extends ap_manage { if (in_array($ext, array('tar','bz','gz'))) { switch($ext){ case 'bz': - $compress_type = TarLib::COMPRESS_BZIP; + $compress_type = Tar::COMPRESS_BZIP; break; case 'gz': - $compress_type = TarLib::COMPRESS_GZIP; + $compress_type = Tar::COMPRESS_GZIP; break; default: - $compress_type = TarLib::COMPRESS_NONE; + $compress_type = Tar::COMPRESS_NONE; } - $tar = new TarLib($file, $compress_type); - if($tar->_initerror < 0){ + $tar = new Tar(); + try { + $tar->open($file, $compress_type); + $tar->extract($target); + return true; + }catch(Exception $e){ if($conf['allowdebug']){ - msg('TarLib Error: '.$tar->TarErrorStr($tar->_initerror),-1); + msg('Tar Error: '.$e->getMessage().' ['.$e->getFile().':'.$e->getLine().']',-1); } return false; } - $ok = $tar->Extract(TarLib::FULL_ARCHIVE, $target, '', 0777); - - if($ok<1){ - if($conf['allowdebug']){ - msg('TarLib Error: '.$tar->TarErrorStr($ok),-1); - } - return false; - } - return true; } else if ($ext == 'zip') { $zip = new ZipLib(); -- cgit v1.2.3 From 4d390d4260c028ff110151e305e93b80f3eb13eb Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Fri, 9 Nov 2012 14:00:14 +0100 Subject: don't merge any global confs into auth plugin configs --- lib/plugins/auth.php | 17 ----------------- 1 file changed, 17 deletions(-) (limited to 'lib') diff --git a/lib/plugins/auth.php b/lib/plugins/auth.php index 4c3c585cf..cd2f9ac12 100644 --- a/lib/plugins/auth.php +++ b/lib/plugins/auth.php @@ -416,21 +416,4 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { global $conf; return ($_SESSION[DOKU_COOKIE]['auth']['time'] >= @filemtime($conf['cachedir'].'/sessionpurge')); } - - /** - * loadConfig() - * merges the plugin's default settings with any local settings - * this function is automatically called through getConf() - */ - function loadConfig() { - global $conf; - - parent::loadConfig(); - - $this->conf['debug'] = $conf['debug']; - $this->conf['useacl'] = $conf['useacl']; - $this->conf['disableactions'] = $conf['disableactions']; - $this->conf['autopasswd'] = $conf['autopasswd']; - $this->conf['passcrypt'] = $conf['ssha']; - } } -- cgit v1.2.3 From 454d868b911059adb8889a2d6afefa016d6a21f5 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Fri, 9 Nov 2012 14:04:41 +0100 Subject: make all sub auth classes call the parent constructor This does nothing currently but allows us adding certain things to the base class later. --- lib/plugins/auth.php | 3 +++ lib/plugins/authad/auth.php | 2 ++ lib/plugins/authldap/auth.php | 2 ++ lib/plugins/authmysql/auth.php | 2 ++ lib/plugins/authpgsql/auth.php | 2 ++ lib/plugins/authplain/auth.php | 1 + 6 files changed, 12 insertions(+) (limited to 'lib') diff --git a/lib/plugins/auth.php b/lib/plugins/auth.php index cd2f9ac12..cce2370d9 100644 --- a/lib/plugins/auth.php +++ b/lib/plugins/auth.php @@ -42,6 +42,9 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin { * able to operate. Set capabilities in $this->cando * array here * + * For future compatibility, sub classes should always include a call + * to parent::__constructor() in their constructors! + * * Set $this->success to false if checks fail * * @author Christopher Smith diff --git a/lib/plugins/authad/auth.php b/lib/plugins/authad/auth.php index 35c19f471..0900a3f87 100644 --- a/lib/plugins/authad/auth.php +++ b/lib/plugins/authad/auth.php @@ -82,6 +82,8 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin { * Constructor */ public function __construct() { + parent::__construct(); + global $conf; $this->cnf = $conf['auth']['ad']; diff --git a/lib/plugins/authldap/auth.php b/lib/plugins/authldap/auth.php index 721abb48e..93683bc16 100644 --- a/lib/plugins/authldap/auth.php +++ b/lib/plugins/authldap/auth.php @@ -19,6 +19,8 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin { * Constructor */ function __construct(){ + parent::__construct(); + global $conf; $this->cnf = $conf['auth']['ldap']; diff --git a/lib/plugins/authmysql/auth.php b/lib/plugins/authmysql/auth.php index 8a8f9a488..368bd74a2 100644 --- a/lib/plugins/authmysql/auth.php +++ b/lib/plugins/authmysql/auth.php @@ -28,6 +28,8 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin { * @author Matthias Grimm */ function __construct() { + parent::__construct(); + global $conf; $this->cnf = $conf['auth']['mysql']; diff --git a/lib/plugins/authpgsql/auth.php b/lib/plugins/authpgsql/auth.php index 824a77882..46154b6ca 100644 --- a/lib/plugins/authpgsql/auth.php +++ b/lib/plugins/authpgsql/auth.php @@ -31,6 +31,8 @@ class auth_plugin_authpgsql extends auth_plugin_authmysql * Constructor */ function auth_plugin_authpgsql() { + parent::__construct(); + global $conf; $this->cnf = $conf['auth']['ad']; diff --git a/lib/plugins/authplain/auth.php b/lib/plugins/authplain/auth.php index 570d029ff..2e72bbd79 100644 --- a/lib/plugins/authplain/auth.php +++ b/lib/plugins/authplain/auth.php @@ -23,6 +23,7 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin { * @author Christopher Smith */ function __construct() { + parent::__construct(); global $config_cascade; if (!@is_readable($config_cascade['plainauth.users']['default'])){ -- cgit v1.2.3 From 5a65cc7f5700c1a96e469b9f5a57bbe1ca879f53 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Fri, 9 Nov 2012 14:07:17 +0100 Subject: some comment cleanup in authad --- lib/plugins/authad/auth.php | 8 +------- 1 file changed, 1 insertion(+), 7 deletions(-) (limited to 'lib') diff --git a/lib/plugins/authad/auth.php b/lib/plugins/authad/auth.php index 0900a3f87..e82610327 100644 --- a/lib/plugins/authad/auth.php +++ b/lib/plugins/authad/auth.php @@ -13,15 +13,9 @@ require_once(DOKU_INC.'inc/adLDAP.php'); * Usage: * Set DokuWiki's local.protected.php auth setting to read * - * $conf['useacl'] = 1; - * $conf['disableactions'] = 'register'; - * $conf['autopasswd'] = 0; * $conf['authtype'] = 'authad'; - * $conf['passcrypt'] = 'ssha'; * - * $conf['auth']['ad']['account_suffix'] = ' - * - * @my.domain.org'; + * $conf['auth']['ad']['account_suffix'] = '@my.domain.org'; * $conf['auth']['ad']['base_dn'] = 'DC=my,DC=domain,DC=org'; * $conf['auth']['ad']['domain_controllers'] = 'srv1.domain.org,srv2.domain.org'; * -- cgit v1.2.3 From 76ce1169a0c8cbb18423b1581800b9aa1050ccd5 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Fri, 9 Nov 2012 14:13:32 +0100 Subject: moved adLDAP to authad plugin and fixed includes --- lib/plugins/authad/adLDAP/adLDAP.php | 951 +++++++++++++++++++++ .../authad/adLDAP/classes/adLDAPComputers.php | 153 ++++ .../authad/adLDAP/classes/adLDAPContacts.php | 294 +++++++ .../authad/adLDAP/classes/adLDAPExchange.php | 390 +++++++++ .../authad/adLDAP/classes/adLDAPFolders.php | 179 ++++ lib/plugins/authad/adLDAP/classes/adLDAPGroups.php | 631 ++++++++++++++ lib/plugins/authad/adLDAP/classes/adLDAPUsers.php | 682 +++++++++++++++ lib/plugins/authad/adLDAP/classes/adLDAPUtils.php | 264 ++++++ .../authad/adLDAP/collections/adLDAPCollection.php | 137 +++ .../collections/adLDAPComputerCollection.php | 46 + .../adLDAP/collections/adLDAPContactCollection.php | 46 + .../adLDAP/collections/adLDAPGroupCollection.php | 46 + .../adLDAP/collections/adLDAPUserCollection.php | 46 + lib/plugins/authad/auth.php | 4 +- 14 files changed, 3866 insertions(+), 3 deletions(-) create mode 100644 lib/plugins/authad/adLDAP/adLDAP.php create mode 100644 lib/plugins/authad/adLDAP/classes/adLDAPComputers.php create mode 100644 lib/plugins/authad/adLDAP/classes/adLDAPContacts.php create mode 100644 lib/plugins/authad/adLDAP/classes/adLDAPExchange.php create mode 100644 lib/plugins/authad/adLDAP/classes/adLDAPFolders.php create mode 100644 lib/plugins/authad/adLDAP/classes/adLDAPGroups.php create mode 100644 lib/plugins/authad/adLDAP/classes/adLDAPUsers.php create mode 100644 lib/plugins/authad/adLDAP/classes/adLDAPUtils.php create mode 100644 lib/plugins/authad/adLDAP/collections/adLDAPCollection.php create mode 100644 lib/plugins/authad/adLDAP/collections/adLDAPComputerCollection.php create mode 100644 lib/plugins/authad/adLDAP/collections/adLDAPContactCollection.php create mode 100644 lib/plugins/authad/adLDAP/collections/adLDAPGroupCollection.php create mode 100644 lib/plugins/authad/adLDAP/collections/adLDAPUserCollection.php (limited to 'lib') diff --git a/lib/plugins/authad/adLDAP/adLDAP.php b/lib/plugins/authad/adLDAP/adLDAP.php new file mode 100644 index 000000000..a8f33b47e --- /dev/null +++ b/lib/plugins/authad/adLDAP/adLDAP.php @@ -0,0 +1,951 @@ +ldapConnection) { + return $this->ldapConnection; + } + return false; + } + + /** + * Get the bind status + * + * @return bool + */ + public function getLdapBind() { + return $this->ldapBind; + } + + /** + * Get the current base DN + * + * @return string + */ + public function getBaseDn() { + return $this->baseDn; + } + + /** + * The group class + * + * @var adLDAPGroups + */ + protected $groupClass; + + /** + * Get the group class interface + * + * @return adLDAPGroups + */ + public function group() { + if (!$this->groupClass) { + $this->groupClass = new adLDAPGroups($this); + } + return $this->groupClass; + } + + /** + * The user class + * + * @var adLDAPUsers + */ + protected $userClass; + + /** + * Get the userclass interface + * + * @return adLDAPUsers + */ + public function user() { + if (!$this->userClass) { + $this->userClass = new adLDAPUsers($this); + } + return $this->userClass; + } + + /** + * The folders class + * + * @var adLDAPFolders + */ + protected $folderClass; + + /** + * Get the folder class interface + * + * @return adLDAPFolders + */ + public function folder() { + if (!$this->folderClass) { + $this->folderClass = new adLDAPFolders($this); + } + return $this->folderClass; + } + + /** + * The utils class + * + * @var adLDAPUtils + */ + protected $utilClass; + + /** + * Get the utils class interface + * + * @return adLDAPUtils + */ + public function utilities() { + if (!$this->utilClass) { + $this->utilClass = new adLDAPUtils($this); + } + return $this->utilClass; + } + + /** + * The contacts class + * + * @var adLDAPContacts + */ + protected $contactClass; + + /** + * Get the contacts class interface + * + * @return adLDAPContacts + */ + public function contact() { + if (!$this->contactClass) { + $this->contactClass = new adLDAPContacts($this); + } + return $this->contactClass; + } + + /** + * The exchange class + * + * @var adLDAPExchange + */ + protected $exchangeClass; + + /** + * Get the exchange class interface + * + * @return adLDAPExchange + */ + public function exchange() { + if (!$this->exchangeClass) { + $this->exchangeClass = new adLDAPExchange($this); + } + return $this->exchangeClass; + } + + /** + * The computers class + * + * @var adLDAPComputers + */ + protected $computersClass; + + /** + * Get the computers class interface + * + * @return adLDAPComputers + */ + public function computer() { + if (!$this->computerClass) { + $this->computerClass = new adLDAPComputers($this); + } + return $this->computerClass; + } + + /** + * Getters and Setters + */ + + /** + * Set the account suffix + * + * @param string $accountSuffix + * @return void + */ + public function setAccountSuffix($accountSuffix) + { + $this->accountSuffix = $accountSuffix; + } + + /** + * Get the account suffix + * + * @return string + */ + public function getAccountSuffix() + { + return $this->accountSuffix; + } + + /** + * Set the domain controllers array + * + * @param array $domainControllers + * @return void + */ + public function setDomainControllers(array $domainControllers) + { + $this->domainControllers = $domainControllers; + } + + /** + * Get the list of domain controllers + * + * @return void + */ + public function getDomainControllers() + { + return $this->domainControllers; + } + + /** + * Sets the port number your domain controller communicates over + * + * @param int $adPort + */ + public function setPort($adPort) + { + $this->adPort = $adPort; + } + + /** + * Gets the port number your domain controller communicates over + * + * @return int + */ + public function getPort() + { + return $this->adPort; + } + + /** + * Set the username of an account with higher priviledges + * + * @param string $adminUsername + * @return void + */ + public function setAdminUsername($adminUsername) + { + $this->adminUsername = $adminUsername; + } + + /** + * Get the username of the account with higher priviledges + * + * This will throw an exception for security reasons + */ + public function getAdminUsername() + { + throw new adLDAPException('For security reasons you cannot access the domain administrator account details'); + } + + /** + * Set the password of an account with higher priviledges + * + * @param string $adminPassword + * @return void + */ + public function setAdminPassword($adminPassword) + { + $this->adminPassword = $adminPassword; + } + + /** + * Get the password of the account with higher priviledges + * + * This will throw an exception for security reasons + */ + public function getAdminPassword() + { + throw new adLDAPException('For security reasons you cannot access the domain administrator account details'); + } + + /** + * Set whether to detect the true primary group + * + * @param bool $realPrimaryGroup + * @return void + */ + public function setRealPrimaryGroup($realPrimaryGroup) + { + $this->realPrimaryGroup = $realPrimaryGroup; + } + + /** + * Get the real primary group setting + * + * @return bool + */ + public function getRealPrimaryGroup() + { + return $this->realPrimaryGroup; + } + + /** + * Set whether to use SSL + * + * @param bool $useSSL + * @return void + */ + public function setUseSSL($useSSL) + { + $this->useSSL = $useSSL; + // Set the default port correctly + if($this->useSSL) { + $this->setPort(self::ADLDAP_LDAPS_PORT); + } + else { + $this->setPort(self::ADLDAP_LDAP_PORT); + } + } + + /** + * Get the SSL setting + * + * @return bool + */ + public function getUseSSL() + { + return $this->useSSL; + } + + /** + * Set whether to use TLS + * + * @param bool $useTLS + * @return void + */ + public function setUseTLS($useTLS) + { + $this->useTLS = $useTLS; + } + + /** + * Get the TLS setting + * + * @return bool + */ + public function getUseTLS() + { + return $this->useTLS; + } + + /** + * Set whether to use SSO + * Requires ldap_sasl_bind support. Be sure --with-ldap-sasl is used when configuring PHP otherwise this function will be undefined. + * + * @param bool $useSSO + * @return void + */ + public function setUseSSO($useSSO) + { + if ($useSSO === true && !$this->ldapSaslSupported()) { + throw new adLDAPException('No LDAP SASL support for PHP. See: http://www.php.net/ldap_sasl_bind'); + } + $this->useSSO = $useSSO; + } + + /** + * Get the SSO setting + * + * @return bool + */ + public function getUseSSO() + { + return $this->useSSO; + } + + /** + * Set whether to lookup recursive groups + * + * @param bool $recursiveGroups + * @return void + */ + public function setRecursiveGroups($recursiveGroups) + { + $this->recursiveGroups = $recursiveGroups; + } + + /** + * Get the recursive groups setting + * + * @return bool + */ + public function getRecursiveGroups() + { + return $this->recursiveGroups; + } + + /** + * Default Constructor + * + * Tries to bind to the AD domain over LDAP or LDAPs + * + * @param array $options Array of options to pass to the constructor + * @throws Exception - if unable to bind to Domain Controller + * @return bool + */ + function __construct($options = array()) { + // You can specifically overide any of the default configuration options setup above + if (count($options) > 0) { + if (array_key_exists("account_suffix",$options)){ $this->accountSuffix = $options["account_suffix"]; } + if (array_key_exists("base_dn",$options)){ $this->baseDn = $options["base_dn"]; } + if (array_key_exists("domain_controllers",$options)){ + if (!is_array($options["domain_controllers"])) { + throw new adLDAPException('[domain_controllers] option must be an array'); + } + $this->domainControllers = $options["domain_controllers"]; + } + if (array_key_exists("admin_username",$options)){ $this->adminUsername = $options["admin_username"]; } + if (array_key_exists("admin_password",$options)){ $this->adminPassword = $options["admin_password"]; } + if (array_key_exists("real_primarygroup",$options)){ $this->realPrimaryGroup = $options["real_primarygroup"]; } + if (array_key_exists("use_ssl",$options)){ $this->setUseSSL($options["use_ssl"]); } + if (array_key_exists("use_tls",$options)){ $this->useTLS = $options["use_tls"]; } + if (array_key_exists("recursive_groups",$options)){ $this->recursiveGroups = $options["recursive_groups"]; } + if (array_key_exists("ad_port",$options)){ $this->setPort($options["ad_port"]); } + if (array_key_exists("sso",$options)) { + $this->setUseSSO($options["sso"]); + if (!$this->ldapSaslSupported()) { + $this->setUseSSO(false); + } + } + } + + if ($this->ldapSupported() === false) { + throw new adLDAPException('No LDAP support for PHP. See: http://www.php.net/ldap'); + } + + return $this->connect(); + } + + /** + * Default Destructor + * + * Closes the LDAP connection + * + * @return void + */ + function __destruct() { + $this->close(); + } + + /** + * Connects and Binds to the Domain Controller + * + * @return bool + */ + public function connect() + { + // Connect to the AD/LDAP server as the username/password + $domainController = $this->randomController(); + if ($this->useSSL) { + $this->ldapConnection = ldap_connect("ldaps://" . $domainController, $this->adPort); + } else { + $this->ldapConnection = ldap_connect($domainController, $this->adPort); + } + + // Set some ldap options for talking to AD + ldap_set_option($this->ldapConnection, LDAP_OPT_PROTOCOL_VERSION, 3); + ldap_set_option($this->ldapConnection, LDAP_OPT_REFERRALS, 0); + + if ($this->useTLS) { + ldap_start_tls($this->ldapConnection); + } + + // Bind as a domain admin if they've set it up + if ($this->adminUsername !== NULL && $this->adminPassword !== NULL) { + $this->ldapBind = @ldap_bind($this->ldapConnection, $this->adminUsername . $this->accountSuffix, $this->adminPassword); + if (!$this->ldapBind) { + if ($this->useSSL && !$this->useTLS) { + // If you have problems troubleshooting, remove the @ character from the ldapldapBind command above to get the actual error message + throw new adLDAPException('Bind to Active Directory failed. Either the LDAPs connection failed or the login credentials are incorrect. AD said: ' . $this->getLastError()); + } + else { + throw new adLDAPException('Bind to Active Directory failed. Check the login credentials and/or server details. AD said: ' . $this->getLastError()); + } + } + } + if ($this->useSSO && $_SERVER['REMOTE_USER'] && $this->adminUsername === null && $_SERVER['KRB5CCNAME']) { + putenv("KRB5CCNAME=" . $_SERVER['KRB5CCNAME']); + $this->ldapBind = @ldap_sasl_bind($this->ldapConnection, NULL, NULL, "GSSAPI"); + if (!$this->ldapBind){ + throw new adLDAPException('Rebind to Active Directory failed. AD said: ' . $this->getLastError()); + } + else { + return true; + } + } + + + if ($this->baseDn == NULL) { + $this->baseDn = $this->findBaseDn(); + } + + return true; + } + + /** + * Closes the LDAP connection + * + * @return void + */ + public function close() { + if ($this->ldapConnection) { + @ldap_close($this->ldapConnection); + } + } + + /** + * Validate a user's login credentials + * + * @param string $username A user's AD username + * @param string $password A user's AD password + * @param bool optional $preventRebind + * @return bool + */ + public function authenticate($username, $password, $preventRebind = false) { + // Prevent null binding + if ($username === NULL || $password === NULL) { return false; } + if (empty($username) || empty($password)) { return false; } + + // Allow binding over SSO for Kerberos + if ($this->useSSO && $_SERVER['REMOTE_USER'] && $_SERVER['REMOTE_USER'] == $username && $this->adminUsername === NULL && $_SERVER['KRB5CCNAME']) { + putenv("KRB5CCNAME=" . $_SERVER['KRB5CCNAME']); + $this->ldapBind = @ldap_sasl_bind($this->ldapConnection, NULL, NULL, "GSSAPI"); + if (!$this->ldapBind) { + throw new adLDAPException('Rebind to Active Directory failed. AD said: ' . $this->getLastError()); + } + else { + return true; + } + } + + // Bind as the user + $ret = true; + $this->ldapBind = @ldap_bind($this->ldapConnection, $username . $this->accountSuffix, $password); + if (!$this->ldapBind){ + $ret = false; + } + + // Cnce we've checked their details, kick back into admin mode if we have it + if ($this->adminUsername !== NULL && !$preventRebind) { + $this->ldapBind = @ldap_bind($this->ldapConnection, $this->adminUsername . $this->accountSuffix , $this->adminPassword); + if (!$this->ldapBind){ + // This should never happen in theory + throw new adLDAPException('Rebind to Active Directory failed. AD said: ' . $this->getLastError()); + } + } + + return $ret; + } + + /** + * Find the Base DN of your domain controller + * + * @return string + */ + public function findBaseDn() + { + $namingContext = $this->getRootDse(array('defaultnamingcontext')); + return $namingContext[0]['defaultnamingcontext'][0]; + } + + /** + * Get the RootDSE properties from a domain controller + * + * @param array $attributes The attributes you wish to query e.g. defaultnamingcontext + * @return array + */ + public function getRootDse($attributes = array("*", "+")) { + if (!$this->ldapBind){ return (false); } + + $sr = @ldap_read($this->ldapConnection, NULL, 'objectClass=*', $attributes); + $entries = @ldap_get_entries($this->ldapConnection, $sr); + return $entries; + } + + /** + * Get last error from Active Directory + * + * This function gets the last message from Active Directory + * This may indeed be a 'Success' message but if you get an unknown error + * it might be worth calling this function to see what errors were raised + * + * return string + */ + public function getLastError() { + return @ldap_error($this->ldapConnection); + } + + /** + * Detect LDAP support in php + * + * @return bool + */ + protected function ldapSupported() + { + if (!function_exists('ldap_connect')) { + return false; + } + return true; + } + + /** + * Detect ldap_sasl_bind support in PHP + * + * @return bool + */ + protected function ldapSaslSupported() + { + if (!function_exists('ldap_sasl_bind')) { + return false; + } + return true; + } + + /** + * Schema + * + * @param array $attributes Attributes to be queried + * @return array + */ + public function adldap_schema($attributes){ + + // LDAP doesn't like NULL attributes, only set them if they have values + // If you wish to remove an attribute you should set it to a space + // TO DO: Adapt user_modify to use ldap_mod_delete to remove a NULL attribute + $mod=array(); + + // Check every attribute to see if it contains 8bit characters and then UTF8 encode them + array_walk($attributes, array($this, 'encode8bit')); + + if ($attributes["address_city"]){ $mod["l"][0]=$attributes["address_city"]; } + if ($attributes["address_code"]){ $mod["postalCode"][0]=$attributes["address_code"]; } + //if ($attributes["address_country"]){ $mod["countryCode"][0]=$attributes["address_country"]; } // use country codes? + if ($attributes["address_country"]){ $mod["c"][0]=$attributes["address_country"]; } + if ($attributes["address_pobox"]){ $mod["postOfficeBox"][0]=$attributes["address_pobox"]; } + if ($attributes["address_state"]){ $mod["st"][0]=$attributes["address_state"]; } + if ($attributes["address_street"]){ $mod["streetAddress"][0]=$attributes["address_street"]; } + if ($attributes["company"]){ $mod["company"][0]=$attributes["company"]; } + if ($attributes["change_password"]){ $mod["pwdLastSet"][0]=0; } + if ($attributes["department"]){ $mod["department"][0]=$attributes["department"]; } + if ($attributes["description"]){ $mod["description"][0]=$attributes["description"]; } + if ($attributes["display_name"]){ $mod["displayName"][0]=$attributes["display_name"]; } + if ($attributes["email"]){ $mod["mail"][0]=$attributes["email"]; } + if ($attributes["expires"]){ $mod["accountExpires"][0]=$attributes["expires"]; } //unix epoch format? + if ($attributes["firstname"]){ $mod["givenName"][0]=$attributes["firstname"]; } + if ($attributes["home_directory"]){ $mod["homeDirectory"][0]=$attributes["home_directory"]; } + if ($attributes["home_drive"]){ $mod["homeDrive"][0]=$attributes["home_drive"]; } + if ($attributes["initials"]){ $mod["initials"][0]=$attributes["initials"]; } + if ($attributes["logon_name"]){ $mod["userPrincipalName"][0]=$attributes["logon_name"]; } + if ($attributes["manager"]){ $mod["manager"][0]=$attributes["manager"]; } //UNTESTED ***Use DistinguishedName*** + if ($attributes["office"]){ $mod["physicalDeliveryOfficeName"][0]=$attributes["office"]; } + if ($attributes["password"]){ $mod["unicodePwd"][0]=$this->user()->encodePassword($attributes["password"]); } + if ($attributes["profile_path"]){ $mod["profilepath"][0]=$attributes["profile_path"]; } + if ($attributes["script_path"]){ $mod["scriptPath"][0]=$attributes["script_path"]; } + if ($attributes["surname"]){ $mod["sn"][0]=$attributes["surname"]; } + if ($attributes["title"]){ $mod["title"][0]=$attributes["title"]; } + if ($attributes["telephone"]){ $mod["telephoneNumber"][0]=$attributes["telephone"]; } + if ($attributes["mobile"]){ $mod["mobile"][0]=$attributes["mobile"]; } + if ($attributes["pager"]){ $mod["pager"][0]=$attributes["pager"]; } + if ($attributes["ipphone"]){ $mod["ipphone"][0]=$attributes["ipphone"]; } + if ($attributes["web_page"]){ $mod["wWWHomePage"][0]=$attributes["web_page"]; } + if ($attributes["fax"]){ $mod["facsimileTelephoneNumber"][0]=$attributes["fax"]; } + if ($attributes["enabled"]){ $mod["userAccountControl"][0]=$attributes["enabled"]; } + if ($attributes["homephone"]){ $mod["homephone"][0]=$attributes["homephone"]; } + + // Distribution List specific schema + if ($attributes["group_sendpermission"]){ $mod["dlMemSubmitPerms"][0]=$attributes["group_sendpermission"]; } + if ($attributes["group_rejectpermission"]){ $mod["dlMemRejectPerms"][0]=$attributes["group_rejectpermission"]; } + + // Exchange Schema + if ($attributes["exchange_homemdb"]){ $mod["homeMDB"][0]=$attributes["exchange_homemdb"]; } + if ($attributes["exchange_mailnickname"]){ $mod["mailNickname"][0]=$attributes["exchange_mailnickname"]; } + if ($attributes["exchange_proxyaddress"]){ $mod["proxyAddresses"][0]=$attributes["exchange_proxyaddress"]; } + if ($attributes["exchange_usedefaults"]){ $mod["mDBUseDefaults"][0]=$attributes["exchange_usedefaults"]; } + if ($attributes["exchange_policyexclude"]){ $mod["msExchPoliciesExcluded"][0]=$attributes["exchange_policyexclude"]; } + if ($attributes["exchange_policyinclude"]){ $mod["msExchPoliciesIncluded"][0]=$attributes["exchange_policyinclude"]; } + if ($attributes["exchange_addressbook"]){ $mod["showInAddressBook"][0]=$attributes["exchange_addressbook"]; } + if ($attributes["exchange_altrecipient"]){ $mod["altRecipient"][0]=$attributes["exchange_altrecipient"]; } + if ($attributes["exchange_deliverandredirect"]){ $mod["deliverAndRedirect"][0]=$attributes["exchange_deliverandredirect"]; } + + // This schema is designed for contacts + if ($attributes["exchange_hidefromlists"]){ $mod["msExchHideFromAddressLists"][0]=$attributes["exchange_hidefromlists"]; } + if ($attributes["contact_email"]){ $mod["targetAddress"][0]=$attributes["contact_email"]; } + + //echo ("
"); print_r($mod);
+        /*
+        // modifying a name is a bit fiddly
+        if ($attributes["firstname"] && $attributes["surname"]){
+            $mod["cn"][0]=$attributes["firstname"]." ".$attributes["surname"];
+            $mod["displayname"][0]=$attributes["firstname"]." ".$attributes["surname"];
+            $mod["name"][0]=$attributes["firstname"]." ".$attributes["surname"];
+        }
+        */
+
+        if (count($mod)==0){ return (false); }
+        return ($mod);
+    }
+    
+    /**
+    * Convert 8bit characters e.g. accented characters to UTF8 encoded characters
+    */
+    protected function encode8Bit(&$item, $key) {
+        $encode = false;
+        if (is_string($item)) {
+            for ($i=0; $i> 7) {
+                    $encode = true;
+                }
+            }
+        }
+        if ($encode === true && $key != 'password') {
+            $item = utf8_encode($item);   
+        }
+    }
+    
+    /**
+    * Select a random domain controller from your domain controller array
+    * 
+    * @return string
+    */
+    protected function randomController() 
+    {
+        mt_srand(doubleval(microtime()) * 100000000); // For older PHP versions
+        /*if (sizeof($this->domainControllers) > 1) {
+            $adController = $this->domainControllers[array_rand($this->domainControllers)]; 
+            // Test if the controller is responding to pings
+            $ping = $this->pingController($adController); 
+            if ($ping === false) { 
+                // Find the current key in the domain controllers array
+                $key = array_search($adController, $this->domainControllers);
+                // Remove it so that we don't end up in a recursive loop
+                unset($this->domainControllers[$key]);
+                // Select a new controller
+                return $this->randomController(); 
+            }
+            else { 
+                return ($adController); 
+            }
+        } */
+        return $this->domainControllers[array_rand($this->domainControllers)];
+    }  
+    
+    /** 
+    * Test basic connectivity to controller 
+    * 
+    * @return bool
+    */ 
+    protected function pingController($host) {
+        $port = $this->adPort; 
+        fsockopen($host, $port, $errno, $errstr, 10); 
+        if ($errno > 0) {
+            return false;
+        }
+        return true;
+    }
+
+}
+
+/**
+* adLDAP Exception Handler
+* 
+* Exceptions of this type are thrown on bind failure or when SSL is required but not configured
+* Example:
+* try {
+*   $adldap = new adLDAP();
+* }
+* catch (adLDAPException $e) {
+*   echo $e;
+*   exit();
+* }
+*/
+class adLDAPException extends Exception {}
+
+?>
\ No newline at end of file
diff --git a/lib/plugins/authad/adLDAP/classes/adLDAPComputers.php b/lib/plugins/authad/adLDAP/classes/adLDAPComputers.php
new file mode 100644
index 000000000..71b24a04f
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/classes/adLDAPComputers.php
@@ -0,0 +1,153 @@
+adldap = $adldap;
+    }
+    
+    /**
+    * Get information about a specific computer. Returned in a raw array format from AD
+    * 
+    * @param string $computerName The name of the computer
+    * @param array $fields Attributes to return
+    * @return array
+    */
+    public function info($computerName, $fields = NULL)
+    {
+        if ($computerName === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+
+        $filter = "(&(objectClass=computer)(cn=" . $computerName . "))";
+        if ($fields === NULL) { 
+            $fields = array("memberof","cn","displayname","dnshostname","distinguishedname","objectcategory","operatingsystem","operatingsystemservicepack","operatingsystemversion"); 
+        }
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+        
+        return $entries;
+    }
+    
+    /**
+    * Find information about the computers. Returned in a raw array format from AD
+    * 
+    * @param string $computerName The name of the computer
+    * @param array $fields Array of parameters to query
+    * @return mixed
+    */
+    public function infoCollection($computerName, $fields = NULL)
+    {
+        if ($computerName === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        $info = $this->info($computerName, $fields);
+        
+        if ($info !== false) {
+            $collection = new adLDAPComputerCollection($info, $this->adldap);
+            return $collection;
+        }
+        return false;
+    }
+    
+    /**
+    * Check if a computer is in a group
+    * 
+    * @param string $computerName The name of the computer
+    * @param string $group The group to check
+    * @param bool $recursive Whether to check recursively
+    * @return array
+    */
+    public function inGroup($computerName, $group, $recursive = NULL)
+    {
+        if ($computerName === NULL) { return false; }
+        if ($group === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); } // use the default option if they haven't set it
+
+        //get a list of the groups
+        $groups = $this->groups($computerName, array("memberof"), $recursive);
+
+        //return true if the specified group is in the group list
+        if (in_array($group, $groups)){ 
+            return true; 
+        }
+
+        return false;
+    }
+    
+    /**
+    * Get the groups a computer is in
+    * 
+    * @param string $computerName The name of the computer
+    * @param bool $recursive Whether to check recursively
+    * @return array
+    */
+    public function groups($computerName, $recursive = NULL)
+    {
+        if ($computerName === NULL) { return false; }
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); } //use the default option if they haven't set it
+        if (!$this->adldap->getLdapBind()){ return false; }
+
+        //search the directory for their information
+        $info = @$this->info($computerName, array("memberof", "primarygroupid"));
+        $groups = $this->adldap->utilities()->niceNames($info[0]["memberof"]); //presuming the entry returned is our guy (unique usernames)
+
+        if ($recursive === true) {
+            foreach ($groups as $id => $groupName){
+              $extraGroups = $this->adldap->group()->recursiveGroups($groupName);
+              $groups = array_merge($groups, $extraGroups);
+            }
+        }
+
+        return $groups;
+    }
+    
+}
+?>
\ No newline at end of file
diff --git a/lib/plugins/authad/adLDAP/classes/adLDAPContacts.php b/lib/plugins/authad/adLDAP/classes/adLDAPContacts.php
new file mode 100644
index 000000000..addd3e5f0
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/classes/adLDAPContacts.php
@@ -0,0 +1,294 @@
+adldap = $adldap;
+    }
+    
+    //*****************************************************************************************************************
+    // CONTACT FUNCTIONS
+    // * Still work to do in this area, and new functions to write
+    
+    /**
+    * Create a contact
+    * 
+    * @param array $attributes The attributes to set to the contact
+    * @return bool
+    */
+    public function create($attributes)
+    {
+        // Check for compulsory fields
+        if (!array_key_exists("display_name", $attributes)) { return "Missing compulsory field [display_name]"; }
+        if (!array_key_exists("email", $attributes)) { return "Missing compulsory field [email]"; }
+        if (!array_key_exists("container", $attributes)) { return "Missing compulsory field [container]"; }
+        if (!is_array($attributes["container"])) { return "Container attribute must be an array."; }
+
+        // Translate the schema
+        $add = $this->adldap->adldap_schema($attributes);
+        
+        // Additional stuff only used for adding contacts
+        $add["cn"][0] = $attributes["display_name"];
+        $add["objectclass"][0] = "top";
+        $add["objectclass"][1] = "person";
+        $add["objectclass"][2] = "organizationalPerson";
+        $add["objectclass"][3] = "contact"; 
+        if (!isset($attributes['exchange_hidefromlists'])) {
+            $add["msExchHideFromAddressLists"][0] = "TRUE";
+        }
+
+        // Determine the container
+        $attributes["container"] = array_reverse($attributes["container"]);
+        $container= "OU=" . implode(",OU=", $attributes["container"]);
+
+        // Add the entry
+        $result = @ldap_add($this->adldap->getLdapConnection(), "CN=" . $this->adldap->utilities()->escapeCharacters($add["cn"][0]) . ", " . $container . "," . $this->adldap->getBaseDn(), $add);
+        if ($result != true) { 
+            return false; 
+        }
+        
+        return true;
+    }  
+    
+    /**
+    * Determine the list of groups a contact is a member of
+    * 
+    * @param string $distinguisedname The full DN of a contact
+    * @param bool $recursive Recursively check groups
+    * @return array
+    */
+    public function groups($distinguishedName, $recursive = NULL)
+    {
+        if ($distinguishedName === NULL) { return false; }
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); } //use the default option if they haven't set it
+        if (!$this->adldap->getLdapBind()){ return false; }
+        
+        // Search the directory for their information
+        $info = @$this->info($distinguishedName, array("memberof", "primarygroupid"));
+        $groups = $this->adldap->utilities()->niceNames($info[0]["memberof"]); //presuming the entry returned is our contact
+
+        if ($recursive === true){
+            foreach ($groups as $id => $groupName){
+                $extraGroups = $this->adldap->group()->recursiveGroups($groupName);
+                $groups = array_merge($groups, $extraGroups);
+            }
+        }
+        
+        return $groups;
+    }
+    
+    /**
+    * Get contact information. Returned in a raw array format from AD
+    * 
+    * @param string $distinguisedname The full DN of a contact
+    * @param array $fields Attributes to be returned
+    * @return array
+    */
+    public function info($distinguishedName, $fields = NULL)
+    {
+        if ($distinguishedName === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+
+        $filter = "distinguishedName=" . $distinguishedName;
+        if ($fields === NULL) { 
+            $fields = array("distinguishedname", "mail", "memberof", "department", "displayname", "telephonenumber", "primarygroupid", "objectsid"); 
+        }
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+        
+        if ($entries[0]['count'] >= 1) {
+            // AD does not return the primary group in the ldap query, we may need to fudge it
+            if ($this->adldap->getRealPrimaryGroup() && isset($entries[0]["primarygroupid"][0]) && isset($entries[0]["primarygroupid"][0])){
+                //$entries[0]["memberof"][]=$this->group_cn($entries[0]["primarygroupid"][0]);
+                $entries[0]["memberof"][] = $this->adldap->group()->getPrimaryGroup($entries[0]["primarygroupid"][0], $entries[0]["objectsid"][0]);
+            } else {
+                $entries[0]["memberof"][] = "CN=Domain Users,CN=Users," . $this->adldap->getBaseDn();
+            }
+        }
+        
+        $entries[0]["memberof"]["count"]++;
+        return $entries;
+    }
+    
+    /**
+    * Find information about the contacts. Returned in a raw array format from AD
+    * 
+    * @param string $distinguishedName The full DN of a contact 
+    * @param array $fields Array of parameters to query
+    * @return mixed
+    */
+    public function infoCollection($distinguishedName, $fields = NULL)
+    {
+        if ($distinguishedName === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        $info = $this->info($distinguishedName, $fields);
+        
+        if ($info !== false) {
+            $collection = new adLDAPContactCollection($info, $this->adldap);
+            return $collection;
+        }
+        return false;
+    }
+    
+    /**
+    * Determine if a contact is a member of a group
+    * 
+    * @param string $distinguisedName The full DN of a contact
+    * @param string $group The group name to query
+    * @param bool $recursive Recursively check groups
+    * @return bool
+    */
+    public function inGroup($distinguisedName, $group, $recursive = NULL)
+    {
+        if ($distinguisedName === NULL) { return false; }
+        if ($group === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); } //use the default option if they haven't set it
+        
+        // Get a list of the groups
+        $groups = $this->groups($distinguisedName, array("memberof"), $recursive);
+        
+        // Return true if the specified group is in the group list
+        if (in_array($group, $groups)){ 
+            return true; 
+        }
+
+        return false;
+    }          
+    
+    /**
+    * Modify a contact
+    * 
+    * @param string $distinguishedName The contact to query
+    * @param array $attributes The attributes to modify.  Note if you set the enabled attribute you must not specify any other attributes
+    * @return bool
+    */
+    public function modify($distinguishedName, $attributes) {
+        if ($distinguishedName === NULL) { return "Missing compulsory field [distinguishedname]"; }
+        
+        // Translate the update to the LDAP schema                
+        $mod = $this->adldap->adldap_schema($attributes);
+        
+        // Check to see if this is an enabled status update
+        if (!$mod) { 
+            return false; 
+        }
+        
+        // Do the update
+        $result = ldap_modify($this->adldap->getLdapConnection(), $distinguishedName, $mod);
+        if ($result == false) { 
+            return false; 
+        }
+        
+        return true;
+    }
+    
+    /**
+    * Delete a contact
+    * 
+    * @param string $distinguishedName The contact dn to delete (please be careful here!)
+    * @return array
+    */
+    public function delete($distinguishedName) 
+    {
+        $result = $this->folder()->delete($distinguishedName);
+        if ($result != true) { 
+            return false; 
+        }       
+        return true;
+    }
+    
+    /**
+    * Return a list of all contacts
+    * 
+    * @param bool $includeDescription Include a description of a contact
+    * @param string $search The search parameters
+    * @param bool $sorted Whether to sort the results
+    * @return array
+    */
+    public function all($includeDescription = false, $search = "*", $sorted = true) {
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        // Perform the search and grab all their details
+        $filter = "(&(objectClass=contact)(cn=" . $search . "))";
+        $fields = array("displayname","distinguishedname");           
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+        $usersArray = array();
+        for ($i=0; $i<$entries["count"]; $i++){
+            if ($includeDescription && strlen($entries[$i]["displayname"][0])>0){
+                $usersArray[$entries[$i]["distinguishedname"][0]] = $entries[$i]["displayname"][0];
+            } elseif ($includeDescription){
+                $usersArray[$entries[$i]["distinguishedname"][0]] = $entries[$i]["distinguishedname"][0];
+            } else {
+                array_push($usersArray, $entries[$i]["distinguishedname"][0]);
+            }
+        }
+        if ($sorted) { 
+            asort($usersArray); 
+        }
+        return $usersArray;
+    }
+    
+    /**
+    * Mail enable a contact
+    * Allows email to be sent to them through Exchange
+    * 
+    * @param string $distinguishedname The contact to mail enable
+    * @param string $emailaddress The email address to allow emails to be sent through
+    * @param string $mailnickname The mailnickname for the contact in Exchange.  If NULL this will be set to the display name
+    * @return bool
+    */
+    public function contactMailEnable($distinguishedName, $emailAddress, $mailNickname = NULL){
+        return $this->adldap->exchange()->contactMailEnable($distinguishedName, $emailAddress, $mailNickname);
+    }
+    
+    
+}
+?>
diff --git a/lib/plugins/authad/adLDAP/classes/adLDAPExchange.php b/lib/plugins/authad/adLDAP/classes/adLDAPExchange.php
new file mode 100644
index 000000000..dd0c6de05
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/classes/adLDAPExchange.php
@@ -0,0 +1,390 @@
+adldap = $adldap;
+    }
+    
+    /**
+    * Create an Exchange account
+    * 
+    * @param string $username The username of the user to add the Exchange account to
+    * @param array $storageGroup The mailbox, Exchange Storage Group, for the user account, this must be a full CN
+    *                            If the storage group has a different base_dn to the adLDAP configuration, set it using $base_dn
+    * @param string $emailAddress The primary email address to add to this user
+    * @param string $mailNickname The mail nick name.  If mail nickname is blank, the username will be used
+    * @param bool $mdbUseDefaults Indicates whether the store should use the default quota, rather than the per-mailbox quota.
+    * @param string $baseDn Specify an alternative base_dn for the Exchange storage group
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function createMailbox($username, $storageGroup, $emailAddress, $mailNickname=NULL, $useDefaults=TRUE, $baseDn=NULL, $isGUID=false)
+    {
+        if ($username === NULL){ return "Missing compulsory field [username]"; }     
+        if ($storageGroup === NULL) { return "Missing compulsory array [storagegroup]"; }
+        if (!is_array($storageGroup)) { return "[storagegroup] must be an array"; }
+        if ($emailAddress === NULL) { return "Missing compulsory field [emailAddress]"; }
+        
+        if ($baseDn === NULL) {
+            $baseDn = $this->adldap->getBaseDn();   
+        }
+        
+        $container = "CN=" . implode(",CN=", $storageGroup);
+        
+        if ($mailNickname === NULL) { 
+            $mailNickname = $username; 
+        }
+        $mdbUseDefaults = $this->adldap->utilities()->boolToString($useDefaults);
+        
+        $attributes = array(
+            'exchange_homemdb'=>$container.",".$baseDn,
+            'exchange_proxyaddress'=>'SMTP:' . $emailAddress,
+            'exchange_mailnickname'=>$mailNickname,
+            'exchange_usedefaults'=>$mdbUseDefaults
+        );
+        $result = $this->adldap->user()->modify($username, $attributes, $isGUID);
+        if ($result == false) { 
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Add an X400 address to Exchange
+    * See http://tools.ietf.org/html/rfc1685 for more information.
+    * An X400 Address looks similar to this X400:c=US;a= ;p=Domain;o=Organization;s=Doe;g=John;
+    * 
+    * @param string $username The username of the user to add the X400 to to
+    * @param string $country Country
+    * @param string $admd Administration Management Domain
+    * @param string $pdmd Private Management Domain (often your AD domain)
+    * @param string $org Organization
+    * @param string $surname Surname
+    * @param string $givenName Given name
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function addX400($username, $country, $admd, $pdmd, $org, $surname, $givenName, $isGUID=false) 
+    {
+        if ($username === NULL){ return "Missing compulsory field [username]"; }     
+        
+        $proxyValue = 'X400:';
+            
+        // Find the dn of the user
+        $user = $this->adldap->user()->info($username, array("cn","proxyaddresses"), $isGUID);
+        if ($user[0]["dn"] === NULL) { return false; }
+        $userDn = $user[0]["dn"];
+        
+        // We do not have to demote an email address from the default so we can just add the new proxy address
+        $attributes['exchange_proxyaddress'] = $proxyValue . 'c=' . $country . ';a=' . $admd . ';p=' . $pdmd . ';o=' . $org . ';s=' . $surname . ';g=' . $givenName . ';';
+       
+        // Translate the update to the LDAP schema                
+        $add = $this->adldap->adldap_schema($attributes);
+        
+        if (!$add) { return false; }
+        
+        // Do the update
+        // Take out the @ to see any errors, usually this error might occur because the address already
+        // exists in the list of proxyAddresses
+        $result = @ldap_mod_add($this->adldap->getLdapConnection(), $userDn, $add);
+        if ($result == false) { 
+            return false; 
+        }
+        
+        return true;
+    }
+    
+    /**
+    * Add an address to Exchange
+    * 
+    * @param string $username The username of the user to add the Exchange account to
+    * @param string $emailAddress The email address to add to this user
+    * @param bool $default Make this email address the default address, this is a bit more intensive as we have to demote any existing default addresses
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function addAddress($username, $emailAddress, $default = FALSE, $isGUID = false) 
+    {
+        if ($username === NULL) { return "Missing compulsory field [username]"; }     
+        if ($emailAddress === NULL) { return "Missing compulsory fields [emailAddress]"; }
+        
+        $proxyValue = 'smtp:';
+        if ($default === true) {
+            $proxyValue = 'SMTP:';
+        }
+              
+        // Find the dn of the user
+        $user = $this->adldap->user()->info($username, array("cn","proxyaddresses"), $isGUID);
+        if ($user[0]["dn"] === NULL){ return false; }
+        $userDn = $user[0]["dn"];
+        
+        // We need to scan existing proxy addresses and demote the default one
+        if (is_array($user[0]["proxyaddresses"]) && $default === true) {
+            $modAddresses = array();
+            for ($i=0;$iadldap->getLdapConnection(), $userDn, $modAddresses);
+            if ($result == false) { 
+                return false; 
+            }
+            
+            return true;
+        }
+        else {
+            // We do not have to demote an email address from the default so we can just add the new proxy address
+            $attributes['exchange_proxyaddress'] = $proxyValue . $emailAddress;
+            
+            // Translate the update to the LDAP schema                
+            $add = $this->adldap->adldap_schema($attributes);
+            
+            if (!$add) { 
+                return false; 
+            }
+            
+            // Do the update
+            // Take out the @ to see any errors, usually this error might occur because the address already
+            // exists in the list of proxyAddresses
+            $result = @ldap_mod_add($this->adldap->getLdapConnection(), $userDn,$add);
+            if ($result == false) { 
+                return false; 
+            }
+            
+            return true;
+        }
+    }
+    
+    /**
+    * Remove an address to Exchange
+    * If you remove a default address the account will no longer have a default, 
+    * we recommend changing the default address first
+    * 
+    * @param string $username The username of the user to add the Exchange account to
+    * @param string $emailAddress The email address to add to this user
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function deleteAddress($username, $emailAddress, $isGUID=false) 
+    {
+        if ($username === NULL) { return "Missing compulsory field [username]"; }     
+        if ($emailAddress === NULL) { return "Missing compulsory fields [emailAddress]"; }
+        
+        // Find the dn of the user
+        $user = $this->adldap->user()->info($username, array("cn","proxyaddresses"), $isGUID);
+        if ($user[0]["dn"] === NULL) { return false; }
+        $userDn = $user[0]["dn"];
+        
+        if (is_array($user[0]["proxyaddresses"])) {
+            $mod = array();
+            for ($i=0;$iadldap->getLdapConnection(), $userDn,$mod);
+            if ($result == false) { 
+                return false; 
+            }
+            
+            return true;
+        }
+        else {
+            return false;
+        }
+    }
+    /**
+    * Change the default address
+    * 
+    * @param string $username The username of the user to add the Exchange account to
+    * @param string $emailAddress The email address to make default
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function primaryAddress($username, $emailAddress, $isGUID = false) 
+    {
+        if ($username === NULL) { return "Missing compulsory field [username]"; }     
+        if ($emailAddress === NULL) { return "Missing compulsory fields [emailAddress]"; }
+        
+        // Find the dn of the user
+        $user = $this->adldap->user()->info($username, array("cn","proxyaddresses"), $isGUID);
+        if ($user[0]["dn"] === NULL){ return false; }
+        $userDn = $user[0]["dn"];
+        
+        if (is_array($user[0]["proxyaddresses"])) {
+            $modAddresses = array();
+            for ($i=0;$iadldap->getLdapConnection(), $userDn, $modAddresses);
+            if ($result == false) { 
+                return false; 
+            }
+            
+            return true;
+        }
+        
+    }
+    
+    /**
+    * Mail enable a contact
+    * Allows email to be sent to them through Exchange
+    * 
+    * @param string $distinguishedName The contact to mail enable
+    * @param string $emailAddress The email address to allow emails to be sent through
+    * @param string $mailNickname The mailnickname for the contact in Exchange.  If NULL this will be set to the display name
+    * @return bool
+    */
+    public function contactMailEnable($distinguishedName, $emailAddress, $mailNickname = NULL)
+    {
+        if ($distinguishedName === NULL) { return "Missing compulsory field [distinguishedName]"; }   
+        if ($emailAddress === NULL) { return "Missing compulsory field [emailAddress]"; }  
+        
+        if ($mailNickname !== NULL) {
+            // Find the dn of the user
+            $user = $this->adldap->contact()->info($distinguishedName, array("cn","displayname"));
+            if ($user[0]["displayname"] === NULL) { return false; }
+            $mailNickname = $user[0]['displayname'][0];
+        }
+        
+        $attributes = array("email"=>$emailAddress,"contact_email"=>"SMTP:" . $emailAddress,"exchange_proxyaddress"=>"SMTP:" . $emailAddress,"exchange_mailnickname" => $mailNickname);
+         
+        // Translate the update to the LDAP schema                
+        $mod = $this->adldap->adldap_schema($attributes);
+        
+        // Check to see if this is an enabled status update
+        if (!$mod) { return false; }
+        
+        // Do the update
+        $result = ldap_modify($this->adldap->getLdapConnection(), $distinguishedName, $mod);
+        if ($result == false) { return false; }
+        
+        return true;
+    }
+    
+    /**
+    * Returns a list of Exchange Servers in the ConfigurationNamingContext of the domain
+    * 
+    * @param array $attributes An array of the AD attributes you wish to return
+    * @return array
+    */
+    public function servers($attributes = array('cn','distinguishedname','serialnumber')) 
+    {
+        if (!$this->adldap->getLdapBind()){ return false; }
+        
+        $configurationNamingContext = $this->adldap->getRootDse(array('configurationnamingcontext'));
+        $sr = @ldap_search($this->adldap->getLdapConnection(), $configurationNamingContext[0]['configurationnamingcontext'][0],'(&(objectCategory=msExchExchangeServer))', $attributes);
+        $entries = @ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+        return $entries;
+    }
+    
+    /**
+    * Returns a list of Storage Groups in Exchange for a given mail server
+    * 
+    * @param string $exchangeServer The full DN of an Exchange server.  You can use exchange_servers() to find the DN for your server
+    * @param array $attributes An array of the AD attributes you wish to return
+    * @param bool $recursive If enabled this will automatically query the databases within a storage group
+    * @return array
+    */
+    public function storageGroups($exchangeServer, $attributes = array('cn','distinguishedname'), $recursive = NULL) 
+    {
+        if (!$this->adldap->getLdapBind()){ return false; }
+        if ($exchangeServer === NULL) { return "Missing compulsory field [exchangeServer]"; }
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); }
+
+        $filter = '(&(objectCategory=msExchStorageGroup))';
+        $sr = @ldap_search($this->adldap->getLdapConnection(), $exchangeServer, $filter, $attributes);
+        $entries = @ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+        if ($recursive === true) {
+            for ($i=0; $i<$entries['count']; $i++) {
+                $entries[$i]['msexchprivatemdb'] = $this->storageDatabases($entries[$i]['distinguishedname'][0]);       
+            }
+        }
+        
+        return $entries;
+    }
+    
+    /**
+    * Returns a list of Databases within any given storage group in Exchange for a given mail server
+    * 
+    * @param string $storageGroup The full DN of an Storage Group.  You can use exchange_storage_groups() to find the DN 
+    * @param array $attributes An array of the AD attributes you wish to return
+    * @return array
+    */
+    public function storageDatabases($storageGroup, $attributes = array('cn','distinguishedname','displayname')) {
+        if (!$this->adldap->getLdapBind()){ return false; }
+        if ($storageGroup === NULL) { return "Missing compulsory field [storageGroup]"; }
+        
+        $filter = '(&(objectCategory=msExchPrivateMDB))';
+        $sr = @ldap_search($this->adldap->getLdapConnection(), $storageGroup, $filter, $attributes);
+        $entries = @ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+        return $entries;
+    }
+}
+?>
\ No newline at end of file
diff --git a/lib/plugins/authad/adLDAP/classes/adLDAPFolders.php b/lib/plugins/authad/adLDAP/classes/adLDAPFolders.php
new file mode 100644
index 000000000..55120152d
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/classes/adLDAPFolders.php
@@ -0,0 +1,179 @@
+adldap = $adldap;
+    }
+    
+    /**
+    * Delete a distinguished name from Active Directory
+    * You should never need to call this yourself, just use the wrapper functions user_delete and contact_delete
+    *
+    * @param string $dn The distinguished name to delete
+    * @return bool
+    */
+    public function delete($dn){ 
+        $result = ldap_delete($this->adldap->getLdapConnection(), $dn);
+        if ($result != true) { 
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Returns a folder listing for a specific OU
+    * See http://adldap.sourceforge.net/wiki/doku.php?id=api_folder_functions
+    * 
+    * @param array $folderName An array to the OU you wish to list. 
+    *                           If set to NULL will list the root, strongly recommended to set 
+    *                           $recursive to false in that instance!
+    * @param string $dnType The type of record to list.  This can be ADLDAP_FOLDER or ADLDAP_CONTAINER.
+    * @param bool $recursive Recursively search sub folders
+    * @param bool $type Specify a type of object to search for
+    * @return array
+    */
+    public function listing($folderName = NULL, $dnType = adLDAP::ADLDAP_FOLDER, $recursive = NULL, $type = NULL) 
+    {
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); } //use the default option if they haven't set it
+        if (!$this->adldap->getLdapBind()) { return false; }
+
+        $filter = '(&';
+        if ($type !== NULL) {
+            switch ($type) {
+                case 'contact':
+                    $filter .= '(objectClass=contact)';
+                    break;
+                case 'computer':
+                    $filter .= '(objectClass=computer)';
+                    break;
+                case 'group':
+                    $filter .= '(objectClass=group)';
+                    break;
+                case 'folder':
+                    $filter .= '(objectClass=organizationalUnit)';
+                    break;
+                case 'container':
+                    $filter .= '(objectClass=container)';
+                    break;
+                case 'domain':
+                    $filter .= '(objectClass=builtinDomain)';
+                    break;
+                default:
+                    $filter .= '(objectClass=user)';
+                    break;   
+            }
+        }
+        else {
+            $filter .= '(objectClass=*)';   
+        }
+        // If the folder name is null then we will search the root level of AD
+        // This requires us to not have an OU= part, just the base_dn
+        $searchOu = $this->adldap->getBaseDn();
+        if (is_array($folderName)) {
+            $ou = $dnType . "=" . implode("," . $dnType . "=", $folderName);
+            $filter .= '(!(distinguishedname=' . $ou . ',' . $this->adldap->getBaseDn() . ')))';
+            $searchOu = $ou . ',' . $this->adldap->getBaseDn();
+        }
+        else {
+            $filter .= '(!(distinguishedname=' . $this->adldap->getBaseDn() . ')))';
+        }
+
+        if ($recursive === true) {
+            $sr = ldap_search($this->adldap->getLdapConnection(), $searchOu, $filter, array('objectclass', 'distinguishedname', 'samaccountname'));
+            $entries = @ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+            if (is_array($entries)) {
+                return $entries;
+            }
+        }
+        else {
+            $sr = ldap_list($this->adldap->getLdapConnection(), $searchOu, $filter, array('objectclass', 'distinguishedname', 'samaccountname'));
+            $entries = @ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+            if (is_array($entries)) {
+                return $entries;
+            }
+        }
+        
+        return false;
+    }
+
+    /**
+    * Create an organizational unit
+    * 
+    * @param array $attributes Default attributes of the ou
+    * @return bool
+    */
+    public function create($attributes)
+    {
+        if (!is_array($attributes)){ return "Attributes must be an array"; }
+        if (!is_array($attributes["container"])) { return "Container attribute must be an array."; }
+        if (!array_key_exists("ou_name",$attributes)) { return "Missing compulsory field [ou_name]"; }
+        if (!array_key_exists("container",$attributes)) { return "Missing compulsory field [container]"; }
+        
+        $attributes["container"] = array_reverse($attributes["container"]);
+
+        $add=array();
+        $add["objectClass"] = "organizationalUnit";
+        $add["OU"] = $attributes['ou_name'];
+        $containers = "";
+        if (count($attributes['container']) > 0) {
+            $containers = "OU=" . implode(",OU=", $attributes["container"]) . ",";
+        }
+
+        $containers = "OU=" . implode(",OU=", $attributes["container"]);
+        $result = ldap_add($this->adldap->getLdapConnection(), "OU=" . $add["OU"] . ", " . $containers . $this->adldap->getBaseDn(), $add);
+        if ($result != true) { 
+            return false; 
+        }
+        
+        return true;
+    }
+    
+}
+
+?>
\ No newline at end of file
diff --git a/lib/plugins/authad/adLDAP/classes/adLDAPGroups.php b/lib/plugins/authad/adLDAP/classes/adLDAPGroups.php
new file mode 100644
index 000000000..05e4cc93b
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/classes/adLDAPGroups.php
@@ -0,0 +1,631 @@
+adldap = $adldap;
+    }
+    
+    /**
+    * Add a group to a group
+    * 
+    * @param string $parent The parent group name
+    * @param string $child The child group name
+    * @return bool
+    */
+    public function addGroup($parent,$child){
+
+        // Find the parent group's dn
+        $parentGroup = $this->ginfo($parent, array("cn"));
+        if ($parentGroup[0]["dn"] === NULL){
+            return false; 
+        }
+        $parentDn = $parentGroup[0]["dn"];
+        
+        // Find the child group's dn
+        $childGroup = $this->info($child, array("cn"));
+        if ($childGroup[0]["dn"] === NULL){ 
+            return false; 
+        }
+        $childDn = $childGroup[0]["dn"];
+                
+        $add = array();
+        $add["member"] = $childDn;
+        
+        $result = @ldap_mod_add($this->adldap->getLdapConnection(), $parentDn, $add);
+        if ($result == false) { 
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Add a user to a group
+    * 
+    * @param string $group The group to add the user to
+    * @param string $user The user to add to the group
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function addUser($group, $user, $isGUID = false)
+    {
+        // Adding a user is a bit fiddly, we need to get the full DN of the user
+        // and add it using the full DN of the group
+        
+        // Find the user's dn
+        $userDn = $this->adldap->user()->dn($user, $isGUID);
+        if ($userDn === false) { 
+            return false; 
+        }
+        
+        // Find the group's dn
+        $groupInfo = $this->info($group, array("cn"));
+        if ($groupInfo[0]["dn"] === NULL) { 
+            return false; 
+        }
+        $groupDn = $groupInfo[0]["dn"];
+        
+        $add = array();
+        $add["member"] = $userDn;
+        
+        $result = @ldap_mod_add($this->adldap->getLdapConnection(), $groupDn, $add);
+        if ($result == false) { 
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Add a contact to a group
+    * 
+    * @param string $group The group to add the contact to
+    * @param string $contactDn The DN of the contact to add
+    * @return bool
+    */
+    public function addContact($group, $contactDn)
+    {
+        // To add a contact we take the contact's DN
+        // and add it using the full DN of the group
+        
+        // Find the group's dn
+        $groupInfo = $this->info($group, array("cn"));
+        if ($groupInfo[0]["dn"] === NULL) { 
+            return false; 
+        }
+        $groupDn = $groupInfo[0]["dn"];
+        
+        $add = array();
+        $add["member"] = $contactDn;
+        
+        $result = @ldap_mod_add($this->adldap->getLdapConnection(), $groupDn, $add);
+        if ($result == false) { 
+            return false; 
+        }
+        return true;
+    }
+
+    /**
+    * Create a group
+    * 
+    * @param array $attributes Default attributes of the group
+    * @return bool
+    */
+    public function create($attributes)
+    {
+        if (!is_array($attributes)){ return "Attributes must be an array"; }
+        if (!array_key_exists("group_name", $attributes)){ return "Missing compulsory field [group_name]"; }
+        if (!array_key_exists("container", $attributes)){ return "Missing compulsory field [container]"; }
+        if (!array_key_exists("description", $attributes)){ return "Missing compulsory field [description]"; }
+        if (!is_array($attributes["container"])){ return "Container attribute must be an array."; }
+        $attributes["container"] = array_reverse($attributes["container"]);
+
+        //$member_array = array();
+        //$member_array[0] = "cn=user1,cn=Users,dc=yourdomain,dc=com";
+        //$member_array[1] = "cn=administrator,cn=Users,dc=yourdomain,dc=com";
+        
+        $add = array();
+        $add["cn"] = $attributes["group_name"];
+        $add["samaccountname"] = $attributes["group_name"];
+        $add["objectClass"] = "Group";
+        $add["description"] = $attributes["description"];
+        //$add["member"] = $member_array; UNTESTED
+
+        $container = "OU=" . implode(",OU=", $attributes["container"]);
+        $result = ldap_add($this->adldap->getLdapConnection(), "CN=" . $add["cn"] . ", " . $container . "," . $this->adldap->getBaseDn(), $add);
+        if ($result != true) { 
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Delete a group account 
+    * 
+    * @param string $group The group to delete (please be careful here!) 
+    * 
+    * @return array 
+    */
+    public function delete($group) {
+        if (!$this->adldap->getLdapBind()){ return false; }
+        if ($group === null){ return "Missing compulsory field [group]"; }
+        
+        $groupInfo = $this->info($group, array("*"));
+        $dn = $groupInfo[0]['distinguishedname'][0]; 
+        $result = $this->adldap->folder()->delete($dn); 
+        if ($result !== true) { 
+            return false; 
+        } return true;   
+    }
+
+    /**
+    * Remove a group from a group
+    * 
+    * @param string $parent The parent group name
+    * @param string $child The child group name
+    * @return bool
+    */
+    public function removeGroup($parent , $child)
+    {
+    
+        // Find the parent dn
+        $parentGroup = $this->info($parent, array("cn"));
+        if ($parentGroup[0]["dn"] === NULL) { 
+            return false; 
+        }
+        $parentDn = $parentGroup[0]["dn"];
+        
+        // Find the child dn
+        $childGroup = $this->info($child, array("cn"));
+        if ($childGroup[0]["dn"] === NULL) { 
+            return false; 
+        }
+        $childDn = $childGroup[0]["dn"];
+        
+        $del = array();
+        $del["member"] = $childDn;
+        
+        $result = @ldap_mod_del($this->adldap->getLdapConnection(), $parentDn, $del);
+        if ($result == false) { 
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Remove a user from a group
+    * 
+    * @param string $group The group to remove a user from
+    * @param string $user The AD user to remove from the group
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function removeUser($group, $user, $isGUID = false)
+    {
+    
+        // Find the parent dn
+        $groupInfo = $this->info($group, array("cn"));
+        if ($groupInfo[0]["dn"] === NULL){ 
+            return false; 
+        }
+        $groupDn = $groupInfo[0]["dn"];
+        
+        // Find the users dn
+        $userDn = $this->adldap->user()->dn($user, $isGUID);
+        if ($userDn === false) {
+            return false; 
+        }
+
+        $del = array();
+        $del["member"] = $userDn;
+        
+        $result = @ldap_mod_del($this->adldap->getLdapConnection(), $groupDn, $del);
+        if ($result == false) {
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Remove a contact from a group
+    * 
+    * @param string $group The group to remove a user from
+    * @param string $contactDn The DN of a contact to remove from the group
+    * @return bool
+    */
+    public function removeContact($group, $contactDn)
+    {
+    
+        // Find the parent dn
+        $groupInfo = $this->info($group, array("cn"));
+        if ($groupInfo[0]["dn"] === NULL) { 
+            return false; 
+        }
+        $groupDn = $groupInfo[0]["dn"];
+    
+        $del = array();
+        $del["member"] = $contactDn;
+        
+        $result = @ldap_mod_del($this->adldap->getLdapConnection(), $groupDn, $del);
+        if ($result == false) { 
+            return false; 
+        }
+        return true;
+    }
+    
+    /**
+    * Return a list of groups in a group
+    * 
+    * @param string $group The group to query
+    * @param bool $recursive Recursively get groups
+    * @return array
+    */
+    public function inGroup($group, $recursive = NULL)
+    {
+        if (!$this->adldap->getLdapBind()){ return false; }
+        if ($recursive === NULL){ $recursive = $this->adldap->getRecursiveGroups(); } // Use the default option if they haven't set it 
+        
+        // Search the directory for the members of a group
+        $info = $this->info($group, array("member","cn"));
+        $groups = $info[0]["member"];
+        if (!is_array($groups)) {
+            return false;   
+        }
+ 
+        $groupArray = array();
+
+        for ($i=0; $i<$groups["count"]; $i++){ 
+             $filter = "(&(objectCategory=group)(distinguishedName=" . $this->adldap->utilities()->ldapSlashes($groups[$i]) . "))";
+             $fields = array("samaccountname", "distinguishedname", "objectClass");
+             $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+             $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+             // not a person, look for a group  
+             if ($entries['count'] == 0 && $recursive == true) {  
+                $filter = "(&(objectCategory=group)(distinguishedName=" . $this->adldap->utilities()->ldapSlashes($groups[$i]) . "))";  
+                $fields = array("distinguishedname");  
+                $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);  
+                $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);  
+                if (!isset($entries[0]['distinguishedname'][0])) {
+                    continue;  
+                }
+                $subGroups = $this->inGroup($entries[0]['distinguishedname'][0], $recursive);  
+                if (is_array($subGroups)) {
+                    $groupArray = array_merge($groupArray, $subGroups); 
+                    $groupArray = array_unique($groupArray);  
+                }
+                continue;  
+             } 
+
+             $groupArray[] = $entries[0]['distinguishedname'][0];
+        }
+        return $groupArray;
+    }
+    
+    /**
+    * Return a list of members in a group
+    * 
+    * @param string $group The group to query
+    * @param bool $recursive Recursively get group members
+    * @return array
+    */
+    public function members($group, $recursive = NULL)
+    {
+        if (!$this->adldap->getLdapBind()){ return false; }
+        if ($recursive === NULL){ $recursive = $this->adldap->getRecursiveGroups(); } // Use the default option if they haven't set it 
+        // Search the directory for the members of a group
+        $info = $this->info($group, array("member","cn"));
+        $users = $info[0]["member"];
+        if (!is_array($users)) {
+            return false;   
+        }
+ 
+        $userArray = array();
+
+        for ($i=0; $i<$users["count"]; $i++){ 
+             $filter = "(&(objectCategory=person)(distinguishedName=" . $this->adldap->utilities()->ldapSlashes($users[$i]) . "))";
+             $fields = array("samaccountname", "distinguishedname", "objectClass");
+             $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+             $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+             // not a person, look for a group  
+             if ($entries['count'] == 0 && $recursive == true) {  
+                $filter = "(&(objectCategory=group)(distinguishedName=" . $this->adldap->utilities()->ldapSlashes($users[$i]) . "))";  
+                $fields = array("samaccountname");  
+                $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);  
+                $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);  
+                if (!isset($entries[0]['samaccountname'][0])) {
+                    continue;  
+                }
+                $subUsers = $this->members($entries[0]['samaccountname'][0], $recursive);  
+                if (is_array($subUsers)) {
+                    $userArray = array_merge($userArray, $subUsers); 
+                    $userArray = array_unique($userArray);  
+                }
+                continue;  
+             } 
+             else if ($entries['count'] == 0) {   
+                continue; 
+             } 
+
+             if ((!isset($entries[0]['samaccountname'][0]) || $entries[0]['samaccountname'][0] === NULL) && $entries[0]['distinguishedname'][0] !== NULL) {
+                 $userArray[] = $entries[0]['distinguishedname'][0];
+             }
+             else if ($entries[0]['samaccountname'][0] !== NULL) {
+                $userArray[] = $entries[0]['samaccountname'][0];
+             }
+        }
+        return $userArray;
+    }
+    
+    /**
+    * Group Information.  Returns an array of raw information about a group.
+    * The group name is case sensitive
+    * 
+    * @param string $groupName The group name to retrieve info about
+    * @param array $fields Fields to retrieve
+    * @return array
+    */
+    public function info($groupName, $fields = NULL)
+    {
+        if ($groupName === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        if (stristr($groupName, '+')) {
+            $groupName = stripslashes($groupName);   
+        }
+        
+        $filter = "(&(objectCategory=group)(name=" . $this->adldap->utilities()->ldapSlashes($groupName) . "))";
+        if ($fields === NULL) { 
+            $fields = array("member","memberof","cn","description","distinguishedname","objectcategory","samaccountname"); 
+        }
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+        return $entries;
+    }
+    
+    /**
+    * Group Information.  Returns an collection
+    * The group name is case sensitive
+    * 
+    * @param string $groupName The group name to retrieve info about
+    * @param array $fields Fields to retrieve
+    * @return adLDAPGroupCollection
+    */
+    public function infoCollection($groupName, $fields = NULL)
+    {
+        if ($groupName === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        $info = $this->info($groupName, $fields);
+        if ($info !== false) {
+            $collection = new adLDAPGroupCollection($info, $this->adldap);
+            return $collection;
+        }
+        return false;
+    }
+    
+    /**
+    * Return a complete list of "groups in groups"
+    * 
+    * @param string $group The group to get the list from
+    * @return array
+    */
+    public function recursiveGroups($group)
+    {
+        if ($group === NULL) { return false; }
+
+        $stack = array(); 
+        $processed = array(); 
+        $retGroups = array(); 
+     
+        array_push($stack, $group); // Initial Group to Start with 
+        while (count($stack) > 0) {
+            $parent = array_pop($stack);
+            array_push($processed, $parent);
+            
+            $info = $this->info($parent, array("memberof"));
+            
+            if (isset($info[0]["memberof"]) && is_array($info[0]["memberof"])) {
+                $groups = $info[0]["memberof"]; 
+                if ($groups) {
+                    $groupNames = $this->adldap->utilities()->niceNames($groups);  
+                    $retGroups = array_merge($retGroups, $groupNames); //final groups to return
+                    foreach ($groupNames as $id => $groupName) { 
+                        if (!in_array($groupName, $processed)) {
+                            array_push($stack, $groupName);
+                        }
+                    }
+                }
+            }
+        }
+        
+        return $retGroups;
+    }
+    
+    /**
+    * Returns a complete list of the groups in AD based on a SAM Account Type  
+    * 
+    * @param string $sAMAaccountType The account type to return
+    * @param bool $includeDescription Whether to return a description
+    * @param string $search Search parameters
+    * @param bool $sorted Whether to sort the results
+    * @return array
+    */
+    public function search($sAMAaccountType = adLDAP::ADLDAP_SECURITY_GLOBAL_GROUP, $includeDescription = false, $search = "*", $sorted = true) {
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        $filter = '(&(objectCategory=group)';
+        if ($sAMAaccountType !== null) {
+            $filter .= '(samaccounttype='. $sAMAaccountType .')';
+        }
+        $filter .= '(cn=' . $search . '))';
+        // Perform the search and grab all their details
+        $fields = array("samaccountname", "description");
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+        $groupsArray = array();        
+        for ($i=0; $i<$entries["count"]; $i++){
+            if ($includeDescription && strlen($entries[$i]["description"][0]) > 0 ) {
+                $groupsArray[$entries[$i]["samaccountname"][0]] = $entries[$i]["description"][0];
+            }
+            else if ($includeDescription){
+                $groupsArray[$entries[$i]["samaccountname"][0]] = $entries[$i]["samaccountname"][0];
+            }
+            else {
+                array_push($groupsArray, $entries[$i]["samaccountname"][0]);
+            }
+        }
+        if ($sorted) { 
+            asort($groupsArray); 
+        }
+        return $groupsArray;
+    }
+    
+    /**
+    * Returns a complete list of all groups in AD
+    * 
+    * @param bool $includeDescription Whether to return a description
+    * @param string $search Search parameters
+    * @param bool $sorted Whether to sort the results
+    * @return array
+    */
+    public function all($includeDescription = false, $search = "*", $sorted = true){
+        $groupsArray = $this->search(null, $includeDescription, $search, $sorted);
+        return $groupsArray;
+    }
+    
+    /**
+    * Returns a complete list of security groups in AD
+    * 
+    * @param bool $includeDescription Whether to return a description
+    * @param string $search Search parameters
+    * @param bool $sorted Whether to sort the results
+    * @return array
+    */
+    public function allSecurity($includeDescription = false, $search = "*", $sorted = true){
+        $groupsArray = $this->search(adLDAP::ADLDAP_SECURITY_GLOBAL_GROUP, $includeDescription, $search, $sorted);
+        return $groupsArray;
+    }
+    
+    /**
+    * Returns a complete list of distribution lists in AD
+    * 
+    * @param bool $includeDescription Whether to return a description
+    * @param string $search Search parameters
+    * @param bool $sorted Whether to sort the results
+    * @return array
+    */
+    public function allDistribution($includeDescription = false, $search = "*", $sorted = true){
+        $groupsArray = $this->search(adLDAP::ADLDAP_DISTRIBUTION_GROUP, $includeDescription, $search, $sorted);
+        return $groupsArray;
+    }
+    
+    /**
+    * Coping with AD not returning the primary group
+    * http://support.microsoft.com/?kbid=321360 
+    * 
+    * This is a re-write based on code submitted by Bruce which prevents the 
+    * need to search each security group to find the true primary group
+    * 
+    * @param string $gid Group ID
+    * @param string $usersid User's Object SID
+    * @return mixed
+    */
+    public function getPrimaryGroup($gid, $usersid)
+    {
+        if ($gid === NULL || $usersid === NULL) { return false; }
+        $sr = false;
+
+        $gsid = substr_replace($usersid, pack('V',$gid), strlen($usersid)-4,4);
+        $filter = '(objectsid=' . $this->adldap->utilities()->getTextSID($gsid).')';
+        $fields = array("samaccountname","distinguishedname");
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+        if (isset($entries[0]['distinguishedname'][0])) {
+            return $entries[0]['distinguishedname'][0];
+        }
+        return false;
+     }
+     
+     /**
+    * Coping with AD not returning the primary group
+    * http://support.microsoft.com/?kbid=321360 
+    * 
+    * For some reason it's not possible to search on primarygrouptoken=XXX
+    * If someone can show otherwise, I'd like to know about it :)
+    * this way is resource intensive and generally a pain in the @#%^
+    * 
+    * @deprecated deprecated since version 3.1, see get get_primary_group
+    * @param string $gid Group ID
+    * @return string
+    */
+    public function cn($gid){    
+        if ($gid === NULL) { return false; }
+        $sr = false;
+        $r = '';
+        
+        $filter = "(&(objectCategory=group)(samaccounttype=" . adLDAP::ADLDAP_SECURITY_GLOBAL_GROUP . "))";
+        $fields = array("primarygrouptoken", "samaccountname", "distinguishedname");
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+        
+        for ($i=0; $i<$entries["count"]; $i++){
+            if ($entries[$i]["primarygrouptoken"][0] == $gid) {
+                $r = $entries[$i]["distinguishedname"][0];
+                $i = $entries["count"];
+            }
+        }
+
+        return $r;
+    }
+}
+?>
diff --git a/lib/plugins/authad/adLDAP/classes/adLDAPUsers.php b/lib/plugins/authad/adLDAP/classes/adLDAPUsers.php
new file mode 100644
index 000000000..96a93b512
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/classes/adLDAPUsers.php
@@ -0,0 +1,682 @@
+adldap = $adldap;
+    }
+    
+    /**
+    * Validate a user's login credentials
+    * 
+    * @param string $username A user's AD username
+    * @param string $password A user's AD password
+    * @param bool optional $prevent_rebind
+    * @return bool
+    */
+    public function authenticate($username, $password, $preventRebind = false) {
+        return $this->adldap->authenticate($username, $password, $preventRebind);
+    }
+    
+    /**
+    * Create a user
+    * 
+    * If you specify a password here, this can only be performed over SSL
+    * 
+    * @param array $attributes The attributes to set to the user account
+    * @return bool
+    */
+    public function create($attributes)
+    {
+        // Check for compulsory fields
+        if (!array_key_exists("username", $attributes)){ return "Missing compulsory field [username]"; }
+        if (!array_key_exists("firstname", $attributes)){ return "Missing compulsory field [firstname]"; }
+        if (!array_key_exists("surname", $attributes)){ return "Missing compulsory field [surname]"; }
+        if (!array_key_exists("email", $attributes)){ return "Missing compulsory field [email]"; }
+        if (!array_key_exists("container", $attributes)){ return "Missing compulsory field [container]"; }
+        if (!is_array($attributes["container"])){ return "Container attribute must be an array."; }
+
+        if (array_key_exists("password",$attributes) && (!$this->adldap->getUseSSL() && !$this->adldap->getUseTLS())){ 
+            throw new adLDAPException('SSL must be configured on your webserver and enabled in the class to set passwords.');
+        }
+
+        if (!array_key_exists("display_name", $attributes)) { 
+            $attributes["display_name"] = $attributes["firstname"] . " " . $attributes["surname"]; 
+        }
+
+        // Translate the schema
+        $add = $this->adldap->adldap_schema($attributes);
+        
+        // Additional stuff only used for adding accounts
+        $add["cn"][0] = $attributes["display_name"];
+        $add["samaccountname"][0] = $attributes["username"];
+        $add["objectclass"][0] = "top";
+        $add["objectclass"][1] = "person";
+        $add["objectclass"][2] = "organizationalPerson";
+        $add["objectclass"][3] = "user"; //person?
+        //$add["name"][0]=$attributes["firstname"]." ".$attributes["surname"];
+
+        // Set the account control attribute
+        $control_options = array("NORMAL_ACCOUNT");
+        if (!$attributes["enabled"]) { 
+            $control_options[] = "ACCOUNTDISABLE"; 
+        }
+        $add["userAccountControl"][0] = $this->accountControl($control_options);
+        
+        // Determine the container
+        $attributes["container"] = array_reverse($attributes["container"]);
+        $container = "OU=" . implode(", OU=",$attributes["container"]);
+
+        // Add the entry
+        $result = @ldap_add($this->adldap->getLdapConnection(), "CN=" . $add["cn"][0] . ", " . $container . "," . $this->adldap->getBaseDn(), $add);
+        if ($result != true) { 
+            return false; 
+        }
+        
+        return true;
+    }
+    
+    /**
+    * Account control options
+    *
+    * @param array $options The options to convert to int 
+    * @return int
+    */
+    protected function accountControl($options)
+    {
+        $val=0;
+
+        if (is_array($options)) {
+            if (in_array("SCRIPT",$options)){ $val=$val+1; }
+            if (in_array("ACCOUNTDISABLE",$options)){ $val=$val+2; }
+            if (in_array("HOMEDIR_REQUIRED",$options)){ $val=$val+8; }
+            if (in_array("LOCKOUT",$options)){ $val=$val+16; }
+            if (in_array("PASSWD_NOTREQD",$options)){ $val=$val+32; }
+            //PASSWD_CANT_CHANGE Note You cannot assign this permission by directly modifying the UserAccountControl attribute.
+            //For information about how to set the permission programmatically, see the "Property flag descriptions" section.
+            if (in_array("ENCRYPTED_TEXT_PWD_ALLOWED",$options)){ $val=$val+128; }
+            if (in_array("TEMP_DUPLICATE_ACCOUNT",$options)){ $val=$val+256; }
+            if (in_array("NORMAL_ACCOUNT",$options)){ $val=$val+512; }
+            if (in_array("INTERDOMAIN_TRUST_ACCOUNT",$options)){ $val=$val+2048; }
+            if (in_array("WORKSTATION_TRUST_ACCOUNT",$options)){ $val=$val+4096; }
+            if (in_array("SERVER_TRUST_ACCOUNT",$options)){ $val=$val+8192; }
+            if (in_array("DONT_EXPIRE_PASSWORD",$options)){ $val=$val+65536; }
+            if (in_array("MNS_LOGON_ACCOUNT",$options)){ $val=$val+131072; }
+            if (in_array("SMARTCARD_REQUIRED",$options)){ $val=$val+262144; }
+            if (in_array("TRUSTED_FOR_DELEGATION",$options)){ $val=$val+524288; }
+            if (in_array("NOT_DELEGATED",$options)){ $val=$val+1048576; }
+            if (in_array("USE_DES_KEY_ONLY",$options)){ $val=$val+2097152; }
+            if (in_array("DONT_REQ_PREAUTH",$options)){ $val=$val+4194304; } 
+            if (in_array("PASSWORD_EXPIRED",$options)){ $val=$val+8388608; }
+            if (in_array("TRUSTED_TO_AUTH_FOR_DELEGATION",$options)){ $val=$val+16777216; }
+        }
+        return $val;
+    }
+    
+    /**
+    * Delete a user account
+    * 
+    * @param string $username The username to delete (please be careful here!)
+    * @param bool $isGUID Is the username a GUID or a samAccountName
+    * @return array
+    */
+    public function delete($username, $isGUID = false) 
+    {      
+        $userinfo = $this->info($username, array("*"), $isGUID);
+        $dn = $userinfo[0]['distinguishedname'][0];
+        $result = $this->adldap->folder()->delete($dn);
+        if ($result != true) { 
+            return false;
+        }        
+        return true;
+    }
+    
+    /**
+    * Groups the user is a member of
+    * 
+    * @param string $username The username to query
+    * @param bool $recursive Recursive list of groups
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return array
+    */
+    public function groups($username, $recursive = NULL, $isGUID = false)
+    {
+        if ($username === NULL) { return false; }
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); } // Use the default option if they haven't set it
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        // Search the directory for their information
+        $info = @$this->info($username, array("memberof", "primarygroupid"), $isGUID);
+        $groups = $this->adldap->utilities()->niceNames($info[0]["memberof"]); // Presuming the entry returned is our guy (unique usernames)
+
+        if ($recursive === true){
+            foreach ($groups as $id => $groupName){
+                $extraGroups = $this->adldap->group()->recursiveGroups($groupName);
+                $groups = array_merge($groups, $extraGroups);
+            }
+        }
+        
+        return $groups;
+    }
+    
+    /**
+    * Find information about the users. Returned in a raw array format from AD
+    * 
+    * @param string $username The username to query
+    * @param array $fields Array of parameters to query
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return array
+    */
+    public function info($username, $fields = NULL, $isGUID = false)
+    {
+        if ($username === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+
+        if ($isGUID === true) {
+            $username = $this->adldap->utilities()->strGuidToHex($username);
+            $filter = "objectguid=" . $username;
+        }
+        else if (strstr($username, "@")) {
+             $filter = "userPrincipalName=" . $username;
+        }
+        else {
+             $filter = "samaccountname=" . $username;
+        }
+        $filter = "(&(objectCategory=person)({$filter}))";
+        if ($fields === NULL) { 
+            $fields = array("samaccountname","mail","memberof","department","displayname","telephonenumber","primarygroupid","objectsid"); 
+        }
+        if (!in_array("objectsid", $fields)) {
+            $fields[] = "objectsid";
+        }
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+        
+        if (isset($entries[0])) {
+            if ($entries[0]['count'] >= 1) {
+                if (in_array("memberof", $fields)) {
+                    // AD does not return the primary group in the ldap query, we may need to fudge it
+                    if ($this->adldap->getRealPrimaryGroup() && isset($entries[0]["primarygroupid"][0]) && isset($entries[0]["objectsid"][0])){
+                        //$entries[0]["memberof"][]=$this->group_cn($entries[0]["primarygroupid"][0]);
+                        $entries[0]["memberof"][] = $this->adldap->group()->getPrimaryGroup($entries[0]["primarygroupid"][0], $entries[0]["objectsid"][0]);
+                    } else {
+                        $entries[0]["memberof"][] = "CN=Domain Users,CN=Users," . $this->adldap->getBaseDn();
+                    }
+                    if (!isset($entries[0]["memberof"]["count"])) {
+                        $entries[0]["memberof"]["count"] = 0;
+                    }
+                    $entries[0]["memberof"]["count"]++;
+                }
+            }
+            
+            return $entries;
+        }
+        return false;
+    }
+    
+    /**
+    * Find information about the users. Returned in a raw array format from AD
+    * 
+    * @param string $username The username to query
+    * @param array $fields Array of parameters to query
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return mixed
+    */
+    public function infoCollection($username, $fields = NULL, $isGUID = false)
+    {
+        if ($username === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        $info = $this->info($username, $fields, $isGUID);
+        
+        if ($info !== false) {
+            $collection = new adLDAPUserCollection($info, $this->adldap);
+            return $collection;
+        }
+        return false;
+    }
+    
+    /**
+    * Determine if a user is in a specific group
+    * 
+    * @param string $username The username to query
+    * @param string $group The name of the group to check against
+    * @param bool $recursive Check groups recursively
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function inGroup($username, $group, $recursive = NULL, $isGUID = false)
+    {
+        if ($username === NULL) { return false; }
+        if ($group === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        if ($recursive === NULL) { $recursive = $this->adldap->getRecursiveGroups(); } // Use the default option if they haven't set it
+        
+        // Get a list of the groups
+        $groups = $this->groups($username, $recursive, $isGUID);
+        
+        // Return true if the specified group is in the group list
+        if (in_array($group, $groups)) { 
+            return true; 
+        }
+
+        return false;
+    }
+    
+    /**
+    * Determine a user's password expiry date
+    * 
+    * @param string $username The username to query
+    * @param book $isGUID Is the username passed a GUID or a samAccountName
+    * @requires bcmath http://www.php.net/manual/en/book.bc.php
+    * @return array
+    */
+    public function passwordExpiry($username, $isGUID = false) 
+    {
+        if ($username === NULL) { return "Missing compulsory field [username]"; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        if (!function_exists('bcmod')) { throw new adLDAPException("Missing function support [bcmod] http://www.php.net/manual/en/book.bc.php"); };
+        
+        $userInfo = $this->info($username, array("pwdlastset", "useraccountcontrol"), $isGUID);
+        $pwdLastSet = $userInfo[0]['pwdlastset'][0];
+        $status = array();
+        
+        if ($userInfo[0]['useraccountcontrol'][0] == '66048') {
+            // Password does not expire
+            return "Does not expire";
+        }
+        if ($pwdLastSet === '0') {
+            // Password has already expired
+            return "Password has expired";
+        }
+        
+         // Password expiry in AD can be calculated from TWO values:
+         //   - User's own pwdLastSet attribute: stores the last time the password was changed
+         //   - Domain's maxPwdAge attribute: how long passwords last in the domain
+         //
+         // Although Microsoft chose to use a different base and unit for time measurements.
+         // This function will convert them to Unix timestamps
+         $sr = ldap_read($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), 'objectclass=*', array('maxPwdAge'));
+         if (!$sr) {
+             return false;
+         }
+         $info = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+         $maxPwdAge = $info[0]['maxpwdage'][0];
+         
+
+         // See MSDN: http://msdn.microsoft.com/en-us/library/ms974598.aspx
+         //
+         // pwdLastSet contains the number of 100 nanosecond intervals since January 1, 1601 (UTC), 
+         // stored in a 64 bit integer. 
+         //
+         // The number of seconds between this date and Unix epoch is 11644473600.
+         //
+         // maxPwdAge is stored as a large integer that represents the number of 100 nanosecond
+         // intervals from the time the password was set before the password expires.
+         //
+         // We also need to scale this to seconds but also this value is a _negative_ quantity!
+         //
+         // If the low 32 bits of maxPwdAge are equal to 0 passwords do not expire
+         //
+         // Unfortunately the maths involved are too big for PHP integers, so I've had to require
+         // BCMath functions to work with arbitrary precision numbers.
+         if (bcmod($maxPwdAge, 4294967296) === '0') {
+            return "Domain does not expire passwords";
+        }
+        
+        // Add maxpwdage and pwdlastset and we get password expiration time in Microsoft's
+        // time units.  Because maxpwd age is negative we need to subtract it.
+        $pwdExpire = bcsub($pwdLastSet, $maxPwdAge);
+    
+        // Convert MS's time to Unix time
+        $status['expiryts'] = bcsub(bcdiv($pwdExpire, '10000000'), '11644473600');
+        $status['expiryformat'] = date('Y-m-d H:i:s', bcsub(bcdiv($pwdExpire, '10000000'), '11644473600'));
+        
+        return $status;
+    }
+    
+    /**
+    * Modify a user
+    * 
+    * @param string $username The username to query
+    * @param array $attributes The attributes to modify.  Note if you set the enabled attribute you must not specify any other attributes
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function modify($username, $attributes, $isGUID = false)
+    {
+        if ($username === NULL) { return "Missing compulsory field [username]"; }
+        if (array_key_exists("password", $attributes) && !$this->adldap->getUseSSL() && !$this->adldap->getUseTLS()) { 
+            throw new adLDAPException('SSL/TLS must be configured on your webserver and enabled in the class to set passwords.');
+        }
+
+        // Find the dn of the user
+        $userDn = $this->dn($username, $isGUID);
+        if ($userDn === false) { 
+            return false; 
+        }
+        
+        // Translate the update to the LDAP schema                
+        $mod = $this->adldap->adldap_schema($attributes);
+        
+        // Check to see if this is an enabled status update
+        if (!$mod && !array_key_exists("enabled", $attributes)){ 
+            return false; 
+        }
+        
+        // Set the account control attribute (only if specified)
+        if (array_key_exists("enabled", $attributes)){
+            if ($attributes["enabled"]){ 
+                $controlOptions = array("NORMAL_ACCOUNT"); 
+            }
+            else { 
+                $controlOptions = array("NORMAL_ACCOUNT", "ACCOUNTDISABLE"); 
+            }
+            $mod["userAccountControl"][0] = $this->accountControl($controlOptions);
+        }
+
+        // Do the update
+        $result = @ldap_modify($this->adldap->getLdapConnection(), $userDn, $mod);
+        if ($result == false) { 
+            return false; 
+        }
+        
+        return true;
+    }
+    
+    /**
+    * Disable a user account
+    * 
+    * @param string $username The username to disable
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function disable($username, $isGUID = false)
+    {
+        if ($username === NULL) { return "Missing compulsory field [username]"; }
+        $attributes = array("enabled" => 0);
+        $result = $this->modify($username, $attributes, $isGUID);
+        if ($result == false) { return false; }
+        
+        return true;
+    }
+    
+    /**
+    * Enable a user account
+    * 
+    * @param string $username The username to enable
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function enable($username, $isGUID = false)
+    {
+        if ($username === NULL) { return "Missing compulsory field [username]"; }
+        $attributes = array("enabled" => 1);
+        $result = $this->modify($username, $attributes, $isGUID);
+        if ($result == false) { return false; }
+        
+        return true;
+    }
+    
+    /**
+    * Set the password of a user - This must be performed over SSL
+    * 
+    * @param string $username The username to modify
+    * @param string $password The new password
+    * @param bool $isGUID Is the username passed a GUID or a samAccountName
+    * @return bool
+    */
+    public function password($username, $password, $isGUID = false)
+    {
+        if ($username === NULL) { return false; }
+        if ($password === NULL) { return false; }
+        if (!$this->adldap->getLdapBind()) { return false; }
+        if (!$this->adldap->getUseSSL() && !$this->adldap->getUseTLS()) { 
+            throw new adLDAPException('SSL must be configured on your webserver and enabled in the class to set passwords.');
+        }
+        
+        $userDn = $this->dn($username, $isGUID);
+        if ($userDn === false) { 
+            return false; 
+        }
+                
+        $add=array();
+        $add["unicodePwd"][0] = $this->encodePassword($password);
+        
+        $result = @ldap_mod_replace($this->adldap->getLdapConnection(), $userDn, $add);
+        if ($result === false){
+            $err = ldap_errno($this->adldap->getLdapConnection());
+            if ($err) {
+                $msg = 'Error ' . $err . ': ' . ldap_err2str($err) . '.';
+                if($err == 53) {
+                    $msg .= ' Your password might not match the password policy.';
+                }
+                throw new adLDAPException($msg);
+            }
+            else {
+                return false;
+            }
+        }
+        
+        return true;
+    }
+    
+    /**
+    * Encode a password for transmission over LDAP
+    *
+    * @param string $password The password to encode
+    * @return string
+    */
+    public function encodePassword($password)
+    {
+        $password="\"".$password."\"";
+        $encoded="";
+        for ($i=0; $i info($username, array("cn"), $isGUID);
+        if ($user[0]["dn"] === NULL) { 
+            return false; 
+        }
+        $userDn = $user[0]["dn"];
+        return $userDn;
+    }
+    
+    /**
+    * Return a list of all users in AD
+    * 
+    * @param bool $includeDescription Return a description of the user
+    * @param string $search Search parameter
+    * @param bool $sorted Sort the user accounts
+    * @return array
+    */
+    public function all($includeDescription = false, $search = "*", $sorted = true)
+    {
+        if (!$this->adldap->getLdapBind()) { return false; }
+        
+        // Perform the search and grab all their details
+        $filter = "(&(objectClass=user)(samaccounttype=" . adLDAP::ADLDAP_NORMAL_ACCOUNT .")(objectCategory=person)(cn=" . $search . "))";
+        $fields = array("samaccountname","displayname");
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+        $usersArray = array();
+        for ($i=0; $i<$entries["count"]; $i++){
+            if ($includeDescription && strlen($entries[$i]["displayname"][0])>0){
+                $usersArray[$entries[$i]["samaccountname"][0]] = $entries[$i]["displayname"][0];
+            } elseif ($includeDescription){
+                $usersArray[$entries[$i]["samaccountname"][0]] = $entries[$i]["samaccountname"][0];
+            } else {
+                array_push($usersArray, $entries[$i]["samaccountname"][0]);
+            }
+        }
+        if ($sorted) { 
+            asort($usersArray); 
+        }
+        return $usersArray;
+    }
+    
+    /**
+    * Converts a username (samAccountName) to a GUID
+    * 
+    * @param string $username The username to query
+    * @return string
+    */
+    public function usernameToGuid($username) 
+    {
+        if (!$this->adldap->getLdapBind()){ return false; }
+        if ($username === null){ return "Missing compulsory field [username]"; }
+        
+        $filter = "samaccountname=" . $username; 
+        $fields = array("objectGUID"); 
+        $sr = @ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields); 
+        if (ldap_count_entries($this->adldap->getLdapConnection(), $sr) > 0) { 
+            $entry = @ldap_first_entry($this->adldap->getLdapConnection(), $sr); 
+            $guid = @ldap_get_values_len($this->adldap->getLdapConnection(), $entry, 'objectGUID'); 
+            $strGUID = $this->adldap->utilities()->binaryToText($guid[0]);          
+            return $strGUID; 
+        }
+        return false; 
+    }
+    
+    /**
+    * Return a list of all users in AD that have a specific value in a field
+    *
+    * @param bool $includeDescription Return a description of the user
+    * @param string $searchField Field to search search for
+    * @param string $searchFilter Value to search for in the specified field
+    * @param bool $sorted Sort the user accounts
+    * @return array
+    */
+    public function find($includeDescription = false, $searchField = false, $searchFilter = false, $sorted = true){
+        if (!$this->adldap->getLdapBind()){ return false; }
+          
+        // Perform the search and grab all their details
+        $searchParams = "";
+        if ($searchField) {
+            $searchParams = "(" . $searchField . "=" . $searchFilter . ")";
+        }                           
+        $filter = "(&(objectClass=user)(samaccounttype=" . adLDAP::ADLDAP_NORMAL_ACCOUNT .")(objectCategory=person)" . $searchParams . ")";
+        $fields = array("samaccountname","displayname");
+        $sr = ldap_search($this->adldap->getLdapConnection(), $this->adldap->getBaseDn(), $filter, $fields);
+        $entries = ldap_get_entries($this->adldap->getLdapConnection(), $sr);
+
+        $usersArray = array();
+        for ($i=0; $i < $entries["count"]; $i++) {
+            if ($includeDescription && strlen($entries[$i]["displayname"][0]) > 0) {
+                $usersArray[$entries[$i]["samaccountname"][0]] = $entries[$i]["displayname"][0];
+            }
+            else if ($includeDescription) {
+                $usersArray[$entries[$i]["samaccountname"][0]] = $entries[$i]["samaccountname"][0];
+            }
+            else {
+                array_push($usersArray, $entries[$i]["samaccountname"][0]);
+            }
+        }
+        if ($sorted){ 
+          asort($usersArray); 
+        }
+        return ($usersArray);
+    }
+    
+    /**
+    * Move a user account to a different OU
+    *
+    * @param string $username The username to move (please be careful here!)
+    * @param array $container The container or containers to move the user to (please be careful here!).
+    * accepts containers in 1. parent 2. child order
+    * @return array
+    */
+    public function move($username, $container) 
+    {
+        if (!$this->adldap->getLdapBind()) { return false; }
+        if ($username === null) { return "Missing compulsory field [username]"; }
+        if ($container === null) { return "Missing compulsory field [container]"; }
+        if (!is_array($container)) { return "Container must be an array"; }
+        
+        $userInfo = $this->info($username, array("*"));
+        $dn = $userInfo[0]['distinguishedname'][0];
+        $newRDn = "cn=" . $username;
+        $container = array_reverse($container);
+        $newContainer = "ou=" . implode(",ou=",$container);
+        $newBaseDn = strtolower($newContainer) . "," . $this->adldap->getBaseDn();
+        $result = @ldap_rename($this->adldap->getLdapConnection(), $dn, $newRDn, $newBaseDn, true);
+        if ($result !== true) {
+            return false;
+        }
+        return true;
+    }
+    
+    /**
+    * Get the last logon time of any user as a Unix timestamp
+    * 
+    * @param string $username
+    * @return long $unixTimestamp
+    */
+    public function getLastLogon($username) {
+        if (!$this->adldap->getLdapBind()) { return false; }
+        if ($username === null) { return "Missing compulsory field [username]"; }
+        $userInfo = $this->info($username, array("lastLogonTimestamp"));
+        $lastLogon = adLDAPUtils::convertWindowsTimeToUnixTime($userInfo[0]['lastLogonTimestamp'][0]);
+        return $lastLogon;
+    }
+    
+}
+?>
diff --git a/lib/plugins/authad/adLDAP/classes/adLDAPUtils.php b/lib/plugins/authad/adLDAP/classes/adLDAPUtils.php
new file mode 100644
index 000000000..f039a4290
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/classes/adLDAPUtils.php
@@ -0,0 +1,264 @@
+adldap = $adldap;
+    }
+    
+    
+    /**
+    * Take an LDAP query and return the nice names, without all the LDAP prefixes (eg. CN, DN)
+    *
+    * @param array $groups
+    * @return array
+    */
+    public function niceNames($groups)
+    {
+
+        $groupArray = array();
+        for ($i=0; $i<$groups["count"]; $i++){ // For each group
+            $line = $groups[$i];
+            
+            if (strlen($line)>0) { 
+                // More presumptions, they're all prefixed with CN=
+                // so we ditch the first three characters and the group
+                // name goes up to the first comma
+                $bits=explode(",", $line);
+                $groupArray[] = substr($bits[0], 3, (strlen($bits[0])-3));
+            }
+        }
+        return $groupArray;    
+    }
+    
+    /**
+    * Escape characters for use in an ldap_create function
+    * 
+    * @param string $str
+    * @return string
+    */
+    public function escapeCharacters($str) {
+        $str = str_replace(",", "\,", $str);
+        return $str;
+    }
+    
+    /**
+    * Escape strings for the use in LDAP filters
+    * 
+    * DEVELOPERS SHOULD BE DOING PROPER FILTERING IF THEY'RE ACCEPTING USER INPUT
+    * Ported from Perl's Net::LDAP::Util escape_filter_value
+    *
+    * @param string $str The string the parse
+    * @author Port by Andreas Gohr 
+    * @return string
+    */
+    public function ldapSlashes($str){
+        return preg_replace('/([\x00-\x1F\*\(\)\\\\])/e',
+                            '"\\\\\".join("",unpack("H2","$1"))',
+                            $str);
+    }
+    
+    /**
+    * Converts a string GUID to a hexdecimal value so it can be queried
+    * 
+    * @param string $strGUID A string representation of a GUID
+    * @return string
+    */
+    public function strGuidToHex($strGUID) 
+    {
+        $strGUID = str_replace('-', '', $strGUID);
+
+        $octet_str = '\\' . substr($strGUID, 6, 2);
+        $octet_str .= '\\' . substr($strGUID, 4, 2);
+        $octet_str .= '\\' . substr($strGUID, 2, 2);
+        $octet_str .= '\\' . substr($strGUID, 0, 2);
+        $octet_str .= '\\' . substr($strGUID, 10, 2);
+        $octet_str .= '\\' . substr($strGUID, 8, 2);
+        $octet_str .= '\\' . substr($strGUID, 14, 2);
+        $octet_str .= '\\' . substr($strGUID, 12, 2);
+        //$octet_str .= '\\' . substr($strGUID, 16, strlen($strGUID));
+        for ($i=16; $i<=(strlen($strGUID)-2); $i++) {
+            if (($i % 2) == 0) {
+                $octet_str .= '\\' . substr($strGUID, $i, 2);
+            }
+        }
+        
+        return $octet_str;
+    }
+    
+    /**
+    * Convert a binary SID to a text SID
+    * 
+    * @param string $binsid A Binary SID
+    * @return string
+    */
+     public function getTextSID($binsid) {
+        $hex_sid = bin2hex($binsid);
+        $rev = hexdec(substr($hex_sid, 0, 2));
+        $subcount = hexdec(substr($hex_sid, 2, 2));
+        $auth = hexdec(substr($hex_sid, 4, 12));
+        $result = "$rev-$auth";
+
+        for ($x=0;$x < $subcount; $x++) {
+            $subauth[$x] =
+                hexdec($this->littleEndian(substr($hex_sid, 16 + ($x * 8), 8)));
+                $result .= "-" . $subauth[$x];
+        }
+
+        // Cheat by tacking on the S-
+        return 'S-' . $result;
+     }
+     
+    /**
+    * Converts a little-endian hex number to one that hexdec() can convert
+    * 
+    * @param string $hex A hex code
+    * @return string
+    */
+     public function littleEndian($hex) 
+     {
+        $result = '';
+        for ($x = strlen($hex) - 2; $x >= 0; $x = $x - 2) {
+            $result .= substr($hex, $x, 2);
+        }
+        return $result;
+     }
+     
+     /**
+    * Converts a binary attribute to a string
+    * 
+    * @param string $bin A binary LDAP attribute
+    * @return string
+    */
+    public function binaryToText($bin) 
+    {
+        $hex_guid = bin2hex($bin); 
+        $hex_guid_to_guid_str = ''; 
+        for($k = 1; $k <= 4; ++$k) { 
+            $hex_guid_to_guid_str .= substr($hex_guid, 8 - 2 * $k, 2); 
+        } 
+        $hex_guid_to_guid_str .= '-'; 
+        for($k = 1; $k <= 2; ++$k) { 
+            $hex_guid_to_guid_str .= substr($hex_guid, 12 - 2 * $k, 2); 
+        } 
+        $hex_guid_to_guid_str .= '-'; 
+        for($k = 1; $k <= 2; ++$k) { 
+            $hex_guid_to_guid_str .= substr($hex_guid, 16 - 2 * $k, 2); 
+        } 
+        $hex_guid_to_guid_str .= '-' . substr($hex_guid, 16, 4); 
+        $hex_guid_to_guid_str .= '-' . substr($hex_guid, 20); 
+        return strtoupper($hex_guid_to_guid_str);   
+    }
+    
+    /**
+    * Converts a binary GUID to a string GUID
+    * 
+    * @param string $binaryGuid The binary GUID attribute to convert
+    * @return string
+    */
+    public function decodeGuid($binaryGuid) 
+    {
+        if ($binaryGuid === null){ return "Missing compulsory field [binaryGuid]"; }
+        
+        $strGUID = $this->binaryToText($binaryGuid);          
+        return $strGUID; 
+    }
+    
+    /**
+    * Convert a boolean value to a string
+    * You should never need to call this yourself
+    *
+    * @param bool $bool Boolean value
+    * @return string
+    */
+    public function boolToStr($bool) 
+    {
+        return ($bool) ? 'TRUE' : 'FALSE';
+    }
+    
+    /**
+    * Convert 8bit characters e.g. accented characters to UTF8 encoded characters
+    */
+    public function encode8Bit(&$item, $key) {
+        $encode = false;
+        if (is_string($item)) {
+            for ($i=0; $i> 7) {
+                    $encode = true;
+                }
+            }
+        }
+        if ($encode === true && $key != 'password') {
+            $item = utf8_encode($item);   
+        }
+    }  
+    
+    /**
+    * Get the current class version number
+    * 
+    * @return string
+    */
+    public function getVersion() {
+        return self::ADLDAP_VERSION;
+    }
+    
+    /**
+    * Round a Windows timestamp down to seconds and remove the seconds between 1601-01-01 and 1970-01-01
+    * 
+    * @param long $windowsTime
+    * @return long $unixTime
+    */
+    public static function convertWindowsTimeToUnixTime($windowsTime) {
+      $unixTime = round($windowsTime / 10000000) - 11644477200; 
+      return $unixTime; 
+    }
+}
+
+?>
\ No newline at end of file
diff --git a/lib/plugins/authad/adLDAP/collections/adLDAPCollection.php b/lib/plugins/authad/adLDAP/collections/adLDAPCollection.php
new file mode 100644
index 000000000..c0a2eb2fa
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/collections/adLDAPCollection.php
@@ -0,0 +1,137 @@
+setInfo($info);   
+        $this->adldap = $adldap;
+    }
+    
+    /**
+    * Set the raw info array from Active Directory
+    * 
+    * @param array $info
+    */
+    public function setInfo(array $info) 
+    {
+        if ($this->info && sizeof($info) >= 1) {
+            unset($this->info);
+        }
+        $this->info = $info;   
+    }
+    
+    /**
+    * Magic get method to retrieve data from the raw array in a formatted way
+    * 
+    * @param string $attribute
+    * @return mixed
+    */
+    public function __get($attribute)
+    {
+        if (isset($this->info[0]) && is_array($this->info[0])) {
+            foreach ($this->info[0] as $keyAttr => $valueAttr) {
+                if (strtolower($keyAttr) == strtolower($attribute)) {
+                    if ($this->info[0][strtolower($attribute)]['count'] == 1) {
+                        return $this->info[0][strtolower($attribute)][0];   
+                    }
+                    else {
+                        $array = array();
+                        foreach ($this->info[0][strtolower($attribute)] as $key => $value) {
+                            if ((string)$key != 'count') {
+                                $array[$key] = $value;
+                            } 
+                        }  
+                        return $array;   
+                    }
+                }   
+            }
+        }
+        else {
+            return NULL;   
+        }
+    }    
+    
+    /**
+    * Magic set method to update an attribute
+    * 
+    * @param string $attribute
+    * @param string $value
+    * @return bool
+    */
+    abstract public function __set($attribute, $value);
+    
+    /** 
+    * Magic isset method to check for the existence of an attribute 
+    * 
+    * @param string $attribute 
+    * @return bool 
+    */ 
+    public function __isset($attribute) {
+        if (isset($this->info[0]) && is_array($this->info[0])) { 
+            foreach ($this->info[0] as $keyAttr => $valueAttr) { 
+                if (strtolower($keyAttr) == strtolower($attribute)) { 
+                    return true; 
+                } 
+            } 
+        } 
+        return false; 
+     } 
+}
+?>
diff --git a/lib/plugins/authad/adLDAP/collections/adLDAPComputerCollection.php b/lib/plugins/authad/adLDAP/collections/adLDAPComputerCollection.php
new file mode 100644
index 000000000..4f11d8f41
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/collections/adLDAPComputerCollection.php
@@ -0,0 +1,46 @@
+
diff --git a/lib/plugins/authad/adLDAP/collections/adLDAPContactCollection.php b/lib/plugins/authad/adLDAP/collections/adLDAPContactCollection.php
new file mode 100644
index 000000000..d42fe6d4c
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/collections/adLDAPContactCollection.php
@@ -0,0 +1,46 @@
+
diff --git a/lib/plugins/authad/adLDAP/collections/adLDAPGroupCollection.php b/lib/plugins/authad/adLDAP/collections/adLDAPGroupCollection.php
new file mode 100644
index 000000000..cff12fc20
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/collections/adLDAPGroupCollection.php
@@ -0,0 +1,46 @@
+
diff --git a/lib/plugins/authad/adLDAP/collections/adLDAPUserCollection.php b/lib/plugins/authad/adLDAP/collections/adLDAPUserCollection.php
new file mode 100644
index 000000000..801d90296
--- /dev/null
+++ b/lib/plugins/authad/adLDAP/collections/adLDAPUserCollection.php
@@ -0,0 +1,46 @@
+
diff --git a/lib/plugins/authad/auth.php b/lib/plugins/authad/auth.php
index e82610327..5c566195e 100644
--- a/lib/plugins/authad/auth.php
+++ b/lib/plugins/authad/auth.php
@@ -2,8 +2,6 @@
 // must be run within Dokuwiki
 if(!defined('DOKU_INC')) die();
 
-require_once(DOKU_INC.'inc/adLDAP.php');
-
 /**
  * Active Directory authentication backend for DokuWiki
  *
@@ -41,7 +39,7 @@ require_once(DOKU_INC.'inc/adLDAP.php');
  * @author  Jan Schumann 
  */
 
-require_once(DOKU_INC.'inc/adLDAP/adLDAP.php');
+require_once(DOKU_PLUGIN.'authad/adLDAP/adLDAP.php');
 
 class auth_plugin_authad extends DokuWiki_Auth_Plugin {
     /**
-- 
cgit v1.2.3


From 46b991a30bc4c7dab4e06bdd3f9a70a34204e005 Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Fri, 9 Nov 2012 14:32:33 +0100
Subject: merge old auth style configs with plugin config

---
 lib/plugins/auth.php | 17 +++++++++++++++++
 1 file changed, 17 insertions(+)

(limited to 'lib')

diff --git a/lib/plugins/auth.php b/lib/plugins/auth.php
index cce2370d9..42dbf1859 100644
--- a/lib/plugins/auth.php
+++ b/lib/plugins/auth.php
@@ -419,4 +419,21 @@ class DokuWiki_Auth_Plugin extends DokuWiki_Plugin {
         global $conf;
         return ($_SESSION[DOKU_COOKIE]['auth']['time'] >= @filemtime($conf['cachedir'].'/sessionpurge'));
     }
+
+    /**
+     * Overrides the standard config loading to integrate old auth module style configs
+     *
+     * @deprecated 2012-11-09
+     */
+    public function loadConfig(){
+        global $conf;
+        $plugin = $this->getPluginName();
+
+        $default = $this->readDefaultSettings();
+        $oldconf = array();
+        if(isset($conf['auth'][$plugin])) $oldconf = (array) $conf['auth'][$plugin];
+
+        $conf['plugin'][$plugin] = array_merge($default, $oldconf, $conf['plugin'][$plugin]);
+        $this->configloaded = true;
+    }
 }
-- 
cgit v1.2.3


From 32fd494aaeb28179d8823354e07c1399e7443c90 Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Fri, 9 Nov 2012 14:54:48 +0100
Subject: authad fixes

* fixes incorrect $this->adldap calls
* makes use of correct plugin config
---
 lib/plugins/authad/auth.php        | 83 ++++++++++++++++++--------------------
 lib/plugins/authad/plugin.info.txt |  4 +-
 2 files changed, 42 insertions(+), 45 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/authad/auth.php b/lib/plugins/authad/auth.php
index 5c566195e..f651d87a1 100644
--- a/lib/plugins/authad/auth.php
+++ b/lib/plugins/authad/auth.php
@@ -2,6 +2,8 @@
 // must be run within Dokuwiki
 if(!defined('DOKU_INC')) die();
 
+require_once(DOKU_PLUGIN.'authad/adLDAP/adLDAP.php');
+
 /**
  * Active Directory authentication backend for DokuWiki
  *
@@ -13,20 +15,20 @@ if(!defined('DOKU_INC')) die();
  *
  *   $conf['authtype']       = 'authad';
  *
- *   $conf['auth']['ad']['account_suffix']     = '@my.domain.org';
- *   $conf['auth']['ad']['base_dn']            = 'DC=my,DC=domain,DC=org';
- *   $conf['auth']['ad']['domain_controllers'] = 'srv1.domain.org,srv2.domain.org';
+ *   $conf['plugin']['authad']['account_suffix']     = '@my.domain.org';
+ *   $conf['plugin']['authad']['base_dn']            = 'DC=my,DC=domain,DC=org';
+ *   $conf['plugin']['authad']['domain_controllers'] = 'srv1.domain.org,srv2.domain.org';
  *
  *   //optional:
- *   $conf['auth']['ad']['sso']                = 1;
- *   $conf['auth']['ad']['ad_username']        = 'root';
- *   $conf['auth']['ad']['ad_password']        = 'pass';
- *   $conf['auth']['ad']['real_primarygroup']  = 1;
- *   $conf['auth']['ad']['use_ssl']            = 1;
- *   $conf['auth']['ad']['use_tls']            = 1;
- *   $conf['auth']['ad']['debug']              = 1;
+ *   $conf['plugin']['authad']['sso']                = 1;
+ *   $conf['plugin']['authad']['ad_username']        = 'root';
+ *   $conf['plugin']['authad']['ad_password']        = 'pass';
+ *   $conf['plugin']['authad']['real_primarygroup']  = 1;
+ *   $conf['plugin']['authad']['use_ssl']            = 1;
+ *   $conf['plugin']['authad']['use_tls']            = 1;
+ *   $conf['plugin']['authad']['debug']              = 1;
  *   // warn user about expiring password this many days in advance:
- *   $conf['auth']['ad']['expirywarn']         = 5;
+ *   $conf['plugin']['authad']['expirywarn']         = 5;
  *
  *   // get additional information to the userinfo array
  *   // add a list of comma separated ldap contact fields.
@@ -38,18 +40,13 @@ if(!defined('DOKU_INC')) die();
  * @author  Andreas Gohr 
  * @author  Jan Schumann 
  */
-
-require_once(DOKU_PLUGIN.'authad/adLDAP/adLDAP.php');
-
 class auth_plugin_authad extends DokuWiki_Auth_Plugin {
-    /**
-     * @var array copy of the auth backend configuration
-     */
-    protected $cnf = array();
+
     /**
      * @var array hold connection data for a specific AD domain
      */
     protected $opts = array();
+
     /**
      * @var array open connections for each AD domain, as adLDAP objects
      */
@@ -76,18 +73,18 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
     public function __construct() {
         parent::__construct();
 
-        global $conf;
-        $this->cnf = $conf['auth']['ad'];
+        // we load the config early to modify it a bit here
+        $this->loadConfig();
 
         // additional information fields
-        if(isset($this->cnf['additional'])) {
-            $this->cnf['additional'] = str_replace(' ', '', $this->cnf['additional']);
-            $this->cnf['additional'] = explode(',', $this->cnf['additional']);
-        } else $this->cnf['additional'] = array();
+        if(isset($this->conf['additional'])) {
+            $this->conf['additional'] = str_replace(' ', '', $this->conf['additional']);
+            $this->conf['additional'] = explode(',', $this->conf['additional']);
+        } else $this->conf['additional'] = array();
 
         // ldap extension is needed
         if(!function_exists('ldap_connect')) {
-            if($this->cnf['debug'])
+            if($this->conf['debug'])
                 msg("AD Auth: PHP LDAP extension not found.", -1);
             $this->success = false;
             return;
@@ -97,7 +94,7 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
         if(!utf8_check($_SERVER['REMOTE_USER'])) {
             $_SERVER['REMOTE_USER'] = utf8_encode($_SERVER['REMOTE_USER']);
         }
-        if($_SERVER['REMOTE_USER'] && $this->cnf['sso']) {
+        if($_SERVER['REMOTE_USER'] && $this->conf['sso']) {
             $_SERVER['REMOTE_USER'] = $this->cleanUser($_SERVER['REMOTE_USER']);
 
             // we need to simulate a login
@@ -127,7 +124,7 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
     public function checkPass($user, $pass) {
         if($_SERVER['REMOTE_USER'] &&
             $_SERVER['REMOTE_USER'] == $user &&
-            $this->cnf['sso']
+            $this->conf['sso']
         ) return true;
 
         $adldap = $this->_adldap($this->_userDomain($user));
@@ -172,11 +169,11 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
         $fields = array('mail', 'displayname', 'samaccountname', 'lastpwd', 'pwdlastset', 'useraccountcontrol');
 
         // add additional fields to read
-        $fields = array_merge($fields, $this->cnf['additional']);
+        $fields = array_merge($fields, $this->conf['additional']);
         $fields = array_unique($fields);
 
         //get info for given user
-        $result = $this->adldap->user()->info($this->_userName($user), $fields);
+        $result = $adldap->user()->info($this->_userName($user), $fields);
         if($result == false){
             return array();
         }
@@ -192,14 +189,14 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
         $info['expires'] = !($result[0]['useraccountcontrol'][0] & 0x10000); //ADS_UF_DONT_EXPIRE_PASSWD
 
         // additional information
-        foreach($this->cnf['additional'] as $field) {
+        foreach($this->conf['additional'] as $field) {
             if(isset($result[0][strtolower($field)])) {
                 $info[$field] = $result[0][strtolower($field)][0];
             }
         }
 
         // handle ActiveDirectory memberOf
-        $info['grps'] = $this->adldap->user()->groups($this->_userName($user),(bool) $this->opts['recursive_groups']);
+        $info['grps'] = $adldap->user()->groups($this->_userName($user),(bool) $this->opts['recursive_groups']);
 
         if(is_array($info['grps'])) {
             foreach($info['grps'] as $ndx => $group) {
@@ -219,14 +216,14 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
         }
 
         // check expiry time
-        if($info['expires'] && $this->cnf['expirywarn']){
-            $timeleft = $this->adldap->user()->passwordExpiry($user); // returns unixtime
+        if($info['expires'] && $this->conf['expirywarn']){
+            $timeleft = $adldap->user()->passwordExpiry($user); // returns unixtime
             $timeleft = round($timeleft/(24*60*60));
             $info['expiresin'] = $timeleft;
 
             // if this is the current user, warn him (once per request only)
             if(($_SERVER['REMOTE_USER'] == $user) &&
-                ($timeleft <= $this->cnf['expirywarn']) &&
+                ($timeleft <= $this->conf['expirywarn']) &&
                 !$this->msgshown
             ) {
                 $msg = sprintf($lang['authpwdexpire'], $timeleft);
@@ -283,7 +280,7 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
         $user   = utf8_strtolower(trim($user));
 
         // is this a known, valid domain? if not discard
-        if(!is_array($this->cnf[$domain])) {
+        if(!is_array($this->conf[$domain])) {
             $domain = '';
         }
 
@@ -316,7 +313,7 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
 
         if($this->users === null) {
             //get info for given user
-            $result = $this->adldap->user()->all();
+            $result = $adldap->user()->all();
             if (!$result) return array();
             $this->users = array_fill_keys($result, false);
         }
@@ -356,9 +353,9 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
         // password changing
         if(isset($changes['pass'])) {
             try {
-                $return = $this->adldap->user()->password($this->_userName($user),$changes['pass']);
+                $return = $adldap->user()->password($this->_userName($user),$changes['pass']);
             } catch (adLDAPException $e) {
-                if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1);
+                if ($this->conf['debug']) msg('AD Auth: '.$e->getMessage(), -1);
                 $return = false;
             }
             if(!$return) msg('AD Auth: failed to change the password. Maybe the password policy was not met?', -1);
@@ -378,9 +375,9 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
         }
         if(count($adchanges)) {
             try {
-                $return = $return & $this->adldap->user()->modify($this->_userName($user),$adchanges);
+                $return = $return & $adldap->user()->modify($this->_userName($user),$adchanges);
             } catch (adLDAPException $e) {
-                if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1);
+                if ($this->conf['debug']) msg('AD Auth: '.$e->getMessage(), -1);
                 $return = false;
             }
         }
@@ -411,7 +408,7 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
             $this->adldap[$domain] = new adLDAP($this->opts);
             return $this->adldap[$domain];
         } catch(adLDAPException $e) {
-            if($this->cnf['debug']) {
+            if($this->conf['debug']) {
                 msg('AD Auth: '.$e->getMessage(), -1);
             }
             $this->success         = false;
@@ -450,12 +447,12 @@ class auth_plugin_authad extends DokuWiki_Auth_Plugin {
      */
     protected function _loadServerConfig($domain) {
         // prepare adLDAP standard configuration
-        $opts = $this->cnf;
+        $opts = $this->conf;
 
         $opts['domain'] = $domain;
 
         // add possible domain specific configuration
-        if($domain && is_array($this->cnf[$domain])) foreach($this->cnf[$domain] as $key => $val) {
+        if($domain && is_array($this->conf[$domain])) foreach($this->conf[$domain] as $key => $val) {
             $opts[$key] = $val;
         }
 
diff --git a/lib/plugins/authad/plugin.info.txt b/lib/plugins/authad/plugin.info.txt
index 598eb848b..f02b5118c 100644
--- a/lib/plugins/authad/plugin.info.txt
+++ b/lib/plugins/authad/plugin.info.txt
@@ -1,7 +1,7 @@
 base   authad
 author Andreas Gohr
 email  andi@splitbrain.org
-date   2012-10-06
-name   active directory auth plugin
+date   2012-11-09
+name   Active Directory auth plugin
 desc   Provides authentication against a Microsoft Active Directory
 url    http://www.dokuwiki.org/plugin:authad
-- 
cgit v1.2.3


From 70e4a085e6a861a12a7b927ba9dfa10d5961f958 Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Fri, 9 Nov 2012 15:36:35 +0100
Subject: fixes for authldap

* makes proper use of plugin config
* adds a few first defaults, but the whole config metadata is still
  missing
* proper PHP5 use and comments
---
 lib/plugins/authldap/auth.php         | 389 +++++++++++++++++++---------------
 lib/plugins/authldap/conf/default.php |   7 +
 2 files changed, 224 insertions(+), 172 deletions(-)
 create mode 100644 lib/plugins/authldap/conf/default.php

(limited to 'lib')

diff --git a/lib/plugins/authldap/auth.php b/lib/plugins/authldap/auth.php
index 93683bc16..6e7bde1f0 100644
--- a/lib/plugins/authldap/auth.php
+++ b/lib/plugins/authldap/auth.php
@@ -11,31 +11,31 @@ if(!defined('DOKU_INC')) die();
  * @author    Jan Schumann 
  */
 class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
-    var $cnf = null;
-    var $con = null;
-    var $bound = 0; // 0: anonymous, 1: user, 2: superuser
+    /* @var resource $con holds the LDAP connection*/
+    protected $con = null;
+
+    /* @var int $bound What type of connection does already exist? */
+    protected $bound = 0; // 0: anonymous, 1: user, 2: superuser
+
+    /* @var array $users User data cache */
+    protected $users = null;
+
+    /* @var array $_pattern User filter pattern */
+    protected $_pattern = null;
 
     /**
      * Constructor
      */
-    function __construct(){
+    public function __construct() {
         parent::__construct();
 
-        global $conf;
-        $this->cnf = $conf['auth']['ldap'];
-
         // ldap extension is needed
         if(!function_exists('ldap_connect')) {
-            if ($this->cnf['debug'])
-                msg("LDAP err: PHP LDAP extension not found.",-1,__LINE__,__FILE__);
+            $this->_debug("LDAP err: PHP LDAP extension not found.", -1, __LINE__, __FILE__);
             $this->success = false;
             return;
         }
 
-        if(empty($this->cnf['groupkey']))   $this->cnf['groupkey']   = 'cn';
-        if(empty($this->cnf['userscope']))  $this->cnf['userscope']  = 'sub';
-        if(empty($this->cnf['groupscope'])) $this->cnf['groupscope'] = 'sub';
-
         // auth_ldap currently just handles authentication, so no
         // capabilities are set
     }
@@ -48,40 +48,45 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
      * to the LDAP server
      *
      * @author  Andreas Gohr 
+     * @param string $user
+     * @param string $pass
      * @return  bool
      */
-    function checkPass($user,$pass){
+    public function checkPass($user, $pass) {
         // reject empty password
         if(empty($pass)) return false;
         if(!$this->_openLDAP()) return false;
 
         // indirect user bind
-        if($this->cnf['binddn'] && $this->cnf['bindpw']){
+        if($this->getConf('binddn') && $this->getConf('bindpw')) {
             // use superuser credentials
-            if(!@ldap_bind($this->con,$this->cnf['binddn'],$this->cnf['bindpw'])){
-                if($this->cnf['debug'])
-                    msg('LDAP bind as superuser: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
+            if(!@ldap_bind($this->con, $this->getConf('binddn'), $this->getConf('bindpw'))) {
+                $this->_debug('LDAP bind as superuser: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                 return false;
             }
             $this->bound = 2;
-        }else if($this->cnf['binddn'] &&
-                 $this->cnf['usertree'] &&
-                 $this->cnf['userfilter']) {
+        } else if($this->getConf('binddn') &&
+            $this->getConf('usertree') &&
+            $this->getConf('userfilter')
+        ) {
             // special bind string
-            $dn = $this->_makeFilter($this->cnf['binddn'],
-                                     array('user'=>$user,'server'=>$this->cnf['server']));
+            $dn = $this->_makeFilter(
+                $this->getConf('binddn'),
+                array('user'=> $user, 'server'=> $this->getConf('server'))
+            );
 
-        }else if(strpos($this->cnf['usertree'], '%{user}')) {
+        } else if(strpos($this->getConf('usertree'), '%{user}')) {
             // direct user bind
-            $dn = $this->_makeFilter($this->cnf['usertree'],
-                                     array('user'=>$user,'server'=>$this->cnf['server']));
+            $dn = $this->_makeFilter(
+                $this->getConf('usertree'),
+                array('user'=> $user, 'server'=> $this->getConf('server'))
+            );
 
-        }else{
+        } else {
             // Anonymous bind
-            if(!@ldap_bind($this->con)){
-                msg("LDAP: can not bind anonymously",-1);
-                if($this->cnf['debug'])
-                    msg('LDAP anonymous bind: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
+            if(!@ldap_bind($this->con)) {
+                msg("LDAP: can not bind anonymously", -1);
+                $this->_debug('LDAP anonymous bind: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                 return false;
             }
         }
@@ -89,18 +94,16 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
         // Try to bind to with the dn if we have one.
         if(!empty($dn)) {
             // User/Password bind
-            if(!@ldap_bind($this->con,$dn,$pass)){
-                if($this->cnf['debug']){
-                    msg("LDAP: bind with $dn failed", -1,__LINE__,__FILE__);
-                    msg('LDAP user dn bind: '.htmlspecialchars(ldap_error($this->con)),0);
-                }
+            if(!@ldap_bind($this->con, $dn, $pass)) {
+                $this->_debug("LDAP: bind with $dn failed", -1, __LINE__, __FILE__);
+                $this->_debug('LDAP user dn bind: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                 return false;
             }
             $this->bound = 1;
             return true;
-        }else{
+        } else {
             // See if we can find the user
-            $info = $this->getUserData($user,true);
+            $info = $this->getUserData($user, true);
             if(empty($info['dn'])) {
                 return false;
             } else {
@@ -108,18 +111,14 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
             }
 
             // Try to bind with the dn provided
-            if(!@ldap_bind($this->con,$dn,$pass)){
-                if($this->cnf['debug']){
-                    msg("LDAP: bind with $dn failed", -1,__LINE__,__FILE__);
-                    msg('LDAP user bind: '.htmlspecialchars(ldap_error($this->con)),0);
-                }
+            if(!@ldap_bind($this->con, $dn, $pass)) {
+                $this->_debug("LDAP: bind with $dn failed", -1, __LINE__, __FILE__);
+                $this->_debug('LDAP user bind: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                 return false;
             }
             $this->bound = 1;
             return true;
         }
-
-        return false;
     }
 
     /**
@@ -144,52 +143,52 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
      * @author  Dan Allen 
      * @author  
      * @author  Stephane Chazelas 
+     *
+     * @param   string $user
+     * @param   bool   $inbind authldap specific, true if in bind phase
      * @return  array containing user data or false
      */
-    function getUserData($user,$inbind=false) {
+    public function getUserData($user, $inbind = false) {
         global $conf;
         if(!$this->_openLDAP()) return false;
 
         // force superuser bind if wanted and not bound as superuser yet
-        if($this->cnf['binddn'] && $this->cnf['bindpw'] && $this->bound < 2){
+        if($this->getConf('binddn') && $this->getConf('bindpw') && $this->bound < 2) {
             // use superuser credentials
-            if(!@ldap_bind($this->con,$this->cnf['binddn'],$this->cnf['bindpw'])){
-                if($this->cnf['debug'])
-                    msg('LDAP bind as superuser: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
+            if(!@ldap_bind($this->con, $this->getConf('binddn'), $this->getConf('bindpw'))) {
+                $this->_debug('LDAP bind as superuser: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                 return false;
             }
             $this->bound = 2;
-        }elseif($this->bound == 0 && !$inbind) {
+        } elseif($this->bound == 0 && !$inbind) {
             // in some cases getUserData is called outside the authentication workflow
             // eg. for sending email notification on subscribed pages. This data might not
             // be accessible anonymously, so we try to rebind the current user here
-            list($loginuser,$loginsticky,$loginpass) = auth_getCookie();
-            if($loginuser && $loginpass){
+            list($loginuser, $loginsticky, $loginpass) = auth_getCookie();
+            if($loginuser && $loginpass) {
                 $loginpass = PMA_blowfish_decrypt($loginpass, auth_cookiesalt(!$loginsticky));
                 $this->checkPass($loginuser, $loginpass);
             }
         }
 
         $info['user']   = $user;
-        $info['server'] = $this->cnf['server'];
+        $info['server'] = $this->getConf('server');
 
         //get info for given user
-        $base = $this->_makeFilter($this->cnf['usertree'], $info);
-        if(!empty($this->cnf['userfilter'])) {
-            $filter = $this->_makeFilter($this->cnf['userfilter'], $info);
+        $base = $this->_makeFilter($this->getConf('usertree'), $info);
+        if($this->getConf('userfilter')) {
+            $filter = $this->_makeFilter($this->getConf('userfilter'), $info);
         } else {
             $filter = "(ObjectClass=*)";
         }
 
-        $sr     = $this->_ldapsearch($this->con, $base, $filter, $this->cnf['userscope']);
+        $sr     = $this->_ldapsearch($this->con, $base, $filter, $this->getConf('userscope'));
         $result = @ldap_get_entries($this->con, $sr);
-        if($this->cnf['debug']){
-            msg('LDAP user search: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
-            msg('LDAP search at: '.htmlspecialchars($base.' '.$filter),0,__LINE__,__FILE__);
-        }
+        $this->_debug('LDAP user search: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
+        $this->_debug('LDAP search at: '.htmlspecialchars($base.' '.$filter), 0, __LINE__, __FILE__);
 
         // Don't accept more or less than one response
-        if(!is_array($result) || $result['count'] != 1){
+        if(!is_array($result) || $result['count'] != 1) {
             return false; //user not found
         }
 
@@ -204,13 +203,13 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
         $info['grps'] = array();
 
         // overwrite if other attribs are specified.
-        if(is_array($this->cnf['mapping'])){
-            foreach($this->cnf['mapping'] as $localkey => $key) {
+        if(is_array($this->getConf('mapping'))) {
+            foreach($this->getConf('mapping') as $localkey => $key) {
                 if(is_array($key)) {
                     // use regexp to clean up user_result
                     list($key, $regexp) = each($key);
-                    if($user_result[$key]) foreach($user_result[$key] as $grp){
-                        if (preg_match($regexp,$grp,$match)) {
+                    if($user_result[$key]) foreach($user_result[$key] as $grp) {
+                        if(preg_match($regexp, $grp, $match)) {
                             if($localkey == 'grps') {
                                 $info[$localkey][] = $match[1];
                             } else {
@@ -223,35 +222,33 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
                 }
             }
         }
-        $user_result = array_merge($info,$user_result);
+        $user_result = array_merge($info, $user_result);
 
         //get groups for given user if grouptree is given
-        if ($this->cnf['grouptree'] || $this->cnf['groupfilter']) {
-            $base   = $this->_makeFilter($this->cnf['grouptree'], $user_result);
-            $filter = $this->_makeFilter($this->cnf['groupfilter'], $user_result);
-            $sr = $this->_ldapsearch($this->con, $base, $filter, $this->cnf['groupscope'], array($this->cnf['groupkey']));
-            if($this->cnf['debug']){
-                msg('LDAP group search: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
-                msg('LDAP search at: '.htmlspecialchars($base.' '.$filter),0,__LINE__,__FILE__);
-            }
-            if(!$sr){
-                msg("LDAP: Reading group memberships failed",-1);
+        if($this->getConf('grouptree') || $this->getConf('groupfilter')) {
+            $base   = $this->_makeFilter($this->getConf('grouptree'), $user_result);
+            $filter = $this->_makeFilter($this->getConf('groupfilter'), $user_result);
+            $sr     = $this->_ldapsearch($this->con, $base, $filter, $this->getConf('groupscope'), array($this->getConf('groupkey')));
+            $this->_debug('LDAP group search: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
+            $this->_debug('LDAP search at: '.htmlspecialchars($base.' '.$filter), 0, __LINE__, __FILE__);
+
+            if(!$sr) {
+                msg("LDAP: Reading group memberships failed", -1);
                 return false;
             }
             $result = ldap_get_entries($this->con, $sr);
             ldap_free_result($sr);
 
-            if(is_array($result)) foreach($result as $grp){
-                if(!empty($grp[$this->cnf['groupkey']][0])){
-                    if($this->cnf['debug'])
-                        msg('LDAP usergroup: '.htmlspecialchars($grp[$this->cnf['groupkey']][0]),0,__LINE__,__FILE__);
-                    $info['grps'][] = $grp[$this->cnf['groupkey']][0];
+            if(is_array($result)) foreach($result as $grp) {
+                if(!empty($grp[$this->getConf('groupkey')][0])) {
+                    $this->_debug('LDAP usergroup: '.htmlspecialchars($grp[$this->getConf('groupkey')][0]), 0, __LINE__, __FILE__);
+                    $info['grps'][] = $grp[$this->getConf('groupkey')][0];
                 }
             }
         }
 
         // always add the default group to the list of groups
-        if(!in_array($conf['defaultgroup'],$info['grps'])){
+        if(!in_array($conf['defaultgroup'], $info['grps'])) {
             $info['grps'][] = $conf['defaultgroup'];
         }
         return $info;
@@ -259,8 +256,10 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
 
     /**
      * Most values in LDAP are case-insensitive
+     *
+     * @return bool
      */
-    function isCaseSensitive(){
+    public function isCaseSensitive() {
         return false;
     }
 
@@ -268,47 +267,47 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
      * Bulk retrieval of user data
      *
      * @author  Dominik Eckelmann 
-     * @param   start     index of first user to be returned
-     * @param   limit     max number of users to be returned
-     * @param   filter    array of field/pattern pairs, null for no filter
+     * @param   int   $start     index of first user to be returned
+     * @param   int   $limit     max number of users to be returned
+     * @param   array $filter  array of field/pattern pairs, null for no filter
      * @return  array of userinfo (refer getUserData for internal userinfo details)
      */
-    function retrieveUsers($start=0,$limit=-1,$filter=array()) {
+    function retrieveUsers($start = 0, $limit = -1, $filter = array()) {
         if(!$this->_openLDAP()) return false;
 
-        if (!isset($this->users)) {
+        if(is_null($this->users)) {
             // Perform the search and grab all their details
-            if(!empty($this->cnf['userfilter'])) {
-                $all_filter = str_replace('%{user}', '*', $this->cnf['userfilter']);
+            if($this->getConf('userfilter')) {
+                $all_filter = str_replace('%{user}', '*', $this->getConf('userfilter'));
             } else {
                 $all_filter = "(ObjectClass=*)";
             }
-            $sr=ldap_search($this->con,$this->cnf['usertree'],$all_filter);
-            $entries = ldap_get_entries($this->con, $sr);
+            $sr          = ldap_search($this->con, $this->getConf('usertree'), $all_filter);
+            $entries     = ldap_get_entries($this->con, $sr);
             $users_array = array();
-            for ($i=0; $i<$entries["count"]; $i++){
+            for($i = 0; $i < $entries["count"]; $i++) {
                 array_push($users_array, $entries[$i]["uid"][0]);
             }
             asort($users_array);
             $result = $users_array;
-            if (!$result) return array();
+            if(!$result) return array();
             $this->users = array_fill_keys($result, false);
         }
-        $i = 0;
+        $i     = 0;
         $count = 0;
         $this->_constructPattern($filter);
         $result = array();
 
-        foreach ($this->users as $user => &$info) {
-            if ($i++ < $start) {
+        foreach($this->users as $user => &$info) {
+            if($i++ < $start) {
                 continue;
             }
-            if ($info === false) {
+            if($info === false) {
                 $info = $this->getUserData($user);
             }
-            if ($this->_filter($user, $info)) {
+            if($this->_filter($user, $info)) {
                 $result[$user] = $info;
-                if (($limit >= 0) && (++$count >= $limit)) break;
+                if(($limit >= 0) && (++$count >= $limit)) break;
             }
         }
         return $result;
@@ -320,50 +319,61 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
      * Used by auth_getUserData to make the filter
      * strings for grouptree and groupfilter
      *
-     * filter      string  ldap search filter with placeholders
-     * placeholders array   array with the placeholders
-     *
      * @author  Troels Liebe Bentsen 
+     * @param   string $filter ldap search filter with placeholders
+     * @param   array  $placeholders placeholders to fill in
      * @return  string
      */
-    function _makeFilter($filter, $placeholders) {
+    protected function _makeFilter($filter, $placeholders) {
         preg_match_all("/%{([^}]+)/", $filter, $matches, PREG_PATTERN_ORDER);
         //replace each match
-        foreach ($matches[1] as $match) {
+        foreach($matches[1] as $match) {
             //take first element if array
             if(is_array($placeholders[$match])) {
                 $value = $placeholders[$match][0];
             } else {
                 $value = $placeholders[$match];
             }
-            $value = $this->_filterEscape($value);
+            $value  = $this->_filterEscape($value);
             $filter = str_replace('%{'.$match.'}', $value, $filter);
         }
         return $filter;
     }
 
     /**
-     * return 1 if $user + $info match $filter criteria, 0 otherwise
+     * return true if $user + $info match $filter criteria, false otherwise
+     *
+     * @author Chris Smith 
      *
-     * @author   Chris Smith 
+     * @param  string $user the user's login name
+     * @param  array  $info the user's userinfo array
+     * @return bool
      */
-    function _filter($user, $info) {
-        foreach ($this->_pattern as $item => $pattern) {
-            if ($item == 'user') {
-                if (!preg_match($pattern, $user)) return 0;
-            } else if ($item == 'grps') {
-                if (!count(preg_grep($pattern, $info['grps']))) return 0;
+    protected  function _filter($user, $info) {
+        foreach($this->_pattern as $item => $pattern) {
+            if($item == 'user') {
+                if(!preg_match($pattern, $user)) return false;
+            } else if($item == 'grps') {
+                if(!count(preg_grep($pattern, $info['grps']))) return false;
             } else {
-                if (!preg_match($pattern, $info[$item])) return 0;
+                if(!preg_match($pattern, $info[$item])) return false;
             }
         }
-        return 1;
+        return true;
     }
 
-    function _constructPattern($filter) {
+    /**
+     * Set the filter pattern
+     *
+     * @author Chris Smith 
+     *
+     * @param $filter
+     * @return void
+     */
+    protected function _constructPattern($filter) {
         $this->_pattern = array();
-        foreach ($filter as $item => $pattern) {
-            $this->_pattern[$item] = '/'.str_replace('/','\/',$pattern).'/i';    // allow regex characters
+        foreach($filter as $item => $pattern) {
+            $this->_pattern[$item] = '/'.str_replace('/', '\/', $pattern).'/i'; // allow regex characters
         }
     }
 
@@ -373,11 +383,15 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
      * Ported from Perl's Net::LDAP::Util escape_filter_value
      *
      * @author Andreas Gohr
+     * @param  string $string
+     * @return string
      */
-    function _filterEscape($string){
-        return preg_replace('/([\x00-\x1F\*\(\)\\\\])/e',
-                            '"\\\\\".join("",unpack("H2","$1"))',
-                            $string);
+    protected function _filterEscape($string) {
+        return preg_replace(
+            '/([\x00-\x1F\*\(\)\\\\])/e',
+            '"\\\\\".join("",unpack("H2","$1"))',
+            $string
+        );
     }
 
     /**
@@ -386,18 +400,18 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
      *
      * @author  Andreas Gohr 
      */
-    function _openLDAP(){
+    protected function _openLDAP() {
         if($this->con) return true; // connection already established
 
         $this->bound = 0;
 
-        $port = ($this->cnf['port']) ? $this->cnf['port'] : 389;
-        $bound = false;
-        $servers = explode(',', $this->cnf['server']);
-        foreach ($servers as $server) {
-            $server = trim($server);
+        $port    = $this->getConf('port');
+        $bound   = false;
+        $servers = explode(',', $this->getConf('server'));
+        foreach($servers as $server) {
+            $server    = trim($server);
             $this->con = @ldap_connect($server, $port);
-            if (!$this->con) {
+            if(!$this->con) {
                 continue;
             }
 
@@ -410,80 +424,111 @@ class auth_plugin_authldap extends DokuWiki_Auth_Plugin {
              */
 
             //set protocol version and dependend options
-            if($this->cnf['version']){
-                if(!@ldap_set_option($this->con, LDAP_OPT_PROTOCOL_VERSION,
-                                     $this->cnf['version'])){
-                    msg('Setting LDAP Protocol version '.$this->cnf['version'].' failed',-1);
-                    if($this->cnf['debug'])
-                        msg('LDAP version set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
-                }else{
+            if($this->getConf('version')) {
+                if(!@ldap_set_option(
+                    $this->con, LDAP_OPT_PROTOCOL_VERSION,
+                    $this->getConf('version')
+                )
+                ) {
+                    msg('Setting LDAP Protocol version '.$this->getConf('version').' failed', -1);
+                    $this->_debug('LDAP version set: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
+                } else {
                     //use TLS (needs version 3)
-                    if($this->cnf['starttls']) {
-                        if (!@ldap_start_tls($this->con)){
-                            msg('Starting TLS failed',-1);
-                            if($this->cnf['debug'])
-                                msg('LDAP TLS set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
+                    if($this->getConf('starttls')) {
+                        if(!@ldap_start_tls($this->con)) {
+                            msg('Starting TLS failed', -1);
+                            $this->_debug('LDAP TLS set: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                         }
                     }
                     // needs version 3
-                    if(isset($this->cnf['referrals'])) {
-                        if(!@ldap_set_option($this->con, LDAP_OPT_REFERRALS,
-                           $this->cnf['referrals'])){
-                            msg('Setting LDAP referrals to off failed',-1);
-                            if($this->cnf['debug'])
-                                msg('LDAP referal set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
+                    if($this->getConf('referrals')) {
+                        if(!@ldap_set_option(
+                            $this->con, LDAP_OPT_REFERRALS,
+                            $this->getConf('referrals')
+                        )
+                        ) {
+                            msg('Setting LDAP referrals to off failed', -1);
+                            $this->_debug('LDAP referal set: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                         }
                     }
                 }
             }
 
             //set deref mode
-            if($this->cnf['deref']){
-                if(!@ldap_set_option($this->con, LDAP_OPT_DEREF, $this->cnf['deref'])){
-                    msg('Setting LDAP Deref mode '.$this->cnf['deref'].' failed',-1);
-                    if($this->cnf['debug'])
-                        msg('LDAP deref set: '.htmlspecialchars(ldap_error($this->con)),0,__LINE__,__FILE__);
+            if($this->getConf('deref')) {
+                if(!@ldap_set_option($this->con, LDAP_OPT_DEREF, $this->getConf('deref'))) {
+                    msg('Setting LDAP Deref mode '.$this->getConf('deref').' failed', -1);
+                    $this->_debug('LDAP deref set: '.htmlspecialchars(ldap_error($this->con)), 0, __LINE__, __FILE__);
                 }
             }
             /* As of PHP 5.3.0 we can set timeout to speedup skipping of invalid servers */
-            if (defined('LDAP_OPT_NETWORK_TIMEOUT')) {
+            if(defined('LDAP_OPT_NETWORK_TIMEOUT')) {
                 ldap_set_option($this->con, LDAP_OPT_NETWORK_TIMEOUT, 1);
             }
             $bound = @ldap_bind($this->con);
-            if ($bound) {
+            if($bound) {
                 break;
             }
         }
 
         if(!$bound) {
-            msg("LDAP: couldn't connect to LDAP server",-1);
+            msg("LDAP: couldn't connect to LDAP server", -1);
             return false;
         }
 
-
-        $this->canDo['getUsers'] = true;
+        $this->cando['getUsers'] = true;
         return true;
     }
 
     /**
      * Wraps around ldap_search, ldap_list or ldap_read depending on $scope
      *
-     * @param  $scope string - can be 'base', 'one' or 'sub'
      * @author Andreas Gohr 
+     * @param resource $link_identifier
+     * @param string   $base_dn
+     * @param string   $filter
+     * @param string   $scope can be 'base', 'one' or 'sub'
+     * @param null     $attributes
+     * @param int      $attrsonly
+     * @param int      $sizelimit
+     * @param int      $timelimit
+     * @param int      $deref
+     * @return resource
      */
-    function _ldapsearch($link_identifier, $base_dn, $filter, $scope='sub', $attributes=null,
-                         $attrsonly=0, $sizelimit=0, $timelimit=0, $deref=LDAP_DEREF_NEVER){
+    protected function _ldapsearch($link_identifier, $base_dn, $filter, $scope = 'sub', $attributes = null,
+                         $attrsonly = 0, $sizelimit = 0, $timelimit = 0, $deref = LDAP_DEREF_NEVER) {
         if(is_null($attributes)) $attributes = array();
 
-        if($scope == 'base'){
-            return @ldap_read($link_identifier, $base_dn, $filter, $attributes,
-                             $attrsonly, $sizelimit, $timelimit, $deref);
-        }elseif($scope == 'one'){
-            return @ldap_list($link_identifier, $base_dn, $filter, $attributes,
-                             $attrsonly, $sizelimit, $timelimit, $deref);
-        }else{
-            return @ldap_search($link_identifier, $base_dn, $filter, $attributes,
-                                $attrsonly, $sizelimit, $timelimit, $deref);
+        if($scope == 'base') {
+            return @ldap_read(
+                $link_identifier, $base_dn, $filter, $attributes,
+                $attrsonly, $sizelimit, $timelimit, $deref
+            );
+        } elseif($scope == 'one') {
+            return @ldap_list(
+                $link_identifier, $base_dn, $filter, $attributes,
+                $attrsonly, $sizelimit, $timelimit, $deref
+            );
+        } else {
+            return @ldap_search(
+                $link_identifier, $base_dn, $filter, $attributes,
+                $attrsonly, $sizelimit, $timelimit, $deref
+            );
         }
     }
+
+    /**
+     * Wrapper around msg() but outputs only when debug is enabled
+     *
+     * @param string $message
+     * @param int    $err
+     * @param int    $line
+     * @param string $file
+     * @return void
+     */
+    protected function _debug($message, $err, $line, $file) {
+        if(!$this->getConf('debug')) return;
+        msg($message, $err, $line, $file);
+    }
+
 }
diff --git a/lib/plugins/authldap/conf/default.php b/lib/plugins/authldap/conf/default.php
new file mode 100644
index 000000000..35971d41d
--- /dev/null
+++ b/lib/plugins/authldap/conf/default.php
@@ -0,0 +1,7 @@
+
Date: Fri, 9 Nov 2012 16:31:57 +0100
Subject: authmysql fixes

* use proper plugin config
* code/PHP5 cleanup
---
 lib/plugins/authmysql/auth.php         | 732 +++++++++++++++++----------------
 lib/plugins/authmysql/conf/default.php |   3 +
 2 files changed, 375 insertions(+), 360 deletions(-)
 create mode 100644 lib/plugins/authmysql/conf/default.php

(limited to 'lib')

diff --git a/lib/plugins/authmysql/auth.php b/lib/plugins/authmysql/auth.php
index 368bd74a2..7d303726b 100644
--- a/lib/plugins/authmysql/auth.php
+++ b/lib/plugins/authmysql/auth.php
@@ -3,7 +3,7 @@
 if(!defined('DOKU_INC')) die();
 
 /**
- * MySQLP authentication backend
+ * MySQL authentication backend
  *
  * @license    GPL 2 (http://www.gnu.org/licenses/gpl.html)
  * @author     Andreas Gohr 
@@ -12,12 +12,14 @@ if(!defined('DOKU_INC')) die();
  * @author     Jan Schumann 
  */
 class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
-    var $dbcon        = 0;
-    var $dbver        = 0;    // database version
-    var $dbrev        = 0;    // database revision
-    var $dbsub        = 0;    // database subrevision
-    var $cnf          = null;
-    var $defaultgroup = "";
+    /** @var resource holds the database connection */
+    protected $dbcon = 0;
+    /** @var int database version*/
+    protected $dbver = 0;
+    /** @var int database revision */
+    protected $dbrev = 0;
+    /** @var int database subrevision */
+    protected $dbsub = 0;
 
     /**
      * Constructor
@@ -27,92 +29,93 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * @author Matthias Grimm 
      */
-    function __construct() {
+    public function __construct() {
         parent::__construct();
 
-        global $conf;
-        $this->cnf = $conf['auth']['mysql'];
-
-        if (method_exists($this, 'auth_basic')){
-            parent::__construct();
-        }
-
         if(!function_exists('mysql_connect')) {
-            if ($this->cnf['debug']){
-                msg("MySQL err: PHP MySQL extension not found.",-1,__LINE__,__FILE__);
-            }
+            $this->_debug("MySQL err: PHP MySQL extension not found.", -1, __LINE__, __FILE__);
             $this->success = false;
             return;
         }
 
-        // default to UTF-8, you rarely want something else
-        if(!isset($this->cnf['charset'])) $this->cnf['charset'] = 'utf8';
-
-        $this->defaultgroup = $conf['defaultgroup'];
-
         // set capabilities based upon config strings set
-        if (empty($this->cnf['server']) || empty($this->cnf['user']) ||
-            !isset($this->cnf['password']) || empty($this->cnf['database'])){
+        if(!$this->getConf('server') || !$this->getConf('user') || !$this->getConf('database')) {
+            $this->_debug("MySQL err: insufficient configuration.", -1, __LINE__, __FILE__);
 
-            if ($this->cnf['debug']){
-                msg("MySQL err: insufficient configuration.",-1,__LINE__,__FILE__);
-            }
             $this->success = false;
             return;
         }
 
-        $this->cando['addUser']      = $this->_chkcnf(array(
-                                            'getUserInfo',
-                                            'getGroups',
-                                            'addUser',
-                                            'getUserID',
-                                            'getGroupID',
-                                            'addGroup',
-                                            'addUserGroup'),true);
-        $this->cando['delUser']      = $this->_chkcnf(array(
-                                            'getUserID',
-                                            'delUser',
-                                            'delUserRefs'),true);
-        $this->cando['modLogin']     = $this->_chkcnf(array(
-                                            'getUserID',
-                                            'updateUser',
-                                            'UpdateTarget'),true);
-        $this->cando['modPass']      = $this->cando['modLogin'];
-        $this->cando['modName']      = $this->cando['modLogin'];
-        $this->cando['modMail']      = $this->cando['modLogin'];
-        $this->cando['modGroups']    = $this->_chkcnf(array(
-                                            'getUserID',
-                                            'getGroups',
-                                            'getGroupID',
-                                            'addGroup',
-                                            'addUserGroup',
-                                            'delGroup',
-                                            'getGroupID',
-                                            'delUserGroup'),true);
+        $this->cando['addUser']   = $this->_chkcnf(
+            array(
+                 'getUserInfo',
+                 'getGroups',
+                 'addUser',
+                 'getUserID',
+                 'getGroupID',
+                 'addGroup',
+                 'addUserGroup'
+            ), true
+        );
+        $this->cando['delUser']   = $this->_chkcnf(
+            array(
+                 'getUserID',
+                 'delUser',
+                 'delUserRefs'
+            ), true
+        );
+        $this->cando['modLogin']  = $this->_chkcnf(
+            array(
+                 'getUserID',
+                 'updateUser',
+                 'UpdateTarget'
+            ), true
+        );
+        $this->cando['modPass']   = $this->cando['modLogin'];
+        $this->cando['modName']   = $this->cando['modLogin'];
+        $this->cando['modMail']   = $this->cando['modLogin'];
+        $this->cando['modGroups'] = $this->_chkcnf(
+            array(
+                 'getUserID',
+                 'getGroups',
+                 'getGroupID',
+                 'addGroup',
+                 'addUserGroup',
+                 'delGroup',
+                 'getGroupID',
+                 'delUserGroup'
+            ), true
+        );
         /* getGroups is not yet supported
            $this->cando['getGroups']    = $this->_chkcnf(array('getGroups',
            'getGroupID'),false); */
-        $this->cando['getUsers']     = $this->_chkcnf(array(
-                                            'getUsers',
-                                            'getUserInfo',
-                                            'getGroups'),false);
-        $this->cando['getUserCount'] = $this->_chkcnf(array('getUsers'),false);
+        $this->cando['getUsers']     = $this->_chkcnf(
+            array(
+                 'getUsers',
+                 'getUserInfo',
+                 'getGroups'
+            ), false
+        );
+        $this->cando['getUserCount'] = $this->_chkcnf(array('getUsers'), false);
     }
 
     /**
      * Check if the given config strings are set
      *
      * @author  Matthias Grimm 
+     * @param   array $keys
+     * @param   bool  $wop is this a check for a write operation?
      * @return  bool
      */
-    function _chkcnf($keys, $wop=false){
-        foreach ($keys as $key){
-            if (empty($this->cnf[$key])) return false;
+    protected function _chkcnf($keys, $wop = false) {
+        foreach($keys as $key) {
+            if(!$this->getConf($key)) return false;
         }
 
         /* write operation and lock array filled with tables names? */
-        if ($wop && (!is_array($this->cnf['TablesToLock']) ||
-                    !count($this->cnf['TablesToLock']))){
+        if($wop && (!is_array($this->getConf('TablesToLock')) ||
+            !count($this->getConf('TablesToLock')))
+        ) {
             return false;
         }
 
@@ -127,27 +130,28 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * Depending on which SQL string is defined in the config, password
      * checking is done here (getpass) or by the database (passcheck)
      *
-     * @param  $user  user who would like access
-     * @param  $pass  user's clear text password to check
+     * @param  string $user user who would like access
+     * @param  string $pass user's clear text password to check
      * @return bool
      *
      * @author  Andreas Gohr 
      * @author  Matthias Grimm 
      */
-    function checkPass($user,$pass){
-        $rc  = false;
+    public function checkPass($user, $pass) {
+        global $conf;
+        $rc = false;
 
         if($this->_openDB()) {
-            $sql    = str_replace('%{user}',$this->_escape($user),$this->cnf['checkPass']);
-            $sql    = str_replace('%{pass}',$this->_escape($pass),$sql);
-            $sql    = str_replace('%{dgroup}',$this->_escape($this->defaultgroup),$sql);
+            $sql    = str_replace('%{user}', $this->_escape($user), $this->getConf('checkPass'));
+            $sql    = str_replace('%{pass}', $this->_escape($pass), $sql);
+            $sql    = str_replace('%{dgroup}', $this->_escape($conf['defaultgroup']), $sql);
             $result = $this->_queryDB($sql);
 
             if($result !== false && count($result) == 1) {
-                if($this->cnf['forwardClearPass'] == 1)
+                if($this->getConf('forwardClearPass') == 1)
                     $rc = true;
                 else
-                    $rc = auth_verifyPassword($pass,$result[0]['pass']);
+                    $rc = auth_verifyPassword($pass, $result[0]['pass']);
             }
             $this->_closeDB();
         }
@@ -155,20 +159,15 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * [public function]
-     *
-     * Returns info about the given user needs to contain
-     * at least these fields:
-     *   name  string  full name of the user
-     *   mail  string  email addres of the user
-     *   grps  array   list of groups the user is in
-     *
-     * @param $user   user's nick to get data for
+     * Return user info
      *
      * @author  Andreas Gohr 
      * @author  Matthias Grimm 
+     *
+     * @param string $user user login to get data for
+     * @return array|bool
      */
-    function getUserData($user){
+    public function getUserData($user) {
         if($this->_openDB()) {
             $this->_lockTables("READ");
             $info = $this->_getUserInfo($user);
@@ -180,45 +179,46 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * [public function]
-     *
      * Create a new User. Returns false if the user already exists,
      * null when an error occurred and true if everything went well.
      *
      * The new user will be added to the default group by this
      * function if grps are not specified (default behaviour).
      *
-     * @param $user  nick of the user
-     * @param $pwd   clear text password
-     * @param $name  full name of the user
-     * @param $mail  email address
-     * @param $grps  array of groups the user should become member of
-     *
      * @author  Andreas Gohr 
      * @author  Chris Smith 
      * @author  Matthias Grimm 
+     *
+     * @param string $user  nick of the user
+     * @param string $pwd   clear text password
+     * @param string $name  full name of the user
+     * @param string $mail  email address
+     * @param array  $grps  array of groups the user should become member of
+     * @return bool|null
      */
-    function createUser($user,$pwd,$name,$mail,$grps=null){
+    public function createUser($user, $pwd, $name, $mail, $grps = null) {
+        global $conf;
+
         if($this->_openDB()) {
-            if (($info = $this->_getUserInfo($user)) !== false)
-                return false;  // user already exists
+            if(($info = $this->_getUserInfo($user)) !== false)
+                return false; // user already exists
 
             // set defaultgroup if no groups were given
-            if ($grps == null)
-                $grps = array($this->defaultgroup);
+            if($grps == null)
+                $grps = array($conf['defaultgroup']);
 
             $this->_lockTables("WRITE");
-            $pwd = $this->cnf['forwardClearPass'] ? $pwd : auth_cryptPassword($pwd);
-            $rc = $this->_addUser($user,$pwd,$name,$mail,$grps);
+            $pwd = $this->getConf('forwardClearPass') ? $pwd : auth_cryptPassword($pwd);
+            $rc  = $this->_addUser($user, $pwd, $name, $mail, $grps);
             $this->_unlockTables();
             $this->_closeDB();
-            if ($rc) return true;
+            if($rc) return true;
         }
-        return null;  // return error
+        return null; // return error
     }
 
     /**
-     * Modify user data [public function]
+     * Modify user data
      *
      * An existing user dataset will be modified. Changes are given in an array.
      *
@@ -237,37 +237,36 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * should be modified). In this case we asure that we don't touch groups
      * even $changes['grps'] is set by mistake.
      *
-     * @param   $user     nick of the user to be changed
-     * @param   $changes  array of field/value pairs to be changed (password
-     *                    will be clear text)
-     * @return  bool      true on success, false on error
-     *
      * @author  Chris Smith 
      * @author  Matthias Grimm 
+     *
+     * @param   string $user    nick of the user to be changed
+     * @param   array  $changes array of field/value pairs to be changed (password will be clear text)
+     * @return  bool   true on success, false on error
      */
-    function modifyUser($user, $changes) {
+    public function modifyUser($user, $changes) {
         $rc = false;
 
-        if (!is_array($changes) || !count($changes))
-            return true;  // nothing to change
+        if(!is_array($changes) || !count($changes))
+            return true; // nothing to change
 
         if($this->_openDB()) {
             $this->_lockTables("WRITE");
 
-            if (($uid = $this->_getUserID($user))) {
+            if(($uid = $this->_getUserID($user))) {
                 $rc = $this->_updateUserInfo($changes, $uid);
 
-                if ($rc && isset($changes['grps']) && $this->cando['modGroups']) {
+                if($rc && isset($changes['grps']) && $this->cando['modGroups']) {
                     $groups = $this->_getGroups($user);
                     $grpadd = array_diff($changes['grps'], $groups);
                     $grpdel = array_diff($groups, $changes['grps']);
 
                     foreach($grpadd as $group)
-                        if (($this->_addUserToGroup($user, $group, 1)) == false)
+                        if(($this->_addUserToGroup($user, $group, 1)) == false)
                             $rc = false;
 
                     foreach($grpdel as $group)
-                        if (($this->_delUserFromGroup($user, $group)) == false)
+                        if(($this->_delUserFromGroup($user, $group)) == false)
                             $rc = false;
                 }
             }
@@ -293,10 +292,10 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
         $count = 0;
 
         if($this->_openDB()) {
-            if (is_array($users) && count($users)) {
+            if(is_array($users) && count($users)) {
                 $this->_lockTables("WRITE");
-                foreach ($users as $user) {
-                    if ($this->_delUser($user))
+                foreach($users as $user) {
+                    if($this->_delUser($user))
                         $count++;
                 }
                 $this->_unlockTables();
@@ -307,28 +306,26 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * [public function]
-     *
      * Counts users which meet certain $filter criteria.
      *
-     * @param  array  $filter  filter criteria in item/pattern pairs
-     * @return count of found users.
-     *
      * @author  Matthias Grimm 
+     *
+     * @param  array $filter  filter criteria in item/pattern pairs
+     * @return int count of found users
      */
-    function getUserCount($filter=array()) {
+    public function getUserCount($filter = array()) {
         $rc = 0;
 
         if($this->_openDB()) {
-            $sql = $this->_createSQLFilter($this->cnf['getUsers'], $filter);
+            $sql = $this->_createSQLFilter($this->getConf('getUsers'), $filter);
 
-            if ($this->dbver >= 4) {
-                $sql = substr($sql, 6);  /* remove 'SELECT' or 'select' */
+            if($this->dbver >= 4) {
+                $sql = substr($sql, 6); /* remove 'SELECT' or 'select' */
                 $sql = "SELECT SQL_CALC_FOUND_ROWS".$sql." LIMIT 1";
                 $this->_queryDB($sql);
                 $result = $this->_queryDB("SELECT FOUND_ROWS()");
-                $rc = $result[0]['FOUND_ROWS()'];
-            } else if (($result = $this->_queryDB($sql)))
+                $rc     = $result[0]['FOUND_ROWS()'];
+            } else if(($result = $this->_queryDB($sql)))
                 $rc = count($result);
 
             $this->_closeDB();
@@ -337,27 +334,27 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * Bulk retrieval of user data. [public function]
-     *
-     * @param   first     index of first user to be returned
-     * @param   limit     max number of users to be returned
-     * @param   filter    array of field/pattern pairs
-     * @return  array of userinfo (refer getUserData for internal userinfo details)
+     * Bulk retrieval of user data
      *
      * @author  Matthias Grimm 
+     *
+     * @param  int          $first  index of first user to be returned
+     * @param  int          $limit  max number of users to be returned
+     * @param  array|string $filter array of field/pattern pairs
+     * @return  array userinfo (refer getUserData for internal userinfo details)
      */
-    function retrieveUsers($first=0,$limit=10,$filter=array()) {
-        $out   = array();
+    public function retrieveUsers($first = 0, $limit = 10, $filter = array()) {
+        $out = array();
 
         if($this->_openDB()) {
             $this->_lockTables("READ");
-            $sql  = $this->_createSQLFilter($this->cnf['getUsers'], $filter);
-            $sql .= " ".$this->cnf['SortOrder']." LIMIT $first, $limit";
+            $sql = $this->_createSQLFilter($this->getConf('getUsers'), $filter);
+            $sql .= " ".$this->getConf('SortOrder')." LIMIT $first, $limit";
             $result = $this->_queryDB($sql);
 
-            if (!empty($result)) {
-                foreach ($result as $user)
-                    if (($info = $this->_getUserInfo($user['user'])))
+            if(!empty($result)) {
+                foreach($result as $user)
+                    if(($info = $this->_getUserInfo($user['user'])))
                         $out[$user['user']] = $info;
             }
 
@@ -368,20 +365,20 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * Give user membership of a group [public function]
-     *
-     * @param   $user
-     * @param   $group
-     * @return  bool    true on success, false on error
+     * Give user membership of a group
      *
      * @author  Matthias Grimm 
+     *
+     * @param   string $user
+     * @param   string $group
+     * @return  bool   true on success, false on error
      */
-    function joinGroup($user, $group) {
+    protected function joinGroup($user, $group) {
         $rc = false;
 
-        if ($this->_openDB()) {
+        if($this->_openDB()) {
             $this->_lockTables("WRITE");
-            $rc  = $this->_addUserToGroup($user, $group);
+            $rc = $this->_addUserToGroup($user, $group);
             $this->_unlockTables();
             $this->_closeDB();
         }
@@ -389,20 +386,19 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * Remove user from a group [public function]
-     *
-     * @param   $user    user that leaves a group
-     * @param   $group   group to leave
-     * @return  bool
+     * Remove user from a group
      *
      * @author  Matthias Grimm 
+     *
+     * @param   string $user  user that leaves a group
+     * @param   string $group group to leave
+     * @return  bool
      */
-    function leaveGroup($user, $group) {
+    protected function leaveGroup($user, $group) {
         $rc = false;
 
-        if ($this->_openDB()) {
+        if($this->_openDB()) {
             $this->_lockTables("WRITE");
-            $uid = $this->_getUserID($user);
             $rc  = $this->_delUserFromGroup($user, $group);
             $this->_unlockTables();
             $this->_closeDB();
@@ -413,54 +409,54 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     /**
      * MySQL is case-insensitive
      */
-    function isCaseSensitive(){
+    public function isCaseSensitive() {
         return false;
     }
 
     /**
      * Adds a user to a group.
      *
-     * If $force is set to '1' non existing groups would be created.
+     * If $force is set to true non existing groups would be created.
      *
      * The database connection must already be established. Otherwise
      * this function does nothing and returns 'false'. It is strongly
      * recommended to call this function only after all participating
      * tables (group and usergroup) have been locked.
      *
-     * @param   $user    user to add to a group
-     * @param   $group   name of the group
-     * @param   $force   '1' create missing groups
-     * @return  bool     'true' on success, 'false' on error
-     *
      * @author Matthias Grimm 
+     *
+     * @param   string $user    user to add to a group
+     * @param   string $group   name of the group
+     * @param   bool   $force   create missing groups
+     * @return  bool   true on success, false on error
      */
-    function _addUserToGroup($user, $group, $force=0) {
+    protected function _addUserToGroup($user, $group, $force = false) {
         $newgroup = 0;
 
-        if (($this->dbcon) && ($user)) {
+        if(($this->dbcon) && ($user)) {
             $gid = $this->_getGroupID($group);
-            if (!$gid) {
-                if ($force) {  // create missing groups
-                    $sql = str_replace('%{group}',$this->_escape($group),$this->cnf['addGroup']);
-                    $gid = $this->_modifyDB($sql);
-                    $newgroup = 1;  // group newly created
+            if(!$gid) {
+                if($force) { // create missing groups
+                    $sql      = str_replace('%{group}', $this->_escape($group), $this->getConf('addGroup'));
+                    $gid      = $this->_modifyDB($sql);
+                    $newgroup = 1; // group newly created
                 }
-                if (!$gid) return false; // group didn't exist and can't be created
+                if(!$gid) return false; // group didn't exist and can't be created
             }
 
-            $sql = $this->cnf['addUserGroup'];
-            if(strpos($sql,'%{uid}') !== false){
+            $sql = $this->getConf('addUserGroup');
+            if(strpos($sql, '%{uid}') !== false) {
                 $uid = $this->_getUserID($user);
-                $sql = str_replace('%{uid}',  $this->_escape($uid),$sql);
+                $sql = str_replace('%{uid}', $this->_escape($uid), $sql);
             }
-            $sql = str_replace('%{user}', $this->_escape($user),$sql);
-            $sql = str_replace('%{gid}',  $this->_escape($gid),$sql);
-            $sql = str_replace('%{group}',$this->_escape($group),$sql);
-            if ($this->_modifyDB($sql) !== false) return true;
-
-            if ($newgroup) { // remove previously created group on error
-                $sql = str_replace('%{gid}',  $this->_escape($gid),$this->cnf['delGroup']);
-                $sql = str_replace('%{group}',$this->_escape($group),$sql);
+            $sql = str_replace('%{user}', $this->_escape($user), $sql);
+            $sql = str_replace('%{gid}', $this->_escape($gid), $sql);
+            $sql = str_replace('%{group}', $this->_escape($group), $sql);
+            if($this->_modifyDB($sql) !== false) return true;
+
+            if($newgroup) { // remove previously created group on error
+                $sql = str_replace('%{gid}', $this->_escape($gid), $this->getConf('delGroup'));
+                $sql = str_replace('%{group}', $this->_escape($group), $sql);
                 $this->_modifyDB($sql);
             }
         }
@@ -470,26 +466,26 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
     /**
      * Remove user from a group
      *
-     * @param   $user    user that leaves a group
-     * @param   $group   group to leave
-     * @return  bool     true on success, false on error
-     *
      * @author  Matthias Grimm 
+     *
+     * @param   string $user  user that leaves a group
+     * @param   string $group group to leave
+     * @return  bool   true on success, false on error
      */
-    function _delUserFromGroup($user, $group) {
+    protected function _delUserFromGroup($user, $group) {
         $rc = false;
 
-        if (($this->dbcon) && ($user)) {
-            $sql = $this->cnf['delUserGroup'];
-            if(strpos($sql,'%{uid}') !== false){
+        if(($this->dbcon) && ($user)) {
+            $sql = $this->getConf('delUserGroup');
+            if(strpos($sql, '%{uid}') !== false) {
                 $uid = $this->_getUserID($user);
-                $sql = str_replace('%{uid}',  $this->_escape($uid),$sql);
+                $sql = str_replace('%{uid}', $this->_escape($uid), $sql);
             }
             $gid = $this->_getGroupID($group);
-            if ($gid) {
-                $sql = str_replace('%{user}', $this->_escape($user),$sql);
-                $sql = str_replace('%{gid}',  $this->_escape($gid),$sql);
-                $sql = str_replace('%{group}',$this->_escape($group),$sql);
+            if($gid) {
+                $sql = str_replace('%{user}', $this->_escape($user), $sql);
+                $sql = str_replace('%{gid}', $this->_escape($gid), $sql);
+                $sql = str_replace('%{group}', $this->_escape($group), $sql);
                 $rc  = $this->_modifyDB($sql) == 0 ? true : false;
             }
         }
@@ -501,19 +497,18 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * The database connection must already be established
      * for this function to work. Otherwise it will return
-     * 'false'.
-     *
-     * @param  $user  user whose groups should be listed
-     * @return bool   false on error
-     * @return array  array containing all groups on success
+     * false.
      *
      * @author Matthias Grimm 
+     *
+     * @param  string $user user whose groups should be listed
+     * @return bool|array false on error, all groups on success
      */
-    function _getGroups($user) {
+    protected function _getGroups($user) {
         $groups = array();
 
         if($this->dbcon) {
-            $sql = str_replace('%{user}',$this->_escape($user),$this->cnf['getGroups']);
+            $sql    = str_replace('%{user}', $this->_escape($user), $this->getConf('getGroups'));
             $result = $this->_queryDB($sql);
 
             if($result !== false && count($result)) {
@@ -530,16 +525,16 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * The database connection must already be established
      * for this function to work. Otherwise it will return
-     * 'false'.
-     *
-     * @param  $user   user whose id is desired
-     * @return user id
+     * false.
      *
      * @author Matthias Grimm 
+     *
+     * @param  string $user user whose id is desired
+     * @return mixed  user id
      */
-    function _getUserID($user) {
+    protected function _getUserID($user) {
         if($this->dbcon) {
-            $sql = str_replace('%{user}',$this->_escape($user),$this->cnf['getUserID']);
+            $sql    = str_replace('%{user}', $this->_escape($user), $this->getConf('getUserID'));
             $result = $this->_queryDB($sql);
             return $result === false ? false : $result[0]['id'];
         }
@@ -551,43 +546,45 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * The database connection must already be established
      * for this function to work. Otherwise it will return
-     * 'false'.
-     *
-     * @param  $user  login of the user
-     * @param  $pwd   encrypted password
-     * @param  $name  full name of the user
-     * @param  $mail  email address
-     * @param  $grps  array of groups the user should become member of
-     * @return bool
+     * false.
      *
      * @author  Andreas Gohr 
      * @author  Chris Smith 
      * @author  Matthias Grimm 
+     *
+     * @param  string $user  login of the user
+     * @param  string $pwd   encrypted password
+     * @param  string $name  full name of the user
+     * @param  string $mail  email address
+     * @param  array  $grps  array of groups the user should become member of
+     * @return bool
      */
-    function _addUser($user,$pwd,$name,$mail,$grps){
+    protected function _addUser($user, $pwd, $name, $mail, $grps) {
         if($this->dbcon && is_array($grps)) {
-            $sql = str_replace('%{user}', $this->_escape($user),$this->cnf['addUser']);
-            $sql = str_replace('%{pass}', $this->_escape($pwd),$sql);
-            $sql = str_replace('%{name}', $this->_escape($name),$sql);
-            $sql = str_replace('%{email}',$this->_escape($mail),$sql);
+            $sql = str_replace('%{user}', $this->_escape($user), $this->getConf('addUser'));
+            $sql = str_replace('%{pass}', $this->_escape($pwd), $sql);
+            $sql = str_replace('%{name}', $this->_escape($name), $sql);
+            $sql = str_replace('%{email}', $this->_escape($mail), $sql);
             $uid = $this->_modifyDB($sql);
+            $gid = false;
+            $group = '';
 
-            if ($uid) {
+            if($uid) {
                 foreach($grps as $group) {
                     $gid = $this->_addUserToGroup($user, $group, 1);
-                    if ($gid === false) break;
+                    if($gid === false) break;
                 }
 
-                if ($gid) return true;
-                else {
+                if($gid !== false){
+                    return true;
+                } else {
                     /* remove the new user and all group relations if a group can't
                      * be assigned. Newly created groups will remain in the database
                      * and won't be removed. This might create orphaned groups but
                      * is not a big issue so we ignore this problem here.
                      */
                     $this->_delUser($user);
-                    if ($this->cnf['debug'])
-                        msg ("MySQL err: Adding user '$user' to group '$group' failed.",-1,__LINE__,__FILE__);
+                    $this->_debug("MySQL err: Adding user '$user' to group '$group' failed.", -1, __LINE__, __FILE__);
                 }
             }
         }
@@ -599,21 +596,21 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * The database connection must already be established
      * for this function to work. Otherwise it will return
-     * 'false'.
-     *
-     * @param  $user   user whose id is desired
-     * @return bool
+     * false.
      *
      * @author Matthias Grimm 
+     *
+     * @param  string $user user whose id is desired
+     * @return bool
      */
-    function _delUser($user) {
+    protected function _delUser($user) {
         if($this->dbcon) {
             $uid = $this->_getUserID($user);
-            if ($uid) {
-                $sql = str_replace('%{uid}',$this->_escape($uid),$this->cnf['delUserRefs']);
+            if($uid) {
+                $sql = str_replace('%{uid}', $this->_escape($uid), $this->getConf('delUserRefs'));
                 $this->_modifyDB($sql);
-                $sql = str_replace('%{uid}',$this->_escape($uid),$this->cnf['delUser']);
-                $sql = str_replace('%{user}',  $this->_escape($user),$sql);
+                $sql = str_replace('%{uid}', $this->_escape($uid), $this->getConf('delUser'));
+                $sql = str_replace('%{user}', $this->_escape($user), $sql);
                 $this->_modifyDB($sql);
                 return true;
             }
@@ -628,17 +625,16 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * must already be established for this function to work.
      * Otherwise it will return 'false'.
      *
-     * @param  $user  user's nick to get data for
-     * @return bool   false on error
-     * @return array  user info on success
-     *
      * @author Matthias Grimm 
+     *
+     * @param  string $user  user's nick to get data for
+     * @return bool|array false on error, user info on success
      */
-    function _getUserInfo($user){
-        $sql = str_replace('%{user}',$this->_escape($user),$this->cnf['getUserInfo']);
+    protected function _getUserInfo($user) {
+        $sql    = str_replace('%{user}', $this->_escape($user), $this->getConf('getUserInfo'));
         $result = $this->_queryDB($sql);
         if($result !== false && count($result)) {
-            $info = $result[0];
+            $info         = $result[0];
             $info['grps'] = $this->_getGroups($user);
             return $info;
         }
@@ -658,43 +654,43 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * The password will be crypted if necessary.
      *
-     * @param  $changes  array of items to change as pairs of item and value
-     * @param  $uid      user id of dataset to change, must be unique in DB
-     * @return true on success or false on error
+     * @param  array $changes  array of items to change as pairs of item and value
+     * @param  mixed $uid      user id of dataset to change, must be unique in DB
+     * @return bool true on success or false on error
      *
      * @author Matthias Grimm 
      */
-    function _updateUserInfo($changes, $uid) {
-        $sql  = $this->cnf['updateUser']." ";
+    protected function _updateUserInfo($changes, $uid) {
+        $sql = $this->getConf('updateUser')." ";
         $cnt = 0;
         $err = 0;
 
         if($this->dbcon) {
-            foreach ($changes as $item => $value) {
-                if ($item == 'user') {
-                    if (($this->_getUserID($changes['user']))) {
+            foreach($changes as $item => $value) {
+                if($item == 'user') {
+                    if(($this->_getUserID($changes['user']))) {
                         $err = 1; /* new username already exists */
-                        break;    /* abort update */
+                        break; /* abort update */
                     }
-                    if ($cnt++ > 0) $sql .= ", ";
-                    $sql .= str_replace('%{user}',$value,$this->cnf['UpdateLogin']);
-                } else if ($item == 'name') {
-                    if ($cnt++ > 0) $sql .= ", ";
-                    $sql .= str_replace('%{name}',$value,$this->cnf['UpdateName']);
-                } else if ($item == 'pass') {
-                    if (!$this->cnf['forwardClearPass'])
+                    if($cnt++ > 0) $sql .= ", ";
+                    $sql .= str_replace('%{user}', $value, $this->getConf('UpdateLogin'));
+                } else if($item == 'name') {
+                    if($cnt++ > 0) $sql .= ", ";
+                    $sql .= str_replace('%{name}', $value, $this->getConf('UpdateName'));
+                } else if($item == 'pass') {
+                    if(!$this->getConf('forwardClearPass'))
                         $value = auth_cryptPassword($value);
-                    if ($cnt++ > 0) $sql .= ", ";
-                    $sql .= str_replace('%{pass}',$value,$this->cnf['UpdatePass']);
-                } else if ($item == 'mail') {
-                    if ($cnt++ > 0) $sql .= ", ";
-                    $sql .= str_replace('%{email}',$value,$this->cnf['UpdateEmail']);
+                    if($cnt++ > 0) $sql .= ", ";
+                    $sql .= str_replace('%{pass}', $value, $this->getConf('UpdatePass'));
+                } else if($item == 'mail') {
+                    if($cnt++ > 0) $sql .= ", ";
+                    $sql .= str_replace('%{email}', $value, $this->getConf('UpdateEmail'));
                 }
             }
 
-            if ($err == 0) {
-                if ($cnt > 0) {
-                    $sql .= " ".str_replace('%{uid}', $uid, $this->cnf['UpdateTarget']);
+            if($err == 0) {
+                if($cnt > 0) {
+                    $sql .= " ".str_replace('%{uid}', $uid, $this->getConf('UpdateTarget'));
                     if(get_class($this) == 'auth_mysql') $sql .= " LIMIT 1"; //some PgSQL inheritance comp.
                     $this->_modifyDB($sql);
                 }
@@ -709,16 +705,16 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * The database connection must already be established
      * for this function to work. Otherwise it will return
-     * 'false'.
-     *
-     * @param  $group   group name which id is desired
-     * @return group id
+     * false.
      *
      * @author Matthias Grimm 
+     *
+     * @param  string $group   group name which id is desired
+     * @return mixed group id
      */
-    function _getGroupID($group) {
+    protected function _getGroupID($group) {
         if($this->dbcon) {
-            $sql = str_replace('%{group}',$this->_escape($group),$this->cnf['getGroupID']);
+            $sql    = str_replace('%{group}', $this->_escape($group), $this->getConf('getGroupID'));
             $result = $this->_queryDB($sql);
             return $result === false ? false : $result[0]['id'];
         }
@@ -730,37 +726,39 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * usage in the object. The successful call to this functions is
      * essential for most functions in this object.
      *
-     * @return bool
-     *
      * @author Matthias Grimm 
+     *
+     * @return bool
      */
-    function _openDB() {
-        if (!$this->dbcon) {
-            $con = @mysql_connect ($this->cnf['server'], $this->cnf['user'], $this->cnf['password']);
-            if ($con) {
-                if ((mysql_select_db($this->cnf['database'], $con))) {
-                    if ((preg_match("/^(\d+)\.(\d+)\.(\d+).*/", mysql_get_server_info ($con), $result)) == 1) {
+    protected function _openDB() {
+        if(!$this->dbcon) {
+            $con = @mysql_connect($this->getConf('server'), $this->getConf('user'), $this->getConf('password'));
+            if($con) {
+                if((mysql_select_db($this->getConf('database'), $con))) {
+                    if((preg_match('/^(\d+)\.(\d+)\.(\d+).*/', mysql_get_server_info($con), $result)) == 1) {
                         $this->dbver = $result[1];
                         $this->dbrev = $result[2];
                         $this->dbsub = $result[3];
                     }
                     $this->dbcon = $con;
-                    if(!empty($this->cnf['charset'])){
-                        mysql_query('SET CHARACTER SET "' . $this->cnf['charset'] . '"', $con);
+                    if($this->getConf('charset')) {
+                        mysql_query('SET CHARACTER SET "'.$this->getConf('charset').'"', $con);
                     }
-                    return true;   // connection and database successfully opened
+                    return true; // connection and database successfully opened
                 } else {
-                    mysql_close ($con);
-                    if ($this->cnf['debug'])
-                        msg("MySQL err: No access to database {$this->cnf['database']}.",-1,__LINE__,__FILE__);
+                    mysql_close($con);
+                    $this->_debug("MySQL err: No access to database {$this->getConf('database')}.", -1, __LINE__, __FILE__);
                 }
-            } else if ($this->cnf['debug'])
-                msg ("MySQL err: Connection to {$this->cnf['user']}@{$this->cnf['server']} not possible.",
-                        -1,__LINE__,__FILE__);
+            } else {
+                $this->_debug(
+                    "MySQL err: Connection to {$this->getConf('user')}@{$this->getConf('server')} not possible.",
+                    -1, __LINE__, __FILE__
+                );
+            }
 
-            return false;  // connection failed
+            return false; // connection failed
         }
-        return true;  // connection already open
+        return true; // connection already open
     }
 
     /**
@@ -768,9 +766,9 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * @author Matthias Grimm 
      */
-    function _closeDB() {
-        if ($this->dbcon) {
-            mysql_close ($this->dbcon);
+    protected function _closeDB() {
+        if($this->dbcon) {
+            mysql_close($this->dbcon);
             $this->dbcon = 0;
         }
     }
@@ -782,27 +780,26 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * This function is only able to handle queries that returns a
      * table such as SELECT.
      *
-     * @param $query  SQL string that contains the query
-     * @return array with the result table
-     *
      * @author Matthias Grimm 
+     *
+     * @param string $query  SQL string that contains the query
+     * @return array with the result table
      */
-    function _queryDB($query) {
-        if($this->cnf['debug'] >= 2){
-            msg('MySQL query: '.hsc($query),0,__LINE__,__FILE__);
+    protected function _queryDB($query) {
+        if($this->getConf('debug') >= 2) {
+            msg('MySQL query: '.hsc($query), 0, __LINE__, __FILE__);
         }
 
         $resultarray = array();
-        if ($this->dbcon) {
-            $result = @mysql_query($query,$this->dbcon);
-            if ($result) {
-                while (($t = mysql_fetch_assoc($result)) !== false)
-                    $resultarray[]=$t;
-                mysql_free_result ($result);
+        if($this->dbcon) {
+            $result = @mysql_query($query, $this->dbcon);
+            if($result) {
+                while(($t = mysql_fetch_assoc($result)) !== false)
+                    $resultarray[] = $t;
+                mysql_free_result($result);
                 return $resultarray;
             }
-            if ($this->cnf['debug'])
-                msg('MySQL err: '.mysql_error($this->dbcon),-1,__LINE__,__FILE__);
+            $this->_debug('MySQL err: '.mysql_error($this->dbcon), -1, __LINE__, __FILE__);
         }
         return false;
     }
@@ -813,20 +810,19 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * This function is only able to handle queries that returns
      * either nothing or an id value such as INPUT, DELETE, UPDATE, etc.
      *
-     * @param $query  SQL string that contains the query
-     * @return insert id or 0, false on error
-     *
      * @author Matthias Grimm 
+     *
+     * @param string $query  SQL string that contains the query
+     * @return int|bool insert id or 0, false on error
      */
-    function _modifyDB($query) {
-        if ($this->dbcon) {
-            $result = @mysql_query($query,$this->dbcon);
-            if ($result) {
+    protected function _modifyDB($query) {
+        if($this->dbcon) {
+            $result = @mysql_query($query, $this->dbcon);
+            if($result) {
                 $rc = mysql_insert_id($this->dbcon); //give back ID on insert
-                if ($rc !== false) return $rc;
+                if($rc !== false) return $rc;
             }
-            if ($this->cnf['debug'])
-                msg('MySQL err: '.mysql_error($this->dbcon),-1,__LINE__,__FILE__);
+            $this->_debug('MySQL err: '.mysql_error($this->dbcon), -1, __LINE__, __FILE__);
         }
         return false;
     }
@@ -845,18 +841,19 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * so that this functionality is simulated by this function. Nevertheless
      * it is not as powerful as transactions, it is a good compromise in safty.
      *
-     * @param $mode  could be 'READ' or 'WRITE'
-     *
      * @author Matthias Grimm 
+     *
+     * @param string $mode  could be 'READ' or 'WRITE'
+     * @return bool
      */
-    function _lockTables($mode) {
-        if ($this->dbcon) {
-            if (is_array($this->cnf['TablesToLock']) && !empty($this->cnf['TablesToLock'])) {
-                if ($mode == "READ" || $mode == "WRITE") {
+    protected function _lockTables($mode) {
+        if($this->dbcon) {
+            if(is_array($this->getConf('TablesToLock'))) {
+                if($mode == "READ" || $mode == "WRITE") {
                     $sql = "LOCK TABLES ";
                     $cnt = 0;
-                    foreach ($this->cnf['TablesToLock'] as $table) {
-                        if ($cnt++ != 0) $sql .= ", ";
+                    foreach($this->getConf('TablesToLock') as $table) {
+                        if($cnt++ != 0) $sql .= ", ";
                         $sql .= "$table $mode";
                     }
                     $this->_modifyDB($sql);
@@ -873,8 +870,8 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      *
      * @author Matthias Grimm 
      */
-    function _unlockTables() {
-        if ($this->dbcon) {
+    protected function _unlockTables() {
+        if($this->dbcon) {
             $this->_modifyDB("UNLOCK TABLES");
             return true;
         }
@@ -886,32 +883,31 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * The database connection must already be established, otherwise the
      * original SQL string without filter criteria will be returned.
      *
-     * @param  $sql     SQL string to which the $filter criteria should be added
-     * @param  $filter  array of filter criteria as pairs of item and pattern
-     * @return SQL string with attached $filter criteria on success
-     * @return the original SQL string on error.
-     *
      * @author Matthias Grimm 
+     *
+     * @param  string $sql     SQL string to which the $filter criteria should be added
+     * @param  array $filter  array of filter criteria as pairs of item and pattern
+     * @return string SQL string with attached $filter criteria on success, original SQL string on error
      */
-    function _createSQLFilter($sql, $filter) {
+    protected function _createSQLFilter($sql, $filter) {
         $SQLfilter = "";
-        $cnt = 0;
+        $cnt       = 0;
 
-        if ($this->dbcon) {
-            foreach ($filter as $item => $pattern) {
+        if($this->dbcon) {
+            foreach($filter as $item => $pattern) {
                 $tmp = '%'.$this->_escape($pattern).'%';
-                if ($item == 'user') {
-                    if ($cnt++ > 0) $SQLfilter .= " AND ";
-                    $SQLfilter .= str_replace('%{user}',$tmp,$this->cnf['FilterLogin']);
-                } else if ($item == 'name') {
-                    if ($cnt++ > 0) $SQLfilter .= " AND ";
-                    $SQLfilter .= str_replace('%{name}',$tmp,$this->cnf['FilterName']);
-                } else if ($item == 'mail') {
-                    if ($cnt++ > 0) $SQLfilter .= " AND ";
-                    $SQLfilter .= str_replace('%{email}',$tmp,$this->cnf['FilterEmail']);
-                } else if ($item == 'grps') {
-                    if ($cnt++ > 0) $SQLfilter .= " AND ";
-                    $SQLfilter .= str_replace('%{group}',$tmp,$this->cnf['FilterGroup']);
+                if($item == 'user') {
+                    if($cnt++ > 0) $SQLfilter .= " AND ";
+                    $SQLfilter .= str_replace('%{user}', $tmp, $this->getConf('FilterLogin'));
+                } else if($item == 'name') {
+                    if($cnt++ > 0) $SQLfilter .= " AND ";
+                    $SQLfilter .= str_replace('%{name}', $tmp, $this->getConf('FilterName'));
+                } else if($item == 'mail') {
+                    if($cnt++ > 0) $SQLfilter .= " AND ";
+                    $SQLfilter .= str_replace('%{email}', $tmp, $this->getConf('FilterEmail'));
+                } else if($item == 'grps') {
+                    if($cnt++ > 0) $SQLfilter .= " AND ";
+                    $SQLfilter .= str_replace('%{group}', $tmp, $this->getConf('FilterGroup'));
                 }
             }
 
@@ -919,9 +915,9 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
             // any of cnf['Filter????'] is not defined, a malformed SQL string
             // would be generated.
 
-            if (strlen($SQLfilter)) {
-                $glue = strpos(strtolower($sql),"where") ? " AND " : " WHERE ";
-                $sql = $sql.$glue.$SQLfilter;
+            if(strlen($SQLfilter)) {
+                $glue = strpos(strtolower($sql), "where") ? " AND " : " WHERE ";
+                $sql  = $sql.$glue.$SQLfilter;
             }
         }
 
@@ -932,18 +928,34 @@ class auth_plugin_authmysql extends DokuWiki_Auth_Plugin {
      * Escape a string for insertion into the database
      *
      * @author Andreas Gohr 
+     *
      * @param  string  $string The string to escape
      * @param  boolean $like   Escape wildcard chars as well?
+     * @return string
      */
-    function _escape($string,$like=false){
-        if($this->dbcon){
+    protected function _escape($string, $like = false) {
+        if($this->dbcon) {
             $string = mysql_real_escape_string($string, $this->dbcon);
-        }else{
+        } else {
             $string = addslashes($string);
         }
-        if($like){
-            $string = addcslashes($string,'%_');
+        if($like) {
+            $string = addcslashes($string, '%_');
         }
         return $string;
     }
+
+    /**
+     * Wrapper around msg() but outputs only when debug is enabled
+     *
+     * @param string $message
+     * @param int    $err
+     * @param int    $line
+     * @param string $file
+     * @return void
+     */
+    protected function _debug($message, $err, $line, $file) {
+        if(!$this->getConf('debug')) return;
+        msg($message, $err, $line, $file);
+    }
 }
diff --git a/lib/plugins/authmysql/conf/default.php b/lib/plugins/authmysql/conf/default.php
new file mode 100644
index 000000000..ea2cdad72
--- /dev/null
+++ b/lib/plugins/authmysql/conf/default.php
@@ -0,0 +1,3 @@
+
Date: Fri, 9 Nov 2012 17:11:10 +0100
Subject: authpgsql fixes

* fixes merge messup (code was made up from parts of authad)
* code and PHP5 cleanup
---
 lib/plugins/authpgsql/auth.php         | 561 +++++++++++++++++++--------------
 lib/plugins/authpgsql/conf/default.php |   3 +
 2 files changed, 326 insertions(+), 238 deletions(-)
 create mode 100644 lib/plugins/authpgsql/conf/default.php

(limited to 'lib')

diff --git a/lib/plugins/authpgsql/auth.php b/lib/plugins/authpgsql/auth.php
index 46154b6ca..3f8ff3249 100644
--- a/lib/plugins/authpgsql/auth.php
+++ b/lib/plugins/authpgsql/auth.php
@@ -1,15 +1,9 @@
 
- */
 // must be run within Dokuwiki
 if(!defined('DOKU_INC')) die();
 
 /**
- * PgSQL authentication backend
+ * PostgreSQL authentication backend
  *
  * This class inherits much functionality from the MySQL class
  * and just reimplements the Postgres specific parts.
@@ -19,315 +13,406 @@ if(!defined('DOKU_INC')) die();
  * @author     Chris Smith 
  * @author     Matthias Grimm 
  * @author     Jan Schumann 
-*/
-class auth_plugin_authpgsql extends auth_plugin_authmysql
-{
-    var $cnf = null;
-    var $opts = null;
-    var $adldap = null;
-    var $users = null;
+ */
+class auth_plugin_authpgsql extends auth_plugin_authmysql {
 
     /**
      * Constructor
+     *
+     * checks if the pgsql interface is available, otherwise it will
+     * set the variable $success of the basis class to false
+     *
+     * @author Matthias Grimm 
+     * @author Andreas Gohr 
      */
-    function auth_plugin_authpgsql() {
-        parent::__construct();
-
-        global $conf;
-        $this->cnf = $conf['auth']['ad'];
+    public function __construct() {
+        // we don't want the stuff the MySQL constructor does, but the grandparent might do something
+        DokuWiki_Auth_Plugin::__construct();
 
-
-        // additional information fields
-        if (isset($this->cnf['additional'])) {
-            $this->cnf['additional'] = str_replace(' ', '', $this->cnf['additional']);
-            $this->cnf['additional'] = explode(',', $this->cnf['additional']);
-        } else $this->cnf['additional'] = array();
-
-        // ldap extension is needed
-        if (!function_exists('ldap_connect')) {
-            if ($this->cnf['debug'])
-                msg("AD Auth: PHP LDAP extension not found.",-1);
+        if(!function_exists('pg_connect')) {
+            $this->_debug("PgSQL err: PHP Postgres extension not found.", -1, __LINE__, __FILE__);
             $this->success = false;
             return;
         }
 
-        // Prepare SSO
-        if($_SERVER['REMOTE_USER'] && $this->cnf['sso']){
-             // remove possible NTLM domain
-             list($dom,$usr) = explode('\\',$_SERVER['REMOTE_USER'],2);
-             if(!$usr) $usr = $dom;
-
-             // remove possible Kerberos domain
-             list($usr,$dom) = explode('@',$usr);
+        $this->loadConfig();
 
-             $dom = strtolower($dom);
-             $_SERVER['REMOTE_USER'] = $usr;
-
-             // we need to simulate a login
-             if(empty($_COOKIE[DOKU_COOKIE])){
-                 $_REQUEST['u'] = $_SERVER['REMOTE_USER'];
-                 $_REQUEST['p'] = 'sso_only';
-             }
+        // set capabilities based upon config strings set
+        if(empty($this->conf['user']) ||
+            empty($this->conf['password']) || empty($this->conf['database'])
+        ) {
+            $this->_debug("PgSQL err: insufficient configuration.", -1, __LINE__, __FILE__);
+            $this->success = false;
+            return;
         }
 
-        // prepare adLDAP standard configuration
-        $this->opts = $this->cnf;
+        $this->cando['addUser']   = $this->_chkcnf(
+            array(
+                 'getUserInfo',
+                 'getGroups',
+                 'addUser',
+                 'getUserID',
+                 'getGroupID',
+                 'addGroup',
+                 'addUserGroup'
+            )
+        );
+        $this->cando['delUser']   = $this->_chkcnf(
+            array(
+                 'getUserID',
+                 'delUser',
+                 'delUserRefs'
+            )
+        );
+        $this->cando['modLogin']  = $this->_chkcnf(
+            array(
+                 'getUserID',
+                 'updateUser',
+                 'UpdateTarget'
+            )
+        );
+        $this->cando['modPass']   = $this->cando['modLogin'];
+        $this->cando['modName']   = $this->cando['modLogin'];
+        $this->cando['modMail']   = $this->cando['modLogin'];
+        $this->cando['modGroups'] = $this->_chkcnf(
+            array(
+                 'getUserID',
+                 'getGroups',
+                 'getGroupID',
+                 'addGroup',
+                 'addUserGroup',
+                 'delGroup',
+                 'getGroupID',
+                 'delUserGroup'
+            )
+        );
+        /* getGroups is not yet supported
+           $this->cando['getGroups']    = $this->_chkcnf(array('getGroups',
+           'getGroupID')); */
+        $this->cando['getUsers']     = $this->_chkcnf(
+            array(
+                 'getUsers',
+                 'getUserInfo',
+                 'getGroups'
+            )
+        );
+        $this->cando['getUserCount'] = $this->_chkcnf(array('getUsers'));
+    }
 
-        // add possible domain specific configuration
-        if($dom && is_array($this->cnf[$dom])) foreach($this->cnf[$dom] as $key => $val){
-            $this->opts[$key] = $val;
+    /**
+     * Check if the given config strings are set
+     *
+     * @author  Matthias Grimm 
+     *
+     * @param   array $keys
+     * @param   bool  $wop
+     * @return  bool
+     */
+    protected function _chkcnf($keys, $wop = false) {
+        foreach($keys as $key) {
+            if(empty($this->conf[$key])) return false;
         }
+        return true;
+    }
 
-        // handle multiple AD servers
-        $this->opts['domain_controllers'] = explode(',',$this->opts['domain_controllers']);
-        $this->opts['domain_controllers'] = array_map('trim',$this->opts['domain_controllers']);
-        $this->opts['domain_controllers'] = array_filter($this->opts['domain_controllers']);
+    /**
+     * Counts users which meet certain $filter criteria.
+     *
+     * @author  Matthias Grimm 
+     *
+     * @param  array  $filter  filter criteria in item/pattern pairs
+     * @return int count of found users.
+     */
+    public function getUserCount($filter = array()) {
+        $rc = 0;
 
-        // we can change the password if SSL is set
-        if($this->opts['use_ssl'] || $this->opts['use_tls']){
-            $this->cando['modPass'] = true;
+        if($this->_openDB()) {
+            $sql = $this->_createSQLFilter($this->conf['getUsers'], $filter);
+
+            // no equivalent of SQL_CALC_FOUND_ROWS in pgsql?
+            if(($result = $this->_queryDB($sql))) {
+                $rc = count($result);
+            }
+            $this->_closeDB();
         }
-        $this->cando['modName'] = true;
-        $this->cando['modMail'] = true;
+        return $rc;
     }
 
     /**
-     * Check user+password [required auth function]
+     * Bulk retrieval of user data
      *
-     * Checks if the given user exists and the given
-     * plaintext password is correct by trying to bind
-     * to the LDAP server
+     * @author  Matthias Grimm 
      *
-     * @author  James Van Lommel 
-     * @return  bool
+     * @param   int   $first     index of first user to be returned
+     * @param   int   $limit     max number of users to be returned
+     * @param   array $filter    array of field/pattern pairs
+     * @return  array userinfo (refer getUserData for internal userinfo details)
      */
-    function checkPass($user, $pass){
-        if($_SERVER['REMOTE_USER'] &&
-           $_SERVER['REMOTE_USER'] == $user &&
-           $this->cnf['sso']) return true;
+    public function retrieveUsers($first = 0, $limit = 10, $filter = array()) {
+        $out = array();
+
+        if($this->_openDB()) {
+            $this->_lockTables("READ");
+            $sql = $this->_createSQLFilter($this->conf['getUsers'], $filter);
+            $sql .= " ".$this->conf['SortOrder']." LIMIT $limit OFFSET $first";
+            $result = $this->_queryDB($sql);
+
+            foreach($result as $user)
+                if(($info = $this->_getUserInfo($user['user'])))
+                    $out[$user['user']] = $info;
 
-        if(!$this->_init()) return false;
-        return $this->adldap->authenticate($user, $pass);
+            $this->_unlockTables();
+            $this->_closeDB();
+        }
+        return $out;
     }
 
+    // @inherit function joinGroup($user, $group)
+    // @inherit function leaveGroup($user, $group) {
+
     /**
-     * Return user info [required auth function]
+     * Adds a user to a group.
      *
-     * Returns info about the given user needs to contain
-     * at least these fields:
+     * If $force is set to true non existing groups would be created.
      *
-     * name string  full name of the user
-     * mail string  email address of the user
-     * grps array   list of groups the user is in
+     * The database connection must already be established. Otherwise
+     * this function does nothing and returns 'false'.
      *
-     * This LDAP specific function returns the following
-     * addional fields:
+     * @author Matthias Grimm 
+     * @author Andreas Gohr   
      *
-     * dn   string  distinguished name (DN)
-     * uid  string  Posix User ID
-     *
-     * @author  James Van Lommel 
+     * @param   string $user    user to add to a group
+     * @param   string $group   name of the group
+     * @param   bool   $force   create missing groups
+     * @return  bool   true on success, false on error
      */
-   function getUserData($user){
-        global $conf;
-        if(!$this->_init()) return false;
-
-        $fields = array('mail','displayname','samaccountname');
-
-        // add additional fields to read
-        $fields = array_merge($fields, $this->cnf['additional']);
-        $fields = array_unique($fields);
-
-        //get info for given user
-        $result = $this->adldap->user_info($user, $fields);
-        //general user info
-        $info['name'] = $result[0]['displayname'][0];
-        $info['mail'] = $result[0]['mail'][0];
-        $info['uid']  = $result[0]['samaccountname'][0];
-        $info['dn']   = $result[0]['dn'];
-
-        // additional information
-        foreach ($this->cnf['additional'] as $field) {
-            if (isset($result[0][strtolower($field)])) {
-                $info[$field] = $result[0][strtolower($field)][0];
+    protected function _addUserToGroup($user, $group, $force = false) {
+        $newgroup = 0;
+
+        if(($this->dbcon) && ($user)) {
+            $gid = $this->_getGroupID($group);
+            if(!$gid) {
+                if($force) { // create missing groups
+                    $sql = str_replace('%{group}', addslashes($group), $this->conf['addGroup']);
+                    $this->_modifyDB($sql);
+                    //group should now exists try again to fetch it
+                    $gid      = $this->_getGroupID($group);
+                    $newgroup = 1; // group newly created
+                }
             }
-        }
-
-        // handle ActiveDirectory memberOf
-        $info['grps'] = $this->adldap->user_groups($user,(bool) $this->opts['recursive_groups']);
+            if(!$gid) return false; // group didn't exist and can't be created
 
-        if (is_array($info['grps'])) {
-            foreach ($info['grps'] as $ndx => $group) {
-                $info['grps'][$ndx] = $this->cleanGroup($group);
+            $sql = $this->conf['addUserGroup'];
+            if(strpos($sql, '%{uid}') !== false) {
+                $uid = $this->_getUserID($user);
+                $sql = str_replace('%{uid}', addslashes($uid), $sql);
+            }
+            $sql = str_replace('%{user}', addslashes($user), $sql);
+            $sql = str_replace('%{gid}', addslashes($gid), $sql);
+            $sql = str_replace('%{group}', addslashes($group), $sql);
+            if($this->_modifyDB($sql) !== false) return true;
+
+            if($newgroup) { // remove previously created group on error
+                $sql = str_replace('%{gid}', addslashes($gid), $this->conf['delGroup']);
+                $sql = str_replace('%{group}', addslashes($group), $sql);
+                $this->_modifyDB($sql);
             }
         }
-
-        // always add the default group to the list of groups
-        if(!is_array($info['grps']) || !in_array($conf['defaultgroup'],$info['grps'])){
-            $info['grps'][] = $conf['defaultgroup'];
-        }
-
-        return $info;
+        return false;
     }
 
+    // @inherit function _delUserFromGroup($user $group)
+    // @inherit function _getGroups($user)
+    // @inherit function _getUserID($user)
+
     /**
-     * Make AD group names usable by DokuWiki.
+     * Adds a new User to the database.
      *
-     * Removes backslashes ('\'), pound signs ('#'), and converts spaces to underscores.
+     * The database connection must already be established
+     * for this function to work. Otherwise it will return
+     * 'false'.
      *
-     * @author  James Van Lommel (jamesvl@gmail.com)
+     * @param  string $user  login of the user
+     * @param  string $pwd   encrypted password
+     * @param  string $name  full name of the user
+     * @param  string $mail  email address
+     * @param  array  $grps  array of groups the user should become member of
+     * @return bool
+     *
+     * @author  Andreas Gohr 
+     * @author  Chris Smith 
+     * @author  Matthias Grimm 
      */
-    function cleanGroup($name) {
-        $sName = str_replace('\\', '', $name);
-        $sName = str_replace('#', '', $sName);
-        $sName = preg_replace('[\s]', '_', $sName);
-        return $sName;
+    protected function _addUser($user, $pwd, $name, $mail, $grps) {
+        if($this->dbcon && is_array($grps)) {
+            $sql = str_replace('%{user}', addslashes($user), $this->conf['addUser']);
+            $sql = str_replace('%{pass}', addslashes($pwd), $sql);
+            $sql = str_replace('%{name}', addslashes($name), $sql);
+            $sql = str_replace('%{email}', addslashes($mail), $sql);
+            if($this->_modifyDB($sql)) {
+                $uid = $this->_getUserID($user);
+            } else {
+                return false;
+            }
+
+            $group = '';
+            $gid = false;
+
+            if($uid) {
+                foreach($grps as $group) {
+                    $gid = $this->_addUserToGroup($user, $group, 1);
+                    if($gid === false) break;
+                }
+
+                if($gid !== false){
+                    return true;
+                } else {
+                    /* remove the new user and all group relations if a group can't
+                     * be assigned. Newly created groups will remain in the database
+                     * and won't be removed. This might create orphaned groups but
+                     * is not a big issue so we ignore this problem here.
+                     */
+                    $this->_delUser($user);
+                    $this->_debug("PgSQL err: Adding user '$user' to group '$group' failed.", -1, __LINE__, __FILE__);
+                }
+            }
+        }
+        return false;
     }
 
     /**
-     * Sanitize user names
+     * Opens a connection to a database and saves the handle for further
+     * usage in the object. The successful call to this functions is
+     * essential for most functions in this object.
+     *
+     * @author Matthias Grimm 
+     *
+     * @return bool
      */
-    function cleanUser($name) {
-        return $this->cleanGroup($name);
+    protected function _openDB() {
+        if(!$this->dbcon) {
+            $dsn = $this->conf['server'] ? 'host='.$this->conf['server'] : '';
+            $dsn .= ' port='.$this->conf['port'];
+            $dsn .= ' dbname='.$this->conf['database'];
+            $dsn .= ' user='.$this->conf['user'];
+            $dsn .= ' password='.$this->conf['password'];
+
+            $con = @pg_connect($dsn);
+            if($con) {
+                $this->dbcon = $con;
+                return true; // connection and database successfully opened
+            } else {
+                $this->_debug(
+                        "PgSQL err: Connection to {$this->conf['user']}@{$this->conf['server']} not possible.",
+                        -1, __LINE__, __FILE__
+                    );
+            }
+            return false; // connection failed
+        }
+        return true; // connection already open
     }
 
     /**
-     * Most values in LDAP are case-insensitive
+     * Closes a database connection.
+     *
+     * @author Matthias Grimm 
      */
-    function isCaseSensitive(){
-        return false;
+    protected function _closeDB() {
+        if($this->dbcon) {
+            pg_close($this->dbcon);
+            $this->dbcon = 0;
+        }
     }
 
     /**
-     * Bulk retrieval of user data
+     * Sends a SQL query to the database and transforms the result into
+     * an associative array.
      *
-     * @author  Dominik Eckelmann 
-     * @param   start     index of first user to be returned
-     * @param   limit     max number of users to be returned
-     * @param   filter    array of field/pattern pairs, null for no filter
-     * @return  array of userinfo (refer getUserData for internal userinfo details)
+     * This function is only able to handle queries that returns a
+     * table such as SELECT.
+     *
+     * @author Matthias Grimm 
+     *
+     * @param  string $query  SQL string that contains the query
+     * @return array the result table
      */
-    function retrieveUsers($start=0,$limit=-1,$filter=array()) {
-        if(!$this->_init()) return false;
-
-        if ($this->users === null) {
-            //get info for given user
-            $result = $this->adldap->all_users();
-            if (!$result) return array();
-            $this->users = array_fill_keys($result, false);
-        }
-
-        $i = 0;
-        $count = 0;
-        $this->_constructPattern($filter);
-        $result = array();
-
-        foreach ($this->users as $user => &$info) {
-            if ($i++ < $start) {
-                continue;
-            }
-            if ($info === false) {
-                $info = $this->getUserData($user);
-            }
-            if ($this->_filter($user, $info)) {
-                $result[$user] = $info;
-                if (($limit >= 0) && (++$count >= $limit)) break;
+    protected function _queryDB($query) {
+        $resultarray = array();
+        if($this->dbcon) {
+            $result = @pg_query($this->dbcon, $query);
+            if($result) {
+                while(($t = pg_fetch_assoc($result)) !== false)
+                    $resultarray[] = $t;
+                pg_free_result($result);
+                return $resultarray;
+            } else{
+                $this->_debug('PgSQL err: '.pg_last_error($this->dbcon), -1, __LINE__, __FILE__);
             }
         }
-        return $result;
+        return false;
     }
 
     /**
-     * Modify user data
+     * Executes an update or insert query. This differs from the
+     * MySQL one because it does NOT return the last insertID
      *
-     * @param   $user      nick of the user to be changed
-     * @param   $changes   array of field/value pairs to be changed
-     * @return  bool
-    */
-    function modifyUser($user, $changes) {
-        $return = true;
-
-        // password changing
-        if(isset($changes['pass'])){
-            try {
-                $return = $this->adldap->user_password($user,$changes['pass']);
-            } catch (adLDAPException $e) {
-                if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1);
-                $return = false;
-            }
-            if(!$return) msg('AD Auth: failed to change the password. Maybe the password policy was not met?',-1);
-        }
-
-        // changing user data
-        $adchanges = array();
-        if(isset($changes['name'])){
-            // get first and last name
-            $parts = explode(' ',$changes['name']);
-            $adchanges['surname']   = array_pop($parts);
-            $adchanges['firstname'] = join(' ',$parts);
-            $adchanges['display_name'] = $changes['name'];
-        }
-        if(isset($changes['mail'])){
-            $adchanges['email'] = $changes['mail'];
-        }
-        if(count($adchanges)){
-            try {
-                $return = $return & $this->adldap->user_modify($user,$adchanges);
-            } catch (adLDAPException $e) {
-                if ($this->cnf['debug']) msg('AD Auth: '.$e->getMessage(), -1);
-                $return = false;
+     * @author Andreas Gohr 
+     */
+    protected function _modifyDB($query) {
+        if($this->dbcon) {
+            $result = @pg_query($this->dbcon, $query);
+            if($result) {
+                pg_free_result($result);
+                return true;
             }
+            $this->_debug('PgSQL err: '.pg_last_error($this->dbcon), -1, __LINE__, __FILE__);
         }
-
-        return $return;
+        return false;
     }
 
     /**
-     * Initialize the AdLDAP library and connect to the server
+     * Start a transaction
+     *
+     * @author Matthias Grimm 
+     *
+     * @param string $mode  could be 'READ' or 'WRITE'
+     * @return bool
      */
-    function _init(){
-        if(!is_null($this->adldap)) return true;
-
-        // connect
-        try {
-            $this->adldap = new adLDAP($this->opts);
-            if (isset($this->opts['ad_username']) && isset($this->opts['ad_password'])) {
-                $this->canDo['getUsers'] = true;
-            }
+    protected function _lockTables($mode) {
+        if($this->dbcon) {
+            $this->_modifyDB('BEGIN');
             return true;
-        } catch (adLDAPException $e) {
-            if ($this->cnf['debug']) {
-                msg('AD Auth: '.$e->getMessage(), -1);
-            }
-            $this->success = false;
-            $this->adldap  = null;
         }
         return false;
     }
 
     /**
-     * return 1 if $user + $info match $filter criteria, 0 otherwise
+     * Commit a transaction
      *
-     * @author   Chris Smith 
+     * @author Matthias Grimm 
      */
-    function _filter($user, $info) {
-        foreach ($this->_pattern as $item => $pattern) {
-            if ($item == 'user') {
-                if (!preg_match($pattern, $user)) return 0;
-            } else if ($item == 'grps') {
-                if (!count(preg_grep($pattern, $info['grps']))) return 0;
-            } else {
-                if (!preg_match($pattern, $info[$item])) return 0;
-            }
+    protected function _unlockTables() {
+        if($this->dbcon) {
+            $this->_modifyDB('COMMIT');
+            return true;
         }
-        return 1;
+        return false;
     }
 
-    function _constructPattern($filter) {
-        $this->_pattern = array();
-        foreach ($filter as $item => $pattern) {
-//          $this->_pattern[$item] = '/'.preg_quote($pattern,"/").'/i';          // don't allow regex characters
-            $this->_pattern[$item] = '/'.str_replace('/','\/',$pattern).'/i';    // allow regex characters
+    /**
+     * Escape a string for insertion into the database
+     *
+     * @author Andreas Gohr 
+     *
+     * @param  string  $string The string to escape
+     * @param  bool    $like   Escape wildcard chars as well?
+     * @return string
+     */
+    protected function _escape($string, $like = false) {
+        $string = pg_escape_string($string);
+        if($like) {
+            $string = addcslashes($string, '%_');
         }
+        return $string;
     }
 }
\ No newline at end of file
diff --git a/lib/plugins/authpgsql/conf/default.php b/lib/plugins/authpgsql/conf/default.php
new file mode 100644
index 000000000..401da80b7
--- /dev/null
+++ b/lib/plugins/authpgsql/conf/default.php
@@ -0,0 +1,3 @@
+
Date: Fri, 9 Nov 2012 17:29:24 +0100
Subject: fixed authplain

* code/PHP5 cleanup
---
 lib/plugins/authplain/auth.php | 215 +++++++++++++++++++++++------------------
 1 file changed, 122 insertions(+), 93 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/authplain/auth.php b/lib/plugins/authplain/auth.php
index 2e72bbd79..3416ede89 100644
--- a/lib/plugins/authplain/auth.php
+++ b/lib/plugins/authplain/auth.php
@@ -11,8 +11,11 @@ if(!defined('DOKU_INC')) die();
  * @author     Jan Schumann 
  */
 class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
-    var $users = null;
-    var $_pattern = array();
+    /** @var array user cache */
+    protected $users = null;
+
+    /** @var array filter pattern */
+    protected $_pattern = array();
 
     /**
      * Constructor
@@ -22,21 +25,21 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      *
      * @author  Christopher Smith 
      */
-    function __construct() {
+    public function __construct() {
         parent::__construct();
         global $config_cascade;
 
-        if (!@is_readable($config_cascade['plainauth.users']['default'])){
+        if(!@is_readable($config_cascade['plainauth.users']['default'])) {
             $this->success = false;
-        }else{
-            if(@is_writable($config_cascade['plainauth.users']['default'])){
-                $this->cando['addUser']      = true;
-                $this->cando['delUser']      = true;
-                $this->cando['modLogin']     = true;
-                $this->cando['modPass']      = true;
-                $this->cando['modName']      = true;
-                $this->cando['modMail']      = true;
-                $this->cando['modGroups']    = true;
+        } else {
+            if(@is_writable($config_cascade['plainauth.users']['default'])) {
+                $this->cando['addUser']   = true;
+                $this->cando['delUser']   = true;
+                $this->cando['modLogin']  = true;
+                $this->cando['modPass']   = true;
+                $this->cando['modName']   = true;
+                $this->cando['modMail']   = true;
+                $this->cando['modGroups'] = true;
             }
             $this->cando['getUsers']     = true;
             $this->cando['getUserCount'] = true;
@@ -44,20 +47,21 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * Check user+password [required auth function]
+     * Check user+password
      *
      * Checks if the given user exists and the given
      * plaintext password is correct
      *
      * @author  Andreas Gohr 
+     * @param string $user
+     * @param string $pass
      * @return  bool
      */
-    function checkPass($user,$pass){
-
+    public function checkPass($user, $pass) {
         $userinfo = $this->getUserData($user);
-        if ($userinfo === false) return false;
+        if($userinfo === false) return false;
 
-        return auth_verifyPassword($pass,$this->users[$user]['pass']);
+        return auth_verifyPassword($pass, $this->users[$user]['pass']);
     }
 
     /**
@@ -71,9 +75,10 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      * grps array   list of groups the user is in
      *
      * @author  Andreas Gohr 
+     * @param string $user
+     * @return array|bool
      */
-    function getUserData($user){
-
+    public function getUserData($user) {
         if($this->users === null) $this->_loadUserData();
         return isset($this->users[$user]) ? $this->users[$user] : false;
     }
@@ -89,30 +94,39 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      *
      * @author  Andreas Gohr 
      * @author  Chris Smith 
+     *
+     * @param string $user
+     * @param string $pwd
+     * @param string $name
+     * @param string $mail
+     * @param array  $grps
+     * @return bool|null|string
      */
-    function createUser($user,$pwd,$name,$mail,$grps=null){
+    public function createUser($user, $pwd, $name, $mail, $grps = null) {
         global $conf;
         global $config_cascade;
 
         // user mustn't already exist
-        if ($this->getUserData($user) !== false) return false;
+        if($this->getUserData($user) !== false) return false;
 
         $pass = auth_cryptPassword($pwd);
 
         // set default group if no groups specified
-        if (!is_array($grps)) $grps = array($conf['defaultgroup']);
+        if(!is_array($grps)) $grps = array($conf['defaultgroup']);
 
         // prepare user line
-        $groups = join(',',$grps);
-        $userline = join(':',array($user,$pass,$name,$mail,$groups))."\n";
+        $groups   = join(',', $grps);
+        $userline = join(':', array($user, $pass, $name, $mail, $groups))."\n";
 
-        if (io_saveFile($config_cascade['plainauth.users']['default'],$userline,true)) {
-            $this->users[$user] = compact('pass','name','mail','grps');
+        if(io_saveFile($config_cascade['plainauth.users']['default'], $userline, true)) {
+            $this->users[$user] = compact('pass', 'name', 'mail', 'grps');
             return $pwd;
         }
 
-        msg('The '.$config_cascade['plainauth.users']['default'].
-                ' file is not writable. Please inform the Wiki-Admin',-1);
+        msg(
+            'The '.$config_cascade['plainauth.users']['default'].
+                ' file is not writable. Please inform the Wiki-Admin', -1
+        );
         return null;
     }
 
@@ -120,43 +134,41 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      * Modify user data
      *
      * @author  Chris Smith 
-     * @param   $user      nick of the user to be changed
-     * @param   $changes   array of field/value pairs to be changed (password will be clear text)
+     * @param   string $user      nick of the user to be changed
+     * @param   array  $changes   array of field/value pairs to be changed (password will be clear text)
      * @return  bool
      */
-    function modifyUser($user, $changes) {
-        global $conf;
+    public function modifyUser($user, $changes) {
         global $ACT;
-        global $INFO;
         global $config_cascade;
 
         // sanity checks, user must already exist and there must be something to change
-        if (($userinfo = $this->getUserData($user)) === false) return false;
-        if (!is_array($changes) || !count($changes)) return true;
+        if(($userinfo = $this->getUserData($user)) === false) return false;
+        if(!is_array($changes) || !count($changes)) return true;
 
         // update userinfo with new data, remembering to encrypt any password
         $newuser = $user;
-        foreach ($changes as $field => $value) {
-            if ($field == 'user') {
+        foreach($changes as $field => $value) {
+            if($field == 'user') {
                 $newuser = $value;
                 continue;
             }
-            if ($field == 'pass') $value = auth_cryptPassword($value);
+            if($field == 'pass') $value = auth_cryptPassword($value);
             $userinfo[$field] = $value;
         }
 
-        $groups = join(',',$userinfo['grps']);
-        $userline = join(':',array($newuser, $userinfo['pass'], $userinfo['name'], $userinfo['mail'], $groups))."\n";
+        $groups   = join(',', $userinfo['grps']);
+        $userline = join(':', array($newuser, $userinfo['pass'], $userinfo['name'], $userinfo['mail'], $groups))."\n";
 
-        if (!$this->deleteUsers(array($user))) {
-            msg('Unable to modify user data. Please inform the Wiki-Admin',-1);
+        if(!$this->deleteUsers(array($user))) {
+            msg('Unable to modify user data. Please inform the Wiki-Admin', -1);
             return false;
         }
 
-        if (!io_saveFile($config_cascade['plainauth.users']['default'],$userline,true)) {
-            msg('There was an error modifying your user data. You should register again.',-1);
+        if(!io_saveFile($config_cascade['plainauth.users']['default'], $userline, true)) {
+            msg('There was an error modifying your user data. You should register again.', -1);
             // FIXME, user has been deleted but not recreated, should force a logout and redirect to login page
-            $ACT == 'register';
+            $ACT = 'register';
             return false;
         }
 
@@ -171,24 +183,24 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      * @param   array  $users   array of users to be deleted
      * @return  int             the number of users deleted
      */
-    function deleteUsers($users) {
+    public function deleteUsers($users) {
         global $config_cascade;
 
-        if (!is_array($users) || empty($users)) return 0;
+        if(!is_array($users) || empty($users)) return 0;
 
-        if ($this->users === null) $this->_loadUserData();
+        if($this->users === null) $this->_loadUserData();
 
         $deleted = array();
-        foreach ($users as $user) {
-            if (isset($this->users[$user])) $deleted[] = preg_quote($user,'/');
+        foreach($users as $user) {
+            if(isset($this->users[$user])) $deleted[] = preg_quote($user, '/');
         }
 
-        if (empty($deleted)) return 0;
+        if(empty($deleted)) return 0;
 
-        $pattern = '/^('.join('|',$deleted).'):/';
+        $pattern = '/^('.join('|', $deleted).'):/';
 
-        if (io_deleteFromFile($config_cascade['plainauth.users']['default'],$pattern,true)) {
-            foreach ($deleted as $user) unset($this->users[$user]);
+        if(io_deleteFromFile($config_cascade['plainauth.users']['default'], $pattern, true)) {
+            foreach($deleted as $user) unset($this->users[$user]);
             return count($deleted);
         }
 
@@ -203,17 +215,20 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      * Return a count of the number of user which meet $filter criteria
      *
      * @author  Chris Smith 
+     *
+     * @param array $filter
+     * @return int
      */
-    function getUserCount($filter=array()) {
+    public function getUserCount($filter = array()) {
 
         if($this->users === null) $this->_loadUserData();
 
-        if (!count($filter)) return count($this->users);
+        if(!count($filter)) return count($this->users);
 
         $count = 0;
         $this->_constructPattern($filter);
 
-        foreach ($this->users as $user => $info) {
+        foreach($this->users as $user => $info) {
             $count += $this->_filter($user, $info);
         }
 
@@ -224,28 +239,29 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      * Bulk retrieval of user data
      *
      * @author  Chris Smith 
-     * @param   start     index of first user to be returned
-     * @param   limit     max number of users to be returned
-     * @param   filter    array of field/pattern pairs
-     * @return  array of userinfo (refer getUserData for internal userinfo details)
+     *
+     * @param   int   $start index of first user to be returned
+     * @param   int   $limit max number of users to be returned
+     * @param   array $filter array of field/pattern pairs
+     * @return  array userinfo (refer getUserData for internal userinfo details)
      */
-    function retrieveUsers($start=0,$limit=0,$filter=array()) {
+    public function retrieveUsers($start = 0, $limit = 0, $filter = array()) {
 
-        if ($this->users === null) $this->_loadUserData();
+        if($this->users === null) $this->_loadUserData();
 
         ksort($this->users);
 
-        $i = 0;
+        $i     = 0;
         $count = 0;
-        $out = array();
+        $out   = array();
         $this->_constructPattern($filter);
 
-        foreach ($this->users as $user => $info) {
-            if ($this->_filter($user, $info)) {
-                if ($i >= $start) {
+        foreach($this->users as $user => $info) {
+            if($this->_filter($user, $info)) {
+                if($i >= $start) {
                     $out[$user] = $info;
                     $count++;
-                    if (($limit > 0) && ($count >= $limit)) break;
+                    if(($limit > 0) && ($count >= $limit)) break;
                 }
                 $i++;
             }
@@ -256,18 +272,24 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
 
     /**
      * Only valid pageid's (no namespaces) for usernames
+     *
+     * @param string $user
+     * @return string
      */
-    function cleanUser($user){
+    public function cleanUser($user) {
         global $conf;
-        return cleanID(str_replace(':',$conf['sepchar'],$user));
+        return cleanID(str_replace(':', $conf['sepchar'], $user));
     }
 
     /**
      * Only valid pageid's (no namespaces) for groupnames
+     *
+     * @param string $group
+     * @return string
      */
-    function cleanGroup($group){
+    public function cleanGroup($group) {
         global $conf;
-        return cleanID(str_replace(':',$conf['sepchar'],$group));
+        return cleanID(str_replace(':', $conf['sepchar'], $group));
     }
 
     /**
@@ -277,7 +299,7 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
      *
      * @author  Andreas Gohr 
      */
-    function _loadUserData(){
+    protected function _loadUserData() {
         global $config_cascade;
 
         $this->users = array();
@@ -285,13 +307,13 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
         if(!@file_exists($config_cascade['plainauth.users']['default'])) return;
 
         $lines = file($config_cascade['plainauth.users']['default']);
-        foreach($lines as $line){
-            $line = preg_replace('/#.*$/','',$line); //ignore comments
+        foreach($lines as $line) {
+            $line = preg_replace('/#.*$/', '', $line); //ignore comments
             $line = trim($line);
             if(empty($line)) continue;
 
-            $row    = explode(":",$line,5);
-            $groups = array_values(array_filter(explode(",",$row[4])));
+            $row    = explode(":", $line, 5);
+            $groups = array_values(array_filter(explode(",", $row[4])));
 
             $this->users[$row[0]]['pass'] = $row[1];
             $this->users[$row[0]]['name'] = urldecode($row[2]);
@@ -301,29 +323,36 @@ class auth_plugin_authplain extends DokuWiki_Auth_Plugin {
     }
 
     /**
-     * return 1 if $user + $info match $filter criteria, 0 otherwise
+     * return true if $user + $info match $filter criteria, false otherwise
      *
      * @author   Chris Smith 
+     *
+     * @param string $user User login
+     * @param array  $info User's userinfo array
+     * @return bool
      */
-    function _filter($user, $info) {
-        // FIXME
-        foreach ($this->_pattern as $item => $pattern) {
-            if ($item == 'user') {
-                if (!preg_match($pattern, $user)) return 0;
-            } else if ($item == 'grps') {
-                if (!count(preg_grep($pattern, $info['grps']))) return 0;
+    protected function _filter($user, $info) {
+        foreach($this->_pattern as $item => $pattern) {
+            if($item == 'user') {
+                if(!preg_match($pattern, $user)) return false;
+            } else if($item == 'grps') {
+                if(!count(preg_grep($pattern, $info['grps']))) return false;
             } else {
-                if (!preg_match($pattern, $info[$item])) return 0;
+                if(!preg_match($pattern, $info[$item])) return false;
             }
         }
-        return 1;
+        return true;
     }
 
-    function _constructPattern($filter) {
+    /**
+     * construct a filter pattern
+     *
+     * @param array $filter
+     */
+    protected function _constructPattern($filter) {
         $this->_pattern = array();
-        foreach ($filter as $item => $pattern) {
-            //        $this->_pattern[$item] = '/'.preg_quote($pattern,"/").'/i';          // don't allow regex characters
-            $this->_pattern[$item] = '/'.str_replace('/','\/',$pattern).'/i';    // allow regex characters
+        foreach($filter as $item => $pattern) {
+            $this->_pattern[$item] = '/'.str_replace('/', '\/', $pattern).'/i'; // allow regex characters
         }
     }
 }
\ No newline at end of file
-- 
cgit v1.2.3


From 23e8f02b8aa3a74fed70f1a496bdb5423908133a Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Sat, 10 Nov 2012 16:11:30 +0100
Subject: added 'text' to config plugin for multi line text configs

---
 lib/plugins/config/settings/config.class.php    | 33 ++++++++++++++++++++++---
 lib/plugins/config/settings/config.metadata.php |  1 +
 2 files changed, 31 insertions(+), 3 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php
index 8c48018d7..9f98231e3 100644
--- a/lib/plugins/config/settings/config.class.php
+++ b/lib/plugins/config/settings/config.class.php
@@ -35,6 +35,7 @@ if (!class_exists('configuration')) {
           msg('No configuration metadata found at - '.htmlspecialchars($datafile),-1);
           return;
         }
+        $meta = array();
         include($datafile);
 
         if (isset($config['varname'])) $this->_name = $config['varname'];
@@ -68,6 +69,7 @@ if (!class_exists('configuration')) {
           $keys = array_merge(array_keys($this->_metadata),array_keys($default), array_keys($local), array_keys($protected));
           $keys = array_unique($keys);
 
+          $param = null;
           foreach ($keys as $key) {
             if (isset($this->_metadata[$key])) {
               $class = $this->_metadata[$key][0];
@@ -425,11 +427,9 @@ if (!class_exists('setting')) {
       $out = '';
 
       if ($fmt=='php') {
-        // translation string needs to be improved FIXME
-        $tr = array("\n"=>'\n', "\r"=>'\r', "\t"=>'\t', "\\" => '\\\\', "'" => '\\\'');
         $tr = array("\\" => '\\\\', "'" => '\\\'');
 
-        $out =  '$'.$var."['".$this->_out_key()."'] = '".strtr($this->_local, $tr)."';\n";
+        $out =  '$'.$var."['".$this->_out_key()."'] = '".strtr( cleanText($this->_local), $tr)."';\n";
       }
 
       return $out;
@@ -494,6 +494,33 @@ if (!class_exists('setting_string')) {
   }
 }
 
+if (!class_exists('setting_text')) {
+    class setting_text extends setting {
+        function html(&$plugin, $echo=false) {
+            $value = '';
+            $disable = '';
+
+            if ($this->is_protected()) {
+                $value = $this->_protected;
+                $disable = 'disabled="disabled"';
+            } else {
+                if ($echo && $this->_error) {
+                    $value = $this->_input;
+                } else {
+                    $value = is_null($this->_local) ? $this->_default : $this->_local;
+                }
+            }
+
+            $key = htmlspecialchars($this->_key);
+            $value = formText($value);
+
+            $label = '';
+            $input = '';
+            return array($label,$input);
+        }
+    }
+}
+
 if (!class_exists('setting_password')) {
   class setting_password extends setting_string {
 
diff --git a/lib/plugins/config/settings/config.metadata.php b/lib/plugins/config/settings/config.metadata.php
index 3607f56c6..33ebb7fd8 100644
--- a/lib/plugins/config/settings/config.metadata.php
+++ b/lib/plugins/config/settings/config.metadata.php
@@ -15,6 +15,7 @@
  *   -------------------------------------------
  *   ''             - default class ('setting'), textarea, minimal input validation, setting output in quotes
  *   'string'       - single line text input, minimal input validation, setting output in quotes
+ *   'text'         - multi line text input, minimal input validation, setting output in quotes
  *   'numeric'      - text input, accepts numbers and arithmetic operators, setting output without quotes
  *                    if given the '_min' and '_max' parameters are used for validation
  *   'numericopt'   - like above, but accepts empty values
-- 
cgit v1.2.3


From 7e29378446eeb33892837048b31b4180e26ccd1f Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Sat, 10 Nov 2012 16:22:34 +0100
Subject: partial revert of 23e8f02b8aa3a74fed70f1a496bdb5423908133a

okay. I can't read. we already had a multiline config. It's the default.
So I reverted my change, except for making use of formText/cleanText for
proper line ending handling and I added made focused textareas a bit
larger.
---
 lib/plugins/config/settings/config.class.php    | 29 +------------------------
 lib/plugins/config/settings/config.metadata.php |  1 -
 lib/plugins/config/style.css                    |  4 ++++
 3 files changed, 5 insertions(+), 29 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php
index 9f98231e3..e6d085bcb 100644
--- a/lib/plugins/config/settings/config.class.php
+++ b/lib/plugins/config/settings/config.class.php
@@ -409,7 +409,7 @@ if (!class_exists('setting')) {
         }
 
         $key = htmlspecialchars($this->_key);
-        $value = htmlspecialchars($value);
+        $value = formText($value);
 
         $label = '';
         $input = '';
@@ -494,33 +494,6 @@ if (!class_exists('setting_string')) {
   }
 }
 
-if (!class_exists('setting_text')) {
-    class setting_text extends setting {
-        function html(&$plugin, $echo=false) {
-            $value = '';
-            $disable = '';
-
-            if ($this->is_protected()) {
-                $value = $this->_protected;
-                $disable = 'disabled="disabled"';
-            } else {
-                if ($echo && $this->_error) {
-                    $value = $this->_input;
-                } else {
-                    $value = is_null($this->_local) ? $this->_default : $this->_local;
-                }
-            }
-
-            $key = htmlspecialchars($this->_key);
-            $value = formText($value);
-
-            $label = '';
-            $input = '';
-            return array($label,$input);
-        }
-    }
-}
-
 if (!class_exists('setting_password')) {
   class setting_password extends setting_string {
 
diff --git a/lib/plugins/config/settings/config.metadata.php b/lib/plugins/config/settings/config.metadata.php
index 33ebb7fd8..3607f56c6 100644
--- a/lib/plugins/config/settings/config.metadata.php
+++ b/lib/plugins/config/settings/config.metadata.php
@@ -15,7 +15,6 @@
  *   -------------------------------------------
  *   ''             - default class ('setting'), textarea, minimal input validation, setting output in quotes
  *   'string'       - single line text input, minimal input validation, setting output in quotes
- *   'text'         - multi line text input, minimal input validation, setting output in quotes
  *   'numeric'      - text input, accepts numbers and arithmetic operators, setting output without quotes
  *                    if given the '_min' and '_max' parameters are used for validation
  *   'numericopt'   - like above, but accepts empty values
diff --git a/lib/plugins/config/style.css b/lib/plugins/config/style.css
index 1be94feb9..397328937 100644
--- a/lib/plugins/config/style.css
+++ b/lib/plugins/config/style.css
@@ -104,6 +104,10 @@
     height: 4em;
 }
 
+#config__manager td textarea.edit:focus {
+    height: 10em;
+}
+
 #config__manager tr .input,
 #config__manager tr input,
 #config__manager tr textarea,
-- 
cgit v1.2.3


From 3295f40a380553bb3f7f3018cee2e4462e0be417 Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Sat, 10 Nov 2012 16:35:16 +0100
Subject: fixed saving in config plugin

Saving worked, but did you log out everytime. Now it is checked if the
auth mechanism was actually changed before assuming the login is
invalid.
---
 lib/plugins/config/admin.php                |  3 +--
 lib/plugins/config/settings/extra.class.php | 15 +++++++++------
 2 files changed, 10 insertions(+), 8 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/config/admin.php b/lib/plugins/config/admin.php
index 0d314d2e6..4d15bfd85 100644
--- a/lib/plugins/config/admin.php
+++ b/lib/plugins/config/admin.php
@@ -65,8 +65,7 @@ class admin_plugin_config extends DokuWiki_Admin_Plugin {
         // save state & force a page reload to get the new settings to take effect
         $_SESSION['PLUGIN_CONFIG'] = array('state' => 'updated', 'time' => time());
         $this->_close_session();
-        header("Location: ".wl($ID,array('do'=>'admin','page'=>'config'),true,'&'));
-        exit();
+        send_redirect(wl($ID,array('do'=>'admin','page'=>'config'),true,'&'));
       }
 
       $this->_close_session();
diff --git a/lib/plugins/config/settings/extra.class.php b/lib/plugins/config/settings/extra.class.php
index f6adf1c18..6998e1fbf 100644
--- a/lib/plugins/config/settings/extra.class.php
+++ b/lib/plugins/config/settings/extra.class.php
@@ -64,7 +64,7 @@ if (!class_exists('setting_authtype')) {
     		// reject disabled plugins
     		if ($plugin_controller->isdisabled($input)) {
 	    		$this->_error = true;
-	    		msg('Auth type ' . $input . ' is disabled.');
+	    		msg('Auth type ' . $input . ' is disabled.', -1);
 	    		return false;
     		}
 
@@ -74,21 +74,24 @@ if (!class_exists('setting_authtype')) {
 	    	// @TODO: throw an error in plugin controller instead of returning null
 	    	if (is_null($auth_plugin)) {
 	    		$this->_error = true;
-	    		msg('Cannot load Auth Plugin "' . $input . '"');
+	    		msg('Cannot load Auth Plugin "' . $input . '"', -1);
 	    		return false;
 	    	}
 
 	    	// verify proper instanciation (is this really a plugin?) @TODO use instanceof? impement interface?
 	    	if (is_object($auth_plugin) && !method_exists($auth_plugin, 'getPluginName')) {
 	    		$this->_error = true;
-				msg('Cannot create Auth Plugin "' . $input . '"');
+				msg('Cannot create Auth Plugin "' . $input . '"', -1);
 	    		return false;
 	    	}
     	}
 
-    	msg('Successfully changed auth system. Please re-login.');
-    	auth_logoff();
-
+        // did we change the auth type? logout
+        global $conf;
+        if($conf['authtype'] != $input) {
+    	    msg('Authentication system changed. Please re-login.');
+    	    auth_logoff();
+        }
     	return true;
     }
   }
-- 
cgit v1.2.3


From 89d02586756515c9fb68a348e99a787d95e999a2 Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Sat, 10 Nov 2012 18:12:39 +0100
Subject: config manager: removed dead/commented code

---
 lib/plugins/config/settings/config.class.php | 13 -------------
 1 file changed, 13 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php
index 8c48018d7..ebf638526 100644
--- a/lib/plugins/config/settings/config.class.php
+++ b/lib/plugins/config/settings/config.class.php
@@ -45,14 +45,8 @@ if (!class_exists('configuration')) {
         $this->_local_files = $config_cascade['main']['local'];
         $this->_protected_files = $config_cascade['main']['protected'];
 
-#        if (isset($file['default'])) $this->_default_file = $file['default'];
-#        if (isset($file['local'])) $this->_local_file = $file['local'];
-#        if (isset($file['protected'])) $this->_protected_file = $file['protected'];
-
         $this->locked = $this->_is_locked();
-
         $this->_metadata = array_merge($meta, $this->get_plugintpl_metadata($conf['template']));
-
         $this->retrieve_settings();
     }
 
@@ -147,7 +141,6 @@ if (!class_exists('configuration')) {
       if (!$file) return array();
 
       $config = array();
-#      $file = eval('return '.$file.';');
 
       if ($this->_format == 'php') {
 
@@ -195,9 +188,6 @@ if (!class_exists('configuration')) {
     function _out_footer() {
       $out = '';
       if ($this->_format == 'php') {
- #         if ($this->_protected_file) {
- #           $out .= "\n@include(".$this->_protected_file.");\n";
- #         }
           $out .= "\n// end auto-generated content\n";
       }
 
@@ -209,7 +199,6 @@ if (!class_exists('configuration')) {
     function _is_locked() {
       if (!$this->_local_files) return true;
 
-#      $local = eval('return '.$this->_local_file.';');
       $local = $this->_local_files[0];
 
       if (!is_writable(dirname($local))) return true;
@@ -425,8 +414,6 @@ if (!class_exists('setting')) {
       $out = '';
 
       if ($fmt=='php') {
-        // translation string needs to be improved FIXME
-        $tr = array("\n"=>'\n', "\r"=>'\r', "\t"=>'\t', "\\" => '\\\\', "'" => '\\\'');
         $tr = array("\\" => '\\\\', "'" => '\\\'');
 
         $out =  '$'.$var."['".$this->_out_key()."'] = '".strtr($this->_local, $tr)."';\n";
-- 
cgit v1.2.3


From b8f41ef0bac4e82cb3b02cd318efaddbaaeb1a78 Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Sat, 10 Nov 2012 18:13:09 +0100
Subject: config manager: let PHP parse the config file

Until now, the config manager did read and parse the various PHP config
files itself. This fails for more complex setups like arrays.

I'm not really sure why this was done. This patch replaces the parsing
with a simple include() call. Everything still seems to work.
---
 lib/plugins/config/settings/config.class.php | 25 +++----------------------
 1 file changed, 3 insertions(+), 22 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php
index ebf638526..722c8df7b 100644
--- a/lib/plugins/config/settings/config.class.php
+++ b/lib/plugins/config/settings/config.class.php
@@ -139,32 +139,13 @@ if (!class_exists('configuration')) {
     function _read_config($file) {
 
       if (!$file) return array();
+      if (!file_exists($file)) return array();
 
       $config = array();
 
       if ($this->_format == 'php') {
-
-        if(@file_exists($file)){
-            $contents = @php_strip_whitespace($file);
-        }else{
-            $contents = '';
-        }
-        $pattern = '/\$'.$this->_name.'\[[\'"]([^=]+)[\'"]\] ?= ?(.*?);(?=[^;]*(?:\$'.$this->_name.'|$))/s';
-        $matches=array();
-        preg_match_all($pattern,$contents,$matches,PREG_SET_ORDER);
-
-        for ($i=0; $i'\\','\\\''=>'\'','\\"'=>'"'));
-
-          $config[$key] = $value;
-        }
+          include($file);
+          $config = ${$this->_name};
       }
 
       return $config;
-- 
cgit v1.2.3


From 60dd32d957e6c4ce2d969c45cc60497f55a39abe Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Sat, 10 Nov 2012 18:18:05 +0100
Subject: added 'array' type for config manager

This allows to use simple arrays in the config file but have a comma
separated list in the config manager.
---
 lib/plugins/config/settings/config.class.php    | 104 ++++++++++++++++++++++++
 lib/plugins/config/settings/config.metadata.php |   3 +
 2 files changed, 107 insertions(+)

(limited to 'lib')

diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php
index 722c8df7b..e4a638eb0 100644
--- a/lib/plugins/config/settings/config.class.php
+++ b/lib/plugins/config/settings/config.class.php
@@ -435,6 +435,110 @@ if (!class_exists('setting')) {
   }
 }
 
+
+if (!class_exists('setting_array')) {
+    class setting_array extends setting {
+
+        /**
+         * Create an array from a string
+         *
+         * @param $string
+         * @return array
+         */
+        protected function _from_string($string){
+            $array = explode(',', $string);
+            $array = array_map('trim', $array);
+            $array = array_filter($array);
+            $array = array_unique($array);
+            return $array;
+        }
+
+        /**
+         * Create a string from an array
+         *
+         * @param $array
+         * @return string
+         */
+        protected function _from_array($array){
+            return join(', ', (array) $array);
+        }
+
+        /**
+         * update setting with user provided value $input
+         * if value fails error check, save it
+         *
+         * @param string $input
+         * @return bool true if changed, false otherwise (incl. on error)
+         */
+        function update($input) {
+            if (is_null($input)) return false;
+            if ($this->is_protected()) return false;
+
+            $input = $this->_from_string($input);
+
+            $value = is_null($this->_local) ? $this->_default : $this->_local;
+            if ($value == $input) return false;
+
+            foreach($input as $item){
+                if ($this->_pattern && !preg_match($this->_pattern,$item)) {
+                    $this->_error = true;
+                    $this->_input = $input;
+                    return false;
+                }
+            }
+
+            $this->_local = $input;
+            return true;
+        }
+
+        protected function _escape($string) {
+            $tr = array("\\" => '\\\\', "'" => '\\\'');
+            return "'".strtr( cleanText($string), $tr)."'";
+        }
+
+        /**
+         * generate string to save setting value to file according to $fmt
+         */
+        function out($var, $fmt='php') {
+
+            if ($this->is_protected()) return '';
+            if (is_null($this->_local) || ($this->_default == $this->_local)) return '';
+
+            $out = '';
+
+            if ($fmt=='php') {
+                $vals = array_map(array($this, '_escape'), $this->_local);
+                $out =  '$'.$var."['".$this->_out_key()."'] = array(".join(', ',$vals).");\n";
+            }
+
+            return $out;
+        }
+
+        function html(&$plugin, $echo=false) {
+            $value = '';
+            $disable = '';
+
+            if ($this->is_protected()) {
+                $value = $this->_protected;
+                $disable = 'disabled="disabled"';
+            } else {
+                if ($echo && $this->_error) {
+                    $value = $this->_input;
+                } else {
+                    $value = is_null($this->_local) ? $this->_default : $this->_local;
+                }
+            }
+
+            $key = htmlspecialchars($this->_key);
+            $value = htmlspecialchars($this->_from_array($value));
+
+            $label = '';
+            $input = '';
+            return array($label,$input);
+        }
+    }
+}
+
 if (!class_exists('setting_string')) {
   class setting_string extends setting {
     function html(&$plugin, $echo=false) {
diff --git a/lib/plugins/config/settings/config.metadata.php b/lib/plugins/config/settings/config.metadata.php
index 3607f56c6..582452917 100644
--- a/lib/plugins/config/settings/config.metadata.php
+++ b/lib/plugins/config/settings/config.metadata.php
@@ -32,6 +32,9 @@
  *                    separated list of checked choices
  *   'fieldset'     - used to group configuration settings, but is not itself a setting. To make this clear in
  *                    the language files the keys for this type should start with '_'.
+ *   'array'        - a simple (one dimensional) array of string values, shown as comma separated list in the
+ *                    config manager but saved as PHP array(). Values may not contain commas themselves.
+ *                    _pattern matching on the array values supported.
  *
  *  Single Setting (source: settings/extra.class.php)
  *  -------------------------------------------------
-- 
cgit v1.2.3


From a21383af58203bf0e6dc36a07ea78fae0b58c1ef Mon Sep 17 00:00:00 2001
From: Andreas Gohr 
Date: Mon, 12 Nov 2012 20:57:27 +0100
Subject: crossbrowser fixes for quicksearch shortening FS#2660

fixes the problem with missing innerText in Firefox (and other browsers)
and corrects shortening in regard to paddings and the use of the
text-overflow attribute
---
 lib/scripts/qsearch.js | 25 ++++++++++++++++++++-----
 1 file changed, 20 insertions(+), 5 deletions(-)

(limited to 'lib')

diff --git a/lib/scripts/qsearch.js b/lib/scripts/qsearch.js
index a309f9e29..c3d0d94fb 100644
--- a/lib/scripts/qsearch.js
+++ b/lib/scripts/qsearch.js
@@ -92,12 +92,18 @@ var dw_qsearch = {
             .show()
             .css('white-space', 'nowrap');
 
-        // shorten namespaces if too long
-        max = dw_qsearch.$outObj[0].clientWidth;
+        // disable overflow during shortening
+        dw_qsearch.$outObj.find('li').css('overflow', 'visible');
+
         $links = dw_qsearch.$outObj.find('a');
-        too_big = (document.documentElement.dir === 'rtl')
-                  ? function (l) { return l.offsetLeft < 0; }
-                  : function (l) { return l.offsetWidth + l.offsetLeft > max; };
+        max    = dw_qsearch.$outObj[0].clientWidth; // maximum width allowed (but take away paddings below)
+        if(document.documentElement.dir === 'rtl'){
+            max -= parseInt(dw_qsearch.$outObj.css('padding-left'));
+            too_big = function (l) { return l.offsetLeft < 0; };
+        }else{
+            max -= parseInt(dw_qsearch.$outObj.css('padding-right'));
+            too_big = function (l) { return l.offsetWidth + l.offsetLeft > max; };
+        }
 
         $links.each(function () {
             var start, length, replace, nsL, nsR, eli, runaway;
@@ -106,6 +112,12 @@ var dw_qsearch = {
                 return;
             }
 
+            // make IE's innerText available to W3C conform browsers
+            if(this.textContent){
+                this.__defineGetter__('innerText', function(){ return this.textContent });
+                this.__defineSetter__('innerText', function(val){ this.textContent = val });
+            }
+
             nsL = this.innerText.indexOf('(');
             nsR = this.innerText.indexOf(')');
             eli = 0;
@@ -138,6 +150,9 @@ var dw_qsearch = {
                 nsR = this.innerText.indexOf(')');
             }
         });
+
+        // reenable overflow
+        dw_qsearch.$outObj.find('li').css('overflow', 'hidden').css('text-overflow','ellipsis');
     }
 };
 
-- 
cgit v1.2.3


From cc564ecd28a1cad0c52c4f2a2f682b2bed1ed01c Mon Sep 17 00:00:00 2001
From: =?UTF-8?q?Schplurtz=20le=20D=C3=A9boulonn=C3=A9?=
 
Date: Sun, 11 Nov 2012 11:18:47 +0100
Subject: compat js findPosX/y more closely mimic historical function

---
 lib/scripts/compatibility.js | 8 ++++----
 1 file changed, 4 insertions(+), 4 deletions(-)

(limited to 'lib')

diff --git a/lib/scripts/compatibility.js b/lib/scripts/compatibility.js
index 385e45854..76b135b23 100644
--- a/lib/scripts/compatibility.js
+++ b/lib/scripts/compatibility.js
@@ -165,13 +165,13 @@ toggleWrap = DEPRECATED_WRAP(dw_editor.toggleWrap);
 setWrap = DEPRECATED_WRAP(dw_editor.setWrap);
 
 function findPosX(object){
-    DEPRECATED('Use jQuery.position() instead');
-    return jQuery(object).position().left;
+    DEPRECATED('Use jQuery.offset() instead');
+    return jQuery(object).offset().left;
 }
 
 function findPosY(object){
-    DEPRECATED('Use jQuery.position() instead');
-    return jQuery(object).position().top;
+    DEPRECATED('Use jQuery.offset() instead');
+    return jQuery(object).offset().top;
 }
 
 function getElementsByClass(searchClass,node,tag){
-- 
cgit v1.2.3


From 649ee76f050057709402fd3d70243ea537d72b27 Mon Sep 17 00:00:00 2001
From: Jakub 
Date: Mon, 12 Nov 2012 21:29:23 +0100
Subject: Czech language update

---
 lib/plugins/acl/lang/cs/lang.php         |  1 +
 lib/plugins/config/lang/cs/lang.php      | 14 ++++++++++++--
 lib/plugins/plugin/lang/cs/lang.php      |  1 +
 lib/plugins/popularity/lang/cs/lang.php  |  1 +
 lib/plugins/revert/lang/cs/lang.php      |  1 +
 lib/plugins/usermanager/lang/cs/lang.php |  1 +
 6 files changed, 17 insertions(+), 2 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/acl/lang/cs/lang.php b/lib/plugins/acl/lang/cs/lang.php
index a1dce0369..feb160a02 100644
--- a/lib/plugins/acl/lang/cs/lang.php
+++ b/lib/plugins/acl/lang/cs/lang.php
@@ -11,6 +11,7 @@
  * @author Vojta Beran 
  * @author zbynek.krivka@seznam.cz
  * @author Bohumir Zamecnik 
+ * @author Jakub A. Těšínský (j@kub.cz)
  */
 $lang['admin_acl']             = 'Správa přístupových práv';
 $lang['acl_group']             = 'Skupina';
diff --git a/lib/plugins/config/lang/cs/lang.php b/lib/plugins/config/lang/cs/lang.php
index d2ec5035a..383afebb4 100644
--- a/lib/plugins/config/lang/cs/lang.php
+++ b/lib/plugins/config/lang/cs/lang.php
@@ -11,6 +11,7 @@
  * @author Vojta Beran 
  * @author zbynek.krivka@seznam.cz
  * @author Bohumir Zamecnik 
+ * @author Jakub A. Těšínský (j@kub.cz)
  */
 $lang['menu']                  = 'Správa nastavení';
 $lang['error']                 = 'Nastavení nebyla změněna kvůli alespoň jedné neplatné položce,
@@ -36,6 +37,8 @@ $lang['_anti_spam']            = 'Protispamová nastavení';
 $lang['_editing']              = 'Nastavení editace';
 $lang['_links']                = 'Nastavení odkazů';
 $lang['_media']                = 'Nastavení médií';
+$lang['_notifications']        = 'Nastavení upozornění';
+$lang['_syndication']          = 'Nastavení syndikace';
 $lang['_advanced']             = 'Pokročilá nastavení';
 $lang['_network']              = 'Nastavení sítě';
 $lang['_plugin_sufix']         = 'Nastavení pluginů ';
@@ -47,6 +50,8 @@ $lang['title']                 = 'Název celé wiki';
 $lang['start']                 = 'Název úvodní stránky';
 $lang['lang']                  = 'Jazyk';
 $lang['template']              = 'Šablona';
+$lang['tagline']               = 'Slogan (pokud ho šablona podporuje)';
+$lang['sidebar']               = 'Jméno stránky s obsahem postranní lišty (pokud ho šablona podporuje). Prázdné pole postranní lištu deaktivuje.';
 $lang['license']               = 'Pod jakou licencí má být tento obsah publikován?';
 $lang['savedir']               = 'Adresář pro ukládání dat';
 $lang['basedir']               = 'Kořenový adresář (např. /dokuwiki/). Pro autodetekci nechte prázdné.';
@@ -55,8 +60,8 @@ $lang['cookiedir']             = 'Cesta pro cookie. Není-li vyplněno, použije
 $lang['dmode']                 = 'Přístupová práva pro vytváření adresářů';
 $lang['fmode']                 = 'Přístupová práva pro vytváření souborů';
 $lang['allowdebug']            = 'Povolit debugování. Vypněte, pokud to nepotřebujete!';
-$lang['recent']                = 'Nedávné změny';
-$lang['recent_days']           = 'Jak staré nedávných změny uchovávat (ve dnech)';
+$lang['recent']                = 'Počet položek v nedávných změnách';
+$lang['recent_days']           = 'Jak staré nedávné změny zobrazovat (ve dnech)';
 $lang['breadcrumbs']           = 'Počet odkazů na navštívené stránky';
 $lang['youarehere']            = 'Hierarchická "drobečková" navigace';
 $lang['fullpath']              = 'Ukazovat plnou cestu ke stránkám v patičce';
@@ -94,6 +99,8 @@ $lang['disableactions_wikicode'] = 'Prohlížet zdrojové kódy/Export wiki text
 $lang['disableactions_other']  = 'Další akce (oddělené čárkou)';
 $lang['auth_security_timeout'] = 'Časový limit pro autentikaci (v sekundách)';
 $lang['securecookie']          = 'Má prohlížeč posílat cookies nastavené přes HTTPS opět jen přes HTTPS? Vypněte tuto volbu, pokud chcete, aby bylo pomocí SSL zabezpečeno pouze přihlašování do wiki, ale obsah budete prohlížet nezabezpečeně.';
+$lang['remote']                = 'Zapne API systému, umožňující jiným aplikacím vzdálený přístup k wiki pomoci XML-RPC nebo jiných mechanizmů.';
+$lang['remoteuser']            = 'Omezit přístup k API na tyto uživatelské skupiny či uživatele (seznam oddělený čárkami). Prázdné pole povolí přístup všem.';
 $lang['usewordblock']          = 'Blokovat spam za použití seznamu známých spamových slov';
 $lang['relnofollow']           = 'Používat rel="nofollow" na externí odkazy';
 $lang['indexdelay']            = 'Časová prodleva před indexací (v sekundách)';
@@ -109,6 +116,7 @@ $lang['target____interwiki']   = 'Cílové okno pro interwiki odkazy';
 $lang['target____extern']      = 'Cílové okno pro externí odkazy';
 $lang['target____media']       = 'Cílové okno pro odkazy na média';
 $lang['target____windows']     = 'Cílové okno pro odkazy na windows sdílení';
+$lang['mediarevisions']        = 'Aktivovat revize souborů';
 $lang['refcheck']              = 'Kontrolovat odkazy na média (před vymazáním)';
 $lang['refshow']               = 'Počet zobrazených odkazů na média';
 $lang['gdlib']                 = 'Verze GD knihovny';
@@ -121,12 +129,14 @@ $lang['notify']                = 'Posílat oznámení o změnách na následují
 $lang['registernotify']        = 'Posílat informace o nově registrovaných uživatelích na tuto mailovou adresu';
 $lang['mailfrom']              = 'E-mailová adresa, která se bude používat pro automatické maily';
 $lang['mailprefix']            = 'Předpona předmětu e-mailu, která se bude používat pro automatické maily';
+$lang['htmlmail']              = 'Posílat emaily v HTML (hezčí ale větší). Při vypnutí budou posílány jen textové emaily.';
 $lang['sitemap']               = 'Generovat Google sitemap (interval ve dnech)';
 $lang['rss_type']              = 'Typ XML kanálu';
 $lang['rss_linkto']            = 'XML kanál odkazuje na';
 $lang['rss_content']           = 'Co zobrazovat v položkách XML kanálu?';
 $lang['rss_update']            = 'Interval aktualizace XML kanálu (v sekundách)';
 $lang['rss_show_summary']      = 'XML kanál ukazuje souhrn v titulku';
+$lang['rss_media']             = 'Jaký typ změn má být uveden v kanálu XML';
 $lang['updatecheck']           = 'Kontrolovat aktualizace a bezpečnostní varování? DokuWiki potřebuje pro tuto funkci přístup k update.dokuwiki.org';
 $lang['userewrite']            = 'Používat "pěkná" URL';
 $lang['useslash']              = 'Používat lomítko jako oddělovač jmenných prostorů v URL';
diff --git a/lib/plugins/plugin/lang/cs/lang.php b/lib/plugins/plugin/lang/cs/lang.php
index 1fd360dca..20a015cd4 100644
--- a/lib/plugins/plugin/lang/cs/lang.php
+++ b/lib/plugins/plugin/lang/cs/lang.php
@@ -12,6 +12,7 @@
  * @author Vojta Beran 
  * @author zbynek.krivka@seznam.cz
  * @author Bohumir Zamecnik 
+ * @author Jakub A. Těšínský (j@kub.cz)
  */
 $lang['menu']                  = 'Správa pluginů';
 $lang['download']              = 'Stáhnout a instalovat plugin';
diff --git a/lib/plugins/popularity/lang/cs/lang.php b/lib/plugins/popularity/lang/cs/lang.php
index d7c58af2e..0b0dbae7f 100644
--- a/lib/plugins/popularity/lang/cs/lang.php
+++ b/lib/plugins/popularity/lang/cs/lang.php
@@ -9,6 +9,7 @@
  * @author Vojta Beran 
  * @author zbynek.krivka@seznam.cz
  * @author Bohumir Zamecnik 
+ * @author Jakub A. Těšínský (j@kub.cz)
  */
 $lang['name']                  = 'Průzkum používání (může chviličku trvat, než se natáhne)';
 $lang['submit']                = 'Odeslat data';
diff --git a/lib/plugins/revert/lang/cs/lang.php b/lib/plugins/revert/lang/cs/lang.php
index 5414ea1e5..dd8d7845c 100644
--- a/lib/plugins/revert/lang/cs/lang.php
+++ b/lib/plugins/revert/lang/cs/lang.php
@@ -12,6 +12,7 @@
  * @author Vojta Beran 
  * @author zbynek.krivka@seznam.cz
  * @author Bohumir Zamecnik 
+ * @author Jakub A. Těšínský (j@kub.cz)
  */
 $lang['menu']                  = 'Obnova zaspamovaných stránek';
 $lang['filter']                = 'Hledat zaspamované stránky';
diff --git a/lib/plugins/usermanager/lang/cs/lang.php b/lib/plugins/usermanager/lang/cs/lang.php
index 8351c190b..6de408e14 100644
--- a/lib/plugins/usermanager/lang/cs/lang.php
+++ b/lib/plugins/usermanager/lang/cs/lang.php
@@ -11,6 +11,7 @@
  * @author Vojta Beran 
  * @author zbynek.krivka@seznam.cz
  * @author Bohumir Zamecnik 
+ * @author Jakub A. Těšínský (j@kub.cz)
  */
 $lang['menu']                  = 'Správa uživatelů';
 $lang['noauth']                = '(autentizace uživatelů není k dispozici)';
-- 
cgit v1.2.3


From de78e4ef14515e4248d5f637558ec451e018799c Mon Sep 17 00:00:00 2001
From: Anael Mobilia 
Date: Mon, 12 Nov 2012 21:43:53 +0100
Subject: French language update

---
 lib/plugins/acl/lang/fr/help.txt             |  10 +-
 lib/plugins/acl/lang/fr/lang.php             |  27 +++--
 lib/plugins/config/lang/fr/intro.txt         |   6 +-
 lib/plugins/config/lang/fr/lang.php          | 175 ++++++++++++++-------------
 lib/plugins/plugin/lang/fr/admin_plugin.txt  |   4 +-
 lib/plugins/plugin/lang/fr/lang.php          |  45 +++----
 lib/plugins/popularity/lang/fr/intro.txt     |   6 +-
 lib/plugins/popularity/lang/fr/lang.php      |   9 +-
 lib/plugins/popularity/lang/fr/submitted.txt |   3 +-
 lib/plugins/revert/lang/fr/intro.txt         |   4 +-
 lib/plugins/revert/lang/fr/lang.php          |   9 +-
 lib/plugins/usermanager/lang/fr/edit.txt     |   2 +-
 lib/plugins/usermanager/lang/fr/lang.php     |  21 ++--
 13 files changed, 167 insertions(+), 154 deletions(-)

(limited to 'lib')

diff --git a/lib/plugins/acl/lang/fr/help.txt b/lib/plugins/acl/lang/fr/help.txt
index 158ec92ed..081978488 100644
--- a/lib/plugins/acl/lang/fr/help.txt
+++ b/lib/plugins/acl/lang/fr/help.txt
@@ -1,9 +1,11 @@
 === Aide rapide ===
 
-Cette page vous permet d'ajouter ou de supprimer des permissions pour les catégories et les pages de votre wiki. Le panneau de gauche liste toutes les catégories et les pages disponibles.
+Cette page vous permet d'ajouter ou de supprimer des autorisations pour les catégories et les pages de votre wiki.
 
-Le formulaire ci-dessus permet d'afficher et de modifier les permissions d'un utilisateur ou d'un groupe sélectionné.
+Le panneau de gauche liste toutes les catégories et les pages disponibles.
 
-Dans le tableau ci-dessous, toutes les listes de contrôle d'accès actuelles sont affichées. Vous pouvez l'utiliser pour supprimer ou modifier rapidement plusieurs ACL.
+Le formulaire ci-dessus permet d'afficher et de modifier les autorisations d'un utilisateur ou d'un groupe sélectionné.
 
-La lecture de [[doku>fr:acl|la documentation officielle des ACL]] pourra vous permettre de bien comprendre le fonctionnement du contrôle d'accès dans DokuWiki.
+Dans le tableau ci-dessous, toutes les listes de contrôle d'accès (ACL) actuelles sont affichées. Vous pouvez l'utiliser pour supprimer ou modifier rapidement plusieurs contrôles d'accès.
+
+La lecture de [[doku>fr:acl|la documentation officielle des contrôles d'accès]] pourra vous permettre de mieux comprendre le fonctionnement du contrôle d'accès dans DokuWiki.
diff --git a/lib/plugins/acl/lang/fr/lang.php b/lib/plugins/acl/lang/fr/lang.php
index b1b3188be..e52bf51a0 100644
--- a/lib/plugins/acl/lang/fr/lang.php
+++ b/lib/plugins/acl/lang/fr/lang.php
@@ -24,32 +24,33 @@
  * @author skimpax@gmail.com
  * @author Yannick Aure 
  * @author Olivier DUVAL 
+ * @author Anael Mobilia 
  */
 $lang['admin_acl']             = 'Gestion de la liste des contrôles d\'accès (ACL)';
 $lang['acl_group']             = 'Groupe';
 $lang['acl_user']              = 'Utilisateur';
-$lang['acl_perms']             = 'Permission pour';
+$lang['acl_perms']             = 'Autorisations pour';
 $lang['page']                  = 'Page';
 $lang['namespace']             = 'Catégorie';
 $lang['btn_select']            = 'Sélectionner';
-$lang['p_user_id']             = 'Permissions actuelles de l\'utilisateur %s sur la page %s: %s.';
-$lang['p_user_ns']             = 'Permissions actuelles de l\'utilisateur %s sur la catégorie %s: %s.';
-$lang['p_group_id']            = 'Permissions actuelles des membres du groupe %s sur la page %s: %s.';
-$lang['p_group_ns']            = 'Permissions actuelles des membres du groupe %s sur la catégorie %s: %s.';
-$lang['p_choose_id']           = 'Saisissez un nom d\'utilisateur ou de groupe dans le formulaire ci-dessus pour afficher ou éditer les permissions relatives à la page %s.';
-$lang['p_choose_ns']           = 'Saisissez un nom d\'utilisateur ou de groupe dans le formulaire ci-dessous pour afficher ou éditer les permissions relatives à la catégorie %s.';
-$lang['p_inherited']           = 'Note : Ces permissions n\'ont pas été explicitement fixées mais sont héritées d\'autres groupes ou catégories supérieures.';
-$lang['p_isadmin']             = 'Note : Le groupe ou l\'utilisateur sélectionné dispose de toutes les permissions car il est paramétré en tant que superutilisateur.';
-$lang['p_include']             = 'Les permissions les plus élevées induisent les plus faibles. Création, Télécharger et Effacer ne s\'appliquent qu\'aux catégories, pas aux pages.';
-$lang['current']               = 'ACL actuelles';
+$lang['p_user_id']             = 'Autorisations actuelles de l\'utilisateur %s sur la page %s : %s.';
+$lang['p_user_ns']             = 'Autorisations actuelles de l\'utilisateur %s sur la catégorie %s : %s.';
+$lang['p_group_id']            = 'Autorisations actuelles des membres du groupe %s sur la page %s : %s.';
+$lang['p_group_ns']            = 'Autorisations actuelles des membres du groupe %s sur la catégorie %s : %s.';
+$lang['p_choose_id']           = 'Saisissez un nom d\'utilisateur ou de groupe dans le formulaire ci-dessous pour afficher ou éditer les autorisations relatives à la page %s.';
+$lang['p_choose_ns']           = 'Saisissez un nom d\'utilisateur ou de groupe dans le formulaire ci-dessous pour afficher ou éditer les autorisations relatives à la catégorie %s.';
+$lang['p_inherited']           = 'Note : ces autorisations n\'ont pas été explicitement définies mais sont héritées de groupes ou catégories supérieurs.';
+$lang['p_isadmin']             = 'Note : le groupe ou l\'utilisateur sélectionné dispose toujours de toutes les autorisations car il est paramétré en tant que super-utilisateur.';
+$lang['p_include']             = 'Les autorisations les plus élevées incluent les plus faibles. Création, Envoyer et Effacer ne s\'appliquent qu\'aux catégories, pas aux pages.';
+$lang['current']               = 'Contrôles d\'accès actuels';
 $lang['where']                 = 'Page/Catégorie';
 $lang['who']                   = 'Utilisateur/Groupe';
-$lang['perm']                  = 'Permissions';
+$lang['perm']                  = 'Autorisations';
 $lang['acl_perm0']             = 'Aucune';
 $lang['acl_perm1']             = 'Lecture';
 $lang['acl_perm2']             = 'Écriture';
 $lang['acl_perm4']             = 'Création';
-$lang['acl_perm8']             = 'Téléverser';
+$lang['acl_perm8']             = 'Envoyer';
 $lang['acl_perm16']            = 'Effacer';
 $lang['acl_new']               = 'Ajouter une nouvelle entrée';
 $lang['acl_mod']               = 'Modifier l\'entrée';
diff --git a/lib/plugins/config/lang/fr/intro.txt b/lib/plugins/config/lang/fr/intro.txt
index 2a59b34d1..3d71f6184 100644
--- a/lib/plugins/config/lang/fr/intro.txt
+++ b/lib/plugins/config/lang/fr/intro.txt
@@ -1,9 +1,9 @@
 ====== Gestionnaire de configuration ======
 
-Utilisez cette page pour contrôler les paramètres de votre installation de DokuWiki. Pour de l'aide sur chaque paramètre, reportez vous à [[doku>fr:config]]. Pour d'autres détails concernant ce module, reportez vous à [[doku>fr:plugin:config]].
+Utilisez cette page pour contrôler les paramètres de votre installation de DokuWiki. Pour de l'aide sur chaque paramètre, reportez vous à [[doku>fr:config]]. Pour plus de détails concernant cette extension, reportez vous à [[doku>fr:plugin:config]].
 
-Les paramètres affichés sur un fond rouge sont protégés et ne peuvent être modifiés avec ce module. Les paramètres affichés sur un fond bleu sont les valeurs par défaut et les valeurs affectées à votre installation sont affichées sur un fond blanc. Les paramètres bleus et blancs peuvent être modifiés.
+Les paramètres affichés sur un fond rouge sont protégés et ne peuvent être modifiés avec cette extension. Les paramètres affichés sur un fond bleu sont les valeurs par défaut et les valeurs spécifiquement définies pour votre installation sont affichées sur un fond blanc. Seuls les paramètres sur fond bleu ou blanc peuvent être modifiés.
 
-N'oubliez pas d'utiliser le bouton **Enregistrer** avant de quitter cette page, sinon vos modifications seront perdues.
+N'oubliez pas d'utiliser le bouton **ENREGISTRER** avant de quitter cette page, sinon vos modifications ne seront pas prises en compte !
 
 
diff --git a/lib/plugins/config/lang/fr/lang.php b/lib/plugins/config/lang/fr/lang.php
index af2217af5..c4b521497 100644
--- a/lib/plugins/config/lang/fr/lang.php
+++ b/lib/plugins/config/lang/fr/lang.php
@@ -19,18 +19,19 @@
  * @author skimpax@gmail.com
  * @author Yannick Aure 
  * @author Olivier DUVAL 
+ * @author Anael Mobilia 
  */
 $lang['menu']                  = 'Paramètres de configuration';
-$lang['error']                 = 'Paramètres non modifiés en raison d\'une valeur non valide, vérifiez vos réglages et réessayez. 
Les valeurs erronées sont entourées d\'une bordure rouge.'; +$lang['error'] = 'Paramètres non modifiés en raison d\'une valeur invalide, vérifiez vos réglages puis réessayez.
Les valeurs erronées sont entourées d\'une bordure rouge.'; $lang['updated'] = 'Paramètres mis à jour avec succès.'; $lang['nochoice'] = '(aucun autre choix possible)'; -$lang['locked'] = 'Le fichier des paramètres ne peut être modifié, si ceci n\'est pas intentionnel,
vérifiez que le nom et les droits du fichier sont corrects.'; -$lang['danger'] = 'Danger : Modifier cette option pourrait rendre inaccessible votre wiki et son menu de configuration.'; -$lang['warning'] = 'Attention : Modifier cette option pourrait engendrer un comportement indésirable.'; -$lang['security'] = 'Avertissement de sécurité : Modifier cette option pourrait induire un risque de sécurité.'; +$lang['locked'] = 'Le fichier des paramètres ne peut être modifié, si ceci n\'est pas intentionnel,
vérifiez que le nom et les autorisations du fichier sont correctes.'; +$lang['danger'] = 'Danger : modifier cette option pourrait rendre inaccessibles votre wiki et son menu de configuration.'; +$lang['warning'] = 'Attention : modifier cette option pourrait engendrer un comportement indésirable.'; +$lang['security'] = 'Avertissement de sécurité : modifier cette option pourrait induire un risque de sécurité.'; $lang['_configuration_manager'] = 'Gestionnaire de configuration'; $lang['_header_dokuwiki'] = 'Paramètres de DokuWiki'; -$lang['_header_plugin'] = 'Paramètres des modules externes'; +$lang['_header_plugin'] = 'Paramètres des extensions'; $lang['_header_template'] = 'Paramètres des modèles'; $lang['_header_undefined'] = 'Paramètres indéfinis'; $lang['_basic'] = 'Paramètres de base'; @@ -39,54 +40,56 @@ $lang['_authentication'] = 'Paramètres d\'authentification'; $lang['_anti_spam'] = 'Paramètres anti-spam'; $lang['_editing'] = 'Paramètres d\'édition'; $lang['_links'] = 'Paramètres des liens'; -$lang['_media'] = 'Paramètres média'; -$lang['_notifications'] = 'Paramètres de Notification'; -$lang['_syndication'] = 'Paramètres de Syndication'; +$lang['_media'] = 'Paramètres des médias'; +$lang['_notifications'] = 'Paramètres de notification'; +$lang['_syndication'] = 'Paramètres de syndication'; $lang['_advanced'] = 'Paramètres avancés'; $lang['_network'] = 'Paramètres réseaux'; -$lang['_plugin_sufix'] = 'Paramètres de module'; +$lang['_plugin_sufix'] = 'Paramètres d\'extension'; $lang['_template_sufix'] = 'Paramètres de modèle'; -$lang['_msg_setting_undefined'] = 'Pas de métadonnée de paramètres.'; -$lang['_msg_setting_no_class'] = 'Pas de classe de paramètres.'; +$lang['_msg_setting_undefined'] = 'Pas de définition de métadonnées'; +$lang['_msg_setting_no_class'] = 'Pas de définition de paramètres.'; $lang['_msg_setting_no_default'] = 'Pas de valeur par défaut.'; -$lang['title'] = 'Titre du wiki'; -$lang['start'] = 'Nom de la page d\'accueil'; -$lang['lang'] = 'Langue'; -$lang['template'] = 'Modèle'; -$lang['license'] = 'Sous quelle licence doit être placé le contenu ?'; -$lang['savedir'] = 'Répertoire de stockage'; -$lang['basedir'] = 'Répertoire de base (ex. : /dokuwiki/). Laisser vide pour une détection automatique.'; -$lang['baseurl'] = 'URL de base. Laisser vide pour une détection automatique.'; +$lang['title'] = 'Titre du wiki (nom du wiki)'; +$lang['start'] = 'Nom de la page d\'accueil à utiliser pour toutes les catégories'; +$lang['lang'] = 'Langue de l\'interface'; +$lang['template'] = 'Modèle (rendu visuel du wiki)'; +$lang['tagline'] = 'Descriptif du site (si le modèle supporte cette fonctionnalité)'; +$lang['sidebar'] = 'Nom du panneau latéral (si le modèle supporte cette fonctionnalité). Laisser le champ vide désactive le panneau latéral.'; +$lang['license'] = 'Sous quelle licence doit-être placé le contenu ?'; +$lang['savedir'] = 'Répertoire d\'enregistrement des données'; +$lang['basedir'] = 'Répertoire de base du serveur (par exemple : /dokuwiki/). Laisser vide pour une détection automatique.'; +$lang['baseurl'] = 'URL de base du site (par exemple http://www.example.com). Laisser vide pour une détection automatique.'; $lang['cookiedir'] = 'Chemin des cookies. Laissez vide pour utiliser l\'URL de base.'; $lang['dmode'] = 'Mode de création des répertoires'; $lang['fmode'] = 'Mode de création des fichiers'; $lang['allowdebug'] = 'Debug (Ne l\'activez que si vous en avez besoin !)'; -$lang['recent'] = 'Nombre de derniers changements à afficher'; +$lang['recent'] = 'Nombre de lignes à afficher - par page - pour les derniers changements'; $lang['recent_days'] = 'Signaler les pages modifiées depuis (en jours)'; -$lang['breadcrumbs'] = 'Nombre de traces à afficher'; -$lang['youarehere'] = 'Traces hiérarchiques'; -$lang['fullpath'] = 'Utiliser le chemin complet dans le pied de page'; +$lang['breadcrumbs'] = 'Nombre de traces à afficher. 0 désactive cette fonctionnalité.'; +$lang['youarehere'] = 'Utiliser des traces hiérarchiques (vous voulez probablement désactiver l\'option ci-dessus)'; +$lang['fullpath'] = 'Afficher le chemin complet des pages dans le pied de page'; $lang['typography'] = 'Effectuer des améliorations typographiques'; $lang['dformat'] = 'Format de date (cf. fonction strftime de PHP)'; -$lang['signature'] = 'Signature'; -$lang['showuseras'] = 'Qu\'afficher en montrant les utilisateurs qui ont récemment modifié la page'; +$lang['signature'] = 'Données à insérer lors de l\'utilisation du bouton « signature » dans l\'éditeur'; +$lang['showuseras'] = 'Données à afficher concernant le dernier utilisateur ayant modifié une page'; $lang['toptoclevel'] = 'Niveau le plus haut à afficher dans la table des matières'; -$lang['tocminheads'] = 'Nombre minimum de titres pour qu\'une table des matières soit construite'; +$lang['tocminheads'] = 'Nombre minimum de titres pour qu\'une table des matières soit affichée'; $lang['maxtoclevel'] = 'Niveau maximum pour figurer dans la table des matières'; $lang['maxseclevel'] = 'Niveau maximum pour modifier des sections'; -$lang['camelcase'] = 'Utiliser CamelCase pour les liens'; +$lang['camelcase'] = 'Utiliser l\'affichage «CamelCase » pour les liens'; $lang['deaccent'] = 'Retirer les accents dans les noms de pages'; -$lang['useheading'] = 'Utiliser le titre de premier niveau'; -$lang['sneaky_index'] = 'Par défaut, DokuWiki affichera toutes les catégories dans la vue par index. Activer cette option permet de cacher celles pour lesquelles l\'utilisateur n\'a pas la permission de lecture. Il peut en résulter le masquage de sous-catégories accessibles. Ceci peut rendre l\'index inutilisable avec certaines ACL.'; +$lang['useheading'] = 'Utiliser le titre de premier niveau pour le nom de la page'; +$lang['sneaky_index'] = 'Par défaut, DokuWiki affichera toutes les catégories dans la vue par index. Activer cette option permet de cacher les catégories pour lesquelles l\'utilisateur n\'a pas l\'autorisation de lecture. Il peut en résulter le masquage de sous-catégories accessibles. Ceci peut rendre l\'index inutilisable avec certains contrôles d\'accès.'; $lang['hidepages'] = 'Cacher les pages correspondant à (expression régulière)'; $lang['useacl'] = 'Utiliser les listes de contrôle d\'accès (ACL)'; $lang['autopasswd'] = 'Auto-générer les mots de passe'; $lang['authtype'] = 'Mécanisme d\'authentification'; $lang['passcrypt'] = 'Méthode de chiffrement des mots de passe'; -$lang['defaultgroup'] = 'Groupe par défaut'; -$lang['superuser'] = 'Superuser - groupe, utilisateur ou liste séparée par des virgules user1,@group1,user2 ayant un accès complet à toutes les pages quelque soit le paramétrage des ACL'; -$lang['manager'] = 'Manager - groupe, utilisateur ou liste séparée par des virgules user1,@group1,user2 ayant accès à certaines fonctions de gestion'; -$lang['profileconfirm'] = 'Confirmer par mot de passe les modifications de profil'; +$lang['defaultgroup'] = 'Groupe par défaut : tous les nouveaux utilisateurs y seront affectés'; +$lang['superuser'] = 'Super-utilisateur : groupe, utilisateur ou liste séparée par des virgules utilisateur1,@groupe1,utilisateur2 ayant un accès complet à toutes les pages quelque soit le paramétrage des contrôle d\'accès'; +$lang['manager'] = 'Manager:- groupe, utilisateur ou liste séparée par des virgules utilisateur1,@groupe1,utilisateur2 ayant accès à certaines fonctionnalités de gestion'; +$lang['profileconfirm'] = 'Confirmer les modifications de profil par la saisie du mot de passe '; $lang['rememberme'] = 'Permettre de conserver de manière permanente les cookies de connexion (mémoriser)'; $lang['disableactions'] = 'Actions à désactiver dans DokuWiki'; $lang['disableactions_check'] = 'Vérifier'; @@ -94,74 +97,76 @@ $lang['disableactions_subscription'] = 'Abonnement aux pages'; $lang['disableactions_wikicode'] = 'Afficher le texte source'; $lang['disableactions_other'] = 'Autres actions (séparées par des virgules)'; $lang['auth_security_timeout'] = 'Délai d\'expiration de sécurité (secondes)'; -$lang['securecookie'] = 'Les cookies mis via HTTPS doivent-ils n\'être envoyé par le navigateur que via HTTPS ? Ne désactivez cette option que si la connexion à votre wiki est sécurisée avec SSL mais que la navigation sur le wiki n\'est pas sécurisée.'; -$lang['remote'] = 'Active l\'API système distante. Ceci autorise d\'autres applications à accéder au wiki via XML-RPC ou d\'autres mécanismes.'; -$lang['remoteuser'] = 'Restreindre l\'accès à l\'API par une liste de groupes ou d\'utilisateurs séparés par une virgule. Laisser vide pour donner l\'accès à n\'importe qui.'; +$lang['securecookie'] = 'Les cookies définis via HTTPS doivent-ils n\'être envoyé par le navigateur que via HTTPS ? Désactivez cette option lorsque seule la connexion à votre wiki est sécurisée avec SSL et que la navigation sur le wiki est effectuée de manière non sécurisée.'; +$lang['remote'] = 'Active l\'API système distante. Ceci permet à d\'autres applications d\'accéder au wiki via XML-RPC ou d\'autres mécanismes.'; +$lang['remoteuser'] = 'Restreindre l\'accès à l\'API à une liste de groupes ou d\'utilisateurs (séparés par une virgule). Laisser vide pour donner l\'accès tout le monde.'; $lang['usewordblock'] = 'Bloquer le spam selon les mots utilisés'; -$lang['relnofollow'] = 'Utiliser rel="nofollow" sur les liens extérieurs'; -$lang['indexdelay'] = 'Délai avant l\'indexation (en secondes)'; -$lang['mailguard'] = 'Brouiller les adresses de courriel'; -$lang['iexssprotect'] = 'Vérifier la présence de code JavaScript ou HTML malveillant dans les fichiers envoyés'; +$lang['relnofollow'] = 'Utiliser l\'attribut « rel="nofollow" » sur les liens extérieurs'; +$lang['indexdelay'] = 'Délai avant l\'indexation (secondes)'; +$lang['mailguard'] = 'Cacher les adresses de courriel'; +$lang['iexssprotect'] = 'Vérifier, dans les fichiers envoyés, la présence de code JavaScript ou HTML malveillant'; $lang['usedraft'] = 'Enregistrer automatiquement un brouillon pendant l\'édition'; -$lang['htmlok'] = 'Permettre HTML dans les pages'; -$lang['phpok'] = 'Permettre PHP dans les pages'; -$lang['locktime'] = 'Âge maximum des fichiers verrous (en secondes)'; -$lang['cachetime'] = 'Âge maximum d\'un fichier en cache (en secondes)'; +$lang['htmlok'] = 'Permettre l\'utilisation de code HTML dans les pages'; +$lang['phpok'] = 'Permettre l\'utilisation de code PHP dans les pages'; +$lang['locktime'] = 'Âge maximum des fichiers de blocage (secondes)'; +$lang['cachetime'] = 'Âge maximum d\'un fichier en cache (secondes)'; $lang['target____wiki'] = 'Cible pour liens internes'; $lang['target____interwiki'] = 'Cible pour liens interwiki'; $lang['target____extern'] = 'Cible pour liens externes'; $lang['target____media'] = 'Cible pour liens média'; $lang['target____windows'] = 'Cible pour liens vers partages Windows'; $lang['mediarevisions'] = 'Activer les révisions (gestion de versions) des médias'; -$lang['refcheck'] = 'Vérifier les références de média'; -$lang['refshow'] = 'Nombre de références de média à montrer'; -$lang['gdlib'] = 'Version de GD Lib'; -$lang['im_convert'] = 'Chemin vers l\'outil de conversion d\'ImageMagick'; +$lang['refcheck'] = 'Vérifier si un média est toujours utilisé avant de le supprimer'; +$lang['refshow'] = 'Nombre de références de média à montrer lorsque le paramètre précédent est actif'; +$lang['gdlib'] = 'Version de la librairie GD'; +$lang['im_convert'] = 'Chemin vers l\'outil de conversion ImageMagick'; $lang['jpg_quality'] = 'Qualité de la compression JPEG (0-100)'; -$lang['fetchsize'] = 'Taille maximale (en octets) du fichier que fetch.php peut télécharger'; +$lang['fetchsize'] = 'Taille maximale (en octets) que fetch.php peut télécharger depuis une URL tierce (par exemple pour conserver en cache et redimensionner une image tierce)'; $lang['subscribers'] = 'Activer l\'abonnement aux pages'; -$lang['subscribe_time'] = 'Délai après lequel les listes d\'abonnement et résumés sont envoyés (en secondes). Devrait être plus petit que le délai précisé dans recent_days.'; -$lang['notify'] = 'Notifier les modifications à cette adresse de courriel'; -$lang['registernotify'] = 'Envoyer un courriel annonçant les nouveaux utilisateurs enregistrés à cette adresse'; -$lang['mailfrom'] = 'Expéditeur des notifications par courriel du wiki'; -$lang['mailprefix'] = 'Préfixe à utiliser dans les objets des courriels automatiques'; -$lang['sitemap'] = 'Fréquence de génération une carte Google du site (en jours)'; -$lang['rss_type'] = 'Type de flux RSS'; -$lang['rss_linkto'] = 'Lien du flux RSS vers'; -$lang['rss_content'] = 'Quel contenu afficher dans le flux RSS ?'; -$lang['rss_update'] = 'Fréquence de mise à jour du flux RSS (en secondes)'; +$lang['subscribe_time'] = 'Délai après lequel les listes d\'abonnement et résumés sont expédiés (en secondes). Devrait être plus petit que le délai précisé dans recent_days.'; +$lang['notify'] = 'Notifier systématiquement les modifications à cette adresse de courriel'; +$lang['registernotify'] = 'Notifier systématiquement les nouveaux utilisateurs enregistrés à cette adresse de courriel'; +$lang['mailfrom'] = 'Adresse de courriel de l\'expéditeur des notifications par courriel du wiki'; +$lang['mailprefix'] = 'Préfixe à utiliser dans les objets des courriels automatiques. Laisser vide pour utiliser le titre du wiki'; +$lang['htmlmail'] = 'Envoyer des courriel HTML multipart (visuellement plus agréable, mais plus lourd). Désactiver pour utiliser uniquement des courriel plain text'; +$lang['sitemap'] = 'Fréquence de génération du sitemap Google (jours). 0 pour désactiver'; +$lang['rss_type'] = 'Type de flux XML (RSS)'; +$lang['rss_linkto'] = 'Lien du flux XML vers'; +$lang['rss_content'] = 'Quel contenu afficher dans le flux XML?'; +$lang['rss_update'] = 'Fréquence de mise à jour du flux XML (secondes)'; $lang['rss_show_summary'] = 'Le flux XML affiche le résumé dans le titre'; -$lang['rss_media'] = 'Quels types de changements devraient être listés dans le flux XML?'; -$lang['updatecheck'] = 'Vérifier les mises à jour ? DokuWiki doit pouvoir contacter update.dokuwiki.org.'; -$lang['userewrite'] = 'URL esthétiques'; -$lang['useslash'] = 'Utiliser « / » comme séparateur de catégorie dans les URL'; +$lang['rss_media'] = 'Quels types de changements doivent être listés dans le flux XML?'; +$lang['updatecheck'] = 'Vérifier les mises à jour et alertes de sécurité? DokuWiki doit pouvoir contacter update.dokuwiki.org'; +$lang['userewrite'] = 'Utiliser des URL esthétiques'; +$lang['useslash'] = 'Utiliser « / » comme séparateur de catégories dans les URL'; $lang['sepchar'] = 'Séparateur de mots dans les noms de page'; $lang['canonical'] = 'Utiliser des URL canoniques'; $lang['fnencode'] = 'Méthode pour l\'encodage des fichiers non-ASCII'; $lang['autoplural'] = 'Rechercher les formes plurielles dans les liens'; -$lang['compression'] = 'Méthode de compression pour les fichiers dans attic'; -$lang['gzip_output'] = 'Utiliser Content-Encoding gzip pour XHTML'; -$lang['compress'] = 'Compresser CSS et JavaScript'; -$lang['cssdatauri'] = 'Taille maximale en octets pour inclure dans les feuilles de styles CSS, les images qui y sont référencées. Cette technique minimise les requêtes HTTP. Pour IE, ceci ne fonctionne qu\'à partir de la version 8 ! Valeurs correctes entre 400 et 600. 0 pour désactiver.'; -$lang['send404'] = 'Renvoyer "HTTP 404/Page Non Trouvée" pour les pages introuvables'; +$lang['compression'] = 'Méthode de compression pour les fichiers attic'; +$lang['gzip_output'] = 'Utiliser gzip pour le Content-Encoding du XHTML'; +$lang['compress'] = 'Compresser les flux CSS et JavaScript'; +$lang['cssdatauri'] = 'Taille maximale en octets pour inclure dans les feuilles de styles CSS les images qui y sont référencées. Cette technique réduit le nombre de requêtes HTTP. Cette fonctionnalité ne fonctionne qu\'à partir de la version 8 d\'Internet Explorer! Nous recommandons une valeur entre 400 et 600. 0 pour désactiver.'; +$lang['send404'] = 'Renvoyer « HTTP 404/Page Not Found » pour les pages inexistantes'; $lang['broken_iua'] = 'La fonction ignore_user_abort est-elle opérationnelle sur votre système ? Ceci peut empêcher le fonctionnement de l\'index de recherche. IIS+PHP/ -CGI dysfonctionne. Voir le bug 852 pour plus d\'info.'; -$lang['xsendfile'] = 'Utiliser l\'en-tête X-Sendfile pour permettre au serveur Web de délivrer des fichiers statiques ? Votre serveur Web doit supporter cette fonctionnalité.'; +CGI dysfonctionne. Voir le bug 852 pour plus d\'informations.'; +$lang['xsendfile'] = 'Utiliser l\'en-tête X-Sendfile pour permettre au serveur web de délivrer les fichiers statiques ? Votre serveur web doit supporter cette fonctionnalité.'; $lang['renderer_xhtml'] = 'Moteur de rendu du format de sortie principal (XHTML)'; -$lang['renderer__core'] = '%s (cœur de dokuwiki)'; -$lang['renderer__plugin'] = '%s (module externe)'; -$lang['proxy____host'] = 'Proxy - Serveur hôte'; -$lang['proxy____port'] = 'Proxy - Numéro de port'; -$lang['proxy____user'] = 'Proxy - Identifiant'; -$lang['proxy____pass'] = 'Proxy - Mot de passe'; -$lang['proxy____ssl'] = 'Proxy - Utilisation de SSL'; -$lang['proxy____except'] = 'Expression régulière de test des URLs pour lesquelles le proxy ne devrait pas être utilisé.'; +$lang['renderer__core'] = '%s (cœur de DokuWiki)'; +$lang['renderer__plugin'] = '%s (extension)'; +$lang['dnslookups'] = 'DokuWiki effectuera une résolution du nom d\'hôte sur les adresses IP des utilisateurs modifiant des pages. Si vous ne possédez pas de serveur DNS, que ce dernier est lent ou que vous ne souhaitez pas utiliser cette fonctionnalité : désactivez-la.'; +$lang['proxy____host'] = 'Mandataire (proxy) - Hôte'; +$lang['proxy____port'] = 'Mandataire - Port'; +$lang['proxy____user'] = 'Mandataire - Identifiant'; +$lang['proxy____pass'] = 'Mandataire - Mot de passe'; +$lang['proxy____ssl'] = 'Mandataire - Utilisation de SSL'; +$lang['proxy____except'] = 'Mandataire - Expression régulière de test des URLs pour lesquelles le mandataire (proxy) ne doit pas être utilisé.'; $lang['safemodehack'] = 'Activer l\'option Mode sans échec'; -$lang['ftp____host'] = 'FTP - Serveur hôte pour Mode sans échec'; -$lang['ftp____port'] = 'FTP - Numéro de port pour Mode sans échec'; -$lang['ftp____user'] = 'FTP - Identifiant pour Mode sans échec'; -$lang['ftp____pass'] = 'FTP - Mot de passe pour Mode sans échec'; -$lang['ftp____root'] = 'FTP - Répertoire racine pour Mode sans échec'; +$lang['ftp____host'] = 'FTP / Mode sans échec - Serveur hôte'; +$lang['ftp____port'] = 'FTP / Mode sans échec - Port'; +$lang['ftp____user'] = 'FTP / Mode sans échec - Identifiant'; +$lang['ftp____pass'] = 'FTP / Mode sans échec - Mot de passe'; +$lang['ftp____root'] = 'FTP / Mode sans échec - Répertoire racine'; $lang['license_o_'] = 'Aucune choisie'; $lang['typography_o_0'] = 'aucun'; $lang['typography_o_1'] = 'guillemets uniquement'; @@ -171,7 +176,7 @@ $lang['userewrite_o_1'] = 'Fichier .htaccess'; $lang['userewrite_o_2'] = 'Interne à DokuWiki'; $lang['deaccent_o_0'] = 'off'; $lang['deaccent_o_1'] = 'supprimer les accents'; -$lang['deaccent_o_2'] = 'convertir en roman'; +$lang['deaccent_o_2'] = 'convertir en caractères latins'; $lang['gdlib_o_0'] = 'Librairie GD non disponible'; $lang['gdlib_o_1'] = 'version 1.x'; $lang['gdlib_o_2'] = 'auto-détectée'; diff --git a/lib/plugins/plugin/lang/fr/admin_plugin.txt b/lib/plugins/plugin/lang/fr/admin_plugin.txt index f90b627f3..b7beba25a 100644 --- a/lib/plugins/plugin/lang/fr/admin_plugin.txt +++ b/lib/plugins/plugin/lang/fr/admin_plugin.txt @@ -1,4 +1,4 @@ -====== Gestion des modules externes ====== +====== Gestion des extensions ====== -Cette page vous permet de gérer tout ce qui a trait aux [[doku>fr:plugins|modules externes]] de DokuWiki. Pour télécharger et installer un module, le répertoire « ''plugin'' » doit être accessible en écriture pour le serveur Web. +Cette page vous permet de gérer tout ce qui a trait aux [[doku>fr:plugins|extensions]] de DokuWiki. Pour pouvoir télécharger et installer un module, le répertoire « ''plugin'' » doit être accessible en écriture pour le serveur web. diff --git a/lib/plugins/plugin/lang/fr/lang.php b/lib/plugins/plugin/lang/fr/lang.php index 31d524cc6..06cd1ab8d 100644 --- a/lib/plugins/plugin/lang/fr/lang.php +++ b/lib/plugins/plugin/lang/fr/lang.php @@ -19,10 +19,11 @@ * @author skimpax@gmail.com * @author Yannick Aure * @author Olivier DUVAL + * @author Anael Mobilia */ -$lang['menu'] = 'Gestion des modules externes'; -$lang['download'] = 'Télécharger et installer un nouveau module'; -$lang['manage'] = 'Modules installés'; +$lang['menu'] = 'Gestion des extensions'; +$lang['download'] = 'Télécharger et installer une nouvelle extension'; +$lang['manage'] = 'Extensions installées'; $lang['btn_info'] = 'Info'; $lang['btn_update'] = 'Mettre à jour'; $lang['btn_delete'] = 'Supprimer'; @@ -35,18 +36,18 @@ $lang['lastupdate'] = 'Dernière mise à jour :'; $lang['source'] = 'Source :'; $lang['unknown'] = 'inconnu'; $lang['updating'] = 'Mise à jour…'; -$lang['updated'] = 'Modules %s mis à jour avec succès'; -$lang['updates'] = 'Les modules suivants ont été mis à jour avec succès'; +$lang['updated'] = 'Extension %s mise à jour avec succès'; +$lang['updates'] = 'Les extensions suivantes ont été mises à jour avec succès'; $lang['update_none'] = 'Aucune mise à jour n\'a été trouvée.'; $lang['deleting'] = 'Suppression…'; -$lang['deleted'] = 'Module %s supprimé.'; +$lang['deleted'] = 'Extension %s supprimée.'; $lang['downloading'] = 'Téléchargement…'; -$lang['downloaded'] = 'Module %s installé avec succès'; -$lang['downloads'] = 'Les modules suivants ont été installés avec succès :'; -$lang['download_none'] = 'Aucun module n\'était trouvé, ou un problème inconnu est survenu durant le téléchargement et l\'installation.'; -$lang['plugin'] = 'Module :'; +$lang['downloaded'] = 'Extension %s installée avec succès'; +$lang['downloads'] = 'Les extensions suivantes ont été installées avec succès :'; +$lang['download_none'] = 'Aucune extension n\'a été trouvée, ou un problème inconnu est survenu durant le téléchargement et l\'installation.'; +$lang['plugin'] = 'Extension :'; $lang['components'] = 'Composants'; -$lang['noinfo'] = 'Ce module externe n\'a transmis aucune information, il pourrait être invalide.'; +$lang['noinfo'] = 'Cette extension n\'a transmis aucune information, elle pourrait être invalide.'; $lang['name'] = 'Nom :'; $lang['date'] = 'Date :'; $lang['type'] = 'Type :'; @@ -54,14 +55,14 @@ $lang['desc'] = 'Description :'; $lang['author'] = 'Auteur :'; $lang['www'] = 'Site web :'; $lang['error'] = 'Une erreur inconnue est survenue.'; -$lang['error_download'] = 'Impossible de télécharger le fichier du module : %s'; -$lang['error_badurl'] = 'URL suspecte. Impossible de déterminer le nom du fichier à partir de l\'URL'; -$lang['error_dircreate'] = 'Impossible de créer le répertoire temporaire pour réceptionner le téléchargement'; -$lang['error_decompress'] = 'Le gestionnaire de modules externes a été incapable de décompresser le fichier téléchargé. Ceci peut être le résultat d\'un mauvais téléchargement, auquel cas vous devriez réessayer ; ou bien le format de compression est inconnu, auquel cas vous devez télécharger et installer le module manuellement.'; -$lang['error_copy'] = 'Une erreur de copie est survenue lors de l\'installation des fichiers du module %s : votre disque est peut-être plein ou les droits d\'accès au fichier sont incorrects. Il a pu en résulter une installation partielle du module rendant votre installation du wiki instable.'; -$lang['error_delete'] = 'Une erreur est survenue à la suppression du module %s. La raison la plus probable est l\'insuffisance des droits sur les fichiers ou le répertoire.'; -$lang['enabled'] = 'Module %s activé.'; -$lang['notenabled'] = 'Le module %s n\'a pas pu être activé, vérifiez le fichier des permissions.'; -$lang['disabled'] = 'Module %s désactivé.'; -$lang['notdisabled'] = 'Le module %s n\'a pas pu être désactivé, vérifiez le fichier des permissions.'; -$lang['packageinstalled'] = 'Ensemble de modules (%d module(s): %s) installé avec succès.'; +$lang['error_download'] = 'Impossible de télécharger le fichier de l\'extension : %s'; +$lang['error_badurl'] = 'URL suspecte : impossible de déterminer le nom du fichier à partir de l\'URL'; +$lang['error_dircreate'] = 'Impossible de créer le répertoire temporaire pour effectuer le téléchargement'; +$lang['error_decompress'] = 'Le gestionnaire d\'extensions a été incapable de décompresser le fichier téléchargé. Ceci peut être le résultat d\'un mauvais téléchargement, auquel cas vous devriez réessayer ; ou bien le format de compression est inconnu, auquel cas vous devez télécharger et installer l\'extension manuellement.'; +$lang['error_copy'] = 'Une erreur de copie est survenue lors de l\'installation des fichiers de l\'extension %s : le disque est peut-être plein ou les autorisations d\'accès sont incorrects. Il a pu en résulter une installation partielle de l\'extension et laisser votre installation du wiki instable.'; +$lang['error_delete'] = 'Une erreur est survenue lors de la suppression de l\'extension %s. La raison la plus probable est l\'insuffisance des autorisations sur les fichiers ou les répertoires.'; +$lang['enabled'] = 'Extension %s activée.'; +$lang['notenabled'] = 'L\'extension %s n\'a pas pu être activée, vérifiez les autorisations des fichiers.'; +$lang['disabled'] = 'Extension %s désactivée.'; +$lang['notdisabled'] = 'L\'extension %s n\'a pas pu être désactivée, vérifiez les autorisations des fichiers.'; +$lang['packageinstalled'] = 'Ensemble d\'extensions (%d extension(s): %s) installé avec succès.'; diff --git a/lib/plugins/popularity/lang/fr/intro.txt b/lib/plugins/popularity/lang/fr/intro.txt index 041e65d69..598523492 100644 --- a/lib/plugins/popularity/lang/fr/intro.txt +++ b/lib/plugins/popularity/lang/fr/intro.txt @@ -1,10 +1,10 @@ ====== Enquête de popularité ====== -Cet [[doku>popularity|outil]] collecte des données anonymes concernant votre wiki et vous permet de les expédier aux développeurs de DokuWiki. Ceci leur permet de mieux comprendre comment DokuWiki est employé par ses utilisateurs et d'orienter les décisions sur les développements futurs en tenant compte des statistiques d'usage réel. +Cet [[doku>popularity|outil]] collecte des données anonymes concernant votre wiki et vous permet de les expédier aux développeurs de DokuWiki. Ceci leur permet de mieux comprendre comment DokuWiki est utilisé par ses utilisateurs et d'orienter les décisions sur les développements futurs en tenant compte des statistiques d'usage réel. -Vous êtes encouragé à répéter l'opération de collecte et d'envoi des données anonymes de temps en temps afin d'informer les développeurs de la croissance de votre wiki. +Vous êtes encouragé à répéter cette opération de temps à autres afin de tenir informés les développeurs de l'évolution de votre wiki. L'ensemble de vos contributions seront recensées via un identifiant anonyme. -Les données collectées contiennent des informations telle que votre version de DokuWiki, le nombre et la taille de vos pages et fichiers, les modules installés ainsi que des informations sur la version de PHP installée. +Les données collectées contiennent des informations telles votre version de DokuWiki, le nombre et la taille de vos pages et fichiers, les extensions installées ainsi que des informations sur la version de PHP installée. Les données brutes qui sont envoyées sont affichées ci dessous. Merci d'utiliser le bouton « Envoyer les données » pour expédier l'information. diff --git a/lib/plugins/popularity/lang/fr/lang.php b/lib/plugins/popularity/lang/fr/lang.php index 904987079..d5bc92081 100644 --- a/lib/plugins/popularity/lang/fr/lang.php +++ b/lib/plugins/popularity/lang/fr/lang.php @@ -16,11 +16,12 @@ * @author skimpax@gmail.com * @author Yannick Aure * @author Olivier DUVAL + * @author Anael Mobilia */ $lang['name'] = 'Enquête de popularité (peut nécessiter un certain temps pour être chargée)'; $lang['submit'] = 'Envoyer les données'; -$lang['autosubmit'] = 'Envoyer les données automatiquement chaque mois'; -$lang['submissionFailed'] = 'Les données ne peuvent pas être envoyées à cause des erreurs suivantes :'; -$lang['submitDirectly'] = 'Vous pouvez envoyer le données manuellement en soumettant ce formulaire.'; +$lang['autosubmit'] = 'Envoyer les données automatiquement une fois par mois'; +$lang['submissionFailed'] = 'Les données ne peuvent pas être expédiées à cause des erreurs suivantes :'; +$lang['submitDirectly'] = 'Vous pouvez envoyer les données manuellement en soumettant ce formulaire.'; $lang['autosubmitError'] = 'La dernière soumission automatique a échoué pour les raisons suivantes :'; -$lang['lastSent'] = 'Les données ont été envoyées '; +$lang['lastSent'] = 'Les données ont été expédiées'; diff --git a/lib/plugins/popularity/lang/fr/submitted.txt b/lib/plugins/popularity/lang/fr/submitted.txt index 0bc4cfe71..edb5e21f6 100644 --- a/lib/plugins/popularity/lang/fr/submitted.txt +++ b/lib/plugins/popularity/lang/fr/submitted.txt @@ -1,2 +1,3 @@ ====== Enquête de popularité ====== -Les données ont été envoyées avec succès. \ No newline at end of file + +Les données ont été expédiées avec succès. \ No newline at end of file diff --git a/lib/plugins/revert/lang/fr/intro.txt b/lib/plugins/revert/lang/fr/intro.txt index 6dcbe74b9..30e6d8a51 100644 --- a/lib/plugins/revert/lang/fr/intro.txt +++ b/lib/plugins/revert/lang/fr/intro.txt @@ -1,3 +1,3 @@ -====== Gestionnaire de réversions ====== +====== Gestionnaire des réversions ====== -Cette page peut vous aider à restaurer des pages après une attaque de spam. Pour trouver la liste des pages vandalisées, entrez un motif de recherche (p. ex. une URL de spam), puis confirmez que les pages trouvées contiennent du spam et annulez leurs éditions. +Cette page vous aide à restaurer des pages après une attaque de spam. Pour trouver la liste des pages vandalisées, entrez un motif de recherche (par exemple : une URL de spam), puis confirmez que les pages trouvées contiennent du spam et annulez leur modifications. diff --git a/lib/plugins/revert/lang/fr/lang.php b/lib/plugins/revert/lang/fr/lang.php index 253e0c96e..07b012e38 100644 --- a/lib/plugins/revert/lang/fr/lang.php +++ b/lib/plugins/revert/lang/fr/lang.php @@ -17,13 +17,14 @@ * @author skimpax@gmail.com * @author Yannick Aure * @author Olivier DUVAL + * @author Anael Mobilia */ -$lang['menu'] = 'Gestionnaire de réversions'; +$lang['menu'] = 'Gestionnaire des réversions'; $lang['filter'] = 'Trouver les pages spammées '; $lang['revert'] = 'Annuler les modifications sélectionnées'; $lang['reverted'] = '%s restauré à la révision %s'; $lang['removed'] = '%s supprimé'; -$lang['revstart'] = 'Processus de réversion démarré. Ceci peut prendre longtemps. Si le script dépasse le délai avant de terminer, vous devrez restaurer de plus petits groupes de pages.'; +$lang['revstart'] = 'Processus de réversion démarré. Ceci peut durer longtemps. Si le script dépasse le délai d\'exécution avant de finir, vous devrez restaurer de plus petits groupes de pages.'; $lang['revstop'] = 'Processus de réversion terminé avec succès.'; -$lang['note1'] = 'Note : cette recherche est insensible à la casse'; -$lang['note2'] = 'Note : cette page sera révisée à la version précédente ne contenant pas le terme spammeur %s.'; +$lang['note1'] = 'Note : cette recherche est sensible à la casse'; +$lang['note2'] = 'Note : cette page sera restaurée à la dernière version ne contenant pas le terme « spam » %s.'; diff --git a/lib/plugins/usermanager/lang/fr/edit.txt b/lib/plugins/usermanager/lang/fr/edit.txt index ec193eb5a..e667989b4 100644 --- a/lib/plugins/usermanager/lang/fr/edit.txt +++ b/lib/plugins/usermanager/lang/fr/edit.txt @@ -1 +1 @@ -===== Modifier les informations d'un utilisateur ===== +===== Modifier l'utilisateur ===== diff --git a/lib/plugins/usermanager/lang/fr/lang.php b/lib/plugins/usermanager/lang/fr/lang.php index d84ff65c3..7e602d0ce 100644 --- a/lib/plugins/usermanager/lang/fr/lang.php +++ b/lib/plugins/usermanager/lang/fr/lang.php @@ -18,10 +18,11 @@ * @author skimpax@gmail.com * @author Yannick Aure * @author Olivier DUVAL + * @author Anael Mobilia */ $lang['menu'] = 'Gestion des utilisateurs'; -$lang['noauth'] = '(authentification utilisateur non disponible)'; -$lang['nosupport'] = '(gestion utilisateur non supportée)'; +$lang['noauth'] = '(authentification de l\'utilisateur non disponible)'; +$lang['nosupport'] = '(gestion de l\'utilisateur non supportée)'; $lang['badauth'] = 'mécanisme d\'authentification invalide'; $lang['user_id'] = 'Identifiant '; $lang['user_pass'] = 'Mot de passe '; @@ -40,20 +41,20 @@ $lang['search'] = 'Rechercher'; $lang['search_prompt'] = 'Effectuer la recherche'; $lang['clear'] = 'Réinitialiser la recherche'; $lang['filter'] = 'Filtre'; -$lang['summary'] = 'Affichage des utilisateurs %1$d-%2$d parmi %3$d trouvé(s). %4$d utilisateur(s) au total.'; -$lang['nonefound'] = 'Aucun utilisateur trouvé. %d utilisateur(s) au total.'; +$lang['summary'] = 'Affichage des utilisateurs %1$d-%2$d parmi %3$d trouvés. %4$d utilisateurs au total.'; +$lang['nonefound'] = 'Aucun utilisateur trouvé. %d utilisateurs au total.'; $lang['delete_ok'] = '%d utilisateurs effacés'; -$lang['delete_fail'] = '%d effacement échoué.'; +$lang['delete_fail'] = '%d effacements échoués.'; $lang['update_ok'] = 'Utilisateur mis à jour avec succès'; -$lang['update_fail'] = 'Échec de la mise à jour utilisateur'; -$lang['update_exists'] = 'Échec du changement de nom d\'utilisateur, le nom spécifié (%s) existe déjà (toutes les autres modifications seront effectuées).'; -$lang['start'] = 'Démarrage'; +$lang['update_fail'] = 'Échec lors de la mise à jour de l\'utilisateur'; +$lang['update_exists'] = 'Échec lors du changement du nom d\'utilisateur : le nom spécifié (%s) existe déjà (toutes les autres modifications seront effectuées).'; +$lang['start'] = 'Début'; $lang['prev'] = 'Précédent'; $lang['next'] = 'Suivant'; -$lang['last'] = 'Dernier'; +$lang['last'] = 'Fin'; $lang['edit_usermissing'] = 'Utilisateur sélectionné non trouvé, cet utilisateur a peut-être été supprimé ou modifié ailleurs.'; $lang['user_notify'] = 'Notifier l\'utilisateur '; -$lang['note_notify'] = 'Envoi de notification par courriel uniquement lorsqu\'un nouveau mot de passe est attribué à l\'utilisateur.'; +$lang['note_notify'] = 'Expédition de notification par courriel uniquement lorsque l\'utilisateur fourni un nouveau mot de passe.'; $lang['note_group'] = 'Les nouveaux utilisateurs seront ajoutés au groupe par défaut (%s) si aucun groupe n\'est spécifié.'; $lang['note_pass'] = 'Le mot de passe sera généré automatiquement si le champ est laissé vide et si la notification de l\'utilisateur est activée.'; $lang['add_ok'] = 'Utilisateur ajouté avec succès'; -- cgit v1.2.3 From 8ca91870d51c8a06a61e4ea7be859abbe6ba00e5 Mon Sep 17 00:00:00 2001 From: Anika Henke Date: Wed, 14 Nov 2012 00:31:22 +0000 Subject: added another place to look for logo to make it more consistent (FS#2656) --- lib/tpl/dokuwiki/tpl_header.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'lib') diff --git a/lib/tpl/dokuwiki/tpl_header.php b/lib/tpl/dokuwiki/tpl_header.php index 0704aa271..19d165059 100644 --- a/lib/tpl/dokuwiki/tpl_header.php +++ b/lib/tpl/dokuwiki/tpl_header.php @@ -20,7 +20,7 @@ if (!defined('DOKU_INC')) die();

Date: Fri, 16 Nov 2012 13:28:15 +0100 Subject: Revert "config manager: let PHP parse the config file" This reverts commit b8f41ef0bac4e82cb3b02cd318efaddbaaeb1a78. We had good reasons for parsing the file ourselves. For example to keep expressions like 7*60*60*24 intact. --- lib/plugins/config/settings/config.class.php | 25 ++++++++++++++++++++++--- 1 file changed, 22 insertions(+), 3 deletions(-) (limited to 'lib') diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php index e4a638eb0..e71a7e5f9 100644 --- a/lib/plugins/config/settings/config.class.php +++ b/lib/plugins/config/settings/config.class.php @@ -139,13 +139,32 @@ if (!class_exists('configuration')) { function _read_config($file) { if (!$file) return array(); - if (!file_exists($file)) return array(); $config = array(); if ($this->_format == 'php') { - include($file); - $config = ${$this->_name}; + + if(@file_exists($file)){ + $contents = @php_strip_whitespace($file); + }else{ + $contents = ''; + } + $pattern = '/\$'.$this->_name.'\[[\'"]([^=]+)[\'"]\] ?= ?(.*?);(?=[^;]*(?:\$'.$this->_name.'|$))/s'; + $matches=array(); + preg_match_all($pattern,$contents,$matches,PREG_SET_ORDER); + + for ($i=0; $i'\\','\\\''=>'\'','\\"'=>'"')); + + $config[$key] = $value; + } } return $config; -- cgit v1.2.3 From cba21baacb4880eefd35279b0589e035c5a5c78e Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Fri, 16 Nov 2012 13:59:17 +0100 Subject: started to add some unit tests to config manager Parsing the config file should be completely tested before we can rely on it and safely extend it. This just adds the first very basic tests. --- lib/plugins/config/_test/configuration.test.php | 31 +++++++++++++++++++++++++ lib/plugins/config/_test/data/config.php | 14 +++++++++++ lib/plugins/config/_test/data/metadata.php | 11 +++++++++ lib/plugins/config/settings/config.class.php | 3 +++ 4 files changed, 59 insertions(+) create mode 100644 lib/plugins/config/_test/configuration.test.php create mode 100644 lib/plugins/config/_test/data/config.php create mode 100644 lib/plugins/config/_test/data/metadata.php (limited to 'lib') diff --git a/lib/plugins/config/_test/configuration.test.php b/lib/plugins/config/_test/configuration.test.php new file mode 100644 index 000000000..eeeff61a3 --- /dev/null +++ b/lib/plugins/config/_test/configuration.test.php @@ -0,0 +1,31 @@ +config = dirname(__FILE__).'/data/config.php'; + $this->meta = dirname(__FILE__).'/data/metadata.php'; + require_once(dirname(__FILE__).'/../settings/config.class.php'); + } + + function test_readconfig() { + $confmgr = new configuration($this->meta); + + $conf = $confmgr->_read_config($this->config); + + //print_r($conf); + + $this->assertEquals('42', $conf['int1']); + $this->assertEquals('6*7', $conf['int2']); + + $this->assertEquals('Hello World', $conf['str1']); + $this->assertEquals('G\'day World', $conf['str2']); + $this->assertEquals('Hello World', $conf['str3']); + $this->assertEquals("Hello 'World'", $conf['str4']); + $this->assertEquals('Hello "World"', $conf['str5']); + } + +} \ No newline at end of file diff --git a/lib/plugins/config/_test/data/config.php b/lib/plugins/config/_test/data/config.php new file mode 100644 index 000000000..4ed450e93 --- /dev/null +++ b/lib/plugins/config/_test/data/config.php @@ -0,0 +1,14 @@ + */ + +if(!defined('CM_KEYMARKER')) define('CM_KEYMARKER','____'); + if (!class_exists('configuration')) { class configuration { -- cgit v1.2.3 From a24fc53e2623640cf5e2d00de741c1b67c9bb294 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Fri, 16 Nov 2012 14:48:14 +0100 Subject: added failing test for array type --- lib/plugins/config/_test/configuration.test.php | 2 ++ lib/plugins/config/_test/data/config.php | 2 ++ lib/plugins/config/_test/data/metadata.php | 2 ++ 3 files changed, 6 insertions(+) (limited to 'lib') diff --git a/lib/plugins/config/_test/configuration.test.php b/lib/plugins/config/_test/configuration.test.php index eeeff61a3..ee03f3849 100644 --- a/lib/plugins/config/_test/configuration.test.php +++ b/lib/plugins/config/_test/configuration.test.php @@ -26,6 +26,8 @@ class plugin_config_configuration_test extends DokuWikiTest { $this->assertEquals('Hello World', $conf['str3']); $this->assertEquals("Hello 'World'", $conf['str4']); $this->assertEquals('Hello "World"', $conf['str5']); + + $this->assertEquals(array('foo', 'bar', 'baz'), $conf['arr1']); } } \ No newline at end of file diff --git a/lib/plugins/config/_test/data/config.php b/lib/plugins/config/_test/data/config.php index 4ed450e93..15d6359ad 100644 --- a/lib/plugins/config/_test/data/config.php +++ b/lib/plugins/config/_test/data/config.php @@ -10,5 +10,7 @@ $conf['str3'] = "Hello World"; $conf['str4'] = "Hello 'World'"; $conf['str5'] = "Hello \"World\""; +$conf['arr1'] = array('foo','bar','baz'); + $conf['foo']['bar'] = 'x1'; $conf['foo']['baz'] = 'x2'; diff --git a/lib/plugins/config/_test/data/metadata.php b/lib/plugins/config/_test/data/metadata.php index 34ab42be7..12902e525 100644 --- a/lib/plugins/config/_test/data/metadata.php +++ b/lib/plugins/config/_test/data/metadata.php @@ -9,3 +9,5 @@ $meta['str3'] = array('string'); $meta['str4'] = array('string'); $meta['str5'] = array('string'); +$meta['arr1'] = array('array'); + -- cgit v1.2.3 From 78f0e83246184ff6cb8679d086b0fa17ab508057 Mon Sep 17 00:00:00 2001 From: Leandro Regueiro Date: Fri, 23 Nov 2012 09:23:29 +0100 Subject: Galician language update --- lib/plugins/acl/lang/gl/lang.php | 1 + lib/plugins/config/lang/gl/lang.php | 107 +++++++++++++++++-------------- lib/plugins/plugin/lang/gl/lang.php | 1 + lib/plugins/popularity/lang/gl/lang.php | 1 + lib/plugins/revert/lang/gl/lang.php | 1 + lib/plugins/usermanager/lang/gl/lang.php | 1 + 6 files changed, 64 insertions(+), 48 deletions(-) (limited to 'lib') diff --git a/lib/plugins/acl/lang/gl/lang.php b/lib/plugins/acl/lang/gl/lang.php index db57598e6..537e03eef 100644 --- a/lib/plugins/acl/lang/gl/lang.php +++ b/lib/plugins/acl/lang/gl/lang.php @@ -4,6 +4,7 @@ * * @author Medúlio * @author Oscar M. Lage + * @author Leandro Regueiro */ $lang['admin_acl'] = 'Xestión da Lista de Control de Acceso (ACL)'; $lang['acl_group'] = 'Grupo'; diff --git a/lib/plugins/config/lang/gl/lang.php b/lib/plugins/config/lang/gl/lang.php index 97b7ecdc8..5ba3be2ec 100644 --- a/lib/plugins/config/lang/gl/lang.php +++ b/lib/plugins/config/lang/gl/lang.php @@ -4,6 +4,7 @@ * * @author Medúlio * @author Oscar M. Lage + * @author Leandro Regueiro */ $lang['menu'] = 'Opcións de Configuración'; $lang['error'] = 'Configuración non actualizada debido a un valor inválido, por favor revisa os teus trocos e volta envialos de novo. @@ -27,6 +28,8 @@ $lang['_anti_spam'] = 'Configuración de Anti-Correo-lixo'; $lang['_editing'] = 'Configuración de Edición'; $lang['_links'] = 'Configuración de Ligazóns'; $lang['_media'] = 'Configuración de Media'; +$lang['_notifications'] = 'Configuración de notificación'; +$lang['_syndication'] = 'Configuración de afiliación'; $lang['_advanced'] = 'Configuración Avanzada'; $lang['_network'] = 'Configuración de Rede'; $lang['_plugin_sufix'] = 'Configuración de Extensións'; @@ -34,26 +37,29 @@ $lang['_template_sufix'] = 'Configuración de Sobreplanta'; $lang['_msg_setting_undefined'] = 'Non hai configuración de metadatos.'; $lang['_msg_setting_no_class'] = 'Non hai configuración de clase.'; $lang['_msg_setting_no_default'] = 'Non hai valor predeterminado.'; -$lang['fmode'] = 'Modo de creación de arquivos'; -$lang['dmode'] = 'Modo de creación de directorios'; +$lang['title'] = 'Título do Wiki'; +$lang['start'] = 'Nome da páxina inicial'; $lang['lang'] = 'Idioma'; +$lang['template'] = 'Sobreplanta'; +$lang['tagline'] = 'Slogan (se o modelo o admite)'; +$lang['sidebar'] = 'Nome da páxina de barra lateral (se o modelo o admite), se o campo está baleiro desactívase a barra lateral'; +$lang['license'] = 'Baixo de que licenza será ceibado o teu contido?'; +$lang['savedir'] = 'Directorio no que se gardarán os datos'; $lang['basedir'] = 'Directorio base'; $lang['baseurl'] = 'URL base'; -$lang['savedir'] = 'Directorio no que se gardarán os datos'; $lang['cookiedir'] = 'Ruta das cookies. Deixar en blanco para usar a url de base.'; -$lang['start'] = 'Nome da páxina inicial'; -$lang['title'] = 'Título do Wiki'; -$lang['template'] = 'Sobreplanta'; -$lang['license'] = 'Baixo de que licenza será ceibado o teu contido?'; -$lang['fullpath'] = 'Amosar a ruta completa das páxinas no pé das mesmas'; +$lang['dmode'] = 'Modo de creación de directorios'; +$lang['fmode'] = 'Modo de creación de arquivos'; +$lang['allowdebug'] = 'Permitir o depurado desactívao se non o precisas!'; $lang['recent'] = 'Trocos recentes'; +$lang['recent_days'] = 'Número de trocos recentes a manter (días)'; $lang['breadcrumbs'] = 'Número de niveis da estrutura de navegación'; $lang['youarehere'] = 'Niveis xerárquicos da estrutura de navegación'; +$lang['fullpath'] = 'Amosar a ruta completa das páxinas no pé das mesmas'; $lang['typography'] = 'Facer substitucións tipográficas'; -$lang['htmlok'] = 'Permitir a inserción de HTML'; -$lang['phpok'] = 'Permitir a inserción de PHP'; $lang['dformat'] = 'Formato de Data (bótalle un ollo á función strftime do PHP)'; $lang['signature'] = 'Sinatura'; +$lang['showuseras'] = 'Que amosar cando se informe do usuario que fixo a última modificación dunha páxina'; $lang['toptoclevel'] = 'Nivel superior para a táboa de contidos'; $lang['tocminheads'] = 'Cantidade mínima de liñas de cabeceira que determinará se a TDC vai ser xerada'; $lang['maxtoclevel'] = 'Nivel máximo para a táboa de contidos'; @@ -61,16 +67,8 @@ $lang['maxseclevel'] = 'Nivel máximo de edición da sección'; $lang['camelcase'] = 'Utilizar CamelCase para as ligazóns'; $lang['deaccent'] = 'Limpar nomes de páxina'; $lang['useheading'] = 'Utilizar a primeira cabeceira para os nomes de páxina'; -$lang['refcheck'] = 'Comprobar a referencia media'; -$lang['refshow'] = 'Número de referencias media a amosar'; -$lang['allowdebug'] = 'Permitir o depurado desactívao se non o precisas!'; -$lang['mediarevisions'] = 'Habilitar revisións dos arquivos-media?'; -$lang['usewordblock'] = 'Bloquear correo-lixo segundo unha lista de verbas'; -$lang['indexdelay'] = 'Retardo denantes de indexar (seg)'; -$lang['relnofollow'] = 'Utilizar rel="nofollow" nas ligazóns externas'; -$lang['mailguard'] = 'Ofuscar enderezos de correo-e'; -$lang['iexssprotect'] = 'Comprobar arquivos subidos na procura de posíbel código JavaScript ou HTML malicioso'; -$lang['showuseras'] = 'Que amosar cando se informe do usuario que fixo a última modificación dunha páxina'; +$lang['sneaky_index'] = 'O DokuWiki amosará por defecto todos os nomes de espazo na vista de índice. Se activas isto agocharanse aqueles onde o usuario non teña permisos de lectura.'; +$lang['hidepages'] = 'Agochar páxinas que coincidan (expresións regulares)'; $lang['useacl'] = 'Utilizar lista de control de acceso'; $lang['autopasswd'] = 'Xerar contrasinais automaticamente'; $lang['authtype'] = 'Backend de autenticación'; @@ -79,57 +77,70 @@ $lang['defaultgroup'] = 'Grupo por defecto'; $lang['superuser'] = 'Super-usuario - un grupo ou usuario con acceso completo a todas as páxinas e funcións independentemente da configuración da ACL'; $lang['manager'] = 'Xestor - un grupo ou usuario con acceso a certas funcións de xestión'; $lang['profileconfirm'] = 'Confirmar trocos de perfil mediante contrasinal'; +$lang['rememberme'] = 'Permitir cookies permanentes de inicio de sesión (lembrarme)'; $lang['disableactions'] = 'Desactivar accións do DokuWiki'; $lang['disableactions_check'] = 'Comprobar'; $lang['disableactions_subscription'] = 'Subscribir/Desubscribir'; $lang['disableactions_wikicode'] = 'Ver fonte/Exportar Datos Raw'; $lang['disableactions_other'] = 'Outras accións (separadas por comas)'; -$lang['sneaky_index'] = 'O DokuWiki amosará por defecto todos os nomes de espazo na vista de índice. Se activas isto agocharanse aqueles onde o usuario non teña permisos de lectura.'; $lang['auth_security_timeout'] = 'Tempo Límite de Seguridade de Autenticación (segundos)'; $lang['securecookie'] = 'Deben enviarse só vía HTTPS polo navegador as cookies configuradas vía HTTPS? Desactiva esta opción cando só o inicio de sesión do teu wiki estea asegurado con SSL pero a navegación do mesmo se faga de xeito inseguro.'; +$lang['remote'] = 'Activar o sistema de API remota. Isto permítelle a outras aplicacións acceder ao wiki a través de XML-RPC ou outros mecanismos.'; +$lang['remoteuser'] = 'Restrinxir o acceso remoto á API aos grupos ou usuarios separados por comas especificados aquí. Déixeo baleiro para concederlle acceso a todos.'; +$lang['usewordblock'] = 'Bloquear correo-lixo segundo unha lista de verbas'; +$lang['relnofollow'] = 'Utilizar rel="nofollow" nas ligazóns externas'; +$lang['indexdelay'] = 'Retardo denantes de indexar (seg)'; +$lang['mailguard'] = 'Ofuscar enderezos de correo-e'; +$lang['iexssprotect'] = 'Comprobar arquivos subidos na procura de posíbel código JavaScript ou HTML malicioso'; +$lang['usedraft'] = 'Gardar un borrador automaticamente no tempo da edición'; +$lang['htmlok'] = 'Permitir a inserción de HTML'; +$lang['phpok'] = 'Permitir a inserción de PHP'; +$lang['locktime'] = 'Tempo máximo para o bloqueo de arquivos (seg.)'; +$lang['cachetime'] = 'Tempo máximo para a caché (seg.)'; +$lang['target____wiki'] = 'Fiestra de destino para as ligazóns internas'; +$lang['target____interwiki'] = 'Fiestra de destino para as ligazóns interwiki'; +$lang['target____extern'] = 'Fiestra de destino para as ligazóns externas'; +$lang['target____media'] = 'Fiestra de destino para as ligazóns de media'; +$lang['target____windows'] = 'Fiestra de destino para as ligazóns de fiestras'; +$lang['mediarevisions'] = 'Habilitar revisións dos arquivos-media?'; +$lang['refcheck'] = 'Comprobar a referencia media'; +$lang['refshow'] = 'Número de referencias media a amosar'; +$lang['gdlib'] = 'Versión da Libraría GD'; +$lang['im_convert'] = 'Ruta deica a ferramenta de conversión ImageMagick'; +$lang['jpg_quality'] = 'Calidade de compresión dos JPG (0-100)'; +$lang['fetchsize'] = 'Tamaño máximo (en bytes) que pode descargar fetch.php dende fontes externas'; +$lang['subscribers'] = 'Activar posibilidade de subscrición á páxina'; +$lang['subscribe_time'] = 'Tempo despois do cal se enviarán os resumos e listas de subscrición (seg.): isto debe ser inferior ao tempo especificado en recent_days.'; +$lang['notify'] = 'Enviar notificacións de trocos a este enderezo de correo-e'; +$lang['registernotify'] = 'Enviar información de novos usuarios rexistrados a este enderezo de correo-e'; +$lang['mailfrom'] = 'Enderezo de correo-e a usar para as mensaxes automáticas'; +$lang['mailprefix'] = 'Prefixo de asunto de correo-e para as mensaxes automáticas'; +$lang['htmlmail'] = 'Enviar mensaxes de e-mail HTML multiparte con mellor aspecto, pero de tamaño maior. Desactivar para as mensaxes de só texto plano.'; +$lang['sitemap'] = 'Xerar mapa do sitio co Google (días)'; +$lang['rss_type'] = 'Tipo de corrente RSS XML'; +$lang['rss_linkto'] = 'A corrente XML liga para'; +$lang['rss_content'] = 'Que queres amosar nos elementos da corrente XML?'; +$lang['rss_update'] = 'Intervalo de actualización da corrente XML (seg.)'; +$lang['rss_show_summary'] = 'Amosar sumario no título da corrente XML'; +$lang['rss_media'] = 'Que tipo de cambios se deben mostrar na fonte XML?'; $lang['updatecheck'] = 'Comprobar se hai actualizacións e avisos de seguridade? O DokuWiki precisa contactar con update.dokuwiki.org para executar esta característica.'; $lang['userewrite'] = 'Utilizar URLs amigábeis'; $lang['useslash'] = 'Utilizar a barra inclinada (/) como separador de nome de espazo nos URLs'; -$lang['usedraft'] = 'Gardar un borrador automaticamente no tempo da edición'; $lang['sepchar'] = 'Verba separadora do nome de páxina'; $lang['canonical'] = 'Utilizar URLs completamente canónicos'; $lang['fnencode'] = 'Método para codificar os nomes de arquivo non-ASCII.'; $lang['autoplural'] = 'Comprobar formas plurais nas ligazóns'; $lang['compression'] = 'Método de compresión para arquivos attic'; -$lang['cachetime'] = 'Tempo máximo para a caché (seg.)'; -$lang['locktime'] = 'Tempo máximo para o bloqueo de arquivos (seg.)'; -$lang['fetchsize'] = 'Tamaño máximo (en bytes) que pode descargar fetch.php dende fontes externas'; -$lang['notify'] = 'Enviar notificacións de trocos a este enderezo de correo-e'; -$lang['registernotify'] = 'Enviar información de novos usuarios rexistrados a este enderezo de correo-e'; -$lang['mailfrom'] = 'Enderezo de correo-e a usar para as mensaxes automáticas'; -$lang['mailprefix'] = 'Prefixo de asunto de correo-e para as mensaxes automáticas'; $lang['gzip_output'] = 'Utilizar Contido-Codificación gzip para o xhtml'; -$lang['gdlib'] = 'Versión da Libraría GD'; -$lang['im_convert'] = 'Ruta deica a ferramenta de conversión ImageMagick'; -$lang['jpg_quality'] = 'Calidade de compresión dos JPG (0-100)'; -$lang['subscribers'] = 'Activar posibilidade de subscrición á páxina'; -$lang['subscribe_time'] = 'Tempo despois do cal se enviarán os resumos e listas de subscrición (seg.): isto debe ser inferior ao tempo especificado en recent_days.'; $lang['compress'] = 'Saída compacta de CSS e Javascript'; -$lang['hidepages'] = 'Agochar páxinas que coincidan (expresións regulares)'; +$lang['cssdatauri'] = 'Tamaño en bytes ata o cal as imaxes referenciadas nos ficheiros CSS se deben incorporar directamente na folla de estilos para reducir o exceso de cabeceiras de solicitudes HTTP. Esta técnica non funciona con IE 7 ou inferior! Valores entre 400 e 600 son axeitados. Defina 0 para desactivar.'; $lang['send404'] = 'Enviar "HTTP 404/Páxina non atopada" para as páxinas inexistentes'; -$lang['sitemap'] = 'Xerar mapa do sitio co Google (días)'; $lang['broken_iua'] = 'Rachou a función ignore_user_abort no teu sistema? Isto podería causar que o índice de procura non funcione. Coñécese que o IIS+PHP/CGI ráchaa. Bótalle un ollo ao Bug 852 para obter máis información.'; $lang['xsendfile'] = 'Empregar a cabeceira X-Sendfile para que o servidor web envie arquivos estáticos? O teu servidor web precisa soportar isto.'; $lang['renderer_xhtml'] = 'Intérprete a empregar para a saída principal (XHTML) do Wiki'; $lang['renderer__core'] = '%s (núcleo do Dokuwiki)'; $lang['renderer__plugin'] = '%s (extensión)'; -$lang['rememberme'] = 'Permitir cookies permanentes de inicio de sesión (lembrarme)'; -$lang['rss_type'] = 'Tipo de corrente RSS XML'; -$lang['rss_linkto'] = 'A corrente XML liga para'; -$lang['rss_content'] = 'Que queres amosar nos elementos da corrente XML?'; -$lang['rss_update'] = 'Intervalo de actualización da corrente XML (seg.)'; -$lang['recent_days'] = 'Número de trocos recentes a manter (días)'; -$lang['rss_show_summary'] = 'Amosar sumario no título da corrente XML'; -$lang['target____wiki'] = 'Fiestra de destino para as ligazóns internas'; -$lang['target____interwiki'] = 'Fiestra de destino para as ligazóns interwiki'; -$lang['target____extern'] = 'Fiestra de destino para as ligazóns externas'; -$lang['target____media'] = 'Fiestra de destino para as ligazóns de media'; -$lang['target____windows'] = 'Fiestra de destino para as ligazóns de fiestras'; +$lang['dnslookups'] = 'DokuWiki buscará os nomes de máquina ou enderezos IP remotos dos usuarios que editen páxinas. Se ten un servidor DNS lento ou que non funciona ou en caso de non querer esta característica, desactive esta opción.'; $lang['proxy____host'] = 'Nome do servidor Proxy'; $lang['proxy____port'] = 'Porto do Proxy'; $lang['proxy____user'] = 'Nome de usuario do Proxy'; diff --git a/lib/plugins/plugin/lang/gl/lang.php b/lib/plugins/plugin/lang/gl/lang.php index a314b71b9..fecdf9425 100644 --- a/lib/plugins/plugin/lang/gl/lang.php +++ b/lib/plugins/plugin/lang/gl/lang.php @@ -4,6 +4,7 @@ * * @author Medúlio * @author Oscar M. Lage + * @author Leandro Regueiro */ $lang['menu'] = 'Xestionar Extensións'; $lang['download'] = 'Descargar e instalar unha nova extensión'; diff --git a/lib/plugins/popularity/lang/gl/lang.php b/lib/plugins/popularity/lang/gl/lang.php index 34bd3935f..8032fccb0 100644 --- a/lib/plugins/popularity/lang/gl/lang.php +++ b/lib/plugins/popularity/lang/gl/lang.php @@ -4,6 +4,7 @@ * * @author Medúlio * @author Oscar M. Lage + * @author Leandro Regueiro */ $lang['name'] = 'Resposta de Popularidade (pode demorar un tempo a cargar)'; $lang['submit'] = 'Enviar Datos'; diff --git a/lib/plugins/revert/lang/gl/lang.php b/lib/plugins/revert/lang/gl/lang.php index a0c5a9785..ad4fe4045 100644 --- a/lib/plugins/revert/lang/gl/lang.php +++ b/lib/plugins/revert/lang/gl/lang.php @@ -4,6 +4,7 @@ * * @author Medúlio * @author Oscar M. Lage + * @author Leandro Regueiro */ $lang['menu'] = 'Xestor de Reversión'; $lang['filter'] = 'Procurar páxinas con correo-lixo'; diff --git a/lib/plugins/usermanager/lang/gl/lang.php b/lib/plugins/usermanager/lang/gl/lang.php index c9c633b39..fb965985f 100644 --- a/lib/plugins/usermanager/lang/gl/lang.php +++ b/lib/plugins/usermanager/lang/gl/lang.php @@ -4,6 +4,7 @@ * * @author Medúlio * @author Oscar M. Lage + * @author Leandro Regueiro */ $lang['menu'] = 'Xestor de Usuarios'; $lang['noauth'] = '(autenticación de usuarios non dispoñible)'; -- cgit v1.2.3 From 46a853c3756aa4abe582ccb0de6f4e1f4b2035c4 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Tue, 27 Nov 2012 17:39:04 +0100 Subject: correct return in sendDigest() the function always returned true, even if no action was taken. This resulted in no further indexer tasks being run. --- lib/exe/indexer.php | 6 +++++- 1 file changed, 5 insertions(+), 1 deletion(-) (limited to 'lib') diff --git a/lib/exe/indexer.php b/lib/exe/indexer.php index 1ccede923..c336514cd 100644 --- a/lib/exe/indexer.php +++ b/lib/exe/indexer.php @@ -181,6 +181,8 @@ function sendDigest() { global $conf; global $USERINFO; + $sent = false; + // remember current user info $olduinfo = $USERINFO; $olduser = $_SERVER['REMOTE_USER']; @@ -236,9 +238,11 @@ function sendDigest() { foreach($change_ids as $change_id) { subscription_send_digest($USERINFO['mail'], $change_id, $lastupdate); + $sent = true; } } elseif ($style === 'list') { subscription_send_list($USERINFO['mail'], $change_ids, $id); + $sent = true; } // TODO: Handle duplicate subscriptions. @@ -252,7 +256,7 @@ function sendDigest() { $USERINFO = $olduinfo; $_SERVER['REMOTE_USER'] = $olduser; echo 'sendDigest(): finished'.NL; - return true; + return $sent; } /** -- cgit v1.2.3 From 3f6c460c29cccb4fdbbbbd14afbdd29916947221 Mon Sep 17 00:00:00 2001 From: Michael Hamann Date: Wed, 28 Nov 2012 17:40:42 +0100 Subject: Correct German plugin manager translation (download != install) --- lib/plugins/plugin/lang/de/lang.php | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'lib') diff --git a/lib/plugins/plugin/lang/de/lang.php b/lib/plugins/plugin/lang/de/lang.php index 8708d7836..9f26a2933 100644 --- a/lib/plugins/plugin/lang/de/lang.php +++ b/lib/plugins/plugin/lang/de/lang.php @@ -53,7 +53,7 @@ $lang['desc'] = 'Beschreibung:'; $lang['author'] = 'Entwickler:'; $lang['www'] = 'Web:'; $lang['error'] = 'Ein unbekannter Fehler ist aufgetreten.'; -$lang['error_download'] = 'Konnte das Plugin %s nicht installieren'; +$lang['error_download'] = 'Konnte das Plugin %s nicht herunterladen'; $lang['error_badurl'] = 'Wahrscheinlich ungültige URL, konnte keinen Dateinamen ausfindig machen'; $lang['error_dircreate'] = 'Konnte keinen temporären Ordner für die Downloads erstellen'; $lang['error_decompress'] = 'Der Plugin Manager konnte das Plugin-Archiv nicht entpacken. Entweder ist der Download fehlerhaft oder das Komprimierungsverfahren wird nicht unterstützt. Bitte versuchen Sie es erneut oder downloaden und installieren Sie das Plugin manuell.'; -- cgit v1.2.3 From 38479cbba628ee76a92ff5f3c974cfa8e6ce9e61 Mon Sep 17 00:00:00 2001 From: Dominik Eckelmann Date: Thu, 29 Nov 2012 16:06:43 +0100 Subject: some coding style improvements - removed some dead/unused code - fixed phpdoc - added typing on methods --- lib/plugins/acl/admin.php | 7 ------- lib/plugins/config/settings/config.class.php | 7 +++---- lib/plugins/info/syntax.php | 20 +++----------------- lib/plugins/plugin/admin.php | 22 ++++------------------ lib/plugins/plugin/classes/ap_download.class.php | 4 +--- lib/plugins/plugin/classes/ap_manage.class.php | 6 +----- lib/plugins/plugin/classes/ap_update.class.php | 2 -- lib/plugins/popularity/action.php | 6 +++++- lib/plugins/popularity/admin.php | 8 ++++++-- lib/plugins/popularity/helper.php | 10 ++++++---- lib/plugins/revert/admin.php | 2 -- lib/plugins/syntax.php | 14 +++++++------- lib/plugins/usermanager/admin.php | 5 +---- 13 files changed, 37 insertions(+), 76 deletions(-) (limited to 'lib') diff --git a/lib/plugins/acl/admin.php b/lib/plugins/acl/admin.php index 1197892f2..0d9cd742a 100644 --- a/lib/plugins/acl/admin.php +++ b/lib/plugins/acl/admin.php @@ -173,8 +173,6 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { * @author Andreas Gohr */ function html() { - global $ID; - echo '
'.NL; echo '

'.$this->getLang('admin_acl').'

'.NL; echo '
'.NL; @@ -208,7 +206,6 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { * @author Andreas Gohr */ function _get_opts($addopts=null){ - global $ID; $opts = array( 'do'=>'admin', 'page'=>'acl', @@ -230,7 +227,6 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { global $ID; global $lang; - $dir = $conf['datadir']; $ns = $this->ns; if(empty($ns)){ $ns = dirname(str_replace(':','/',$ID)); @@ -326,7 +322,6 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { * @author Andreas Gohr */ function _html_detail(){ - global $conf; global $ID; echo '
'.NL; @@ -493,7 +488,6 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { * @author Andreas Gohr */ function _html_list_acl($item){ - global $ID; $ret = ''; // what to display if($item['label']){ @@ -764,7 +758,6 @@ class admin_plugin_acl extends DokuWiki_Admin_Plugin { * @author Andreas Gohr */ function _html_select(){ - global $conf; $inlist = false; if($this->who && diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php index 8c48018d7..a30a0605b 100644 --- a/lib/plugins/config/settings/config.class.php +++ b/lib/plugins/config/settings/config.class.php @@ -369,7 +369,7 @@ if (!class_exists('setting')) { * update setting with user provided value $input * if value fails error check, save it * - * @return true if changed, false otherwise (incl. on error) + * @return boolean true if changed, false otherwise (incl. on error) */ function update($input) { if (is_null($input)) return false; @@ -426,7 +426,6 @@ if (!class_exists('setting')) { if ($fmt=='php') { // translation string needs to be improved FIXME - $tr = array("\n"=>'\n', "\r"=>'\r', "\t"=>'\t', "\\" => '\\\\', "'" => '\\\''); $tr = array("\\" => '\\\\', "'" => '\\\''); $out = '$'.$var."['".$this->_out_key()."'] = '".strtr($this->_local, $tr)."';\n"; @@ -538,7 +537,7 @@ if (!class_exists('setting_email')) { * update setting with user provided value $input * if value fails error check, save it * - * @return true if changed, false otherwise (incl. on error) + * @return boolean true if changed, false otherwise (incl. on error) */ function update($input) { if (is_null($input)) return false; @@ -574,7 +573,7 @@ if (!class_exists('setting_richemail')) { * update setting with user provided value $input * if value fails error check, save it * - * @return true if changed, false otherwise (incl. on error) + * @return boolean true if changed, false otherwise (incl. on error) */ function update($input) { if (is_null($input)) return false; diff --git a/lib/plugins/info/syntax.php b/lib/plugins/info/syntax.php index 9aedbf0aa..d813aa23a 100644 --- a/lib/plugins/info/syntax.php +++ b/lib/plugins/info/syntax.php @@ -15,20 +15,6 @@ if(!defined('DOKU_INC')) die(); */ class syntax_plugin_info extends DokuWiki_Syntax_Plugin { - /** - * return some info - */ - function getInfo(){ - return array( - 'author' => 'Andreas Gohr', - 'email' => 'andi@splitbrain.org', - 'date' => '2008-09-12', - 'name' => 'Info Plugin', - 'desc' => 'Displays information about various DokuWiki internals', - 'url' => 'http://dokuwiki.org/plugin:info', - ); - } - /** * What kind of syntax are we? */ @@ -114,7 +100,7 @@ class syntax_plugin_info extends DokuWiki_Syntax_Plugin { * * uses some of the original renderer methods */ - function _plugins_xhtml($type, &$renderer){ + function _plugins_xhtml($type, Doku_Renderer &$renderer){ global $lang; $renderer->doc .= '
    '; @@ -152,7 +138,7 @@ class syntax_plugin_info extends DokuWiki_Syntax_Plugin { * * uses some of the original renderer methods */ - function _helpermethods_xhtml(&$renderer){ + function _helpermethods_xhtml(Doku_Renderer &$renderer){ global $lang; $plugins = plugin_list('helper'); @@ -237,7 +223,7 @@ class syntax_plugin_info extends DokuWiki_Syntax_Plugin { /** * Adds a TOC item */ - function _addToTOC($text, $level, &$renderer){ + function _addToTOC($text, $level, Doku_Renderer_xhtml &$renderer){ global $conf; if (($level >= $conf['toptoclevel']) && ($level <= $conf['maxtoclevel'])){ diff --git a/lib/plugins/plugin/admin.php b/lib/plugins/plugin/admin.php index b2108f185..8b1ee3c7d 100644 --- a/lib/plugins/plugin/admin.php +++ b/lib/plugins/plugin/admin.php @@ -33,6 +33,10 @@ class admin_plugin_plugin extends DokuWiki_Admin_Plugin { var $disabled = 0; var $plugin = ''; var $cmd = ''; + + /** + * @var ap_manage + */ var $handler = NULL; var $functions = array('delete','update',/*'settings',*/'info'); // require a plugin name @@ -43,27 +47,9 @@ class admin_plugin_plugin extends DokuWiki_Admin_Plugin { var $error = ''; function admin_plugin_plugin() { - global $conf; $this->disabled = plugin_isdisabled('plugin'); } - /** - * return some info - */ - function getInfo(){ - $disabled = ($this->disabled) ? '(disabled)' : ''; - - return array( - 'author' => 'Christopher Smith', - 'email' => 'chris@jalakai.co.uk', - 'date' => '2009-11-11', - 'name' => 'Plugin Manager', - 'desc' => "Manage Plugins, including automated plugin installer $disabled", - 'url' => 'http://www.dokuwiki.org/plugin:plugin', - ); - } - - /** * return sort order for position in admin menu */ diff --git a/lib/plugins/plugin/classes/ap_download.class.php b/lib/plugins/plugin/classes/ap_download.class.php index 0eb567c80..3cc455867 100644 --- a/lib/plugins/plugin/classes/ap_download.class.php +++ b/lib/plugins/plugin/classes/ap_download.class.php @@ -7,7 +7,6 @@ class ap_download extends ap_manage { * Initiate the plugin download */ function process() { - global $lang; global $INPUT; $plugin_url = $INPUT->str('url'); @@ -45,7 +44,6 @@ class ap_download extends ap_manage { * Process the downloaded file */ function download($url, $overwrite=false) { - global $lang; // check the url $matches = array(); if (!preg_match("/[^\/]*$/", $url, $matches) || !$matches[0]) { @@ -241,7 +239,7 @@ class ap_download extends ap_manage { * if neither bz, gz or zip are recognized, tar is assumed. * * @author Andreas Gohr - * @returns false if the file can't be read, otherwise an "extension" + * @returns boolean|string false if the file can't be read, otherwise an "extension" */ function guess_archive($file){ $fh = fopen($file,'rb'); diff --git a/lib/plugins/plugin/classes/ap_manage.class.php b/lib/plugins/plugin/classes/ap_manage.class.php index 28579cbe9..3ec740dae 100644 --- a/lib/plugins/plugin/classes/ap_manage.class.php +++ b/lib/plugins/plugin/classes/ap_manage.class.php @@ -69,7 +69,6 @@ class ap_manage { } function html_pluginlist() { - global $ID; global $plugin_protected; foreach ($this->manager->plugin_list as $plugin) { @@ -195,11 +194,8 @@ class ap_manage { closedir($dh); return @rmdir($path); - } else { - return @unlink($path); } - - return false; + return @unlink($path); } diff --git a/lib/plugins/plugin/classes/ap_update.class.php b/lib/plugins/plugin/classes/ap_update.class.php index c43429a1b..5d7f6cb08 100644 --- a/lib/plugins/plugin/classes/ap_update.class.php +++ b/lib/plugins/plugin/classes/ap_update.class.php @@ -5,8 +5,6 @@ class ap_update extends ap_download { var $overwrite = true; function process() { - global $lang; - $plugin_url = $this->plugin_readlog($this->plugin, 'url'); $this->download($plugin_url, $this->overwrite); return ''; diff --git a/lib/plugins/popularity/action.php b/lib/plugins/popularity/action.php index 1c7a2f65d..f0cbb771b 100644 --- a/lib/plugins/popularity/action.php +++ b/lib/plugins/popularity/action.php @@ -9,6 +9,10 @@ require_once(DOKU_PLUGIN.'action.php'); require_once(DOKU_PLUGIN.'popularity/admin.php'); class action_plugin_popularity extends Dokuwiki_Action_Plugin { + + /** + * @var helper_plugin_popularity + */ var $helper; function action_plugin_popularity(){ @@ -22,7 +26,7 @@ class action_plugin_popularity extends Dokuwiki_Action_Plugin { $controller->register_hook('INDEXER_TASKS_RUN', 'AFTER', $this, '_autosubmit', array()); } - function _autosubmit(&$event, $param){ + function _autosubmit(Doku_Event &$event, $param){ //Do we have to send the data now if ( !$this->helper->isAutosubmitEnabled() || $this->_isTooEarlyToSubmit() ){ return; diff --git a/lib/plugins/popularity/admin.php b/lib/plugins/popularity/admin.php index 474a09ef9..deb8048f4 100644 --- a/lib/plugins/popularity/admin.php +++ b/lib/plugins/popularity/admin.php @@ -14,6 +14,10 @@ if(!defined('DOKU_INC')) die(); */ class admin_plugin_popularity extends DokuWiki_Admin_Plugin { var $version; + + /** + * @var helper_plugin_popularity + */ var $helper; var $sentStatus = null; @@ -118,9 +122,9 @@ class admin_plugin_popularity extends DokuWiki_Admin_Plugin { /** * Build the form which presents the data to be sent - * @param string $submit How is the data supposed to be sent? (may be: 'browser' or 'server') + * @param string $submissionMode How is the data supposed to be sent? (may be: 'browser' or 'server') * @param string $data The popularity data, if it has already been computed. NULL otherwise. - * @return The form, as an html string + * @return string The form, as an html string */ function buildForm($submissionMode, $data = null){ $url = ($submissionMode === 'browser' ? $this->helper->submitUrl : script()); diff --git a/lib/plugins/popularity/helper.php b/lib/plugins/popularity/helper.php index 34521021d..5bbeddba0 100644 --- a/lib/plugins/popularity/helper.php +++ b/lib/plugins/popularity/helper.php @@ -29,6 +29,8 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { */ var $popularityLastSubmitFile; + var $version; + function helper_plugin_popularity(){ global $conf; @@ -69,7 +71,7 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { /** * Check if autosubmit is enabled - * @return TRUE if we should send data once a month, FALSE otherwise + * @return boolean TRUE if we should send data once a month, FALSE otherwise */ function isAutoSubmitEnabled(){ return @file_exists($this->autosubmitFile); @@ -78,7 +80,7 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { /** * Send the data, to the submit url * @param string $data The popularity data - * @return An empty string if everything worked fine, a string describing the error otherwise + * @return string An empty string if everything worked fine, a string describing the error otherwise */ function sendData($data){ $error = ''; @@ -102,7 +104,7 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { /** * Gather all information - * @return The popularity data as a string + * @return string The popularity data as a string */ function gatherAsString(){ $data = $this->_gather(); @@ -119,7 +121,7 @@ class helper_plugin_popularity extends Dokuwiki_Plugin { /** * Gather all information - * @return The popularity data as an array + * @return array The popularity data as an array */ function _gather(){ global $conf; diff --git a/lib/plugins/revert/admin.php b/lib/plugins/revert/admin.php index 958cf5acf..fcdaa230d 100644 --- a/lib/plugins/revert/admin.php +++ b/lib/plugins/revert/admin.php @@ -73,8 +73,6 @@ class admin_plugin_revert extends DokuWiki_Admin_Plugin { * Start the reversion process */ function _revert($revert,$filter){ - global $conf; - echo '

    '; echo '

    '.$this->getLang('revstart').'

    '; diff --git a/lib/plugins/syntax.php b/lib/plugins/syntax.php index 8b94493e4..552cc747a 100644 --- a/lib/plugins/syntax.php +++ b/lib/plugins/syntax.php @@ -84,13 +84,13 @@ class DokuWiki_Syntax_Plugin extends Doku_Parser_Mode { * * Usually you should only need the $match param. * - * @param $match string The text matched by the patterns - * @param $state int The lexer state for the match - * @param $pos int The character position of the matched text - * @param $handler Doku_Handler Reference to the Doku_Handler object - * @return array Return an array with all data you want to use in render + * @param string $match The text matched by the patterns + * @param int $state The lexer state for the match + * @param int $pos The character position of the matched text + * @param Doku_Handler $handler Reference to the Doku_Handler object + * @return array Return an array with all data you want to use in render */ - function handle($match, $state, $pos, &$handler){ + function handle($match, $state, $pos, Doku_Handler &$handler){ trigger_error('handle() not implemented in '.get_class($this), E_USER_WARNING); } @@ -117,7 +117,7 @@ class DokuWiki_Syntax_Plugin extends Doku_Parser_Mode { * @param $data array data created by handler() * @return boolean rendered correctly? */ - function render($format, &$renderer, $data) { + function render($format, Doku_Renderer &$renderer, $data) { trigger_error('render() not implemented in '.get_class($this), E_USER_WARNING); } diff --git a/lib/plugins/usermanager/admin.php b/lib/plugins/usermanager/admin.php index 30b65debb..cf8963e64 100644 --- a/lib/plugins/usermanager/admin.php +++ b/lib/plugins/usermanager/admin.php @@ -73,8 +73,6 @@ class admin_plugin_usermanager extends DokuWiki_Admin_Plugin { * handle user request */ function handle() { - global $ID; - if (is_null($this->_auth)) return false; // extract the command and any specific parameters @@ -308,7 +306,6 @@ class admin_plugin_usermanager extends DokuWiki_Admin_Plugin { function _htmlInputField($id, $name, $label, $value, $cando, $indent=0) { $class = $cando ? '' : ' class="disabled"'; - $disabled = $cando ? '' : ' disabled="disabled"'; echo str_pad('',$indent); if($name == 'userpass'){ @@ -549,7 +546,7 @@ class admin_plugin_usermanager extends DokuWiki_Admin_Plugin { /** * retrieve & clean user data from the form * - * @return array(user, password, full name, email, array(groups)) + * @return array (user, password, full name, email, array(groups)) */ function _retrieveUser($clean=true) { global $auth; -- cgit v1.2.3 From 4f4c6fd5079db8beb50ea9b9aa08351a49a57d21 Mon Sep 17 00:00:00 2001 From: Michael Hamann Date: Mon, 3 Dec 2012 00:07:36 +0100 Subject: lib/exe/indexer.php: Fix sending of the GIF when it is deferred FS#2646 Before this change the GIF wasn't sent at all when the PHP settings indicate that sending of the GIF needs to be deferred and it was sent when the debug output was on. --- lib/exe/indexer.php | 7 +++++-- 1 file changed, 5 insertions(+), 2 deletions(-) (limited to 'lib') diff --git a/lib/exe/indexer.php b/lib/exe/indexer.php index c336514cd..28ee5331f 100644 --- a/lib/exe/indexer.php +++ b/lib/exe/indexer.php @@ -37,9 +37,12 @@ if ($evt->advise_before()) { runTrimRecentChanges(true) or $evt->advise_after(); } -if($defer) sendGIF(); -if(!$output) ob_end_clean(); +if(!$output) { + ob_end_clean(); + if($defer) sendGIF(); +} + exit; // -------------------------------------------------------------------- -- cgit v1.2.3 From 71e90b1c66985b02b7df3387930a5fa007ca9755 Mon Sep 17 00:00:00 2001 From: Osama Al-Kofahi Date: Sun, 6 Jan 2013 15:53:07 +0100 Subject: Arabic language update --- lib/plugins/config/lang/ar/lang.php | 101 ++++++++++++++++++------------------ 1 file changed, 51 insertions(+), 50 deletions(-) (limited to 'lib') diff --git a/lib/plugins/config/lang/ar/lang.php b/lib/plugins/config/lang/ar/lang.php index 2e55446ec..76c155812 100644 --- a/lib/plugins/config/lang/ar/lang.php +++ b/lib/plugins/config/lang/ar/lang.php @@ -28,6 +28,7 @@ $lang['_anti_spam'] = 'اعدادات مضاد النفاية'; $lang['_editing'] = 'اعدادات التحرير'; $lang['_links'] = 'اعدادات الروابط'; $lang['_media'] = 'اعدادات الوسائط'; +$lang['_notifications'] = 'اعدادات التنبيه'; $lang['_advanced'] = 'اعدادات متقدمة'; $lang['_network'] = 'اعدادات الشبكة'; $lang['_plugin_sufix'] = 'اعدادات الملحقات'; @@ -35,29 +36,30 @@ $lang['_template_sufix'] = 'اعدادات القوالب'; $lang['_msg_setting_undefined'] = 'لا بيانات إعدادات.'; $lang['_msg_setting_no_class'] = 'لا صنف إعدادات.'; $lang['_msg_setting_no_default'] = 'لا قيمة افتراضية.'; -$lang['fmode'] = 'نمط انشاء الملفات'; -$lang['dmode'] = 'نمط انشاء المجلدات'; -$lang['lang'] = 'لغة الواجهة'; -$lang['basedir'] = 'مسار الخادوم (مثال. /dokuwiki/) اترك فارغا للاكتشاف التلقائي.'; -$lang['baseurl'] = 'عنوان الخادوم (مثال. http://www.yourserver.com). اترك فارغا للاكتشاف التلقائي.'; -$lang['savedir'] = 'دليل حفظ البيانات'; -$lang['cookiedir'] = 'مسار الكعكات. اترك فارغا لاستخدام baseurl.'; -$lang['start'] = 'اسم صفحة البداية'; $lang['title'] = 'عنوان الويكي'; +$lang['start'] = 'اسم صفحة البداية'; +$lang['lang'] = 'لغة الواجهة'; $lang['template'] = 'القالب'; $lang['tagline'] = 'Tagline (في حال دعم القالب له) '; $lang['sidebar'] = 'اسم صفحة الشريط الجانبي (في حال دعم القالب له). تركه فارغا يعطل الشريط الجانبي.'; $lang['license'] = 'تحت أي رخصة تريد اصدار المحتوى؟'; -$lang['fullpath'] = 'اظهر المحتوى الكامل للصفحات في '; +$lang['savedir'] = 'دليل حفظ البيانات'; +$lang['basedir'] = 'مسار الخادوم (مثال. /dokuwiki/) اترك فارغا للاكتشاف التلقائي.'; +$lang['baseurl'] = 'عنوان الخادوم (مثال. http://www.yourserver.com). اترك فارغا للاكتشاف التلقائي.'; +$lang['cookiedir'] = 'مسار الكعكات. اترك فارغا لاستخدام baseurl.'; +$lang['dmode'] = 'نمط انشاء المجلدات'; +$lang['fmode'] = 'نمط انشاء الملفات'; +$lang['allowdebug'] = 'مكّن التنقيح عطّلها إن لم تكن بحاجلة لها!'; $lang['recent'] = 'أحدث التغييرات'; +$lang['recent_days'] = 'مدة إبقاء أحدث التغييرات (ايام)'; $lang['breadcrumbs'] = 'عدد العناقيد للزيارات'; $lang['youarehere'] = 'عناقيد هرمية'; +$lang['fullpath'] = 'اظهر المحتوى الكامل للصفحات في '; $lang['typography'] = 'اعمل استبدالات طبوغرافية'; -$lang['htmlok'] = 'مكّن تضمين HTML'; -$lang['phpok'] = 'مكّن تضمين PHP'; $lang['dformat'] = 'تنسيق التاريخ (انظر وظيفة PHP,s strftime)'; $lang['signature'] = 'التوقيع'; +$lang['showuseras'] = 'الذي يعرض لاظهار المستخدم الذي قام بآخر تحرير لصفحة'; $lang['toptoclevel'] = 'المستوى الأعلى لمحتويات الجدول'; $lang['tocminheads'] = 'الحد الأدنى من الترويسات لبناء جدول المحتويات'; $lang['maxtoclevel'] = 'المستوى الأقصى لمحتويات الجدول'; @@ -65,16 +67,8 @@ $lang['maxseclevel'] = 'المستوى الأقصى لتحرير ال $lang['camelcase'] = 'استخدم CamelCase للروابط'; $lang['deaccent'] = 'نظّف اسماء الصفحات'; $lang['useheading'] = 'استخدم اول ترويسة كأسم للصفحة'; -$lang['refcheck'] = 'التحقق من مرجع الوسائط'; -$lang['refshow'] = 'عدد مراجع الوسائط لتعرض'; -$lang['allowdebug'] = 'مكّن التنقيح عطّلها إن لم تكن بحاجلة لها!'; -$lang['mediarevisions'] = 'تفعيل إصدارات الوسائط؟'; -$lang['usewordblock'] = 'احجز الغثاء بناء على قائمة كلمات'; -$lang['indexdelay'] = 'التأخير قبل الفهرسة (ثوان)'; -$lang['relnofollow'] = 'استخدم rel="nofollow" للروابط الخارجية'; -$lang['mailguard'] = 'عناوين بريدية مبهمة'; -$lang['iexssprotect'] = 'تحقق الملفات المرفوعة من احتمال وجود أكواد جافاسكربت أو HTML ضارة'; -$lang['showuseras'] = 'الذي يعرض لاظهار المستخدم الذي قام بآخر تحرير لصفحة'; +$lang['sneaky_index'] = 'افتراضيا، ستعرض دوكو ويكي كل اسماء النطاقات في عرض الفهرس. تفعيل هذا الخيار سيخفي مالا يملك المستخدم صلاحية قراءته. قد يؤدي هذا إلى اخفاء نطاقات فرعية متاحة. وقد يؤدي لجعل صفحة الفهرس معطلة في بعض اعدادات ACL.'; +$lang['hidepages'] = 'أخف الصفحات المنطبق عليها (تعابير شرطية)'; $lang['useacl'] = 'استخدم قائمة التحم بالوصول'; $lang['autopasswd'] = 'ولد كلمات سر تلقائيا'; $lang['authtype'] = 'آلية المواثقة'; @@ -83,61 +77,68 @@ $lang['defaultgroup'] = 'المجموعة الافتراضية'; $lang['superuser'] = 'مجموعة المستخدم المتفوق أو مستخدم أو قائمة مفصولة بالفاصلة مستخدم1،@مجموعة، مستخدم2 صلاحيتهم الوصول الكامل لكل الصفحات و الوظائف بغض النظر عن اعدادات ACL'; $lang['manager'] = 'مجموعة المدراء أو مستخدم أو قائمة مفصولة بالفاصلة مستخدم1،@مجموعة، مستخدم2 صلاحيتهم بعض الوظائف الادارية'; $lang['profileconfirm'] = 'اكد تغيير اللاحة بكلمة المرور'; +$lang['rememberme'] = 'اسمح بكعكات الدخول الدائم (تذكرني)'; $lang['disableactions'] = 'عطّل اجراءات دوكو ويكي'; $lang['disableactions_check'] = 'تحقق'; $lang['disableactions_subscription'] = 'اشترك/الغ الاشتراك'; $lang['disableactions_wikicode'] = 'اعرض المصدر/صدّر صرفا'; $lang['disableactions_other'] = 'اجراءات أخرى (مفصولة بالفاصلة)'; -$lang['sneaky_index'] = 'افتراضيا، ستعرض دوكو ويكي كل اسماء النطاقات في عرض الفهرس. تفعيل هذا الخيار سيخفي مالا يملك المستخدم صلاحية قراءته. قد يؤدي هذا إلى اخفاء نطاقات فرعية متاحة. وقد يؤدي لجعل صفحة الفهرس معطلة في بعض اعدادات ACL.'; $lang['auth_security_timeout'] = 'زمن انتهاء أمان المواثقة (ثوان)'; $lang['securecookie'] = 'هل يفرض على كعكات التصفح المعدة عبر HTTPS ان ترسل فقط عبر HTTPS من قبل المتصفح؟ عطل هذا إن كان الولوج للويكي مؤمنا فقط عبر SSL لكن تصفح الويكي غير مؤمن.'; $lang['remote'] = 'مكّن نظام API البعيد. يسمح هذا لبرامج أخرى بالوصول للويكي عبر XML-RPC أو آليات أخرى.'; $lang['remoteuser'] = 'احصر الوصول البعيد ل API لمستخدمين ومجموعات يفصل بينها بالفاصلة هنا. اترك فارغا لتمكين الجميع.'; +$lang['usewordblock'] = 'احجز الغثاء بناء على قائمة كلمات'; +$lang['relnofollow'] = 'استخدم rel="nofollow" للروابط الخارجية'; +$lang['indexdelay'] = 'التأخير قبل الفهرسة (ثوان)'; +$lang['mailguard'] = 'عناوين بريدية مبهمة'; +$lang['iexssprotect'] = 'تحقق الملفات المرفوعة من احتمال وجود أكواد جافاسكربت أو HTML ضارة'; +$lang['usedraft'] = 'احفظ المسودة تلقائيا أثناء التحرير'; +$lang['htmlok'] = 'مكّن تضمين HTML'; +$lang['phpok'] = 'مكّن تضمين PHP'; +$lang['locktime'] = 'الحد الأعظمي لقفل الملف (ثوان)'; +$lang['cachetime'] = 'الحد الأعظم لعمر المخُبأ (ثوان)'; +$lang['target____wiki'] = 'النافذة الهدف للروابط الداخلية'; +$lang['target____interwiki'] = 'النافذة الهدف للروابط الممرة interwiki'; +$lang['target____extern'] = 'النافذة الهدف للروابط الخارجية'; +$lang['target____media'] = 'النافذة الهدف لروابط الوسائط'; +$lang['target____windows'] = 'النافذة الهدف لروابط النوافذ'; +$lang['mediarevisions'] = 'تفعيل إصدارات الوسائط؟'; +$lang['refcheck'] = 'التحقق من مرجع الوسائط'; +$lang['refshow'] = 'عدد مراجع الوسائط لتعرض'; +$lang['gdlib'] = 'اصدار مكتبة GD'; +$lang['im_convert'] = 'المسار إلى اداة تحويل ImageMagick'; +$lang['jpg_quality'] = 'دقة ضغط JPG (0-100)'; +$lang['fetchsize'] = 'الحجم الأعظمي (بايت) ل fetch.php لتنزيله من الخارج'; +$lang['subscribers'] = 'مكن دعم اشتراك الصفحة'; +$lang['subscribe_time'] = 'المهلة بعد ارسال قوائم الاشتراكات والملخصات (ثوان); هذا يجب أن يكون أقل من الوقت المخصص في أيام أحدث التغييرات.'; +$lang['notify'] = 'ارسل تنبيهات التغيير لهذا البريد'; +$lang['registernotify'] = 'ارسل بيانات عن المستخدمين المسجلين جديدا لهذا البريد'; +$lang['mailfrom'] = 'البريد الالكتروني ليستخدم للرسائل الآلية'; +$lang['mailprefix'] = 'بادئة موضوع البريد لتستخدم مع الرسائل الآلية'; +$lang['sitemap'] = 'ولد خرائط موقع جوجل (أيام)'; +$lang['rss_type'] = 'نوع تلقيمات XML'; +$lang['rss_linkto'] = 'تلقيمات XML توصل إلى'; +$lang['rss_content'] = 'مالذي يعرض في عناصر تلقيمات XML؟'; +$lang['rss_update'] = 'تحديث تلقيم XML (ثوان)'; +$lang['rss_show_summary'] = 'تلقيم XML يظهر ملخصا في العنوان'; +$lang['rss_media'] = 'مانوع التغييرات التي ستدرج في تغذية XML؟'; $lang['updatecheck'] = 'تحقق من التحديثات و تنبيهات الأمان؟ دوكو ويكي ستحتاج للاتصال ب update.dokuwiki.org لأجل ذلك'; $lang['userewrite'] = 'استعمل عناوين URLs جميلة'; $lang['useslash'] = 'استخدم الشرطة كفاصل النطاق في العناوين'; -$lang['usedraft'] = 'احفظ المسودة تلقائيا أثناء التحرير'; $lang['sepchar'] = 'فاصل كلمة اسم الصفحة'; $lang['canonical'] = 'استخدم العناوين الشائعة كاملة'; $lang['fnencode'] = 'نظام ترميز اسماء الملفات بغير الأسكي.'; $lang['autoplural'] = 'تحقق من صيغ الجمع في الروابط'; $lang['compression'] = 'طريقة الغضط لملفات attic'; -$lang['cachetime'] = 'الحد الأعظم لعمر المخُبأ (ثوان)'; -$lang['locktime'] = 'الحد الأعظمي لقفل الملف (ثوان)'; -$lang['fetchsize'] = 'الحجم الأعظمي (بايت) ل fetch.php لتنزيله من الخارج'; -$lang['notify'] = 'ارسل تنبيهات التغيير لهذا البريد'; -$lang['registernotify'] = 'ارسل بيانات عن المستخدمين المسجلين جديدا لهذا البريد'; -$lang['mailfrom'] = 'البريد الالكتروني ليستخدم للرسائل الآلية'; -$lang['mailprefix'] = 'بادئة موضوع البريد لتستخدم مع الرسائل الآلية'; $lang['gzip_output'] = 'استخدم ترميز-محتوى gzip ل xhtml'; -$lang['gdlib'] = 'اصدار مكتبة GD'; -$lang['im_convert'] = 'المسار إلى اداة تحويل ImageMagick'; -$lang['jpg_quality'] = 'دقة ضغط JPG (0-100)'; -$lang['subscribers'] = 'مكن دعم اشتراك الصفحة'; -$lang['subscribe_time'] = 'المهلة بعد ارسال قوائم الاشتراكات والملخصات (ثوان); هذا يجب أن يكون أقل من الوقت المخصص في أيام أحدث التغييرات.'; $lang['compress'] = 'رُص مخرجات CSS و جافا سكربت'; $lang['cssdatauri'] = 'الحجم بالبايتات للصور المذكورة في CSS التي ستُضمن في صفحة-التنسيق لخفض طلبات HTTP. لن تعمل هذه التقنية في IE 7 أو أقل! 400 إلى 600 بايت تعد قيمة جيدة. اضبط إلى 0 لتعطلها.'; -$lang['hidepages'] = 'أخف الصفحات المنطبق عليها (تعابير شرطية)'; $lang['send404'] = 'ارسل "HTTP 404/Page Not Found" للصفحات غير الموجودة'; -$lang['sitemap'] = 'ولد خرائط موقع جوجل (أيام)'; $lang['broken_iua'] = 'هل الوظيفة ignore_user_abort معطلة على جهازك؟ قد يؤدي ذلك لتعطيل فهرسة البحث. IIS+PHP/CGI تعرف بأنها لاتعمل. أنظر العلة 852 لمزيد من المعلومات.'; $lang['xsendfile'] = 'استخدم ترويسة X-Sendfile لتمكين خادم الوب من تقديم ملفات ثابتة؟ يجب أن يكون خادم الوب داعما له.'; $lang['renderer_xhtml'] = 'المحرك ليستخدم لمخرجات الويكي الأساسية وفق (xhtml).'; $lang['renderer__core'] = '%s (نواة دوكو ويكي)'; $lang['renderer__plugin'] = '%s (ملحق)'; -$lang['rememberme'] = 'اسمح بكعكات الدخول الدائم (تذكرني)'; -$lang['rss_type'] = 'نوع تلقيمات XML'; -$lang['rss_linkto'] = 'تلقيمات XML توصل إلى'; -$lang['rss_content'] = 'مالذي يعرض في عناصر تلقيمات XML؟'; -$lang['rss_update'] = 'تحديث تلقيم XML (ثوان)'; -$lang['recent_days'] = 'مدة إبقاء أحدث التغييرات (ايام)'; -$lang['rss_show_summary'] = 'تلقيم XML يظهر ملخصا في العنوان'; -$lang['rss_media'] = 'مانوع التغييرات التي ستدرج في تغذية XML؟'; -$lang['target____wiki'] = 'النافذة الهدف للروابط الداخلية'; -$lang['target____interwiki'] = 'النافذة الهدف للروابط الممرة interwiki'; -$lang['target____extern'] = 'النافذة الهدف للروابط الخارجية'; -$lang['target____media'] = 'النافذة الهدف لروابط الوسائط'; -$lang['target____windows'] = 'النافذة الهدف لروابط النوافذ'; $lang['proxy____host'] = 'اسم خادوم الوكيل'; $lang['proxy____port'] = 'منفذ الوكيل'; $lang['proxy____user'] = 'اسم مستخدم الوكيل'; -- cgit v1.2.3 From 7eaa7703a43b9f22f12be04e8580a3f2515fb146 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?=E6=97=A5=E5=90=91=E5=B0=8F=E9=83=8E?= Date: Wed, 9 Jan 2013 20:30:03 +0100 Subject: Traditional Chinese language update --- lib/plugins/acl/lang/zh-tw/help.txt | 8 ++-- lib/plugins/acl/lang/zh-tw/lang.php | 21 +++++----- lib/plugins/config/lang/zh-tw/intro.txt | 6 +-- lib/plugins/config/lang/zh-tw/lang.php | 56 +++++++++++++++---------- lib/plugins/plugin/lang/zh-tw/admin_plugin.txt | 4 +- lib/plugins/plugin/lang/zh-tw/lang.php | 55 ++++++++++++------------ lib/plugins/popularity/lang/zh-tw/intro.txt | 9 ++-- lib/plugins/popularity/lang/zh-tw/lang.php | 9 ++-- lib/plugins/popularity/lang/zh-tw/submitted.txt | 2 +- lib/plugins/revert/lang/zh-tw/intro.txt | 2 +- lib/plugins/revert/lang/zh-tw/lang.php | 5 ++- lib/plugins/usermanager/lang/zh-tw/lang.php | 17 ++++---- 12 files changed, 104 insertions(+), 90 deletions(-) (limited to 'lib') diff --git a/lib/plugins/acl/lang/zh-tw/help.txt b/lib/plugins/acl/lang/zh-tw/help.txt index d5d031059..2d1c84b7d 100644 --- a/lib/plugins/acl/lang/zh-tw/help.txt +++ b/lib/plugins/acl/lang/zh-tw/help.txt @@ -1,11 +1,11 @@ -=== 快速指南: === +=== 快速指南: === -你可以用這個頁面為維基中的分類空間或頁面增加或移除權限。 +你可以用這個頁面,為本 wiki 中的分類名稱或頁面增加或移除權限。 -左方面板顯示了所有分類空間和頁面。 +左方面板顯示了所有分類名稱和頁面。 上方表格允許你觀看及修改選取的使用者或群組的權限。 下方表格顯示了目前所有的存取控制表 (ACL),你可以用它快速刪除或更改多項規則。 -閱讀 [[doku>acl|official documentation on ACL]] 可以幫助你完整地了解 DokuWiki 存取控制的運作。 +閱讀 [[doku>acl|official documentation on ACL]] 可以幫助你完整地了解 DokuWiki 存取控制的運作。 \ No newline at end of file diff --git a/lib/plugins/acl/lang/zh-tw/lang.php b/lib/plugins/acl/lang/zh-tw/lang.php index ff115df18..ff2c6a184 100644 --- a/lib/plugins/acl/lang/zh-tw/lang.php +++ b/lib/plugins/acl/lang/zh-tw/lang.php @@ -12,25 +12,26 @@ * @author Danny Lin * @author Shuo-Ting Jian * @author syaoranhinata@gmail.com + * @author Ichirou Uchiki */ $lang['admin_acl'] = '管理存取控制表 (ACL)'; $lang['acl_group'] = '群組'; $lang['acl_user'] = '使用者'; $lang['acl_perms'] = '設定權限於'; $lang['page'] = '頁面'; -$lang['namespace'] = '分類空間'; +$lang['namespace'] = '分類名稱'; $lang['btn_select'] = '選擇'; -$lang['p_user_id'] = '使用者 %s 目前在頁面 %s 擁有以下權限:%s。'; -$lang['p_user_ns'] = '使用者 %s 目前在分類空間 %s 擁有以下權限:%s。'; -$lang['p_group_id'] = '群組 %s 的成員目前在頁面 %s 擁有以下權限:%s。'; -$lang['p_group_ns'] = '群組 %s 的成員目前在分類空間 %s 擁有以下權限:%s。'; +$lang['p_user_id'] = '使用者 %s 目前在頁面 %s 裏擁有以下權限:%s。'; +$lang['p_user_ns'] = '使用者 %s 目前在分類名稱 %s 裏擁有以下權限:%s。'; +$lang['p_group_id'] = '群組 %s 的成員目前在頁面 %s 裏擁有以下權限:%s。'; +$lang['p_group_ns'] = '群組 %s 的成員目前在分類名稱 %s 裏擁有以下權限:%s。'; $lang['p_choose_id'] = '請在上方表格輸入使用者或群組以檢視或編輯頁面 %s 的權限設定。'; -$lang['p_choose_ns'] = '請在上方表格輸入使用者或群組以檢視或編輯分類空間 %s 的權限設定。'; -$lang['p_inherited'] = '注意:這些權限並未明確指定,而是從群組或上層的分類空間繼承而來。'; -$lang['p_isadmin'] = '注意:選取的群組或使用者擁有完整權限,因為它被設定為超級使用者。'; -$lang['p_include'] = '較高的權限亦包含了較低的權限。新增、上傳與刪除權限只能設定在分類空間,不能設定在頁面。'; +$lang['p_choose_ns'] = '請在上方表格輸入使用者或群組以檢視或編輯分類名稱 %s 的權限設定。'; +$lang['p_inherited'] = '注意:這些權限並未明確指定,它們是從群組或上層的分類名稱繼承而來。'; +$lang['p_isadmin'] = '注意:選取的群組或使用者擁有完整權限,因為他或他們已成為超級使用者。'; +$lang['p_include'] = '較高的權限亦包含了較低的權限。新增、上傳與刪除權限只能套用至分類名稱,不能套用至頁面。'; $lang['current'] = '目前的存取控制規則'; -$lang['where'] = '頁面/分類空間'; +$lang['where'] = '頁面/分類名稱'; $lang['who'] = '使用者/群組'; $lang['perm'] = '權限'; $lang['acl_perm0'] = '無'; diff --git a/lib/plugins/config/lang/zh-tw/intro.txt b/lib/plugins/config/lang/zh-tw/intro.txt index 4cacfc43f..228c12e0a 100644 --- a/lib/plugins/config/lang/zh-tw/intro.txt +++ b/lib/plugins/config/lang/zh-tw/intro.txt @@ -1,7 +1,7 @@ ====== 設定管理器 ====== -使用本頁控制您的 Dokuwiki 設定。每個獨立設定的相關訊息可參閱 [[doku>config]]。設定管理器的更多訊息請參閱 [[doku>plugin:config]]。 +使用本頁控制您的 Dokuwiki 設定。您可以參閱 [[doku>config]],查看每個獨立設定的相關訊息。要知道更多設定管理器的資訊,請瀏覽 [[doku>plugin:config]]。 -淡紅色背景的項目是被保護的,不能通過這個管理器更改。藍色背景的項目是系統的預設值,白色背景的項目是您更改過的。藍色和白色的設定項目都可以更改。 +淡紅色背景的項目是受到保護的,不能通過這管理器更改。藍色背景的項目是系統的預設值,白色背景的項目是您更改過的。藍色和白色的設定項目都可以更改。 -離開本頁之前不要忘記點擊最下面的 **儲存** 按鈕,否則您的修改將不會生效。 \ No newline at end of file +離開本頁之前,不要忘記點擊最下面的 **儲存** 按鈕,否則您的修改不會生效。 \ No newline at end of file diff --git a/lib/plugins/config/lang/zh-tw/lang.php b/lib/plugins/config/lang/zh-tw/lang.php index 204b2b229..8f5b16220 100644 --- a/lib/plugins/config/lang/zh-tw/lang.php +++ b/lib/plugins/config/lang/zh-tw/lang.php @@ -10,19 +10,20 @@ * @author Danny Lin * @author Shuo-Ting Jian * @author syaoranhinata@gmail.com + * @author Ichirou Uchiki */ $lang['menu'] = '系統設定'; -$lang['error'] = '設定因為不合法的值而未更新,請檢查您的更改並重新送出。 -
    不正確的值會被紅色方框包住。'; -$lang['updated'] = '成功地更新設定。'; +$lang['error'] = '因為含有不合規格的設定值,故未能更新設定。請檢查您的更改並重新送出。 +
    不正確的設定值,會以紅色方框包住。'; +$lang['updated'] = '設定已更新。'; $lang['nochoice'] = '(無其他可用選項)'; $lang['locked'] = '設定檔無法更新,若非故意,請確認本地檔名及權限正確。'; -$lang['danger'] = '危險:改變此選項可能使您無法存取維基及設定選單。'; +$lang['danger'] = '危險:改變此選項,可能使您無法存取本 wiki 及設定選單。'; $lang['warning'] = '警告:改變此選項可能導致不可預期的行為。'; $lang['security'] = '安全性警告:改變此選項可能造成安全風險。'; $lang['_configuration_manager'] = '設定管理器'; $lang['_header_dokuwiki'] = 'DokuWiki 設定'; -$lang['_header_plugin'] = '插件設定'; +$lang['_header_plugin'] = '附加元件設定'; $lang['_header_template'] = '樣板設定'; $lang['_header_undefined'] = '未定義設定'; $lang['_basic'] = '基本設定'; @@ -32,17 +33,21 @@ $lang['_anti_spam'] = '反垃圾設定'; $lang['_editing'] = '編輯設定'; $lang['_links'] = '連結設定'; $lang['_media'] = '媒體設定'; +$lang['_notifications'] = '提醒設定'; +$lang['_syndication'] = '聚合設定'; $lang['_advanced'] = '進階設定'; $lang['_network'] = '網路設定'; -$lang['_plugin_sufix'] = '插件設定'; +$lang['_plugin_sufix'] = '附加元件設定'; $lang['_template_sufix'] = '樣板設定'; $lang['_msg_setting_undefined'] = '設定的後設數據不存在。'; $lang['_msg_setting_no_class'] = '設定的分類不存在。'; $lang['_msg_setting_no_default'] = '無預設值'; -$lang['title'] = '維基標題'; +$lang['title'] = '本 wiki 的標題'; $lang['start'] = '開始頁面的名稱'; $lang['lang'] = '語系'; $lang['template'] = '樣板'; +$lang['tagline'] = '副標題 (若模板支援此功能)'; +$lang['sidebar'] = '側欄的頁面名稱 (若模板支援此功能) 。若把它留空,則會停用側欄'; $lang['license'] = '您希望您的內容為何種授權方式?'; $lang['savedir'] = '儲存資料的目錄'; $lang['basedir'] = '根目錄'; @@ -67,15 +72,15 @@ $lang['maxseclevel'] = '可編輯段落的最大層級'; $lang['camelcase'] = '對連結使用 CamelCase'; $lang['deaccent'] = '清理頁面名稱'; $lang['useheading'] = '使用第一個標題作為頁面名稱'; -$lang['sneaky_index'] = '預設情況下,DokuWiki 會在索引頁會顯示所有分類空間。啟用此選項會隱藏用戶沒有閱讀權限的頁面,但也可能將能閱讀的子頁面一併隱藏。在特定 ACL 設定下,這可能導致索引無法使用。'; +$lang['sneaky_index'] = '預設情況下,DokuWiki 會在索引頁會顯示所有分類名稱。啟用此選項,會隱藏使用者沒有閱讀權限的頁面,但也可能將他可以閱讀的子頁面一併隱藏。在特定 ACL 設定下,這可能導致索引無法使用。'; $lang['hidepages'] = '隱藏匹配的界面 (正規式)'; $lang['useacl'] = '使用存取控制名單'; $lang['autopasswd'] = '自動產生密碼'; $lang['authtype'] = '認證後台管理方式'; $lang['passcrypt'] = '密碼加密方式'; $lang['defaultgroup'] = '預設群組'; -$lang['superuser'] = '超級用戶 - 不論 ACL 如何設定,都能訪問所有頁面與功能的用戶組/用戶'; -$lang['manager'] = '管理員 - 能訪問相應管理功能的用戶组/用戶'; +$lang['superuser'] = '超級使用者 —— 不論 ACL 如何設定,都能訪問所有頁面與功能的群組或使用者'; +$lang['manager'] = '管理員 —— 能訪問相應管理功能的群組或使用者'; $lang['profileconfirm'] = '修改個人資料時需要確認密碼'; $lang['rememberme'] = '允許自動登入 (記住我)'; $lang['disableactions'] = '停用的 DokuWiki 動作'; @@ -84,11 +89,13 @@ $lang['disableactions_subscription'] = '訂閱/取消訂閱'; $lang['disableactions_wikicode'] = '檢視原始碼/匯出原始檔'; $lang['disableactions_other'] = '其他功能 (逗號分隔)'; $lang['auth_security_timeout'] = '安全認證的計時 (秒)'; -$lang['securecookie'] = 'HTTPS 頁面設定的 cookie 是否只能由瀏覽器經 HTTPS 傳送?取消此選項後,只有登入維基會被 SSL 保護而瀏覽時不會。'; +$lang['securecookie'] = 'HTTPS 頁面設定的 cookie 是否只能由瀏覽器經 HTTPS 傳送?取消此選項後,只有登入本 wiki 才會受 SSL 保護,瀏覽時則不受保護。'; +$lang['remote'] = '啟用遠程 API 系统。這允許其他程式經 XML-RPC 或其他機制來訪問本 wiki 。'; +$lang['remoteuser'] = '將遠程 API 的訪問權限,限制在指定的群組或使用者中。以逗號分隔群組或使用者。留空表示允許任何人訪問。'; $lang['usewordblock'] = '根據字詞表阻擋垃圾訊息'; $lang['relnofollow'] = '外部連結使用 rel="nofollow"'; $lang['indexdelay'] = '建立索引前的延遲時間 (秒)'; -$lang['mailguard'] = '混淆 E-mail 位址'; +$lang['mailguard'] = '自動弄亂使用者的電郵地址,以作保護'; $lang['iexssprotect'] = '檢查上傳的檔案中是否隱含惡意的 JavaScript 或 HTML 碼'; $lang['usedraft'] = '編輯時自動儲存草稿'; $lang['htmlok'] = '允許嵌入式 HTML'; @@ -96,10 +103,11 @@ $lang['phpok'] = '允許嵌入式 PHP'; $lang['locktime'] = '檔案的最大鎖定時間 (秒)'; $lang['cachetime'] = '緩存的最大存在時間 (秒)'; $lang['target____wiki'] = '內部連結的目標視窗'; -$lang['target____interwiki'] = '跨維基連結的目標視窗'; +$lang['target____interwiki'] = 'Wiki間互連的目標視窗'; $lang['target____extern'] = '外部連結的目標視窗'; $lang['target____media'] = '媒體連結的目標視窗'; $lang['target____windows'] = 'Windows 連結的目標視窗'; +$lang['mediarevisions'] = '啟用媒體修訂歷史嗎?'; $lang['refcheck'] = '媒體連結檢查'; $lang['refshow'] = '媒體連結的顯示數量'; $lang['gdlib'] = 'GD Lib 版本'; @@ -108,11 +116,12 @@ $lang['jpg_quality'] = 'JPG 壓縮品質(0-100)'; $lang['fetchsize'] = 'fetch.php 可以從外部下載的最大檔案尺寸 (bytes)'; $lang['subscribers'] = '啟用頁面訂閱'; $lang['subscribe_time'] = '訂閱列表和摘要發送的時間間隔 (秒);這個值應該小於指定的最近更改保留時間 (recent_days)。'; -$lang['notify'] = '寄送變更通知信到這個 E-mail 位址'; -$lang['registernotify'] = '寄送新使用者註冊資訊到這個 E-mail 位址'; +$lang['notify'] = '寄送變更通知信到這個電郵地址'; +$lang['registernotify'] = '寄送新使用者註冊資訊到這個電郵地址'; $lang['mailfrom'] = '自動發送郵件時使用的郵件地址'; $lang['mailprefix'] = '自動發送郵件時使用的標題前綴'; -$lang['sitemap'] = '產生 Google 站台地圖 (天)'; +$lang['htmlmail'] = '發送更加美觀,但體積會更大的 HTML 多部份電郵。若停用它,表示只發送純文字電郵。'; +$lang['sitemap'] = '產生 Google 站台地圖 (以多少天計算) 。輸入0表示停用'; $lang['rss_type'] = 'XML feed 類型'; $lang['rss_linkto'] = 'XML feed 連結到'; $lang['rss_content'] = 'XML feed 項目中顯示什麼呢?'; @@ -121,7 +130,7 @@ $lang['rss_show_summary'] = '於標題中顯示簡要的 XML feed'; $lang['rss_media'] = '在 XML feed 中應列出哪些變更?'; $lang['updatecheck'] = '檢查更新與安全性警告?DokuWiki 需要聯繫 update.dokuwiki.org 才能使用此功能。'; $lang['userewrite'] = '使用好看的 URL'; -$lang['useslash'] = '在 URL 中使用斜線作為分類空間的分隔字元'; +$lang['useslash'] = '在 URL 中使用斜線作為分類名稱的分隔字元'; $lang['sepchar'] = '頁面名稱中單字的分隔字元'; $lang['canonical'] = '使用最典型的 URL'; $lang['fnencode'] = '非 ASCII 文件名稱的編輯方法。'; @@ -129,13 +138,14 @@ $lang['autoplural'] = '檢查複數形式的連結 (英文)'; $lang['compression'] = 'attic 文件的壓縮方式'; $lang['gzip_output'] = '對 xhtml 使用 gzip 內容編碼'; $lang['compress'] = '壓縮 CSS 與 JavaScript 的輸出'; -$lang['cssdatauri'] = 'CSS 中所引用的圖片假如小於該數字大小(bytes),將會被直接嵌入 CSS 中來減少 HTTP Request 的發送。此功能在 IE 7 及之下版本不支援。推薦使用 400600 之間。設定為0 則停用。'; +$lang['cssdatauri'] = '假如 CSS 中所引用的圖片小於該數字大小(bytes),圖片將被直接嵌入 CSS 中,以減少 HTTP Request 的發送。 IE 7 及以下的版本並不支援此功能。推薦把此數值設定成 400600 bytes 之間。若輸入 0 則停用此功能。'; $lang['send404'] = '存取不存在的頁面時送出 "HTTP 404/Page Not Found"'; $lang['broken_iua'] = 'ignore_user_abort 功能失效了?這有可能導致搜索索引不可用。IIS+PHP/CGI 已損壞。請參閱 Bug 852 獲取更多信息。'; $lang['xsendfile'] = '使用 X-Sendfile 頭讓服務器發送狀態文件?您的服務器需要支持該功能。'; -$lang['renderer_xhtml'] = '主要維基輸出 (xhtml) 的的渲染器'; +$lang['renderer_xhtml'] = '主要wiki輸出 (xhtml) 的渲染器'; $lang['renderer__core'] = '%s (dokuwiki 核心)'; -$lang['renderer__plugin'] = '%s (插件)'; +$lang['renderer__plugin'] = '%s (附加元件)'; +$lang['dnslookups'] = 'Dokuwiki 將查詢使用者編輯頁面的遠程 IP 位址主機名稱。若您的 DNS 服務器速度較慢、失效,或者您不想要此功能,请停用此選項'; $lang['proxy____host'] = 'Proxy 伺服器名稱'; $lang['proxy____port'] = 'Proxy 連接埠'; $lang['proxy____user'] = 'Proxy 使用者名稱'; @@ -183,10 +193,10 @@ $lang['xsendfile_o_2'] = '標準 X-Sendfile 標頭'; $lang['xsendfile_o_3'] = '專有 Nginx X-Accel-Redirect 標頭'; $lang['showuseras_o_loginname'] = '登入名稱'; $lang['showuseras_o_username'] = '完整姓名'; -$lang['showuseras_o_email'] = '使用者的 email 位址 (根據郵件監控設定混淆化)'; -$lang['showuseras_o_email_link'] = '使用者的 email 位址標示成 mailto: link'; +$lang['showuseras_o_email'] = '使用者的電郵地址 (根據郵件監控設定混淆化)'; +$lang['showuseras_o_email_link'] = '使用者的電郵地址標示成 mailto: 連結'; $lang['useheading_o_0'] = '永不'; $lang['useheading_o_navigation'] = '僅導覽'; -$lang['useheading_o_content'] = '僅維基內容'; +$lang['useheading_o_content'] = '僅本 wiki 內容'; $lang['useheading_o_1'] = '總是'; $lang['readdircache'] = 'readdir 緩存的最大存在時間 (秒)'; diff --git a/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt b/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt index 84d095f51..54fe7a59e 100644 --- a/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt +++ b/lib/plugins/plugin/lang/zh-tw/admin_plugin.txt @@ -1,3 +1,3 @@ -====== 插件管理器 ====== +====== 附加元件管理器 ====== -您可以用本頁管理與 Dokuwiki [[doku>plugins|插件]] 相關的選項。若要正常下載及安裝插件,插件所在的資料夾必須允許網頁伺服器寫入。 +您可以用本頁管理與 Dokuwiki [[doku>plugins|附加元件]] 相關的選項。若要正常下載及安裝附加元件,附加元件所在的資料夾必須允許網頁伺服器寫入。 \ No newline at end of file diff --git a/lib/plugins/plugin/lang/zh-tw/lang.php b/lib/plugins/plugin/lang/zh-tw/lang.php index 8fa3efb0a..7b38a02c8 100644 --- a/lib/plugins/plugin/lang/zh-tw/lang.php +++ b/lib/plugins/plugin/lang/zh-tw/lang.php @@ -10,10 +10,11 @@ * @author Danny Lin * @author Shuo-Ting Jian * @author syaoranhinata@gmail.com + * @author Ichirou Uchiki */ -$lang['menu'] = '管理插件 (Plugins)'; -$lang['download'] = '下載與安裝插件'; -$lang['manage'] = '已安裝的插件'; +$lang['menu'] = '管理附加元件'; +$lang['download'] = '下載與安裝附加元件'; +$lang['manage'] = '已安裝的附加元件'; $lang['btn_info'] = '資訊'; $lang['btn_update'] = '更新'; $lang['btn_delete'] = '刪除'; @@ -25,34 +26,34 @@ $lang['installed'] = '安裝:'; $lang['lastupdate'] = '上次更新:'; $lang['source'] = '來源:'; $lang['unknown'] = '未知'; -$lang['updating'] = '更新中 ...'; -$lang['updated'] = '插件 %s 成功地更新'; -$lang['updates'] = '以下的插件已經成功地更新'; -$lang['update_none'] = '找不到更新'; -$lang['deleting'] = '刪除中 ...'; -$lang['deleted'] = '插件 %s 已刪除。'; -$lang['downloading'] = '下載中 ...'; -$lang['downloaded'] = '插件 %s 已成功地安裝'; -$lang['downloads'] = '以下的插件已成功地安裝:'; -$lang['download_none'] = '找不到插件,或在下載與安裝時發生了未知的問題'; -$lang['plugin'] = '插件:'; +$lang['updating'] = '更新中……'; +$lang['updated'] = '已更新附加元件 %s '; +$lang['updates'] = '已更新下列附加元件'; +$lang['update_none'] = '找不到更新。'; +$lang['deleting'] = '刪除中……'; +$lang['deleted'] = '已刪除附加元件 %s 。'; +$lang['downloading'] = '下載中……'; +$lang['downloaded'] = '已安裝附加元件 %s '; +$lang['downloads'] = '已安裝下列附加元件:'; +$lang['download_none'] = '找不到附加元件,或者在下載與安裝時發生了未知的問題。'; +$lang['plugin'] = '附加元件:'; $lang['components'] = '元件'; -$lang['noinfo'] = '此插件沒有回傳任何資訊,可能是無效的'; +$lang['noinfo'] = '此附加元件沒有回傳任何資訊,它可能已失效。'; $lang['name'] = '名稱:'; $lang['date'] = '日期:'; $lang['type'] = '類型:'; $lang['desc'] = '描述:'; $lang['author'] = '作者:'; -$lang['www'] = '網頁:'; -$lang['error'] = '一個未知的錯誤發生。'; -$lang['error_download'] = '無法下載插件檔案: %s'; -$lang['error_badurl'] = 'URL 可能有問題 - 從 URL 中無法得知文件名'; +$lang['www'] = '網頁:'; +$lang['error'] = '發生了未知的錯誤。'; +$lang['error_download'] = '無法下載附加元件檔案: %s'; +$lang['error_badurl'] = 'URL 可能有問題 —— 從 URL 中無法得知文件名'; $lang['error_dircreate'] = '無法建立暫存目錄來接收下載的內容'; -$lang['error_decompress'] = '插件管理器無法解壓下載的文件。這可能是由於下載出現錯誤,遇到這種情況,請您再次嘗試;或者是壓縮格式無法識別,遇到這種情況,您需要手動下載並安裝該插件。'; -$lang['error_copy'] = '嘗試安裝插件 %s 的相關文件時發生複製錯誤:可能是磁碟空間不足或檔案存取權限錯誤。這可能是由於未安裝完全的插件使維基系統不穩定導致。'; -$lang['error_delete'] = '嘗試刪除插件 %s 時發生錯誤。最可能原因是檔案或目錄存取權限不足'; -$lang['enabled'] = '插件 %s 已啟用。'; -$lang['notenabled'] = '插件 %s 無法啟用,請檢查檔案權限。'; -$lang['disabled'] = '插件 %s 已停用。'; -$lang['notdisabled'] = '插件 %s 無法停用,請檢查檔案權限。'; -$lang['packageinstalled'] = '插件 (%d 插件%s: %s) 已成功地安裝。'; +$lang['error_decompress'] = '附加元件管理器無法把下載的文件解壓,這可能是由於下載出現錯誤。遇到這種情況,請您再次嘗試。此外,無法識別壓縮格式也可能導致無法解壓。若是如此,您需要手動下載並安裝該附加元件。'; +$lang['error_copy'] = '嘗試安裝附加元件 %s 的相關文件時,發生複製錯誤。這可能是磁碟空間不足,或檔案存取權限錯誤。未安裝好的附加元件,也許會令wiki系統不穩定。'; +$lang['error_delete'] = '嘗試刪除附加元件 %s 時發生錯誤。最有可能原因是檔案或目錄存取權限不足'; +$lang['enabled'] = '附加元件 %s 已啟用。'; +$lang['notenabled'] = '附加元件 %s 無法啟用,請檢查檔案權限。'; +$lang['disabled'] = '附加元件 %s 已停用。'; +$lang['notdisabled'] = '附加元件 %s 無法停用,請檢查檔案權限。'; +$lang['packageinstalled'] = '附加元件 (%d 附加元件%s: %s) 已安裝好。'; diff --git a/lib/plugins/popularity/lang/zh-tw/intro.txt b/lib/plugins/popularity/lang/zh-tw/intro.txt index 37c63dced..2a6337237 100644 --- a/lib/plugins/popularity/lang/zh-tw/intro.txt +++ b/lib/plugins/popularity/lang/zh-tw/intro.txt @@ -1,10 +1,9 @@ ====== 人氣回饋 ====== -本工具會從您的維基站台收集訊息,並以匿名的方式發送給 DokuWiki 的開發者。這有助於他們了解使用者們如何使用 DokuWiki ,並能基於實際統計資料對未來開發做出更準確的決策。 +本工具會從您的 wiki 站台收集訊息,並以匿名的方式發送給 DokuWiki 的開發者。這有助於他們了解使用者們如何使用 DokuWiki ,並能基於實際統計資料對未來開發做出更準確的決策。 -我們鼓勵您經常重複這個步驟,讓開發者了解您的維基站台的成長情形。您的資料集將會被標識為一個匿名的識別碼 (ID)。 +我們鼓勵您經常重複這個步驟,讓開發者了解您的 wiki 站台的成長情形。您的資料集將會被標識為一個匿名的識別碼 (ID) 。 -收集的資料包括 DokuWiki 版本、頁面數量、檔案大小、安裝的插件、伺服器的 PHP 資訊。 - -將被發送的原始資料顯示如下。請點擊「發送資料」按鈕進行傳輸。 +收集的資料包括 DokuWiki 版本、頁面數量、檔案大小、安裝的附加元件,以及伺服器的 PHP 資訊。 +將送出的原始資料顯示如下。請點擊「發送資料」按鈕進行傳輸。 \ No newline at end of file diff --git a/lib/plugins/popularity/lang/zh-tw/lang.php b/lib/plugins/popularity/lang/zh-tw/lang.php index 3d19ce53a..890c23bfa 100644 --- a/lib/plugins/popularity/lang/zh-tw/lang.php +++ b/lib/plugins/popularity/lang/zh-tw/lang.php @@ -10,11 +10,12 @@ * @author Danny Lin * @author Shuo-Ting Jian * @author syaoranhinata@gmail.com + * @author Ichirou Uchiki */ -$lang['name'] = '人氣回饋(載入可能需要一些時間)'; +$lang['name'] = '人氣回饋(可能需要一些時間載入)'; $lang['submit'] = '發送資料'; $lang['autosubmit'] = '每月自動發送'; -$lang['submissionFailed'] = '由於以下原因,資料無法發送:'; -$lang['submitDirectly'] = '你可以利用以下的表單來發手動發送資料.'; -$lang['autosubmitError'] = '由於以下原因,上次自動發送失敗:'; +$lang['submissionFailed'] = '由於以下原因,資料無法發送:'; +$lang['submitDirectly'] = '你可以利用以下的表單來發手動發送資料。'; +$lang['autosubmitError'] = '由於以下原因,上次自動發送無法進行:'; $lang['lastSent'] = '資料已發送'; diff --git a/lib/plugins/popularity/lang/zh-tw/submitted.txt b/lib/plugins/popularity/lang/zh-tw/submitted.txt index 6febcd5b8..430a8a47a 100644 --- a/lib/plugins/popularity/lang/zh-tw/submitted.txt +++ b/lib/plugins/popularity/lang/zh-tw/submitted.txt @@ -1,3 +1,3 @@ ====== 人氣回饋 ====== -資料已發送成功 \ No newline at end of file +資料已發送。 \ No newline at end of file diff --git a/lib/plugins/revert/lang/zh-tw/intro.txt b/lib/plugins/revert/lang/zh-tw/intro.txt index 17632b1dd..b6da47e58 100644 --- a/lib/plugins/revert/lang/zh-tw/intro.txt +++ b/lib/plugins/revert/lang/zh-tw/intro.txt @@ -1,3 +1,3 @@ ====== 還原管理器 ====== -本頁面能幫助您自動還原被垃圾訊息攻擊的頁面過來。先輸入關鍵字詞搜尋包含垃圾訊息的頁面(如垃圾訊息的 URL),確認找到的頁面確實包含垃圾訊息,再將它們還原。 +本頁面能幫助您自動還原遭垃圾訊息攻擊的頁面。先輸入關鍵字詞,搜尋包含垃圾訊息的頁面(例如垃圾訊息的 URL),確認找到的頁面確實包含垃圾訊息,再將它們還原。 \ No newline at end of file diff --git a/lib/plugins/revert/lang/zh-tw/lang.php b/lib/plugins/revert/lang/zh-tw/lang.php index 64da648cd..afd858455 100644 --- a/lib/plugins/revert/lang/zh-tw/lang.php +++ b/lib/plugins/revert/lang/zh-tw/lang.php @@ -10,6 +10,7 @@ * @author Danny Lin * @author Shuo-Ting Jian * @author syaoranhinata@gmail.com + * @author Ichirou Uchiki */ $lang['menu'] = '還原管理'; $lang['filter'] = '搜索包含垃圾訊息的頁面'; @@ -17,6 +18,6 @@ $lang['revert'] = '還原選取的頁面'; $lang['reverted'] = '%s 已還原為版本 %s'; $lang['removed'] = '%s 已移除'; $lang['revstart'] = '已開始還原操作。有可能需要很長時間。如果程式執行逾時,請嘗試分次還原少量內容。'; -$lang['revstop'] = '還原程序已成功完成。'; +$lang['revstop'] = '還原程序已完成。'; $lang['note1'] = '注意:搜尋區分大小寫'; -$lang['note2'] = '注意:此頁面將被還原為最後一個不含垃圾訊息 %s 的版本。'; +$lang['note2'] = '注意:我們將把此頁面還原作最後一個不含垃圾訊息 %s 的版本。'; diff --git a/lib/plugins/usermanager/lang/zh-tw/lang.php b/lib/plugins/usermanager/lang/zh-tw/lang.php index 23b4fdac6..1db35cc82 100644 --- a/lib/plugins/usermanager/lang/zh-tw/lang.php +++ b/lib/plugins/usermanager/lang/zh-tw/lang.php @@ -11,6 +11,7 @@ * @author Danny Lin * @author Shuo-Ting Jian * @author syaoranhinata@gmail.com + * @author Ichirou Uchiki */ $lang['menu'] = '帳號管理器'; $lang['noauth'] = '(帳號認證尚未開放)'; @@ -18,8 +19,8 @@ $lang['nosupport'] = '(尚不支援帳號管理)'; $lang['badauth'] = '錯誤的認證機制'; $lang['user_id'] = '帳號'; $lang['user_pass'] = '密碼'; -$lang['user_name'] = '真實姓名'; -$lang['user_mail'] = 'E-mail'; +$lang['user_name'] = '名稱'; +$lang['user_mail'] = '電郵'; $lang['user_groups'] = '群組'; $lang['field'] = '欄位'; $lang['value'] = '設定值'; @@ -36,10 +37,10 @@ $lang['filter'] = '篩選條件(Filter)'; $lang['summary'] = '顯示帳號 %1$d-%2$d,共 %3$d 筆符合。共有 %4$d 個帳號。'; $lang['nonefound'] = '找不到帳號。共有 %d 個帳號。'; $lang['delete_ok'] = '已刪除 %d 個帳號'; -$lang['delete_fail'] = '%d 個帳號刪除失敗。'; +$lang['delete_fail'] = '%d 個帳號無法刪除。'; $lang['update_ok'] = '已更新該帳號'; -$lang['update_fail'] = '更新該帳號時失敗'; -$lang['update_exists'] = '變更帳號名稱 (%s) 失敗,因為有同名帳號存在(其他修改已套用)。'; +$lang['update_fail'] = '無法更新該帳號'; +$lang['update_exists'] = '無法變更帳號名稱 (%s) ,因為有同名帳號存在。其他修改則已套用。'; $lang['start'] = '開始'; $lang['prev'] = '上一頁'; $lang['next'] = '下一頁'; @@ -47,9 +48,9 @@ $lang['last'] = '最後一頁'; $lang['edit_usermissing'] = '找不到選取的帳號,可能已被刪除或改為其他名稱。'; $lang['user_notify'] = '通知使用者'; $lang['note_notify'] = '通知信只會在指定使用者新密碼時寄送。'; -$lang['note_group'] = '如果沒有指定群組,新使用者將會被加入到預設群組(%s)當中。'; +$lang['note_group'] = '如果沒有指定群組,新使用者將會列入至預設群組(%s)當中。'; $lang['note_pass'] = '如果沒有輸入這個欄位而且有勾選通知使用者,則會自動產生一組密碼。'; -$lang['add_ok'] = '新增使用者成功'; -$lang['add_fail'] = '新增使用者失敗'; +$lang['add_ok'] = '已新增使用者'; +$lang['add_fail'] = '無法新增使用者'; $lang['notify_ok'] = '通知信已寄出'; $lang['notify_fail'] = '通知信無法寄出'; -- cgit v1.2.3 From d0ad4a7dbf04cff927ca85efa1a53176a0401620 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Sun, 13 Jan 2013 10:53:58 +0100 Subject: grayscaled some interwiki icons --- lib/images/interwiki/dokubug.gif | Bin 166 -> 194 bytes lib/images/interwiki/paypal.gif | Bin 138 -> 139 bytes lib/images/interwiki/skype.gif | Bin 157 -> 142 bytes 3 files changed, 0 insertions(+), 0 deletions(-) (limited to 'lib') diff --git a/lib/images/interwiki/dokubug.gif b/lib/images/interwiki/dokubug.gif index 3432b8d57..08c1ca1f1 100644 Binary files a/lib/images/interwiki/dokubug.gif and b/lib/images/interwiki/dokubug.gif differ diff --git a/lib/images/interwiki/paypal.gif b/lib/images/interwiki/paypal.gif index a2dc89431..633797fac 100644 Binary files a/lib/images/interwiki/paypal.gif and b/lib/images/interwiki/paypal.gif differ diff --git a/lib/images/interwiki/skype.gif b/lib/images/interwiki/skype.gif index 2c900a8b2..d9bd575a6 100644 Binary files a/lib/images/interwiki/skype.gif and b/lib/images/interwiki/skype.gif differ -- cgit v1.2.3 From 741c52751f7b22a3167d9475b2adb1a79f5eeea6 Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Wed, 16 Jan 2013 13:41:42 +0100 Subject: parse arrays from config file --- lib/plugins/config/_test/configuration.test.php | 2 +- lib/plugins/config/settings/config.class.php | 23 ++++++++++++++++++++--- 2 files changed, 21 insertions(+), 4 deletions(-) (limited to 'lib') diff --git a/lib/plugins/config/_test/configuration.test.php b/lib/plugins/config/_test/configuration.test.php index ee03f3849..b808ad505 100644 --- a/lib/plugins/config/_test/configuration.test.php +++ b/lib/plugins/config/_test/configuration.test.php @@ -30,4 +30,4 @@ class plugin_config_configuration_test extends DokuWikiTest { $this->assertEquals(array('foo', 'bar', 'baz'), $conf['arr1']); } -} \ No newline at end of file +} diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php index 5a2aa2980..7f15df6fb 100644 --- a/lib/plugins/config/settings/config.class.php +++ b/lib/plugins/config/settings/config.class.php @@ -157,14 +157,31 @@ if (!class_exists('configuration')) { preg_match_all($pattern,$contents,$matches,PREG_SET_ORDER); for ($i=0; $i'\\','\\\''=>'\'','\\"'=>'"')); + + // handle arrays + if(preg_match('/array ?\((.*)\)/', $value, $match)){ + $arr = explode(',', $match[1]); + + // remove quotes from quoted strings & unescape escaped data + $len = count($arr); + for($j=0; $j<$len; $j++){ + $arr[$j] = preg_replace('/^(\'|")(.*)(?'\\','\\\''=>'\'','\\"'=>'"')); + } + + $value = $arr; + }else{ + // remove quotes from quoted strings & unescape escaped data + $value = preg_replace('/^(\'|")(.*)(?'\\','\\\''=>'\'','\\"'=>'"')); + } $config[$key] = $value; } -- cgit v1.2.3 From d12150d88f5fe8d5718313ab6c14ab8c907c61ff Mon Sep 17 00:00:00 2001 From: Andreas Gohr Date: Wed, 16 Jan 2013 13:59:41 +0100 Subject: fixed problems with spaced arrays --- lib/plugins/config/_test/data/config.php | 2 +- lib/plugins/config/settings/config.class.php | 3 ++- 2 files changed, 3 insertions(+), 2 deletions(-) (limited to 'lib') diff --git a/lib/plugins/config/_test/data/config.php b/lib/plugins/config/_test/data/config.php index 15d6359ad..83255f937 100644 --- a/lib/plugins/config/_test/data/config.php +++ b/lib/plugins/config/_test/data/config.php @@ -10,7 +10,7 @@ $conf['str3'] = "Hello World"; $conf['str4'] = "Hello 'World'"; $conf['str5'] = "Hello \"World\""; -$conf['arr1'] = array('foo','bar','baz'); +$conf['arr1'] = array('foo','bar', 'baz'); $conf['foo']['bar'] = 'x1'; $conf['foo']['baz'] = 'x2'; diff --git a/lib/plugins/config/settings/config.class.php b/lib/plugins/config/settings/config.class.php index 7f15df6fb..7ff310b20 100644 --- a/lib/plugins/config/settings/config.class.php +++ b/lib/plugins/config/settings/config.class.php @@ -166,12 +166,13 @@ if (!class_exists('configuration')) { // handle arrays - if(preg_match('/array ?\((.*)\)/', $value, $match)){ + if(preg_match('/^array ?\((.*)\)/', $value, $match)){ $arr = explode(',', $match[1]); // remove quotes from quoted strings & unescape escaped data $len = count($arr); for($j=0; $j<$len; $j++){ + $arr[$j] = trim($arr[$j]); $arr[$j] = preg_replace('/^(\'|")(.*)(?'\\','\\\''=>'\'','\\"'=>'"')); } -- cgit v1.2.3 From 187b13eb2e4f044659ad056a038b7aed65033579 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Daniel=20L=C3=B3pez=20Prat?= Date: Fri, 18 Jan 2013 10:07:50 +0100 Subject: Catalan language update --- lib/plugins/acl/lang/ca/lang.php | 1 + lib/plugins/config/lang/ca/lang.php | 96 +++++++++++++++++--------------- lib/plugins/plugin/lang/ca/lang.php | 2 + lib/plugins/popularity/lang/ca/lang.php | 1 + lib/plugins/revert/lang/ca/lang.php | 1 + lib/plugins/usermanager/lang/ca/lang.php | 1 + 6 files changed, 57 insertions(+), 45 deletions(-) (limited to 'lib') diff --git a/lib/plugins/acl/lang/ca/lang.php b/lib/plugins/acl/lang/ca/lang.php index 10f656062..183db711b 100644 --- a/lib/plugins/acl/lang/ca/lang.php +++ b/lib/plugins/acl/lang/ca/lang.php @@ -7,6 +7,7 @@ * @author Carles Bellver * @author carles.bellver@gmail.com * @author carles.bellver@cent.uji.es + * @author daniel@6temes.cat */ $lang['admin_acl'] = 'Gestió de la Llista de Control d\'Accés'; $lang['acl_group'] = 'Grup'; diff --git a/lib/plugins/config/lang/ca/lang.php b/lib/plugins/config/lang/ca/lang.php index 84680450a..205d7aa6b 100644 --- a/lib/plugins/config/lang/ca/lang.php +++ b/lib/plugins/config/lang/ca/lang.php @@ -6,6 +6,7 @@ * @author carles.bellver@gmail.com * @author carles.bellver@cent.uji.es * @author Carles Bellver + * @author daniel@6temes.cat */ $lang['menu'] = 'Paràmetres de configuració'; $lang['error'] = 'Els paràmetres no s\'han pogut actualitzar per causa d\'un valor incorrecte Reviseu els canvis i torneu a enviar-los.
    Els valors incorrectes es ressaltaran amb un marc vermell.'; @@ -28,6 +29,8 @@ $lang['_anti_spam'] = 'Paràmetres anti-brossa'; $lang['_editing'] = 'Paràmetres d\'edició'; $lang['_links'] = 'Paràmetres d\'enllaços'; $lang['_media'] = 'Paràmetres de mitjans'; +$lang['_notifications'] = 'Paràmetres de notificació'; +$lang['_syndication'] = 'Paràmetres de sindicació'; $lang['_advanced'] = 'Paràmetres avançats'; $lang['_network'] = 'Paràmetres de xarxa'; $lang['_plugin_sufix'] = 'Paràmetres de connectors'; @@ -35,25 +38,29 @@ $lang['_template_sufix'] = 'Paràmetres de plantilla'; $lang['_msg_setting_undefined'] = 'Falten metadades de paràmetre.'; $lang['_msg_setting_no_class'] = 'Falta classe de paràmetre.'; $lang['_msg_setting_no_default'] = 'No hi ha valor per defecte.'; -$lang['fmode'] = 'Mode de creació de fitxers'; -$lang['dmode'] = 'Mode de creació de directoris'; -$lang['lang'] = 'Idioma'; -$lang['basedir'] = 'Directori base'; -$lang['baseurl'] = 'URL base'; -$lang['savedir'] = 'Directori per desar les dades'; -$lang['start'] = 'Nom de la pàgina d\'inici'; $lang['title'] = 'Títol del wiki'; +$lang['start'] = 'Nom de la pàgina d\'inici'; +$lang['lang'] = 'Idioma'; $lang['template'] = 'Plantilla'; +$lang['tagline'] = 'Lema (si la plantilla ho suporta)'; +$lang['sidebar'] = 'Nom de la barra lateral (si la plantilla ho suporta). Si ho deixeu buit, la barra lateral es deshabilitarà.'; $lang['license'] = 'Amb quina llicència voleu publicar el contingut?'; -$lang['fullpath'] = 'Mostra el camí complet de les pàgines al peu'; +$lang['savedir'] = 'Directori per desar les dades'; +$lang['basedir'] = 'Directori base'; +$lang['baseurl'] = 'URL base'; +$lang['cookiedir'] = 'Adreça per a les galetes. Si ho deixeu en blanc, es farà servir la URL base.'; +$lang['dmode'] = 'Mode de creació de directoris'; +$lang['fmode'] = 'Mode de creació de fitxers'; +$lang['allowdebug'] = 'Permet depuració inhabiliteu si no és necessari'; $lang['recent'] = 'Canvis recents'; +$lang['recent_days'] = 'Quantitat de canvis recents que es mantenen (dies)'; $lang['breadcrumbs'] = 'Nombre d\'engrunes'; $lang['youarehere'] = 'Camí d\'engrunes jeràrquic'; +$lang['fullpath'] = 'Mostra el camí complet de les pàgines al peu'; $lang['typography'] = 'Substitucions tipogràfiques'; -$lang['htmlok'] = 'Permet HTML incrustat'; -$lang['phpok'] = 'Permet PHP incrustat'; $lang['dformat'] = 'Format de data (vg. la funció PHP strftime)'; $lang['signature'] = 'Signatura'; +$lang['showuseras'] = 'Què cal visualitzar quan es mostra el darrer usuari que ha editat la pàgina'; $lang['toptoclevel'] = 'Nivell superior per a la taula de continguts'; $lang['tocminheads'] = 'Quantitat mínima d\'encapçalaments que determina si es construeix o no la taula de continguts.'; $lang['maxtoclevel'] = 'Nivell màxim per a la taula de continguts'; @@ -61,15 +68,8 @@ $lang['maxseclevel'] = 'Nivell màxim d\'edició de seccions'; $lang['camelcase'] = 'Utilitza CamelCase per als enllaços'; $lang['deaccent'] = 'Noms de pàgina nets'; $lang['useheading'] = 'Utilitza el primer encapçalament per als noms de pàgina'; -$lang['refcheck'] = 'Comprova la referència en els fitxers de mitjans'; -$lang['refshow'] = 'Nombre de referències de mitjans per mostrar'; -$lang['allowdebug'] = 'Permet depuració inhabiliteu si no és necessari'; -$lang['usewordblock'] = 'Bloca brossa per llista de paraules'; -$lang['indexdelay'] = 'Retard abans d\'indexar (segons)'; -$lang['relnofollow'] = 'Utilitza rel="nofollow" en enllaços externs'; -$lang['mailguard'] = 'Ofusca les adreces de correu'; -$lang['iexssprotect'] = 'Comprova codi HTML o Javascript maligne en els fitxers penjats'; -$lang['showuseras'] = 'Què cal visualitzar quan es mostra el darrer usuari que ha editat la pàgina'; +$lang['sneaky_index'] = 'Per defecte, DokuWiki mostrarà tots els espai en la visualització d\'índex. Si activeu aquest paràmetre, s\'ocultaran aquells espais en els quals l\'usuari no té accés de lectura. Això pot fer que s\'ocultin subespais que sí que són accessibles. En algunes configuracions ACL pot fer que l\'índex resulti inutilitzable.'; +$lang['hidepages'] = 'Oculta pàgines coincidents (expressions regulars)'; $lang['useacl'] = 'Utilitza llistes de control d\'accés'; $lang['autopasswd'] = 'Generació automàtica de contrasenyes'; $lang['authtype'] = 'Rerefons d\'autenticació'; @@ -78,54 +78,60 @@ $lang['defaultgroup'] = 'Grup per defecte'; $lang['superuser'] = 'Superusuari: un grup o usuari amb accés complet a totes les pàgines i funcions independentment dels paràmetres ACL'; $lang['manager'] = 'Administrador: un grup o usuari amb accés a certes funcions d\'administració'; $lang['profileconfirm'] = 'Confirma amb contrasenya els canvis en el perfil'; +$lang['rememberme'] = 'Permet galetes de sessió permanents ("recorda\'m")'; $lang['disableactions'] = 'Inhabilita accions DokuWiki'; $lang['disableactions_check'] = 'Revisa'; $lang['disableactions_subscription'] = 'Subscripció/cancel·lació'; $lang['disableactions_wikicode'] = 'Mostra/exporta font'; $lang['disableactions_other'] = 'Altres accions (separades per comes)'; -$lang['sneaky_index'] = 'Per defecte, DokuWiki mostrarà tots els espai en la visualització d\'índex. Si activeu aquest paràmetre, s\'ocultaran aquells espais en els quals l\'usuari no té accés de lectura. Això pot fer que s\'ocultin subespais que sí que són accessibles. En algunes configuracions ACL pot fer que l\'índex resulti inutilitzable.'; $lang['auth_security_timeout'] = 'Temps d\'espera de seguretat en l\'autenticació (segons)'; $lang['securecookie'] = 'Les galetes que s\'han creat via HTTPS, només s\'han d\'enviar des del navegador per HTTPS? Inhabiliteu aquesta opció si només l\'inici de sessió del wiki es fa amb SSL i la navegació del wiki es fa sense seguretat.'; +$lang['usewordblock'] = 'Bloca brossa per llista de paraules'; +$lang['relnofollow'] = 'Utilitza rel="nofollow" en enllaços externs'; +$lang['indexdelay'] = 'Retard abans d\'indexar (segons)'; +$lang['mailguard'] = 'Ofusca les adreces de correu'; +$lang['iexssprotect'] = 'Comprova codi HTML o Javascript maligne en els fitxers penjats'; +$lang['usedraft'] = 'Desa automàticament un esborrany mentre s\'edita'; +$lang['htmlok'] = 'Permet HTML incrustat'; +$lang['phpok'] = 'Permet PHP incrustat'; +$lang['locktime'] = 'Durada màxima dels fitxers de bloqueig (segons)'; +$lang['cachetime'] = 'Durada màxima de la memòria cau (segons)'; +$lang['target____wiki'] = 'Finestra de destinació en enllaços interns'; +$lang['target____interwiki'] = 'Finestra de destinació en enllaços interwiki'; +$lang['target____extern'] = 'Finestra de destinació en enllaços externs'; +$lang['target____media'] = 'Finestra de destinació en enllaços de mitjans'; +$lang['target____windows'] = 'Finestra de destinació en enllaços de Windows'; +$lang['refcheck'] = 'Comprova la referència en els fitxers de mitjans'; +$lang['refshow'] = 'Nombre de referències de mitjans per mostrar'; +$lang['gdlib'] = 'Versió GD Lib'; +$lang['im_convert'] = 'Camí de la utilitat convert d\'ImageMagick'; +$lang['jpg_quality'] = 'Qualitat de compressió JPEG (0-100)'; +$lang['fetchsize'] = 'Mida màxima (bytes) que fetch.php pot baixar d\'un lloc extern'; +$lang['subscribers'] = 'Habilita la subscripció a pàgines'; +$lang['notify'] = 'Envia notificacions de canvis a aquesta adreça de correu'; +$lang['registernotify'] = 'Envia informació sobre nous usuaris registrats a aquesta adreça de correu'; +$lang['mailfrom'] = 'Adreça de correu remitent per a missatges automàtics'; +$lang['sitemap'] = 'Genera mapa del lloc en format Google (dies)'; +$lang['rss_type'] = 'Tipus de canal XML'; +$lang['rss_linkto'] = 'Destinació dels enllaços en el canal XML'; +$lang['rss_content'] = 'Què es mostrarà en els elements del canal XML?'; +$lang['rss_update'] = 'Interval d\'actualització del canal XML (segons)'; +$lang['rss_show_summary'] = 'Mostra resum en els títols del canal XML'; $lang['updatecheck'] = 'Comprova actualitzacions i avisos de seguretat. DokuWiki necessitarà contactar amb update.dokuwiki.org per utilitzar aquesta característica.'; $lang['userewrite'] = 'Utilitza URL nets'; $lang['useslash'] = 'Utilitza la barra / com a separador d\'espais en els URL'; -$lang['usedraft'] = 'Desa automàticament un esborrany mentre s\'edita'; $lang['sepchar'] = 'Separador de paraules en els noms de pàgina'; $lang['canonical'] = 'Utilitza URL canònics complets'; $lang['autoplural'] = 'Comprova formes plurals en els enllaços'; $lang['compression'] = 'Mètode de compressió per als fitxers de les golfes'; -$lang['cachetime'] = 'Durada màxima de la memòria cau (segons)'; -$lang['locktime'] = 'Durada màxima dels fitxers de bloqueig (segons)'; -$lang['fetchsize'] = 'Mida màxima (bytes) que fetch.php pot baixar d\'un lloc extern'; -$lang['notify'] = 'Envia notificacions de canvis a aquesta adreça de correu'; -$lang['registernotify'] = 'Envia informació sobre nous usuaris registrats a aquesta adreça de correu'; -$lang['mailfrom'] = 'Adreça de correu remitent per a missatges automàtics'; $lang['gzip_output'] = 'Codifica contingut xhtml com a gzip'; -$lang['gdlib'] = 'Versió GD Lib'; -$lang['im_convert'] = 'Camí de la utilitat convert d\'ImageMagick'; -$lang['jpg_quality'] = 'Qualitat de compressió JPEG (0-100)'; -$lang['subscribers'] = 'Habilita la subscripció a pàgines'; $lang['compress'] = 'Sortida CSS i Javascript compacta'; -$lang['hidepages'] = 'Oculta pàgines coincidents (expressions regulars)'; $lang['send404'] = 'Envia "HTTP 404/Page Not Found" per a les pàgines inexistents'; -$lang['sitemap'] = 'Genera mapa del lloc en format Google (dies)'; $lang['broken_iua'] = 'No funciona en el vostre sistema la funció ignore_user_abort? Això podria malmetre l\'índex de cerques. Amb IIS+PHP/CGI se sap que no funciona. Vg. Bug 852 per a més informació.'; $lang['xsendfile'] = 'Utilitza la capçalera X-Sendfile perquè el servidor web distribueixi fitxers estàtics. No funciona amb tots els servidors web.'; $lang['renderer_xhtml'] = 'Renderitzador que cal utilitzar per a la sortida principal (xhtml) del wiki'; $lang['renderer__core'] = '%s (ànima del dokuwiki)'; $lang['renderer__plugin'] = '%s (connector)'; -$lang['rememberme'] = 'Permet galetes de sessió permanents ("recorda\'m")'; -$lang['rss_type'] = 'Tipus de canal XML'; -$lang['rss_linkto'] = 'Destinació dels enllaços en el canal XML'; -$lang['rss_content'] = 'Què es mostrarà en els elements del canal XML?'; -$lang['rss_update'] = 'Interval d\'actualització del canal XML (segons)'; -$lang['recent_days'] = 'Quantitat de canvis recents que es mantenen (dies)'; -$lang['rss_show_summary'] = 'Mostra resum en els títols del canal XML'; -$lang['target____wiki'] = 'Finestra de destinació en enllaços interns'; -$lang['target____interwiki'] = 'Finestra de destinació en enllaços interwiki'; -$lang['target____extern'] = 'Finestra de destinació en enllaços externs'; -$lang['target____media'] = 'Finestra de destinació en enllaços de mitjans'; -$lang['target____windows'] = 'Finestra de destinació en enllaços de Windows'; $lang['proxy____host'] = 'Nom del servidor intermediari'; $lang['proxy____port'] = 'Port del servidor intermediari'; $lang['proxy____user'] = 'Nom d\'usuari del servidor intermediari'; diff --git a/lib/plugins/plugin/lang/ca/lang.php b/lib/plugins/plugin/lang/ca/lang.php index 0e3ef05df..5c7933666 100644 --- a/lib/plugins/plugin/lang/ca/lang.php +++ b/lib/plugins/plugin/lang/ca/lang.php @@ -6,6 +6,7 @@ * @author carles.bellver@gmail.com * @author carles.bellver@cent.uji.es * @author Carles Bellver + * @author daniel@6temes.cat */ $lang['menu'] = 'Gestió de connectors'; $lang['download'] = 'Baixa i instal·la un nou connector'; @@ -51,3 +52,4 @@ $lang['enabled'] = 'S\'ha habilitat el connector %s.'; $lang['notenabled'] = 'No s\'ha pogut habilitar el connector %s. Comproveu els permisos dels fitxers.'; $lang['disabled'] = 'S\'ha inhabilitat el connector %s.'; $lang['notdisabled'] = 'No s\'ha pogut inhabilitar el connector %s. Comproveu els permisos dels fitxers.'; +$lang['packageinstalled'] = 'El paquet del connector (%d plugins(s): %s) s\'ha instal·lat correctament.'; diff --git a/lib/plugins/popularity/lang/ca/lang.php b/lib/plugins/popularity/lang/ca/lang.php index e6fdcd533..b30846118 100644 --- a/lib/plugins/popularity/lang/ca/lang.php +++ b/lib/plugins/popularity/lang/ca/lang.php @@ -5,6 +5,7 @@ * @author Carles Bellver * @author Carles Bellver * @author carles.bellver@cent.uji.es + * @author daniel@6temes.cat */ $lang['name'] = 'Retroacció sobre popularitat (pot trigar una mica a carregar)'; $lang['submit'] = 'Envia dades'; diff --git a/lib/plugins/revert/lang/ca/lang.php b/lib/plugins/revert/lang/ca/lang.php index b8800911f..4f4d518ea 100644 --- a/lib/plugins/revert/lang/ca/lang.php +++ b/lib/plugins/revert/lang/ca/lang.php @@ -6,6 +6,7 @@ * @author carles.bellver@gmail.com * @author carles.bellver@cent.uji.es * @author Carles Bellver + * @author daniel@6temes.cat */ $lang['menu'] = 'Gestió de reversions'; $lang['filter'] = 'Cerca pàgines brossa'; diff --git a/lib/plugins/usermanager/lang/ca/lang.php b/lib/plugins/usermanager/lang/ca/lang.php index 445556973..6debd73ca 100644 --- a/lib/plugins/usermanager/lang/ca/lang.php +++ b/lib/plugins/usermanager/lang/ca/lang.php @@ -6,6 +6,7 @@ * @author carles.bellver@gmail.com * @author carles.bellver@cent.uji.es * @author Carles Bellver + * @author daniel@6temes.cat */ $lang['menu'] = 'Gestió d\'usuaris'; $lang['noauth'] = '(l\'autenticació d\'usuaris no està disponible)'; -- cgit v1.2.3 From e6c4a8221e93692572a1e78b9319a94b5ba07a0c Mon Sep 17 00:00:00 2001 From: Erdem Date: Fri, 18 Jan 2013 10:08:48 +0100 Subject: Turkish language update --- lib/plugins/acl/lang/tr/lang.php | 1 + lib/plugins/config/lang/tr/lang.php | 47 ++++++++++++++++---------------- lib/plugins/plugin/lang/tr/lang.php | 1 + lib/plugins/popularity/lang/tr/lang.php | 2 ++ lib/plugins/revert/lang/tr/lang.php | 1 + lib/plugins/usermanager/lang/tr/lang.php | 1 + 6 files changed, 30 insertions(+), 23 deletions(-) (limited to 'lib') diff --git a/lib/plugins/acl/lang/tr/lang.php b/lib/plugins/acl/lang/tr/lang.php index de96d2906..629ca546b 100644 --- a/lib/plugins/acl/lang/tr/lang.php +++ b/lib/plugins/acl/lang/tr/lang.php @@ -8,6 +8,7 @@ * @author Cihan Kahveci * @author Yavuz Selim * @author Caleb Maclennan + * @author farukerdemoncel@gmail.com */ $lang['admin_acl'] = 'Erişim Kontrol Listesi (ACL) Yönetimi'; $lang['acl_group'] = 'Grup'; diff --git a/lib/plugins/config/lang/tr/lang.php b/lib/plugins/config/lang/tr/lang.php index 6d7d7cc2e..5bc4f3fc1 100644 --- a/lib/plugins/config/lang/tr/lang.php +++ b/lib/plugins/config/lang/tr/lang.php @@ -6,6 +6,7 @@ * @author Cihan Kahveci * @author Yavuz Selim * @author Caleb Maclennan + * @author farukerdemoncel@gmail.com */ $lang['menu'] = 'Site Ayarları'; $lang['error'] = 'Ayarlar yanlış bir değer girildiği için güncellenemedi. Lütfen değişikliklerinizi gözden geçirin ve tekrar gönderin. @@ -36,25 +37,25 @@ $lang['_template_sufix'] = 'Şablon (Template) Ayarları'; $lang['_msg_setting_undefined'] = 'Ayar üstverisi yok.'; $lang['_msg_setting_no_class'] = 'Ayar sınıfı yok.'; $lang['_msg_setting_no_default'] = 'Varsayılan değer yok.'; -$lang['fmode'] = 'Dosya oluşturma yetkisi'; -$lang['dmode'] = 'Klasör oluşturma yetkisi'; -$lang['lang'] = 'Dil'; -$lang['basedir'] = 'Kök dizin'; -$lang['baseurl'] = 'Kök URL'; -$lang['savedir'] = 'Verileri kaydetmek için kullanılacak klasör'; -$lang['start'] = 'Ana sayfa adı'; $lang['title'] = 'Wiki başlığı'; +$lang['start'] = 'Ana sayfa adı'; +$lang['lang'] = 'Dil'; $lang['template'] = 'Şablon (Template)'; $lang['license'] = 'İçeriğinizi hangi lisans altında yayınlansın?'; -$lang['fullpath'] = 'sayfaların tüm patikasını (full path) göster'; +$lang['savedir'] = 'Verileri kaydetmek için kullanılacak klasör'; +$lang['basedir'] = 'Kök dizin'; +$lang['baseurl'] = 'Kök URL'; +$lang['dmode'] = 'Klasör oluşturma yetkisi'; +$lang['fmode'] = 'Dosya oluşturma yetkisi'; +$lang['allowdebug'] = 'Yanlış ayıklamasına izin ver lazım değilse etkisiz kıl!'; $lang['recent'] = 'En son değiştirilenler'; $lang['breadcrumbs'] = 'Ekmek kırıntıların sayısı'; $lang['youarehere'] = 'hiyerarşik ekmek kırıntıları'; +$lang['fullpath'] = 'sayfaların tüm patikasını (full path) göster'; $lang['typography'] = 'Tipografik değiştirmeleri yap'; -$lang['htmlok'] = 'Gömülü HTML koduna izin ver'; -$lang['phpok'] = 'Gömülü PHP koduna izin ver'; $lang['dformat'] = 'Tarih biçimi (PHP\'nin strftime fonksiyonuna bakın)'; $lang['signature'] = 'İmza'; +$lang['showuseras'] = 'Bir sayfayı en son düzenleyen kullanıcıya ne gösterilsin'; $lang['toptoclevel'] = 'İçindekiler için en üst seviye'; $lang['tocminheads'] = 'İçindekilerin oluşturulması için gereken (en az) başlık sayısı'; $lang['maxtoclevel'] = 'İçindekiler için en fazla seviye'; @@ -62,15 +63,6 @@ $lang['maxseclevel'] = 'Bölümün azami düzenleme düzeyi'; $lang['camelcase'] = 'Linkler için CamelCase kullan'; $lang['deaccent'] = 'Sayfa adlarınız temizle'; $lang['useheading'] = 'Sayfa isimleri için ilk başlığı kullan'; -$lang['refcheck'] = 'Araç kaynak denetimi'; -$lang['refshow'] = 'Gösterilecek araç kaynağı sayısı'; -$lang['allowdebug'] = 'Yanlış ayıklamasına izin ver lazım değilse etkisiz kıl!'; -$lang['usewordblock'] = 'Wordlistesine göre spam engelle'; -$lang['indexdelay'] = 'Indekslemeden evvel zaman gecikmesi (saniye)'; -$lang['relnofollow'] = 'Dışsal linkler rel="nofollow" kullan'; -$lang['mailguard'] = 'Email adreslerini karart'; -$lang['iexssprotect'] = 'Yüklenmiş dosyaları muhtemel kötu niyetli JavaScript veya HTML koduna kontrol et'; -$lang['showuseras'] = 'Bir sayfayı en son düzenleyen kullanıcıya ne gösterilsin'; $lang['useacl'] = 'Erişim kontrol listesini kullan'; $lang['autopasswd'] = 'Parolaları otamatikmen üret'; $lang['authtype'] = 'Kimlik denetleme arka uç'; @@ -79,16 +71,25 @@ $lang['defaultgroup'] = 'Varsayılan grup'; $lang['disableactions'] = 'DokuWiki eylemlerini etkisiz kıl'; $lang['disableactions_check'] = 'Kontrol et'; $lang['disableactions_subscription'] = 'Abone ol/Abonelikten vazgeç'; -$lang['canonical'] = 'Tamolarak kurallara uygun URL\'leri kullan'; -$lang['mailfrom'] = 'Otomatik e-postalar için kullanılacak e-posta adresi'; +$lang['usewordblock'] = 'Wordlistesine göre spam engelle'; +$lang['relnofollow'] = 'Dışsal linkler rel="nofollow" kullan'; +$lang['indexdelay'] = 'Indekslemeden evvel zaman gecikmesi (saniye)'; +$lang['mailguard'] = 'Email adreslerini karart'; +$lang['iexssprotect'] = 'Yüklenmiş dosyaları muhtemel kötu niyetli JavaScript veya HTML koduna kontrol et'; +$lang['htmlok'] = 'Gömülü HTML koduna izin ver'; +$lang['phpok'] = 'Gömülü PHP koduna izin ver'; +$lang['refcheck'] = 'Araç kaynak denetimi'; +$lang['refshow'] = 'Gösterilecek araç kaynağı sayısı'; $lang['gdlib'] = 'GD Lib sürümü'; $lang['jpg_quality'] = 'JPG sıkıştırma kalitesi [0-100]'; +$lang['mailfrom'] = 'Otomatik e-postalar için kullanılacak e-posta adresi'; $lang['sitemap'] = 'Google site haritası oluştur (gün)'; -$lang['renderer__core'] = '%s (dokuwiki çekirdeği)'; -$lang['renderer__plugin'] = '%s (eklenti)'; $lang['rss_content'] = 'XML beslemesinde ne gösterilsin?'; $lang['rss_update'] = 'XML beslemesini güncelleme aralığı'; $lang['rss_show_summary'] = 'XML beslemesinde özeti başlıkta göster'; +$lang['canonical'] = 'Tamolarak kurallara uygun URL\'leri kullan'; +$lang['renderer__core'] = '%s (dokuwiki çekirdeği)'; +$lang['renderer__plugin'] = '%s (eklenti)'; $lang['proxy____host'] = 'Proxy sunucu adı'; $lang['proxy____user'] = 'Proxy kullanıcı adı'; $lang['proxy____pass'] = 'Proxy şifresi'; diff --git a/lib/plugins/plugin/lang/tr/lang.php b/lib/plugins/plugin/lang/tr/lang.php index 9a655e400..9598ade7d 100644 --- a/lib/plugins/plugin/lang/tr/lang.php +++ b/lib/plugins/plugin/lang/tr/lang.php @@ -6,6 +6,7 @@ * @author Cihan Kahveci * @author Yavuz Selim * @author Caleb Maclennan + * @author farukerdemoncel@gmail.com */ $lang['menu'] = 'Eklenti Yönetimi'; $lang['download'] = 'Yeni bir eklenti indirip kur'; diff --git a/lib/plugins/popularity/lang/tr/lang.php b/lib/plugins/popularity/lang/tr/lang.php index fe87d1548..5339176bc 100644 --- a/lib/plugins/popularity/lang/tr/lang.php +++ b/lib/plugins/popularity/lang/tr/lang.php @@ -6,6 +6,8 @@ * @author Cihan Kahveci * @author Yavuz Selim * @author Caleb Maclennan + * @author farukerdemoncel@gmail.com */ $lang['name'] = 'Popülerlik Geribeslemesi (yüklemesi uzun sürebilir)'; $lang['submit'] = 'Verileri Gönder'; +$lang['lastSent'] = 'Bilgiler gönderildi'; diff --git a/lib/plugins/revert/lang/tr/lang.php b/lib/plugins/revert/lang/tr/lang.php index aa1458a95..9030c31e3 100644 --- a/lib/plugins/revert/lang/tr/lang.php +++ b/lib/plugins/revert/lang/tr/lang.php @@ -6,6 +6,7 @@ * @author Cihan Kahveci * @author Yavuz Selim * @author Caleb Maclennan + * @author farukerdemoncel@gmail.com */ $lang['menu'] = 'Eskiye Döndürme'; $lang['filter'] = 'Spam bulunan sayfaları ara'; diff --git a/lib/plugins/usermanager/lang/tr/lang.php b/lib/plugins/usermanager/lang/tr/lang.php index b9c9cfc52..7ddb7dd5d 100644 --- a/lib/plugins/usermanager/lang/tr/lang.php +++ b/lib/plugins/usermanager/lang/tr/lang.php @@ -6,6 +6,7 @@ * @author Cihan Kahveci * @author Yavuz Selim * @author Caleb Maclennan + * @author farukerdemoncel@gmail.com */ $lang['menu'] = 'Kullanıcı Yönetimi'; $lang['noauth'] = '(kullanıcı onaylaması yoktur)'; -- cgit v1.2.3 From 9fd5ca2ec2955ee29404be1a39ddd9affcd0c78f Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Stefan=20Gro=CC=88nke?= Date: Sat, 19 Jan 2013 16:30:42 +0100 Subject: jQuery latest * jQuery 1.9.0 * jQuery-UI v1.9.2 * jQuery.fn.live > jQuery.fn.on * jQuery.fn.browser replacement (jquery.mb.browser.js) --- lib/exe/js.php | 1 + lib/scripts/behaviour.js | 74 +- .../images/ui-bg_flat_0_aaaaaa_40x100.png | Bin .../images/ui-bg_flat_75_ffffff_40x100.png | Bin .../images/ui-bg_glass_55_fbf9ee_1x400.png | Bin .../images/ui-bg_glass_65_ffffff_1x400.png | Bin .../images/ui-bg_glass_75_dadada_1x400.png | Bin .../images/ui-bg_glass_75_e6e6e6_1x400.png | Bin .../images/ui-bg_glass_95_fef1ec_1x400.png | Bin .../ui-bg_highlight-soft_75_cccccc_1x100.png | Bin .../images/ui-icons_222222_256x240.png | Bin .../images/ui-icons_2e83ff_256x240.png | Bin .../images/ui-icons_454545_256x240.png | Bin .../images/ui-icons_888888_256x240.png | Bin .../images/ui-icons_cd0a0a_256x240.png | Bin .../jquery-ui-theme/jquery-ui-1.9.2.custom.css | 462 + .../jquery-ui-theme/jquery-ui-1.9.2.custom.min.css | 5 + lib/scripts/jquery/jquery-ui-theme/smoothness.css | 568 - lib/scripts/jquery/jquery-ui.js | 21842 +++++++++++-------- lib/scripts/jquery/jquery-ui.min.js | 420 +- lib/scripts/jquery/jquery.cookie.js | 107 +- lib/scripts/jquery/jquery.js | 9046 -------- lib/scripts/jquery/jquery.mb.browser.js | 104 + lib/scripts/jquery/jquery.mb.browser.min.js | 21 + lib/scripts/jquery/jquery.min.js | 8 +- lib/scripts/jquery/update.sh | 28 - 26 files changed, 13186 insertions(+), 19500 deletions(-) mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png mode change 100644 => 100755 lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png create mode 100755 lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.css create mode 100755 lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.min.css delete mode 100644 lib/scripts/jquery/jquery-ui-theme/smoothness.css mode change 100644 => 100755 lib/scripts/jquery/jquery-ui.js mode change 100644 => 100755 lib/scripts/jquery/jquery-ui.min.js delete mode 100644 lib/scripts/jquery/jquery.js create mode 100644 lib/scripts/jquery/jquery.mb.browser.js create mode 100644 lib/scripts/jquery/jquery.mb.browser.min.js delete mode 100755 lib/scripts/jquery/update.sh (limited to 'lib') diff --git a/lib/exe/js.php b/lib/exe/js.php index 42979eeed..7c1c27138 100644 --- a/lib/exe/js.php +++ b/lib/exe/js.php @@ -43,6 +43,7 @@ function js_out(){ DOKU_INC."lib/scripts/jquery/jquery$min.js", DOKU_INC.'lib/scripts/jquery/jquery.cookie.js', DOKU_INC."lib/scripts/jquery/jquery-ui$min.js", + DOKU_INC."lib/scripts/jquery/jquery.mb.browser.js", DOKU_INC."lib/scripts/fileuploader.js", DOKU_INC."lib/scripts/fileuploaderextended.js", DOKU_INC.'lib/scripts/helpers.js', diff --git a/lib/scripts/behaviour.js b/lib/scripts/behaviour.js index cffdde042..6878b0b96 100644 --- a/lib/scripts/behaviour.js +++ b/lib/scripts/behaviour.js @@ -1,3 +1,38 @@ +/** + * Hides elements with a slide animation + * + * @param fn optional callback to run after hiding + * @author Adrian Lang + */ +jQuery.fn.dw_hide = function(fn) { + return this.slideUp('fast', fn); +}; + +/** + * Unhides elements with a slide animation + * + * @param fn optional callback to run after hiding + * @author Adrian Lang + */ +jQuery.fn.dw_show = function(fn) { + return this.slideDown('fast', fn); +}; + +/** + * Toggles visibility of an element using a slide element + * + * @param bool the current state of the element (optional) + */ +jQuery.fn.dw_toggle = function(bool, fn) { + return this.each(function() { + var $this = jQuery(this); + if (typeof bool === 'undefined') { + bool = $this.is(':hidden'); + } + $this[bool ? "dw_show" : "dw_hide" ](fn); + }); +}; + /** * Automatic behaviours * @@ -16,7 +51,7 @@ var dw_behaviour = { dw_behaviour.subscription(); dw_behaviour.revisionBoxHandler(); - jQuery('#page__revisions input[type=checkbox]').live('click', + jQuery('#page__revisions input[type=checkbox]').on('click', dw_behaviour.revisionBoxHandler ); }, @@ -77,7 +112,7 @@ var dw_behaviour = { return; } - jQuery('a.windows').live('click', function(){ + jQuery('a.windows').on('click', function(){ alert(LANG.nosmblinks.replace(/\\n/,"\n")); }); }, @@ -142,39 +177,4 @@ var dw_behaviour = { }; -/** - * Hides elements with a slide animation - * - * @param fn optional callback to run after hiding - * @author Adrian Lang - */ -jQuery.fn.dw_hide = function(fn) { - return this.slideUp('fast', fn); -}; - -/** - * Unhides elements with a slide animation - * - * @param fn optional callback to run after hiding - * @author Adrian Lang - */ -jQuery.fn.dw_show = function(fn) { - return this.slideDown('fast', fn); -}; - -/** - * Toggles visibility of an element using a slide element - * - * @param bool the current state of the element (optional) - */ -jQuery.fn.dw_toggle = function(bool, fn) { - return this.each(function() { - var $this = jQuery(this); - if (typeof bool === 'undefined') { - bool = $this.is(':hidden'); - } - $this[bool ? "dw_show" : "dw_hide" ](fn); - }); -}; - jQuery(dw_behaviour.init); diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_0_aaaaaa_40x100.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_flat_75_ffffff_40x100.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_55_fbf9ee_1x400.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_65_ffffff_1x400.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_dadada_1x400.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_75_e6e6e6_1x400.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_glass_95_fef1ec_1x400.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_222222_256x240.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_2e83ff_256x240.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_454545_256x240.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_888888_256x240.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png b/lib/scripts/jquery/jquery-ui-theme/images/ui-icons_cd0a0a_256x240.png old mode 100644 new mode 100755 diff --git a/lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.css b/lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.css new file mode 100755 index 000000000..9fa4a2d2a --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.css @@ -0,0 +1,462 @@ +/*! jQuery UI - v1.9.2 - 2012-11-23 +* http://jqueryui.com +* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css +* To view and modify this theme, visit http://jqueryui.com/themeroller/ +* Copyright (c) 2012 jQuery Foundation and other contributors Licensed MIT */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { border: 0; clip: rect(0 0 0 0); height: 1px; margin: -1px; overflow: hidden; padding: 0; position: absolute; width: 1px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } +.ui-accordion .ui-accordion-header { display: block; cursor: pointer; position: relative; margin-top: 2px; padding: .5em .5em .5em .7em; zoom: 1; } +.ui-accordion .ui-accordion-icons { padding-left: 2.2em; } +.ui-accordion .ui-accordion-noicons { padding-left: .7em; } +.ui-accordion .ui-accordion-icons .ui-accordion-icons { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-accordion-header-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; overflow: auto; zoom: 1; } +.ui-autocomplete { + position: absolute; + top: 0; + left: 0; + cursor: default; +} + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button, .ui-button:link, .ui-button:visited, .ui-button:hover, .ui-button:active { text-decoration: none; } +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}.ui-dialog { position: absolute; top: 0; left: 0; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +.ui-menu { list-style:none; padding: 2px; margin: 0; display:block; outline: none; } +.ui-menu .ui-menu { margin-top: -3px; position: absolute; } +.ui-menu .ui-menu-item { margin: 0; padding: 0; zoom: 1; width: 100%; } +.ui-menu .ui-menu-divider { margin: 5px -2px 5px -2px; height: 0; font-size: 0; line-height: 0; border-width: 1px 0 0 0; } +.ui-menu .ui-menu-item a { text-decoration: none; display: block; padding: 2px .4em; line-height: 1.5; zoom: 1; font-weight: normal; } +.ui-menu .ui-menu-item a.ui-state-focus, +.ui-menu .ui-menu-item a.ui-state-active { font-weight: normal; margin: -1px; } + +.ui-menu .ui-state-disabled { font-weight: normal; margin: .4em 0 .2em; line-height: 1.5; } +.ui-menu .ui-state-disabled a { cursor: default; } + +/* icon support */ +.ui-menu-icons { position: relative; } +.ui-menu-icons .ui-menu-item a { position: relative; padding-left: 2em; } + +/* left-aligned */ +.ui-menu .ui-icon { position: absolute; top: .2em; left: .2em; } + +/* right-aligned */ +.ui-menu .ui-menu-icon { position: static; float: right; } +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }.ui-spinner { position:relative; display: inline-block; overflow: hidden; padding: 0; vertical-align: middle; } +.ui-spinner-input { border: none; background: none; padding: 0; margin: .2em 0; vertical-align: middle; margin-left: .4em; margin-right: 22px; } +.ui-spinner-button { width: 16px; height: 50%; font-size: .5em; padding: 0; margin: 0; text-align: center; position: absolute; cursor: default; display: block; overflow: hidden; right: 0; } +.ui-spinner a.ui-spinner-button { border-top: none; border-bottom: none; border-right: none; } /* more specificity required here to overide default borders */ +.ui-spinner .ui-icon { position: absolute; margin-top: -8px; top: 50%; left: 0; } /* vertical centre icon */ +.ui-spinner-up { top: 0; } +.ui-spinner-down { bottom: 0; } + +/* TR overrides */ +.ui-spinner .ui-icon-triangle-1-s { + /* need to fix icons sprite */ + background-position:-65px -16px; +} +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 0; margin: 1px .2em 0 0; border-bottom: 0; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-active { margin-bottom: -1px; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-active a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-tabs-loading a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tooltip { + padding: 8px; + position: absolute; + z-index: 9999; + max-width: 300px; + -webkit-box-shadow: 0 0 5px #aaa; + box-shadow: 0 0 5px #aaa; +} +/* Fades and background-images don't work well together in IE6, drop the image */ +* html .ui-tooltip { + background-image: none; +} +body .ui-tooltip { border-width: 2px; } + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-hover a, .ui-state-hover a:hover, .ui-state-hover a:link, .ui-state-hover a:visited { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } +.ui-state-disabled .ui-icon { filter:Alpha(Opacity=35); } /* For IE8 - See #6059 */ + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-on { background-position: -96px -144px; } +.ui-icon-radio-off { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .3;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .3;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; } \ No newline at end of file diff --git a/lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.min.css b/lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.min.css new file mode 100755 index 000000000..e96496989 --- /dev/null +++ b/lib/scripts/jquery/jquery-ui-theme/jquery-ui-1.9.2.custom.min.css @@ -0,0 +1,5 @@ +/*! jQuery UI - v1.9.2 - 2012-11-23 +* http://jqueryui.com +* Includes: jquery.ui.core.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css +* To view and modify this theme, visit http://jqueryui.com/themeroller/ +* Copyright (c) 2012 jQuery Foundation and other contributors Licensed MIT */.ui-helper-hidden{display:none}.ui-helper-hidden-accessible{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none}.ui-helper-clearfix:before,.ui-helper-clearfix:after{content:"";display:table}.ui-helper-clearfix:after{clear:both}.ui-helper-clearfix{zoom:1}.ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0)}.ui-state-disabled{cursor:default!important}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%}.ui-accordion .ui-accordion-header{display:block;cursor:pointer;position:relative;margin-top:2px;padding:.5em .5em .5em .7em;zoom:1}.ui-accordion .ui-accordion-icons{padding-left:2.2em}.ui-accordion .ui-accordion-noicons{padding-left:.7em}.ui-accordion .ui-accordion-icons .ui-accordion-icons{padding-left:2.2em}.ui-accordion .ui-accordion-header .ui-accordion-header-icon{position:absolute;left:.5em;top:50%;margin-top:-8px}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;overflow:auto;zoom:1}.ui-autocomplete{position:absolute;top:0;left:0;cursor:default}* html .ui-autocomplete{width:1px}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;cursor:pointer;text-align:center;zoom:1;overflow:visible}.ui-button,.ui-button:link,.ui-button:visited,.ui-button:hover,.ui-button:active{text-decoration:none}.ui-button-icon-only{width:2.2em}button.ui-button-icon-only{width:2.4em}.ui-button-icons-only{width:3.4em}button.ui-button-icons-only{width:3.7em}.ui-button .ui-button-text{display:block;line-height:1.4}.ui-button-text-only .ui-button-text{padding:.4em 1em}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em}input.ui-button{padding:.4em 1em}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em}.ui-buttonset{margin-right:7px}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em}button.ui-button::-moz-focus-inner{border:0;padding:0}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px}.ui-datepicker .ui-datepicker-prev{left:2px}.ui-datepicker .ui-datepicker-next{right:2px}.ui-datepicker .ui-datepicker-prev-hover{left:1px}.ui-datepicker .ui-datepicker-next-hover{right:1px}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0}.ui-datepicker select.ui-datepicker-month-year{width:100%}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0}.ui-datepicker td{border:0;padding:1px}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left}.ui-datepicker.ui-datepicker-multi{width:auto}.ui-datepicker-multi .ui-datepicker-group{float:left}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left}.ui-datepicker-row-break{clear:both;width:100%;font-size:0em}.ui-datepicker-rtl{direction:rtl}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right}.ui-datepicker-rtl .ui-datepicker-group{float:right}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px}.ui-datepicker-cover{position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px}.ui-dialog{position:absolute;top:0;left:0;padding:.2em;width:300px;overflow:hidden}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px}.ui-draggable .ui-dialog-titlebar{cursor:move}.ui-menu{list-style:none;padding:2px;margin:0;display:block;outline:none}.ui-menu .ui-menu{margin-top:-3px;position:absolute}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;width:100%}.ui-menu .ui-menu-divider{margin:5px -2px 5px -2px;height:0;font-size:0;line-height:0;border-width:1px 0 0 0}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:2px .4em;line-height:1.5;zoom:1;font-weight:normal}.ui-menu .ui-menu-item a.ui-state-focus,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px}.ui-menu .ui-state-disabled{font-weight:normal;margin:.4em 0 .2em;line-height:1.5}.ui-menu .ui-state-disabled a{cursor:default}.ui-menu-icons{position:relative}.ui-menu-icons .ui-menu-item a{position:relative;padding-left:2em}.ui-menu .ui-icon{position:absolute;top:.2em;left:.2em}.ui-menu .ui-menu-icon{position:static;float:right}.ui-progressbar{height:2em;text-align:left;overflow:hidden}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%}.ui-resizable{position:relative}.ui-resizable-handle{position:absolute;font-size:0.1px;display:block}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black}.ui-slider{position:relative;text-align:left}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0}.ui-slider-horizontal{height:.8em}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em}.ui-slider-horizontal .ui-slider-range{top:0;height:100%}.ui-slider-horizontal .ui-slider-range-min{left:0}.ui-slider-horizontal .ui-slider-range-max{right:0}.ui-slider-vertical{width:.8em;height:100px}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em}.ui-slider-vertical .ui-slider-range{left:0;width:100%}.ui-slider-vertical .ui-slider-range-min{bottom:0}.ui-slider-vertical .ui-slider-range-max{top:0}.ui-spinner{position:relative;display:inline-block;overflow:hidden;padding:0;vertical-align:middle}.ui-spinner-input{border:none;background:none;padding:0;margin:.2em 0;vertical-align:middle;margin-left:.4em;margin-right:22px}.ui-spinner-button{width:16px;height:50%;font-size:.5em;padding:0;margin:0;text-align:center;position:absolute;cursor:default;display:block;overflow:hidden;right:0}.ui-spinner a.ui-spinner-button{border-top:none;border-bottom:none;border-right:none}.ui-spinner .ui-icon{position:absolute;margin-top:-8px;top:50%;left:0}.ui-spinner-up{top:0}.ui-spinner-down{bottom:0}.ui-spinner .ui-icon-triangle-1-s{background-position:-65px -16px}.ui-tabs{position:relative;padding:.2em;zoom:1}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:1px .2em 0 0;border-bottom:0;padding:0;white-space:nowrap}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none}.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px;padding-bottom:1px}.ui-tabs .ui-tabs-nav li.ui-tabs-active a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-tabs-loading a{cursor:text}.ui-tabs .ui-tabs-nav li a,.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a{cursor:pointer}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none}.ui-tooltip{padding:8px;position:absolute;z-index:9999;max-width:300px;-webkit-box-shadow:0 0 5px #aaa;box-shadow:0 0 5px #aaa}* html .ui-tooltip{background-image:none}body .ui-tooltip{border-width:2px}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em}.ui-widget .ui-widget{font-size:1em}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222}.ui-widget-content a{color:#222}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold}.ui-widget-header a{color:#222}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-hover a,.ui-state-hover a:hover,.ui-state-hover a:link,.ui-state-hover a:visited{color:#212121;text-decoration:none}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none}.ui-state-disabled .ui-icon{filter:Alpha(Opacity=35)}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png)}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png)}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png)}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png)}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png)}.ui-icon-carat-1-n{background-position:0 0}.ui-icon-carat-1-ne{background-position:-16px 0}.ui-icon-carat-1-e{background-position:-32px 0}.ui-icon-carat-1-se{background-position:-48px 0}.ui-icon-carat-1-s{background-position:-64px 0}.ui-icon-carat-1-sw{background-position:-80px 0}.ui-icon-carat-1-w{background-position:-96px 0}.ui-icon-carat-1-nw{background-position:-112px 0}.ui-icon-carat-2-n-s{background-position:-128px 0}.ui-icon-carat-2-e-w{background-position:-144px 0}.ui-icon-triangle-1-n{background-position:0 -16px}.ui-icon-triangle-1-ne{background-position:-16px -16px}.ui-icon-triangle-1-e{background-position:-32px -16px}.ui-icon-triangle-1-se{background-position:-48px -16px}.ui-icon-triangle-1-s{background-position:-64px -16px}.ui-icon-triangle-1-sw{background-position:-80px -16px}.ui-icon-triangle-1-w{background-position:-96px -16px}.ui-icon-triangle-1-nw{background-position:-112px -16px}.ui-icon-triangle-2-n-s{background-position:-128px -16px}.ui-icon-triangle-2-e-w{background-position:-144px -16px}.ui-icon-arrow-1-n{background-position:0 -32px}.ui-icon-arrow-1-ne{background-position:-16px -32px}.ui-icon-arrow-1-e{background-position:-32px -32px}.ui-icon-arrow-1-se{background-position:-48px -32px}.ui-icon-arrow-1-s{background-position:-64px -32px}.ui-icon-arrow-1-sw{background-position:-80px -32px}.ui-icon-arrow-1-w{background-position:-96px -32px}.ui-icon-arrow-1-nw{background-position:-112px -32px}.ui-icon-arrow-2-n-s{background-position:-128px -32px}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px}.ui-icon-arrow-2-e-w{background-position:-160px -32px}.ui-icon-arrow-2-se-nw{background-position:-176px -32px}.ui-icon-arrowstop-1-n{background-position:-192px -32px}.ui-icon-arrowstop-1-e{background-position:-208px -32px}.ui-icon-arrowstop-1-s{background-position:-224px -32px}.ui-icon-arrowstop-1-w{background-position:-240px -32px}.ui-icon-arrowthick-1-n{background-position:0 -48px}.ui-icon-arrowthick-1-ne{background-position:-16px -48px}.ui-icon-arrowthick-1-e{background-position:-32px -48px}.ui-icon-arrowthick-1-se{background-position:-48px -48px}.ui-icon-arrowthick-1-s{background-position:-64px -48px}.ui-icon-arrowthick-1-sw{background-position:-80px -48px}.ui-icon-arrowthick-1-w{background-position:-96px -48px}.ui-icon-arrowthick-1-nw{background-position:-112px -48px}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px}.ui-icon-arrowreturn-1-w{background-position:-64px -64px}.ui-icon-arrowreturn-1-n{background-position:-80px -64px}.ui-icon-arrowreturn-1-e{background-position:-96px -64px}.ui-icon-arrowreturn-1-s{background-position:-112px -64px}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px}.ui-icon-arrow-4{background-position:0 -80px}.ui-icon-arrow-4-diag{background-position:-16px -80px}.ui-icon-extlink{background-position:-32px -80px}.ui-icon-newwin{background-position:-48px -80px}.ui-icon-refresh{background-position:-64px -80px}.ui-icon-shuffle{background-position:-80px -80px}.ui-icon-transfer-e-w{background-position:-96px -80px}.ui-icon-transferthick-e-w{background-position:-112px -80px}.ui-icon-folder-collapsed{background-position:0 -96px}.ui-icon-folder-open{background-position:-16px -96px}.ui-icon-document{background-position:-32px -96px}.ui-icon-document-b{background-position:-48px -96px}.ui-icon-note{background-position:-64px -96px}.ui-icon-mail-closed{background-position:-80px -96px}.ui-icon-mail-open{background-position:-96px -96px}.ui-icon-suitcase{background-position:-112px -96px}.ui-icon-comment{background-position:-128px -96px}.ui-icon-person{background-position:-144px -96px}.ui-icon-print{background-position:-160px -96px}.ui-icon-trash{background-position:-176px -96px}.ui-icon-locked{background-position:-192px -96px}.ui-icon-unlocked{background-position:-208px -96px}.ui-icon-bookmark{background-position:-224px -96px}.ui-icon-tag{background-position:-240px -96px}.ui-icon-home{background-position:0 -112px}.ui-icon-flag{background-position:-16px -112px}.ui-icon-calendar{background-position:-32px -112px}.ui-icon-cart{background-position:-48px -112px}.ui-icon-pencil{background-position:-64px -112px}.ui-icon-clock{background-position:-80px -112px}.ui-icon-disk{background-position:-96px -112px}.ui-icon-calculator{background-position:-112px -112px}.ui-icon-zoomin{background-position:-128px -112px}.ui-icon-zoomout{background-position:-144px -112px}.ui-icon-search{background-position:-160px -112px}.ui-icon-wrench{background-position:-176px -112px}.ui-icon-gear{background-position:-192px -112px}.ui-icon-heart{background-position:-208px -112px}.ui-icon-star{background-position:-224px -112px}.ui-icon-link{background-position:-240px -112px}.ui-icon-cancel{background-position:0 -128px}.ui-icon-plus{background-position:-16px -128px}.ui-icon-plusthick{background-position:-32px -128px}.ui-icon-minus{background-position:-48px -128px}.ui-icon-minusthick{background-position:-64px -128px}.ui-icon-close{background-position:-80px -128px}.ui-icon-closethick{background-position:-96px -128px}.ui-icon-key{background-position:-112px -128px}.ui-icon-lightbulb{background-position:-128px -128px}.ui-icon-scissors{background-position:-144px -128px}.ui-icon-clipboard{background-position:-160px -128px}.ui-icon-copy{background-position:-176px -128px}.ui-icon-contact{background-position:-192px -128px}.ui-icon-image{background-position:-208px -128px}.ui-icon-video{background-position:-224px -128px}.ui-icon-script{background-position:-240px -128px}.ui-icon-alert{background-position:0 -144px}.ui-icon-info{background-position:-16px -144px}.ui-icon-notice{background-position:-32px -144px}.ui-icon-help{background-position:-48px -144px}.ui-icon-check{background-position:-64px -144px}.ui-icon-bullet{background-position:-80px -144px}.ui-icon-radio-on{background-position:-96px -144px}.ui-icon-radio-off{background-position:-112px -144px}.ui-icon-pin-w{background-position:-128px -144px}.ui-icon-pin-s{background-position:-144px -144px}.ui-icon-play{background-position:0 -160px}.ui-icon-pause{background-position:-16px -160px}.ui-icon-seek-next{background-position:-32px -160px}.ui-icon-seek-prev{background-position:-48px -160px}.ui-icon-seek-end{background-position:-64px -160px}.ui-icon-seek-start{background-position:-80px -160px}.ui-icon-seek-first{background-position:-80px -160px}.ui-icon-stop{background-position:-96px -160px}.ui-icon-eject{background-position:-112px -160px}.ui-icon-volume-off{background-position:-128px -160px}.ui-icon-volume-on{background-position:-144px -160px}.ui-icon-power{background-position:0 -176px}.ui-icon-signal-diag{background-position:-16px -176px}.ui-icon-signal{background-position:-32px -176px}.ui-icon-battery-0{background-position:-48px -176px}.ui-icon-battery-1{background-position:-64px -176px}.ui-icon-battery-2{background-position:-80px -176px}.ui-icon-battery-3{background-position:-96px -176px}.ui-icon-circle-plus{background-position:0 -192px}.ui-icon-circle-minus{background-position:-16px -192px}.ui-icon-circle-close{background-position:-32px -192px}.ui-icon-circle-triangle-e{background-position:-48px -192px}.ui-icon-circle-triangle-s{background-position:-64px -192px}.ui-icon-circle-triangle-w{background-position:-80px -192px}.ui-icon-circle-triangle-n{background-position:-96px -192px}.ui-icon-circle-arrow-e{background-position:-112px -192px}.ui-icon-circle-arrow-s{background-position:-128px -192px}.ui-icon-circle-arrow-w{background-position:-144px -192px}.ui-icon-circle-arrow-n{background-position:-160px -192px}.ui-icon-circle-zoomin{background-position:-176px -192px}.ui-icon-circle-zoomout{background-position:-192px -192px}.ui-icon-circle-check{background-position:-208px -192px}.ui-icon-circlesmall-plus{background-position:0 -208px}.ui-icon-circlesmall-minus{background-position:-16px -208px}.ui-icon-circlesmall-close{background-position:-32px -208px}.ui-icon-squaresmall-plus{background-position:-48px -208px}.ui-icon-squaresmall-minus{background-position:-64px -208px}.ui-icon-squaresmall-close{background-position:-80px -208px}.ui-icon-grip-dotted-vertical{background-position:0 -224px}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px}.ui-icon-grip-solid-vertical{background-position:-32px -224px}.ui-icon-grip-solid-horizontal{background-position:-48px -224px}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px}.ui-icon-grip-diagonal-se{background-position:-80px -224px}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30)}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px} \ No newline at end of file diff --git a/lib/scripts/jquery/jquery-ui-theme/smoothness.css b/lib/scripts/jquery/jquery-ui-theme/smoothness.css deleted file mode 100644 index 910d24b95..000000000 --- a/lib/scripts/jquery/jquery-ui-theme/smoothness.css +++ /dev/null @@ -1,568 +0,0 @@ -/* - * jQuery UI CSS Framework 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Theming/API - */ - -/* Layout helpers -----------------------------------*/ -.ui-helper-hidden { display: none; } -.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } -.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } -.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } -.ui-helper-clearfix { display: inline-block; } -/* required comment for clearfix to work in Opera \*/ -* html .ui-helper-clearfix { height:1%; } -.ui-helper-clearfix { display:block; } -/* end clearfix */ -.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } - - -/* Interaction Cues -----------------------------------*/ -.ui-state-disabled { cursor: default !important; } - - -/* Icons -----------------------------------*/ - -/* states and images */ -.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } - - -/* Misc visuals -----------------------------------*/ - -/* Overlays */ -.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } - - -/* - * jQuery UI CSS Framework 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Theming/API - * - * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px - */ - - -/* Component containers -----------------------------------*/ -.ui-widget { font-size: 1.1em; } -.ui-widget .ui-widget { font-size: 1em; } -.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-size: 1em; } -.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } -.ui-widget-content a { color: #222222; } -.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } -.ui-widget-header a { color: #222222; } - -/* Interaction states -----------------------------------*/ -.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } -.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } -.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } -.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } -.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } -.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } -.ui-widget :active { outline: none; } - -/* Interaction Cues -----------------------------------*/ -.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; } -.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } -.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } -.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } -.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } -.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } -.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } -.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } - -/* Icons -----------------------------------*/ - -/* states and images */ -.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } -.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } -.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } -.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } -.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } -.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } -.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } -.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } - -/* positioning */ -.ui-icon-carat-1-n { background-position: 0 0; } -.ui-icon-carat-1-ne { background-position: -16px 0; } -.ui-icon-carat-1-e { background-position: -32px 0; } -.ui-icon-carat-1-se { background-position: -48px 0; } -.ui-icon-carat-1-s { background-position: -64px 0; } -.ui-icon-carat-1-sw { background-position: -80px 0; } -.ui-icon-carat-1-w { background-position: -96px 0; } -.ui-icon-carat-1-nw { background-position: -112px 0; } -.ui-icon-carat-2-n-s { background-position: -128px 0; } -.ui-icon-carat-2-e-w { background-position: -144px 0; } -.ui-icon-triangle-1-n { background-position: 0 -16px; } -.ui-icon-triangle-1-ne { background-position: -16px -16px; } -.ui-icon-triangle-1-e { background-position: -32px -16px; } -.ui-icon-triangle-1-se { background-position: -48px -16px; } -.ui-icon-triangle-1-s { background-position: -64px -16px; } -.ui-icon-triangle-1-sw { background-position: -80px -16px; } -.ui-icon-triangle-1-w { background-position: -96px -16px; } -.ui-icon-triangle-1-nw { background-position: -112px -16px; } -.ui-icon-triangle-2-n-s { background-position: -128px -16px; } -.ui-icon-triangle-2-e-w { background-position: -144px -16px; } -.ui-icon-arrow-1-n { background-position: 0 -32px; } -.ui-icon-arrow-1-ne { background-position: -16px -32px; } -.ui-icon-arrow-1-e { background-position: -32px -32px; } -.ui-icon-arrow-1-se { background-position: -48px -32px; } -.ui-icon-arrow-1-s { background-position: -64px -32px; } -.ui-icon-arrow-1-sw { background-position: -80px -32px; } -.ui-icon-arrow-1-w { background-position: -96px -32px; } -.ui-icon-arrow-1-nw { background-position: -112px -32px; } -.ui-icon-arrow-2-n-s { background-position: -128px -32px; } -.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } -.ui-icon-arrow-2-e-w { background-position: -160px -32px; } -.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } -.ui-icon-arrowstop-1-n { background-position: -192px -32px; } -.ui-icon-arrowstop-1-e { background-position: -208px -32px; } -.ui-icon-arrowstop-1-s { background-position: -224px -32px; } -.ui-icon-arrowstop-1-w { background-position: -240px -32px; } -.ui-icon-arrowthick-1-n { background-position: 0 -48px; } -.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } -.ui-icon-arrowthick-1-e { background-position: -32px -48px; } -.ui-icon-arrowthick-1-se { background-position: -48px -48px; } -.ui-icon-arrowthick-1-s { background-position: -64px -48px; } -.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } -.ui-icon-arrowthick-1-w { background-position: -96px -48px; } -.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } -.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } -.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } -.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } -.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } -.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } -.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } -.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } -.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } -.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } -.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } -.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } -.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } -.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } -.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } -.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } -.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } -.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } -.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } -.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } -.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } -.ui-icon-arrow-4 { background-position: 0 -80px; } -.ui-icon-arrow-4-diag { background-position: -16px -80px; } -.ui-icon-extlink { background-position: -32px -80px; } -.ui-icon-newwin { background-position: -48px -80px; } -.ui-icon-refresh { background-position: -64px -80px; } -.ui-icon-shuffle { background-position: -80px -80px; } -.ui-icon-transfer-e-w { background-position: -96px -80px; } -.ui-icon-transferthick-e-w { background-position: -112px -80px; } -.ui-icon-folder-collapsed { background-position: 0 -96px; } -.ui-icon-folder-open { background-position: -16px -96px; } -.ui-icon-document { background-position: -32px -96px; } -.ui-icon-document-b { background-position: -48px -96px; } -.ui-icon-note { background-position: -64px -96px; } -.ui-icon-mail-closed { background-position: -80px -96px; } -.ui-icon-mail-open { background-position: -96px -96px; } -.ui-icon-suitcase { background-position: -112px -96px; } -.ui-icon-comment { background-position: -128px -96px; } -.ui-icon-person { background-position: -144px -96px; } -.ui-icon-print { background-position: -160px -96px; } -.ui-icon-trash { background-position: -176px -96px; } -.ui-icon-locked { background-position: -192px -96px; } -.ui-icon-unlocked { background-position: -208px -96px; } -.ui-icon-bookmark { background-position: -224px -96px; } -.ui-icon-tag { background-position: -240px -96px; } -.ui-icon-home { background-position: 0 -112px; } -.ui-icon-flag { background-position: -16px -112px; } -.ui-icon-calendar { background-position: -32px -112px; } -.ui-icon-cart { background-position: -48px -112px; } -.ui-icon-pencil { background-position: -64px -112px; } -.ui-icon-clock { background-position: -80px -112px; } -.ui-icon-disk { background-position: -96px -112px; } -.ui-icon-calculator { background-position: -112px -112px; } -.ui-icon-zoomin { background-position: -128px -112px; } -.ui-icon-zoomout { background-position: -144px -112px; } -.ui-icon-search { background-position: -160px -112px; } -.ui-icon-wrench { background-position: -176px -112px; } -.ui-icon-gear { background-position: -192px -112px; } -.ui-icon-heart { background-position: -208px -112px; } -.ui-icon-star { background-position: -224px -112px; } -.ui-icon-link { background-position: -240px -112px; } -.ui-icon-cancel { background-position: 0 -128px; } -.ui-icon-plus { background-position: -16px -128px; } -.ui-icon-plusthick { background-position: -32px -128px; } -.ui-icon-minus { background-position: -48px -128px; } -.ui-icon-minusthick { background-position: -64px -128px; } -.ui-icon-close { background-position: -80px -128px; } -.ui-icon-closethick { background-position: -96px -128px; } -.ui-icon-key { background-position: -112px -128px; } -.ui-icon-lightbulb { background-position: -128px -128px; } -.ui-icon-scissors { background-position: -144px -128px; } -.ui-icon-clipboard { background-position: -160px -128px; } -.ui-icon-copy { background-position: -176px -128px; } -.ui-icon-contact { background-position: -192px -128px; } -.ui-icon-image { background-position: -208px -128px; } -.ui-icon-video { background-position: -224px -128px; } -.ui-icon-script { background-position: -240px -128px; } -.ui-icon-alert { background-position: 0 -144px; } -.ui-icon-info { background-position: -16px -144px; } -.ui-icon-notice { background-position: -32px -144px; } -.ui-icon-help { background-position: -48px -144px; } -.ui-icon-check { background-position: -64px -144px; } -.ui-icon-bullet { background-position: -80px -144px; } -.ui-icon-radio-off { background-position: -96px -144px; } -.ui-icon-radio-on { background-position: -112px -144px; } -.ui-icon-pin-w { background-position: -128px -144px; } -.ui-icon-pin-s { background-position: -144px -144px; } -.ui-icon-play { background-position: 0 -160px; } -.ui-icon-pause { background-position: -16px -160px; } -.ui-icon-seek-next { background-position: -32px -160px; } -.ui-icon-seek-prev { background-position: -48px -160px; } -.ui-icon-seek-end { background-position: -64px -160px; } -.ui-icon-seek-start { background-position: -80px -160px; } -/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ -.ui-icon-seek-first { background-position: -80px -160px; } -.ui-icon-stop { background-position: -96px -160px; } -.ui-icon-eject { background-position: -112px -160px; } -.ui-icon-volume-off { background-position: -128px -160px; } -.ui-icon-volume-on { background-position: -144px -160px; } -.ui-icon-power { background-position: 0 -176px; } -.ui-icon-signal-diag { background-position: -16px -176px; } -.ui-icon-signal { background-position: -32px -176px; } -.ui-icon-battery-0 { background-position: -48px -176px; } -.ui-icon-battery-1 { background-position: -64px -176px; } -.ui-icon-battery-2 { background-position: -80px -176px; } -.ui-icon-battery-3 { background-position: -96px -176px; } -.ui-icon-circle-plus { background-position: 0 -192px; } -.ui-icon-circle-minus { background-position: -16px -192px; } -.ui-icon-circle-close { background-position: -32px -192px; } -.ui-icon-circle-triangle-e { background-position: -48px -192px; } -.ui-icon-circle-triangle-s { background-position: -64px -192px; } -.ui-icon-circle-triangle-w { background-position: -80px -192px; } -.ui-icon-circle-triangle-n { background-position: -96px -192px; } -.ui-icon-circle-arrow-e { background-position: -112px -192px; } -.ui-icon-circle-arrow-s { background-position: -128px -192px; } -.ui-icon-circle-arrow-w { background-position: -144px -192px; } -.ui-icon-circle-arrow-n { background-position: -160px -192px; } -.ui-icon-circle-zoomin { background-position: -176px -192px; } -.ui-icon-circle-zoomout { background-position: -192px -192px; } -.ui-icon-circle-check { background-position: -208px -192px; } -.ui-icon-circlesmall-plus { background-position: 0 -208px; } -.ui-icon-circlesmall-minus { background-position: -16px -208px; } -.ui-icon-circlesmall-close { background-position: -32px -208px; } -.ui-icon-squaresmall-plus { background-position: -48px -208px; } -.ui-icon-squaresmall-minus { background-position: -64px -208px; } -.ui-icon-squaresmall-close { background-position: -80px -208px; } -.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } -.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } -.ui-icon-grip-solid-vertical { background-position: -32px -224px; } -.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } -.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } -.ui-icon-grip-diagonal-se { background-position: -80px -224px; } - - -/* Misc visuals -----------------------------------*/ - -/* Corner radius */ -.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } -.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } - -/* Overlays */ -.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } -.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* - * jQuery UI Resizable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Resizable#theming - */ -.ui-resizable { position: relative;} -.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } -.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } -.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } -.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } -.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } -.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } -.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } -.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } -.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } -.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* - * jQuery UI Selectable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectable#theming - */ -.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } -/* - * jQuery UI Accordion 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Accordion#theming - */ -/* IE/Win - Fix animation bug - #4615 */ -.ui-accordion { width: 100%; } -.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } -.ui-accordion .ui-accordion-li-fix { display: inline; } -.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } -.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } -.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } -.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } -.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } -.ui-accordion .ui-accordion-content-active { display: block; } -/* - * jQuery UI Autocomplete 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete#theming - */ -.ui-autocomplete { position: absolute; cursor: default; } - -/* workarounds */ -* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ - -/* - * jQuery UI Menu 1.8.16 - * - * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Menu#theming - */ -.ui-menu { - list-style:none; - padding: 2px; - margin: 0; - display:block; - float: left; -} -.ui-menu .ui-menu { - margin-top: -3px; -} -.ui-menu .ui-menu-item { - margin:0; - padding: 0; - zoom: 1; - float: left; - clear: left; - width: 100%; -} -.ui-menu .ui-menu-item a { - text-decoration:none; - display:block; - padding:.2em .4em; - line-height:1.5; - zoom:1; -} -.ui-menu .ui-menu-item a.ui-state-hover, -.ui-menu .ui-menu-item a.ui-state-active { - font-weight: normal; - margin: -1px; -} -/* - * jQuery UI Button 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Button#theming - */ -.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ -.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ -button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ -.ui-button-icons-only { width: 3.4em; } -button.ui-button-icons-only { width: 3.7em; } - -/*button text element */ -.ui-button .ui-button-text { display: block; line-height: 1.4; } -.ui-button-text-only .ui-button-text { padding: .4em 1em; } -.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } -.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } -.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } -.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } -/* no icon support for input elements, provide padding by default */ -input.ui-button { padding: .4em 1em; } - -/*button icon element(s) */ -.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } -.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } -.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } -.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } -.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } - -/*button sets*/ -.ui-buttonset { margin-right: 7px; } -.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } - -/* workarounds */ -button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ -/* - * jQuery UI Dialog 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog#theming - */ -.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } -.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } -.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } -.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } -.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } -.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } -.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } -.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } -.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } -.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } -.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } -.ui-draggable .ui-dialog-titlebar { cursor: move; } -/* - * jQuery UI Slider 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider#theming - */ -.ui-slider { position: relative; text-align: left; } -.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } -.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } - -.ui-slider-horizontal { height: .8em; } -.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } -.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } -.ui-slider-horizontal .ui-slider-range-min { left: 0; } -.ui-slider-horizontal .ui-slider-range-max { right: 0; } - -.ui-slider-vertical { width: .8em; height: 100px; } -.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } -.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } -.ui-slider-vertical .ui-slider-range-min { bottom: 0; } -.ui-slider-vertical .ui-slider-range-max { top: 0; }/* - * jQuery UI Tabs 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs#theming - */ -.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ -.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } -.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } -.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } -.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } -.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } -.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ -.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } -.ui-tabs .ui-tabs-hide { display: none !important; } -/* - * jQuery UI Datepicker 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker#theming - */ -.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } -.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } -.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } -.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } -.ui-datepicker .ui-datepicker-prev { left:2px; } -.ui-datepicker .ui-datepicker-next { right:2px; } -.ui-datepicker .ui-datepicker-prev-hover { left:1px; } -.ui-datepicker .ui-datepicker-next-hover { right:1px; } -.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } -.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } -.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } -.ui-datepicker select.ui-datepicker-month-year {width: 100%;} -.ui-datepicker select.ui-datepicker-month, -.ui-datepicker select.ui-datepicker-year { width: 49%;} -.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } -.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } -.ui-datepicker td { border: 0; padding: 1px; } -.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } -.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } -.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } -.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } - -/* with multiple calendars */ -.ui-datepicker.ui-datepicker-multi { width:auto; } -.ui-datepicker-multi .ui-datepicker-group { float:left; } -.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } -.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } -.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } -.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } -.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } -.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } - -/* RTL support */ -.ui-datepicker-rtl { direction: rtl; } -.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } -.ui-datepicker-rtl .ui-datepicker-group { float:right; } -.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } -.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } - -/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ -.ui-datepicker-cover { - display: none; /*sorry for IE5*/ - display/**/: block; /*sorry for IE5*/ - position: absolute; /*must have*/ - z-index: -1; /*must have*/ - filter: mask(); /*must have*/ - top: -4px; /*must have*/ - left: -4px; /*must have*/ - width: 200px; /*must have*/ - height: 200px; /*must have*/ -}/* - * jQuery UI Progressbar 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar#theming - */ -.ui-progressbar { height:2em; text-align: left; } -.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/lib/scripts/jquery/jquery-ui.js b/lib/scripts/jquery/jquery-ui.js old mode 100644 new mode 100755 index cd515f361..6dc062e6a --- a/lib/scripts/jquery/jquery-ui.js +++ b/lib/scripts/jquery/jquery-ui.js @@ -1,14 +1,13 @@ -/*! - * jQuery UI 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ +/*! jQuery UI - v1.9.2 - 2012-11-23 +* http://jqueryui.com +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.position.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.effect.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js, jquery.ui.menu.js, jquery.ui.progressbar.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.slider.js, jquery.ui.sortable.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js +* Copyright (c) 2012 jQuery Foundation and other contributors Licensed MIT */ + (function( $, undefined ) { +var uuid = 0, + runiqueId = /^ui-id-\d+$/; + // prevent duplicate loading // this is only a problem because we proxy existing functions // and we don't want to double proxy them @@ -18,26 +17,18 @@ if ( $.ui.version ) { } $.extend( $.ui, { - version: "1.8.16", + version: "1.9.2", keyCode: { - ALT: 18, BACKSPACE: 8, - CAPS_LOCK: 20, COMMA: 188, - COMMAND: 91, - COMMAND_LEFT: 91, // COMMAND - COMMAND_RIGHT: 93, - CONTROL: 17, DELETE: 46, DOWN: 40, END: 35, ENTER: 13, ESCAPE: 27, HOME: 36, - INSERT: 45, LEFT: 37, - MENU: 93, // COMMAND_RIGHT NUMPAD_ADD: 107, NUMPAD_DECIMAL: 110, NUMPAD_DIVIDE: 111, @@ -48,18 +39,14 @@ $.extend( $.ui, { PAGE_UP: 33, PERIOD: 190, RIGHT: 39, - SHIFT: 16, SPACE: 32, TAB: 9, - UP: 38, - WINDOWS: 91 // COMMAND + UP: 38 } }); // plugins $.fn.extend({ - propAttr: $.fn.prop || $.fn.attr, - _focus: $.fn.focus, focus: function( delay, fn ) { return typeof delay === "number" ? @@ -77,13 +64,13 @@ $.fn.extend({ scrollParent: function() { var scrollParent; - if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + if (($.ui.ie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { scrollParent = this.parents().filter(function() { - return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + return (/(relative|absolute|fixed)/).test($.css(this,'position')) && (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x')); }).eq(0); } else { scrollParent = this.parents().filter(function() { - return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + return (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x')); }).eq(0); } @@ -119,95 +106,63 @@ $.fn.extend({ return 0; }, - disableSelection: function() { - return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + - ".ui-disableSelection", function( event ) { - event.preventDefault(); - }); - }, - - enableSelection: function() { - return this.unbind( ".ui-disableSelection" ); - } -}); - -$.each( [ "Width", "Height" ], function( i, name ) { - var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], - type = name.toLowerCase(), - orig = { - innerWidth: $.fn.innerWidth, - innerHeight: $.fn.innerHeight, - outerWidth: $.fn.outerWidth, - outerHeight: $.fn.outerHeight - }; - - function reduce( elem, size, border, margin ) { - $.each( side, function() { - size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; - if ( border ) { - size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; - } - if ( margin ) { - size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; - } - }); - return size; - } - - $.fn[ "inner" + name ] = function( size ) { - if ( size === undefined ) { - return orig[ "inner" + name ].call( this ); - } - + uniqueId: function() { return this.each(function() { - $( this ).css( type, reduce( this, size ) + "px" ); + if ( !this.id ) { + this.id = "ui-id-" + (++uuid); + } }); - }; - - $.fn[ "outer" + name] = function( size, margin ) { - if ( typeof size !== "number" ) { - return orig[ "outer" + name ].call( this, size ); - } + }, + removeUniqueId: function() { return this.each(function() { - $( this).css( type, reduce( this, size, true, margin ) + "px" ); + if ( runiqueId.test( this.id ) ) { + $( this ).removeAttr( "id" ); + } }); - }; + } }); // selectors function focusable( element, isTabIndexNotNaN ) { - var nodeName = element.nodeName.toLowerCase(); + var map, mapName, img, + nodeName = element.nodeName.toLowerCase(); if ( "area" === nodeName ) { - var map = element.parentNode, - mapName = map.name, - img; + map = element.parentNode; + mapName = map.name; if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { return false; } img = $( "img[usemap=#" + mapName + "]" )[0]; return !!img && visible( img ); } - return ( /input|select|textarea|button|object/.test( nodeName ) - ? !element.disabled - : "a" == nodeName - ? element.href || isTabIndexNotNaN - : isTabIndexNotNaN) + return ( /input|select|textarea|button|object/.test( nodeName ) ? + !element.disabled : + "a" === nodeName ? + element.href || isTabIndexNotNaN : + isTabIndexNotNaN) && // the element and all of its ancestors must be visible - && visible( element ); + visible( element ); } function visible( element ) { - return !$( element ).parents().andSelf().filter(function() { - return $.curCSS( this, "visibility" ) === "hidden" || - $.expr.filters.hidden( this ); - }).length; + return $.expr.filters.visible( element ) && + !$( element ).parents().andSelf().filter(function() { + return $.css( this, "visibility" ) === "hidden"; + }).length; } $.extend( $.expr[ ":" ], { - data: function( elem, i, match ) { - return !!$.data( elem, match[ 3 ] ); - }, + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, focusable: function( element ) { return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); @@ -225,6 +180,11 @@ $(function() { var body = document.body, div = body.appendChild( div = document.createElement( "div" ) ); + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the element to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + $.extend( div.style, { minHeight: "100px", height: "auto", @@ -240,57 +200,134 @@ $(function() { body.removeChild( div ).style.display = "none"; }); +// support: jQuery <1.8 +if ( !$( "" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.css( elem, "padding" + this ) ) || 0; + if ( border ) { + size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.css( elem, "margin" + this ) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413) +if ( $( "" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) { + $.fn.removeData = (function( removeData ) { + return function( key ) { + if ( arguments.length ) { + return removeData.call( this, $.camelCase( key ) ); + } else { + return removeData.call( this ); + } + }; + })( $.fn.removeData ); +} + // deprecated + +(function() { + var uaMatch = /msie ([\w.]+)/.exec( navigator.userAgent.toLowerCase() ) || []; + $.ui.ie = uaMatch.length ? true : false; + $.ui.ie6 = parseFloat( uaMatch[ 1 ], 10 ) === 6; +})(); + +$.fn.extend({ + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + $.extend( $.ui, { // $.ui.plugin is deprecated. Use the proxy pattern instead. plugin: { add: function( module, option, set ) { - var proto = $.ui[ module ].prototype; - for ( var i in set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { proto.plugins[ i ] = proto.plugins[ i ] || []; proto.plugins[ i ].push( [ option, set[ i ] ] ); } }, call: function( instance, name, args ) { - var set = instance.plugins[ name ]; - if ( !set || !instance.element[ 0 ].parentNode ) { + var i, + set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) { return; } - - for ( var i = 0; i < set.length; i++ ) { + + for ( i = 0; i < set.length; i++ ) { if ( instance.options[ set[ i ][ 0 ] ] ) { set[ i ][ 1 ].apply( instance.element, args ); } } } }, - - // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() - contains: function( a, b ) { - return document.compareDocumentPosition ? - a.compareDocumentPosition( b ) & 16 : - a !== b && a.contains( b ); - }, - + + contains: $.contains, + // only used by resizable hasScroll: function( el, a ) { - + //If overflow is hidden, the element might have extra content, but the user wants to hide it if ( $( el ).css( "overflow" ) === "hidden") { return false; } - + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", has = false; - + if ( el[ scroll ] > 0 ) { return true; } - + // TODO: determine which cases actually cause this to happen // if the element doesn't have the scroll set, see if it's possible to // set the scroll @@ -299,7 +336,7 @@ $.extend( $.ui, { el[ scroll ] = 0; return has; }, - + // these are odd functions, fix the API or move into individual plugins isOverAxis: function( x, reference, size ) { //Determines when x coordinate is over "b" element axis @@ -312,51 +349,25 @@ $.extend( $.ui, { }); })( jQuery ); -/*! - * jQuery UI Widget 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ (function( $, undefined ) { -// jQuery 1.4+ -if ( $.cleanData ) { - var _cleanData = $.cleanData; - $.cleanData = function( elems ) { - for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { - try { - $( elem ).triggerHandler( "remove" ); - // http://bugs.jquery.com/ticket/8235 - } catch( e ) {} - } - _cleanData( elems ); - }; -} else { - var _remove = $.fn.remove; - $.fn.remove = function( selector, keepData ) { - return this.each(function() { - if ( !keepData ) { - if ( !selector || $.filter( selector, [ this ] ).length ) { - $( "*", this ).add( [ this ] ).each(function() { - try { - $( this ).triggerHandler( "remove" ); - // http://bugs.jquery.com/ticket/8235 - } catch( e ) {} - }); - } - } - return _remove.call( $(this), selector, keepData ); - }); - }; -} +var uuid = 0, + slice = Array.prototype.slice, + _cleanData = $.cleanData; +$.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); +}; $.widget = function( name, base, prototype ) { - var namespace = name.split( "." )[ 0 ], - fullName; + var fullName, existingConstructor, constructor, basePrototype, + namespace = name.split( "." )[ 0 ]; + name = name.split( "." )[ 1 ]; fullName = namespace + "-" + name; @@ -366,81 +377,167 @@ $.widget = function( name, base, prototype ) { } // create selector for plugin - $.expr[ ":" ][ fullName ] = function( elem ) { - return !!$.data( elem, name ); + $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); }; $[ namespace ] = $[ namespace ] || {}; - $[ namespace ][ name ] = function( options, element ) { + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + // allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) if ( arguments.length ) { this._createWidget( options, element ); } }; + // extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + // copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + // track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + }); - var basePrototype = new base(); + basePrototype = new base(); // we need to make the options hash a property directly on the new instance // otherwise we'll modify the options hash on the prototype that we're // inheriting from -// $.each( basePrototype, function( key, val ) { -// if ( $.isPlainObject(val) ) { -// basePrototype[ key ] = $.extend( {}, val ); -// } -// }); - basePrototype.options = $.extend( true, {}, basePrototype.options ); - $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( $.isFunction( value ) ) { + prototype[ prop ] = (function() { + var _super = function() { + return base.prototype[ prop ].apply( this, arguments ); + }, + _superApply = function( args ) { + return base.prototype[ prop ].apply( this, args ); + }; + return function() { + var __super = this._super, + __superApply = this._superApply, + returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + })(); + } + }); + constructor.prototype = $.widget.extend( basePrototype, { + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name + }, prototype, { + constructor: constructor, namespace: namespace, widgetName: name, - widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, - widgetBaseClass: fullName - }, prototype ); + // TODO remove widgetBaseClass, see #8155 + widgetBaseClass: fullName, + widgetFullName: fullName + }); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto ); + }); + // remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } - $.widget.bridge( name, $[ namespace ][ name ] ); + $.widget.bridge( name, constructor ); +}; + +$.widget.extend = function( target ) { + var input = slice.call( arguments, 1 ), + inputIndex = 0, + inputLength = input.length, + key, + value; + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; }; $.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; $.fn[ name ] = function( options ) { var isMethodCall = typeof options === "string", - args = Array.prototype.slice.call( arguments, 1 ), + args = slice.call( arguments, 1 ), returnValue = this; // allow multiple hashes to be passed on init options = !isMethodCall && args.length ? - $.extend.apply( null, [ true, options ].concat(args) ) : + $.widget.extend.apply( null, [ options ].concat(args) ) : options; - // prevent calls to internal methods - if ( isMethodCall && options.charAt( 0 ) === "_" ) { - return returnValue; - } - if ( isMethodCall ) { this.each(function() { - var instance = $.data( this, name ), - methodValue = instance && $.isFunction( instance[options] ) ? - instance[ options ].apply( instance, args ) : - instance; - // TODO: add this back in 1.9 and use $.error() (see #5972) -// if ( !instance ) { -// throw "cannot call methods on " + name + " prior to initialization; " + -// "attempted to call method '" + options + "'"; -// } -// if ( !$.isFunction( instance[options] ) ) { -// throw "no such method '" + options + "' for " + name + " widget instance"; -// } -// var methodValue = instance[ options ].apply( instance, args ); + var methodValue, + instance = $.data( this, fullName ); + if ( !instance ) { + return $.error( "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + " widget instance" ); + } + methodValue = instance[ options ].apply( instance, args ); if ( methodValue !== instance && methodValue !== undefined ) { - returnValue = methodValue; + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; return false; } }); } else { this.each(function() { - var instance = $.data( this, name ); + var instance = $.data( this, fullName ); if ( instance ) { instance.option( options || {} )._init(); } else { - $.data( this, name, new object( options, this ) ); + $.data( this, fullName, new object( options, this ) ); } }); } @@ -449,74 +546,126 @@ $.widget.bridge = function( name, object ) { }; }; -$.Widget = function( options, element ) { - // allow instantiation without initializing for simple inheritance - if ( arguments.length ) { - this._createWidget( options, element ); - } -}; +$.Widget = function( /* options, element */ ) {}; +$.Widget._childConstructors = []; $.Widget.prototype = { widgetName: "widget", widgetEventPrefix: "", + defaultElement: "
    ", options: { - disabled: false + disabled: false, + + // callbacks + create: null }, _createWidget: function( options, element ) { - // $.widget.bridge stores the plugin instance, but we do it anyway - // so that it's stored even before the _create function runs - $.data( element, this.widgetName, this ); + element = $( element || this.defaultElement || this )[ 0 ]; this.element = $( element ); - this.options = $.extend( true, {}, + this.uuid = uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + this.options = $.widget.extend( {}, this.options, this._getCreateOptions(), options ); - var self = this; - this.element.bind( "remove." + this.widgetName, function() { - self.destroy(); - }); + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + // 1.9 BC for #7810 + // TODO remove dual storage + $.data( element, this.widgetName, this ); + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } this._create(); - this._trigger( "create" ); + this._trigger( "create", null, this._getCreateEventData() ); this._init(); }, - _getCreateOptions: function() { - return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; - }, - _create: function() {}, - _init: function() {}, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() this.element - .unbind( "." + this.widgetName ) - .removeData( this.widgetName ); + .unbind( this.eventNamespace ) + // 1.9 BC for #7810 + // TODO remove dual storage + .removeData( this.widgetName ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); this.widget() - .unbind( "." + this.widgetName ) + .unbind( this.eventNamespace ) .removeAttr( "aria-disabled" ) .removeClass( - this.widgetBaseClass + "-disabled " + + this.widgetFullName + "-disabled " + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); }, + _destroy: $.noop, widget: function() { return this.element; }, option: function( key, value ) { - var options = key; + var options = key, + parts, + curOption, + i; if ( arguments.length === 0 ) { // don't return a reference to the internal hash - return $.extend( {}, this.options ); + return $.widget.extend( {}, this.options ); } - if (typeof key === "string" ) { - if ( value === undefined ) { - return this.options[ key ]; - } + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } options = {}; - options[ key ] = value; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( value === undefined ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( value === undefined ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } } this._setOptions( options ); @@ -524,10 +673,11 @@ $.Widget.prototype = { return this; }, _setOptions: function( options ) { - var self = this; - $.each( options, function( key, value ) { - self._setOption( key, value ); - }); + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } return this; }, @@ -536,10 +686,10 @@ $.Widget.prototype = { if ( key === "disabled" ) { this.widget() - [ value ? "addClass" : "removeClass"]( - this.widgetBaseClass + "-disabled" + " " + - "ui-state-disabled" ) + .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value ) .attr( "aria-disabled", value ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); } return this; @@ -552,46 +702,171 @@ $.Widget.prototype = { return this._setOption( "disabled", true ); }, + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement, + instance = this; + + // no suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + // accept selectors, DOM elements + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^(\w+)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + delegateElement.delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + _trigger: function( type, event, data ) { - var callback = this.options[ type ]; + var prop, orig, + callback = this.options[ type ]; + data = data || {}; event = $.Event( event ); event.type = ( type === this.widgetEventPrefix ? type : this.widgetEventPrefix + type ).toLowerCase(); - data = data || {}; + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; // copy original event properties over to the new event - // this would happen if we could call $.event.fix instead of $.Event - // but we don't have a way to force an event to be fixed multiple times - if ( event.originalEvent ) { - for ( var i = $.event.props.length, prop; i; ) { - prop = $.event.props[ --i ]; - event[ prop ] = event.originalEvent[ prop ]; + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } } } this.element.trigger( event, data ); - - return !( $.isFunction(callback) && - callback.call( this.element[0], event, data ) === false || + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || event.isDefaultPrevented() ); } }; +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && ( $.effects.effect[ effectName ] || $.uiBackCompat !== false && $.effects[ effectName ] ) ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + $.Widget.prototype._getCreateOptions = function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }; +} + })( jQuery ); -/*! - * jQuery UI Mouse 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js - */ (function( $, undefined ) { var mouseHandled = false; @@ -600,21 +875,22 @@ $( document ).mouseup( function( e ) { }); $.widget("ui.mouse", { + version: "1.9.2", options: { - cancel: ':input,option', + cancel: 'input,textarea,button,select,option', distance: 1, delay: 0 }, _mouseInit: function() { - var self = this; + var that = this; this.element .bind('mousedown.'+this.widgetName, function(event) { - return self._mouseDown(event); + return that._mouseDown(event); }) .bind('click.'+this.widgetName, function(event) { - if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { - $.removeData(event.target, self.widgetName + '.preventClickEvent'); + if (true === $.data(event.target, that.widgetName + '.preventClickEvent')) { + $.removeData(event.target, that.widgetName + '.preventClickEvent'); event.stopImmediatePropagation(); return false; } @@ -627,22 +903,27 @@ $.widget("ui.mouse", { // other instances of mouse _mouseDestroy: function() { this.element.unbind('.'+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + } }, _mouseDown: function(event) { // don't let more than one widget handle mouseStart - if( mouseHandled ) { return }; + if( mouseHandled ) { return; } // we may have missed mouseup (out of window) (this._mouseStarted && this._mouseUp(event)); this._mouseDownEvent = event; - var self = this, - btnIsLeft = (event.which == 1), + var that = this, + btnIsLeft = (event.which === 1), // event.target.nodeName works around a bug in IE 8 with // disabled inputs (#7620) - elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { return true; } @@ -650,7 +931,7 @@ $.widget("ui.mouse", { this.mouseDelayMet = !this.options.delay; if (!this.mouseDelayMet) { this._mouseDelayTimer = setTimeout(function() { - self.mouseDelayMet = true; + that.mouseDelayMet = true; }, this.options.delay); } @@ -669,24 +950,24 @@ $.widget("ui.mouse", { // these delegates are required to keep context this._mouseMoveDelegate = function(event) { - return self._mouseMove(event); + return that._mouseMove(event); }; this._mouseUpDelegate = function(event) { - return self._mouseUp(event); + return that._mouseUp(event); }; $(document) .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); event.preventDefault(); - + mouseHandled = true; return true; }, _mouseMove: function(event) { // IE mouseup check - mouseup happened when mouse was out of window - if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + if ($.ui.ie && !(document.documentMode >= 9) && !event.button) { return this._mouseUp(event); } @@ -712,8 +993,8 @@ $.widget("ui.mouse", { if (this._mouseStarted) { this._mouseStarted = false; - if (event.target == this._mouseDownEvent.target) { - $.data(event.target, this.widgetName + '.preventClickEvent', true); + if (event.target === this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); } this._mouseStop(event); @@ -742,2370 +1023,4983 @@ $.widget("ui.mouse", { }); })(jQuery); -/* - * jQuery UI Draggable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Draggables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ (function( $, undefined ) { -$.widget("ui.draggable", $.ui.mouse, { - widgetEventPrefix: "drag", - options: { - addClasses: true, - appendTo: "parent", - axis: false, - connectToSortable: false, - containment: false, - cursor: "auto", - cursorAt: false, - grid: false, - handle: false, - helper: "original", - iframeFix: false, - opacity: false, - refreshPositions: false, - revert: false, - revertDuration: 500, - scope: "default", - scroll: true, - scrollSensitivity: 20, - scrollSpeed: 20, - snap: false, - snapMode: "both", - snapTolerance: 20, - stack: false, - zIndex: false - }, - _create: function() { - - if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) - this.element[0].style.position = 'relative'; +$.ui = $.ui || {}; - (this.options.addClasses && this.element.addClass("ui-draggable")); - (this.options.disabled && this.element.addClass("ui-draggable-disabled")); - - this._mouseInit(); - - }, - - destroy: function() { - if(!this.element.data('draggable')) return; - this.element - .removeData("draggable") - .unbind(".draggable") - .removeClass("ui-draggable" - + " ui-draggable-dragging" - + " ui-draggable-disabled"); - this._mouseDestroy(); - - return this; - }, +var cachedScrollbarWidth, + max = Math.max, + abs = Math.abs, + round = Math.round, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseInt( offsets[ 0 ], 10 ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseInt( offsets[ 1 ], 10 ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} - _mouseCapture: function(event) { +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "
    " ), + innerDiv = div.children()[0]; - var o = this.options; + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); - // among others, prevent a drag on a resizable-handle - if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) - return false; + w2 = innerDiv.offsetWidth; - //Quit if we're not on a valid handle - this.handle = this._getHandle(event); - if (!this.handle) - return false; - - if ( o.iframeFix ) { - $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { - $('
    ') - .css({ - width: this.offsetWidth+"px", height: this.offsetHeight+"px", - position: "absolute", opacity: "0.001", zIndex: 1000 - }) - .css($(this).offset()) - .appendTo("body"); - }); + if ( w1 === w2 ) { + w2 = div[0].clientWidth; } - return true; + div.remove(); + return (cachedScrollbarWidth = w1 - w2); }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ), + overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[0].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[0].scrollHeight ); + return { + width: hasOverflowX ? $.position.scrollbarWidth() : 0, + height: hasOverflowY ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[0] ); + return { + element: withinElement, + isWindow: isWindow, + offset: withinElement.offset() || { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + width: isWindow ? withinElement.width() : withinElement.outerWidth(), + height: isWindow ? withinElement.height() : withinElement.outerHeight() + }; + } +}; - _mouseStart: function(event) { - - var o = this.options; +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } - //Create and append the visible helper - this.helper = this._createHelper(event); + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); - //Cache the helper size - this._cacheHelperProportions(); + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; - //If ddmanager is used for droppables, set the global draggable - if($.ui.ddmanager) - $.ui.ddmanager.current = this; + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + targetOffset = { top: 0, left: 0 }; + } else if ( $.isWindow( targetElem ) ) { + targetWidth = target.width(); + targetHeight = target.height(); + targetOffset = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + targetOffset = { top: targetElem.pageY, left: targetElem.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + targetOffset = target.offset(); + } + // clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); - /* - * - Position generation - - * This block generates everything position related - it's the core of draggables. - */ + // force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; - //Cache the margins of the original element - this._cacheMargins(); + if ( pos.length === 1) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; - //Store the helper's css position - this.cssPosition = this.helper.css("position"); - this.scrollParent = this.helper.scrollParent(); + // reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + }); - //The element's absolute position on the page minus margins - this.offset = this.positionAbs = this.element.offset(); - this.offset = { - top: this.offset.top - this.margins.top, - left: this.offset.left - this.margins.left - }; + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } - $.extend(this.offset, { - click: { //Where the click happened, relative to the element - left: event.pageX - this.offset.left, - top: event.pageY - this.offset.top - }, - parent: this._getParentOffset(), - relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper - }); + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } - //Generate the original position - this.originalPosition = this.position = this._generatePosition(event); - this.originalPageX = event.pageX; - this.originalPageY = event.pageY; + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } - //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied - (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; - //Set a containment if given in the options - if(o.containment) - this._setContainment(); + return this.each(function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); - //Trigger event + callbacks - if(this._trigger("start", event) === false) { - this._clear(); - return false; + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; } - //Recache the helper size - this._cacheHelperProportions(); - - //Prepare the droppable offsets - if ($.ui.ddmanager && !o.dropBehaviour) - $.ui.ddmanager.prepareOffsets(this, event); - - this.helper.addClass("ui-draggable-dragging"); - this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position - - //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) - if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); - - return true; - }, - - _mouseDrag: function(event, noPropagation) { + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } - //Compute the helpers position - this.position = this._generatePosition(event); - this.positionAbs = this._convertPositionTo("absolute"); + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; - //Call plugins and callbacks and use the resulting position if something is returned - if (!noPropagation) { - var ui = this._uiHash(); - if(this._trigger('drag', event, ui) === false) { - this._mouseUp({}); - return false; - } - this.position = ui.position; + // if the browser doesn't support fractions, then round for consistent results + if ( !$.support.offsetFractions ) { + position.left = round( position.left ); + position.top = round( position.top ); } - if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; - if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; - if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); - - return false; - }, + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; - _mouseStop: function(event) { + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem : elem + }); + } + }); - //If we are using droppables, inform the manager about the drop - var dropped = false; - if ($.ui.ddmanager && !this.options.dropBehaviour) - dropped = $.ui.ddmanager.drop(this, event); + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } - //if a drop comes from outside (a sortable) - if(this.dropped) { - dropped = this.dropped; - this.dropped = false; + if ( options.using ) { + // adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; } - - //if the original element is removed, don't bother to continue if helper is set to "original" - if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") - return false; - if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { - var self = this; - $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { - if(self._trigger("stop", event) !== false) { - self._clear(); + elem.offset( $.extend( position, { using: using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // element is wider than within + if ( data.collisionWidth > outerWidth ) { + // element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; + position.left += overLeft - newOverRight; + // element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + // element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } } - }); - } else { - if(this._trigger("stop", event) !== false) { - this._clear(); + // too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + // too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + // adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // element is taller than within + if ( data.collisionHeight > outerHeight ) { + // element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; + position.top += overTop - newOverBottom; + // element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + // element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + // too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + // too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + // adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); } } - - return false; }, - - _mouseUp: function(event) { - if (this.options.iframeFix === true) { - $("div.ui-draggable-iframeFix").each(function() { - this.parentNode.removeChild(this); - }); //Remove frame helpers + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } + else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset; + if ( ( position.top + myOffset + atOffset + offset) > overTop && ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) ) { + position.top += myOffset + atOffset + offset; + } + } + else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop; + if ( ( position.top + myOffset + atOffset + offset) > overBottom && ( newOverTop > 0 || abs( newOverTop ) < overBottom ) ) { + position.top += myOffset + atOffset + offset; + } + } } - - //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) - if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); - - return $.ui.mouse.prototype._mouseUp.call(this, event); }, - - cancel: function() { - - if(this.helper.is(".ui-draggable-dragging")) { - this._mouseUp({}); - } else { - this._clear(); + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); } - - return this; - - }, + } +}; - _getHandle: function(event) { +// fraction support test +(function () { + var testElement, testElementParent, testElementStyle, offsetLeft, i, + body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ); + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px;"; + + offsetLeft = $( div ).offset().left; + $.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11; + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); +})(); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + // offset option + (function( $ ) { + var _position = $.fn.position; + $.fn.position = function( options ) { + if ( !options || !options.offset ) { + return _position.call( this, options ); + } + var offset = options.offset.split( " " ), + at = options.at.split( " " ); + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + if ( /^\d/.test( offset[ 0 ] ) ) { + offset[ 0 ] = "+" + offset[ 0 ]; + } + if ( /^\d/.test( offset[ 1 ] ) ) { + offset[ 1 ] = "+" + offset[ 1 ]; + } + if ( at.length === 1 ) { + if ( /left|center|right/.test( at[ 0 ] ) ) { + at[ 1 ] = "center"; + } else { + at[ 1 ] = at[ 0 ]; + at[ 0 ] = "center"; + } + } + return _position.call( this, $.extend( options, { + at: at[ 0 ] + offset[ 0 ] + " " + at[ 1 ] + offset[ 1 ], + offset: undefined + } ) ); + }; + }( jQuery ) ); +} - var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; - $(this.options.handle, this.element) - .find("*") - .andSelf() - .each(function() { - if(this == event.target) handle = true; - }); +}( jQuery ) ); +(function( $, undefined ) { - return handle; +var uid = 0, + hideProps = {}, + showProps = {}; + +hideProps.height = hideProps.paddingTop = hideProps.paddingBottom = + hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide"; +showProps.height = showProps.paddingTop = showProps.paddingBottom = + showProps.borderTopWidth = showProps.borderBottomWidth = "show"; + +$.widget( "ui.accordion", { + version: "1.9.2", + options: { + active: 0, + animate: {}, + collapsible: false, + event: "click", + header: "> li > :first-child,> :not(li):even", + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + // callbacks + activate: null, + beforeActivate: null }, - _createHelper: function(event) { + _create: function() { + var accordionId = this.accordionId = "ui-accordion-" + + (this.element.attr( "id" ) || ++uid), + options = this.options; + + this.prevShow = this.prevHide = $(); + this.element.addClass( "ui-accordion ui-widget ui-helper-reset" ); + + this.headers = this.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ); + this._hoverable( this.headers ); + this._focusable( this.headers ); + + this.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ) + .hide(); + + // don't allow collapsible: false and active: false / null + if ( !options.collapsible && (options.active === false || options.active == null) ) { + options.active = 0; + } + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this.active = this._findActive( options.active ) + .addClass( "ui-accordion-header-active ui-state-active" ) + .toggleClass( "ui-corner-all ui-corner-top" ); + this.active.next() + .addClass( "ui-accordion-content-active" ) + .show(); + + this._createIcons(); + this.refresh(); - var o = this.options; - var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + // ARIA + this.element.attr( "role", "tablist" ); - if(!helper.parents('body').length) - helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + this.headers + .attr( "role", "tab" ) + .each(function( i ) { + var header = $( this ), + headerId = header.attr( "id" ), + panel = header.next(), + panelId = panel.attr( "id" ); + if ( !headerId ) { + headerId = accordionId + "-header-" + i; + header.attr( "id", headerId ); + } + if ( !panelId ) { + panelId = accordionId + "-panel-" + i; + panel.attr( "id", panelId ); + } + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + }) + .next() + .attr( "role", "tabpanel" ); - if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) - helper.css("position", "absolute"); + this.headers + .not( this.active ) + .attr({ + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }) + .hide(); - return helper; + // make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr({ + "aria-selected": "true", + tabIndex: 0 + }) + .next() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + } + this._on( this.headers, { keydown: "_keydown" }); + this._on( this.headers.next(), { keydown: "_panelKeyDown" }); + this._setupEvents( options.event ); }, - _adjustOffsetFromHelper: function(obj) { - if (typeof obj == 'string') { - obj = obj.split(' '); + _getCreateEventData: function() { + return { + header: this.active, + content: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icons = this.options.icons; + if ( icons ) { + $( "" ) + .addClass( "ui-accordion-header-icon ui-icon " + icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-accordion-header-icon" ) + .removeClass( icons.header ) + .addClass( icons.activeHeader ); + this.headers.addClass( "ui-accordion-icons" ); } - if ($.isArray(obj)) { - obj = {left: +obj[0], top: +obj[1] || 0}; + }, + + _destroyIcons: function() { + this.headers + .removeClass( "ui-accordion-icons" ) + .children( ".ui-accordion-header-icon" ) + .remove(); + }, + + _destroy: function() { + var contents; + + // clean up main element + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + // clean up headers + this.headers + .removeClass( "ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-controls" ) + .removeAttr( "tabIndex" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + this._destroyIcons(); + + // clean up content panels + contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-labelledby" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); } - if ('left' in obj) { - this.offset.click.left = obj.left + this.margins.left; + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; } - if ('right' in obj) { - this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); } - if ('top' in obj) { - this.offset.click.top = obj.top + this.margins.top; + + this._super( key, value ); + + // setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); } - if ('bottom' in obj) { - this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key === "disabled" ) { + this.headers.add( this.headers.next() ) + .toggleClass( "ui-state-disabled", !!value ); } }, - _getParentOffset: function() { + _keydown: function( event ) { + if ( event.altKey || event.ctrlKey ) { + return; + } - //Get the offsetParent and cache its position - this.offsetParent = this.helper.offsetParent(); - var po = this.offsetParent.offset(); + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; - // This is a special case where we need to modify a offset calculated on start, since the following happened: - // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent - // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that - // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag - if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { - po.left += this.scrollParent.scrollLeft(); - po.top += this.scrollParent.scrollTop(); + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; } - if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information - || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix - po = { top: 0, left: 0 }; + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + event.preventDefault(); + } + }, - return { - top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), - left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) - }; + _panelKeyDown : function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().focus(); + } + }, + + refresh: function() { + var maxHeight, overflow, + heightStyle = this.options.heightStyle, + parent = this.element.parent(); + + + if ( heightStyle === "fill" ) { + // IE 6 treats height like minHeight, so we need to turn off overflow + // in order to get a reliable height + // we use the minHeight support test because we assume that only + // browsers that don't support minHeight will treat height as minHeight + if ( !$.support.minHeight ) { + overflow = parent.css( "overflow" ); + parent.css( "overflow", "hidden"); + } + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + if ( overflow ) { + parent.css( "overflow", overflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + }) + .height( maxHeight ); + } }, - _getRelativeOffset: function() { + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; - if(this.cssPosition == "relative") { - var p = this.element.position(); - return { - top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), - left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() - }; - } else { - return { top: 0, left: 0 }; + // trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; } + // trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler({ + target: active, + currentTarget: active, + preventDefault: $.noop + }); }, - _cacheMargins: function() { - this.margins = { - left: (parseInt(this.element.css("marginLeft"),10) || 0), - top: (parseInt(this.element.css("marginTop"),10) || 0), - right: (parseInt(this.element.css("marginRight"),10) || 0), - bottom: (parseInt(this.element.css("marginBottom"),10) || 0) - }; + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); }, - _cacheHelperProportions: function() { - this.helperProportions = { - width: this.helper.outerWidth(), - height: this.helper.outerHeight() - }; + _setupEvents: function( event ) { + var events = {}; + if ( !event ) { + return; + } + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + this._on( this.headers, events ); }, - _setContainment: function() { + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; - var o = this.options; - if(o.containment == 'parent') o.containment = this.helper[0].parentNode; - if(o.containment == 'document' || o.containment == 'window') this.containment = [ - o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, - o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, - (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, - (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top - ]; + event.preventDefault(); - if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { - var c = $(o.containment); - var ce = c[0]; if(!ce) return; - var co = c.offset(); - var over = ($(ce).css("overflow") != 'hidden'); + if ( + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } - this.containment = [ - (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), - (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), - (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, - (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom - ]; - this.relative_container = c; + options.active = collapsing ? false : this.headers.index( clicked ); - } else if(o.containment.constructor == Array) { - this.containment = o.containment; - } - - }, - - _convertPositionTo: function(d, pos) { + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); - if(!pos) pos = this.position; - var mod = d == "absolute" ? 1 : -1; - var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + // switch classes + // corner classes on the previously active header stay after the animation + active.removeClass( "ui-accordion-header-active ui-state-active" ); + if ( options.icons ) { + active.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.activeHeader ) + .addClass( options.icons.header ); + } - return { - top: ( - pos.top // The absolute mouse position - + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent - + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) - - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) - ), - left: ( - pos.left // The absolute mouse position - + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent - + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) - - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) - ) - }; + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-corner-all" ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ); + if ( options.icons ) { + clicked.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.activeHeader ); + } + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } }, - _generatePosition: function(event) { - - var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); - var pageX = event.pageX; - var pageY = event.pageY; + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; - /* - * - Position constraining - - * Constrain the position to a mix of grid, containment. - */ + // handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; - if(this.originalPosition) { //If we are not dragging yet, we won't check for options - var containment; - if(this.containment) { - if (this.relative_container){ - var co = this.relative_container.offset(); - containment = [ this.containment[0] + co.left, - this.containment[1] + co.top, - this.containment[2] + co.left, - this.containment[3] + co.top ]; - } - else { - containment = this.containment; - } + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } - if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; - if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; - if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; - if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; - } + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + toHide.prev().attr( "aria-selected", "false" ); + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.headers.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); + } - if(o.grid) { - //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) - var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; - pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + toShow + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }) + .prev() + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, - var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; - pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; - } + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + if ( typeof options === "number" ) { + duration = options; } + if ( typeof options === "string" ) { + easing = options; + } + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; - return { - top: ( - pageY // The absolute mouse position - - this.offset.click.top // Click offset (relative to the element) - - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent - - this.offset.parent.top // The offsetParent's offset without borders (offset + border) - + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) - ), - left: ( - pageX // The absolute mouse position - - this.offset.click.left // Click offset (relative to the element) - - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent - - this.offset.parent.left // The offsetParent's offset without borders (offset + border) - + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) - ) - }; - - }, + if ( !toHide.length ) { + return toShow.animate( showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( hideProps, duration, easing, complete ); + } - _clear: function() { - this.helper.removeClass("ui-draggable-dragging"); - if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); - //if($.ui.ddmanager) $.ui.ddmanager.current = null; - this.helper = null; - this.cancelHelperRemoval = false; + total = toShow.show().outerHeight(); + toHide.animate( hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + }); + toShow + .hide() + .animate( showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + adjust += fx.now; + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + }); }, - // From now on bulk stuff - mainly helpers + _toggleComplete: function( data ) { + var toHide = data.oldPanel; - _trigger: function(type, event, ui) { - ui = ui || this._uiHash(); - $.ui.plugin.call(this, type, [event, ui]); - if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins - return $.Widget.prototype._trigger.call(this, type, event, ui); - }, + toHide + .removeClass( "ui-accordion-content-active" ) + .prev() + .removeClass( "ui-corner-top" ) + .addClass( "ui-corner-all" ); - plugins: {}, + // Work around for rendering bug in IE (#5421) + if ( toHide.length ) { + toHide.parent()[0].className = toHide.parent()[0].className; + } - _uiHash: function(event) { - return { - helper: this.helper, - position: this.position, - originalPosition: this.originalPosition, - offset: this.positionAbs - }; + this._trigger( "activate", null, data ); } - }); -$.extend($.ui.draggable, { - version: "1.8.16" -}); -$.ui.plugin.add("draggable", "connectToSortable", { - start: function(event, ui) { - var inst = $(this).data("draggable"), o = inst.options, - uiSortable = $.extend({}, ui, { item: inst.element }); - inst.sortables = []; - $(o.connectToSortable).each(function() { - var sortable = $.data(this, 'sortable'); - if (sortable && !sortable.options.disabled) { - inst.sortables.push({ - instance: sortable, - shouldRevert: sortable.options.revert - }); - sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). - sortable._trigger("activate", event, uiSortable); +// DEPRECATED +if ( $.uiBackCompat !== false ) { + // navigation options + (function( $, prototype ) { + $.extend( prototype.options, { + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); } }); - }, - stop: function(event, ui) { - - //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper - var inst = $(this).data("draggable"), - uiSortable = $.extend({}, ui, { item: inst.element }); + var _create = prototype._create; + prototype._create = function() { + if ( this.options.navigation ) { + var that = this, + headers = this.element.find( this.options.header ), + content = headers.next(), + current = headers.add( content ) + .find( "a" ) + .filter( this.options.navigationFilter ) + [ 0 ]; + if ( current ) { + headers.add( content ).each( function( index ) { + if ( $.contains( this, current ) ) { + that.options.active = Math.floor( index / 2 ); + return false; + } + }); + } + } + _create.call( this ); + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); + + // height options + (function( $, prototype ) { + $.extend( prototype.options, { + heightStyle: null, // remove default so we fall back to old values + autoHeight: true, // use heightStyle: "auto" + clearStyle: false, // use heightStyle: "content" + fillSpace: false // use heightStyle: "fill" + }); - $.each(inst.sortables, function() { - if(this.instance.isOver) { + var _create = prototype._create, + _setOption = prototype._setOption; - this.instance.isOver = 0; + $.extend( prototype, { + _create: function() { + this.options.heightStyle = this.options.heightStyle || + this._mergeHeightStyle(); - inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance - this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + _create.call( this ); + }, - //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' - if(this.shouldRevert) this.instance.options.revert = true; + _setOption: function( key ) { + if ( key === "autoHeight" || key === "clearStyle" || key === "fillSpace" ) { + this.options.heightStyle = this._mergeHeightStyle(); + } + _setOption.apply( this, arguments ); + }, - //Trigger the stop of the sortable - this.instance._mouseStop(event); + _mergeHeightStyle: function() { + var options = this.options; - this.instance.options.helper = this.instance.options._helper; + if ( options.fillSpace ) { + return "fill"; + } - //If the helper has been the original item, restore properties in the sortable - if(inst.options.helper == 'original') - this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + if ( options.clearStyle ) { + return "content"; + } - } else { - this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance - this.instance._trigger("deactivate", event, uiSortable); + if ( options.autoHeight ) { + return "auto"; + } } - }); + }( jQuery, jQuery.ui.accordion.prototype ) ); - }, - drag: function(event, ui) { + // icon options + (function( $, prototype ) { + $.extend( prototype.options.icons, { + activeHeader: null, // remove default so we fall back to old values + headerSelected: "ui-icon-triangle-1-s" + }); - var inst = $(this).data("draggable"), self = this; + var _createIcons = prototype._createIcons; + prototype._createIcons = function() { + if ( this.options.icons ) { + this.options.icons.activeHeader = this.options.icons.activeHeader || + this.options.icons.headerSelected; + } + _createIcons.call( this ); + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); - var checkPos = function(o) { - var dyClick = this.offset.click.top, dxClick = this.offset.click.left; - var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; - var itemHeight = o.height, itemWidth = o.width; - var itemTop = o.top, itemLeft = o.left; + // expanded active option, activate method + (function( $, prototype ) { + prototype.activate = prototype._activate; - return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + var _findActive = prototype._findActive; + prototype._findActive = function( index ) { + if ( index === -1 ) { + index = false; + } + if ( index && typeof index !== "number" ) { + index = this.headers.index( this.headers.filter( index ) ); + if ( index === -1 ) { + index = false; + } + } + return _findActive.call( this, index ); }; + }( jQuery, jQuery.ui.accordion.prototype ) ); - $.each(inst.sortables, function(i) { - - //Copy over some variables to allow calling the sortable's native _intersectsWith - this.instance.positionAbs = inst.positionAbs; - this.instance.helperProportions = inst.helperProportions; - this.instance.offset.click = inst.offset.click; - - if(this.instance._intersectsWith(this.instance.containerCache)) { + // resize method + jQuery.ui.accordion.prototype.resize = jQuery.ui.accordion.prototype.refresh; - //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once - if(!this.instance.isOver) { + // change events + (function( $, prototype ) { + $.extend( prototype.options, { + change: null, + changestart: null + }); - this.instance.isOver = 1; - //Now we fake the start of dragging for the sortable instance, - //by cloning the list group item, appending it to the sortable and using it as inst.currentItem - //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) - this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); - this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it - this.instance.options.helper = function() { return ui.helper[0]; }; + var _trigger = prototype._trigger; + prototype._trigger = function( type, event, data ) { + var ret = _trigger.apply( this, arguments ); + if ( !ret ) { + return false; + } - event.target = this.instance.currentItem[0]; - this.instance._mouseCapture(event, true); - this.instance._mouseStart(event, true, true); + if ( type === "beforeActivate" ) { + ret = _trigger.call( this, "changestart", event, { + oldHeader: data.oldHeader, + oldContent: data.oldPanel, + newHeader: data.newHeader, + newContent: data.newPanel + }); + } else if ( type === "activate" ) { + ret = _trigger.call( this, "change", event, { + oldHeader: data.oldHeader, + oldContent: data.oldPanel, + newHeader: data.newHeader, + newContent: data.newPanel + }); + } + return ret; + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); + + // animated option + // NOTE: this only provides support for "slide", "bounceslide", and easings + // not the full $.ui.accordion.animations API + (function( $, prototype ) { + $.extend( prototype.options, { + animate: null, + animated: "slide" + }); - //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes - this.instance.offset.click.top = inst.offset.click.top; - this.instance.offset.click.left = inst.offset.click.left; - this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; - this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + var _create = prototype._create; + prototype._create = function() { + var options = this.options; + if ( options.animate === null ) { + if ( !options.animated ) { + options.animate = false; + } else if ( options.animated === "slide" ) { + options.animate = 300; + } else if ( options.animated === "bounceslide" ) { + options.animate = { + duration: 200, + down: { + easing: "easeOutBounce", + duration: 1000 + } + }; + } else { + options.animate = options.animated; + } + } - inst._trigger("toSortable", event); - inst.dropped = this.instance.element; //draggable revert needs that - //hack so receive/update callbacks work (mostly) - inst.currentItem = inst.element; - this.instance.fromOutside = inst; + _create.call( this ); + }; + }( jQuery, jQuery.ui.accordion.prototype ) ); +} - } +})( jQuery ); +(function( $, undefined ) { - //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable - if(this.instance.currentItem) this.instance._mouseDrag(event); +// used to prevent race conditions with remote data sources +var requestIndex = 0; - } else { +$.widget( "ui.autocomplete", { + version: "1.9.2", + defaultElement: "", + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null, - //If it doesn't intersect with the sortable, and it intersected before, - //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval - if(this.instance.isOver) { + // callbacks + change: null, + close: null, + focus: null, + open: null, + response: null, + search: null, + select: null + }, - this.instance.isOver = 0; - this.instance.cancelHelperRemoval = true; - - //Prevent reverting on this forced stop - this.instance.options.revert = false; - - // The out event needs to be triggered independently - this.instance._trigger('out', event, this.instance._uiHash(this.instance)); - - this.instance._mouseStop(event, true); - this.instance.options.helper = this.instance.options._helper; + pending: 0, - //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size - this.instance.currentItem.remove(); - if(this.instance.placeholder) this.instance.placeholder.remove(); + _create: function() { + // Some browsers only repeat keydown events, not keypress events, + // so we use the suppressKeyPress flag to determine if we've already + // handled the keydown event. #7269 + // Unfortunately the code for & in keypress is the same as the up arrow, + // so we use the suppressKeyPressRepeat flag to avoid handling keypress + // events when we know the keydown event was used to modify the + // search term. #7799 + var suppressKeyPress, suppressKeyPressRepeat, suppressInput; + + this.isMultiLine = this._isMultiLine(); + this.valueMethod = this.element[ this.element.is( "input,textarea" ) ? "val" : "text" ]; + this.isNewMenu = true; - inst._trigger("fromSortable", event); - inst.dropped = false; //draggable revert needs that + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ); + + this._on( this.element, { + keydown: function( event ) { + if ( this.element.prop( "readOnly" ) ) { + suppressKeyPress = true; + suppressInput = true; + suppressKeyPressRepeat = true; + return; } - }; + suppressKeyPress = false; + suppressInput = false; + suppressKeyPressRepeat = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + suppressKeyPress = true; + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + suppressKeyPress = true; + this._move( "nextPage", event ); + break; + case keyCode.UP: + suppressKeyPress = true; + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + suppressKeyPress = true; + this._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( this.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + this.menu.select( event ); + } + break; + case keyCode.TAB: + if ( this.menu.active ) { + this.menu.select( event ); + } + break; + case keyCode.ESCAPE: + if ( this.menu.element.is( ":visible" ) ) { + this._value( this.term ); + this.close( event ); + // Different browsers have different default behavior for escape + // Single press can mean undo or clear + // Double press in IE means clear the whole form + event.preventDefault(); + } + break; + default: + suppressKeyPressRepeat = true; + // search timeout should be triggered before the input value is changed + this._searchTimeout( event ); + break; + } + }, + keypress: function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + return; + } + if ( suppressKeyPressRepeat ) { + return; + } + + // replicate some key handlers to allow them to repeat in Firefox and Opera + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + this._move( "nextPage", event ); + break; + case keyCode.UP: + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + this._keyEvent( "next", event ); + break; + } + }, + input: function( event ) { + if ( suppressInput ) { + suppressInput = false; + event.preventDefault(); + return; + } + this._searchTimeout( event ); + }, + focus: function() { + this.selectedItem = null; + this.previous = this._value(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + clearTimeout( this.searching ); + this.close( event ); + this._change( event ); + } }); - } -}); + this._initSource(); + this.menu = $( "
      " ) + .addClass( "ui-autocomplete" ) + .appendTo( this.document.find( this.options.appendTo || "body" )[ 0 ] ) + .menu({ + // custom key handling for now + input: $(), + // disable ARIA support, the live region takes care of that + role: null + }) + .zIndex( this.element.zIndex() + 1 ) + .hide() + .data( "menu" ); -$.ui.plugin.add("draggable", "cursor", { - start: function(event, ui) { - var t = $('body'), o = $(this).data('draggable').options; - if (t.css("cursor")) o._cursor = t.css("cursor"); - t.css("cursor", o.cursor); - }, - stop: function(event, ui) { - var o = $(this).data('draggable').options; - if (o._cursor) $('body').css("cursor", o._cursor); - } -}); + this._on( this.menu.element, { + mousedown: function( event ) { + // prevent moving focus out of the text field + event.preventDefault(); -$.ui.plugin.add("draggable", "opacity", { - start: function(event, ui) { - var t = $(ui.helper), o = $(this).data('draggable').options; - if(t.css("opacity")) o._opacity = t.css("opacity"); - t.css('opacity', o.opacity); - }, - stop: function(event, ui) { - var o = $(this).data('draggable').options; - if(o._opacity) $(ui.helper).css('opacity', o._opacity); - } -}); + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + }); -$.ui.plugin.add("draggable", "scroll", { - start: function(event, ui) { - var i = $(this).data("draggable"); - if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); - }, - drag: function(event, ui) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = this.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + this._delay(function() { + var that = this; + this.document.one( "mousedown", function( event ) { + if ( event.target !== that.element[ 0 ] && + event.target !== menuElement && + !$.contains( menuElement, event.target ) ) { + that.close(); + } + }); + }); + } + }, + menufocus: function( event, ui ) { + // #7024 - Prevent accidental activation of menu items in Firefox + if ( this.isNewMenu ) { + this.isNewMenu = false; + if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) { + this.menu.blur(); + + this.document.one( "mousemove", function() { + $( event.target ).trigger( event.originalEvent ); + }); - var i = $(this).data("draggable"), o = i.options, scrolled = false; + return; + } + } - if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + // back compat for _renderItem using item.autocomplete, via #7810 + // TODO remove the fallback, see #8156 + var item = ui.item.data( "ui-autocomplete-item" ) || ui.item.data( "item.autocomplete" ); + if ( false !== this._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) { + this._value( item.value ); + } + } else { + // Normally the input is populated with the item's value as the + // menu is navigated, causing screen readers to notice a change and + // announce the item. Since the focus event was canceled, this doesn't + // happen, so we update the live region so that screen readers can + // still notice the change and announce it. + this.liveRegion.text( item.value ); + } + }, + menuselect: function( event, ui ) { + // back compat for _renderItem using item.autocomplete, via #7810 + // TODO remove the fallback, see #8156 + var item = ui.item.data( "ui-autocomplete-item" ) || ui.item.data( "item.autocomplete" ), + previous = this.previous; + + // only trigger when focus was lost (click on menu) + if ( this.element[0] !== this.document[0].activeElement ) { + this.element.focus(); + this.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + this._delay(function() { + this.previous = previous; + this.selectedItem = item; + }); + } - if(!o.axis || o.axis != 'x') { - if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) - i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; - else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) - i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; - } + if ( false !== this._trigger( "select", event, { item: item } ) ) { + this._value( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + this.term = this._value(); - if(!o.axis || o.axis != 'y') { - if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) - i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; - else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) - i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + this.close( event ); + this.selectedItem = item; } + }); - } else { + this.liveRegion = $( "", { + role: "status", + "aria-live": "polite" + }) + .addClass( "ui-helper-hidden-accessible" ) + .insertAfter( this.element ); - if(!o.axis || o.axis != 'x') { - if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) - scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); - else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) - scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); - } + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } - if(!o.axis || o.axis != 'y') { - if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) - scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); - else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) - scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); } + }); + }, + + _destroy: function() { + clearTimeout( this.searching ); + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ); + this.menu.element.remove(); + this.liveRegion.remove(); + }, + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( this.document.find( value || "body" )[0] ); + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); } + }, - if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) - $.ui.ddmanager.prepareOffsets(i, event); + _isMultiLine: function() { + // Textareas are always multi-line + if ( this.element.is( "textarea" ) ) { + return true; + } + // Inputs are always single-line, even if inside a contentEditable element + // IE also treats inputs as contentEditable + if ( this.element.is( "input" ) ) { + return false; + } + // All other element types are determined by whether or not they're contentEditable + return this.element.prop( "isContentEditable" ); + }, - } -}); + _initSource: function() { + var array, url, + that = this; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter( array, request.term ) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( that.xhr ) { + that.xhr.abort(); + } + that.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, -$.ui.plugin.add("draggable", "snap", { - start: function(event, ui) { + _searchTimeout: function( event ) { + clearTimeout( this.searching ); + this.searching = this._delay(function() { + // only search if the value has changed + if ( this.term !== this._value() ) { + this.selectedItem = null; + this.search( null, event ); + } + }, this.options.delay ); + }, - var i = $(this).data("draggable"), o = i.options; - i.snapElements = []; + search: function( value, event ) { + value = value != null ? value : this._value(); - $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { - var $t = $(this); var $o = $t.offset(); - if(this != i.element[0]) i.snapElements.push({ - item: this, - width: $t.outerWidth(), height: $t.outerHeight(), - top: $o.top, left: $o.left - }); - }); + // always save the actual value, not the one passed as an argument + this.term = this._value(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + if ( this._trigger( "search", event ) === false ) { + return; + } + return this._search( value ); }, - drag: function(event, ui) { - var inst = $(this).data("draggable"), o = inst.options; - var d = o.snapTolerance; + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + this.cancelSearch = false; - var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, - y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + this.source( { term: value }, this._response() ); + }, - for (var i = inst.snapElements.length - 1; i >= 0; i--){ + _response: function() { + var that = this, + index = ++requestIndex; - var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, - t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } - //Yes, I know, this is insane ;) - if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { - if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); - inst.snapElements[i].snapping = false; - continue; + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); } + }; + }, - if(o.snapMode != 'inner') { - var ts = Math.abs(t - y2) <= d; - var bs = Math.abs(b - y1) <= d; - var ls = Math.abs(l - x2) <= d; - var rs = Math.abs(r - x1) <= d; - if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; - if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; - if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; - if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; - } - - var first = (ts || bs || ls || rs); - - if(o.snapMode != 'outer') { - var ts = Math.abs(t - y1) <= d; - var bs = Math.abs(b - y2) <= d; - var ls = Math.abs(l - x1) <= d; - var rs = Math.abs(r - x2) <= d; - if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; - if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; - if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; - if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; - } - - if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) - (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); - inst.snapElements[i].snapping = (ts || bs || ls || rs || first); - - }; + __response: function( content ) { + if ( content ) { + content = this._normalize( content ); + } + this._trigger( "response", null, { content: content } ); + if ( !this.options.disabled && content && content.length && !this.cancelSearch ) { + this._suggest( content ); + this._trigger( "open" ); + } else { + // use ._close() instead of .close() so we don't cancel future searches + this._close(); + } + }, - } -}); + close: function( event ) { + this.cancelSearch = true; + this._close( event ); + }, -$.ui.plugin.add("draggable", "stack", { - start: function(event, ui) { + _close: function( event ) { + if ( this.menu.element.is( ":visible" ) ) { + this.menu.element.hide(); + this.menu.blur(); + this.isNewMenu = true; + this._trigger( "close", event ); + } + }, - var o = $(this).data("draggable").options; + _change: function( event ) { + if ( this.previous !== this._value() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, - var group = $.makeArray($(o.stack)).sort(function(a,b) { - return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); - }); - if (!group.length) { return; } - - var min = parseInt(group[0].style.zIndex) || 0; - $(group).each(function(i) { - this.style.zIndex = min + i; + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function( item ) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); }); + }, - this[0].style.zIndex = min + group.length; + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + this.menu.refresh(); - } -}); + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); -$.ui.plugin.add("draggable", "zIndex", { - start: function(event, ui) { - var t = $(ui.helper), o = $(this).data("draggable").options; - if(t.css("zIndex")) o._zIndex = t.css("zIndex"); - t.css('zIndex', o.zIndex); + if ( this.options.autoFocus ) { + this.menu.next(); + } }, - stop: function(event, ui) { - var o = $(this).data("draggable").options; - if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); - } -}); - -})(jQuery); -/* - * jQuery UI Droppable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Droppables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.mouse.js - * jquery.ui.draggable.js - */ -(function( $, undefined ) { -$.widget("ui.droppable", { - widgetEventPrefix: "drop", - options: { - accept: '*', - activeClass: false, - addClasses: true, - greedy: false, - hoverClass: false, - scope: 'default', - tolerance: 'intersect' + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); }, - _create: function() { - - var o = this.options, accept = o.accept; - this.isover = 0; this.isout = 1; - - this.accept = $.isFunction(accept) ? accept : function(d) { - return d.is(accept); - }; - - //Store the droppable's proportions - this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; - - // Add the reference and positions to the manager - $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; - $.ui.ddmanager.droppables[o.scope].push(this); - - (o.addClasses && this.element.addClass("ui-droppable")); + _renderMenu: function( ul, items ) { + var that = this; + $.each( items, function( index, item ) { + that._renderItemData( ul, item ); + }); }, - destroy: function() { - var drop = $.ui.ddmanager.droppables[this.options.scope]; - for ( var i = 0; i < drop.length; i++ ) - if ( drop[i] == this ) - drop.splice(i, 1); - - this.element - .removeClass("ui-droppable ui-droppable-disabled") - .removeData("droppable") - .unbind(".droppable"); - - return this; + _renderItemData: function( ul, item ) { + return this._renderItem( ul, item ).data( "ui-autocomplete-item", item ); }, - _setOption: function(key, value) { + _renderItem: function( ul, item ) { + return $( "
    • " ) + .append( $( "" ).text( item.label ) ) + .appendTo( ul ); + }, - if(key == 'accept') { - this.accept = $.isFunction(value) ? value : function(d) { - return d.is(value); - }; + _move: function( direction, event ) { + if ( !this.menu.element.is( ":visible" ) ) { + this.search( null, event ); + return; } - $.Widget.prototype._setOption.apply(this, arguments); + if ( this.menu.isFirstItem() && /^previous/.test( direction ) || + this.menu.isLastItem() && /^next/.test( direction ) ) { + this._value( this.term ); + this.menu.blur(); + return; + } + this.menu[ direction ]( event ); }, - _activate: function(event) { - var draggable = $.ui.ddmanager.current; - if(this.options.activeClass) this.element.addClass(this.options.activeClass); - (draggable && this._trigger('activate', event, this.ui(draggable))); + widget: function() { + return this.menu.element; }, - _deactivate: function(event) { - var draggable = $.ui.ddmanager.current; - if(this.options.activeClass) this.element.removeClass(this.options.activeClass); - (draggable && this._trigger('deactivate', event, this.ui(draggable))); + _value: function() { + return this.valueMethod.apply( this.element, arguments ); }, - _over: function(event) { - - var draggable = $.ui.ddmanager.current; - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); - if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { - if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); - this._trigger('over', event, this.ui(draggable)); + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); } + } +}); +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"); }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); - _out: function(event) { - - var draggable = $.ui.ddmanager.current; - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element - if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { - if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); - this._trigger('out', event, this.ui(draggable)); +// live region extension, adding a `messages` option +// NOTE: This is an experimental API. We are still investigating +// a full solution for string manipulation and internationalization. +$.widget( "ui.autocomplete", $.ui.autocomplete, { + options: { + messages: { + noResults: "No search results.", + results: function( amount ) { + return amount + ( amount > 1 ? " results are" : " result is" ) + + " available, use up and down arrow keys to navigate."; + } } - }, - _drop: function(event,custom) { - - var draggable = custom || $.ui.ddmanager.current; - if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element - - var childrenIntersection = false; - this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { - var inst = $.data(this, 'droppable'); - if( - inst.options.greedy - && !inst.options.disabled - && inst.options.scope == draggable.options.scope - && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) - && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) - ) { childrenIntersection = true; return false; } - }); - if(childrenIntersection) return false; - - if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { - if(this.options.activeClass) this.element.removeClass(this.options.activeClass); - if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); - this._trigger('drop', event, this.ui(draggable)); - return this.element; + __response: function( content ) { + var message; + this._superApply( arguments ); + if ( this.options.disabled || this.cancelSearch ) { + return; } - - return false; - - }, - - ui: function(c) { - return { - draggable: (c.currentItem || c.element), - helper: c.helper, - position: c.position, - offset: c.positionAbs - }; + if ( content && content.length ) { + message = this.options.messages.results( content.length ); + } else { + message = this.options.messages.noResults; + } + this.liveRegion.text( message ); } - -}); - -$.extend($.ui.droppable, { - version: "1.8.16" }); -$.ui.intersect = function(draggable, droppable, toleranceMode) { - - if (!droppable.offset) return false; - var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, - y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; - var l = droppable.offset.left, r = l + droppable.proportions.width, - t = droppable.offset.top, b = t + droppable.proportions.height; +}( jQuery )); +(function( $, undefined ) { - switch (toleranceMode) { - case 'fit': - return (l <= x1 && x2 <= r - && t <= y1 && y2 <= b); - break; - case 'intersect': - return (l < x1 + (draggable.helperProportions.width / 2) // Right Half - && x2 - (draggable.helperProportions.width / 2) < r // Left Half - && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half - && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half - break; - case 'pointer': - var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), - draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), - isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); - return isOver; - break; - case 'touch': - return ( - (y1 >= t && y1 <= b) || // Top edge touching - (y2 >= t && y2 <= b) || // Bottom edge touching - (y1 < t && y2 > b) // Surrounded vertically - ) && ( - (x1 >= l && x1 <= r) || // Left edge touching - (x2 >= l && x2 <= r) || // Right edge touching - (x1 < l && x2 > r) // Surrounded horizontally - ); - break; - default: - return false; - break; +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } } + return radios; + }; -}; +$.widget( "ui.button", { + version: "1.9.2", + defaultElement: "').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); } - - //Store needed variables - this.offset = this.helper.offset(); - this.position = { left: curleft, top: curtop }; - this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; - this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; - this.originalPosition = { left: curleft, top: curtop }; - this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; - this.originalMousePosition = { left: event.pageX, top: event.pageY }; - - //Aspect Ratio - this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); - - var cursor = $('.ui-resizable-' + this.axis).css('cursor'); - $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); - - el.addClass("ui-resizable-resizing"); - this._propagate("start", event); - return true; }, - _mouseDrag: function(event) { - - //Increase performance, avoid regex - var el = this.helper, o = this.options, props = {}, - self = this, smp = this.originalMousePosition, a = this.axis; - - var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; - var trigger = this._change[a]; - if (!trigger) return false; - - // Calculate the attrs that will be change - var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; - - // Put this in the mouseDrag handler since the user can start pressing shift while resizing - this._updateVirtualBoundaries(event.shiftKey); - if (this._aspectRatio || event.shiftKey) - data = this._updateRatio(data, event); - - data = this._respectSize(data, event); - - // plugins callbacks need to be called first - this._propagate("resize", event); - - el.css({ - top: this.position.top + "px", left: this.position.left + "px", - width: this.size.width + "px", height: this.size.height + "px" - }); - - if (!this._helper && this._proportionallyResizeElements.length) - this._proportionallyResize(); - - this._updateCache(data); - - // calling the user callback at the end - this._trigger('resize', event, this.ui()); - - return false; + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } }, - _mouseStop: function(event) { - - this.resizing = false; - var o = this.options, self = this; - - if(this._helper) { - var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), - soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, - soffsetw = ista ? 0 : self.sizeDiff.width; - - var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, - left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, - top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; - - if (!o.animate) - this.element.css($.extend(s, { top: top, left: left })); - - self.helper.height(self.size.height); - self.helper.width(self.size.width); - - if (this._helper && !o.animate) this._proportionallyResize(); + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); } - - $('body').css('cursor', 'auto'); - - this.element.removeClass("ui-resizable-resizing"); - - this._propagate("stop", event); - - if (this._helper) this.helper.remove(); - return false; - + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); }, - _updateVirtualBoundaries: function(forceAspectRatio) { - var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; - - b = { - minWidth: isNumber(o.minWidth) ? o.minWidth : 0, - maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, - minHeight: isNumber(o.minHeight) ? o.minHeight : 0, - maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity - }; - - if(this._aspectRatio || forceAspectRatio) { - // We want to create an enclosing box whose aspect ration is the requested one - // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension - pMinWidth = b.minHeight * this.aspectRatio; - pMinHeight = b.minWidth / this.aspectRatio; - pMaxWidth = b.maxHeight * this.aspectRatio; - pMaxHeight = b.maxWidth / this.aspectRatio; + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $(''); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); - if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; - if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; - if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; - if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; - } - this._vBoundaries = b; - }, + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } - _updateCache: function(data) { - var o = this.options; - this.offset = this.helper.offset(); - if (isNumber(data.left)) this.position.left = data.left; - if (isNumber(data.top)) this.position.top = data.top; - if (isNumber(data.height)) this.size.height = data.height; - if (isNumber(data.width)) this.size.width = data.width; + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; }, - _updateRatio: function(data, event) { - - var o = this.options, cpos = this.position, csize = this.size, a = this.axis; - - if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); - else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, - if (a == 'sw') { - data.left = cpos.left + (csize.width - data.width); - data.top = null; + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; } - if (a == 'nw') { - data.top = cpos.top + (csize.height - data.height); - data.left = cpos.left + (csize.width - data.width); + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); } - - return data; + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", false); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry }, - _respectSize: function(data, event) { - - var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, - ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), - isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); - - if (isminw) data.width = o.minWidth; - if (isminh) data.height = o.minHeight; - if (ismaxw) data.width = o.maxWidth; - if (ismaxh) data.height = o.maxHeight; - - var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; - var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); - - if (isminw && cw) data.left = dw - o.minWidth; - if (ismaxw && cw) data.left = dw - o.maxWidth; - if (isminh && ch) data.top = dh - o.minHeight; - if (ismaxh && ch) data.top = dh - o.maxHeight; - - // fixing jump error on top/left - bug #2330 - var isNotwh = !data.width && !data.height; - if (isNotwh && !data.left && data.top) data.top = null; - else if (isNotwh && !data.top && data.left) data.left = null; - - return data; + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", true); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; }, - _proportionallyResize: function() { - - var o = this.options; - if (!this._proportionallyResizeElements.length) return; - var element = this.helper || this.element; - - for (var i=0; i < this._proportionallyResizeElements.length; i++) { - - var prel = this._proportionallyResizeElements[i]; + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, - if (!this.borderDif) { - var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], - p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, - this.borderDif = $.map(b, function(v, i) { - var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; - return border + padding; - }); + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); } - - if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) - continue; - - prel.css({ - height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, - width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 - }); - - }; - + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } }, - _renderProxy: function() { - - var el = this.element, o = this.options; - this.elementOffset = el.offset(); - - if(this._helper) { - - this.helper = this.helper || $('
      '); - - // fix ie6 offset TODO: This seems broken - var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), - pxyoffset = ( ie6 ? 2 : -1 ); - - this.helper.addClass(this._helper).css({ - width: this.element.outerWidth() + pxyoffset, - height: this.element.outerHeight() + pxyoffset, - position: 'absolute', - left: this.elementOffset.left - ie6offset +'px', - top: this.elementOffset.top - ie6offset +'px', - zIndex: ++o.zIndex //TODO: Don't modify option - }); - - this.helper - .appendTo("body") - .disableSelection(); + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, - } else { - this.helper = this.element; + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); } - }, - _change: { - e: function(event, dx, dy) { - return { width: this.originalSize.width + dx }; - }, - w: function(event, dx, dy) { - var o = this.options, cs = this.originalSize, sp = this.originalPosition; - return { left: sp.left + dx, width: cs.width - dx }; - }, - n: function(event, dx, dy) { - var o = this.options, cs = this.originalSize, sp = this.originalPosition; - return { top: sp.top + dy, height: cs.height - dy }; - }, - s: function(event, dx, dy) { - return { height: this.originalSize.height + dy }; - }, - se: function(event, dx, dy) { - return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); - }, - sw: function(event, dx, dy) { - return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); - }, - ne: function(event, dx, dy) { - return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); - }, - nw: function(event, dx, dy) { - return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); } }, - _propagate: function(n, event) { - $.ui.plugin.call(this, n, [event, this.ui()]); - (n != "resize" && this._trigger(n, event, this.ui())); + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); }, - plugins: {}, - - ui: function() { - return { - originalElement: this.originalElement, - element: this.element, - helper: this.helper, - position: this.position, - size: this.size, - originalSize: this.originalSize, - originalPosition: this.originalPosition - }; - } - -}); - -$.extend($.ui.resizable, { - version: "1.8.16" -}); - -/* - * Resizable Extensions - */ - -$.ui.plugin.add("resizable", "alsoResize", { + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); - start: function (event, ui) { - var self = $(this).data("resizable"), o = self.options; - - var _store = function (exp) { - $(exp).each(function() { - var el = $(this); - el.data("resizable-alsoresize", { - width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), - left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), - position: el.css('position') // to reset Opera on stop() - }); - }); - }; - - if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { - if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } - else { $.each(o.alsoResize, function (exp) { _store(exp); }); } - }else{ - _store(o.alsoResize); + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; } - }, - - resize: function (event, ui) { - var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; - - var delta = { - height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, - top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 - }, - - _alsoResize = function (exp, c) { - $(exp).each(function() { - var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, - css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; - - $.each(css, function (i, prop) { - var sum = (start[prop]||0) + (delta[prop]||0); - if (sum && sum >= 0) - style[prop] = sum || null; - }); - - // Opera fixing relative position - if ($.browser.opera && /relative/.test(el.css('position'))) { - self._revertToRelativePosition = true; - el.css({ position: 'absolute', top: 'auto', left: 'auto' }); - } - - el.css(style); - }); - }; - - if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { - $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); - }else{ - _alsoResize(o.alsoResize); + if (handled) { + event.preventDefault(); + event.stopPropagation(); } }, - stop: function (event, ui) { - var self = $(this).data("resizable"), o = self.options; - - var _reset = function (exp) { - $(exp).each(function() { - var el = $(this); - // reset position for Opera - no need to verify it was changed - el.css({ position: el.data("resizable-alsoresize").position }); - }); - }; - - if (self._revertToRelativePosition) { - self._revertToRelativePosition = false; - if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { - $.each(o.alsoResize, function (exp) { _reset(exp); }); - }else{ - _reset(o.alsoResize); - } + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); } + }, - $(this).removeData("resizable-alsoresize"); - } -}); - -$.ui.plugin.add("resizable", "animate", { - - stop: function(event, ui) { - var self = $(this).data("resizable"), o = self.options; - - var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), - soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, - soffsetw = ista ? 0 : self.sizeDiff.width; - - var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, - left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, - top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; - - self.element.animate( - $.extend(style, top && left ? { top: top, left: left } : {}), { - duration: o.animateDuration, - easing: o.animateEasing, - step: function() { - - var data = { - width: parseInt(self.element.css('width'), 10), - height: parseInt(self.element.css('height'), 10), - top: parseInt(self.element.css('top'), 10), - left: parseInt(self.element.css('left'), 10) - }; - - if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); - - // propagating resize, and updating values for each animation step - self._updateCache(data); - self._propagate("resize", event); - + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); } } - ); - } - -}); - -$.ui.plugin.add("resizable", "containment", { - - start: function(event, ui) { - var self = $(this).data("resizable"), o = self.options, el = self.element; - var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; - if (!ce) return; - - self.containerElement = $(ce); - - if (/document/.test(oc) || oc == document) { - self.containerOffset = { left: 0, top: 0 }; - self.containerPosition = { left: 0, top: 0 }; - - self.parentData = { - element: $(document), left: 0, top: 0, - width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight - }; - } - - // i'm a node, so compute top, left, right, bottom - else { - var element = $(ce), p = []; - $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); - - self.containerOffset = element.offset(); - self.containerPosition = element.position(); - self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; - - var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, - width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); - - self.parentData = { - element: ce, left: co.left, top: co.top, width: width, height: height - }; + catch (err) { + $.datepicker.log(err); + } } + return true; }, - resize: function(event, ui) { - var self = $(this).data("resizable"), o = self.options, - ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, - pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; - - if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; - - if (cp.left < (self._helper ? co.left : 0)) { - self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); - if (pRatio) self.size.height = self.size.width / o.aspectRatio; - self.position.left = o.helper ? co.left : 0; + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } } - - if (cp.top < (self._helper ? co.top : 0)) { - self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); - if (pRatio) self.size.width = self.size.height * o.aspectRatio; - self.position.top = self._helper ? co.top : 0; + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; } - - self.offset.left = self.parentData.left+self.position.left; - self.offset.top = self.parentData.top+self.position.top; - - var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), - hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); - - var isParent = self.containerElement.get(0) == self.element.parent().get(0), - isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); - - if(isParent && isOffsetRelative) woset -= self.parentData.left; - - if (woset + self.size.width >= self.parentData.width) { - self.size.width = self.parentData.width - woset; - if (pRatio) self.size.height = self.size.width / self.aspectRatio; + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; - if (hoset + self.size.height >= self.parentData.height) { - self.size.height = self.parentData.height - hoset; - if (pRatio) self.size.width = self.size.height * self.aspectRatio; + // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed + if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; } }, - stop: function(event, ui){ - var self = $(this).data("resizable"), o = self.options, cp = self.position, - co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; - - var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; - - if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) - $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + this.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, - if (self._helper && !o.animate && (/static/).test(ce.css('position'))) - $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, - } -}); + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); + var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); -$.ui.plugin.add("resizable", "ghost", { + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; - start: function(event, ui) { + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); - var self = $(this).data("resizable"), o = self.options, cs = self.size; + return offset; + }, - self.ghost = self.originalElement.clone(); - self.ghost - .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) - .addClass('ui-resizable-ghost') - .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, - self.ghost.appendTo(self.helper); + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed + if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } }, - resize: function(event, ui){ - var self = $(this).data("resizable"), o = self.options; - if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); }, - stop: function(event, ui){ - var self = $(this).data("resizable"), o = self.options; - if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); - } - -}); + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; -$.ui.plugin.add("resizable", "grid", { + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); - resize: function(event, ui) { - var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; - o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; - var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, - if (/^(se|s|e)$/.test(a)) { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - } - else if (/^(ne)$/.test(a)) { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - self.position.top = op.top - oy; + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; } - else if (/^(sw)$/.test(a)) { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - self.position.left = op.left - ox; + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; } else { - self.size.width = os.width + ox; - self.size.height = os.height + oy; - self.position.top = op.top - oy; - self.position.left = op.left - ox; + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); } - } - -}); + this._notifyChange(inst); + this._adjustDate(target); + }, -var num = function(v) { - return parseInt(v, 10) || 0; -}; + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, -var isNumber = function(value) { - return !isNaN(parseInt(value, 10)); -}; + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, -})(jQuery); -/* - * jQuery UI Selectable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, -$.widget("ui.selectable", $.ui.mouse, { - options: { - appendTo: 'body', - autoRefresh: true, - distance: 0, - filter: '*', - tolerance: 'touch' + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } }, - _create: function() { - var self = this; - this.element.addClass("ui-selectable"); + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, - this.dragged = false; + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, - // cache selectee children based on filter - var selectees; - this.refresh = function() { - selectees = $(self.options.filter, self.element[0]); - selectees.each(function() { - var $this = $(this); - var pos = $this.offset(); - $.data(this, "selectable-item", { - element: this, - $element: $this, - left: pos.left, - top: pos.top, - right: pos.left + $this.outerWidth(), - bottom: pos.top + $this.outerHeight(), - startselected: false, - selected: $this.hasClass('ui-selected'), - selecting: $this.hasClass('ui-selecting'), - unselecting: $this.hasClass('ui-unselecting') - }); + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + var extra = value.substr(iValue); + if (!/^\s+/.test(extra)) { + throw "Extra/unparsed characters found in date: " + extra; + } + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, 'stepMonths'); + var id = '#' + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find('[data-handler]').map(function () { + var handler = { + prev: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); + }, + next: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); + }, + hide: function () { + window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); + return false; + }, + selectMonth: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); + return false; + }, + selectYear: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); + return false; + } + }; + $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '
      ' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
      ' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
      ' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
      '; + } + calender += '
      ' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
      ' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
      ' + this._get(inst, 'weekHeader') + '
      ' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
      ' + (isMultiMonth ? '
      ' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
      ' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.ui.ie6 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
      '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
      '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.delegate(selector, 'mouseout', function() { + $(this).removeClass('ui-state-hover'); + if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover'); + if (this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover'); + }) + .delegate(selector, 'mouseover', function(){ + if (!$.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) { + $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + $(this).addClass('ui-state-hover'); + if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover'); + if (this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover'); + } + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find(document.body).append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.9.2"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +(function( $, undefined ) { + +var uiDialogClasses = "ui-dialog ui-widget ui-widget-content ui-corner-all ", + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + version: "1.9.2", + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: "close", + dialogClass: "", + draggable: true, + hide: null, + height: "auto", + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: "center", + at: "center", + of: window, + collision: "fit", + // ensure that the titlebar is never outside the document + using: function( pos ) { + var topOffset = $( this ).css( pos ).offset().top; + if ( topOffset < 0 ) { + $( this ).css( "top", pos.top - topOffset ); + } + } + }, + resizable: true, + show: null, + stack: true, + title: "", + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr( "title" ); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + this.oldPosition = { + parent: this.element.parent(), + index: this.element.parent().children().index( this.element ) + }; + this.options.title = this.options.title || this.originalTitle; + var that = this, + options = this.options, + + title = options.title || " ", + uiDialog, + uiDialogTitlebar, + uiDialogTitlebarClose, + uiDialogTitle, + uiDialogButtonPane; + + uiDialog = ( this.uiDialog = $( "
      " ) ) + .addClass( uiDialogClasses + options.dialogClass ) + .css({ + display: "none", + outline: 0, // TODO: move to stylesheet + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + .attr( "tabIndex", -1) + .keydown(function( event ) { + if ( options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE ) { + that.close( event ); + event.preventDefault(); + } + }) + .mousedown(function( event ) { + that.moveToTop( false, event ); + }) + .appendTo( "body" ); + + this.element + .show() + .removeAttr( "title" ) + .addClass( "ui-dialog-content ui-widget-content" ) + .appendTo( uiDialog ); + + uiDialogTitlebar = ( this.uiDialogTitlebar = $( "
      " ) ) + .addClass( "ui-dialog-titlebar ui-widget-header " + + "ui-corner-all ui-helper-clearfix" ) + .bind( "mousedown", function() { + // Dialog isn't getting focus when dragging (#8063) + uiDialog.focus(); + }) + .prependTo( uiDialog ); + + uiDialogTitlebarClose = $( "" ) + .addClass( "ui-dialog-titlebar-close ui-corner-all" ) + .attr( "role", "button" ) + .click(function( event ) { + event.preventDefault(); + that.close( event ); + }) + .appendTo( uiDialogTitlebar ); + + ( this.uiDialogTitlebarCloseText = $( "" ) ) + .addClass( "ui-icon ui-icon-closethick" ) + .text( options.closeText ) + .appendTo( uiDialogTitlebarClose ); + + uiDialogTitle = $( "" ) + .uniqueId() + .addClass( "ui-dialog-title" ) + .html( title ) + .prependTo( uiDialogTitlebar ); + + uiDialogButtonPane = ( this.uiDialogButtonPane = $( "
      " ) ) + .addClass( "ui-dialog-buttonpane ui-widget-content ui-helper-clearfix" ); + + ( this.uiButtonSet = $( "
      " ) ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + uiDialog.attr({ + role: "dialog", + "aria-labelledby": uiDialogTitle.attr( "id" ) + }); + + uiDialogTitlebar.find( "*" ).add( uiDialogTitlebar ).disableSelection(); + this._hoverable( uiDialogTitlebarClose ); + this._focusable( uiDialogTitlebarClose ); + + if ( options.draggable && $.fn.draggable ) { + this._makeDraggable(); + } + if ( options.resizable && $.fn.resizable ) { + this._makeResizable(); + } + + this._createButtons( options.buttons ); + this._isOpen = false; + + if ( $.fn.bgiframe ) { + uiDialog.bgiframe(); + } + + // prevent tabbing out of modal dialogs + this._on( uiDialog, { keydown: function( event ) { + if ( !options.modal || event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $( ":tabbable", uiDialog ), + first = tabbables.filter( ":first" ), + last = tabbables.filter( ":last" ); + + if ( event.target === last[0] && !event.shiftKey ) { + first.focus( 1 ); + return false; + } else if ( event.target === first[0] && event.shiftKey ) { + last.focus( 1 ); + return false; + } + }}); + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + _destroy: function() { + var next, + oldPosition = this.oldPosition; + + if ( this.overlay ) { + this.overlay.destroy(); + } + this.uiDialog.hide(); + this.element + .removeClass( "ui-dialog-content ui-widget-content" ) + .hide() + .appendTo( "body" ); + this.uiDialog.remove(); + + if ( this.originalTitle ) { + this.element.attr( "title", this.originalTitle ); + } + + next = oldPosition.parent.children().eq( oldPosition.index ); + // Don't try to place the dialog next to itself (#8613) + if ( next.length && next[ 0 ] !== this.element[ 0 ] ) { + next.before( this.element ); + } else { + oldPosition.parent.append( this.element ); + } + }, + + widget: function() { + return this.uiDialog; + }, + + close: function( event ) { + var that = this, + maxZ, thisZ; + + if ( !this._isOpen ) { + return; + } + + if ( false === this._trigger( "beforeClose", event ) ) { + return; + } + + this._isOpen = false; + + if ( this.overlay ) { + this.overlay.destroy(); + } + + if ( this.options.hide ) { + this._hide( this.uiDialog, this.options.hide, function() { + that._trigger( "close", event ); + }); + } else { + this.uiDialog.hide(); + this._trigger( "close", event ); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if ( this.options.modal ) { + maxZ = 0; + $( ".ui-dialog" ).each(function() { + if ( this !== that.uiDialog[0] ) { + thisZ = $( this ).css( "z-index" ); + if ( !isNaN( thisZ ) ) { + maxZ = Math.max( maxZ, thisZ ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return this; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function( force, event ) { + var options = this.options, + saveScroll; + + if ( ( options.modal && !force ) || + ( !options.stack && !options.modal ) ) { + return this._trigger( "focus", event ); + } + + if ( options.zIndex > $.ui.dialog.maxZ ) { + $.ui.dialog.maxZ = options.zIndex; + } + if ( this.overlay ) { + $.ui.dialog.maxZ += 1; + $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ; + this.overlay.$el.css( "z-index", $.ui.dialog.overlay.maxZ ); + } + + // Save and then restore scroll + // Opera 9.5+ resets when parent z-index is changed. + // http://bugs.jqueryui.com/ticket/3193 + saveScroll = { + scrollTop: this.element.scrollTop(), + scrollLeft: this.element.scrollLeft() + }; + $.ui.dialog.maxZ += 1; + this.uiDialog.css( "z-index", $.ui.dialog.maxZ ); + this.element.attr( saveScroll ); + this._trigger( "focus", event ); + + return this; + }, + + open: function() { + if ( this._isOpen ) { + return; + } + + var hasFocus, + options = this.options, + uiDialog = this.uiDialog; + + this._size(); + this._position( options.position ); + uiDialog.show( options.show ); + this.overlay = options.modal ? new $.ui.dialog.overlay( this ) : null; + this.moveToTop( true ); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + hasFocus = this.element.find( ":tabbable" ); + if ( !hasFocus.length ) { + hasFocus = this.uiDialogButtonPane.find( ":tabbable" ); + if ( !hasFocus.length ) { + hasFocus = uiDialog; + } + } + hasFocus.eq( 0 ).focus(); + + this._isOpen = true; + this._trigger( "open" ); + + return this; + }, + + _createButtons: function( buttons ) { + var that = this, + hasButtons = false; + + // if we already have a button pane, remove it + this.uiDialogButtonPane.remove(); + this.uiButtonSet.empty(); + + if ( typeof buttons === "object" && buttons !== null ) { + $.each( buttons, function() { + return !(hasButtons = true); }); - }; - this.refresh(); + } + if ( hasButtons ) { + $.each( buttons, function( name, props ) { + var button, click; + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + // Default to a non-submitting button + props = $.extend( { type: "button" }, props ); + // Change the context for the click callback to be the main element + click = props.click; + props.click = function() { + click.apply( that.element[0], arguments ); + }; + button = $( "", props ) + .appendTo( that.uiButtonSet ); + if ( $.fn.button ) { + button.button(); + } + }); + this.uiDialog.addClass( "ui-dialog-buttons" ); + this.uiDialogButtonPane.appendTo( this.uiDialog ); + } else { + this.uiDialog.removeClass( "ui-dialog-buttons" ); + } + }, - this.selectees = selectees.addClass("ui-selectee"); + _makeDraggable: function() { + var that = this, + options = this.options; - this._mouseInit(); + function filteredUi( ui ) { + return { + position: ui.position, + offset: ui.offset + }; + } - this.helper = $("
      "); + this.uiDialog.draggable({ + cancel: ".ui-dialog-content, .ui-dialog-titlebar-close", + handle: ".ui-dialog-titlebar", + containment: "document", + start: function( event, ui ) { + $( this ) + .addClass( "ui-dialog-dragging" ); + that._trigger( "dragStart", event, filteredUi( ui ) ); + }, + drag: function( event, ui ) { + that._trigger( "drag", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + options.position = [ + ui.position.left - that.document.scrollLeft(), + ui.position.top - that.document.scrollTop() + ]; + $( this ) + .removeClass( "ui-dialog-dragging" ); + that._trigger( "dragStop", event, filteredUi( ui ) ); + $.ui.dialog.overlay.resize(); + } + }); }, - destroy: function() { - this.selectees - .removeClass("ui-selectee") - .removeData("selectable-item"); - this.element - .removeClass("ui-selectable ui-selectable-disabled") - .removeData("selectable") - .unbind(".selectable"); - this._mouseDestroy(); + _makeResizable: function( handles ) { + handles = (handles === undefined ? this.options.resizable : handles); + var that = this, + options = this.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = this.uiDialog.css( "position" ), + resizeHandles = typeof handles === 'string' ? + handles : + "n,e,s,w,se,sw,ne,nw"; - return this; + function filteredUi( ui ) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + this.uiDialog.resizable({ + cancel: ".ui-dialog-content", + containment: "document", + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: this._minHeight(), + handles: resizeHandles, + start: function( event, ui ) { + $( this ).addClass( "ui-dialog-resizing" ); + that._trigger( "resizeStart", event, filteredUi( ui ) ); + }, + resize: function( event, ui ) { + that._trigger( "resize", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + $( this ).removeClass( "ui-dialog-resizing" ); + options.height = $( this ).height(); + options.width = $( this ).width(); + that._trigger( "resizeStop", event, filteredUi( ui ) ); + $.ui.dialog.overlay.resize(); + } + }) + .css( "position", position ) + .find( ".ui-resizable-se" ) + .addClass( "ui-icon ui-icon-grip-diagonal-se" ); }, - _mouseStart: function(event) { - var self = this; + _minHeight: function() { + var options = this.options; - this.opos = [event.pageX, event.pageY]; + if ( options.height === "auto" ) { + return options.minHeight; + } else { + return Math.min( options.minHeight, options.height ); + } + }, - if (this.options.disabled) - return; + _position: function( position ) { + var myAt = [], + offset = [ 0, 0 ], + isVisible; - var options = this.options; + if ( position ) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); - this.selectees = $(options.filter, this.element[0]); + if ( typeof position === "string" || (typeof position === "object" && "0" in position ) ) { + myAt = position.split ? position.split( " " ) : [ position[ 0 ], position[ 1 ] ]; + if ( myAt.length === 1 ) { + myAt[ 1 ] = myAt[ 0 ]; + } - this._trigger("start", event); + $.each( [ "left", "top" ], function( i, offsetPosition ) { + if ( +myAt[ i ] === myAt[ i ] ) { + offset[ i ] = myAt[ i ]; + myAt[ i ] = offsetPosition; + } + }); - $(options.appendTo).append(this.helper); - // position helper (lasso) - this.helper.css({ - "left": event.clientX, - "top": event.clientY, - "width": 0, - "height": 0 - }); + position = { + my: myAt[0] + (offset[0] < 0 ? offset[0] : "+" + offset[0]) + " " + + myAt[1] + (offset[1] < 0 ? offset[1] : "+" + offset[1]), + at: myAt.join( " " ) + }; + } - if (options.autoRefresh) { - this.refresh(); + position = $.extend( {}, $.ui.dialog.prototype.options.position, position ); + } else { + position = $.ui.dialog.prototype.options.position; } - this.selectees.filter('.ui-selected').each(function() { - var selectee = $.data(this, "selectable-item"); - selectee.startselected = true; - if (!event.metaKey) { - selectee.$element.removeClass('ui-selected'); - selectee.selected = false; - selectee.$element.addClass('ui-unselecting'); - selectee.unselecting = true; - // selectable UNSELECTING callback - self._trigger("unselecting", event, { - unselecting: selectee.element - }); + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is( ":visible" ); + if ( !isVisible ) { + this.uiDialog.show(); + } + this.uiDialog.position( position ); + if ( !isVisible ) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var that = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + that._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; } }); - $(event.target).parents().andSelf().each(function() { - var selectee = $.data(this, "selectable-item"); - if (selectee) { - var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); - selectee.$element - .removeClass(doSelect ? "ui-unselecting" : "ui-selected") - .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); - selectee.unselecting = !doSelect; - selectee.selecting = doSelect; - selectee.selected = doSelect; - // selectable (UN)SELECTING callback - if (doSelect) { - self._trigger("selecting", event, { - selecting: selectee.element - }); + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function( key, value ) { + var isDraggable, isResizable, + uiDialog = this.uiDialog; + + switch ( key ) { + case "buttons": + this._createButtons( value ); + break; + case "closeText": + // ensure that we always pass a string + this.uiDialogTitlebarCloseText.text( "" + value ); + break; + case "dialogClass": + uiDialog + .removeClass( this.options.dialogClass ) + .addClass( uiDialogClasses + value ); + break; + case "disabled": + if ( value ) { + uiDialog.addClass( "ui-dialog-disabled" ); } else { - self._trigger("unselecting", event, { - unselecting: selectee.element + uiDialog.removeClass( "ui-dialog-disabled" ); + } + break; + case "draggable": + isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + this._makeDraggable(); + } + break; + case "position": + this._position( value ); + break; + case "resizable": + // currently resizable, becoming non-resizable + isResizable = uiDialog.is( ":data(resizable)" ); + if ( isResizable && !value ) { + uiDialog.resizable( "destroy" ); + } + + // currently resizable, changing handles + if ( isResizable && typeof value === "string" ) { + uiDialog.resizable( "option", "handles", value ); + } + + // currently non-resizable, becoming resizable + if ( !isResizable && value !== false ) { + this._makeResizable( value ); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $( ".ui-dialog-title", this.uiDialogTitlebar ) + .html( "" + ( value || " " ) ); + break; + } + + this._super( key, value ); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var nonContentHeight, minContentHeight, autoHeight, + options = this.options, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: "auto", + minHeight: 0, + height: 0 + }); + + if ( options.minWidth > options.width ) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: "auto", + width: options.width + }) + .outerHeight(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", "minHeight", this._minHeight() ); + } + } +}); + +$.extend($.ui.dialog, { + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr( "id" ); + if ( !id ) { + this.uuid += 1; + id = this.uuid; + } + return "ui-dialog-title-" + id; + }, + + overlay: function( dialog ) { + this.$el = $.ui.dialog.overlay.create( dialog ); + } +}); + +$.extend( $.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map( + "focus,mousedown,mouseup,keydown,keypress,click".split( "," ), + function( event ) { + return event + ".dialog-overlay"; + } + ).join( " " ), + create: function( dialog ) { + if ( this.instances.length === 0 ) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ( $.ui.dialog.overlay.instances.length ) { + $( document ).bind( $.ui.dialog.overlay.events, function( event ) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ( $( event.target ).zIndex() < $.ui.dialog.overlay.maxZ ) { + return false; + } }); } - return false; + }, 1 ); + + // handle window resize + $( window ).bind( "resize.dialog-overlay", $.ui.dialog.overlay.resize ); + } + + var $el = ( this.oldInstances.pop() || $( "
      " ).addClass( "ui-widget-overlay" ) ); + + // allow closing by pressing the escape key + $( document ).bind( "keydown.dialog-overlay", function( event ) { + var instances = $.ui.dialog.overlay.instances; + // only react to the event if we're the top overlay + if ( instances.length !== 0 && instances[ instances.length - 1 ] === $el && + dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE ) { + + dialog.close( event ); + event.preventDefault(); } }); - }, + $el.appendTo( document.body ).css({ + width: this.width(), + height: this.height() + }); - _mouseDrag: function(event) { - var self = this; - this.dragged = true; + if ( $.fn.bgiframe ) { + $el.bgiframe(); + } - if (this.options.disabled) - return; + this.instances.push( $el ); + return $el; + }, - var options = this.options; + destroy: function( $el ) { + var indexOf = $.inArray( $el, this.instances ), + maxZ = 0; - var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; - if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } - if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } - this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + if ( indexOf !== -1 ) { + this.oldInstances.push( this.instances.splice( indexOf, 1 )[ 0 ] ); + } - this.selectees.each(function() { - var selectee = $.data(this, "selectable-item"); - //prevent helper from being selected if appendTo: selectable - if (!selectee || selectee.element == self.element[0]) - return; - var hit = false; - if (options.tolerance == 'touch') { - hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); - } else if (options.tolerance == 'fit') { - hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); - } + if ( this.instances.length === 0 ) { + $( [ document, window ] ).unbind( ".dialog-overlay" ); + } - if (hit) { - // SELECT - if (selectee.selected) { - selectee.$element.removeClass('ui-selected'); - selectee.selected = false; - } - if (selectee.unselecting) { - selectee.$element.removeClass('ui-unselecting'); - selectee.unselecting = false; - } - if (!selectee.selecting) { - selectee.$element.addClass('ui-selecting'); - selectee.selecting = true; - // selectable SELECTING callback - self._trigger("selecting", event, { - selecting: selectee.element - }); - } - } else { - // UNSELECT - if (selectee.selecting) { - if (event.metaKey && selectee.startselected) { - selectee.$element.removeClass('ui-selecting'); - selectee.selecting = false; - selectee.$element.addClass('ui-selected'); - selectee.selected = true; - } else { - selectee.$element.removeClass('ui-selecting'); - selectee.selecting = false; - if (selectee.startselected) { - selectee.$element.addClass('ui-unselecting'); - selectee.unselecting = true; - } - // selectable UNSELECTING callback - self._trigger("unselecting", event, { - unselecting: selectee.element - }); - } - } - if (selectee.selected) { - if (!event.metaKey && !selectee.startselected) { - selectee.$element.removeClass('ui-selected'); - selectee.selected = false; + $el.height( 0 ).width( 0 ).remove(); - selectee.$element.addClass('ui-unselecting'); - selectee.unselecting = true; - // selectable UNSELECTING callback - self._trigger("unselecting", event, { - unselecting: selectee.element - }); - } - } - } + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + $.each( this.instances, function() { + maxZ = Math.max( maxZ, this.css( "z-index" ) ); }); - - return false; + this.maxZ = maxZ; }, - _mouseStop: function(event) { - var self = this; + height: function() { + var scrollHeight, + offsetHeight; + // handle IE + if ( $.ui.ie ) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); - this.dragged = false; + if ( scrollHeight < offsetHeight ) { + return $( window ).height() + "px"; + } else { + return scrollHeight + "px"; + } + // handle "good" browsers + } else { + return $( document ).height() + "px"; + } + }, - var options = this.options; + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.ui.ie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); - $('.ui-unselecting', this.element[0]).each(function() { - var selectee = $.data(this, "selectable-item"); - selectee.$element.removeClass('ui-unselecting'); - selectee.unselecting = false; - selectee.startselected = false; - self._trigger("unselected", event, { - unselected: selectee.element - }); - }); - $('.ui-selecting', this.element[0]).each(function() { - var selectee = $.data(this, "selectable-item"); - selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); - selectee.selecting = false; - selectee.selected = true; - selectee.startselected = true; - self._trigger("selected", event, { - selected: selectee.element - }); - }); - this._trigger("stop", event); + if ( scrollWidth < offsetWidth ) { + return $( window ).width() + "px"; + } else { + return scrollWidth + "px"; + } + // handle "good" browsers + } else { + return $( document ).width() + "px"; + } + }, - this.helper.remove(); + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $( [] ); + $.each( $.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add( this ); + }); - return false; + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); } - }); -$.extend($.ui.selectable, { - version: "1.8.16" +$.extend( $.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy( this.$el ); + } }); -})(jQuery); -/* - * jQuery UI Sortable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Sortables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ +}( jQuery ) ); (function( $, undefined ) { -$.widget("ui.sortable", $.ui.mouse, { - widgetEventPrefix: "sort", +$.widget("ui.draggable", $.ui.mouse, { + version: "1.9.2", + widgetEventPrefix: "drag", options: { + addClasses: true, appendTo: "parent", axis: false, - connectWith: false, + connectToSortable: false, containment: false, - cursor: 'auto', + cursor: "auto", cursorAt: false, - dropOnEmpty: true, - forcePlaceholderSize: false, - forceHelperSize: false, grid: false, handle: false, helper: "original", - items: '> *', + iframeFix: false, opacity: false, - placeholder: false, + refreshPositions: false, revert: false, + revertDuration: 500, + scope: "default", scroll: true, scrollSensitivity: 20, scrollSpeed: 20, - scope: "default", - tolerance: "intersect", - zIndex: 1000 + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false }, _create: function() { - var o = this.options; - this.containerCache = {}; - this.element.addClass("ui-sortable"); - - //Get the items - this.refresh(); - - //Let's determine if the items are being displayed horizontally - this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; - //Let's determine the parent's offset - this.offset = this.element.offset(); + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); - //Initialize mouse events for interaction this._mouseInit(); }, - destroy: function() { - this.element - .removeClass("ui-sortable ui-sortable-disabled") - .removeData("sortable") - .unbind(".sortable"); + _destroy: function() { + this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" ); this._mouseDestroy(); - - for ( var i = this.items.length - 1; i >= 0; i-- ) - this.items[i].item.removeData("sortable-item"); - - return this; }, - _setOption: function(key, value){ - if ( key === "disabled" ) { - this.options[ key ] = value; - - this.widget() - [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); - } else { - // Don't call widget base _setOption for disable as it adds ui-state-disabled class - $.Widget.prototype._setOption.apply(this, arguments); - } - }, - - _mouseCapture: function(event, overrideHandle) { - - if (this.reverting) { - return false; - } - - if(this.options.disabled || this.options.type == 'static') return false; - - //We have to refresh the items data once first - this._refreshItems(event); + _mouseCapture: function(event) { - //Find out if the clicked node (or one of its parents) is a actual item in this.items - var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { - if($.data(this, 'sortable-item') == self) { - currentItem = $(this); - return false; - } - }); - if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + var o = this.options; - if(!currentItem) return false; - if(this.options.handle && !overrideHandle) { - var validHandle = false; + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; - $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); - if(!validHandle) return false; - } + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
      ') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); - this.currentItem = currentItem; - this._removeCurrentsFromItems(); return true; }, - _mouseStart: function(event, overrideHandle, noActivation) { - - var o = this.options, self = this; - this.currentContainer = this; + _mouseStart: function(event) { - //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture - this.refreshPositions(); + var o = this.options; //Create and append the visible helper this.helper = this._createHelper(event); + this.helper.addClass("ui-draggable-dragging"); + //Cache the helper size this._cacheHelperProportions(); + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + /* * - Position generation - * This block generates everything position related - it's the core of draggables. @@ -3114,21 +6008,17 @@ $.widget("ui.sortable", $.ui.mouse, { //Cache the margins of the original element this._cacheMargins(); - //Get the next scrolling parent + //Store the helper's css position + this.cssPosition = this.helper.css("position"); this.scrollParent = this.helper.scrollParent(); //The element's absolute position on the page minus margins - this.offset = this.currentItem.offset(); + this.offset = this.positionAbs = this.element.offset(); this.offset = { top: this.offset.top - this.margins.top, left: this.offset.left - this.margins.left }; - // Only after we got the offset, we can change the helper's position to absolute - // TODO: Still need to figure out a way to make relative sorting possible - this.helper.css("position", "absolute"); - this.cssPosition = this.helper.css("position"); - $.extend(this.offset, { click: { //Where the click happened, relative to the element left: event.pageX - this.offset.left, @@ -3139,1062 +6029,1658 @@ $.widget("ui.sortable", $.ui.mouse, { }); //Generate the original position - this.originalPosition = this._generatePosition(event); + this.originalPosition = this.position = this._generatePosition(event); this.originalPageX = event.pageX; this.originalPageY = event.pageY; //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); - //Cache the former DOM position - this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + //Set a containment if given in the options + if(o.containment) + this._setContainment(); - //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way - if(this.helper[0] != this.currentItem[0]) { - this.currentItem.hide(); + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; } - //Create the placeholder - this._createPlaceholder(); + //Recache the helper size + this._cacheHelperProportions(); - //Set a containment if given in the options - if(o.containment) - this._setContainment(); + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var that = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(that._trigger("stop", event) !== false) { + that._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + //Remove frame helpers + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.ui.ie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; - if(o.cursor) { // cursor option - if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); - $('body').css("cursor", o.cursor); - } + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); - if(o.opacity) { // opacity option - if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); - this.helper.css("opacity", o.opacity); - } + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; - if(o.zIndex) { // zIndex option - if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); - this.helper.css("zIndex", o.zIndex); + } else if(o.containment.constructor == Array) { + this.containment = o.containment; } - //Prepare scrolling - if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') - this.overflowOffset = this.scrollParent.offset(); + }, - //Call callbacks - this._trigger("start", event, this._uiHash()); + _convertPositionTo: function(d, pos) { - //Recache the helper size - if(!this._preserveHelperProportions) - this._cacheHelperProportions(); + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; - //Post 'activate' events to possible containers - if(!noActivation) { - for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } - } + }, - //Prepare possible droppables - if($.ui.ddmanager) - $.ui.ddmanager.current = this; + _generatePosition: function(event) { - if ($.ui.ddmanager && !o.dropBehaviour) - $.ui.ddmanager.prepareOffsets(this, event); + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; - this.dragging = true; + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ - this.helper.addClass("ui-sortable-helper"); - this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position - return true; + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } - }, + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } - _mouseDrag: function(event) { + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; - //Compute the helpers position - this.position = this._generatePosition(event); - this.positionAbs = this._convertPositionTo("absolute"); + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } - if (!this.lastPositionAbs) { - this.lastPositionAbs = this.positionAbs; } - //Do scrolling - if(this.options.scroll) { - var o = this.options, scrolled = false; - if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; - if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) - this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; - else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) - this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + }, - if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) - this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; - else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) - this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, - } else { + // From now on bulk stuff - mainly helpers - if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) - scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); - else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) - scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, - if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) - scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); - else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) - scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + plugins: {}, - } + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } - if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) - $.ui.ddmanager.prepareOffsets(this, event); - } +}); - //Regenerate the absolute position used for position checks - this.positionAbs = this._convertPositionTo("absolute"); +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { - //Set the helper position - if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; - if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); - //Rearrange - for (var i = this.items.length - 1; i >= 0; i--) { + }, + stop: function(event, ui) { - //Cache variables and intersection, continue if no intersection - var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); - if (!intersection) continue; + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); - if(itemElement != this.currentItem[0] //cannot intersect with itself - && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before - && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked - && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) - //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container - ) { + $.each(inst.sortables, function() { + if(this.instance.isOver) { - this.direction = intersection == 1 ? "down" : "up"; + this.instance.isOver = 0; - if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { - this._rearrange(event, item); - } else { - break; - } + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) - this._trigger("change", event, this._uiHash()); - break; - } - } + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; - //Post events to containers - this._contactContainers(event); + //Trigger the stop of the sortable + this.instance._mouseStop(event); - //Interconnect with droppables - if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + this.instance.options.helper = this.instance.options._helper; - //Call callbacks - this._trigger('sort', event, this._uiHash()); + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); - this.lastPositionAbs = this.positionAbs; - return false; + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } - }, + }); - _mouseStop: function(event, noPropagation) { + }, + drag: function(event, ui) { - if(!event) return; + var inst = $(this).data("draggable"), that = this; - //If we are using droppables, inform the manager about the drop - if ($.ui.ddmanager && !this.options.dropBehaviour) - $.ui.ddmanager.drop(this, event); + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; - if(this.options.revert) { - var self = this; - var cur = self.placeholder.offset(); + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; - self.reverting = true; + $.each(inst.sortables, function(i) { - $(this.helper).animate({ - left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), - top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) - }, parseInt(this.options.revert, 10) || 500, function() { - self._clear(event); - }); - } else { - this._clear(event, noPropagation); - } + var innermostIntersecting = false; + var thisSortable = this; + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; - return false; + if(this.instance._intersectsWith(this.instance.containerCache)) { + innermostIntersecting = true; + $.each(inst.sortables, function () { + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + if (this != thisSortable + && this.instance._intersectsWith(this.instance.containerCache) + && $.ui.contains(thisSortable.instance.element[0], this.instance.element[0])) + innermostIntersecting = false; + return innermostIntersecting; + }); + } - }, - cancel: function() { + if(innermostIntersecting) { + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { - var self = this; + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(that).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; - if(this.dragging) { + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); - this._mouseUp({ target: null }); + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; - if(this.options.helper == "original") - this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); - else - this.currentItem.show(); + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; - //Post deactivating events to containers - for (var i = this.containers.length - 1; i >= 0; i--){ - this.containers[i]._trigger("deactivate", null, self._uiHash(this)); - if(this.containers[i].containerCache.over) { - this.containers[i]._trigger("out", null, self._uiHash(this)); - this.containers[i].containerCache.over = 0; } - } - - } - if (this.placeholder) { - //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! - if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); - if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); - - $.extend(this, { - helper: null, - dragging: false, - reverting: false, - _noFinalSort: null - }); + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); - if(this.domPosition.prev) { - $(this.domPosition.prev).after(this.currentItem); } else { - $(this.domPosition.parent).prepend(this.currentItem); - } - } - return this; + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { - }, + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; - serialize: function(o) { + //Prevent reverting on this forced stop + this.instance.options.revert = false; - var items = this._getItemsAsjQuery(o && o.connected); - var str = []; o = o || {}; + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); - $(items).each(function() { - var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); - if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); - }); + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; - if(!str.length && o.key) { - str.push(o.key + '='); - } + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); - return str.join('&'); + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } - }, + }; - toArray: function(o) { + }); - var items = this._getItemsAsjQuery(o && o.connected); - var ret = []; o = o || {}; + } +}); - items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); - return ret; +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); - /* Be careful with the following core functions */ - _intersectsWith: function(item) { +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { - var x1 = this.positionAbs.left, - x2 = x1 + this.helperProportions.width, - y1 = this.positionAbs.top, - y2 = y1 + this.helperProportions.height; + var i = $(this).data("draggable"), o = i.options, scrolled = false; - var l = item.left, - r = l + item.width, - t = item.top, - b = t + item.height; + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { - var dyClick = this.offset.click.top, - dxClick = this.offset.click.left; + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } - var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } - if( this.options.tolerance == "pointer" - || this.options.forcePointerForContainers - || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) - ) { - return isOverElement; } else { - return (l < x1 + (this.helperProportions.width / 2) // Right Half - && x2 - (this.helperProportions.width / 2) < r // Left Half - && t < y1 + (this.helperProportions.height / 2) // Bottom Half - && y2 - (this.helperProportions.height / 2) < b ); // Top Half + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } } - }, - _intersectsWithPointer: function(item) { + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); - var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), - isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), - isOverElement = isOverElementHeight && isOverElementWidth, - verticalDirection = this._getDragVerticalDirection(), - horizontalDirection = this._getDragHorizontalDirection(); + } +}); - if (!isOverElement) - return false; +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { - return this.floating ? - ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) - : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); }, + drag: function(event, ui) { - _intersectsWithSides: function(item) { + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; - var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), - isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), - verticalDirection = this._getDragVerticalDirection(), - horizontalDirection = this._getDragHorizontalDirection(); + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; - if (this.floating && horizontalDirection) { - return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); - } else { - return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); - } + for (var i = inst.snapElements.length - 1; i >= 0; i--){ - }, + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; - _getDragVerticalDirection: function() { - var delta = this.positionAbs.top - this.lastPositionAbs.top; - return delta != 0 && (delta > 0 ? "down" : "up"); - }, + } +}); - _getDragHorizontalDirection: function() { - var delta = this.positionAbs.left - this.lastPositionAbs.left; - return delta != 0 && (delta > 0 ? "right" : "left"); - }, +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { - refresh: function(event) { - this._refreshItems(event); - this.refreshPositions(); - return this; - }, + var o = $(this).data("draggable").options; - _connectWith: function() { - var options = this.options; - return options.connectWith.constructor == String - ? [options.connectWith] - : options.connectWith; - }, - - _getItemsAsjQuery: function(connected) { + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } - var self = this; - var items = []; - var queries = []; - var connectWith = this._connectWith(); + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); - if(connectWith && connected) { - for (var i = connectWith.length - 1; i >= 0; i--){ - var cur = $(connectWith[i]); - for (var j = cur.length - 1; j >= 0; j--){ - var inst = $.data(cur[j], 'sortable'); - if(inst && inst != this && !inst.options.disabled) { - queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); - } - }; - }; - } + this[0].style.zIndex = min + group.length; - queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + } +}); - for (var i = queries.length - 1; i >= 0; i--){ - queries[i][0].each(function() { - items.push(this); - }); - }; +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); - return $(items); +})(jQuery); +(function( $, undefined ) { +$.widget("ui.droppable", { + version: "1.9.2", + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' }, + _create: function() { - _removeCurrentsFromItems: function() { + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; - var list = this.currentItem.find(":data(sortable-item)"); + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; - for (var i=0; i < this.items.length; i++) { + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; - for (var j=0; j < list.length; j++) { - if(list[j] == this.items[i].item[0]) - this.items.splice(i,1); - }; + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); - }; + (o.addClasses && this.element.addClass("ui-droppable")); }, - _refreshItems: function(event) { + _destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); - this.items = []; - this.containers = [this]; - var items = this.items; - var self = this; - var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; - var connectWith = this._connectWith(); + this.element.removeClass("ui-droppable ui-droppable-disabled"); + }, - if(connectWith) { - for (var i = connectWith.length - 1; i >= 0; i--){ - var cur = $(connectWith[i]); - for (var j = cur.length - 1; j >= 0; j--){ - var inst = $.data(cur[j], 'sortable'); - if(inst && inst != this && !inst.options.disabled) { - queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); - this.containers.push(inst); - } - }; + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); }; } + $.Widget.prototype._setOption.apply(this, arguments); + }, - for (var i = queries.length - 1; i >= 0; i--) { - var targetData = queries[i][1]; - var _queries = queries[i][0]; + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, - for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { - var item = $(_queries[j]); + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, - item.data('sortable-item', targetData); // Data for target checking (mouse manager) + _over: function(event) { - items.push({ - item: item, - instance: targetData, - width: 0, height: 0, - left: 0, top: 0 - }); - }; - }; + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } }, - refreshPositions: function(fast) { + _out: function(event) { - //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change - if(this.offsetParent && this.helper) { - this.offset.parent = this._getParentOffset(); - } + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element - for (var i = this.items.length - 1; i >= 0; i--){ - var item = this.items[i]; + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } - //We ignore calculating positions of all connected containers when we're not over them - if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) - continue; + }, - var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + _drop: function(event,custom) { - if (!fast) { - item.width = t.outerWidth(); - item.height = t.outerHeight(); - } + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element - var p = t.offset(); - item.left = p.left; - item.top = p.top; - }; + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; - if(this.options.custom && this.options.custom.refreshContainers) { - this.options.custom.refreshContainers.call(this); - } else { - for (var i = this.containers.length - 1; i >= 0; i--){ - var p = this.containers[i].element.offset(); - this.containers[i].containerCache.left = p.left; - this.containers[i].containerCache.top = p.top; - this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); - this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); - }; + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; } - return this; - }, - - _createPlaceholder: function(that) { + return false; - var self = that || this, o = self.options; + }, - if(!o.placeholder || o.placeholder.constructor == String) { - var className = o.placeholder; - o.placeholder = { - element: function() { + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } - var el = $(document.createElement(self.currentItem[0].nodeName)) - .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") - .removeClass("ui-sortable-helper")[0]; +}); - if(!className) - el.style.visibility = "hidden"; +$.ui.intersect = function(draggable, droppable, toleranceMode) { - return el; - }, - update: function(container, p) { + if (!droppable.offset) return false; - // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that - // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified - if(className && !o.forcePlaceholderSize) return; + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; - //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item - if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; - if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; - } - }; + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; } - //Create the placeholder - self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); - - //Append it after the actual current item - self.currentItem.after(self.placeholder); - - //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) - o.placeholder.update(self, self.placeholder); +}; - }, +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { - _contactContainers: function(event) { - - // get innermost container that intersects with item - var innermostContainer = null, innermostIndex = null; - - - for (var i = this.containers.length - 1; i >= 0; i--){ + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); - // never consider a container that's located within the item itself - if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) - continue; + droppablesLoop: for (var i = 0; i < m.length; i++) { - if(this._intersectsWith(this.containers[i].containerCache)) { + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue - // if we've already found a container and it's more "inner" than this, then continue - if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) - continue; + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables - innermostContainer = this.containers[i]; - innermostIndex = i; - - } else { - // container doesn't intersect. trigger "out" event if necessary - if(this.containers[i].containerCache.over) { - this.containers[i]._trigger("out", event, this._uiHash(this)); - this.containers[i].containerCache.over = 0; - } - } + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; } - - // if no intersecting containers found, return - if(!innermostContainer) return; - // move the item into the container if it's not there already - if(this.containers.length === 1) { - this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); - this.containers[innermostIndex].containerCache.over = 1; - } else if(this.currentContainer != this.containers[innermostIndex]) { - - //When entering a new container, we will find the item with the least distance and append our item near it - var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; - for (var j = this.items.length - 1; j >= 0; j--) { - if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; - var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; - if(Math.abs(cur - base) < dist) { - dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; - } - } - - if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled - return; - - this.currentContainer = this.containers[innermostIndex]; - itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); - this._trigger("change", event, this._uiHash()); - this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); - - //Update the placeholder - this.options.placeholder.update(this.currentContainer, this.placeholder); - - this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); - this.containers[innermostIndex].containerCache.over = 1; - } - - }, + drop: function(draggable, event) { - _createHelper: function(event) { - - var o = this.options; - var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); - - if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already - $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { - if(helper[0] == this.currentItem[0]) - this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; - if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); - if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } - return helper; + }); + return dropped; }, - - _adjustOffsetFromHelper: function(obj) { - if (typeof obj == 'string') { - obj = obj.split(' '); - } - if ($.isArray(obj)) { - obj = {left: +obj[0], top: +obj[1] || 0}; - } - if ('left' in obj) { - this.offset.click.left = obj.left + this.margins.left; - } - if ('right' in obj) { - this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; - } - if ('top' in obj) { - this.offset.click.top = obj.top + this.margins.top; - } - if ('bottom' in obj) { - this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; - } + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); }, + drag: function(draggable, event) { - _getParentOffset: function() { - + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); - //Get the offsetParent and cache its position - this.offsetParent = this.helper.offsetParent(); - var po = this.offsetParent.offset(); + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { - // This is a special case where we need to modify a offset calculated on start, since the following happened: - // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent - // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that - // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag - if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { - po.left += this.scrollParent.scrollLeft(); - po.top += this.scrollParent.scrollTop(); - } + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); - if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information - || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix - po = { top: 0, left: 0 }; + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; - return { - top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), - left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) - }; + var parentInstance; + if (this.options.greedy) { + // find droppable parents with same scope + var scope = this.options.scope; + var parent = this.element.parents(':data(droppable)').filter(function () { + return $.data(this, 'droppable').options.scope === scope; + }); - }, + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } - _getRelativeOffset: function() { + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } - if(this.cssPosition == "relative") { - var p = this.currentItem.position(); - return { - top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), - left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() - }; - } else { - return { top: 0, left: 0 }; - } + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); - }, + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); - _cacheMargins: function() { - this.margins = { - left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), - top: (parseInt(this.currentItem.css("marginTop"),10) || 0) - }; }, + dragStop: function( draggable, event ) { + draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; - _cacheHelperProportions: function() { - this.helperProportions = { - width: this.helper.outerWidth(), - height: this.helper.outerHeight() - }; - }, +})(jQuery); +;(jQuery.effects || (function($, undefined) { - _setContainment: function() { +var backCompat = $.uiBackCompat !== false, + // prefix used for storing data on .data() + dataSpace = "ui-effects-"; - var o = this.options; - if(o.containment == 'parent') o.containment = this.helper[0].parentNode; - if(o.containment == 'document' || o.containment == 'window') this.containment = [ - 0 - this.offset.relative.left - this.offset.parent.left, - 0 - this.offset.relative.top - this.offset.parent.top, - $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, - ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top - ]; +$.effects = { + effect: {} +}; - if(!(/^(document|window|parent)$/).test(o.containment)) { - var ce = $(o.containment)[0]; - var co = $(o.containment).offset(); - var over = ($(ce).css("overflow") != 'hidden'); +/*! + * jQuery Color Animations v2.0.0 + * http://jquery.com/ + * + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + * + * Date: Mon Aug 13 13:41:02 2012 -0500 + */ +(function( jQuery, undefined ) { + + var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor".split(" "), + + // plusequals test for += 100 -= 100 + rplusequals = /^([\-+])=\s*(\d+\.?\d*)/, + // a set of RE's that can match strings and generate color tuples. + stringParsers = [{ + re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ], + execResult[ 3 ], + execResult[ 4 ] + ]; + } + }, { + re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ] * 2.55, + execResult[ 2 ] * 2.55, + execResult[ 3 ] * 2.55, + execResult[ 4 ] + ]; + } + }, { + // this regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ], 16 ) + ]; + } + }, { + // this regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9])([a-f0-9])([a-f0-9])/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ] + execResult[ 3 ], 16 ) + ]; + } + }, { + re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/, + space: "hsla", + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ] / 100, + execResult[ 3 ] / 100, + execResult[ 4 ] + ]; + } + }], + + // jQuery.Color( ) + color = jQuery.Color = function( color, green, blue, alpha ) { + return new jQuery.Color.fn.parse( color, green, blue, alpha ); + }, + spaces = { + rgba: { + props: { + red: { + idx: 0, + type: "byte" + }, + green: { + idx: 1, + type: "byte" + }, + blue: { + idx: 2, + type: "byte" + } + } + }, - this.containment = [ - co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, - co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, - co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, - co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - ]; + hsla: { + props: { + hue: { + idx: 0, + type: "degrees" + }, + saturation: { + idx: 1, + type: "percent" + }, + lightness: { + idx: 2, + type: "percent" + } + } } - }, + propTypes = { + "byte": { + floor: true, + max: 255 + }, + "percent": { + max: 1 + }, + "degrees": { + mod: 360, + floor: true + } + }, + support = color.support = {}, - _convertPositionTo: function(d, pos) { - - if(!pos) pos = this.position; - var mod = d == "absolute" ? 1 : -1; - var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); - - return { - top: ( - pos.top // The absolute mouse position - + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent - + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) - - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) - ), - left: ( - pos.left // The absolute mouse position - + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent - + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) - - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) - ) - }; + // element for support tests + supportElem = jQuery( "

      " )[ 0 ], - }, + // colors = jQuery.Color.names + colors, - _generatePosition: function(event) { + // local aliases of functions called often + each = jQuery.each; - var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); +// determine rgba support immediately +supportElem.style.cssText = "background-color:rgba(1,1,1,.5)"; +support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1; - // This is another very weird special case that only happens for relative elements: - // 1. If the css position is relative - // 2. and the scroll parent is the document or similar to the offset parent - // we have to refresh the relative offset during the scroll so there are no jumps - if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { - this.offset.relative = this._getRelativeOffset(); - } +// define cache name and alpha properties +// for rgba and hsla spaces +each( spaces, function( spaceName, space ) { + space.cache = "_" + spaceName; + space.props.alpha = { + idx: 3, + type: "percent", + def: 1 + }; +}); - var pageX = event.pageX; - var pageY = event.pageY; +function clamp( value, prop, allowEmpty ) { + var type = propTypes[ prop.type ] || {}; - /* - * - Position constraining - - * Constrain the position to a mix of grid, containment. - */ + if ( value == null ) { + return (allowEmpty || !prop.def) ? null : prop.def; + } - if(this.originalPosition) { //If we are not dragging yet, we won't check for options + // ~~ is an short way of doing floor for positive numbers + value = type.floor ? ~~value : parseFloat( value ); - if(this.containment) { - if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; - if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; - if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; - if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; - } + // IE will pass in empty strings as value for alpha, + // which will hit this case + if ( isNaN( value ) ) { + return prop.def; + } - if(o.grid) { - var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; - pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + if ( type.mod ) { + // we add mod before modding to make sure that negatives values + // get converted properly: -10 -> 350 + return (value + type.mod) % type.mod; + } - var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; - pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; - } + // for now all property types without mod have min and max + return 0 > value ? 0 : type.max < value ? type.max : value; +} - } +function stringParse( string ) { + var inst = color(), + rgba = inst._rgba = []; - return { - top: ( - pageY // The absolute mouse position - - this.offset.click.top // Click offset (relative to the element) - - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent - - this.offset.parent.top // The offsetParent's offset without borders (offset + border) - + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) - ), - left: ( - pageX // The absolute mouse position - - this.offset.click.left // Click offset (relative to the element) - - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent - - this.offset.parent.left // The offsetParent's offset without borders (offset + border) - + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) - ) - }; + string = string.toLowerCase(); - }, + each( stringParsers, function( i, parser ) { + var parsed, + match = parser.re.exec( string ), + values = match && parser.parse( match ), + spaceName = parser.space || "rgba"; - _rearrange: function(event, i, a, hardRefresh) { + if ( values ) { + parsed = inst[ spaceName ]( values ); - a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + // if this was an rgba parse the assignment might happen twice + // oh well.... + inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ]; + rgba = inst._rgba = parsed._rgba; - //Various things done here to improve the performance: - // 1. we create a setTimeout, that calls refreshPositions - // 2. on the instance, we have a counter variable, that get's higher after every append - // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same - // 4. this lets only the last addition to the timeout stack through - this.counter = this.counter ? ++this.counter : 1; - var self = this, counter = this.counter; + // exit each( stringParsers ) here because we matched + return false; + } + }); - window.setTimeout(function() { - if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove - },0); + // Found a stringParser that handled it + if ( rgba.length ) { - }, + // if this came from a parsed string, force "transparent" when alpha is 0 + // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0) + if ( rgba.join() === "0,0,0,0" ) { + jQuery.extend( rgba, colors.transparent ); + } + return inst; + } - _clear: function(event, noPropagation) { + // named colors + return colors[ string ]; +} - this.reverting = false; - // We delay all events that have to be triggered to after the point where the placeholder has been removed and - // everything else normalized again - var delayedTriggers = [], self = this; +color.fn = jQuery.extend( color.prototype, { + parse: function( red, green, blue, alpha ) { + if ( red === undefined ) { + this._rgba = [ null, null, null, null ]; + return this; + } + if ( red.jquery || red.nodeType ) { + red = jQuery( red ).css( green ); + green = undefined; + } - // We first have to update the dom position of the actual currentItem - // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) - if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); - this._noFinalSort = null; + var inst = this, + type = jQuery.type( red ), + rgba = this._rgba = []; - if(this.helper[0] == this.currentItem[0]) { - for(var i in this._storedCSS) { - if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; - } - this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); - } else { - this.currentItem.show(); + // more than 1 argument specified - assume ( red, green, blue, alpha ) + if ( green !== undefined ) { + red = [ red, green, blue, alpha ]; + type = "array"; } - if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); - if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed - if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element - if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); - for (var i = this.containers.length - 1; i >= 0; i--){ - if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { - delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); - delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); - } - }; - }; + if ( type === "string" ) { + return this.parse( stringParse( red ) || colors._default ); + } - //Post events to containers - for (var i = this.containers.length - 1; i >= 0; i--){ - if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); - if(this.containers[i].containerCache.over) { - delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); - this.containers[i].containerCache.over = 0; - } + if ( type === "array" ) { + each( spaces.rgba.props, function( key, prop ) { + rgba[ prop.idx ] = clamp( red[ prop.idx ], prop ); + }); + return this; } - //Do what was originally in plugins - if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor - if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity - if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + if ( type === "object" ) { + if ( red instanceof color ) { + each( spaces, function( spaceName, space ) { + if ( red[ space.cache ] ) { + inst[ space.cache ] = red[ space.cache ].slice(); + } + }); + } else { + each( spaces, function( spaceName, space ) { + var cache = space.cache; + each( space.props, function( key, prop ) { - this.dragging = false; - if(this.cancelHelperRemoval) { - if(!noPropagation) { - this._trigger("beforeStop", event, this._uiHash()); - for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events - this._trigger("stop", event, this._uiHash()); + // if the cache doesn't exist, and we know how to convert + if ( !inst[ cache ] && space.to ) { + + // if the value was null, we don't need to copy it + // if the key was alpha, we don't need to copy it either + if ( key === "alpha" || red[ key ] == null ) { + return; + } + inst[ cache ] = space.to( inst._rgba ); + } + + // this is the only case where we allow nulls for ALL properties. + // call clamp with alwaysAllowEmpty + inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true ); + }); + + // everything defined but alpha? + if ( inst[ cache ] && $.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) { + // use the default of 1 + inst[ cache ][ 3 ] = 1; + if ( space.from ) { + inst._rgba = space.from( inst[ cache ] ); + } + } + }); } - return false; + return this; } + }, + is: function( compare ) { + var is = color( compare ), + same = true, + inst = this; - if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + each( spaces, function( _, space ) { + var localCache, + isCache = is[ space.cache ]; + if (isCache) { + localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || []; + each( space.props, function( _, prop ) { + if ( isCache[ prop.idx ] != null ) { + same = ( isCache[ prop.idx ] === localCache[ prop.idx ] ); + return same; + } + }); + } + return same; + }); + return same; + }, + _space: function() { + var used = [], + inst = this; + each( spaces, function( spaceName, space ) { + if ( inst[ space.cache ] ) { + used.push( spaceName ); + } + }); + return used.pop(); + }, + transition: function( other, distance ) { + var end = color( other ), + spaceName = end._space(), + space = spaces[ spaceName ], + startColor = this.alpha() === 0 ? color( "transparent" ) : this, + start = startColor[ space.cache ] || space.to( startColor._rgba ), + result = start.slice(); + + end = end[ space.cache ]; + each( space.props, function( key, prop ) { + var index = prop.idx, + startValue = start[ index ], + endValue = end[ index ], + type = propTypes[ prop.type ] || {}; + + // if null, don't override start value + if ( endValue === null ) { + return; + } + // if null - use end + if ( startValue === null ) { + result[ index ] = endValue; + } else { + if ( type.mod ) { + if ( endValue - startValue > type.mod / 2 ) { + startValue += type.mod; + } else if ( startValue - endValue > type.mod / 2 ) { + startValue -= type.mod; + } + } + result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop ); + } + }); + return this[ spaceName ]( result ); + }, + blend: function( opaque ) { + // if we are already opaque - return ourself + if ( this._rgba[ 3 ] === 1 ) { + return this; + } - //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! - this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + var rgb = this._rgba.slice(), + a = rgb.pop(), + blend = color( opaque )._rgba; - if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + return color( jQuery.map( rgb, function( v, i ) { + return ( 1 - a ) * blend[ i ] + a * v; + })); + }, + toRgbaString: function() { + var prefix = "rgba(", + rgba = jQuery.map( this._rgba, function( v, i ) { + return v == null ? ( i > 2 ? 1 : 0 ) : v; + }); - if(!noPropagation) { - for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events - this._trigger("stop", event, this._uiHash()); + if ( rgba[ 3 ] === 1 ) { + rgba.pop(); + prefix = "rgb("; } - this.fromOutside = false; - return true; - + return prefix + rgba.join() + ")"; }, + toHslaString: function() { + var prefix = "hsla(", + hsla = jQuery.map( this.hsla(), function( v, i ) { + if ( v == null ) { + v = i > 2 ? 1 : 0; + } - _trigger: function() { - if ($.Widget.prototype._trigger.apply(this, arguments) === false) { - this.cancel(); + // catch 1 and 2 + if ( i && i < 3 ) { + v = Math.round( v * 100 ) + "%"; + } + return v; + }); + + if ( hsla[ 3 ] === 1 ) { + hsla.pop(); + prefix = "hsl("; } + return prefix + hsla.join() + ")"; }, + toHexString: function( includeAlpha ) { + var rgba = this._rgba.slice(), + alpha = rgba.pop(); - _uiHash: function(inst) { - var self = inst || this; - return { - helper: self.helper, - placeholder: self.placeholder || $([]), - position: self.position, - originalPosition: self.originalPosition, - offset: self.positionAbs, - item: self.currentItem, - sender: inst ? inst.element : null - }; - } + if ( includeAlpha ) { + rgba.push( ~~( alpha * 255 ) ); + } -}); + return "#" + jQuery.map( rgba, function( v ) { -$.extend($.ui.sortable, { - version: "1.8.16" + // default to 0 when nulls exist + v = ( v || 0 ).toString( 16 ); + return v.length === 1 ? "0" + v : v; + }).join(""); + }, + toString: function() { + return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString(); + } }); +color.fn.parse.prototype = color.fn; -})(jQuery); -/* - * jQuery UI Effects 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/ - */ -;jQuery.effects || (function($, undefined) { - -$.effects = {}; +// hsla conversions adapted from: +// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021 +function hue2rgb( p, q, h ) { + h = ( h + 1 ) % 1; + if ( h * 6 < 1 ) { + return p + (q - p) * h * 6; + } + if ( h * 2 < 1) { + return q; + } + if ( h * 3 < 2 ) { + return p + (q - p) * ((2/3) - h) * 6; + } + return p; +} +spaces.hsla.to = function ( rgba ) { + if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) { + return [ null, null, null, rgba[ 3 ] ]; + } + var r = rgba[ 0 ] / 255, + g = rgba[ 1 ] / 255, + b = rgba[ 2 ] / 255, + a = rgba[ 3 ], + max = Math.max( r, g, b ), + min = Math.min( r, g, b ), + diff = max - min, + add = max + min, + l = add * 0.5, + h, s; + + if ( min === max ) { + h = 0; + } else if ( r === max ) { + h = ( 60 * ( g - b ) / diff ) + 360; + } else if ( g === max ) { + h = ( 60 * ( b - r ) / diff ) + 120; + } else { + h = ( 60 * ( r - g ) / diff ) + 240; + } -/******************************************************************************/ -/****************************** COLOR ANIMATIONS ******************************/ -/******************************************************************************/ + if ( l === 0 || l === 1 ) { + s = l; + } else if ( l <= 0.5 ) { + s = diff / add; + } else { + s = diff / ( 2 - add ); + } + return [ Math.round(h) % 360, s, l, a == null ? 1 : a ]; +}; -// override the animation for color styles -$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', - 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], -function(i, attr) { - $.fx.step[attr] = function(fx) { - if (!fx.colorInit) { - fx.start = getColor(fx.elem, attr); - fx.end = getRGB(fx.end); - fx.colorInit = true; - } +spaces.hsla.from = function ( hsla ) { + if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) { + return [ null, null, null, hsla[ 3 ] ]; + } + var h = hsla[ 0 ] / 360, + s = hsla[ 1 ], + l = hsla[ 2 ], + a = hsla[ 3 ], + q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s, + p = 2 * l - q; + + return [ + Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ), + Math.round( hue2rgb( p, q, h ) * 255 ), + Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ), + a + ]; +}; - fx.elem.style[attr] = 'rgb(' + - Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + - Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + - Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; - }; -}); -// Color Conversion functions from highlightFade -// By Blair Mitchelmore -// http://jquery.offput.ca/highlightFade/ +each( spaces, function( spaceName, space ) { + var props = space.props, + cache = space.cache, + to = space.to, + from = space.from; -// Parse strings looking for color tuples [255,255,255] -function getRGB(color) { - var result; + // makes rgba() and hsla() + color.fn[ spaceName ] = function( value ) { - // Check if we're already dealing with an array of colors - if ( color && color.constructor == Array && color.length == 3 ) - return color; + // generate a cache for this space if it doesn't exist + if ( to && !this[ cache ] ) { + this[ cache ] = to( this._rgba ); + } + if ( value === undefined ) { + return this[ cache ].slice(); + } - // Look for rgb(num,num,num) - if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) - return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + var ret, + type = jQuery.type( value ), + arr = ( type === "array" || type === "object" ) ? value : arguments, + local = this[ cache ].slice(); - // Look for rgb(num%,num%,num%) - if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) - return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + each( props, function( key, prop ) { + var val = arr[ type === "object" ? key : prop.idx ]; + if ( val == null ) { + val = local[ prop.idx ]; + } + local[ prop.idx ] = clamp( val, prop ); + }); - // Look for #a0b1c2 - if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) - return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + if ( from ) { + ret = color( from( local ) ); + ret[ cache ] = local; + return ret; + } else { + return color( local ); + } + }; - // Look for #fff - if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) - return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + // makes red() green() blue() alpha() hue() saturation() lightness() + each( props, function( key, prop ) { + // alpha is included in more than one space + if ( color.fn[ key ] ) { + return; + } + color.fn[ key ] = function( value ) { + var vtype = jQuery.type( value ), + fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ), + local = this[ fn ](), + cur = local[ prop.idx ], + match; - // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 - if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) - return colors['transparent']; + if ( vtype === "undefined" ) { + return cur; + } - // Otherwise, we're most likely dealing with a named color - return colors[$.trim(color).toLowerCase()]; -} + if ( vtype === "function" ) { + value = value.call( this, cur ); + vtype = jQuery.type( value ); + } + if ( value == null && prop.empty ) { + return this; + } + if ( vtype === "string" ) { + match = rplusequals.exec( value ); + if ( match ) { + value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 ); + } + } + local[ prop.idx ] = value; + return this[ fn ]( local ); + }; + }); +}); -function getColor(elem, attr) { - var color; +// add .fx.step functions +each( stepHooks, function( i, hook ) { + jQuery.cssHooks[ hook ] = { + set: function( elem, value ) { + var parsed, curElem, + backgroundColor = ""; + + if ( jQuery.type( value ) !== "string" || ( parsed = stringParse( value ) ) ) { + value = color( parsed || value ); + if ( !support.rgba && value._rgba[ 3 ] !== 1 ) { + curElem = hook === "backgroundColor" ? elem.parentNode : elem; + while ( + (backgroundColor === "" || backgroundColor === "transparent") && + curElem && curElem.style + ) { + try { + backgroundColor = jQuery.css( curElem, "backgroundColor" ); + curElem = curElem.parentNode; + } catch ( e ) { + } + } - do { - color = $.curCSS(elem, attr); + value = value.blend( backgroundColor && backgroundColor !== "transparent" ? + backgroundColor : + "_default" ); + } - // Keep going until we find an element that has color, or we hit the body - if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) - break; + value = value.toRgbaString(); + } + try { + elem.style[ hook ] = value; + } catch( error ) { + // wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit' + } + } + }; + jQuery.fx.step[ hook ] = function( fx ) { + if ( !fx.colorInit ) { + fx.start = color( fx.elem, hook ); + fx.end = color( fx.end ); + fx.colorInit = true; + } + jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) ); + }; +}); - attr = "backgroundColor"; - } while ( elem = elem.parentNode ); +jQuery.cssHooks.borderColor = { + expand: function( value ) { + var expanded = {}; - return getRGB(color); + each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) { + expanded[ "border" + part + "Color" ] = value; + }); + return expanded; + } }; -// Some named colors to work with -// From Interface by Stefan Petre -// http://interface.eyecon.ro/ - -var colors = { - aqua:[0,255,255], - azure:[240,255,255], - beige:[245,245,220], - black:[0,0,0], - blue:[0,0,255], - brown:[165,42,42], - cyan:[0,255,255], - darkblue:[0,0,139], - darkcyan:[0,139,139], - darkgrey:[169,169,169], - darkgreen:[0,100,0], - darkkhaki:[189,183,107], - darkmagenta:[139,0,139], - darkolivegreen:[85,107,47], - darkorange:[255,140,0], - darkorchid:[153,50,204], - darkred:[139,0,0], - darksalmon:[233,150,122], - darkviolet:[148,0,211], - fuchsia:[255,0,255], - gold:[255,215,0], - green:[0,128,0], - indigo:[75,0,130], - khaki:[240,230,140], - lightblue:[173,216,230], - lightcyan:[224,255,255], - lightgreen:[144,238,144], - lightgrey:[211,211,211], - lightpink:[255,182,193], - lightyellow:[255,255,224], - lime:[0,255,0], - magenta:[255,0,255], - maroon:[128,0,0], - navy:[0,0,128], - olive:[128,128,0], - orange:[255,165,0], - pink:[255,192,203], - purple:[128,0,128], - violet:[128,0,128], - red:[255,0,0], - silver:[192,192,192], - white:[255,255,255], - yellow:[255,255,0], - transparent: [255,255,255] +// Basic color names only. +// Usage of any of the other color names requires adding yourself or including +// jquery.color.svg-names.js. +colors = jQuery.Color.names = { + // 4.1. Basic color keywords + aqua: "#00ffff", + black: "#000000", + blue: "#0000ff", + fuchsia: "#ff00ff", + gray: "#808080", + green: "#008000", + lime: "#00ff00", + maroon: "#800000", + navy: "#000080", + olive: "#808000", + purple: "#800080", + red: "#ff0000", + silver: "#c0c0c0", + teal: "#008080", + white: "#ffffff", + yellow: "#ffff00", + + // 4.2.3. "transparent" color keyword + transparent: [ null, null, null, 0 ], + + _default: "#ffffff" }; +})( jQuery ); + /******************************************************************************/ /****************************** CLASS ANIMATIONS ******************************/ /******************************************************************************/ +(function() { -var classAnimationActions = ['add', 'remove', 'toggle'], +var classAnimationActions = [ "add", "remove", "toggle" ], shorthandStyles = { border: 1, borderBottom: 1, @@ -4207,199 +7693,253 @@ var classAnimationActions = ['add', 'remove', 'toggle'], padding: 1 }; +$.each([ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ], function( _, prop ) { + $.fx.step[ prop ] = function( fx ) { + if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) { + jQuery.style( fx.elem, prop, fx.end ); + fx.setAttr = true; + } + }; +}); + function getElementStyles() { - var style = document.defaultView - ? document.defaultView.getComputedStyle(this, null) - : this.currentStyle, + var style = this.ownerDocument.defaultView ? + this.ownerDocument.defaultView.getComputedStyle( this, null ) : + this.currentStyle, newStyle = {}, key, - camelCase; + len; // webkit enumerates style porperties - if (style && style.length && style[0] && style[style[0]]) { - var len = style.length; - while (len--) { - key = style[len]; - if (typeof style[key] == 'string') { - camelCase = key.replace(/\-(\w)/g, function(all, letter){ - return letter.toUpperCase(); - }); - newStyle[camelCase] = style[key]; + if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) { + len = style.length; + while ( len-- ) { + key = style[ len ]; + if ( typeof style[ key ] === "string" ) { + newStyle[ $.camelCase( key ) ] = style[ key ]; } } } else { - for (key in style) { - if (typeof style[key] === 'string') { - newStyle[key] = style[key]; + for ( key in style ) { + if ( typeof style[ key ] === "string" ) { + newStyle[ key ] = style[ key ]; } } } - + return newStyle; } -function filterStyles(styles) { - var name, value; - for (name in styles) { - value = styles[name]; - if ( - // ignore null and undefined values - value == null || - // ignore functions (when does this occur?) - $.isFunction(value) || - // shorthand styles that need to be expanded - name in shorthandStyles || - // ignore scrollbars (break in IE) - (/scrollbar/).test(name) || - - // only colors or values that can be converted to numbers - (!(/color/i).test(name) && isNaN(parseFloat(value))) - ) { - delete styles[name]; - } - } - - return styles; -} -function styleDifference(oldStyle, newStyle) { - var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 - name; +function styleDifference( oldStyle, newStyle ) { + var diff = {}, + name, value; - for (name in newStyle) { - if (oldStyle[name] != newStyle[name]) { - diff[name] = newStyle[name]; + for ( name in newStyle ) { + value = newStyle[ name ]; + if ( oldStyle[ name ] !== value ) { + if ( !shorthandStyles[ name ] ) { + if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) { + diff[ name ] = value; + } + } } } return diff; } -$.effects.animateClass = function(value, duration, easing, callback) { - if ($.isFunction(easing)) { - callback = easing; - easing = null; - } +$.effects.animateClass = function( value, duration, easing, callback ) { + var o = $.speed( duration, easing, callback ); - return this.queue(function() { - var that = $(this), - originalStyleAttr = that.attr('style') || ' ', - originalStyle = filterStyles(getElementStyles.call(this)), - newStyle, - className = that.attr('class'); + return this.queue( function() { + var animated = $( this ), + baseClass = animated.attr( "class" ) || "", + applyClassChange, + allAnimations = o.children ? animated.find( "*" ).andSelf() : animated; - $.each(classAnimationActions, function(i, action) { - if (value[action]) { - that[action + 'Class'](value[action]); - } + // map the animated objects to store the original styles. + allAnimations = allAnimations.map(function() { + var el = $( this ); + return { + el: el, + start: getElementStyles.call( this ) + }; }); - newStyle = filterStyles(getElementStyles.call(this)); - that.attr('class', className); - that.animate(styleDifference(originalStyle, newStyle), { - queue: false, - duration: duration, - easing: easing, - complete: function() { - $.each(classAnimationActions, function(i, action) { - if (value[action]) { that[action + 'Class'](value[action]); } - }); - // work around bug in IE by clearing the cssText before setting it - if (typeof that.attr('style') == 'object') { - that.attr('style').cssText = ''; - that.attr('style').cssText = originalStyleAttr; - } else { - that.attr('style', originalStyleAttr); + // apply class change + applyClassChange = function() { + $.each( classAnimationActions, function(i, action) { + if ( value[ action ] ) { + animated[ action + "Class" ]( value[ action ] ); } - if (callback) { callback.apply(this, arguments); } - $.dequeue( this ); - } + }); + }; + applyClassChange(); + + // map all animated objects again - calculate new styles and diff + allAnimations = allAnimations.map(function() { + this.end = getElementStyles.call( this.el[ 0 ] ); + this.diff = styleDifference( this.start, this.end ); + return this; + }); + + // apply original class + animated.attr( "class", baseClass ); + + // map all animated objects again - this time collecting a promise + allAnimations = allAnimations.map(function() { + var styleInfo = this, + dfd = $.Deferred(), + opts = jQuery.extend({}, o, { + queue: false, + complete: function() { + dfd.resolve( styleInfo ); + } + }); + + this.el.animate( this.diff, opts ); + return dfd.promise(); + }); + + // once all animations have completed: + $.when.apply( $, allAnimations.get() ).done(function() { + + // set the final class + applyClassChange(); + + // for each animated element, + // clear all css properties that were animated + $.each( arguments, function() { + var el = this.el; + $.each( this.diff, function(key) { + el.css( key, '' ); + }); + }); + + // this is guarnteed to be there if you use jQuery.speed() + // it also handles dequeuing the next anim... + o.complete.call( animated[ 0 ] ); }); }); }; $.fn.extend({ _addClass: $.fn.addClass, - addClass: function(classNames, speed, easing, callback) { - return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + addClass: function( classNames, speed, easing, callback ) { + return speed ? + $.effects.animateClass.call( this, + { add: classNames }, speed, easing, callback ) : + this._addClass( classNames ); }, _removeClass: $.fn.removeClass, - removeClass: function(classNames,speed,easing,callback) { - return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + removeClass: function( classNames, speed, easing, callback ) { + return speed ? + $.effects.animateClass.call( this, + { remove: classNames }, speed, easing, callback ) : + this._removeClass( classNames ); }, _toggleClass: $.fn.toggleClass, - toggleClass: function(classNames, force, speed, easing, callback) { - if ( typeof force == "boolean" || force === undefined ) { + toggleClass: function( classNames, force, speed, easing, callback ) { + if ( typeof force === "boolean" || force === undefined ) { if ( !speed ) { - // without speed parameter; - return this._toggleClass(classNames, force); + // without speed parameter + return this._toggleClass( classNames, force ); } else { - return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + return $.effects.animateClass.call( this, + (force ? { add: classNames } : { remove: classNames }), + speed, easing, callback ); } } else { - // without switch parameter; - return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + // without force parameter + return $.effects.animateClass.call( this, + { toggle: classNames }, force, speed, easing ); } }, - switchClass: function(remove,add,speed,easing,callback) { - return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + switchClass: function( remove, add, speed, easing, callback) { + return $.effects.animateClass.call( this, { + add: add, + remove: remove + }, speed, easing, callback ); } }); - +})(); /******************************************************************************/ /*********************************** EFFECTS **********************************/ /******************************************************************************/ -$.extend($.effects, { - version: "1.8.16", +(function() { + +$.extend( $.effects, { + version: "1.9.2", // Saves a set of properties in a data storage - save: function(element, set) { - for(var i=0; i < set.length; i++) { - if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + save: function( element, set ) { + for( var i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] ); + } } }, // Restores a set of previously saved properties from a data storage - restore: function(element, set) { - for(var i=0; i < set.length; i++) { - if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + restore: function( element, set ) { + var val, i; + for( i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + val = element.data( dataSpace + set[ i ] ); + // support: jQuery 1.6.2 + // http://bugs.jquery.com/ticket/9917 + // jQuery 1.6.2 incorrectly returns undefined for any falsy value. + // We can't differentiate between "" and 0 here, so we just assume + // empty string since it's likely to be a more common value... + if ( val === undefined ) { + val = ""; + } + element.css( set[ i ], val ); + } } }, - setMode: function(el, mode) { - if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + setMode: function( el, mode ) { + if (mode === "toggle") { + mode = el.is( ":hidden" ) ? "show" : "hide"; + } return mode; }, - getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value - // this should be a little more flexible in the future to handle a string & hash + // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + getBaseline: function( origin, original ) { var y, x; - switch (origin[0]) { - case 'top': y = 0; break; - case 'middle': y = 0.5; break; - case 'bottom': y = 1; break; - default: y = origin[0] / original.height; - }; - switch (origin[1]) { - case 'left': x = 0; break; - case 'center': x = 0.5; break; - case 'right': x = 1; break; - default: x = origin[1] / original.width; + switch ( origin[ 0 ] ) { + case "top": y = 0; break; + case "middle": y = 0.5; break; + case "bottom": y = 1; break; + default: y = origin[ 0 ] / original.height; + } + switch ( origin[ 1 ] ) { + case "left": x = 0; break; + case "center": x = 0.5; break; + case "right": x = 1; break; + default: x = origin[ 1 ] / original.width; + } + return { + x: x, + y: y }; - return {x: x, y: y}; }, // Wraps the element around a wrapper that copies position properties - createWrapper: function(element) { + createWrapper: function( element ) { // if the element is already wrapped, return it - if (element.parent().is('.ui-effects-wrapper')) { + if ( element.parent().is( ".ui-effects-wrapper" )) { return element.parent(); } @@ -4407,108 +7947,149 @@ $.extend($.effects, { var props = { width: element.outerWidth(true), height: element.outerHeight(true), - 'float': element.css('float') + "float": element.css( "float" ) }, - wrapper = $('

      ') - .addClass('ui-effects-wrapper') + wrapper = $( "
      " ) + .addClass( "ui-effects-wrapper" ) .css({ - fontSize: '100%', - background: 'transparent', - border: 'none', + fontSize: "100%", + background: "transparent", + border: "none", margin: 0, padding: 0 }), + // Store the size in case width/height are defined in % - Fixes #5245 + size = { + width: element.width(), + height: element.height() + }, active = document.activeElement; - element.wrap(wrapper); + // support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch( e ) { + active = document.body; + } + + element.wrap( wrapper ); // Fixes #7595 - Elements lose focus when wrapped. if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { $( active ).focus(); } - - wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element // transfer positioning properties to the wrapper - if (element.css('position') == 'static') { - wrapper.css({ position: 'relative' }); - element.css({ position: 'relative' }); + if ( element.css( "position" ) === "static" ) { + wrapper.css({ position: "relative" }); + element.css({ position: "relative" }); } else { - $.extend(props, { - position: element.css('position'), - zIndex: element.css('z-index') + $.extend( props, { + position: element.css( "position" ), + zIndex: element.css( "z-index" ) }); - $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { - props[pos] = element.css(pos); - if (isNaN(parseInt(props[pos], 10))) { - props[pos] = 'auto'; + $.each([ "top", "left", "bottom", "right" ], function(i, pos) { + props[ pos ] = element.css( pos ); + if ( isNaN( parseInt( props[ pos ], 10 ) ) ) { + props[ pos ] = "auto"; } }); - element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + element.css({ + position: "relative", + top: 0, + left: 0, + right: "auto", + bottom: "auto" + }); } + element.css(size); - return wrapper.css(props).show(); + return wrapper.css( props ).show(); }, - removeWrapper: function(element) { - var parent, - active = document.activeElement; - - if (element.parent().is('.ui-effects-wrapper')) { - parent = element.parent().replaceWith(element); + removeWrapper: function( element ) { + var active = document.activeElement; + + if ( element.parent().is( ".ui-effects-wrapper" ) ) { + element.parent().replaceWith( element ); + // Fixes #7595 - Elements lose focus when wrapped. if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { $( active ).focus(); } - return parent; } - + + return element; }, - setTransition: function(element, list, factor, value) { + setTransition: function( element, list, factor, value ) { value = value || {}; - $.each(list, function(i, x){ - unit = element.cssUnit(x); - if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + $.each( list, function( i, x ) { + var unit = element.cssUnit( x ); + if ( unit[ 0 ] > 0 ) { + value[ x ] = unit[ 0 ] * factor + unit[ 1 ]; + } }); return value; } }); +// return an effect options object for the given parameters: +function _normalizeArguments( effect, options, speed, callback ) { -function _normalizeArguments(effect, options, speed, callback) { - // shift params for method overloading - if (typeof effect == 'object') { - callback = options; - speed = null; + // allow passing all options as the first parameter + if ( $.isPlainObject( effect ) ) { options = effect; - effect = options.effect; + effect = effect.effect; + } + + // convert to an object + effect = { effect: effect }; + + // catch (effect, null, ...) + if ( options == null ) { + options = {}; } - if ($.isFunction(options)) { + + // catch (effect, callback) + if ( $.isFunction( options ) ) { callback = options; speed = null; options = {}; } - if (typeof options == 'number' || $.fx.speeds[options]) { + + // catch (effect, speed, ?) + if ( typeof options === "number" || $.fx.speeds[ options ] ) { callback = speed; speed = options; options = {}; } - if ($.isFunction(speed)) { + + // catch (effect, options, callback) + if ( $.isFunction( speed ) ) { callback = speed; speed = null; } - options = options || {}; + // add options to effect + if ( options ) { + $.extend( effect, options ); + } speed = speed || options.duration; - speed = $.fx.off ? 0 : typeof speed == 'number' - ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + effect.duration = $.fx.off ? 0 : + typeof speed === "number" ? speed : + speed in $.fx.speeds ? $.fx.speeds[ speed ] : + $.fx.speeds._default; - callback = callback || options.complete; + effect.complete = callback || options.complete; - return [effect, options, speed, callback]; + return effect; } function standardSpeed( speed ) { @@ -4516,7252 +8097,6783 @@ function standardSpeed( speed ) { if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { return true; } - + // invalid strings - treat as "normal" speed - if ( typeof speed === "string" && !$.effects[ speed ] ) { + if ( typeof speed === "string" && !$.effects.effect[ speed ] ) { + // TODO: remove in 2.0 (#7115) + if ( backCompat && $.effects[ speed ] ) { + return false; + } return true; } - + return false; } $.fn.extend({ - effect: function(effect, options, speed, callback) { - var args = _normalizeArguments.apply(this, arguments), - // TODO: make effects take actual parameters instead of a hash - args2 = { - options: args[1], - duration: args[2], - callback: args[3] - }, - mode = args2.options.mode, - effectMethod = $.effects[effect]; - - if ( $.fx.off || !effectMethod ) { + effect: function( /* effect, options, speed, callback */ ) { + var args = _normalizeArguments.apply( this, arguments ), + mode = args.mode, + queue = args.queue, + effectMethod = $.effects.effect[ args.effect ], + + // DEPRECATED: remove in 2.0 (#7115) + oldEffectMethod = !effectMethod && backCompat && $.effects[ args.effect ]; + + if ( $.fx.off || !( effectMethod || oldEffectMethod ) ) { // delegate to the original method (e.g., .show()) if possible if ( mode ) { - return this[ mode ]( args2.duration, args2.callback ); + return this[ mode ]( args.duration, args.complete ); } else { - return this.each(function() { - if ( args2.callback ) { - args2.callback.call( this ); + return this.each( function() { + if ( args.complete ) { + args.complete.call( this ); } }); } } - - return effectMethod.call(this, args2); + + function run( next ) { + var elem = $( this ), + complete = args.complete, + mode = args.mode; + + function done() { + if ( $.isFunction( complete ) ) { + complete.call( elem[0] ); + } + if ( $.isFunction( next ) ) { + next(); + } + } + + // if the element is hiddden and mode is hide, + // or element is visible and mode is show + if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) { + done(); + } else { + effectMethod.call( elem[0], args, done ); + } + } + + // TODO: remove this check in 2.0, effectMethod will always be true + if ( effectMethod ) { + return queue === false ? this.each( run ) : this.queue( queue || "fx", run ); + } else { + // DEPRECATED: remove in 2.0 (#7115) + return oldEffectMethod.call(this, { + options: args, + duration: args.duration, + callback: args.complete, + mode: args.mode + }); + } }, _show: $.fn.show, - show: function(speed) { + show: function( speed ) { if ( standardSpeed( speed ) ) { - return this._show.apply(this, arguments); + return this._show.apply( this, arguments ); } else { - var args = _normalizeArguments.apply(this, arguments); - args[1].mode = 'show'; - return this.effect.apply(this, args); + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "show"; + return this.effect.call( this, args ); } }, _hide: $.fn.hide, - hide: function(speed) { + hide: function( speed ) { if ( standardSpeed( speed ) ) { - return this._hide.apply(this, arguments); + return this._hide.apply( this, arguments ); } else { - var args = _normalizeArguments.apply(this, arguments); - args[1].mode = 'hide'; - return this.effect.apply(this, args); + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "hide"; + return this.effect.call( this, args ); } }, // jQuery core overloads toggle and creates _toggle __toggle: $.fn.toggle, - toggle: function(speed) { + toggle: function( speed ) { if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { - return this.__toggle.apply(this, arguments); + return this.__toggle.apply( this, arguments ); } else { - var args = _normalizeArguments.apply(this, arguments); - args[1].mode = 'toggle'; - return this.effect.apply(this, args); + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "toggle"; + return this.effect.call( this, args ); } }, // helper functions cssUnit: function(key) { - var style = this.css(key), val = []; - $.each( ['em','px','%','pt'], function(i, unit){ - if(style.indexOf(unit) > 0) - val = [parseFloat(style), unit]; + var style = this.css( key ), + val = []; + + $.each( [ "em", "px", "%", "pt" ], function( i, unit ) { + if ( style.indexOf( unit ) > 0 ) { + val = [ parseFloat( style ), unit ]; + } }); return val; } }); - +})(); /******************************************************************************/ /*********************************** EASING ***********************************/ /******************************************************************************/ -/* - * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ - * - * Uses the built in easing capabilities added In jQuery 1.1 - * to offer multiple easing options - * - * TERMS OF USE - jQuery Easing - * - * Open source under the BSD License. - * - * Copyright 2008 George McGinley Smith - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without modification, - * are permitted provided that the following conditions are met: - * - * Redistributions of source code must retain the above copyright notice, this list of - * conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above copyright notice, this list - * of conditions and the following disclaimer in the documentation and/or other materials - * provided with the distribution. - * - * Neither the name of the author nor the names of contributors may be used to endorse - * or promote products derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY - * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE - * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, - * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE - * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED - * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING - * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED - * OF THE POSSIBILITY OF SUCH DAMAGE. - * -*/ +(function() { -// t: current time, b: begInnIng value, c: change In value, d: duration -$.easing.jswing = $.easing.swing; +// based on easing equations from Robert Penner (http://www.robertpenner.com/easing) -$.extend($.easing, -{ - def: 'easeOutQuad', - swing: function (x, t, b, c, d) { - //alert($.easing.default); - return $.easing[$.easing.def](x, t, b, c, d); - }, - easeInQuad: function (x, t, b, c, d) { - return c*(t/=d)*t + b; - }, - easeOutQuad: function (x, t, b, c, d) { - return -c *(t/=d)*(t-2) + b; - }, - easeInOutQuad: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t + b; - return -c/2 * ((--t)*(t-2) - 1) + b; - }, - easeInCubic: function (x, t, b, c, d) { - return c*(t/=d)*t*t + b; - }, - easeOutCubic: function (x, t, b, c, d) { - return c*((t=t/d-1)*t*t + 1) + b; - }, - easeInOutCubic: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t + b; - return c/2*((t-=2)*t*t + 2) + b; - }, - easeInQuart: function (x, t, b, c, d) { - return c*(t/=d)*t*t*t + b; - }, - easeOutQuart: function (x, t, b, c, d) { - return -c * ((t=t/d-1)*t*t*t - 1) + b; - }, - easeInOutQuart: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t*t + b; - return -c/2 * ((t-=2)*t*t*t - 2) + b; - }, - easeInQuint: function (x, t, b, c, d) { - return c*(t/=d)*t*t*t*t + b; - }, - easeOutQuint: function (x, t, b, c, d) { - return c*((t=t/d-1)*t*t*t*t + 1) + b; - }, - easeInOutQuint: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; - return c/2*((t-=2)*t*t*t*t + 2) + b; - }, - easeInSine: function (x, t, b, c, d) { - return -c * Math.cos(t/d * (Math.PI/2)) + c + b; - }, - easeOutSine: function (x, t, b, c, d) { - return c * Math.sin(t/d * (Math.PI/2)) + b; - }, - easeInOutSine: function (x, t, b, c, d) { - return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; - }, - easeInExpo: function (x, t, b, c, d) { - return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; - }, - easeOutExpo: function (x, t, b, c, d) { - return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; - }, - easeInOutExpo: function (x, t, b, c, d) { - if (t==0) return b; - if (t==d) return b+c; - if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; - return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; - }, - easeInCirc: function (x, t, b, c, d) { - return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; - }, - easeOutCirc: function (x, t, b, c, d) { - return c * Math.sqrt(1 - (t=t/d-1)*t) + b; - }, - easeInOutCirc: function (x, t, b, c, d) { - if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; - return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; - }, - easeInElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +}); + +$.extend( baseEasings, { + Sine: function ( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); }, - easeOutElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + Circ: function ( p ) { + return 1 - Math.sqrt( 1 - p * p ); }, - easeInOutElastic: function (x, t, b, c, d) { - var s=1.70158;var p=0;var a=c; - if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); - if (a < Math.abs(c)) { a=c; var s=p/4; } - else var s = p/(2*Math.PI) * Math.asin (c/a); - if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; - return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; - }, - easeInBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - return c*(t/=d)*t*((s+1)*t - s) + b; - }, - easeOutBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; - }, - easeInOutBack: function (x, t, b, c, d, s) { - if (s == undefined) s = 1.70158; - if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; - return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 ); }, - easeInBounce: function (x, t, b, c, d) { - return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; - }, - easeOutBounce: function (x, t, b, c, d) { - if ((t/=d) < (1/2.75)) { - return c*(7.5625*t*t) + b; - } else if (t < (2/2.75)) { - return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; - } else if (t < (2.5/2.75)) { - return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; - } else { - return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; - } + Back: function( p ) { + return p * p * ( 3 * p - 2 ); }, - easeInOutBounce: function (x, t, b, c, d) { - if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; - return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + Bounce: function ( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); } }); -/* - * - * TERMS OF USE - EASING EQUATIONS - * - * Open source under the BSD License. - * - * Copyright 2001 Robert Penner - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without modification, - * are permitted provided that the following conditions are met: - * - * Redistributions of source code must retain the above copyright notice, this list of - * conditions and the following disclaimer. - * Redistributions in binary form must reproduce the above copyright notice, this list - * of conditions and the following disclaimer in the documentation and/or other materials - * provided with the distribution. - * - * Neither the name of the author nor the names of contributors may be used to endorse - * or promote products derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY - * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE - * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, - * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE - * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED - * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING - * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED - * OF THE POSSIBILITY OF SUCH DAMAGE. - * - */ +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < 0.5 ? + easeIn( p * 2 ) / 2 : + 1 - easeIn( p * -2 + 2 ) / 2; + }; +}); + +})(); + +})(jQuery)); +(function( $, undefined ) { + +var rvertical = /up|down|vertical/, + rpositivemotion = /up|left|vertical|horizontal/; + +$.effects.effect.blind = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + direction = o.direction || "up", + vertical = rvertical.test( direction ), + ref = vertical ? "height" : "width", + ref2 = vertical ? "top" : "left", + motion = rpositivemotion.test( direction ), + animation = {}, + show = mode === "show", + wrapper, distance, margin; + + // if already wrapped, the wrapper's properties are my property. #6245 + if ( el.parent().is( ".ui-effects-wrapper" ) ) { + $.effects.save( el.parent(), props ); + } else { + $.effects.save( el, props ); + } + el.show(); + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + distance = wrapper[ ref ](); + margin = parseFloat( wrapper.css( ref2 ) ) || 0; + + animation[ ref ] = show ? distance : 0; + if ( !motion ) { + el + .css( vertical ? "bottom" : "right", 0 ) + .css( vertical ? "top" : "left", "auto" ) + .css({ position: "absolute" }); + + animation[ ref2 ] = show ? margin : distance + margin; + } + + // start at 0 if we are showing + if ( show ) { + wrapper.css( ref, 0 ); + if ( ! motion ) { + wrapper.css( ref2, margin + distance ); + } + } + + // Animate + wrapper.animate( animation, { + duration: o.duration, + easing: o.easing, + queue: false, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); + +}; })(jQuery); -/* - * jQuery UI Effects Blind 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Blind - * - * Depends: - * jquery.effects.core.js - */ (function( $, undefined ) { -$.effects.blind = function(o) { +$.effects.effect.bounce = function( o, done ) { + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + + // defaults: + mode = $.effects.setMode( el, o.mode || "effect" ), + hide = mode === "hide", + show = mode === "show", + direction = o.direction || "up", + distance = o.distance, + times = o.times || 5, + + // number of internal animations + anims = times * 2 + ( show || hide ? 1 : 0 ), + speed = o.duration / anims, + easing = o.easing, + + // utility: + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ), + i, + upAnim, + downAnim, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + // Avoid touching opacity to prevent clearType and PNG issues in IE + if ( show || hide ) { + props.push( "opacity" ); + } + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); // Create Wrapper - return this.queue(function() { + // default distance for the BIGGEST bounce is the outer Distance / 3 + if ( !distance ) { + distance = el[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3; + } - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; + if ( show ) { + downAnim = { opacity: 1 }; + downAnim[ ref ] = 0; - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'vertical'; // Default direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var ref = (direction == 'vertical') ? 'height' : 'width'; - var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); - if(mode == 'show') wrapper.css(ref, 0); // Shift - - // Animation - var animation = {}; - animation[ref] = mode == 'show' ? distance : 0; - - // Animate - wrapper.animate(animation, o.duration, o.options.easing, function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }); + // if we are showing, force opacity 0 and set the initial position + // then do the "first" animation + el.css( "opacity", 0 ) + .css( ref, motion ? -distance * 2 : distance * 2 ) + .animate( downAnim, speed, easing ); + } + + // start at the smallest distance if we are hiding + if ( hide ) { + distance = distance / Math.pow( 2, times - 1 ); + } + + downAnim = {}; + downAnim[ ref ] = 0; + // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here + for ( i = 0; i < times; i++ ) { + upAnim = {}; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + el.animate( upAnim, speed, easing ) + .animate( downAnim, speed, easing ); + + distance = hide ? distance * 2 : distance / 2; + } + + // Last Bounce when Hiding + if ( hide ) { + upAnim = { opacity: 0 }; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + el.animate( upAnim, speed, easing ); + } + + el.queue(function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); }); + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); + }; })(jQuery); -/* - * jQuery UI Effects Bounce 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Bounce - * - * Depends: - * jquery.effects.core.js - */ (function( $, undefined ) { -$.effects.bounce = function(o) { +$.effects.effect.clip = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "vertical", + vert = direction === "vertical", + size = vert ? "height" : "width", + position = vert ? "top" : "left", + animation = {}, + wrapper, animate, distance; + + // Save & Show + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + animate = ( el[0].tagName === "IMG" ) ? wrapper : el; + distance = animate[ size ](); - return this.queue(function() { + // Shift + if ( show ) { + animate.css( size, 0 ); + animate.css( position, distance / 2 ); + } - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; + // Create Animation Object: + animation[ size ] = show ? distance : 0; + animation[ position ] = show ? 0 : distance / 2; - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var direction = o.options.direction || 'up'; // Default direction - var distance = o.options.distance || 20; // Default distance - var times = o.options.times || 5; // Default # of times - var speed = o.duration || 250; // Default speed per bounce - if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); - if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift - if (mode == 'hide') distance = distance / (times * 2); - if (mode != 'hide') times--; - - // Animate - if (mode == 'show') { // Show Bounce - var animation = {opacity: 1}; - animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation, speed / 2, o.options.easing); - distance = distance / 2; - times--; - }; - for (var i = 0; i < times; i++) { // Bounces - var animation1 = {}, animation2 = {}; - animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); - distance = (mode == 'hide') ? distance * 2 : distance / 2; - }; - if (mode == 'hide') { // Last Bounce - var animation = {opacity: 0}; - animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - el.animate(animation, speed / 2, o.options.easing, function(){ - el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - } else { - var animation1 = {}, animation2 = {}; - animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; - el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - }); - }; - el.queue('fx', function() { el.dequeue(); }); - el.dequeue(); + // Animate + animate.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( !show ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } }); }; })(jQuery); -/* - * jQuery UI Effects Clip 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Clip - * - * Depends: - * jquery.effects.core.js - */ (function( $, undefined ) { -$.effects.clip = function(o) { +$.effects.effect.drop = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "opacity", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "left", + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ) ? "pos" : "neg", + animation = { + opacity: show ? 1 : 0 + }, + distance; + + // Adjust + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + distance = o.distance || el[ ref === "top" ? "outerHeight": "outerWidth" ]( true ) / 2; + + if ( show ) { + el + .css( "opacity", 0 ) + .css( ref, motion === "pos" ? -distance : distance ); + } + + // Animation + animation[ ref ] = ( show ? + ( motion === "pos" ? "+=" : "-=" ) : + ( motion === "pos" ? "-=" : "+=" ) ) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.explode = function( o, done ) { + + var rows = o.pieces ? Math.round( Math.sqrt( o.pieces ) ) : 3, + cells = rows, + el = $( this ), + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + + // show and then visibility:hidden the element before calculating offset + offset = el.show().css( "visibility", "hidden" ).offset(), + + // width and height of a piece + width = Math.ceil( el.outerWidth() / cells ), + height = Math.ceil( el.outerHeight() / rows ), + pieces = [], + + // loop + i, j, left, top, mx, my; + + // children animate complete: + function childComplete() { + pieces.push( this ); + if ( pieces.length === rows * cells ) { + animComplete(); + } + } + + // clone the element for each row and cell. + for( i = 0; i < rows ; i++ ) { // ===> + top = offset.top + i * height; + my = i - ( rows - 1 ) / 2 ; + + for( j = 0; j < cells ; j++ ) { // ||| + left = offset.left + j * width; + mx = j - ( cells - 1 ) / 2 ; + + // Create a clone of the now hidden main element that will be absolute positioned + // within a wrapper div off the -left and -top equal to size of our pieces + el + .clone() + .appendTo( "body" ) + .wrap( "
      " ) + .css({ + position: "absolute", + visibility: "visible", + left: -j * width, + top: -i * height + }) + + // select the wrapper - make it overflow: hidden and absolute positioned based on + // where the original was located +left and +top equal to the size of pieces + .parent() + .addClass( "ui-effects-explode" ) + .css({ + position: "absolute", + overflow: "hidden", + width: width, + height: height, + left: left + ( show ? mx * width : 0 ), + top: top + ( show ? my * height : 0 ), + opacity: show ? 0 : 1 + }).animate({ + left: left + ( show ? 0 : mx * width ), + top: top + ( show ? 0 : my * height ), + opacity: show ? 1 : 0 + }, o.duration || 500, o.easing, childComplete ); + } + } + + function animComplete() { + el.css({ + visibility: "visible" + }); + $( pieces ).remove(); + if ( !show ) { + el.hide(); + } + done(); + } +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.fade = function( o, done ) { + var el = $( this ), + mode = $.effects.setMode( el, o.mode || "toggle" ); + + el.animate({ + opacity: mode + }, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: done + }); +}; + +})( jQuery ); +(function( $, undefined ) { + +$.effects.effect.fold = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + hide = mode === "hide", + size = o.size || 15, + percent = /([0-9]+)%/.exec( size ), + horizFirst = !!o.horizFirst, + widthFirst = show !== horizFirst, + ref = widthFirst ? [ "width", "height" ] : [ "height", "width" ], + duration = o.duration / 2, + wrapper, distance, + animation1 = {}, + animation2 = {}; + + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + distance = widthFirst ? + [ wrapper.width(), wrapper.height() ] : + [ wrapper.height(), wrapper.width() ]; + + if ( percent ) { + size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ]; + } + if ( show ) { + wrapper.css( horizFirst ? { + height: 0, + width: size + } : { + height: size, + width: 0 + }); + } + + // Animation + animation1[ ref[ 0 ] ] = show ? distance[ 0 ] : size; + animation2[ ref[ 1 ] ] = show ? distance[ 1 ] : 0; + + // Animate + wrapper + .animate( animation1, duration, o.easing ) + .animate( animation2, duration, o.easing, function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.highlight = function( o, done ) { + var elem = $( this ), + props = [ "backgroundImage", "backgroundColor", "opacity" ], + mode = $.effects.setMode( elem, o.mode || "show" ), + animation = { + backgroundColor: elem.css( "backgroundColor" ) + }; + + if (mode === "hide") { + animation.opacity = 0; + } + + $.effects.save( elem, props ); + + elem + .show() + .css({ + backgroundImage: "none", + backgroundColor: o.color || "#ffff99" + }) + .animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + elem.hide(); + } + $.effects.restore( elem, props ); + done(); + } + }); +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.pulsate = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "show" ), + show = mode === "show", + hide = mode === "hide", + showhide = ( show || mode === "hide" ), + + // showing or hiding leaves of the "last" animation + anims = ( ( o.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ), + duration = o.duration / anims, + animateTo = 0, + queue = elem.queue(), + queuelen = queue.length, + i; + + if ( show || !elem.is(":visible")) { + elem.css( "opacity", 0 ).show(); + animateTo = 1; + } + + // anims - 1 opacity "toggles" + for ( i = 1; i < anims; i++ ) { + elem.animate({ + opacity: animateTo + }, duration, o.easing ); + animateTo = 1 - animateTo; + } + + elem.animate({ + opacity: animateTo + }, duration, o.easing); - return this.queue(function() { + elem.queue(function() { + if ( hide ) { + elem.hide(); + } + done(); + }); - // Create element - var el = $(this), props = ['position','top','bottom','left','right','height','width']; + // We just queued up "anims" animations, we need to put them next in the queue + if ( queuelen > 1 ) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + elem.dequeue(); +}; - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'vertical'; // Default direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var animate = el[0].tagName == 'IMG' ? wrapper : el; - var ref = { - size: (direction == 'vertical') ? 'height' : 'width', - position: (direction == 'vertical') ? 'top' : 'left' +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.puff = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "hide" ), + hide = mode === "hide", + percent = parseInt( o.percent, 10 ) || 150, + factor = percent / 100, + original = { + height: elem.height(), + width: elem.width(), + outerHeight: elem.outerHeight(), + outerWidth: elem.outerWidth() }; - var distance = (direction == 'vertical') ? animate.height() : animate.width(); - if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift - - // Animation - var animation = {}; - animation[ref.size] = mode == 'show' ? distance : 0; - animation[ref.position] = mode == 'show' ? 0 : distance / 2; - - // Animate - animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); - }}); + $.extend( o, { + effect: "scale", + queue: false, + fade: true, + mode: mode, + complete: done, + percent: hide ? percent : 100, + from: hide ? + original : + { + height: original.height * factor, + width: original.width * factor, + outerHeight: original.outerHeight * factor, + outerWidth: original.outerWidth * factor + } }); + elem.effect( o ); }; -})(jQuery); -/* - * jQuery UI Effects Drop 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Drop - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { +$.effects.effect.scale = function( o, done ) { + + // Create element + var el = $( this ), + options = $.extend( true, {}, o ), + mode = $.effects.setMode( el, o.mode || "effect" ), + percent = parseInt( o.percent, 10 ) || + ( parseInt( o.percent, 10 ) === 0 ? 0 : ( mode === "hide" ? 0 : 100 ) ), + direction = o.direction || "both", + origin = o.origin, + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }, + factor = { + y: direction !== "horizontal" ? (percent / 100) : 1, + x: direction !== "vertical" ? (percent / 100) : 1 + }; -$.effects.drop = function(o) { + // We are going to pass this effect to the size effect: + options.effect = "size"; + options.queue = false; + options.complete = done; - return this.queue(function() { + // Set default origin and restore for show/hide + if ( mode !== "effect" ) { + options.origin = origin || ["middle","center"]; + options.restore = true; + } - // Create element - var el = $(this), props = ['position','top','bottom','left','right','opacity']; + options.from = o.from || ( mode === "show" ? { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + } : original ); + options.to = { + height: original.height * factor.y, + width: original.width * factor.x, + outerHeight: original.outerHeight * factor.y, + outerWidth: original.outerWidth * factor.x + }; - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var direction = o.options.direction || 'left'; // Default Direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); - if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift - - // Animation - var animation = {opacity: mode == 'show' ? 1 : 0}; - animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - - // Animate - el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); + // Fade option to support puff + if ( options.fade ) { + if ( mode === "show" ) { + options.from.opacity = 0; + options.to.opacity = 1; + } + if ( mode === "hide" ) { + options.from.opacity = 1; + options.to.opacity = 0; + } + } - }); + // Animate + el.effect( options ); }; -})(jQuery); -/* - * jQuery UI Effects Explode 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Explode - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { +$.effects.effect.size = function( o, done ) { -$.effects.explode = function(o) { + // Create element + var original, baseline, factor, + el = $( this ), + props0 = [ "position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity" ], - return this.queue(function() { + // Always restore + props1 = [ "position", "top", "bottom", "left", "right", "overflow", "opacity" ], - var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; - var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + // Copy for children + props2 = [ "width", "height", "overflow" ], + cProps = [ "fontSize" ], + vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ], + hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ], - o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; - var el = $(this).show().css('visibility', 'hidden'); - var offset = el.offset(); + // Set options + mode = $.effects.setMode( el, o.mode || "effect" ), + restore = o.restore || mode !== "effect", + scale = o.scale || "both", + origin = o.origin || [ "middle", "center" ], + position = el.css( "position" ), + props = restore ? props0 : props1, + zero = { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + }; - //Substract the margins - not fixing the problem yet. - offset.top -= parseInt(el.css("marginTop"),10) || 0; - offset.left -= parseInt(el.css("marginLeft"),10) || 0; + if ( mode === "show" ) { + el.show(); + } + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }; - var width = el.outerWidth(true); - var height = el.outerHeight(true); + if ( o.mode === "toggle" && mode === "show" ) { + el.from = o.to || zero; + el.to = o.from || original; + } else { + el.from = o.from || ( mode === "show" ? zero : original ); + el.to = o.to || ( mode === "hide" ? zero : original ); + } - for(var i=0;i
      ') - .css({ - position: 'absolute', - visibility: 'visible', - left: -j*(width/cells), - top: -i*(height/rows) - }) - .parent() - .addClass('ui-effects-explode') - .css({ - position: 'absolute', - overflow: 'hidden', - width: width/cells, - height: height/rows, - left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), - top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), - opacity: o.options.mode == 'show' ? 0 : 1 - }).animate({ - left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), - top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), - opacity: o.options.mode == 'show' ? 1 : 0 - }, o.duration || 500); + // Set scaling factor + factor = { + from: { + y: el.from.height / original.height, + x: el.from.width / original.width + }, + to: { + y: el.to.height / original.height, + x: el.to.width / original.width + } + }; + + // Scale the css box + if ( scale === "box" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( vProps ); + el.from = $.effects.setTransition( el, vProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, vProps, factor.to.y, el.to ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + props = props.concat( hProps ); + el.from = $.effects.setTransition( el, hProps, factor.from.x, el.from ); + el.to = $.effects.setTransition( el, hProps, factor.to.x, el.to ); } } - // Set a timeout, to call the callback approx. when the other animations have finished - setTimeout(function() { + // Scale the content + if ( scale === "content" || scale === "both" ) { - o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); - if(o.callback) o.callback.apply(el[0]); // Callback - el.dequeue(); + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( cProps ).concat( props2 ); + el.from = $.effects.setTransition( el, cProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, cProps, factor.to.y, el.to ); + } + } - $('div.ui-effects-explode').remove(); + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + el.css( "overflow", "hidden" ).css( el.from ); + + // Adjust + if (origin) { // Calculate baseline shifts + baseline = $.effects.getBaseline( origin, original ); + el.from.top = ( original.outerHeight - el.outerHeight() ) * baseline.y; + el.from.left = ( original.outerWidth - el.outerWidth() ) * baseline.x; + el.to.top = ( original.outerHeight - el.to.outerHeight ) * baseline.y; + el.to.left = ( original.outerWidth - el.to.outerWidth ) * baseline.x; + } + el.css( el.from ); // set top & left + + // Animate + if ( scale === "content" || scale === "both" ) { // Scale the children + + // Add margins/font-size + vProps = vProps.concat([ "marginTop", "marginBottom" ]).concat(cProps); + hProps = hProps.concat([ "marginLeft", "marginRight" ]); + props2 = props0.concat(vProps).concat(hProps); + + el.find( "*[width]" ).each( function(){ + var child = $( this ), + c_original = { + height: child.height(), + width: child.width(), + outerHeight: child.outerHeight(), + outerWidth: child.outerWidth() + }; + if (restore) { + $.effects.save(child, props2); + } - }, o.duration || 500); + child.from = { + height: c_original.height * factor.from.y, + width: c_original.width * factor.from.x, + outerHeight: c_original.outerHeight * factor.from.y, + outerWidth: c_original.outerWidth * factor.from.x + }; + child.to = { + height: c_original.height * factor.to.y, + width: c_original.width * factor.to.x, + outerHeight: c_original.height * factor.to.y, + outerWidth: c_original.width * factor.to.x + }; + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + child.from = $.effects.setTransition( child, vProps, factor.from.y, child.from ); + child.to = $.effects.setTransition( child, vProps, factor.to.y, child.to ); + } - }); + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + child.from = $.effects.setTransition( child, hProps, factor.from.x, child.from ); + child.to = $.effects.setTransition( child, hProps, factor.to.x, child.to ); + } -}; + // Animate children + child.css( child.from ); + child.animate( child.to, o.duration, o.easing, function() { -})(jQuery); -/* - * jQuery UI Effects Fade 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fade - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { + // Restore children + if ( restore ) { + $.effects.restore( child, props2 ); + } + }); + }); + } -$.effects.fade = function(o) { - return this.queue(function() { - var elem = $(this), - mode = $.effects.setMode(elem, o.options.mode || 'hide'); + // Animate + el.animate( el.to, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( el.to.opacity === 0 ) { + el.css( "opacity", el.from.opacity ); + } + if( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + if ( !restore ) { + + // we need to calculate our new positioning based on the scaling + if ( position === "static" ) { + el.css({ + position: "relative", + top: el.to.top, + left: el.to.left + }); + } else { + $.each([ "top", "left" ], function( idx, pos ) { + el.css( pos, function( _, str ) { + var val = parseInt( str, 10 ), + toRef = idx ? el.to.left : el.to.top; + + // if original was "auto", recalculate the new value from wrapper + if ( str === "auto" ) { + return toRef + "px"; + } - elem.animate({ opacity: mode }, { - queue: false, - duration: o.duration, - easing: o.options.easing, - complete: function() { - (o.callback && o.callback.apply(this, arguments)); - elem.dequeue(); + return val + toRef + "px"; + }); + }); + } } - }); + + $.effects.removeWrapper( el ); + done(); + } }); + }; })(jQuery); -/* - * jQuery UI Effects Fold 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fold - * - * Depends: - * jquery.effects.core.js - */ (function( $, undefined ) { -$.effects.fold = function(o) { - - return this.queue(function() { - - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; - - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode - var size = o.options.size || 15; // Default fold size - var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value - var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var widthFirst = ((mode == 'show') != horizFirst); - var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; - var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; - var percent = /([0-9]+)%/.exec(size); - if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; - if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift - - // Animation - var animation1 = {}, animation2 = {}; - animation1[ref[0]] = mode == 'show' ? distance[0] : size; - animation2[ref[1]] = mode == 'show' ? distance[1] : 0; - - // Animate - wrapper.animate(animation1, duration, o.options.easing) - .animate(animation2, duration, o.options.easing, function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(el[0], arguments); // Callback - el.dequeue(); +$.effects.effect.shake = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "effect" ), + direction = o.direction || "left", + distance = o.distance || 20, + times = o.times || 3, + anims = times * 2 + 1, + speed = Math.round(o.duration/anims), + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + animation = {}, + animation1 = {}, + animation2 = {}, + i, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + // Animation + animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance; + animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2; + animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2; + + // Animate + el.animate( animation, speed, o.easing ); + + // Shakes + for ( i = 1; i < times; i++ ) { + el.animate( animation1, speed, o.easing ).animate( animation2, speed, o.easing ); + } + el + .animate( animation1, speed, o.easing ) + .animate( animation, speed / 2, o.easing ) + .queue(function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); }); - }); + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); }; })(jQuery); -/* - * jQuery UI Effects Highlight 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Highlight - * - * Depends: - * jquery.effects.core.js - */ (function( $, undefined ) { -$.effects.highlight = function(o) { - return this.queue(function() { - var elem = $(this), - props = ['backgroundImage', 'backgroundColor', 'opacity'], - mode = $.effects.setMode(elem, o.options.mode || 'show'), - animation = { - backgroundColor: elem.css('backgroundColor') - }; +$.effects.effect.slide = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "width", "height" ], + mode = $.effects.setMode( el, o.mode || "show" ), + show = mode === "show", + direction = o.direction || "left", + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + distance, + animation = {}; + + // Adjust + $.effects.save( el, props ); + el.show(); + distance = o.distance || el[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ); + + $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + if ( show ) { + el.css( ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance ); + } - if (mode == 'hide') { - animation.opacity = 0; + // Animation + animation[ ref ] = ( show ? + ( positiveMotion ? "+=" : "-=") : + ( positiveMotion ? "-=" : "+=")) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); } + }); +}; - $.effects.save(elem, props); - elem - .show() +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.transfer = function( o, done ) { + var elem = $( this ), + target = $( o.to ), + targetFixed = target.css( "position" ) === "fixed", + body = $("body"), + fixTop = targetFixed ? body.scrollTop() : 0, + fixLeft = targetFixed ? body.scrollLeft() : 0, + endPosition = target.offset(), + animation = { + top: endPosition.top - fixTop , + left: endPosition.left - fixLeft , + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $( '
      ' ) + .appendTo( document.body ) + .addClass( o.className ) .css({ - backgroundImage: 'none', - backgroundColor: o.options.color || '#ffff99' + top: startPosition.top - fixTop , + left: startPosition.left - fixLeft , + height: elem.innerHeight(), + width: elem.innerWidth(), + position: targetFixed ? "fixed" : "absolute" }) - .animate(animation, { - queue: false, - duration: o.duration, - easing: o.options.easing, - complete: function() { - (mode == 'hide' && elem.hide()); - $.effects.restore(elem, props); - (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); - (o.callback && o.callback.apply(this, arguments)); - elem.dequeue(); - } + .animate( animation, o.duration, o.easing, function() { + transfer.remove(); + done(); }); - }); }; })(jQuery); -/* - * jQuery UI Effects Pulsate 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Pulsate - * - * Depends: - * jquery.effects.core.js - */ (function( $, undefined ) { -$.effects.pulsate = function(o) { - return this.queue(function() { - var elem = $(this), - mode = $.effects.setMode(elem, o.options.mode || 'show'); - times = ((o.options.times || 5) * 2) - 1; - duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, - isVisible = elem.is(':visible'), - animateTo = 0; - - if (!isVisible) { - elem.css('opacity', 0).show(); - animateTo = 1; - } - - if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { - times--; - } +var mouseHandled = false; - for (var i = 0; i < times; i++) { - elem.animate({ opacity: animateTo }, duration, o.options.easing); - animateTo = (animateTo + 1) % 2; - } +$.widget( "ui.menu", { + version: "1.9.2", + defaultElement: "
        ", + delay: 300, + options: { + icons: { + submenu: "ui-icon-carat-1-e" + }, + menus: "ul", + position: { + my: "left top", + at: "right top" + }, + role: "menu", - elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { - if (animateTo == 0) { - elem.hide(); - } - (o.callback && o.callback.apply(this, arguments)); - }); + // callbacks + blur: null, + focus: null, + select: null + }, - elem - .queue('fx', function() { elem.dequeue(); }) - .dequeue(); - }); -}; + _create: function() { + this.activeMenu = this.element; + this.element + .uniqueId() + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ) + .attr({ + role: this.options.role, + tabIndex: 0 + }) + // need to catch all clicks on disabled menu + // not possible through _on + .bind( "click" + this.eventNamespace, $.proxy(function( event ) { + if ( this.options.disabled ) { + event.preventDefault(); + } + }, this )); -})(jQuery); -/* - * jQuery UI Effects Scale 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Scale - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { + if ( this.options.disabled ) { + this.element + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } -$.effects.puff = function(o) { - return this.queue(function() { - var elem = $(this), - mode = $.effects.setMode(elem, o.options.mode || 'hide'), - percent = parseInt(o.options.percent, 10) || 150, - factor = percent / 100, - original = { height: elem.height(), width: elem.width() }; - - $.extend(o.options, { - fade: true, - mode: mode, - percent: mode == 'hide' ? percent : 100, - from: mode == 'hide' - ? original - : { - height: original.height * factor, - width: original.width * factor + this._on({ + // Prevent focus from sticking to links inside menu after clicking + // them (focus should always stay on UL during navigation). + "mousedown .ui-menu-item > a": function( event ) { + event.preventDefault(); + }, + "click .ui-state-disabled > a": function( event ) { + event.preventDefault(); + }, + "click .ui-menu-item:has(a)": function( event ) { + var target = $( event.target ).closest( ".ui-menu-item" ); + if ( !mouseHandled && target.not( ".ui-state-disabled" ).length ) { + mouseHandled = true; + + this.select( event ); + // Open submenu on click + if ( target.has( ".ui-menu" ).length ) { + this.expand( event ); + } else if ( !this.element.is( ":focus" ) ) { + // Redirect focus to the menu + this.element.trigger( "focus", [ true ] ); + + // If the active item is on the top level, let it stay active. + // Otherwise, blur the active item since it is no longer visible. + if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) { + clearTimeout( this.timer ); + } + } + } + }, + "mouseenter .ui-menu-item": function( event ) { + var target = $( event.currentTarget ); + // Remove ui-state-active class from siblings of the newly focused menu item + // to avoid a jump caused by adjacent elements both having a class with a border + target.siblings().children( ".ui-state-active" ).removeClass( "ui-state-active" ); + this.focus( event, target ); + }, + mouseleave: "collapseAll", + "mouseleave .ui-menu": "collapseAll", + focus: function( event, keepActiveItem ) { + // If there's already an active item, keep it active + // If not, activate the first item + var item = this.active || this.element.children( ".ui-menu-item" ).eq( 0 ); + + if ( !keepActiveItem ) { + this.focus( event, item ); } + }, + blur: function( event ) { + this._delay(function() { + if ( !$.contains( this.element[0], this.document[0].activeElement ) ) { + this.collapseAll( event ); + } + }); + }, + keydown: "_keydown" }); - elem.effect('scale', o.options, o.duration, o.callback); - elem.dequeue(); - }); -}; - -$.effects.scale = function(o) { - - return this.queue(function() { + this.refresh(); - // Create element - var el = $(this); + // Clicks outside of a menu collapse any open menus + this._on( this.document, { + click: function( event ) { + if ( !$( event.target ).closest( ".ui-menu" ).length ) { + this.collapseAll( event ); + } - // Set options - var options = $.extend(true, {}, o.options); - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent - var direction = o.options.direction || 'both'; // Set default axis - var origin = o.options.origin; // The origin of the scaling - if (mode != 'effect') { // Set default origin and restore for show/hide - options.origin = origin || ['middle','center']; - options.restore = true; - } - var original = {height: el.height(), width: el.width()}; // Save original - el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state - - // Adjust - var factor = { // Set scaling factor - y: direction != 'horizontal' ? (percent / 100) : 1, - x: direction != 'vertical' ? (percent / 100) : 1 - }; - el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + // Reset the mouseHandled flag + mouseHandled = false; + } + }); + }, - if (o.options.fade) { // Fade option to support puff - if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; - if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; - }; + _destroy: function() { + // Destroy (sub)menus + this.element + .removeAttr( "aria-activedescendant" ) + .find( ".ui-menu" ).andSelf() + .removeClass( "ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .show(); + + // Destroy menu items + this.element.find( ".ui-menu-item" ) + .removeClass( "ui-menu-item" ) + .removeAttr( "role" ) + .removeAttr( "aria-disabled" ) + .children( "a" ) + .removeUniqueId() + .removeClass( "ui-corner-all ui-state-hover" ) + .removeAttr( "tabIndex" ) + .removeAttr( "role" ) + .removeAttr( "aria-haspopup" ) + .children().each( function() { + var elem = $( this ); + if ( elem.data( "ui-menu-submenu-carat" ) ) { + elem.remove(); + } + }); - // Animation - options.from = el.from; options.to = el.to; options.mode = mode; + // Destroy menu dividers + this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" ); + }, - // Animate - el.effect('size', options, o.duration, o.callback); - el.dequeue(); - }); + _keydown: function( event ) { + var match, prev, character, skip, regex, + preventDefault = true; -}; + function escape( value ) { + return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ); + } -$.effects.size = function(o) { + switch ( event.keyCode ) { + case $.ui.keyCode.PAGE_UP: + this.previousPage( event ); + break; + case $.ui.keyCode.PAGE_DOWN: + this.nextPage( event ); + break; + case $.ui.keyCode.HOME: + this._move( "first", "first", event ); + break; + case $.ui.keyCode.END: + this._move( "last", "last", event ); + break; + case $.ui.keyCode.UP: + this.previous( event ); + break; + case $.ui.keyCode.DOWN: + this.next( event ); + break; + case $.ui.keyCode.LEFT: + this.collapse( event ); + break; + case $.ui.keyCode.RIGHT: + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + this.expand( event ); + } + break; + case $.ui.keyCode.ENTER: + case $.ui.keyCode.SPACE: + this._activate( event ); + break; + case $.ui.keyCode.ESCAPE: + this.collapse( event ); + break; + default: + preventDefault = false; + prev = this.previousFilter || ""; + character = String.fromCharCode( event.keyCode ); + skip = false; - return this.queue(function() { + clearTimeout( this.filterTimer ); - // Create element - var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; - var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore - var props2 = ['width','height','overflow']; // Copy for children - var cProps = ['fontSize']; - var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; - var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + if ( character === prev ) { + skip = true; + } else { + character = prev + character; + } - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var restore = o.options.restore || false; // Default restore - var scale = o.options.scale || 'both'; // Default scale mode - var origin = o.options.origin; // The origin of the sizing - var original = {height: el.height(), width: el.width()}; // Save original - el.from = o.options.from || original; // Default from state - el.to = o.options.to || original; // Default to state - // Adjust - if (origin) { // Calculate baseline shifts - var baseline = $.effects.getBaseline(origin, original); - el.from.top = (original.height - el.from.height) * baseline.y; - el.from.left = (original.width - el.from.width) * baseline.x; - el.to.top = (original.height - el.to.height) * baseline.y; - el.to.left = (original.width - el.to.width) * baseline.x; - }; - var factor = { // Set scaling factor - from: {y: el.from.height / original.height, x: el.from.width / original.width}, - to: {y: el.to.height / original.height, x: el.to.width / original.width} - }; - if (scale == 'box' || scale == 'both') { // Scale the css box - if (factor.from.y != factor.to.y) { // Vertical props scaling - props = props.concat(vProps); - el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); - el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); - }; - if (factor.from.x != factor.to.x) { // Horizontal props scaling - props = props.concat(hProps); - el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); - el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); - }; - }; - if (scale == 'content' || scale == 'both') { // Scale the content - if (factor.from.y != factor.to.y) { // Vertical props scaling - props = props.concat(cProps); - el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); - el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); - }; - }; - $.effects.save(el, restore ? props : props1); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - el.css('overflow','hidden').css(el.from); // Shift - - // Animate - if (scale == 'content' || scale == 'both') { // Scale the children - vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size - hProps = hProps.concat(['marginLeft','marginRight']); // Add margins - props2 = props.concat(vProps).concat(hProps); // Concat - el.find("*[width]").each(function(){ - child = $(this); - if (restore) $.effects.save(child, props2); - var c_original = {height: child.height(), width: child.width()}; // Save original - child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; - child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; - if (factor.from.y != factor.to.y) { // Vertical props scaling - child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); - child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); - }; - if (factor.from.x != factor.to.x) { // Horizontal props scaling - child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); - child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); - }; - child.css(child.from); // Shift children - child.animate(child.to, o.duration, o.options.easing, function(){ - if (restore) $.effects.restore(child, props2); // Restore children - }); // Animate children + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); }); - }; + match = skip && match.index( this.active.next() ) !== -1 ? + this.active.nextAll( ".ui-menu-item" ) : + match; + + // If no matches on the current filter, reset to the last character pressed + // to move down the menu to the first item that starts with that character + if ( !match.length ) { + character = String.fromCharCode( event.keyCode ); + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); + }); + } - // Animate - el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if (el.to.opacity === 0) { - el.css('opacity', el.from.opacity); + if ( match.length ) { + this.focus( event, match ); + if ( match.length > 1 ) { + this.previousFilter = character; + this.filterTimer = this._delay(function() { + delete this.previousFilter; + }, 1000 ); + } else { + delete this.previousFilter; + } + } else { + delete this.previousFilter; } - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); + } - }); + if ( preventDefault ) { + event.preventDefault(); + } + }, -}; + _activate: function( event ) { + if ( !this.active.is( ".ui-state-disabled" ) ) { + if ( this.active.children( "a[aria-haspopup='true']" ).length ) { + this.expand( event ); + } else { + this.select( event ); + } + } + }, -})(jQuery); -/* - * jQuery UI Effects Shake 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Shake - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { + refresh: function() { + var menus, + icon = this.options.icons.submenu, + submenus = this.element.find( this.options.menus ); -$.effects.shake = function(o) { + // Initialize nested menus + submenus.filter( ":not(.ui-menu)" ) + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .hide() + .attr({ + role: this.options.role, + "aria-hidden": "true", + "aria-expanded": "false" + }) + .each(function() { + var menu = $( this ), + item = menu.prev( "a" ), + submenuCarat = $( "" ) + .addClass( "ui-menu-icon ui-icon " + icon ) + .data( "ui-menu-submenu-carat", true ); + + item + .attr( "aria-haspopup", "true" ) + .prepend( submenuCarat ); + menu.attr( "aria-labelledby", item.attr( "id" ) ); + }); - return this.queue(function() { + menus = submenus.add( this.element ); - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; + // Don't refresh list items that are already adapted + menus.children( ":not(.ui-menu-item):has(a)" ) + .addClass( "ui-menu-item" ) + .attr( "role", "presentation" ) + .children( "a" ) + .uniqueId() + .addClass( "ui-corner-all" ) + .attr({ + tabIndex: -1, + role: this._itemRole() + }); - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode - var direction = o.options.direction || 'left'; // Default direction - var distance = o.options.distance || 20; // Default distance - var times = o.options.times || 3; // Default # of times - var speed = o.duration || o.options.duration || 140; // Default speed per shake - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - - // Animation - var animation = {}, animation1 = {}, animation2 = {}; - animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; - animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; - animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; - - // Animate - el.animate(animation, speed, o.options.easing); - for (var i = 1; i < times; i++) { // Shakes - el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); - }; - el.animate(animation1, speed, o.options.easing). - animate(animation, speed / 2, o.options.easing, function(){ // Last shake - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback + // Initialize unlinked menu-items containing spaces and/or dashes only as dividers + menus.children( ":not(.ui-menu-item)" ).each(function() { + var item = $( this ); + // hyphen, em dash, en dash + if ( !/[^\-—–\s]/.test( item.text() ) ) { + item.addClass( "ui-widget-content ui-menu-divider" ); + } }); - el.queue('fx', function() { el.dequeue(); }); - el.dequeue(); - }); -}; + // Add aria-disabled attribute to any disabled menu item + menus.children( ".ui-state-disabled" ).attr( "aria-disabled", "true" ); -})(jQuery); -/* - * jQuery UI Effects Slide 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Slide - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { + // If the active item has been removed, blur the menu + if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + this.blur(); + } + }, -$.effects.slide = function(o) { + _itemRole: function() { + return { + menu: "menuitem", + listbox: "option" + }[ this.options.role ]; + }, - return this.queue(function() { + focus: function( event, item ) { + var nested, focused; + this.blur( event, event && event.type === "focus" ); - // Create element - var el = $(this), props = ['position','top','bottom','left','right']; + this._scrollIntoView( item ); - // Set options - var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode - var direction = o.options.direction || 'left'; // Default Direction - - // Adjust - $.effects.save(el, props); el.show(); // Save & Show - $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper - var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; - var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; - var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); - if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift - - // Animation - var animation = {}; - animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; - - // Animate - el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { - if(mode == 'hide') el.hide(); // Hide - $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore - if(o.callback) o.callback.apply(this, arguments); // Callback - el.dequeue(); - }}); + this.active = item.first(); + focused = this.active.children( "a" ).addClass( "ui-state-focus" ); + // Only update aria-activedescendant if there's a role + // otherwise we assume focus is managed elsewhere + if ( this.options.role ) { + this.element.attr( "aria-activedescendant", focused.attr( "id" ) ); + } - }); + // Highlight active parent menu item, if any + this.active + .parent() + .closest( ".ui-menu-item" ) + .children( "a:first" ) + .addClass( "ui-state-active" ); -}; + if ( event && event.type === "keydown" ) { + this._close(); + } else { + this.timer = this._delay(function() { + this._close(); + }, this.delay ); + } -})(jQuery); -/* - * jQuery UI Effects Transfer 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Transfer - * - * Depends: - * jquery.effects.core.js - */ -(function( $, undefined ) { + nested = item.children( ".ui-menu" ); + if ( nested.length && ( /^mouse/.test( event.type ) ) ) { + this._startOpening(nested); + } + this.activeMenu = item.parent(); -$.effects.transfer = function(o) { - return this.queue(function() { - var elem = $(this), - target = $(o.options.to), - endPosition = target.offset(), - animation = { - top: endPosition.top, - left: endPosition.left, - height: target.innerHeight(), - width: target.innerWidth() - }, - startPosition = elem.offset(), - transfer = $('
        ') - .appendTo(document.body) - .addClass(o.options.className) - .css({ - top: startPosition.top, - left: startPosition.left, - height: elem.innerHeight(), - width: elem.innerWidth(), - position: 'absolute' - }) - .animate(animation, o.duration, o.options.easing, function() { - transfer.remove(); - (o.callback && o.callback.apply(elem[0], arguments)); - elem.dequeue(); - }); - }); -}; + this._trigger( "focus", event, { item: item } ); + }, -})(jQuery); -/* - * jQuery UI Accordion 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Accordion - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { + _scrollIntoView: function( item ) { + var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; + if ( this._hasScroll() ) { + borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0; + paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0; + offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; + scroll = this.activeMenu.scrollTop(); + elementHeight = this.activeMenu.height(); + itemHeight = item.height(); -$.widget( "ui.accordion", { - options: { - active: 0, - animated: "slide", - autoHeight: true, - clearStyle: false, - collapsible: false, - event: "click", - fillSpace: false, - header: "> li > :first-child,> :not(li):even", - icons: { - header: "ui-icon-triangle-1-e", - headerSelected: "ui-icon-triangle-1-s" - }, - navigation: false, - navigationFilter: function() { - return this.href.toLowerCase() === location.href.toLowerCase(); + if ( offset < 0 ) { + this.activeMenu.scrollTop( scroll + offset ); + } else if ( offset + itemHeight > elementHeight ) { + this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight ); + } } }, - _create: function() { - var self = this, - options = self.options; + blur: function( event, fromFocus ) { + if ( !fromFocus ) { + clearTimeout( this.timer ); + } - self.running = 0; + if ( !this.active ) { + return; + } - self.element - .addClass( "ui-accordion ui-widget ui-helper-reset" ) - // in lack of child-selectors in CSS - // we need to mark top-LIs in a UL-accordion for some IE-fix - .children( "li" ) - .addClass( "ui-accordion-li-fix" ); + this.active.children( "a" ).removeClass( "ui-state-focus" ); + this.active = null; - self.headers = self.element.find( options.header ) - .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) - .bind( "mouseenter.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).addClass( "ui-state-hover" ); - }) - .bind( "mouseleave.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).removeClass( "ui-state-hover" ); - }) - .bind( "focus.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).addClass( "ui-state-focus" ); - }) - .bind( "blur.accordion", function() { - if ( options.disabled ) { - return; - } - $( this ).removeClass( "ui-state-focus" ); - }); + this._trigger( "blur", event, { item: this.active } ); + }, - self.headers.next() - .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + _startOpening: function( submenu ) { + clearTimeout( this.timer ); - if ( options.navigation ) { - var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); - if ( current.length ) { - var header = current.closest( ".ui-accordion-header" ); - if ( header.length ) { - // anchor within header - self.active = header; - } else { - // anchor within content - self.active = current.closest( ".ui-accordion-content" ).prev(); - } - } + // Don't open if already open fixes a Firefox bug that caused a .5 pixel + // shift in the submenu position when mousing over the carat icon + if ( submenu.attr( "aria-hidden" ) !== "true" ) { + return; } - self.active = self._findActive( self.active || options.active ) - .addClass( "ui-state-default ui-state-active" ) - .toggleClass( "ui-corner-all" ) - .toggleClass( "ui-corner-top" ); - self.active.next().addClass( "ui-accordion-content-active" ); + this.timer = this._delay(function() { + this._close(); + this._open( submenu ); + }, this.delay ); + }, - self._createIcons(); - self.resize(); - - // ARIA - self.element.attr( "role", "tablist" ); + _open: function( submenu ) { + var position = $.extend({ + of: this.active + }, this.options.position ); - self.headers - .attr( "role", "tab" ) - .bind( "keydown.accordion", function( event ) { - return self._keydown( event ); - }) - .next() - .attr( "role", "tabpanel" ); + clearTimeout( this.timer ); + this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) ) + .hide() + .attr( "aria-hidden", "true" ); - self.headers - .not( self.active || "" ) - .attr({ - "aria-expanded": "false", - "aria-selected": "false", - tabIndex: -1 - }) - .next() - .hide(); + submenu + .show() + .removeAttr( "aria-hidden" ) + .attr( "aria-expanded", "true" ) + .position( position ); + }, - // make sure at least one header is in the tab order - if ( !self.active.length ) { - self.headers.eq( 0 ).attr( "tabIndex", 0 ); - } else { - self.active - .attr({ - "aria-expanded": "true", - "aria-selected": "true", - tabIndex: 0 - }); - } + collapseAll: function( event, all ) { + clearTimeout( this.timer ); + this.timer = this._delay(function() { + // If we were passed an event, look for the submenu that contains the event + var currentMenu = all ? this.element : + $( event && event.target ).closest( this.element.find( ".ui-menu" ) ); - // only need links in tab order for Safari - if ( !$.browser.safari ) { - self.headers.find( "a" ).attr( "tabIndex", -1 ); + // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway + if ( !currentMenu.length ) { + currentMenu = this.element; + } + + this._close( currentMenu ); + + this.blur( event ); + this.activeMenu = currentMenu; + }, this.delay ); + }, + + // With no arguments, closes the currently active menu - if nothing is active + // it closes all menus. If passed an argument, it will search for menus BELOW + _close: function( startMenu ) { + if ( !startMenu ) { + startMenu = this.active ? this.active.parent() : this.element; } - if ( options.event ) { - self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { - self._clickHandler.call( self, event, this ); - event.preventDefault(); - }); + startMenu + .find( ".ui-menu" ) + .hide() + .attr( "aria-hidden", "true" ) + .attr( "aria-expanded", "false" ) + .end() + .find( "a.ui-state-active" ) + .removeClass( "ui-state-active" ); + }, + + collapse: function( event ) { + var newItem = this.active && + this.active.parent().closest( ".ui-menu-item", this.element ); + if ( newItem && newItem.length ) { + this._close(); + this.focus( event, newItem ); } }, - _createIcons: function() { - var options = this.options; - if ( options.icons ) { - $( "" ) - .addClass( "ui-icon " + options.icons.header ) - .prependTo( this.headers ); - this.active.children( ".ui-icon" ) - .toggleClass(options.icons.header) - .toggleClass(options.icons.headerSelected); - this.element.addClass( "ui-accordion-icons" ); + expand: function( event ) { + var newItem = this.active && + this.active + .children( ".ui-menu " ) + .children( ".ui-menu-item" ) + .first(); + + if ( newItem && newItem.length ) { + this._open( newItem.parent() ); + + // Delay so Firefox will not hide activedescendant change in expanding submenu from AT + this._delay(function() { + this.focus( event, newItem ); + }); } }, - _destroyIcons: function() { - this.headers.children( ".ui-icon" ).remove(); - this.element.removeClass( "ui-accordion-icons" ); + next: function( event ) { + this._move( "next", "first", event ); }, - destroy: function() { - var options = this.options; + previous: function( event ) { + this._move( "prev", "last", event ); + }, - this.element - .removeClass( "ui-accordion ui-widget ui-helper-reset" ) - .removeAttr( "role" ); + isFirstItem: function() { + return this.active && !this.active.prevAll( ".ui-menu-item" ).length; + }, - this.headers - .unbind( ".accordion" ) - .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) - .removeAttr( "role" ) - .removeAttr( "aria-expanded" ) - .removeAttr( "aria-selected" ) - .removeAttr( "tabIndex" ); + isLastItem: function() { + return this.active && !this.active.nextAll( ".ui-menu-item" ).length; + }, - this.headers.find( "a" ).removeAttr( "tabIndex" ); - this._destroyIcons(); - var contents = this.headers.next() - .css( "display", "" ) - .removeAttr( "role" ) - .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); - if ( options.autoHeight || options.fillHeight ) { - contents.css( "height", "" ); + _move: function( direction, filter, event ) { + var next; + if ( this.active ) { + if ( direction === "first" || direction === "last" ) { + next = this.active + [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" ) + .eq( -1 ); + } else { + next = this.active + [ direction + "All" ]( ".ui-menu-item" ) + .eq( 0 ); + } + } + if ( !next || !next.length || !this.active ) { + next = this.activeMenu.children( ".ui-menu-item" )[ filter ](); } - return $.Widget.prototype.destroy.call( this ); + this.focus( event, next ); }, - _setOption: function( key, value ) { - $.Widget.prototype._setOption.apply( this, arguments ); - - if ( key == "active" ) { - this.activate( value ); + nextPage: function( event ) { + var item, base, height; + + if ( !this.active ) { + this.next( event ); + return; } - if ( key == "icons" ) { - this._destroyIcons(); - if ( value ) { - this._createIcons(); - } + if ( this.isLastItem() ) { + return; } - // #5332 - opacity doesn't cascade to positioned elements in IE - // so we need to add the disabled class to the headers and panels - if ( key == "disabled" ) { - this.headers.add(this.headers.next()) - [ value ? "addClass" : "removeClass" ]( - "ui-accordion-disabled ui-state-disabled" ); + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.nextAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base - height < 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ) + [ !this.active ? "first" : "last" ]() ); } }, - _keydown: function( event ) { - if ( this.options.disabled || event.altKey || event.ctrlKey ) { + previousPage: function( event ) { + var item, base, height; + if ( !this.active ) { + this.next( event ); return; } - - var keyCode = $.ui.keyCode, - length = this.headers.length, - currentIndex = this.headers.index( event.target ), - toFocus = false; - - switch ( event.keyCode ) { - case keyCode.RIGHT: - case keyCode.DOWN: - toFocus = this.headers[ ( currentIndex + 1 ) % length ]; - break; - case keyCode.LEFT: - case keyCode.UP: - toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; - break; - case keyCode.SPACE: - case keyCode.ENTER: - this._clickHandler( { target: event.target }, event.target ); - event.preventDefault(); + if ( this.isFirstItem() ) { + return; } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.prevAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base + height > 0; + }); - if ( toFocus ) { - $( event.target ).attr( "tabIndex", -1 ); - $( toFocus ).attr( "tabIndex", 0 ); - toFocus.focus(); - return false; + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ).first() ); } + }, - return true; + _hasScroll: function() { + return this.element.outerHeight() < this.element.prop( "scrollHeight" ); }, - resize: function() { - var options = this.options, - maxHeight; + select: function( event ) { + // TODO: It should never be possible to not have an active item at this + // point, but the tests don't trigger mouseenter before click. + this.active = this.active || $( event.target ).closest( ".ui-menu-item" ); + var ui = { item: this.active }; + if ( !this.active.has( ".ui-menu" ).length ) { + this.collapseAll( event, true ); + } + this._trigger( "select", event, ui ); + } +}); - if ( options.fillSpace ) { - if ( $.browser.msie ) { - var defOverflow = this.element.parent().css( "overflow" ); - this.element.parent().css( "overflow", "hidden"); - } - maxHeight = this.element.parent().height(); - if ($.browser.msie) { - this.element.parent().css( "overflow", defOverflow ); - } +}( jQuery )); +(function( $, undefined ) { - this.headers.each(function() { - maxHeight -= $( this ).outerHeight( true ); - }); +$.widget( "ui.progressbar", { + version: "1.9.2", + options: { + value: 0, + max: 100 + }, - this.headers.next() - .each(function() { - $( this ).height( Math.max( 0, maxHeight - - $( this ).innerHeight() + $( this ).height() ) ); - }) - .css( "overflow", "auto" ); - } else if ( options.autoHeight ) { - maxHeight = 0; - this.headers.next() - .each(function() { - maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); - }) - .height( maxHeight ); - } + min: 0, - return this; - }, + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); - activate: function( index ) { - // TODO this gets called on init, changing the option without an explicit call for that - this.options.active = index; - // call clickHandler with custom event - var active = this._findActive( index )[ 0 ]; - this._clickHandler( { target: active }, active ); + this.valueDiv = $( "
        " ) + .appendTo( this.element ); - return this; + this.oldValue = this._value(); + this._refreshValue(); }, - _findActive: function( selector ) { - return selector - ? typeof selector === "number" - ? this.headers.filter( ":eq(" + selector + ")" ) - : this.headers.not( this.headers.not( selector ) ) - : selector === false - ? $( [] ) - : this.headers.filter( ":eq(0)" ); + _destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); }, - // TODO isn't event.target enough? why the separate target argument? - _clickHandler: function( event, target ) { - var options = this.options; - if ( options.disabled ) { - return; + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); } - // called only when using activate(false) to close all parts programmatically - if ( !event.target ) { - if ( !options.collapsible ) { - return; + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); } - this.active - .removeClass( "ui-state-active ui-corner-top" ) - .addClass( "ui-state-default ui-corner-all" ) - .children( ".ui-icon" ) - .removeClass( options.icons.headerSelected ) - .addClass( options.icons.header ); - this.active.next().addClass( "ui-accordion-content-active" ); - var toHide = this.active.next(), - data = { - options: options, - newHeader: $( [] ), - oldHeader: options.active, - newContent: $( [] ), - oldContent: toHide - }, - toShow = ( this.active = $( [] ) ); - this._toggle( toShow, toHide, data ); - return; } - // get the click target - var clicked = $( event.currentTarget || target ), - clickedIsActive = clicked[0] === this.active[0]; - - // TODO the option is changed, is that correct? - // TODO if it is correct, shouldn't that happen after determining that the click is valid? - options.active = options.collapsible && clickedIsActive ? - false : - this.headers.index( clicked ); + this._super( key, value ); + }, - // if animations are still active, or the active header is the target, ignore click - if ( this.running || ( !options.collapsible && clickedIsActive ) ) { - return; + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, - // find elements to show and hide - var active = this.active, - toShow = clicked.next(), - toHide = this.active.next(), - data = { - options: options, - newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, - oldHeader: this.active, - newContent: clickedIsActive && options.collapsible ? $([]) : toShow, - oldContent: toHide - }, - down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + _percentage: function() { + return 100 * this._value() / this.options.max; + }, - // when the call to ._toggle() comes after the class changes - // it causes a very odd bug in IE 8 (see #6720) - this.active = clickedIsActive ? $([]) : clicked; - this._toggle( toShow, toHide, data, clickedIsActive, down ); + _refreshValue: function() { + var value = this.value(), + percentage = this._percentage(); - // switch classes - active - .removeClass( "ui-state-active ui-corner-top" ) - .addClass( "ui-state-default ui-corner-all" ) - .children( ".ui-icon" ) - .removeClass( options.icons.headerSelected ) - .addClass( options.icons.header ); - if ( !clickedIsActive ) { - clicked - .removeClass( "ui-state-default ui-corner-all" ) - .addClass( "ui-state-active ui-corner-top" ) - .children( ".ui-icon" ) - .removeClass( options.icons.header ) - .addClass( options.icons.headerSelected ); - clicked - .next() - .addClass( "ui-accordion-content-active" ); + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); } - return; - }, - - _toggle: function( toShow, toHide, data, clickedIsActive, down ) { - var self = this, - options = self.options; + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); - self.toShow = toShow; - self.toHide = toHide; - self.data = data; +})( jQuery ); +(function( $, undefined ) { - var complete = function() { - if ( !self ) { - return; - } - return self._completed.apply( self, arguments ); - }; +$.widget("ui.resizable", $.ui.mouse, { + version: "1.9.2", + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { - // trigger changestart event - self._trigger( "changestart", null, self.data ); + var that = this, o = this.options; + this.element.addClass("ui-resizable"); - // count elements to animate - self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); - if ( options.animated ) { - var animOptions = {}; + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { - if ( options.collapsible && clickedIsActive ) { - animOptions = { - toShow: $( [] ), - toHide: toHide, - complete: complete, - down: down, - autoHeight: options.autoHeight || options.fillSpace - }; - } else { - animOptions = { - toShow: toShow, - toHide: toHide, - complete: complete, - down: down, - autoHeight: options.autoHeight || options.fillSpace - }; - } + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
        ').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); - if ( !options.proxied ) { - options.proxied = options.animated; - } + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); - if ( !options.proxiedDuration ) { - options.proxiedDuration = options.duration; - } + this.elementIsWrapper = true; - options.animated = $.isFunction( options.proxied ) ? - options.proxied( animOptions ) : - options.proxied; + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); - options.duration = $.isFunction( options.proxiedDuration ) ? - options.proxiedDuration( animOptions ) : - options.proxiedDuration; + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); - var animations = $.ui.accordion.animations, - duration = options.duration, - easing = options.animated; + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); - if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { - easing = "slide"; - } - if ( !animations[ easing ] ) { - animations[ easing ] = function( options ) { - this.slide( options, { - easing: easing, - duration: duration || 700 - }); - }; - } + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); - animations[ easing ]( animOptions ); - } else { - if ( options.collapsible && clickedIsActive ) { - toShow.toggle(); - } else { - toHide.hide(); - toShow.show(); - } + // fix handlers offset + this._proportionallyResize(); - complete( true ); } - // TODO assert that the blur and focus triggers are really necessary, remove otherwise - toHide.prev() - .attr({ - "aria-expanded": "false", - "aria-selected": "false", - tabIndex: -1 - }) - .blur(); - toShow.prev() - .attr({ - "aria-expanded": "true", - "aria-selected": "true", - tabIndex: 0 - }) - .focus(); - }, + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { - _completed: function( cancel ) { - this.running = cancel ? 0 : --this.running; - if ( this.running ) { - return; - } + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; - if ( this.options.clearStyle ) { - this.toShow.add( this.toHide ).css({ - height: "", - overflow: "" - }); - } + for(var i = 0; i < n.length; i++) { - // other classes are removed before the animation; this one needs to stay until completed - this.toHide.removeClass( "ui-accordion-content-active" ); - // Work around for rendering bug in IE (#5421) - if ( this.toHide.length ) { - this.toHide.parent()[0].className = this.toHide.parent()[0].className; - } + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
        '); - this._trigger( "change", null, this.data ); - } -}); + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); -$.extend( $.ui.accordion, { - version: "1.8.16", - animations: { - slide: function( options, additions ) { - options = $.extend({ - easing: "swing", - duration: 300 - }, options, additions ); - if ( !options.toHide.size() ) { - options.toShow.animate({ - height: "show", - paddingTop: "show", - paddingBottom: "show" - }, options ); - return; - } - if ( !options.toShow.size() ) { - options.toHide.animate({ - height: "hide", - paddingTop: "hide", - paddingBottom: "hide" - }, options ); - return; - } - var overflow = options.toShow.css( "overflow" ), - percentDone = 0, - showProps = {}, - hideProps = {}, - fxAttrs = [ "height", "paddingTop", "paddingBottom" ], - originalWidth; - // fix width before calculating height of hidden element - var s = options.toShow; - originalWidth = s[0].style.width; - s.width( parseInt( s.parent().width(), 10 ) - - parseInt( s.css( "paddingLeft" ), 10 ) - - parseInt( s.css( "paddingRight" ), 10 ) - - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) - - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); - - $.each( fxAttrs, function( i, prop ) { - hideProps[ prop ] = "hide"; - - var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); - showProps[ prop ] = { - value: parts[ 1 ], - unit: parts[ 2 ] || "px" + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); }; - }); - options.toShow.css({ height: 0, overflow: "hidden" }).show(); - options.toHide - .filter( ":hidden" ) - .each( options.complete ) - .end() - .filter( ":visible" ) - .animate( hideProps, { - step: function( now, settings ) { - // only calculate the percent when animating height - // IE gets very inconsistent results when animating elements - // with small values, which is common for padding - if ( settings.prop == "height" ) { - percentDone = ( settings.end - settings.start === 0 ) ? 0 : - ( settings.now - settings.start ) / ( settings.end - settings.start ); - } - - options.toShow[ 0 ].style[ settings.prop ] = - ( percentDone * showProps[ settings.prop ].value ) - + showProps[ settings.prop ].unit; - }, - duration: options.duration, - easing: options.easing, - complete: function() { - if ( !options.autoHeight ) { - options.toShow.css( "height", "" ); - } - options.toShow.css({ - width: originalWidth, - overflow: overflow - }); - options.complete(); - } - }); - }, - bounceslide: function( options ) { - this.slide( options, { - easing: options.down ? "easeOutBounce" : "swing", - duration: options.down ? 1000 : 200 - }); - } - } -}); -})( jQuery ); -/* - * jQuery UI Autocomplete 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.position.js - */ -(function( $, undefined ) { + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } -// used to prevent race conditions with remote data sources -var requestIndex = 0; + } -$.widget( "ui.autocomplete", { - options: { - appendTo: "body", - autoFocus: false, - delay: 300, - minLength: 1, - position: { - my: "left top", - at: "left bottom", - collision: "none" - }, - source: null - }, + this._renderAxis = function(target) { - pending: 0, + target = target || this.element; - _create: function() { - var self = this, - doc = this.element[ 0 ].ownerDocument, - suppressKeyPress; + for(var i in this.handles) { - this.element - .addClass( "ui-autocomplete-input" ) - .attr( "autocomplete", "off" ) - // TODO verify these actually work as intended - .attr({ - role: "textbox", - "aria-autocomplete": "list", - "aria-haspopup": "true" - }) - .bind( "keydown.autocomplete", function( event ) { - if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { - return; - } + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); - suppressKeyPress = false; - var keyCode = $.ui.keyCode; - switch( event.keyCode ) { - case keyCode.PAGE_UP: - self._move( "previousPage", event ); - break; - case keyCode.PAGE_DOWN: - self._move( "nextPage", event ); - break; - case keyCode.UP: - self._move( "previous", event ); - // prevent moving cursor to beginning of text field in some browsers - event.preventDefault(); - break; - case keyCode.DOWN: - self._move( "next", event ); - // prevent moving cursor to end of text field in some browsers - event.preventDefault(); - break; - case keyCode.ENTER: - case keyCode.NUMPAD_ENTER: - // when menu is open and has focus - if ( self.menu.active ) { - // #6055 - Opera still allows the keypress to occur - // which causes forms to submit - suppressKeyPress = true; - event.preventDefault(); - } - //passthrough - ENTER and TAB both select the current element - case keyCode.TAB: - if ( !self.menu.active ) { - return; - } - self.menu.select( event ); - break; - case keyCode.ESCAPE: - self.element.val( self.term ); - self.close( event ); - break; - default: - // keypress is triggered before the input value is changed - clearTimeout( self.searching ); - self.searching = setTimeout(function() { - // only search if the value has changed - if ( self.term != self.element.val() ) { - self.selectedItem = null; - self.search( null, event ); - } - }, self.options.delay ); - break; - } - }) - .bind( "keypress.autocomplete", function( event ) { - if ( suppressKeyPress ) { - suppressKeyPress = false; - event.preventDefault(); - } - }) - .bind( "focus.autocomplete", function() { - if ( self.options.disabled ) { - return; - } + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); - self.selectedItem = null; - self.previous = self.element.val(); - }) - .bind( "blur.autocomplete", function( event ) { - if ( self.options.disabled ) { - return; } - clearTimeout( self.searching ); - // clicks on the menu (or a button to trigger a search) will cause a blur event - self.closing = setTimeout(function() { - self.close( event ); - self._change( event ); - }, 150 ); - }); - this._initSource(); - this.response = function() { - return self._response.apply( self, arguments ); + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } }; - this.menu = $( "
          " ) - .addClass( "ui-autocomplete" ) - .appendTo( $( this.options.appendTo || "body", doc )[0] ) - // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) - .mousedown(function( event ) { - // clicking on the scrollbar causes focus to shift to the body - // but we can't detect a mouseup or a click immediately afterward - // so we have to track the next mousedown and close the menu if - // the user clicks somewhere outside of the autocomplete - var menuElement = self.menu.element[ 0 ]; - if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { - setTimeout(function() { - $( document ).one( 'mousedown', function( event ) { - if ( event.target !== self.element[ 0 ] && - event.target !== menuElement && - !$.ui.contains( menuElement, event.target ) ) { - self.close(); - } - }); - }, 1 ); - } - // use another timeout to make sure the blur-event-handler on the input was already triggered - setTimeout(function() { - clearTimeout( self.closing ); - }, 13); - }) - .menu({ - focus: function( event, ui ) { - var item = ui.item.data( "item.autocomplete" ); - if ( false !== self._trigger( "focus", event, { item: item } ) ) { - // use value to match what will end up in the input, if it was a key event - if ( /^key/.test(event.originalEvent.type) ) { - self.element.val( item.value ); - } - } - }, - selected: function( event, ui ) { - var item = ui.item.data( "item.autocomplete" ), - previous = self.previous; - - // only trigger when focus was lost (click on menu) - if ( self.element[0] !== doc.activeElement ) { - self.element.focus(); - self.previous = previous; - // #6109 - IE triggers two focus events and the second - // is asynchronous, so we need to reset the previous - // term synchronously and asynchronously :-( - setTimeout(function() { - self.previous = previous; - self.selectedItem = item; - }, 1); - } + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); - if ( false !== self._trigger( "select", event, { item: item } ) ) { - self.element.val( item.value ); - } - // reset the term after the select event - // this allows custom select handling to work properly - self.term = self.element.val(); + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); - self.close( event ); - self.selectedItem = item; - }, - blur: function( event, ui ) { - // don't set the value of the text field if it's already correct - // this prevents moving the cursor unnecessarily - if ( self.menu.element.is(":visible") && - ( self.element.val() !== self.term ) ) { - self.element.val( self.term ); + //Matching axis name + this._handles.mouseover(function() { + if (!that.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + that.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .mouseenter(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + that._handles.show(); + }) + .mouseleave(function(){ + if (o.disabled) return; + if (!that.resizing) { + $(this).addClass("ui-resizable-autohide"); + that._handles.hide(); } - } - }) - .zIndex( this.element.zIndex() + 1 ) - // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 - .css({ top: 0, left: 0 }) - .hide() - .data( "menu" ); - if ( $.fn.bgiframe ) { - this.menu.element.bgiframe(); + }); } - }, - destroy: function() { - this.element - .removeClass( "ui-autocomplete-input" ) - .removeAttr( "autocomplete" ) - .removeAttr( "role" ) - .removeAttr( "aria-autocomplete" ) - .removeAttr( "aria-haspopup" ); - this.menu.element.remove(); - $.Widget.prototype.destroy.call( this ); + //Initialize the mouse interaction + this._mouseInit(); + }, - _setOption: function( key, value ) { - $.Widget.prototype._setOption.apply( this, arguments ); - if ( key === "source" ) { - this._initSource(); - } - if ( key === "appendTo" ) { - this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) - } - if ( key === "disabled" && value && this.xhr ) { - this.xhr.abort(); + _destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").removeData("ui-resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }).insertAfter( wrapper ); + wrapper.remove(); } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; }, - _initSource: function() { - var self = this, - array, - url; - if ( $.isArray(this.options.source) ) { - array = this.options.source; - this.source = function( request, response ) { - response( $.ui.autocomplete.filter(array, request.term) ); - }; - } else if ( typeof this.options.source === "string" ) { - url = this.options.source; - this.source = function( request, response ) { - if ( self.xhr ) { - self.xhr.abort(); - } - self.xhr = $.ajax({ - url: url, - data: request, - dataType: "json", - autocompleteRequest: ++requestIndex, - success: function( data, status ) { - if ( this.autocompleteRequest === requestIndex ) { - response( data ); - } - }, - error: function() { - if ( this.autocompleteRequest === requestIndex ) { - response( [] ); - } - } - }); - }; - } else { - this.source = this.options.source; + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } } + + return !this.options.disabled && handle; }, - search: function( value, event ) { - value = value != null ? value : this.element.val(); + _mouseStart: function(event) { - // always save the actual value, not the one passed as an argument - this.term = this.element.val(); + var o = this.options, iniPos = this.element.position(), el = this.element; - if ( value.length < this.options.minLength ) { - return this.close( event ); + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); } - clearTimeout( this.closing ); - if ( this._trigger( "search", event ) === false ) { - return; + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; } - return this._search( value ); - }, + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; - _search: function( value ) { - this.pending++; - this.element.addClass( "ui-autocomplete-loading" ); + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); - this.source( { term: value }, this.response ); - }, + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); - _response: function( content ) { - if ( !this.options.disabled && content && content.length ) { - content = this._normalize( content ); - this._suggest( content ); - this._trigger( "open" ); - } else { - this.close(); - } - this.pending--; - if ( !this.pending ) { - this.element.removeClass( "ui-autocomplete-loading" ); - } + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; }, - close: function( event ) { - clearTimeout( this.closing ); - if ( this.menu.element.is(":visible") ) { - this.menu.element.hide(); - this.menu.deactivate(); - this._trigger( "close", event ); - } - }, - - _change: function( event ) { - if ( this.previous !== this.element.val() ) { - this._trigger( "change", event, { item: this.selectedItem } ); - } + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + that = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]); + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; }, - _normalize: function( items ) { - // assume all items have the right format when the first item is complete - if ( items.length && items[0].label && items[0].value ) { - return items; + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, that = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : that.sizeDiff.height, + soffsetw = ista ? 0 : that.sizeDiff.width; + + var s = { width: (that.helper.width() - soffsetw), height: (that.helper.height() - soffseth) }, + left = (parseInt(that.element.css('left'), 10) + (that.position.left - that.originalPosition.left)) || null, + top = (parseInt(that.element.css('top'), 10) + (that.position.top - that.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + that.helper.height(that.size.height); + that.helper.width(that.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); } - return $.map( items, function(item) { - if ( typeof item === "string" ) { - return { - label: item, - value: item - }; - } - return $.extend({ - label: item.label || item.value, - value: item.value || item.label - }, item ); - }); + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + }, - _suggest: function( items ) { - var ul = this.menu.element - .empty() - .zIndex( this.element.zIndex() + 1 ); - this._renderMenu( ul, items ); - // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate - this.menu.deactivate(); - this.menu.refresh(); + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; - // size and position menu - ul.show(); - this._resizeMenu(); - ul.position( $.extend({ - of: this.element - }, this.options.position )); + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; - if ( this.options.autoFocus ) { - this.menu.next( new $.Event("mouseover") ); + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; } + this._vBoundaries = b; }, - _resizeMenu: function() { - var ul = this.menu.element; - ul.outerWidth( Math.max( - ul.width( "" ).outerWidth(), - this.element.outerWidth() - ) ); + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; }, - _renderMenu: function( ul, items ) { - var self = this; - $.each( items, function( index, item ) { - self._renderItem( ul, item ); - }); - }, + _updateRatio: function(data, event) { - _renderItem: function( ul, item) { - return $( "
        • " ) - .data( "item.autocomplete", item ) - .append( $( "" ).text( item.label ) ) - .appendTo( ul ); - }, + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; - _move: function( direction, event ) { - if ( !this.menu.element.is(":visible") ) { - this.search( null, event ); - return; + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; } - if ( this.menu.first() && /^previous/.test(direction) || - this.menu.last() && /^next/.test(direction) ) { - this.element.val( this.term ); - this.menu.deactivate(); - return; + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); } - this.menu[ direction ]( event ); - }, - - widget: function() { - return this.menu.element; - } -}); -$.extend( $.ui.autocomplete, { - escapeRegex: function( value ) { - return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + return data; }, - filter: function(array, term) { - var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); - return $.grep( array, function(value) { - return matcher.test( value.label || value.value || value ); - }); - } -}); -}( jQuery )); + _respectSize: function(data, event) { -/* - * jQuery UI Menu (not officially released) - * - * This widget isn't yet finished and the API is subject to change. We plan to finish - * it for the next release. You're welcome to give it a try anyway and give us feedback, - * as long as you're okay with migrating your code later on. We can help with that, too. - * - * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Menu - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function($) { + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); -$.widget("ui.menu", { - _create: function() { - var self = this; - this.element - .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") - .attr({ - role: "listbox", - "aria-activedescendant": "ui-active-menuitem" - }) - .click(function( event ) { - if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { - return; - } - // temporary - event.preventDefault(); - self.select( event ); - }); - this.refresh(); - }, - - refresh: function() { - var self = this; - - // don't refresh list items that are already adapted - var items = this.element.children("li:not(.ui-menu-item):has(a)") - .addClass("ui-menu-item") - .attr("role", "menuitem"); - - items.children("a") - .addClass("ui-corner-all") - .attr("tabindex", -1) - // mouseenter doesn't work with event delegation - .mouseenter(function( event ) { - self.activate( event, $(this).parent() ); - }) - .mouseleave(function() { - self.deactivate(); - }); - }, + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; - activate: function( event, item ) { - this.deactivate(); - if (this.hasScroll()) { - var offset = item.offset().top - this.element.offset().top, - scroll = this.element.scrollTop(), - elementHeight = this.element.height(); - if (offset < 0) { - this.element.scrollTop( scroll + offset); - } else if (offset >= elementHeight) { - this.element.scrollTop( scroll + offset - elementHeight + item.height()); - } - } - this.active = item.eq(0) - .children("a") - .addClass("ui-state-hover") - .attr("id", "ui-active-menuitem") - .end(); - this._trigger("focus", event, { item: item }); - }, + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); - deactivate: function() { - if (!this.active) { return; } + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; - this.active.children("a") - .removeClass("ui-state-hover") - .removeAttr("id"); - this._trigger("blur"); - this.active = null; - }, + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; - next: function(event) { - this.move("next", ".ui-menu-item:first", event); + return data; }, - previous: function(event) { - this.move("prev", ".ui-menu-item:last", event); - }, + _proportionallyResize: function() { - first: function() { - return this.active && !this.active.prevAll(".ui-menu-item").length; - }, + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; - last: function() { - return this.active && !this.active.nextAll(".ui-menu-item").length; - }, + for (var i=0; i < this._proportionallyResizeElements.length; i++) { - move: function(direction, edge, event) { - if (!this.active) { - this.activate(event, this.element.children(edge)); - return; - } - var next = this.active[direction + "All"](".ui-menu-item").eq(0); - if (next.length) { - this.activate(event, next); - } else { - this.activate(event, this.element.children(edge)); - } - }, + var prel = this._proportionallyResizeElements[i]; - // TODO merge with previousPage - nextPage: function(event) { - if (this.hasScroll()) { - // TODO merge with no-scroll-else - if (!this.active || this.last()) { - this.activate(event, this.element.children(".ui-menu-item:first")); - return; - } - var base = this.active.offset().top, - height = this.element.height(), - result = this.element.children(".ui-menu-item").filter(function() { - var close = $(this).offset().top - base - height + $(this).height(); - // TODO improve approximation - return close < 10 && close > -10; - }); + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; - // TODO try to catch this earlier when scrollTop indicates the last page anyway - if (!result.length) { - result = this.element.children(".ui-menu-item:last"); + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); } - this.activate(event, result); - } else { - this.activate(event, this.element.children(".ui-menu-item") - .filter(!this.active || this.last() ? ":first" : ":last")); - } - }, - // TODO merge with nextPage - previousPage: function(event) { - if (this.hasScroll()) { - // TODO merge with no-scroll-else - if (!this.active || this.first()) { - this.activate(event, this.element.children(".ui-menu-item:last")); - return; - } + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); - var base = this.active.offset().top, - height = this.element.height(); - result = this.element.children(".ui-menu-item").filter(function() { - var close = $(this).offset().top - base + height - $(this).height(); - // TODO improve approximation - return close < 10 && close > -10; - }); + }; - // TODO try to catch this earlier when scrollTop indicates the last page anyway - if (!result.length) { - result = this.element.children(".ui-menu-item:first"); - } - this.activate(event, result); - } else { - this.activate(event, this.element.children(".ui-menu-item") - .filter(!this.active || this.first() ? ":last" : ":first")); - } }, - hasScroll: function() { - return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); - }, + _renderProxy: function() { - select: function( event ) { - this._trigger("selected", event, { item: this.active }); - } -}); + var el = this.element, o = this.options; + this.elementOffset = el.offset(); -}(jQuery)); -/* - * jQuery UI Button 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Button - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { + if(this._helper) { -var lastActive, startXPos, startYPos, clickDragged, - baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", - stateClasses = "ui-state-hover ui-state-active ", - typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", - formResetHandler = function() { - var buttons = $( this ).find( ":ui-button" ); - setTimeout(function() { - buttons.button( "refresh" ); - }, 1 ); - }, - radioGroup = function( radio ) { - var name = radio.name, - form = radio.form, - radios = $( [] ); - if ( name ) { - if ( form ) { - radios = $( form ).find( "[name='" + name + "']" ); - } else { - radios = $( "[name='" + name + "']", radio.ownerDocument ) - .filter(function() { - return !this.form; - }); - } + this.helper = this.helper || $('
          '); + + // fix ie6 offset TODO: This seems broken + var ie6offset = ($.ui.ie6 ? 1 : 0), + pxyoffset = ( $.ui.ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; } - return radios; - }; -$.widget( "ui.button", { - options: { - disabled: null, - text: true, - label: null, - icons: { - primary: null, - secondary: null + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); } }, - _create: function() { - this.element.closest( "form" ) - .unbind( "reset.button" ) - .bind( "reset.button", formResetHandler ); - if ( typeof this.options.disabled !== "boolean" ) { - this.options.disabled = this.element.propAttr( "disabled" ); - } + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, - this._determineButtonType(); - this.hasTitle = !!this.buttonElement.attr( "title" ); + plugins: {}, - var self = this, - options = this.options, - toggleButton = this.type === "checkbox" || this.type === "radio", - hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), - focusClass = "ui-state-focus"; + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } - if ( options.label === null ) { - options.label = this.buttonElement.html(); - } +}); - if ( this.element.is( ":disabled" ) ) { - options.disabled = true; - } +/* + * Resizable Extensions + */ - this.buttonElement - .addClass( baseClasses ) - .attr( "role", "button" ) - .bind( "mouseenter.button", function() { - if ( options.disabled ) { - return; - } - $( this ).addClass( "ui-state-hover" ); - if ( this === lastActive ) { - $( this ).addClass( "ui-state-active" ); - } - }) - .bind( "mouseleave.button", function() { - if ( options.disabled ) { - return; - } - $( this ).removeClass( hoverClass ); - }) - .bind( "click.button", function( event ) { - if ( options.disabled ) { - event.preventDefault(); - event.stopImmediatePropagation(); - } - }); +$.ui.plugin.add("resizable", "alsoResize", { - this.element - .bind( "focus.button", function() { - // no need to check disabled, focus won't be triggered anyway - self.buttonElement.addClass( focusClass ); - }) - .bind( "blur.button", function() { - self.buttonElement.removeClass( focusClass ); - }); + start: function (event, ui) { + var that = $(this).data("resizable"), o = that.options; - if ( toggleButton ) { - this.element.bind( "change.button", function() { - if ( clickDragged ) { - return; - } - self.refresh(); - }); - // if mouse moves between mousedown and mouseup (drag) set clickDragged flag - // prevents issue where button state changes but checkbox/radio checked state - // does not in Firefox (see ticket #6970) - this.buttonElement - .bind( "mousedown.button", function( event ) { - if ( options.disabled ) { - return; - } - clickDragged = false; - startXPos = event.pageX; - startYPos = event.pageY; - }) - .bind( "mouseup.button", function( event ) { - if ( options.disabled ) { - return; - } - if ( startXPos !== event.pageX || startYPos !== event.pageY ) { - clickDragged = true; - } + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); } + }, - if ( this.type === "checkbox" ) { - this.buttonElement.bind( "click.button", function() { - if ( options.disabled || clickDragged ) { - return false; - } - $( this ).toggleClass( "ui-state-active" ); - self.buttonElement.attr( "aria-pressed", self.element[0].checked ); - }); - } else if ( this.type === "radio" ) { - this.buttonElement.bind( "click.button", function() { - if ( options.disabled || clickDragged ) { - return false; - } - $( this ).addClass( "ui-state-active" ); - self.buttonElement.attr( "aria-pressed", "true" ); + resize: function (event, ui) { + var that = $(this).data("resizable"), o = that.options, os = that.originalSize, op = that.originalPosition; - var radio = self.element[ 0 ]; - radioGroup( radio ) - .not( radio ) - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", "false" ); - }); - } else { - this.buttonElement - .bind( "mousedown.button", function() { - if ( options.disabled ) { - return false; - } - $( this ).addClass( "ui-state-active" ); - lastActive = this; - $( document ).one( "mouseup", function() { - lastActive = null; - }); - }) - .bind( "mouseup.button", function() { - if ( options.disabled ) { - return false; - } - $( this ).removeClass( "ui-state-active" ); - }) - .bind( "keydown.button", function(event) { - if ( options.disabled ) { - return false; - } - if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { - $( this ).addClass( "ui-state-active" ); - } - }) - .bind( "keyup.button", function() { - $( this ).removeClass( "ui-state-active" ); - }); + var delta = { + height: (that.size.height - os.height) || 0, width: (that.size.width - os.width) || 0, + top: (that.position.top - op.top) || 0, left: (that.position.left - op.left) || 0 + }, - if ( this.buttonElement.is("a") ) { - this.buttonElement.keyup(function(event) { - if ( event.keyCode === $.ui.keyCode.SPACE ) { - // TODO pass through original event correctly (just as 2nd argument doesn't work) - $( this ).click(); - } + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; }); - } - } - // TODO: pull out $.Widget's handling for the disabled option into - // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can - // be overridden by individual plugins - this._setOption( "disabled", options.disabled ); - this._resetButton(); + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } }, - _determineButtonType: function() { + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); - if ( this.element.is(":checkbox") ) { - this.type = "checkbox"; - } else if ( this.element.is(":radio") ) { - this.type = "radio"; - } else if ( this.element.is("input") ) { - this.type = "input"; - } else { - this.type = "button"; - } +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var that = $(this).data("resizable"), o = that.options; + + var pr = that._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : that.sizeDiff.height, + soffsetw = ista ? 0 : that.sizeDiff.width; + + var style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) }, + left = (parseInt(that.element.css('left'), 10) + (that.position.left - that.originalPosition.left)) || null, + top = (parseInt(that.element.css('top'), 10) + (that.position.top - that.originalPosition.top)) || null; + + that.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(that.element.css('width'), 10), + height: parseInt(that.element.css('height'), 10), + top: parseInt(that.element.css('top'), 10), + left: parseInt(that.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + that._updateCache(data); + that._propagate("resize", event); - if ( this.type === "checkbox" || this.type === "radio" ) { - // we don't search against the document in case the element - // is disconnected from the DOM - var ancestor = this.element.parents().filter(":last"), - labelSelector = "label[for='" + this.element.attr("id") + "']"; - this.buttonElement = ancestor.find( labelSelector ); - if ( !this.buttonElement.length ) { - ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); - this.buttonElement = ancestor.filter( labelSelector ); - if ( !this.buttonElement.length ) { - this.buttonElement = ancestor.find( labelSelector ); } } - this.element.addClass( "ui-helper-hidden-accessible" ); + ); + } - var checked = this.element.is( ":checked" ); - if ( checked ) { - this.buttonElement.addClass( "ui-state-active" ); - } - this.buttonElement.attr( "aria-pressed", checked ); - } else { - this.buttonElement = this.element; - } - }, +}); - widget: function() { - return this.buttonElement; - }, +$.ui.plugin.add("resizable", "containment", { - destroy: function() { - this.element - .removeClass( "ui-helper-hidden-accessible" ); - this.buttonElement - .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) - .removeAttr( "role" ) - .removeAttr( "aria-pressed" ) - .html( this.buttonElement.find(".ui-button-text").html() ); + start: function(event, ui) { + var that = $(this).data("resizable"), o = that.options, el = that.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; - if ( !this.hasTitle ) { - this.buttonElement.removeAttr( "title" ); + that.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + that.containerOffset = { left: 0, top: 0 }; + that.containerPosition = { left: 0, top: 0 }; + + that.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; } - $.Widget.prototype.destroy.call( this ); - }, + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); - _setOption: function( key, value ) { - $.Widget.prototype._setOption.apply( this, arguments ); - if ( key === "disabled" ) { - if ( value ) { - this.element.propAttr( "disabled", true ); - } else { - this.element.propAttr( "disabled", false ); - } - return; + that.containerOffset = element.offset(); + that.containerPosition = element.position(); + that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = that.containerOffset, ch = that.containerSize.height, cw = that.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + that.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; } - this._resetButton(); }, - refresh: function() { - var isDisabled = this.element.is( ":disabled" ); - if ( isDisabled !== this.options.disabled ) { - this._setOption( "disabled", isDisabled ); - } - if ( this.type === "radio" ) { - radioGroup( this.element[0] ).each(function() { - if ( $( this ).is( ":checked" ) ) { - $( this ).button( "widget" ) - .addClass( "ui-state-active" ) - .attr( "aria-pressed", "true" ); - } else { - $( this ).button( "widget" ) - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", "false" ); - } - }); - } else if ( this.type === "checkbox" ) { - if ( this.element.is( ":checked" ) ) { - this.buttonElement - .addClass( "ui-state-active" ) - .attr( "aria-pressed", "true" ); - } else { - this.buttonElement - .removeClass( "ui-state-active" ) - .attr( "aria-pressed", "false" ); - } + resize: function(event, ui) { + var that = $(this).data("resizable"), o = that.options, + ps = that.containerSize, co = that.containerOffset, cs = that.size, cp = that.position, + pRatio = that._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = that.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (that._helper ? co.left : 0)) { + that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left)); + if (pRatio) that.size.height = that.size.width / that.aspectRatio; + that.position.left = o.helper ? co.left : 0; } - }, - _resetButton: function() { - if ( this.type === "input" ) { - if ( this.options.label ) { - this.element.val( this.options.label ); - } - return; + if (cp.top < (that._helper ? co.top : 0)) { + that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top); + if (pRatio) that.size.width = that.size.height * that.aspectRatio; + that.position.top = that._helper ? co.top : 0; } - var buttonElement = this.buttonElement.removeClass( typeClasses ), - buttonText = $( "" ) - .addClass( "ui-button-text" ) - .html( this.options.label ) - .appendTo( buttonElement.empty() ) - .text(), - icons = this.options.icons, - multipleIcons = icons.primary && icons.secondary, - buttonClasses = []; - if ( icons.primary || icons.secondary ) { - if ( this.options.text ) { - buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); - } + that.offset.left = that.parentData.left+that.position.left; + that.offset.top = that.parentData.top+that.position.top; - if ( icons.primary ) { - buttonElement.prepend( "" ); - } + var woset = Math.abs( (that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width ), + hoset = Math.abs( (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height ); - if ( icons.secondary ) { - buttonElement.append( "" ); - } + var isParent = that.containerElement.get(0) == that.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(that.containerElement.css('position')); - if ( !this.options.text ) { - buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + if(isParent && isOffsetRelative) woset -= that.parentData.left; - if ( !this.hasTitle ) { - buttonElement.attr( "title", buttonText ); - } - } - } else { - buttonClasses.push( "ui-button-text-only" ); + if (woset + that.size.width >= that.parentData.width) { + that.size.width = that.parentData.width - woset; + if (pRatio) that.size.height = that.size.width / that.aspectRatio; } - buttonElement.addClass( buttonClasses.join( " " ) ); + + if (hoset + that.size.height >= that.parentData.height) { + that.size.height = that.parentData.height - hoset; + if (pRatio) that.size.width = that.size.height * that.aspectRatio; + } + }, + + stop: function(event, ui){ + var that = $(this).data("resizable"), o = that.options, cp = that.position, + co = that.containerOffset, cop = that.containerPosition, ce = that.containerElement; + + var helper = $(that.helper), ho = helper.offset(), w = helper.outerWidth() - that.sizeDiff.width, h = helper.outerHeight() - that.sizeDiff.height; + + if (that._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (that._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + } }); -$.widget( "ui.buttonset", { - options: { - items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" - }, +$.ui.plugin.add("resizable", "ghost", { - _create: function() { - this.element.addClass( "ui-buttonset" ); - }, - - _init: function() { - this.refresh(); - }, + start: function(event, ui) { - _setOption: function( key, value ) { - if ( key === "disabled" ) { - this.buttons.button( "option", key, value ); - } + var that = $(this).data("resizable"), o = that.options, cs = that.size; + + that.ghost = that.originalElement.clone(); + that.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + that.ghost.appendTo(that.helper); - $.Widget.prototype._setOption.apply( this, arguments ); - }, - - refresh: function() { - var ltr = this.element.css( "direction" ) === "ltr"; - - this.buttons = this.element.find( this.options.items ) - .filter( ":ui-button" ) - .button( "refresh" ) - .end() - .not( ":ui-button" ) - .button() - .end() - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) - .filter( ":first" ) - .addClass( ltr ? "ui-corner-left" : "ui-corner-right" ) - .end() - .filter( ":last" ) - .addClass( ltr ? "ui-corner-right" : "ui-corner-left" ) - .end() - .end(); }, - destroy: function() { - this.element.removeClass( "ui-buttonset" ); - this.buttons - .map(function() { - return $( this ).button( "widget" )[ 0 ]; - }) - .removeClass( "ui-corner-left ui-corner-right" ) - .end() - .button( "destroy" ); + resize: function(event, ui){ + var that = $(this).data("resizable"), o = that.options; + if (that.ghost) that.ghost.css({ position: 'relative', height: that.size.height, width: that.size.width }); + }, - $.Widget.prototype.destroy.call( this ); + stop: function(event, ui){ + var that = $(this).data("resizable"), o = that.options; + if (that.ghost && that.helper) that.helper.get(0).removeChild(that.ghost.get(0)); } + }); -}( jQuery ) ); -/* - * jQuery UI Datepicker 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker - * - * Depends: - * jquery.ui.core.js - */ -(function( $, undefined ) { +$.ui.plugin.add("resizable", "grid", { -$.extend($.ui, { datepicker: { version: "1.8.16" } }); + resize: function(event, ui) { + var that = $(this).data("resizable"), o = that.options, cs = that.size, os = that.originalSize, op = that.originalPosition, a = that.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); -var PROP_NAME = 'datepicker'; -var dpuuid = new Date().getTime(); -var instActive; + if (/^(se|s|e)$/.test(a)) { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + that.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + that.position.left = op.left - ox; + } + else { + that.size.width = os.width + ox; + that.size.height = os.height + oy; + that.position.top = op.top - oy; + that.position.left = op.left - ox; + } + } -/* Date picker manager. - Use the singleton instance of this class, $.datepicker, to interact with the date picker. - Settings for (groups of) date pickers are maintained in an instance object, - allowing multiple different settings on the same page. */ +}); -function Datepicker() { - this.debug = false; // Change this to true to start debugging - this._curInst = null; // The current instance in use - this._keyEvent = false; // If the last event was a key event - this._disabledInputs = []; // List of date picker inputs that have been disabled - this._datepickerShowing = false; // True if the popup picker is showing , false if not - this._inDialog = false; // True if showing within a "dialog", false if not - this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division - this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class - this._appendClass = 'ui-datepicker-append'; // The name of the append marker class - this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class - this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class - this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class - this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class - this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class - this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class - this.regional = []; // Available regional settings, indexed by language code - this.regional[''] = { // Default regional settings - closeText: 'Done', // Display text for close link - prevText: 'Prev', // Display text for previous month link - nextText: 'Next', // Display text for next month link - currentText: 'Today', // Display text for current month link - monthNames: ['January','February','March','April','May','June', - 'July','August','September','October','November','December'], // Names of months for drop-down and formatting - monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting - dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting - dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting - dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday - weekHeader: 'Wk', // Column header for week of the year - dateFormat: 'mm/dd/yy', // See format options on parseDate - firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... - isRTL: false, // True if right-to-left language, false if left-to-right - showMonthAfterYear: false, // True if the year select precedes month, false for month then year - yearSuffix: '' // Additional text to append to the year in the month headers - }; - this._defaults = { // Global defaults for all the date picker instances - showOn: 'focus', // 'focus' for popup on focus, - // 'button' for trigger button, or 'both' for either - showAnim: 'fadeIn', // Name of jQuery animation for popup - showOptions: {}, // Options for enhanced animations - defaultDate: null, // Used when field is blank: actual date, - // +/-number for offset from today, null for today - appendText: '', // Display text following the input box, e.g. showing the format - buttonText: '...', // Text for trigger button - buttonImage: '', // URL for trigger button image - buttonImageOnly: false, // True if the image appears alone, false if it appears on a button - hideIfNoPrevNext: false, // True to hide next/previous month links - // if not applicable, false to just disable them - navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links - gotoCurrent: false, // True if today link goes back to current selection instead - changeMonth: false, // True if month can be selected directly, false if only prev/next - changeYear: false, // True if year can be selected directly, false if only prev/next - yearRange: 'c-10:c+10', // Range of years to display in drop-down, - // either relative to today's year (-nn:+nn), relative to currently displayed year - // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) - showOtherMonths: false, // True to show dates in other months, false to leave blank - selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable - showWeek: false, // True to show week of the year, false to not show it - calculateWeek: this.iso8601Week, // How to calculate the week of the year, - // takes a Date and returns the number of the week for it - shortYearCutoff: '+10', // Short year values < this are in the current century, - // > this are in the previous century, - // string value starting with '+' for current year + value - minDate: null, // The earliest selectable date, or null for no limit - maxDate: null, // The latest selectable date, or null for no limit - duration: 'fast', // Duration of display/closure - beforeShowDay: null, // Function that takes a date and returns an array with - // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', - // [2] = cell title (optional), e.g. $.datepicker.noWeekends - beforeShow: null, // Function that takes an input field and - // returns a set of custom settings for the date picker - onSelect: null, // Define a callback function when a date is selected - onChangeMonthYear: null, // Define a callback function when the month or year is changed - onClose: null, // Define a callback function when the datepicker is closed - numberOfMonths: 1, // Number of months to show at a time - showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) - stepMonths: 1, // Number of months to step back/forward - stepBigMonths: 12, // Number of months to step back/forward for the big links - altField: '', // Selector for an alternate field to store selected dates into - altFormat: '', // The date format to use for the alternate field - constrainInput: true, // The input is constrained by the current date format - showButtonPanel: false, // True to show button panel, false to not show it - autoSize: false, // True to size the input for the date format, false to leave as is - disabled: false // The initial disabled state - }; - $.extend(this._defaults, this.regional['']); - this.dpDiv = bindHover($('
          ')); -} +var num = function(v) { + return parseInt(v, 10) || 0; +}; -$.extend(Datepicker.prototype, { - /* Class name added to elements to indicate already configured with a date picker. */ - markerClassName: 'hasDatepicker', - - //Keep track of the maximum number of rows displayed (see #7043) - maxRows: 4, +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; - /* Debug logging (if enabled). */ - log: function () { - if (this.debug) - console.log.apply('', arguments); - }, - - // TODO rename to "widget" when switching to widget factory - _widgetDatepicker: function() { - return this.dpDiv; - }, +})(jQuery); +(function( $, undefined ) { - /* Override the default settings for all instances of the date picker. - @param settings object - the new settings to use as defaults (anonymous object) - @return the manager object */ - setDefaults: function(settings) { - extendRemove(this._defaults, settings || {}); - return this; +$.widget("ui.selectable", $.ui.mouse, { + version: "1.9.2", + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' }, + _create: function() { + var that = this; - /* Attach the date picker to a jQuery selection. - @param target element - the target input field or division or span - @param settings object - the new settings to use for this date picker instance (anonymous) */ - _attachDatepicker: function(target, settings) { - // check for settings on the control itself - in namespace 'date:' - var inlineSettings = null; - for (var attrName in this._defaults) { - var attrValue = target.getAttribute('date:' + attrName); - if (attrValue) { - inlineSettings = inlineSettings || {}; - try { - inlineSettings[attrName] = eval(attrValue); - } catch (err) { - inlineSettings[attrName] = attrValue; - } - } - } - var nodeName = target.nodeName.toLowerCase(); - var inline = (nodeName == 'div' || nodeName == 'span'); - if (!target.id) { - this.uuid += 1; - target.id = 'dp' + this.uuid; - } - var inst = this._newInst($(target), inline); - inst.settings = $.extend({}, settings || {}, inlineSettings || {}); - if (nodeName == 'input') { - this._connectDatepicker(target, inst); - } else if (inline) { - this._inlineDatepicker(target, inst); - } + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(that.options.filter, that.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
          "); }, - /* Create a new instance object. */ - _newInst: function(target, inline) { - var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars - return {id: id, input: target, // associated target - selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection - drawMonth: 0, drawYear: 0, // month being drawn - inline: inline, // is datepicker inline or not - dpDiv: (!inline ? this.dpDiv : // presentation div - bindHover($('
          ')))}; + _destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled"); + this._mouseDestroy(); }, - /* Attach the date picker to an input field. */ - _connectDatepicker: function(target, inst) { - var input = $(target); - inst.append = $([]); - inst.trigger = $([]); - if (input.hasClass(this.markerClassName)) + _mouseStart: function(event) { + var that = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) return; - this._attachments(input, inst); - input.addClass(this.markerClassName).keydown(this._doKeyDown). - keypress(this._doKeyPress).keyup(this._doKeyUp). - bind("setData.datepicker", function(event, key, value) { - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key) { - return this._get(inst, key); - }); - this._autoSize(inst); - $.data(target, PROP_NAME, inst); - //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) - if( inst.settings.disabled ) { - this._disableDatepicker( target ); - } - }, - /* Make attachments based on settings. */ - _attachments: function(input, inst) { - var appendText = this._get(inst, 'appendText'); - var isRTL = this._get(inst, 'isRTL'); - if (inst.append) - inst.append.remove(); - if (appendText) { - inst.append = $('' + appendText + ''); - input[isRTL ? 'before' : 'after'](inst.append); + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); } - input.unbind('focus', this._showDatepicker); - if (inst.trigger) - inst.trigger.remove(); - var showOn = this._get(inst, 'showOn'); - if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field - input.focus(this._showDatepicker); - if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked - var buttonText = this._get(inst, 'buttonText'); - var buttonImage = this._get(inst, 'buttonImage'); - inst.trigger = $(this._get(inst, 'buttonImageOnly') ? - $('').addClass(this._triggerClass). - attr({ src: buttonImage, alt: buttonText, title: buttonText }) : - $('').addClass(this._triggerClass). - html(buttonImage == '' ? buttonText : $('').attr( - { src:buttonImage, alt:buttonText, title:buttonText }))); - input[isRTL ? 'before' : 'after'](inst.trigger); - inst.trigger.click(function() { - if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) - $.datepicker._hideDatepicker(); - else - $.datepicker._showDatepicker(input[0]); + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + that._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } return false; - }); - } + } + }); + }, - /* Apply the maximum length for the date format. */ - _autoSize: function(inst) { - if (this._get(inst, 'autoSize') && !inst.inline) { - var date = new Date(2009, 12 - 1, 20); // Ensure double digits - var dateFormat = this._get(inst, 'dateFormat'); - if (dateFormat.match(/[DM]/)) { - var findMax = function(names) { - var max = 0; - var maxI = 0; - for (var i = 0; i < names.length; i++) { - if (names[i].length > max) { - max = names[i].length; - maxI = i; + _mouseDrag: function(event) { + var that = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == that.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + that._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; } + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); } - return maxI; - }; - date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? - 'monthNames' : 'monthNamesShort')))); - date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? - 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } } - inst.input.attr('size', this._formatDate(inst, date).length); - } + }); + + return false; }, - /* Attach an inline date picker to a div. */ - _inlineDatepicker: function(target, inst) { - var divSpan = $(target); - if (divSpan.hasClass(this.markerClassName)) - return; - divSpan.addClass(this.markerClassName).append(inst.dpDiv). - bind("setData.datepicker", function(event, key, value){ - inst.settings[key] = value; - }).bind("getData.datepicker", function(event, key){ - return this._get(inst, key); + _mouseStop: function(event) { + var that = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + that._trigger("unselected", event, { + unselected: selectee.element }); - $.data(target, PROP_NAME, inst); - this._setDate(inst, this._getDefaultDate(inst), true); - this._updateDatepicker(inst); - this._updateAlternate(inst); - //If disabled option is true, disable the datepicker before showing it (see ticket #5665) - if( inst.settings.disabled ) { - this._disableDatepicker( target ); - } - // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements - // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height - inst.dpDiv.css( "display", "block" ); - }, + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + that._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); - /* Pop-up the date picker in a "dialog" box. - @param input element - ignored - @param date string or Date - the initial date to display - @param onSelect function - the function to call when a date is selected - @param settings object - update the dialog date picker instance's settings (anonymous object) - @param pos int[2] - coordinates for the dialog's position within the screen or - event - with x/y coordinates or - leave empty for default (screen centre) - @return the manager object */ - _dialogDatepicker: function(input, date, onSelect, settings, pos) { - var inst = this._dialogInst; // internal instance - if (!inst) { - this.uuid += 1; - var id = 'dp' + this.uuid; - this._dialogInput = $(''); - this._dialogInput.keydown(this._doKeyDown); - $('body').append(this._dialogInput); - inst = this._dialogInst = this._newInst(this._dialogInput, false); - inst.settings = {}; - $.data(this._dialogInput[0], PROP_NAME, inst); - } - extendRemove(inst.settings, settings || {}); - date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); - this._dialogInput.val(date); + this.helper.remove(); - this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); - if (!this._pos) { - var browserWidth = document.documentElement.clientWidth; - var browserHeight = document.documentElement.clientHeight; - var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; - var scrollY = document.documentElement.scrollTop || document.body.scrollTop; - this._pos = // should use actual width/height below - [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; - } + return false; + } - // move input on screen for focus, but hidden behind dialog - this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); - inst.settings.onSelect = onSelect; - this._inDialog = true; - this.dpDiv.addClass(this._dialogClass); - this._showDatepicker(this._dialogInput[0]); - if ($.blockUI) - $.blockUI(this.dpDiv); - $.data(this._dialogInput[0], PROP_NAME, inst); - return this; - }, +}); - /* Detach a datepicker from its control. - @param target element - the target input field or division or span */ - _destroyDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - $.removeData(target, PROP_NAME); - if (nodeName == 'input') { - inst.append.remove(); - inst.trigger.remove(); - $target.removeClass(this.markerClassName). - unbind('focus', this._showDatepicker). - unbind('keydown', this._doKeyDown). - unbind('keypress', this._doKeyPress). - unbind('keyup', this._doKeyUp); - } else if (nodeName == 'div' || nodeName == 'span') - $target.removeClass(this.markerClassName).empty(); - }, +})(jQuery); +(function( $, undefined ) { - /* Enable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _enableDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = false; - inst.trigger.filter('button'). - each(function() { this.disabled = false; }).end(). - filter('img').css({opacity: '1.0', cursor: ''}); - } - else if (nodeName == 'div' || nodeName == 'span') { - var inline = $target.children('.' + this._inlineClass); - inline.children().removeClass('ui-state-disabled'); - inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). - removeAttr("disabled"); - } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry - }, +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; - /* Disable the date picker to a jQuery selection. - @param target element - the target input field or division or span */ - _disableDatepicker: function(target) { - var $target = $(target); - var inst = $.data(target, PROP_NAME); - if (!$target.hasClass(this.markerClassName)) { - return; - } - var nodeName = target.nodeName.toLowerCase(); - if (nodeName == 'input') { - target.disabled = true; - inst.trigger.filter('button'). - each(function() { this.disabled = true; }).end(). - filter('img').css({opacity: '0.5', cursor: 'default'}); - } - else if (nodeName == 'div' || nodeName == 'span') { - var inline = $target.children('.' + this._inlineClass); - inline.children().addClass('ui-state-disabled'); - inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). - attr("disabled", "disabled"); - } - this._disabledInputs = $.map(this._disabledInputs, - function(value) { return (value == target ? null : value); }); // delete entry - this._disabledInputs[this._disabledInputs.length] = target; - }, +$.widget( "ui.slider", $.ui.mouse, { + version: "1.9.2", + widgetEventPrefix: "slide", - /* Is the first field in a jQuery collection disabled as a datepicker? - @param target element - the target input field or division or span - @return boolean - true if disabled, false if enabled */ - _isDisabledDatepicker: function(target) { - if (!target) { - return false; - } - for (var i = 0; i < this._disabledInputs.length; i++) { - if (this._disabledInputs[i] == target) - return true; - } - return false; + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null }, - /* Retrieve the instance data for the target control. - @param target element - the target input field or division or span - @return object - the associated instance data - @throws error if a jQuery problem getting data */ - _getInst: function(target) { - try { - return $.data(target, PROP_NAME); - } - catch (err) { - throw 'Missing instance data for this datepicker'; - } - }, + _create: function() { + var i, handleCount, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); - /* Update or retrieve the settings for a date picker attached to an input field or division. - @param target element - the target input field or division or span - @param name object - the new settings to update or - string - the name of the setting to change or retrieve, - when retrieving also 'all' for all instance settings or - 'defaults' for all global defaults - @param value any - the new value for the setting - (omit if above is an object or to retrieve a value) */ - _optionDatepicker: function(target, name, value) { - var inst = this._getInst(target); - if (arguments.length == 2 && typeof name == 'string') { - return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : - (inst ? (name == 'all' ? $.extend({}, inst.settings) : - this._get(inst, name)) : null)); - } - var settings = name || {}; - if (typeof name == 'string') { - settings = {}; - settings[name] = value; - } - if (inst) { - if (this._curInst == inst) { - this._hideDatepicker(); + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } } - var date = this._getDateDatepicker(target, true); - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - extendRemove(inst.settings, settings); - // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided - if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) - inst.settings.minDate = this._formatDate(inst, minDate); - if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) - inst.settings.maxDate = this._formatDate(inst, maxDate); - this._attachments($(target), inst); - this._autoSize(inst); - this._setDate(inst, date); - this._updateAlternate(inst); - this._updateDatepicker(inst); + + this.range = $( "
          " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); } - }, - // change method deprecated - _changeDatepicker: function(target, name, value) { - this._optionDatepicker(target, name, value); - }, + handleCount = ( o.values && o.values.length ) || 1; - /* Redraw the date picker attached to an input field or division. - @param target element - the target input field or division or span */ - _refreshDatepicker: function(target) { - var inst = this._getInst(target); - if (inst) { - this._updateDatepicker(inst); + for ( i = existingHandles.length; i < handleCount; i++ ) { + handles.push( handle ); } - }, - /* Set the dates for a jQuery selection. - @param target element - the target input field or division or span - @param date Date - the new date */ - _setDateDatepicker: function(target, date) { - var inst = this._getInst(target); - if (inst) { - this._setDate(inst, date); - this._updateDatepicker(inst); - this._updateAlternate(inst); - } - }, + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) ); - /* Get the date(s) for the first entry in a jQuery selection. - @param target element - the target input field or division or span - @param noDefault boolean - true if no default date is to be used - @return Date - the current date */ - _getDateDatepicker: function(target, noDefault) { - var inst = this._getInst(target); - if (inst && !inst.inline) - this._setDateFromField(inst, noDefault); - return (inst ? this._getDate(inst) : null); - }, + this.handle = this.handles.eq( 0 ); - /* Handle keystrokes. */ - _doKeyDown: function(event) { - var inst = $.datepicker._getInst(event.target); - var handled = true; - var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); - inst._keyEvent = true; - if ($.datepicker._datepickerShowing) - switch (event.keyCode) { - case 9: $.datepicker._hideDatepicker(); - handled = false; - break; // hide on tab out - case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + - $.datepicker._currentClass + ')', inst.dpDiv); - if (sel[0]) - $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); - var onSelect = $.datepicker._get(inst, 'onSelect'); - if (onSelect) { - var dateStr = $.datepicker._formatDate(inst); + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .mouseenter(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }) + .mouseleave(function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); - // trigger custom callback - onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + this.handles.each(function( i ) { + $( this ).data( "ui-slider-handle-index", i ); + }); + + this._on( this.handles, { + keydown: function( event ) { + var allowed, curVal, newVal, step, + index = $( event.target ).data( "ui-slider-handle-index" ); + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !this._keySliding ) { + this._keySliding = true; + $( event.target ).addClass( "ui-state-active" ); + allowed = this._start( event, index ); + if ( allowed === false ) { + return; } - else - $.datepicker._hideDatepicker(); - return false; // don't submit the form - break; // select the value on enter - case 27: $.datepicker._hideDatepicker(); - break; // hide on escape - case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? - -$.datepicker._get(inst, 'stepBigMonths') : - -$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // previous month/year on page up/+ ctrl - case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? - +$.datepicker._get(inst, 'stepBigMonths') : - +$.datepicker._get(inst, 'stepMonths')), 'M'); - break; // next month/year on page down/+ ctrl - case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); - handled = event.ctrlKey || event.metaKey; - break; // clear on ctrl or command +end - case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); - handled = event.ctrlKey || event.metaKey; - break; // current on ctrl or command +home - case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); - handled = event.ctrlKey || event.metaKey; - // -1 day on ctrl or command +left - if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? - -$.datepicker._get(inst, 'stepBigMonths') : - -$.datepicker._get(inst, 'stepMonths')), 'M'); - // next month/year on alt +left on Mac + } break; - case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); - handled = event.ctrlKey || event.metaKey; - break; // -1 week on ctrl or command +up - case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); - handled = event.ctrlKey || event.metaKey; - // +1 day on ctrl or command +right - if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? - +$.datepicker._get(inst, 'stepBigMonths') : - +$.datepicker._get(inst, 'stepMonths')), 'M'); - // next month/year on alt +right + } + + step = this.options.step; + if ( this.options.values && this.options.values.length ) { + curVal = newVal = this.values( index ); + } else { + curVal = newVal = this.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = this._valueMin(); break; - case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); - handled = event.ctrlKey || event.metaKey; - break; // +1 week on ctrl or command +down - default: handled = false; + case $.ui.keyCode.END: + newVal = this._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = this._trimAlignValue( curVal + ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = this._trimAlignValue( curVal - ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === this._valueMax() ) { + return; + } + newVal = this._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === this._valueMin() ) { + return; + } + newVal = this._trimAlignValue( curVal - step ); + break; + } + + this._slide( event, index, newVal ); + }, + keyup: function( event ) { + var index = $( event.target ).data( "ui-slider-handle-index" ); + + if ( this._keySliding ) { + this._keySliding = false; + this._stop( event, index ); + this._change( event, index ); + $( event.target ).removeClass( "ui-state-active" ); + } + } + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + _destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + this._mouseDestroy(); + }, + + _mouseCapture: function( event ) { + var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle, + that = this, + o = this.options; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - that.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; } - else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home - $.datepicker._showDatepicker(this); - else { - handled = false; + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); } - if (handled) { - event.preventDefault(); - event.stopPropagation(); + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; } - }, + this._mouseSliding = true; - /* Filter entered characters - based on date format. */ - _doKeyPress: function(event) { - var inst = $.datepicker._getInst(event.target); - if ($.datepicker._get(inst, 'constrainInput')) { - var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); - var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); - return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + this._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); } + this._animateOff = true; + return true; }, - /* Synchronise manual entry and field/alternate field. */ - _doKeyUp: function(event) { - var inst = $.datepicker._getInst(event.target); - if (inst.input.val() != inst.lastVal) { - try { - var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), - (inst.input ? inst.input.val() : null), - $.datepicker._getFormatConfig(inst)); - if (date) { // only if valid - $.datepicker._setDateFromField(inst); - $.datepicker._updateAlternate(inst); - $.datepicker._updateDatepicker(inst); - } - } - catch (event) { - $.datepicker.log(event); - } - } + _mouseStart: function() { return true; }, - /* Pop-up the date picker for a given input field. - If false returned from beforeShow event handler do not show. - @param input element - the input field attached to the date picker or - event - if triggered by focus */ - _showDatepicker: function(input) { - input = input.target || input; - if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger - input = $('input', input.parentNode)[0]; - if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here - return; - var inst = $.datepicker._getInst(input); - if ($.datepicker._curInst && $.datepicker._curInst != inst) { - if ( $.datepicker._datepickerShowing ) { - $.datepicker._triggerOnClose($.datepicker._curInst); - } - $.datepicker._curInst.dpDiv.stop(true, true); - } - var beforeShow = $.datepicker._get(inst, 'beforeShow'); - var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; - if(beforeShowSettings === false){ - //false - return; + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); } - extendRemove(inst.settings, beforeShowSettings); - inst.lastVal = null; - $.datepicker._lastInput = input; - $.datepicker._setDateFromField(inst); - if ($.datepicker._inDialog) // hide cursor - input.value = ''; - if (!$.datepicker._pos) { // position below input - $.datepicker._pos = $.datepicker._findPos(input); - $.datepicker._pos[1] += input.offsetHeight; // add the height + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; } - var isFixed = false; - $(input).parents().each(function() { - isFixed |= $(this).css('position') == 'fixed'; - return !isFixed; - }); - if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled - $.datepicker._pos[0] -= document.documentElement.scrollLeft; - $.datepicker._pos[1] -= document.documentElement.scrollTop; + if ( percentMouse < 0 ) { + percentMouse = 0; } - var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; - $.datepicker._pos = null; - //to avoid flashes on Firefox - inst.dpDiv.empty(); - // determine sizing offscreen - inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); - $.datepicker._updateDatepicker(inst); - // fix width for dynamic number of date pickers - // and adjust position before showing - offset = $.datepicker._checkOffset(inst, offset, isFixed); - inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? - 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', - left: offset.left + 'px', top: offset.top + 'px'}); - if (!inst.inline) { - var showAnim = $.datepicker._get(inst, 'showAnim'); - var duration = $.datepicker._get(inst, 'duration'); - var postProcess = function() { - var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only - if( !! cover.length ){ - var borders = $.datepicker._getBorders(inst.dpDiv); - cover.css({left: -borders[0], top: -borders[1], - width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); - } - }; - inst.dpDiv.zIndex($(input).zIndex()+1); - $.datepicker._datepickerShowing = true; - if ($.effects && $.effects[showAnim]) - inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); - else - inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); - if (!showAnim || !duration) - postProcess(); - if (inst.input.is(':visible') && !inst.input.is(':disabled')) - inst.input.focus(); - $.datepicker._curInst = inst; + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); }, - /* Generate the date picker content. */ - _updateDatepicker: function(inst) { - var self = this; - self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) - var borders = $.datepicker._getBorders(inst.dpDiv); - instActive = inst; // for delegate hover events - inst.dpDiv.empty().append(this._generateHTML(inst)); - var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only - if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 - cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); } - inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); - var numMonths = this._getNumberOfMonths(inst); - var cols = numMonths[1]; - var width = 17; - inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); - if (cols > 1) - inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); - inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + - 'Class']('ui-datepicker-multi'); - inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + - 'Class']('ui-datepicker-rtl'); - if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && - // #6694 - don't focus the input if it's already focused - // this breaks the change event in IE - inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) - inst.input.focus(); - // deffered render of the years select (to avoid flashes on Firefox) - if( inst.yearshtml ){ - var origyearshtml = inst.yearshtml; - setTimeout(function(){ - //assure that inst.yearshtml didn't change. - if( origyearshtml === inst.yearshtml && inst.yearshtml ){ - inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); } - origyearshtml = inst.yearshtml = null; - }, 0); + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } } }, - /* Retrieve the size of left and top borders for an element. - @param elem (jQuery object) the element of interest - @return (number[2]) the left and top borders */ - _getBorders: function(elem) { - var convert = function(value) { - return {thin: 1, medium: 2, thick: 3}[value] || value; + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() }; - return [parseFloat(convert(elem.css('border-left-width'))), - parseFloat(convert(elem.css('border-top-width')))]; - }, - - /* Check positioning to remain on screen. */ - _checkOffset: function(inst, offset, isFixed) { - var dpWidth = inst.dpDiv.outerWidth(); - var dpHeight = inst.dpDiv.outerHeight(); - var inputWidth = inst.input ? inst.input.outerWidth() : 0; - var inputHeight = inst.input ? inst.input.outerHeight() : 0; - var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); - var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); - - offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); - offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; - offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; - - // now check if datepicker is showing outside window viewport - move to a better place if so. - offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? - Math.abs(offset.left + dpWidth - viewWidth) : 0); - offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? - Math.abs(dpHeight + inputHeight) : 0); + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } - return offset; + this._trigger( "stop", event, uiHash ); }, - /* Find an object's position on the screen. */ - _findPos: function(obj) { - var inst = this._getInst(obj); - var isRTL = this._get(inst, 'isRTL'); - while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { - obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; - } - var position = $(obj).offset(); - return [position.left, position.top]; - }, + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } - /* Trigger custom callback of onClose. */ - _triggerOnClose: function(inst) { - var onClose = this._get(inst, 'onClose'); - if (onClose) - onClose.apply((inst.input ? inst.input[0] : null), - [(inst.input ? inst.input.val() : ''), inst]); + this._trigger( "change", event, uiHash ); + } }, - /* Hide the date picker from view. - @param input element - the input field attached to the date picker */ - _hideDatepicker: function(input) { - var inst = this._curInst; - if (!inst || (input && inst != $.data(input, PROP_NAME))) + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); return; - if (this._datepickerShowing) { - var showAnim = this._get(inst, 'showAnim'); - var duration = this._get(inst, 'duration'); - var postProcess = function() { - $.datepicker._tidyDialog(inst); - this._curInst = null; - }; - if ($.effects && $.effects[showAnim]) - inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); - else - inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : - (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); - if (!showAnim) - postProcess(); - $.datepicker._triggerOnClose(inst); - this._datepickerShowing = false; - this._lastInput = null; - if (this._inDialog) { - this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); - if ($.blockUI) { - $.unblockUI(); - $('body').append(this.dpDiv); - } - } - this._inDialog = false; } - }, - /* Tidy up after a dialog display. */ - _tidyDialog: function(inst) { - inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + return this._value(); }, - /* Close date picker if clicked elsewhere. */ - _checkExternalClick: function(event) { - if (!$.datepicker._curInst) - return; - var $target = $(event.target); - if ($target[0].id != $.datepicker._mainDivId && - $target.parents('#' + $.datepicker._mainDivId).length == 0 && - !$target.hasClass($.datepicker.markerClassName) && - !$target.hasClass($.datepicker._triggerClass) && - $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) - $.datepicker._hideDatepicker(); - }, + values: function( index, newValue ) { + var vals, + newValues, + i; - /* Adjust one of the date sub-fields. */ - _adjustDate: function(id, offset, period) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._isDisabledDatepicker(target[0])) { + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); return; } - this._adjustInstDate(inst, offset + - (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning - period); - this._updateDatepicker(inst); + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } }, - /* Action for current link. */ - _gotoToday: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - if (this._get(inst, 'gotoCurrent') && inst.currentDay) { - inst.selectedDay = inst.currentDay; - inst.drawMonth = inst.selectedMonth = inst.currentMonth; - inst.drawYear = inst.selectedYear = inst.currentYear; + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; } - else { - var date = new Date(); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.prop( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.prop( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + case "min": + case "max": + this._animateOff = true; + this._refreshValue(); + this._animateOff = false; + break; } - this._notifyChange(inst); - this._adjustDate(target); }, - /* Action for selecting a new month/year. */ - _selectMonthYear: function(id, select, period) { - var target = $(id); - var inst = this._getInst(target[0]); - inst['selected' + (period == 'M' ? 'Month' : 'Year')] = - inst['draw' + (period == 'M' ? 'Month' : 'Year')] = - parseInt(select.options[select.selectedIndex].value,10); - this._notifyChange(inst); - this._adjustDate(target); - }, + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); - /* Action for selecting a day. */ - _selectDay: function(id, month, year, td) { - var target = $(id); - if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { - return; - } - var inst = this._getInst(target[0]); - inst.selectedDay = inst.currentDay = $('a', td).html(); - inst.selectedMonth = inst.currentMonth = month; - inst.selectedYear = inst.currentYear = year; - this._selectDate(id, this._formatDate(inst, - inst.currentDay, inst.currentMonth, inst.currentYear)); + return val; }, - /* Erase the input field and hide the date picker. */ - _clearDate: function(id) { - var target = $(id); - var inst = this._getInst(target[0]); - this._selectDate(target, ''); - }, + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } - /* Update the input field with the selected date. */ - _selectDate: function(id, dateStr) { - var target = $(id); - var inst = this._getInst(target[0]); - dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); - if (inst.input) - inst.input.val(dateStr); - this._updateAlternate(inst); - var onSelect = this._get(inst, 'onSelect'); - if (onSelect) - onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback - else if (inst.input) - inst.input.trigger('change'); // fire the change event - if (inst.inline) - this._updateDatepicker(inst); - else { - this._hideDatepicker(); - this._lastInput = inst.input[0]; - if (typeof(inst.input[0]) != 'object') - inst.input.focus(); // restore focus - this._lastInput = null; + return vals; } }, - /* Update any alternate field to synchronise with the main field. */ - _updateAlternate: function(inst) { - var altField = this._get(inst, 'altField'); - if (altField) { // update alternate field too - var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); - var date = this._getDate(inst); - var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); - $(altField).each(function() { $(this).val(dateStr); }); + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); }, - /* Set as beforeShowDay function to prevent selection of weekends. - @param date Date - the date to customise - @return [boolean, string] - is this date selectable?, what is its CSS class? */ - noWeekends: function(date) { - var day = date.getDay(); - return [(day > 0 && day < 6), '']; + _valueMin: function() { + return this.options.min; }, - /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. - @param date Date - the date to get the week for - @return number - the number of the week within the year that contains this date */ - iso8601Week: function(date) { - var checkDate = new Date(date.getTime()); - // Find Thursday of this week starting on Monday - checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); - var time = checkDate.getTime(); - checkDate.setMonth(0); // Compare with Jan 1 - checkDate.setDate(1); - return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + _valueMax: function() { + return this.options.max; }, - /* Parse a string value into a date object. - See formatDate below for the possible formats. + _refreshValue: function() { + var lastValPercent, valPercent, value, valueMin, valueMax, + oRange = this.options.range, + o = this.options, + that = this, + animate = ( !this._animateOff ) ? o.animate : false, + _set = {}; - @param format string - the expected format of the date - @param value string - the date in the above format - @param settings Object - attributes include: - shortYearCutoff number - the cutoff year for determining the century (optional) - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return Date - the extracted date value or null if value is blank */ - parseDate: function (format, value, settings) { - if (format == null || value == null) - throw 'Invalid arguments'; - value = (typeof value == 'object' ? value.toString() : value + ''); - if (value == '') - return null; - var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; - shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : - new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - var year = -1; - var month = -1; - var day = -1; - var doy = -1; - var literal = false; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Extract a number from the string value - var getNumber = function(match) { - var isDoubled = lookAhead(match); - var size = (match == '@' ? 14 : (match == '!' ? 20 : - (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); - var digits = new RegExp('^\\d{1,' + size + '}'); - var num = value.substring(iValue).match(digits); - if (!num) - throw 'Missing number at position ' + iValue; - iValue += num[0].length; - return parseInt(num[0], 10); - }; - // Extract a name from the string value and convert to an index - var getName = function(match, shortNames, longNames) { - var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { - return [ [k, v] ]; - }).sort(function (a, b) { - return -(a[1].length - b[1].length); - }); - var index = -1; - $.each(names, function (i, pair) { - var name = pair[1]; - if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { - index = pair[0]; - iValue += name.length; - return false; + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i ) { + valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100; + _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( that.options.range === true ) { + if ( that.orientation === "horizontal" ) { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } } + lastValPercent = valPercent; }); - if (index != -1) - return index + 1; - else - throw 'Unknown name at position ' + iValue; - }; - // Confirm that a literal character matches the string value - var checkLiteral = function() { - if (value.charAt(iValue) != format.charAt(iFormat)) - throw 'Unexpected literal at position ' + iValue; - iValue++; - }; - var iValue = 0; - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - checkLiteral(); - else - switch (format.charAt(iFormat)) { - case 'd': - day = getNumber('d'); - break; - case 'D': - getName('D', dayNamesShort, dayNames); - break; - case 'o': - doy = getNumber('o'); - break; - case 'm': - month = getNumber('m'); - break; - case 'M': - month = getName('M', monthNamesShort, monthNames); - break; - case 'y': - year = getNumber('y'); - break; - case '@': - var date = new Date(getNumber('@')); - year = date.getFullYear(); - month = date.getMonth() + 1; - day = date.getDate(); - break; - case '!': - var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); - year = date.getFullYear(); - month = date.getMonth() + 1; - day = date.getDate(); - break; - case "'": - if (lookAhead("'")) - checkLiteral(); - else - literal = true; - break; - default: - checkLiteral(); - } - } - if (iValue < value.length){ - throw "Extra/unparsed characters found in date: " + value.substring(iValue); - } - if (year == -1) - year = new Date().getFullYear(); - else if (year < 100) - year += new Date().getFullYear() - new Date().getFullYear() % 100 + - (year <= shortYearCutoff ? 0 : -100); - if (doy > -1) { - month = 1; - day = doy; - do { - var dim = this._getDaysInMonth(year, month - 1); - if (day <= dim) - break; - month++; - day -= dim; - } while (true); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } } - var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); - if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) - throw 'Invalid date'; // E.g. 31/02/00 - return date; + } + +}); + +}(jQuery)); +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + version: "1.9.2", + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 }, + _create: function() { - /* Standard date formats. */ - ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) - COOKIE: 'D, dd M yy', - ISO_8601: 'yy-mm-dd', - RFC_822: 'D, d M y', - RFC_850: 'DD, dd-M-y', - RFC_1036: 'D, d M y', - RFC_1123: 'D, d M yy', - RFC_2822: 'D, d M yy', - RSS: 'D, d M y', // RFC 822 - TICKS: '!', - TIMESTAMP: '@', - W3C: 'yy-mm-dd', // ISO 8601 + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); - _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + - Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + //Get the items + this.refresh(); - /* Format a date object into a string value. - The format can be combinations of the following: - d - day of month (no leading zero) - dd - day of month (two digit) - o - day of year (no leading zeros) - oo - day of year (three digit) - D - day name short - DD - day name long - m - month of year (no leading zero) - mm - month of year (two digit) - M - month name short - MM - month name long - y - year (two digit) - yy - year (four digit) - @ - Unix timestamp (ms since 01/01/1970) - ! - Windows ticks (100ns since 01/01/0001) - '...' - literal text - '' - single quote + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; - @param format string - the desired format of the date - @param date Date - the date value to format - @param settings Object - attributes include: - dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) - dayNames string[7] - names of the days from Sunday (optional) - monthNamesShort string[12] - abbreviated names of the months (optional) - monthNames string[12] - names of the months (optional) - @return string - the date in the above format */ - formatDate: function (format, date, settings) { - if (!date) - return ''; - var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; - var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; - var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; - var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; - }; - // Format a number, with leading zero if necessary - var formatNumber = function(match, value, len) { - var num = '' + value; - if (lookAhead(match)) - while (num.length < len) - num = '0' + num; - return num; - }; - // Format a name, short or long as requested - var formatName = function(match, value, shortNames, longNames) { - return (lookAhead(match) ? longNames[value] : shortNames[value]); - }; - var output = ''; - var literal = false; - if (date) - for (var iFormat = 0; iFormat < format.length; iFormat++) { - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - output += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': - output += formatNumber('d', date.getDate(), 2); - break; - case 'D': - output += formatName('D', date.getDay(), dayNamesShort, dayNames); - break; - case 'o': - output += formatNumber('o', - Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); - break; - case 'm': - output += formatNumber('m', date.getMonth() + 1, 2); - break; - case 'M': - output += formatName('M', date.getMonth(), monthNamesShort, monthNames); - break; - case 'y': - output += (lookAhead('y') ? date.getFullYear() : - (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); - break; - case '@': - output += date.getTime(); - break; - case '!': - output += date.getTime() * 10000 + this._ticksTo1970; - break; - case "'": - if (lookAhead("'")) - output += "'"; - else - literal = true; - break; - default: - output += format.charAt(iFormat); - } + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + _destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget().toggleClass( "ui-sortable-disabled", !!value ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == that) { + currentItem = $(this); + return false; } - return output; + }); + if($.data(event.target, that.widgetName + '-item') == that) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + }, - /* Extract all possible characters from the date format. */ - _possibleChars: function (format) { - var chars = ''; - var literal = false; - // Check whether a format character is doubled - var lookAhead = function(match) { - var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); - if (matches) - iFormat++; - return matches; + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left }; - for (var iFormat = 0; iFormat < format.length; iFormat++) - if (literal) - if (format.charAt(iFormat) == "'" && !lookAhead("'")) - literal = false; - else - chars += format.charAt(iFormat); - else - switch (format.charAt(iFormat)) { - case 'd': case 'm': case 'y': case '@': - chars += '0123456789'; - break; - case 'D': case 'M': - return null; // Accept anything - case "'": - if (lookAhead("'")) - chars += "'"; - else - literal = true; - break; - default: - chars += format.charAt(iFormat); - } - return chars; - }, - /* Get a setting value, defaulting if necessary. */ - _get: function(inst, name) { - return inst.settings[name] !== undefined ? - inst.settings[name] : this._defaults[name]; - }, + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); - /* Parse existing date and initialise date picker. */ - _setDateFromField: function(inst, noDefault) { - if (inst.input.val() == inst.lastVal) { - return; + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); } - var dateFormat = this._get(inst, 'dateFormat'); - var dates = inst.lastVal = inst.input ? inst.input.val() : null; - var date, defaultDate; - date = defaultDate = this._getDefaultDate(inst); - var settings = this._getFormatConfig(inst); - try { - date = this.parseDate(dateFormat, dates, settings) || defaultDate; - } catch (event) { - this.log(event); - dates = (noDefault ? '' : dates); + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); } - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - inst.currentDay = (dates ? date.getDate() : 0); - inst.currentMonth = (dates ? date.getMonth() : 0); - inst.currentYear = (dates ? date.getFullYear() : 0); - this._adjustInstDate(inst); - }, - /* Retrieve the default date shown on opening. */ - _getDefaultDate: function(inst) { - return this._restrictMinMax(inst, - this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); - }, + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } - /* A date may be specified as an exact value or a relative one. */ - _determineDate: function(inst, date, defaultDate) { - var offsetNumeric = function(offset) { - var date = new Date(); - date.setDate(date.getDate() + offset); - return date; - }; - var offsetString = function(offset) { - try { - return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), - offset, $.datepicker._getFormatConfig(inst)); - } - catch (e) { - // Ignore - } - var date = (offset.toLowerCase().match(/^c/) ? - $.datepicker._getDate(inst) : null) || new Date(); - var year = date.getFullYear(); - var month = date.getMonth(); - var day = date.getDate(); - var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; - var matches = pattern.exec(offset); - while (matches) { - switch (matches[2] || 'd') { - case 'd' : case 'D' : - day += parseInt(matches[1],10); break; - case 'w' : case 'W' : - day += parseInt(matches[1],10) * 7; break; - case 'm' : case 'M' : - month += parseInt(matches[1],10); - day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); - break; - case 'y': case 'Y' : - year += parseInt(matches[1],10); - day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); - break; - } - matches = pattern.exec(offset); - } - return new Date(year, month, day); - }; - var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : - (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); - newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); - if (newDate) { - newDate.setHours(0); - newDate.setMinutes(0); - newDate.setSeconds(0); - newDate.setMilliseconds(0); + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); } - return this._daylightSavingAdjust(newDate); - }, - /* Handle switch to/from daylight saving. - Hours may be non-zero on daylight saving cut-over: - > 12 when midnight changeover, but then cannot generate - midnight datetime, so jump to 1AM, otherwise reset. - @param date (Date) the date to check - @return (Date) the corrected date */ - _daylightSavingAdjust: function(date) { - if (!date) return null; - date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); - return date; - }, + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); - /* Set the date(s) directly. */ - _setDate: function(inst, date, noChange) { - var clear = !date; - var origMonth = inst.selectedMonth; - var origYear = inst.selectedYear; - var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); - inst.selectedDay = inst.currentDay = newDate.getDate(); - inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); - inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); - if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) - this._notifyChange(inst); - this._adjustInstDate(inst); - if (inst.input) { - inst.input.val(clear ? '' : this._formatDate(inst)); + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, this._uiHash(this)); } } - }, - /* Retrieve the date(s) directly. */ - _getDate: function(inst) { - var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : - this._daylightSavingAdjust(new Date( - inst.currentYear, inst.currentMonth, inst.currentDay))); - return startDate; + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, - /* Generate the HTML for the current state of the date picker. */ - _generateHTML: function(inst) { - var today = new Date(); - today = this._daylightSavingAdjust( - new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time - var isRTL = this._get(inst, 'isRTL'); - var showButtonPanel = this._get(inst, 'showButtonPanel'); - var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); - var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); - var numMonths = this._getNumberOfMonths(inst); - var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); - var stepMonths = this._get(inst, 'stepMonths'); - var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); - var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : - new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - var drawMonth = inst.drawMonth - showCurrentAtPos; - var drawYear = inst.drawYear; - if (drawMonth < 0) { - drawMonth += 12; - drawYear--; + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; } - if (maxDate) { - var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), - maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); - maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); - while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { - drawMonth--; - if (drawMonth < 0) { - drawMonth = 11; - drawYear--; - } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); } - inst.drawMonth = drawMonth; - inst.drawYear = drawYear; - var prevText = this._get(inst, 'prevText'); - prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, - this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), - this._getFormatConfig(inst))); - var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? - '' + prevText + '' : - (hideIfNoPrevNext ? '' : '' + prevText + '')); - var nextText = this._get(inst, 'nextText'); - nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, - this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), - this._getFormatConfig(inst))); - var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? - '' + nextText + '' : - (hideIfNoPrevNext ? '' : '' + nextText + '')); - var currentText = this._get(inst, 'currentText'); - var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); - currentText = (!navigationAsDateFormat ? currentText : - this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); - var controls = (!inst.inline ? '' : ''); - var buttonPanel = (showButtonPanel) ? '
          ' + (isRTL ? controls : '') + - (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
          ' : ''; - var firstDay = parseInt(this._get(inst, 'firstDay'),10); - firstDay = (isNaN(firstDay) ? 0 : firstDay); - var showWeek = this._get(inst, 'showWeek'); - var dayNames = this._get(inst, 'dayNames'); - var dayNamesShort = this._get(inst, 'dayNamesShort'); - var dayNamesMin = this._get(inst, 'dayNamesMin'); - var monthNames = this._get(inst, 'monthNames'); - var monthNamesShort = this._get(inst, 'monthNamesShort'); - var beforeShowDay = this._get(inst, 'beforeShowDay'); - var showOtherMonths = this._get(inst, 'showOtherMonths'); - var selectOtherMonths = this._get(inst, 'selectOtherMonths'); - var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; - var defaultDate = this._getDefaultDate(inst); - var html = ''; - for (var row = 0; row < numMonths[0]; row++) { - var group = ''; - this.maxRows = 4; - for (var col = 0; col < numMonths[1]; col++) { - var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); - var cornerClass = ' ui-corner-all'; - var calender = ''; - if (isMultiMonth) { - calender += '
          '; - } - calender += '
          ' + - (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + - (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + - this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, - row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers - '
          ' + - ''; - var thead = (showWeek ? '' : ''); - for (var dow = 0; dow < 7; dow++) { // days of the week - var day = (dow + firstDay) % 7; - thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + - '' + dayNamesMin[day] + ''; - } - calender += thead + ''; - var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); - if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) - inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); - var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; - var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate - var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) - this.maxRows = numRows; - var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); - for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows - calender += ''; - var tbody = (!showWeek ? '' : ''); - for (var dow = 0; dow < 7; dow++) { // create date picker days - var daySettings = (beforeShowDay ? - beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); - var otherMonth = (printDate.getMonth() != drawMonth); - var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || - (minDate && printDate < minDate) || (maxDate && printDate > maxDate); - tbody += ''; // display selectable date - printDate.setDate(printDate.getDate() + 1); - printDate = this._daylightSavingAdjust(printDate); - } - calender += tbody + ''; - } - drawMonth++; - if (drawMonth > 11) { - drawMonth = 0; - drawYear++; + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + // Only put the placeholder inside the current Container, skip all + // items form other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this moving items in "sub-sortables" can cause the placeholder to jitter + // beetween the outer and inner container. + if (item.instance !== this.currentContainer) continue; + + if (itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; } - calender += '
          ' + this._get(inst, 'weekHeader') + '
          ' + - this._get(inst, 'calculateWeek')(printDate) + '' + // actions - (otherMonth && !showOtherMonths ? ' ' : // display for other months - (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
          ' + (isMultiMonth ? '
          ' + - ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
          ' : '') : ''); - group += calender; + + this._trigger("change", event, this._uiHash()); + break; } - html += group; } - html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? - '' : ''); - inst._keyEvent = false; - return html; + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + }, - /* Generate the month and year header. */ - _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, - secondary, monthNames, monthNamesShort) { - var changeMonth = this._get(inst, 'changeMonth'); - var changeYear = this._get(inst, 'changeYear'); - var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); - var html = '
          '; - var monthHtml = ''; - // month selection - if (secondary || !changeMonth) - monthHtml += '' + monthNames[drawMonth] + ''; - else { - var inMinYear = (minDate && minDate.getFullYear() == drawYear); - var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); - monthHtml += ''; + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var that = this; + var cur = this.placeholder.offset(); + + this.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + that._clear(event); + }); + } else { + this._clear(event, noPropagation); } - if (!showMonthAfterYear) - html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); - // year selection - if ( !inst.yearshtml ) { - inst.yearshtml = ''; - if (secondary || !changeYear) - html += '' + drawYear + ''; - else { - // determine range of years to display - var years = this._get(inst, 'yearRange').split(':'); - var thisYear = new Date().getFullYear(); - var determineYear = function(value) { - var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : - (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : - parseInt(value, 10))); - return (isNaN(year) ? thisYear : year); - }; - var year = determineYear(years[0]); - var endYear = Math.max(year, determineYear(years[1] || '')); - year = (minDate ? Math.max(year, minDate.getFullYear()) : year); - endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); - inst.yearshtml += ''; - - html += inst.yearshtml; - inst.yearshtml = null; } + } - html += this._get(inst, 'yearSuffix'); - if (showMonthAfterYear) - html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; - html += '
          '; // Close datepicker_header - return html; - }, - /* Adjust one of the date sub-fields. */ - _adjustInstDate: function(inst, offset, period) { - var year = inst.drawYear + (period == 'Y' ? offset : 0); - var month = inst.drawMonth + (period == 'M' ? offset : 0); - var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + - (period == 'D' ? offset : 0); - var date = this._restrictMinMax(inst, - this._daylightSavingAdjust(new Date(year, month, day))); - inst.selectedDay = date.getDate(); - inst.drawMonth = inst.selectedMonth = date.getMonth(); - inst.drawYear = inst.selectedYear = date.getFullYear(); - if (period == 'M' || period == 'Y') - this._notifyChange(inst); + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + }, - /* Ensure a date is within any min/max bounds. */ - _restrictMinMax: function(inst, date) { - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - var newDate = (minDate && date < minDate ? minDate : date); - newDate = (maxDate && newDate > maxDate ? maxDate : newDate); - return newDate; + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + }, - /* Notify change of month/year. */ - _notifyChange: function(inst) { - var onChange = this._get(inst, 'onChangeMonthYear'); - if (onChange) - onChange.apply((inst.input ? inst.input[0] : null), - [inst.selectedYear, inst.selectedMonth + 1, inst]); + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + }, - /* Determine the number of months to show. */ - _getNumberOfMonths: function(inst) { - var numMonths = this._get(inst, 'numberOfMonths'); - return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } }, - /* Determine the current maximum date - ensure no time components are set. */ - _getMinMaxDate: function(inst, minMax) { - return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + }, - /* Find the number of days in a given month. */ - _getDaysInMonth: function(year, month) { - return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + }, - /* Find the day of the week of the first of a month. */ - _getFirstDayOfMonth: function(year, month) { - return new Date(year, month, 1).getDay(); + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); }, - /* Determines if we should allow a "next/prev" month display change. */ - _canAdjustMonth: function(inst, offset, curYear, curMonth) { - var numMonths = this._getNumberOfMonths(inst); - var date = this._daylightSavingAdjust(new Date(curYear, - curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); - if (offset < 0) - date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); - return this._isInRange(inst, date); + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); }, - /* Is the given date in the accepted range? */ - _isInRange: function(inst, date) { - var minDate = this._getMinMaxDate(inst, 'min'); - var maxDate = this._getMinMaxDate(inst, 'max'); - return ((!minDate || date.getTime() >= minDate.getTime()) && - (!maxDate || date.getTime() <= maxDate.getTime())); + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; }, - /* Provide the configuration settings for formatting/parsing. */ - _getFormatConfig: function(inst) { - var shortYearCutoff = this._get(inst, 'shortYearCutoff'); - shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : - new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); - return {shortYearCutoff: shortYearCutoff, - dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), - monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; }, - /* Format the given date for display. */ - _formatDate: function(inst, day, month, year) { - if (!day) { - inst.currentDay = inst.selectedDay; - inst.currentMonth = inst.selectedMonth; - inst.currentYear = inst.selectedYear; - } - var date = (day ? (typeof day == 'object' ? day : - this._daylightSavingAdjust(new Date(year, month, day))) : - this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); - return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); - } -}); + _getItemsAsjQuery: function(connected) { -/* - * Bind hover events for datepicker elements. - * Done via delegate so the binding only occurs once in the lifetime of the parent div. - * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. - */ -function bindHover(dpDiv) { - var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; - return dpDiv.bind('mouseout', function(event) { - var elem = $( event.target ).closest( selector ); - if ( !elem.length ) { - return; - } - elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); - }) - .bind('mouseover', function(event) { - var elem = $( event.target ).closest( selector ); - if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || - !elem.length ) { - return; - } - elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); - elem.addClass('ui-state-hover'); - if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); - if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); - }); -} + var items = []; + var queries = []; + var connectWith = this._connectWith(); -/* jQuery extend now ignores nulls! */ -function extendRemove(target, props) { - $.extend(target, props); - for (var name in props) - if (props[name] == null || props[name] == undefined) - target[name] = props[name]; - return target; -}; + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } -/* Determine whether an object is an array. */ -function isArray(a) { - return (a && (($.browser.safari && typeof a == 'object' && a.length) || - (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); -}; + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; -/* Invoke the datepicker functionality. - @param options string - a command, optionally followed by additional parameters or - Object - settings for attaching new datepicker functionality - @return jQuery object */ -$.fn.datepicker = function(options){ - - /* Verify an empty collection wasn't passed - Fixes #6976 */ - if ( !this.length ) { - return this; - } - - /* Initialise the date picker. */ - if (!$.datepicker.initialized) { - $(document).mousedown($.datepicker._checkExternalClick). - find('body').append($.datepicker.dpDiv); - $.datepicker.initialized = true; - } + return $(items); - var otherArgs = Array.prototype.slice.call(arguments, 1); - if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) - return $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this[0]].concat(otherArgs)); - if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') - return $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this[0]].concat(otherArgs)); - return this.each(function() { - typeof options == 'string' ? - $.datepicker['_' + options + 'Datepicker']. - apply($.datepicker, [this].concat(otherArgs)) : - $.datepicker._attachDatepicker(this, options); - }); -}; + }, -$.datepicker = new Datepicker(); // singleton instance -$.datepicker.initialized = false; -$.datepicker.uuid = new Date().getTime(); -$.datepicker.version = "1.8.16"; + _removeCurrentsFromItems: function() { -// Workaround for #4055 -// Add another global to avoid noConflict issues with inline event handlers -window['DP_jQuery_' + dpuuid] = $; + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); -})(jQuery); -/* - * jQuery UI Dialog 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function( $, undefined ) { + this.items = $.grep(this.items, function (item) { + for (var j=0; j < list.length; j++) { + if(list[j] == item.item[0]) + return false; + }; + return true; + }); -var uiDialogClasses = - 'ui-dialog ' + - 'ui-widget ' + - 'ui-widget-content ' + - 'ui-corner-all ', - sizeRelatedOptions = { - buttons: true, - height: true, - maxHeight: true, - maxWidth: true, - minHeight: true, - minWidth: true, - width: true - }, - resizableRelatedOptions = { - maxHeight: true, - maxWidth: true, - minHeight: true, - minWidth: true }, - // support for jQuery 1.3.2 - handle common attrFn methods for dialog - attrFn = $.attrFn || { - val: true, - css: true, - html: true, - text: true, - data: true, - width: true, - height: true, - offset: true, - click: true - }; -$.widget("ui.dialog", { - options: { - autoOpen: true, - buttons: {}, - closeOnEscape: true, - closeText: 'close', - dialogClass: '', - draggable: true, - hide: null, - height: 'auto', - maxHeight: false, - maxWidth: false, - minHeight: 150, - minWidth: 150, - modal: false, - position: { - my: 'center', - at: 'center', - collision: 'fit', - // ensure that the titlebar is never outside the document - using: function(pos) { - var topOffset = $(this).css(pos).offset().top; - if (topOffset < 0) { - $(this).css('top', pos.top - topOffset); - } - } - }, - resizable: true, - show: null, - stack: true, - title: '', - width: 300, - zIndex: 1000 - }, + _refreshItems: function(event) { - _create: function() { - this.originalTitle = this.element.attr('title'); - // #5742 - .attr() might return a DOMElement - if ( typeof this.originalTitle !== "string" ) { - this.originalTitle = ""; + this.items = []; + this.containers = [this]; + var items = this.items; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; } - this.options.title = this.options.title || this.originalTitle; - var self = this, - options = self.options, + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; - title = options.title || ' ', - titleId = $.ui.dialog.getTitleId(self.element), + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); - uiDialog = (self.uiDialog = $('
          ')) - .appendTo(document.body) - .hide() - .addClass(uiDialogClasses + options.dialogClass) - .css({ - zIndex: options.zIndex - }) - // setting tabIndex makes the div focusable - // setting outline to 0 prevents a border on focus in Mozilla - .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { - if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && - event.keyCode === $.ui.keyCode.ESCAPE) { - - self.close(event); - event.preventDefault(); - } - }) - .attr({ - role: 'dialog', - 'aria-labelledby': titleId - }) - .mousedown(function(event) { - self.moveToTop(false, event); - }), + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) - uiDialogContent = self.element - .show() - .removeAttr('title') - .addClass( - 'ui-dialog-content ' + - 'ui-widget-content') - .appendTo(uiDialog), - - uiDialogTitlebar = (self.uiDialogTitlebar = $('
          ')) - .addClass( - 'ui-dialog-titlebar ' + - 'ui-widget-header ' + - 'ui-corner-all ' + - 'ui-helper-clearfix' - ) - .prependTo(uiDialog), - - uiDialogTitlebarClose = $('') - .addClass( - 'ui-dialog-titlebar-close ' + - 'ui-corner-all' - ) - .attr('role', 'button') - .hover( - function() { - uiDialogTitlebarClose.addClass('ui-state-hover'); - }, - function() { - uiDialogTitlebarClose.removeClass('ui-state-hover'); - } - ) - .focus(function() { - uiDialogTitlebarClose.addClass('ui-state-focus'); - }) - .blur(function() { - uiDialogTitlebarClose.removeClass('ui-state-focus'); - }) - .click(function(event) { - self.close(event); - return false; - }) - .appendTo(uiDialogTitlebar), + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; - uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) - .addClass( - 'ui-icon ' + - 'ui-icon-closethick' - ) - .text(options.closeText) - .appendTo(uiDialogTitlebarClose), + }, - uiDialogTitle = $('') - .addClass('ui-dialog-title') - .attr('id', titleId) - .html(title) - .prependTo(uiDialogTitlebar); + refreshPositions: function(fast) { - //handling of deprecated beforeclose (vs beforeClose) option - //Ticket #4669 http://dev.jqueryui.com/ticket/4669 - //TODO: remove in 1.9pre - if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { - options.beforeClose = options.beforeclose; + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); } - uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; - if (options.draggable && $.fn.draggable) { - self._makeDraggable(); - } - if (options.resizable && $.fn.resizable) { - self._makeResizable(); - } + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; - self._createButtons(options.buttons); - self._isOpen = false; + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; - if ($.fn.bgiframe) { - uiDialog.bgiframe(); - } - }, + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } - _init: function() { - if ( this.options.autoOpen ) { - this.open(); + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; } + + return this; }, - destroy: function() { - var self = this; - - if (self.overlay) { - self.overlay.destroy(); - } - self.uiDialog.hide(); - self.element - .unbind('.dialog') - .removeData('dialog') - .removeClass('ui-dialog-content ui-widget-content') - .hide().appendTo('body'); - self.uiDialog.remove(); + _createPlaceholder: function(that) { + that = that || this; + var o = that.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(that.currentItem[0].nodeName)) + .addClass(className || that.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { - if (self.originalTitle) { - self.element.attr('title', self.originalTitle); + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css('paddingTop')||0, 10) - parseInt(that.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css('paddingLeft')||0, 10) - parseInt(that.currentItem.css('paddingRight')||0, 10)); }; + } + }; } - return self; - }, + //Create the placeholder + that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem)); + + //Append it after the actual current item + that.currentItem.after(that.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(that, that.placeholder); - widget: function() { - return this.uiDialog; }, - close: function(event) { - var self = this, - maxZ, thisZ; - - if (false === self._trigger('beforeClose', event)) { - return; - } + _contactContainers: function(event) { - if (self.overlay) { - self.overlay.destroy(); - } - self.uiDialog.unbind('keypress.ui-dialog'); + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; - self._isOpen = false; - if (self.options.hide) { - self.uiDialog.hide(self.options.hide, function() { - self._trigger('close', event); - }); - } else { - self.uiDialog.hide(); - self._trigger('close', event); - } + for (var i = this.containers.length - 1; i >= 0; i--){ - $.ui.dialog.overlay.resize(); + // never consider a container that's located within the item itself + if($.contains(this.currentItem[0], this.containers[i].element[0])) + continue; - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) - if (self.options.modal) { - maxZ = 0; - $('.ui-dialog').each(function() { - if (this !== self.uiDialog[0]) { - thisZ = $(this).css('z-index'); - if(!isNaN(thisZ)) { - maxZ = Math.max(maxZ, thisZ); - } + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; } - }); - $.ui.dialog.maxZ = maxZ; + } + } - return self; - }, + // if no intersecting containers found, return + if(!innermostContainer) return; - isOpen: function() { - return this._isOpen; - }, + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; + var posProperty = this.containers[innermostIndex].floating ? 'left' : 'top'; + var sizeProperty = this.containers[innermostIndex].floating ? 'width' : 'height'; + var base = this.positionAbs[posProperty] + this.offset.click[posProperty]; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + if(this.items[j].item[0] == this.currentItem[0]) continue; + var cur = this.items[j].item.offset()[posProperty]; + var nearBottom = false; + if(Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)){ + nearBottom = true; + cur += this.items[j][sizeProperty]; + } + + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = nearBottom ? "up": "down"; + } + } - // the force parameter allows us to move modal dialogs to their correct - // position on open - moveToTop: function(force, event) { - var self = this, - options = self.options, - saveScroll; + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; - if ((options.modal && !force) || - (!options.stack && !options.modal)) { - return self._trigger('focus', event); - } + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); - if (options.zIndex > $.ui.dialog.maxZ) { - $.ui.dialog.maxZ = options.zIndex; - } - if (self.overlay) { - $.ui.dialog.maxZ += 1; - self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; } - //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. - // http://ui.jquery.com/bugs/ticket/3193 - saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; - $.ui.dialog.maxZ += 1; - self.uiDialog.css('z-index', $.ui.dialog.maxZ); - self.element.attr(saveScroll); - self._trigger('focus', event); - return self; }, - open: function() { - if (this._isOpen) { return; } - - var self = this, - options = self.options, - uiDialog = self.uiDialog; + _createHelper: function(event) { - self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; - self._size(); - self._position(options.position); - uiDialog.show(options.show); - self.moveToTop(true); + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); - // prevent tabbing out of modal dialogs - if (options.modal) { - uiDialog.bind('keypress.ui-dialog', function(event) { - if (event.keyCode !== $.ui.keyCode.TAB) { - return; - } + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); - var tabbables = $(':tabbable', this), - first = tabbables.filter(':first'), - last = tabbables.filter(':last'); + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; - if (event.target === last[0] && !event.shiftKey) { - first.focus(1); - return false; - } else if (event.target === first[0] && event.shiftKey) { - last.focus(1); - return false; - } - }); - } + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); - // set focus to the first tabbable element in the content area or the first button - // if there are no tabbable elements, set focus on the dialog itself - $(self.element.find(':tabbable').get().concat( - uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( - uiDialog.get()))).eq(0).focus(); - - self._isOpen = true; - self._trigger('open'); - - return self; - }, - - _createButtons: function(buttons) { - var self = this, - hasButtons = false, - uiDialogButtonPane = $('
          ') - .addClass( - 'ui-dialog-buttonpane ' + - 'ui-widget-content ' + - 'ui-helper-clearfix' - ), - uiButtonSet = $( "
          " ) - .addClass( "ui-dialog-buttonset" ) - .appendTo( uiDialogButtonPane ); + return helper; - // if we already have a button pane, remove it - self.uiDialog.find('.ui-dialog-buttonpane').remove(); + }, - if (typeof buttons === 'object' && buttons !== null) { - $.each(buttons, function() { - return !(hasButtons = true); - }); + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); } - if (hasButtons) { - $.each(buttons, function(name, props) { - props = $.isFunction( props ) ? - { click: props, text: name } : - props; - var button = $('') - .click(function() { - props.click.apply(self.element[0], arguments); - }) - .appendTo(uiButtonSet); - // can't use .attr( props, true ) with jQuery 1.3.2. - $.each( props, function( key, value ) { - if ( key === "click" ) { - return; - } - if ( key in attrFn ) { - button[ key ]( value ); - } else { - button.attr( key, value ); - } - }); - if ($.fn.button) { - button.button(); - } - }); - uiDialogButtonPane.appendTo(self.uiDialog); + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; } }, - _makeDraggable: function() { - var self = this, - options = self.options, - doc = $(document), - heightBeforeDrag; + _getParentOffset: function() { - function filteredUi(ui) { - return { - position: ui.position, - offset: ui.offset - }; + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); } - self.uiDialog.draggable({ - cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', - handle: '.ui-dialog-titlebar', - containment: 'document', - start: function(event, ui) { - heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); - $(this).height($(this).height()).addClass("ui-dialog-dragging"); - self._trigger('dragStart', event, filteredUi(ui)); - }, - drag: function(event, ui) { - self._trigger('drag', event, filteredUi(ui)); - }, - stop: function(event, ui) { - options.position = [ui.position.left - doc.scrollLeft(), - ui.position.top - doc.scrollTop()]; - $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); - self._trigger('dragStop', event, filteredUi(ui)); - $.ui.dialog.overlay.resize(); - } - }); + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.ui.ie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + }, - _makeResizable: function(handles) { - handles = (handles === undefined ? this.options.resizable : handles); - var self = this, - options = self.options, - // .ui-resizable has position: relative defined in the stylesheet - // but dialogs have to use absolute or fixed positioning - position = self.uiDialog.css('position'), - resizeHandles = (typeof handles === 'string' ? - handles : - 'n,e,s,w,se,sw,ne,nw' - ); + _getRelativeOffset: function() { - function filteredUi(ui) { + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); return { - originalPosition: ui.originalPosition, - originalSize: ui.originalSize, - position: ui.position, - size: ui.size + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() }; + } else { + return { top: 0, left: 0 }; } - self.uiDialog.resizable({ - cancel: '.ui-dialog-content', - containment: 'document', - alsoResize: self.element, - maxWidth: options.maxWidth, - maxHeight: options.maxHeight, - minWidth: options.minWidth, - minHeight: self._minHeight(), - handles: resizeHandles, - start: function(event, ui) { - $(this).addClass("ui-dialog-resizing"); - self._trigger('resizeStart', event, filteredUi(ui)); - }, - resize: function(event, ui) { - self._trigger('resize', event, filteredUi(ui)); - }, - stop: function(event, ui) { - $(this).removeClass("ui-dialog-resizing"); - options.height = $(this).height(); - options.width = $(this).width(); - self._trigger('resizeStop', event, filteredUi(ui)); - $.ui.dialog.overlay.resize(); - } - }) - .css('position', position) - .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); }, - _minHeight: function() { - var options = this.options; + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, - if (options.height === 'auto') { - return options.minHeight; - } else { - return Math.min(options.minHeight, options.height); - } + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; }, - _position: function(position) { - var myAt = [], - offset = [0, 0], - isVisible; + _setContainment: function() { - if (position) { - // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( - // if (typeof position == 'string' || $.isArray(position)) { - // myAt = $.isArray(position) ? position : position.split(' '); + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; - if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { - myAt = position.split ? position.split(' ') : [position[0], position[1]]; - if (myAt.length === 1) { - myAt[1] = myAt[0]; - } + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); - $.each(['left', 'top'], function(i, offsetPosition) { - if (+myAt[i] === myAt[i]) { - offset[i] = myAt[i]; - myAt[i] = offsetPosition; - } - }); + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } - position = { - my: myAt.join(" "), - at: myAt.join(" "), - offset: offset.join(" ") - }; - } + }, - position = $.extend({}, $.ui.dialog.prototype.options.position, position); - } else { - position = $.ui.dialog.prototype.options.position; - } + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; - // need to show the dialog to get the actual offset in the position plugin - isVisible = this.uiDialog.is(':visible'); - if (!isVisible) { - this.uiDialog.show(); - } - this.uiDialog - // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 - .css({ top: 0, left: 0 }) - .position($.extend({ of: window }, position)); - if (!isVisible) { - this.uiDialog.hide(); - } }, - _setOptions: function( options ) { - var self = this, - resizableOptions = {}, - resize = false; + _generatePosition: function(event) { - $.each( options, function( key, value ) { - self._setOption( key, value ); - - if ( key in sizeRelatedOptions ) { - resize = true; - } - if ( key in resizableRelatedOptions ) { - resizableOptions[ key ] = value; - } - }); + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); - if ( resize ) { - this._size(); - } - if ( this.uiDialog.is( ":data(resizable)" ) ) { - this.uiDialog.resizable( "option", resizableOptions ); + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); } - }, - _setOption: function(key, value){ - var self = this, - uiDialog = self.uiDialog; - - switch (key) { - //handling of deprecated beforeclose (vs beforeClose) option - //Ticket #4669 http://dev.jqueryui.com/ticket/4669 - //TODO: remove in 1.9pre - case "beforeclose": - key = "beforeClose"; - break; - case "buttons": - self._createButtons(value); - break; - case "closeText": - // ensure that we always pass a string - self.uiDialogTitlebarCloseText.text("" + value); - break; - case "dialogClass": - uiDialog - .removeClass(self.options.dialogClass) - .addClass(uiDialogClasses + value); - break; - case "disabled": - if (value) { - uiDialog.addClass('ui-dialog-disabled'); - } else { - uiDialog.removeClass('ui-dialog-disabled'); - } - break; - case "draggable": - var isDraggable = uiDialog.is( ":data(draggable)" ); - if ( isDraggable && !value ) { - uiDialog.draggable( "destroy" ); - } - - if ( !isDraggable && value ) { - self._makeDraggable(); - } - break; - case "position": - self._position(value); - break; - case "resizable": - // currently resizable, becoming non-resizable - var isResizable = uiDialog.is( ":data(resizable)" ); - if (isResizable && !value) { - uiDialog.resizable('destroy'); - } + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options - // currently resizable, changing handles - if (isResizable && typeof value === 'string') { - uiDialog.resizable('option', 'handles', value); - } + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } - // currently non-resizable, becoming resizable - if (!isResizable && value !== false) { - self._makeResizable(value); - } - break; - case "title": - // convert whatever was passed in o a string, for html() to not throw up - $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); - break; } - $.Widget.prototype._setOption.apply(self, arguments); + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + }, - _size: function() { - /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content - * divs will both have width and height set, so we need to reset them - */ - var options = this.options, - nonContentHeight, - minContentHeight, - isVisible = this.uiDialog.is( ":visible" ); + _rearrange: function(event, i, a, hardRefresh) { - // reset content sizing - this.element.show().css({ - width: 'auto', - minHeight: 0, - height: 0 + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var counter = this.counter; + + this._delay(function() { + if(counter == this.counter) this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove }); - if (options.minWidth > options.width) { - options.width = options.minWidth; - } + }, - // reset wrapper sizing - // determine the height of all the non-content elements - nonContentHeight = this.uiDialog.css({ - height: 'auto', - width: options.width - }) - .height(); - minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); - - if ( options.height === "auto" ) { - // only needed for IE6 support - if ( $.support.minHeight ) { - this.element.css({ - minHeight: minContentHeight, - height: "auto" - }); - } else { - this.uiDialog.show(); - var autoHeight = this.element.css( "height", "auto" ).height(); - if ( !isVisible ) { - this.uiDialog.hide(); - } - this.element.height( Math.max( autoHeight, minContentHeight ) ); + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = []; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); } else { - this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + this.currentItem.show(); } - if (this.uiDialog.is(':data(resizable)')) { - this.uiDialog.resizable('option', 'minHeight', this._minHeight()); - } - } -}); + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed -$.extend($.ui.dialog, { - version: "1.8.16", + // Check if the items Container has Changed and trigger appropriate + // events. + if (this !== this.currentContainer) { + if(!noPropagation) { + delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + } + } - uuid: 0, - maxZ: 0, - getTitleId: function($el) { - var id = $el.attr('id'); - if (!id) { - this.uuid += 1; - id = this.uuid; + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } } - return 'ui-dialog-title-' + id; - }, - - overlay: function(dialog) { - this.$el = $.ui.dialog.overlay.create(dialog); - } -}); -$.extend($.ui.dialog.overlay, { - instances: [], - // reuse old instances due to IE memory leak with alpha transparency (see #5185) - oldInstances: [], - maxZ: 0, - events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), - function(event) { return event + '.dialog-overlay'; }).join(' '), - create: function(dialog) { - if (this.instances.length === 0) { - // prevent use of anchors and inputs - // we use a setTimeout in case the overlay is created from an - // event that we're going to be cancelling (see #2804) - setTimeout(function() { - // handle $(el).dialog().dialog('close') (see #4065) - if ($.ui.dialog.overlay.instances.length) { - $(document).bind($.ui.dialog.overlay.events, function(event) { - // stop events if the z-index of the target is < the z-index of the overlay - // we cannot return true when we don't want to cancel the event (#3523) - if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { - return false; - } - }); - } - }, 1); + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index - // allow closing by pressing the escape key - $(document).bind('keydown.dialog-overlay', function(event) { - if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && - event.keyCode === $.ui.keyCode.ESCAPE) { - - dialog.close(event); - event.preventDefault(); - } - }); + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } - // handle window resize - $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + this.fromOutside = false; + return false; } - var $el = (this.oldInstances.pop() || $('
          ').addClass('ui-widget-overlay')) - .appendTo(document.body) - .css({ - width: this.width(), - height: this.height() - }); + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); - if ($.fn.bgiframe) { - $el.bgiframe(); + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); } - this.instances.push($el); - return $el; + this.fromOutside = false; + return true; + }, - destroy: function($el) { - var indexOf = $.inArray($el, this.instances); - if (indexOf != -1){ - this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); } + }, + + _uiHash: function(_inst) { + var inst = _inst || this; + return { + helper: inst.helper, + placeholder: inst.placeholder || $([]), + position: inst.position, + originalPosition: inst.originalPosition, + offset: inst.positionAbs, + item: inst.currentItem, + sender: _inst ? _inst.element : null + }; + } - if (this.instances.length === 0) { - $([document, window]).unbind('.dialog-overlay'); +}); + +})(jQuery); +(function( $ ) { + +function modifier( fn ) { + return function() { + var previous = this.element.val(); + fn.apply( this, arguments ); + this._refresh(); + if ( previous !== this.element.val() ) { + this._trigger( "change" ); } + }; +} - $el.remove(); - - // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) - var maxZ = 0; - $.each(this.instances, function() { - maxZ = Math.max(maxZ, this.css('z-index')); - }); - this.maxZ = maxZ; +$.widget( "ui.spinner", { + version: "1.9.2", + defaultElement: "", + widgetEventPrefix: "spin", + options: { + culture: null, + icons: { + down: "ui-icon-triangle-1-s", + up: "ui-icon-triangle-1-n" + }, + incremental: true, + max: null, + min: null, + numberFormat: null, + page: 10, + step: 1, + + change: null, + spin: null, + start: null, + stop: null }, - height: function() { - var scrollHeight, - offsetHeight; - // handle IE 6 - if ($.browser.msie && $.browser.version < 7) { - scrollHeight = Math.max( - document.documentElement.scrollHeight, - document.body.scrollHeight - ); - offsetHeight = Math.max( - document.documentElement.offsetHeight, - document.body.offsetHeight - ); + _create: function() { + // handle string values that need to be parsed + this._setOption( "max", this.options.max ); + this._setOption( "min", this.options.min ); + this._setOption( "step", this.options.step ); - if (scrollHeight < offsetHeight) { - return $(window).height() + 'px'; - } else { - return scrollHeight + 'px'; + // format the value, but don't constrain + this._value( this.element.val(), true ); + + this._draw(); + this._on( this._events ); + this._refresh(); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); } - // handle "good" browsers - } else { - return $(document).height() + 'px'; - } + }); }, - width: function() { - var scrollWidth, - offsetWidth; - // handle IE - if ( $.browser.msie ) { - scrollWidth = Math.max( - document.documentElement.scrollWidth, - document.body.scrollWidth - ); - offsetWidth = Math.max( - document.documentElement.offsetWidth, - document.body.offsetWidth - ); + _getCreateOptions: function() { + var options = {}, + element = this.element; - if (scrollWidth < offsetWidth) { - return $(window).width() + 'px'; - } else { - return scrollWidth + 'px'; + $.each( [ "min", "max", "step" ], function( i, option ) { + var value = element.attr( option ); + if ( value !== undefined && value.length ) { + options[ option ] = value; } - // handle "good" browsers - } else { - return $(document).width() + 'px'; - } + }); + + return options; }, - resize: function() { - /* If the dialog is draggable and the user drags it past the - * right edge of the window, the document becomes wider so we - * need to stretch the overlay. If the user then drags the - * dialog back to the left, the document will become narrower, - * so we need to shrink the overlay to the appropriate size. - * This is handled by shrinking the overlay before setting it - * to the full document size. - */ - var $overlays = $([]); - $.each($.ui.dialog.overlay.instances, function() { - $overlays = $overlays.add(this); - }); + _events: { + keydown: function( event ) { + if ( this._start( event ) && this._keydown( event ) ) { + event.preventDefault(); + } + }, + keyup: "_stop", + focus: function() { + this.previous = this.element.val(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } - $overlays.css({ - width: 0, - height: 0 - }).css({ - width: $.ui.dialog.overlay.width(), - height: $.ui.dialog.overlay.height() - }); - } -}); + this._refresh(); + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event ); + } + }, + mousewheel: function( event, delta ) { + if ( !delta ) { + return; + } + if ( !this.spinning && !this._start( event ) ) { + return false; + } -$.extend($.ui.dialog.overlay.prototype, { - destroy: function() { - $.ui.dialog.overlay.destroy(this.$el); - } -}); + this._spin( (delta > 0 ? 1 : -1) * this.options.step, event ); + clearTimeout( this.mousewheelTimer ); + this.mousewheelTimer = this._delay(function() { + if ( this.spinning ) { + this._stop( event ); + } + }, 100 ); + event.preventDefault(); + }, + "mousedown .ui-spinner-button": function( event ) { + var previous; + + // We never want the buttons to have focus; whenever the user is + // interacting with the spinner, the focus should be on the input. + // If the input is focused then this.previous is properly set from + // when the input first received focus. If the input is not focused + // then we need to set this.previous based on the value before spinning. + previous = this.element[0] === this.document[0].activeElement ? + this.previous : this.element.val(); + function checkFocus() { + var isActive = this.element[0] === this.document[0].activeElement; + if ( !isActive ) { + this.element.focus(); + this.previous = previous; + // support: IE + // IE sets focus asynchronously, so we need to check if focus + // moved off of the input because the user clicked on the button. + this._delay(function() { + this.previous = previous; + }); + } + } -}(jQuery)); -/* - * jQuery UI Position 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function( $, undefined ) { + // ensure focus is on (or stays on) the text field + event.preventDefault(); + checkFocus.call( this ); + + // support: IE + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + // and check (again) if focus moved off of the input. + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + checkFocus.call( this ); + }); -$.ui = $.ui || {}; + if ( this._start( event ) === false ) { + return; + } -var horizontalPositions = /left|center|right/, - verticalPositions = /top|center|bottom/, - center = "center", - _position = $.fn.position, - _offset = $.fn.offset; + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + "mouseup .ui-spinner-button": "_stop", + "mouseenter .ui-spinner-button": function( event ) { + // button will add ui-state-active if mouse was down while mouseleave and kept down + if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) { + return; + } -$.fn.position = function( options ) { - if ( !options || !options.of ) { - return _position.apply( this, arguments ); - } + if ( this._start( event ) === false ) { + return false; + } + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + // TODO: do we really want to consider this a stop? + // shouldn't we just stop the repeater and wait until mouseup before + // we trigger the stop event? + "mouseleave .ui-spinner-button": "_stop" + }, - // make a copy, we don't want to modify arguments - options = $.extend( {}, options ); + _draw: function() { + var uiSpinner = this.uiSpinner = this.element + .addClass( "ui-spinner-input" ) + .attr( "autocomplete", "off" ) + .wrap( this._uiSpinnerHtml() ) + .parent() + // add buttons + .append( this._buttonHtml() ); - var target = $( options.of ), - targetElem = target[0], - collision = ( options.collision || "flip" ).split( " " ), - offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], - targetWidth, - targetHeight, - basePosition; + this.element.attr( "role", "spinbutton" ); - if ( targetElem.nodeType === 9 ) { - targetWidth = target.width(); - targetHeight = target.height(); - basePosition = { top: 0, left: 0 }; - // TODO: use $.isWindow() in 1.9 - } else if ( targetElem.setTimeout ) { - targetWidth = target.width(); - targetHeight = target.height(); - basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; - } else if ( targetElem.preventDefault ) { - // force left top to allow flipping - options.at = "left top"; - targetWidth = targetHeight = 0; - basePosition = { top: options.of.pageY, left: options.of.pageX }; - } else { - targetWidth = target.outerWidth(); - targetHeight = target.outerHeight(); - basePosition = target.offset(); - } + // button bindings + this.buttons = uiSpinner.find( ".ui-spinner-button" ) + .attr( "tabIndex", -1 ) + .button() + .removeClass( "ui-corner-all" ); - // force my and at to have valid horizontal and veritcal positions - // if a value is missing or invalid, it will be converted to center - $.each( [ "my", "at" ], function() { - var pos = ( options[this] || "" ).split( " " ); - if ( pos.length === 1) { - pos = horizontalPositions.test( pos[0] ) ? - pos.concat( [center] ) : - verticalPositions.test( pos[0] ) ? - [ center ].concat( pos ) : - [ center, center ]; - } - pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; - pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; - options[ this ] = pos; - }); + // IE 6 doesn't understand height: 50% for the buttons + // unless the wrapper has an explicit height + if ( this.buttons.height() > Math.ceil( uiSpinner.height() * 0.5 ) && + uiSpinner.height() > 0 ) { + uiSpinner.height( uiSpinner.height() ); + } - // normalize collision option - if ( collision.length === 1 ) { - collision[ 1 ] = collision[ 0 ]; - } + // disable spinner if element was already disabled + if ( this.options.disabled ) { + this.disable(); + } + }, - // normalize offset option - offset[ 0 ] = parseInt( offset[0], 10 ) || 0; - if ( offset.length === 1 ) { - offset[ 1 ] = offset[ 0 ]; - } - offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + _keydown: function( event ) { + var options = this.options, + keyCode = $.ui.keyCode; - if ( options.at[0] === "right" ) { - basePosition.left += targetWidth; - } else if ( options.at[0] === center ) { - basePosition.left += targetWidth / 2; - } + switch ( event.keyCode ) { + case keyCode.UP: + this._repeat( null, 1, event ); + return true; + case keyCode.DOWN: + this._repeat( null, -1, event ); + return true; + case keyCode.PAGE_UP: + this._repeat( null, options.page, event ); + return true; + case keyCode.PAGE_DOWN: + this._repeat( null, -options.page, event ); + return true; + } - if ( options.at[1] === "bottom" ) { - basePosition.top += targetHeight; - } else if ( options.at[1] === center ) { - basePosition.top += targetHeight / 2; - } + return false; + }, - basePosition.left += offset[ 0 ]; - basePosition.top += offset[ 1 ]; + _uiSpinnerHtml: function() { + return ""; + }, - return this.each(function() { - var elem = $( this ), - elemWidth = elem.outerWidth(), - elemHeight = elem.outerHeight(), - marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, - marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, - collisionWidth = elemWidth + marginLeft + - ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), - collisionHeight = elemHeight + marginTop + - ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), - position = $.extend( {}, basePosition ), - collisionPosition; + _buttonHtml: function() { + return "" + + "" + + "" + + "" + + "" + + "" + + ""; + }, - if ( options.my[0] === "right" ) { - position.left -= elemWidth; - } else if ( options.my[0] === center ) { - position.left -= elemWidth / 2; + _start: function( event ) { + if ( !this.spinning && this._trigger( "start", event ) === false ) { + return false; } - if ( options.my[1] === "bottom" ) { - position.top -= elemHeight; - } else if ( options.my[1] === center ) { - position.top -= elemHeight / 2; + if ( !this.counter ) { + this.counter = 1; } + this.spinning = true; + return true; + }, - // prevent fractions (see #5280) - position.left = Math.round( position.left ); - position.top = Math.round( position.top ); + _repeat: function( i, steps, event ) { + i = i || 500; - collisionPosition = { - left: position.left - marginLeft, - top: position.top - marginTop - }; + clearTimeout( this.timer ); + this.timer = this._delay(function() { + this._repeat( 40, steps, event ); + }, i ); - $.each( [ "left", "top" ], function( i, dir ) { - if ( $.ui.position[ collision[i] ] ) { - $.ui.position[ collision[i] ][ dir ]( position, { - targetWidth: targetWidth, - targetHeight: targetHeight, - elemWidth: elemWidth, - elemHeight: elemHeight, - collisionPosition: collisionPosition, - collisionWidth: collisionWidth, - collisionHeight: collisionHeight, - offset: offset, - my: options.my, - at: options.at - }); - } - }); + this._spin( steps * this.options.step, event ); + }, - if ( $.fn.bgiframe ) { - elem.bgiframe(); + _spin: function( step, event ) { + var value = this.value() || 0; + + if ( !this.counter ) { + this.counter = 1; } - elem.offset( $.extend( position, { using: options.using } ) ); - }); -}; -$.ui.position = { - fit: { - left: function( position, data ) { - var win = $( window ), - over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); - position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); - }, - top: function( position, data ) { - var win = $( window ), - over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); - position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + value = this._adjustValue( value + step * this._increment( this.counter ) ); + + if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false) { + this._value( value ); + this.counter++; } }, - flip: { - left: function( position, data ) { - if ( data.at[0] === center ) { - return; - } - var win = $( window ), - over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), - myOffset = data.my[ 0 ] === "left" ? - -data.elemWidth : - data.my[ 0 ] === "right" ? - data.elemWidth : - 0, - atOffset = data.at[ 0 ] === "left" ? - data.targetWidth : - -data.targetWidth, - offset = -2 * data.offset[ 0 ]; - position.left += data.collisionPosition.left < 0 ? - myOffset + atOffset + offset : - over > 0 ? - myOffset + atOffset + offset : - 0; - }, - top: function( position, data ) { - if ( data.at[1] === center ) { - return; - } - var win = $( window ), - over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), - myOffset = data.my[ 1 ] === "top" ? - -data.elemHeight : - data.my[ 1 ] === "bottom" ? - data.elemHeight : - 0, - atOffset = data.at[ 1 ] === "top" ? - data.targetHeight : - -data.targetHeight, - offset = -2 * data.offset[ 1 ]; - position.top += data.collisionPosition.top < 0 ? - myOffset + atOffset + offset : - over > 0 ? - myOffset + atOffset + offset : - 0; + _increment: function( i ) { + var incremental = this.options.incremental; + + if ( incremental ) { + return $.isFunction( incremental ) ? + incremental( i ) : + Math.floor( i*i*i/50000 - i*i/500 + 17*i/200 + 1 ); } - } -}; -// offset setter from jQuery 1.4 -if ( !$.offset.setOffset ) { - $.offset.setOffset = function( elem, options ) { - // set position first, in-case top/left are set even on static elem - if ( /static/.test( $.curCSS( elem, "position" ) ) ) { - elem.style.position = "relative"; - } - var curElem = $( elem ), - curOffset = curElem.offset(), - curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, - curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, - props = { - top: (options.top - curOffset.top) + curTop, - left: (options.left - curOffset.left) + curLeft - }; - - if ( 'using' in options ) { - options.using.call( elem, props ); - } else { - curElem.css( props ); + return 1; + }, + + _precision: function() { + var precision = this._precisionOf( this.options.step ); + if ( this.options.min !== null ) { + precision = Math.max( precision, this._precisionOf( this.options.min ) ); } - }; + return precision; + }, - $.fn.offset = function( options ) { - var elem = this[ 0 ]; - if ( !elem || !elem.ownerDocument ) { return null; } - if ( options ) { - return this.each(function() { - $.offset.setOffset( this, options ); - }); + _precisionOf: function( num ) { + var str = num.toString(), + decimal = str.indexOf( "." ); + return decimal === -1 ? 0 : str.length - decimal - 1; + }, + + _adjustValue: function( value ) { + var base, aboveMin, + options = this.options; + + // make sure we're at a valid step + // - find out where we are relative to the base (min or 0) + base = options.min !== null ? options.min : 0; + aboveMin = value - base; + // - round to the nearest step + aboveMin = Math.round(aboveMin / options.step) * options.step; + // - rounding is based on 0, so adjust back to our base + value = base + aboveMin; + + // fix precision from bad JS floating point math + value = parseFloat( value.toFixed( this._precision() ) ); + + // clamp the value + if ( options.max !== null && value > options.max) { + return options.max; + } + if ( options.min !== null && value < options.min ) { + return options.min; } - return _offset.call( this ); - }; -} -}( jQuery )); -/* - * jQuery UI Progressbar 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { + return value; + }, -$.widget( "ui.progressbar", { - options: { - value: 0, - max: 100 + _stop: function( event ) { + if ( !this.spinning ) { + return; + } + + clearTimeout( this.timer ); + clearTimeout( this.mousewheelTimer ); + this.counter = 0; + this.spinning = false; + this._trigger( "stop", event ); }, - min: 0, + _setOption: function( key, value ) { + if ( key === "culture" || key === "numberFormat" ) { + var prevValue = this._parse( this.element.val() ); + this.options[ key ] = value; + this.element.val( this._format( prevValue ) ); + return; + } - _create: function() { - this.element - .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) - .attr({ - role: "progressbar", - "aria-valuemin": this.min, - "aria-valuemax": this.options.max, - "aria-valuenow": this._value() - }); + if ( key === "max" || key === "min" || key === "step" ) { + if ( typeof value === "string" ) { + value = this._parse( value ); + } + } - this.valueDiv = $( "
          " ) - .appendTo( this.element ); + this._super( key, value ); - this.oldValue = this._value(); - this._refreshValue(); + if ( key === "disabled" ) { + if ( value ) { + this.element.prop( "disabled", true ); + this.buttons.button( "disable" ); + } else { + this.element.prop( "disabled", false ); + this.buttons.button( "enable" ); + } + } }, - destroy: function() { - this.element - .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) - .removeAttr( "role" ) - .removeAttr( "aria-valuemin" ) - .removeAttr( "aria-valuemax" ) - .removeAttr( "aria-valuenow" ); - - this.valueDiv.remove(); + _setOptions: modifier(function( options ) { + this._super( options ); + this._value( this.element.val() ); + }), - $.Widget.prototype.destroy.apply( this, arguments ); + _parse: function( val ) { + if ( typeof val === "string" && val !== "" ) { + val = window.Globalize && this.options.numberFormat ? + Globalize.parseFloat( val, 10, this.options.culture ) : +val; + } + return val === "" || isNaN( val ) ? null : val; }, - value: function( newValue ) { - if ( newValue === undefined ) { - return this._value(); + _format: function( value ) { + if ( value === "" ) { + return ""; } + return window.Globalize && this.options.numberFormat ? + Globalize.format( value, this.options.numberFormat, this.options.culture ) : + value; + }, - this._setOption( "value", newValue ); - return this; + _refresh: function() { + this.element.attr({ + "aria-valuemin": this.options.min, + "aria-valuemax": this.options.max, + // TODO: what should we do with values that can't be parsed? + "aria-valuenow": this._parse( this.element.val() ) + }); }, - _setOption: function( key, value ) { - if ( key === "value" ) { - this.options.value = value; - this._refreshValue(); - if ( this._value() === this.options.max ) { - this._trigger( "complete" ); + // update the value without triggering change + _value: function( value, allowAny ) { + var parsed; + if ( value !== "" ) { + parsed = this._parse( value ); + if ( parsed !== null ) { + if ( !allowAny ) { + parsed = this._adjustValue( parsed ); + } + value = this._format( parsed ); } } + this.element.val( value ); + this._refresh(); + }, - $.Widget.prototype._setOption.apply( this, arguments ); + _destroy: function() { + this.element + .removeClass( "ui-spinner-input" ) + .prop( "disabled", false ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + this.uiSpinner.replaceWith( this.element ); }, - _value: function() { - var val = this.options.value; - // normalize invalid value - if ( typeof val !== "number" ) { - val = 0; - } - return Math.min( this.options.max, Math.max( this.min, val ) ); + stepUp: modifier(function( steps ) { + this._stepUp( steps ); + }), + _stepUp: function( steps ) { + this._spin( (steps || 1) * this.options.step ); }, - _percentage: function() { - return 100 * this._value() / this.options.max; + stepDown: modifier(function( steps ) { + this._stepDown( steps ); + }), + _stepDown: function( steps ) { + this._spin( (steps || 1) * -this.options.step ); }, - _refreshValue: function() { - var value = this.value(); - var percentage = this._percentage(); + pageUp: modifier(function( pages ) { + this._stepUp( (pages || 1) * this.options.page ); + }), - if ( this.oldValue !== value ) { - this.oldValue = value; - this._trigger( "change" ); - } + pageDown: modifier(function( pages ) { + this._stepDown( (pages || 1) * this.options.page ); + }), - this.valueDiv - .toggle( value > this.min ) - .toggleClass( "ui-corner-right", value === this.options.max ) - .width( percentage.toFixed(0) + "%" ); - this.element.attr( "aria-valuenow", value ); - } -}); + value: function( newVal ) { + if ( !arguments.length ) { + return this._parse( this.element.val() ); + } + modifier( this._value ).call( this, newVal ); + }, -$.extend( $.ui.progressbar, { - version: "1.8.16" + widget: function() { + return this.uiSpinner; + } }); -})( jQuery ); -/* - * jQuery UI Slider 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ +}( jQuery ) ); (function( $, undefined ) { -// number of pages in a slider -// (how many times can you page up/down to go through the whole range) -var numPages = 5; +var tabId = 0, + rhash = /#.*$/; -$.widget( "ui.slider", $.ui.mouse, { +function getNextTabId() { + return ++tabId; +} - widgetEventPrefix: "slide", +function isLocal( anchor ) { + return anchor.hash.length > 1 && + anchor.href.replace( rhash, "" ) === + location.href.replace( rhash, "" ) + // support: Safari 5.1 + // Safari 5.1 doesn't encode spaces in window.location + // but it does encode spaces from anchors (#8777) + .replace( /\s/g, "%20" ); +} +$.widget( "ui.tabs", { + version: "1.9.2", + delay: 300, options: { - animate: false, - distance: 0, - max: 100, - min: 0, - orientation: "horizontal", - range: false, - step: 1, - value: 0, - values: null + active: null, + collapsible: false, + event: "click", + heightStyle: "content", + hide: null, + show: null, + + // callbacks + activate: null, + beforeActivate: null, + beforeLoad: null, + load: null }, _create: function() { - var self = this, - o = this.options, - existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), - handle = "", - handleCount = ( o.values && o.values.length ) || 1, - handles = []; + var that = this, + options = this.options, + active = options.active, + locationHash = location.hash.substring( 1 ); - this._keySliding = false; - this._mouseSliding = false; - this._animateOff = true; - this._handleIndex = null; - this._detectOrientation(); - this._mouseInit(); + this.running = false; this.element - .addClass( "ui-slider" + - " ui-slider-" + this.orientation + - " ui-widget" + - " ui-widget-content" + - " ui-corner-all" + - ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); - - this.range = $([]); - - if ( o.range ) { - if ( o.range === true ) { - if ( !o.values ) { - o.values = [ this._valueMin(), this._valueMin() ]; + .addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-tabs-collapsible", options.collapsible ) + // Prevent users from focusing disabled tabs via click + .delegate( ".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function( event ) { + if ( $( this ).is( ".ui-state-disabled" ) ) { + event.preventDefault(); } - if ( o.values.length && o.values.length !== 2 ) { - o.values = [ o.values[0], o.values[0] ]; + }) + // support: IE <9 + // Preventing the default action in mousedown doesn't prevent IE + // from focusing the element, so if the anchor gets focused, blur. + // We don't have to worry about focusing the previously focused + // element since clicking on a non-focusable element should focus + // the body anyway. + .delegate( ".ui-tabs-anchor", "focus" + this.eventNamespace, function() { + if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) { + this.blur(); } + }); + + this._processTabs(); + + if ( active === null ) { + // check the fragment identifier in the URL + if ( locationHash ) { + this.tabs.each(function( i, tab ) { + if ( $( tab ).attr( "aria-controls" ) === locationHash ) { + active = i; + return false; + } + }); } - this.range = $( "
          " ) - .appendTo( this.element ) - .addClass( "ui-slider-range" + - // note: this isn't the most fittingly semantic framework class for this element, - // but worked best visually with a variety of themes - " ui-widget-header" + - ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); - } + // check for a tab marked active via a class + if ( active === null ) { + active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) ); + } - for ( var i = existingHandles.length; i < handleCount; i += 1 ) { - handles.push( handle ); + // no active tab, set to false + if ( active === null || active === -1 ) { + active = this.tabs.length ? 0 : false; + } } - this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + // handle numbers: negative, out of range + if ( active !== false ) { + active = this.tabs.index( this.tabs.eq( active ) ); + if ( active === -1 ) { + active = options.collapsible ? false : 0; + } + } + options.active = active; - this.handle = this.handles.eq( 0 ); + // don't allow collapsible: false and active: false + if ( !options.collapsible && options.active === false && this.anchors.length ) { + options.active = 0; + } - this.handles.add( this.range ).filter( "a" ) - .click(function( event ) { - event.preventDefault(); - }) - .hover(function() { - if ( !o.disabled ) { - $( this ).addClass( "ui-state-hover" ); - } - }, function() { - $( this ).removeClass( "ui-state-hover" ); - }) - .focus(function() { - if ( !o.disabled ) { - $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); - $( this ).addClass( "ui-state-focus" ); - } else { - $( this ).blur(); - } - }) - .blur(function() { - $( this ).removeClass( "ui-state-focus" ); - }); + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + if ( $.isArray( options.disabled ) ) { + options.disabled = $.unique( options.disabled.concat( + $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) { + return that.tabs.index( li ); + }) + ) ).sort(); + } - this.handles.each(function( i ) { - $( this ).data( "index.ui-slider-handle", i ); - }); + // check for length avoids error when initializing empty list + if ( this.options.active !== false && this.anchors.length ) { + this.active = this._findActive( this.options.active ); + } else { + this.active = $(); + } - this.handles - .keydown(function( event ) { - var ret = true, - index = $( this ).data( "index.ui-slider-handle" ), - allowed, - curVal, - newVal, - step; - - if ( self.options.disabled ) { - return; - } - - switch ( event.keyCode ) { - case $.ui.keyCode.HOME: - case $.ui.keyCode.END: - case $.ui.keyCode.PAGE_UP: - case $.ui.keyCode.PAGE_DOWN: - case $.ui.keyCode.UP: - case $.ui.keyCode.RIGHT: - case $.ui.keyCode.DOWN: - case $.ui.keyCode.LEFT: - ret = false; - if ( !self._keySliding ) { - self._keySliding = true; - $( this ).addClass( "ui-state-active" ); - allowed = self._start( event, index ); - if ( allowed === false ) { - return; - } - } - break; - } - - step = self.options.step; - if ( self.options.values && self.options.values.length ) { - curVal = newVal = self.values( index ); - } else { - curVal = newVal = self.value(); - } - - switch ( event.keyCode ) { - case $.ui.keyCode.HOME: - newVal = self._valueMin(); - break; - case $.ui.keyCode.END: - newVal = self._valueMax(); - break; - case $.ui.keyCode.PAGE_UP: - newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); - break; - case $.ui.keyCode.PAGE_DOWN: - newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); - break; - case $.ui.keyCode.UP: - case $.ui.keyCode.RIGHT: - if ( curVal === self._valueMax() ) { - return; - } - newVal = self._trimAlignValue( curVal + step ); - break; - case $.ui.keyCode.DOWN: - case $.ui.keyCode.LEFT: - if ( curVal === self._valueMin() ) { - return; - } - newVal = self._trimAlignValue( curVal - step ); - break; - } - - self._slide( event, index, newVal ); - - return ret; - - }) - .keyup(function( event ) { - var index = $( this ).data( "index.ui-slider-handle" ); - - if ( self._keySliding ) { - self._keySliding = false; - self._stop( event, index ); - self._change( event, index ); - $( this ).removeClass( "ui-state-active" ); - } - - }); + this._refresh(); - this._refreshValue(); + if ( this.active.length ) { + this.load( options.active ); + } + }, - this._animateOff = false; + _getCreateEventData: function() { + return { + tab: this.active, + panel: !this.active.length ? $() : this._getPanelForTab( this.active ) + }; }, - destroy: function() { - this.handles.remove(); - this.range.remove(); + _tabKeydown: function( event ) { + var focusedTab = $( this.document[0].activeElement ).closest( "li" ), + selectedIndex = this.tabs.index( focusedTab ), + goingForward = true; - this.element - .removeClass( "ui-slider" + - " ui-slider-horizontal" + - " ui-slider-vertical" + - " ui-slider-disabled" + - " ui-widget" + - " ui-widget-content" + - " ui-corner-all" ) - .removeData( "slider" ) - .unbind( ".slider" ); + if ( this._handlePageNav( event ) ) { + return; + } - this._mouseDestroy(); + switch ( event.keyCode ) { + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + selectedIndex++; + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.LEFT: + goingForward = false; + selectedIndex--; + break; + case $.ui.keyCode.END: + selectedIndex = this.anchors.length - 1; + break; + case $.ui.keyCode.HOME: + selectedIndex = 0; + break; + case $.ui.keyCode.SPACE: + // Activate only, no collapsing + event.preventDefault(); + clearTimeout( this.activating ); + this._activate( selectedIndex ); + return; + case $.ui.keyCode.ENTER: + // Toggle (cancel delayed activation, allow collapsing) + event.preventDefault(); + clearTimeout( this.activating ); + // Determine if we should collapse or activate + this._activate( selectedIndex === this.options.active ? false : selectedIndex ); + return; + default: + return; + } - return this; + // Focus the appropriate tab, based on which key was pressed + event.preventDefault(); + clearTimeout( this.activating ); + selectedIndex = this._focusNextTab( selectedIndex, goingForward ); + + // Navigating with control key will prevent automatic activation + if ( !event.ctrlKey ) { + // Update aria-selected immediately so that AT think the tab is already selected. + // Otherwise AT may confuse the user by stating that they need to activate the tab, + // but the tab will already be activated by the time the announcement finishes. + focusedTab.attr( "aria-selected", "false" ); + this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" ); + + this.activating = this._delay(function() { + this.option( "active", selectedIndex ); + }, this.delay ); + } }, - _mouseCapture: function( event ) { - var o = this.options, - position, - normValue, - distance, - closestHandle, - self, - index, - allowed, - offset, - mouseOverHandle; + _panelKeydown: function( event ) { + if ( this._handlePageNav( event ) ) { + return; + } - if ( o.disabled ) { - return false; + // Ctrl+up moves focus to the current tab + if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) { + event.preventDefault(); + this.active.focus(); } + }, - this.elementSize = { - width: this.element.outerWidth(), - height: this.element.outerHeight() - }; - this.elementOffset = this.element.offset(); + // Alt+page up/down moves focus to the previous/next tab (and activates) + _handlePageNav: function( event ) { + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) { + this._activate( this._focusNextTab( this.options.active - 1, false ) ); + return true; + } + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) { + this._activate( this._focusNextTab( this.options.active + 1, true ) ); + return true; + } + }, - position = { x: event.pageX, y: event.pageY }; - normValue = this._normValueFromMouse( position ); - distance = this._valueMax() - this._valueMin() + 1; - self = this; - this.handles.each(function( i ) { - var thisDistance = Math.abs( normValue - self.values(i) ); - if ( distance > thisDistance ) { - distance = thisDistance; - closestHandle = $( this ); - index = i; + _findNextTab: function( index, goingForward ) { + var lastTabIndex = this.tabs.length - 1; + + function constrain() { + if ( index > lastTabIndex ) { + index = 0; } - }); + if ( index < 0 ) { + index = lastTabIndex; + } + return index; + } - // workaround for bug #3736 (if both handles of a range are at 0, - // the first is always used as the one with least distance, - // and moving it is obviously prevented by preventing negative ranges) - if( o.range === true && this.values(1) === o.min ) { - index += 1; - closestHandle = $( this.handles[index] ); + while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) { + index = goingForward ? index + 1 : index - 1; } - allowed = this._start( event, index ); - if ( allowed === false ) { - return false; + return index; + }, + + _focusNextTab: function( index, goingForward ) { + index = this._findNextTab( index, goingForward ); + this.tabs.eq( index ).focus(); + return index; + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "disabled" ) { + // don't use the widget factory's disabled handling + this._setupDisabled( value ); + return; } - this._mouseSliding = true; - self._handleIndex = index; + this._super( key, value); - closestHandle - .addClass( "ui-state-active" ) - .focus(); - - offset = closestHandle.offset(); - mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); - this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { - left: event.pageX - offset.left - ( closestHandle.width() / 2 ), - top: event.pageY - offset.top - - ( closestHandle.height() / 2 ) - - ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - - ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + - ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) - }; + if ( key === "collapsible" ) { + this.element.toggleClass( "ui-tabs-collapsible", value ); + // Setting collapsible: false while collapsed; open first panel + if ( !value && this.options.active === false ) { + this._activate( 0 ); + } + } - if ( !this.handles.hasClass( "ui-state-hover" ) ) { - this._slide( event, index, normValue ); + if ( key === "event" ) { + this._setupEvents( value ); } - this._animateOff = true; - return true; - }, - _mouseStart: function( event ) { - return true; + if ( key === "heightStyle" ) { + this._setupHeightStyle( value ); + } }, - _mouseDrag: function( event ) { - var position = { x: event.pageX, y: event.pageY }, - normValue = this._normValueFromMouse( position ); - - this._slide( event, this._handleIndex, normValue ); + _tabId: function( tab ) { + return tab.attr( "aria-controls" ) || "ui-tabs-" + getNextTabId(); + }, - return false; + _sanitizeSelector: function( hash ) { + return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : ""; }, - _mouseStop: function( event ) { - this.handles.removeClass( "ui-state-active" ); - this._mouseSliding = false; + refresh: function() { + var options = this.options, + lis = this.tablist.children( ":has(a[href])" ); - this._stop( event, this._handleIndex ); - this._change( event, this._handleIndex ); + // get disabled tabs from class attribute from HTML + // this will get converted to a boolean if needed in _refresh() + options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) { + return lis.index( tab ); + }); - this._handleIndex = null; - this._clickOffset = null; - this._animateOff = false; + this._processTabs(); + + // was collapsed or no tabs + if ( options.active === false || !this.anchors.length ) { + options.active = false; + this.active = $(); + // was active, but active tab is gone + } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) { + // all remaining tabs are disabled + if ( this.tabs.length === options.disabled.length ) { + options.active = false; + this.active = $(); + // activate previous tab + } else { + this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) ); + } + // was active, active tab still exists + } else { + // make sure active index is correct + options.active = this.tabs.index( this.active ); + } - return false; - }, - - _detectOrientation: function() { - this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + this._refresh(); }, - _normValueFromMouse: function( position ) { - var pixelTotal, - pixelMouse, - percentMouse, - valueTotal, - valueMouse; + _refresh: function() { + this._setupDisabled( this.options.disabled ); + this._setupEvents( this.options.event ); + this._setupHeightStyle( this.options.heightStyle ); - if ( this.orientation === "horizontal" ) { - pixelTotal = this.elementSize.width; - pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + this.tabs.not( this.active ).attr({ + "aria-selected": "false", + tabIndex: -1 + }); + this.panels.not( this._getPanelForTab( this.active ) ) + .hide() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + + // Make sure one tab is in the tab order + if ( !this.active.length ) { + this.tabs.eq( 0 ).attr( "tabIndex", 0 ); } else { - pixelTotal = this.elementSize.height; - pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + this.active + .addClass( "ui-tabs-active ui-state-active" ) + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + this._getPanelForTab( this.active ) + .show() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); } + }, - percentMouse = ( pixelMouse / pixelTotal ); - if ( percentMouse > 1 ) { - percentMouse = 1; - } - if ( percentMouse < 0 ) { - percentMouse = 0; - } - if ( this.orientation === "vertical" ) { - percentMouse = 1 - percentMouse; - } + _processTabs: function() { + var that = this; - valueTotal = this._valueMax() - this._valueMin(); - valueMouse = this._valueMin() + percentMouse * valueTotal; + this.tablist = this._getList() + .addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .attr( "role", "tablist" ); - return this._trimAlignValue( valueMouse ); - }, + this.tabs = this.tablist.find( "> li:has(a[href])" ) + .addClass( "ui-state-default ui-corner-top" ) + .attr({ + role: "tab", + tabIndex: -1 + }); - _start: function( event, index ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); - } - return this._trigger( "start", event, uiHash ); - }, + this.anchors = this.tabs.map(function() { + return $( "a", this )[ 0 ]; + }) + .addClass( "ui-tabs-anchor" ) + .attr({ + role: "presentation", + tabIndex: -1 + }); - _slide: function( event, index, newVal ) { - var otherVal, - newValues, - allowed; + this.panels = $(); - if ( this.options.values && this.options.values.length ) { - otherVal = this.values( index ? 0 : 1 ); + this.anchors.each(function( i, anchor ) { + var selector, panel, panelId, + anchorId = $( anchor ).uniqueId().attr( "id" ), + tab = $( anchor ).closest( "li" ), + originalAriaControls = tab.attr( "aria-controls" ); - if ( ( this.options.values.length === 2 && this.options.range === true ) && - ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) - ) { - newVal = otherVal; + // inline tab + if ( isLocal( anchor ) ) { + selector = anchor.hash; + panel = that.element.find( that._sanitizeSelector( selector ) ); + // remote tab + } else { + panelId = that._tabId( tab ); + selector = "#" + panelId; + panel = that.element.find( selector ); + if ( !panel.length ) { + panel = that._createPanel( panelId ); + panel.insertAfter( that.panels[ i - 1 ] || that.tablist ); + } + panel.attr( "aria-live", "polite" ); } - if ( newVal !== this.values( index ) ) { - newValues = this.values(); - newValues[ index ] = newVal; - // A slide can be canceled by returning false from the slide callback - allowed = this._trigger( "slide", event, { - handle: this.handles[ index ], - value: newVal, - values: newValues - } ); - otherVal = this.values( index ? 0 : 1 ); - if ( allowed !== false ) { - this.values( index, newVal, true ); - } + if ( panel.length) { + that.panels = that.panels.add( panel ); } - } else { - if ( newVal !== this.value() ) { - // A slide can be canceled by returning false from the slide callback - allowed = this._trigger( "slide", event, { - handle: this.handles[ index ], - value: newVal - } ); - if ( allowed !== false ) { - this.value( newVal ); - } + if ( originalAriaControls ) { + tab.data( "ui-tabs-aria-controls", originalAriaControls ); } - } + tab.attr({ + "aria-controls": selector.substring( 1 ), + "aria-labelledby": anchorId + }); + panel.attr( "aria-labelledby", anchorId ); + }); + + this.panels + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .attr( "role", "tabpanel" ); }, - _stop: function( event, index ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); - } + // allow overriding how to find the list for rare usage scenarios (#7715) + _getList: function() { + return this.element.find( "ol,ul" ).eq( 0 ); + }, - this._trigger( "stop", event, uiHash ); + _createPanel: function( id ) { + return $( "
          " ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); }, - _change: function( event, index ) { - if ( !this._keySliding && !this._mouseSliding ) { - var uiHash = { - handle: this.handles[ index ], - value: this.value() - }; - if ( this.options.values && this.options.values.length ) { - uiHash.value = this.values( index ); - uiHash.values = this.values(); + _setupDisabled: function( disabled ) { + if ( $.isArray( disabled ) ) { + if ( !disabled.length ) { + disabled = false; + } else if ( disabled.length === this.anchors.length ) { + disabled = true; } + } - this._trigger( "change", event, uiHash ); + // disable tabs + for ( var i = 0, li; ( li = this.tabs[ i ] ); i++ ) { + if ( disabled === true || $.inArray( i, disabled ) !== -1 ) { + $( li ) + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } else { + $( li ) + .removeClass( "ui-state-disabled" ) + .removeAttr( "aria-disabled" ); + } } + + this.options.disabled = disabled; }, - value: function( newValue ) { - if ( arguments.length ) { - this.options.value = this._trimAlignValue( newValue ); - this._refreshValue(); - this._change( null, 0 ); - return; + _setupEvents: function( event ) { + var events = { + click: function( event ) { + event.preventDefault(); + } + }; + if ( event ) { + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); } - return this._value(); + this._off( this.anchors.add( this.tabs ).add( this.panels ) ); + this._on( this.anchors, events ); + this._on( this.tabs, { keydown: "_tabKeydown" } ); + this._on( this.panels, { keydown: "_panelKeydown" } ); + + this._focusable( this.tabs ); + this._hoverable( this.tabs ); }, - values: function( index, newValue ) { - var vals, - newValues, - i; + _setupHeightStyle: function( heightStyle ) { + var maxHeight, overflow, + parent = this.element.parent(); - if ( arguments.length > 1 ) { - this.options.values[ index ] = this._trimAlignValue( newValue ); - this._refreshValue(); - this._change( null, index ); - return; - } + if ( heightStyle === "fill" ) { + // IE 6 treats height like minHeight, so we need to turn off overflow + // in order to get a reliable height + // we use the minHeight support test because we assume that only + // browsers that don't support minHeight will treat height as minHeight + if ( !$.support.minHeight ) { + overflow = parent.css( "overflow" ); + parent.css( "overflow", "hidden"); + } + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); - if ( arguments.length ) { - if ( $.isArray( arguments[ 0 ] ) ) { - vals = this.options.values; - newValues = arguments[ 0 ]; - for ( i = 0; i < vals.length; i += 1 ) { - vals[ i ] = this._trimAlignValue( newValues[ i ] ); - this._change( null, i ); - } - this._refreshValue(); - } else { - if ( this.options.values && this.options.values.length ) { - return this._values( index ); - } else { - return this.value(); + if ( position === "absolute" || position === "fixed" ) { + return; } + maxHeight -= elem.outerHeight( true ); + }); + if ( overflow ) { + parent.css( "overflow", overflow ); } - } else { - return this._values(); + + this.element.children().not( this.panels ).each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.panels.each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.panels.each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }).height( maxHeight ); } }, - _setOption: function( key, value ) { - var i, - valsLength = 0; + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + anchor = $( event.currentTarget ), + tab = anchor.closest( "li" ), + clickedIsActive = tab[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : this._getPanelForTab( tab ), + toHide = !active.length ? $() : this._getPanelForTab( active ), + eventData = { + oldTab: active, + oldPanel: toHide, + newTab: collapsing ? $() : tab, + newPanel: toShow + }; - if ( $.isArray( this.options.values ) ) { - valsLength = this.options.values.length; + event.preventDefault(); + + if ( tab.hasClass( "ui-state-disabled" ) || + // tab is already loading + tab.hasClass( "ui-tabs-loading" ) || + // can't switch durning an animation + this.running || + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; } - $.Widget.prototype._setOption.apply( this, arguments ); + options.active = collapsing ? false : this.tabs.index( tab ); - switch ( key ) { - case "disabled": - if ( value ) { - this.handles.filter( ".ui-state-focus" ).blur(); - this.handles.removeClass( "ui-state-hover" ); - this.handles.propAttr( "disabled", true ); - this.element.addClass( "ui-disabled" ); - } else { - this.handles.propAttr( "disabled", false ); - this.element.removeClass( "ui-disabled" ); - } - break; - case "orientation": - this._detectOrientation(); - this.element - .removeClass( "ui-slider-horizontal ui-slider-vertical" ) - .addClass( "ui-slider-" + this.orientation ); - this._refreshValue(); - break; - case "value": - this._animateOff = true; - this._refreshValue(); - this._change( null, 0 ); - this._animateOff = false; - break; - case "values": - this._animateOff = true; - this._refreshValue(); - for ( i = 0; i < valsLength; i += 1 ) { - this._change( null, i ); - } - this._animateOff = false; - break; + this.active = clickedIsActive ? $() : tab; + if ( this.xhr ) { + this.xhr.abort(); } - }, - //internal value getter - // _value() returns value trimmed by min and max, aligned by step - _value: function() { - var val = this.options.value; - val = this._trimAlignValue( val ); + if ( !toHide.length && !toShow.length ) { + $.error( "jQuery UI Tabs: Mismatching fragment identifier." ); + } - return val; + if ( toShow.length ) { + this.load( this.tabs.index( tab ), event ); + } + this._toggle( event, eventData ); }, - //internal values getter - // _values() returns array of values trimmed by min and max, aligned by step - // _values( index ) returns single value trimmed by min and max, aligned by step - _values: function( index ) { - var val, - vals, - i; + // handles show/hide for selecting tabs + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel; - if ( arguments.length ) { - val = this.options.values[ index ]; - val = this._trimAlignValue( val ); + this.running = true; - return val; - } else { - // .slice() creates a copy of the array - // this copy gets trimmed by min and max and then returned - vals = this.options.values.slice(); - for ( i = 0; i < vals.length; i+= 1) { - vals[ i ] = this._trimAlignValue( vals[ i ] ); + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } + + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); + + if ( toShow.length && that.options.show ) { + that._show( toShow, that.options.show, complete ); + } else { + toShow.show(); + complete(); } + } - return vals; + // start out by hiding, then showing, then completing + if ( toHide.length && this.options.hide ) { + this._hide( toHide, this.options.hide, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); + } else { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); } - }, - - // returns the step-aligned value that val is closest to, between (inclusive) min and max - _trimAlignValue: function( val ) { - if ( val <= this._valueMin() ) { - return this._valueMin(); + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + eventData.oldTab.attr( "aria-selected", "false" ); + // If we're switching tabs, remove the old tab from the tab order. + // If we're opening from collapsed state, remove the previous tab from the tab order. + // If we're collapsing, then keep the collapsing tab in the tab order. + if ( toShow.length && toHide.length ) { + eventData.oldTab.attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.tabs.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); } - if ( val >= this._valueMax() ) { - return this._valueMax(); + + toShow.attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + eventData.newTab.attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _activate: function( index ) { + var anchor, + active = this._findActive( index ); + + // trying to activate the already active panel + if ( active[ 0 ] === this.active[ 0 ] ) { + return; } - var step = ( this.options.step > 0 ) ? this.options.step : 1, - valModStep = (val - this._valueMin()) % step, - alignValue = val - valModStep; - if ( Math.abs(valModStep) * 2 >= step ) { - alignValue += ( valModStep > 0 ) ? step : ( -step ); + // trying to collapse, simulate a click on the current active header + if ( !active.length ) { + active = this.active; } - // Since JavaScript has problems with large floats, round - // the final value to 5 digits after the decimal point (see #4124) - return parseFloat( alignValue.toFixed(5) ); + anchor = active.find( ".ui-tabs-anchor" )[ 0 ]; + this._eventHandler({ + target: anchor, + currentTarget: anchor, + preventDefault: $.noop + }); }, - _valueMin: function() { - return this.options.min; + _findActive: function( index ) { + return index === false ? $() : this.tabs.eq( index ); }, - _valueMax: function() { - return this.options.max; - }, - - _refreshValue: function() { - var oRange = this.options.range, - o = this.options, - self = this, - animate = ( !this._animateOff ) ? o.animate : false, - valPercent, - _set = {}, - lastValPercent, - value, - valueMin, - valueMax; + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + if ( typeof index === "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } - if ( this.options.values && this.options.values.length ) { - this.handles.each(function( i, j ) { - valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; - _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; - $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); - if ( self.options.range === true ) { - if ( self.orientation === "horizontal" ) { - if ( i === 0 ) { - self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); - } - if ( i === 1 ) { - self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - } else { - if ( i === 0 ) { - self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); - } - if ( i === 1 ) { - self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - } - } - lastValPercent = valPercent; - }); - } else { - value = this.value(); - valueMin = this._valueMin(); - valueMax = this._valueMax(); - valPercent = ( valueMax !== valueMin ) ? - ( value - valueMin ) / ( valueMax - valueMin ) * 100 : - 0; - _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; - this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + return index; + }, - if ( oRange === "min" && this.orientation === "horizontal" ) { - this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); - } - if ( oRange === "max" && this.orientation === "horizontal" ) { - this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); - } - if ( oRange === "min" && this.orientation === "vertical" ) { - this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); - } - if ( oRange === "max" && this.orientation === "vertical" ) { - this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); - } + _destroy: function() { + if ( this.xhr ) { + this.xhr.abort(); } - } -}); + this.element.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ); -$.extend( $.ui.slider, { - version: "1.8.16" -}); + this.tablist + .removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .removeAttr( "role" ); -}(jQuery)); -/* - * jQuery UI Tabs 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function( $, undefined ) { + this.anchors + .removeClass( "ui-tabs-anchor" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeData( "href.tabs" ) + .removeData( "load.tabs" ) + .removeUniqueId(); -var tabId = 0, - listId = 0; + this.tabs.add( this.panels ).each(function() { + if ( $.data( this, "ui-tabs-destroy" ) ) { + $( this ).remove(); + } else { + $( this ) + .removeClass( "ui-state-default ui-state-active ui-state-disabled " + + "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-live" ) + .removeAttr( "aria-busy" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "role" ); + } + }); -function getNextTabId() { - return ++tabId; -} + this.tabs.each(function() { + var li = $( this ), + prev = li.data( "ui-tabs-aria-controls" ); + if ( prev ) { + li.attr( "aria-controls", prev ); + } else { + li.removeAttr( "aria-controls" ); + } + }); -function getNextListId() { - return ++listId; -} + this.panels.show(); -$.widget( "ui.tabs", { - options: { - add: null, - ajaxOptions: null, - cache: false, - cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } - collapsible: false, - disable: null, - disabled: [], - enable: null, - event: "click", - fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } - idPrefix: "ui-tabs-", - load: null, - panelTemplate: "
          ", - remove: null, - select: null, - show: null, - spinner: "Loading…", - tabTemplate: "
        • #{label}
        • " + if ( this.options.heightStyle !== "content" ) { + this.panels.css( "height", "" ); + } }, - _create: function() { - this._tabify( true ); + enable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === false ) { + return; + } + + if ( index === undefined ) { + disabled = false; + } else { + index = this._getIndex( index ); + if ( $.isArray( disabled ) ) { + disabled = $.map( disabled, function( num ) { + return num !== index ? num : null; + }); + } else { + disabled = $.map( this.tabs, function( li, num ) { + return num !== index ? num : null; + }); + } + } + this._setupDisabled( disabled ); }, - _setOption: function( key, value ) { - if ( key == "selected" ) { - if (this.options.collapsible && value == this.options.selected ) { + disable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === true ) { + return; + } + + if ( index === undefined ) { + disabled = true; + } else { + index = this._getIndex( index ); + if ( $.inArray( index, disabled ) !== -1 ) { return; } - this.select( value ); - } else { - this.options[ key ] = value; - this._tabify(); + if ( $.isArray( disabled ) ) { + disabled = $.merge( [ index ], disabled ).sort(); + } else { + disabled = [ index ]; + } } + this._setupDisabled( disabled ); }, - _tabId: function( a ) { - return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || - this.options.idPrefix + getNextTabId(); - }, + load: function( index, event ) { + index = this._getIndex( index ); + var that = this, + tab = this.tabs.eq( index ), + anchor = tab.find( ".ui-tabs-anchor" ), + panel = this._getPanelForTab( tab ), + eventData = { + tab: tab, + panel: panel + }; - _sanitizeSelector: function( hash ) { - // we need this because an id may contain a ":" - return hash.replace( /:/g, "\\:" ); + // not remote + if ( isLocal( anchor[ 0 ] ) ) { + return; + } + + this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) ); + + // support: jQuery <1.8 + // jQuery <1.8 returns false if the request is canceled in beforeSend, + // but as of 1.8, $.ajax() always returns a jqXHR object. + if ( this.xhr && this.xhr.statusText !== "canceled" ) { + tab.addClass( "ui-tabs-loading" ); + panel.attr( "aria-busy", "true" ); + + this.xhr + .success(function( response ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + panel.html( response ); + that._trigger( "load", event, eventData ); + }, 1 ); + }) + .complete(function( jqXHR, status ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + if ( status === "abort" ) { + that.panels.stop( false, true ); + } + + tab.removeClass( "ui-tabs-loading" ); + panel.removeAttr( "aria-busy" ); + + if ( jqXHR === that.xhr ) { + delete that.xhr; + } + }, 1 ); + }); + } }, - _cookie: function() { - var cookie = this.cookie || - ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); - return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + // TODO: Remove this function in 1.10 when ajaxOptions is removed + _ajaxSettings: function( anchor, event, eventData ) { + var that = this; + return { + url: anchor.attr( "href" ), + beforeSend: function( jqXHR, settings ) { + return that._trigger( "beforeLoad", event, + $.extend( { jqXHR : jqXHR, ajaxSettings: settings }, eventData ) ); + } + }; }, - _ui: function( tab, panel ) { + _getPanelForTab: function( tab ) { + var id = $( tab ).attr( "aria-controls" ); + return this.element.find( this._sanitizeSelector( "#" + id ) ); + } +}); + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + + // helper method for a lot of the back compat extensions + $.ui.tabs.prototype._ui = function( tab, panel ) { return { tab: tab, panel: panel, index: this.anchors.index( tab ) }; - }, + }; - _cleanup: function() { - // restore all former loading tabs labels - this.lis.filter( ".ui-state-processing" ) - .removeClass( "ui-state-processing" ) - .find( "span:data(label.tabs)" ) - .each(function() { - var el = $( this ); - el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + // url method + $.widget( "ui.tabs", $.ui.tabs, { + url: function( index, url ) { + this.anchors.eq( index ).attr( "href", url ); + } + }); + + // TODO: Remove _ajaxSettings() method when removing this extension + // ajaxOptions and cache options + $.widget( "ui.tabs", $.ui.tabs, { + options: { + ajaxOptions: null, + cache: false + }, + + _create: function() { + this._super(); + + var that = this; + + this._on({ tabsbeforeload: function( event, ui ) { + // tab is already cached + if ( $.data( ui.tab[ 0 ], "cache.tabs" ) ) { + event.preventDefault(); + return; + } + + ui.jqXHR.success(function() { + if ( that.options.cache ) { + $.data( ui.tab[ 0 ], "cache.tabs", true ); + } }); - }, + }}); + }, - _tabify: function( init ) { - var self = this, - o = this.options, - fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + _ajaxSettings: function( anchor, event, ui ) { + var ajaxOptions = this.options.ajaxOptions; + return $.extend( {}, ajaxOptions, { + error: function( xhr, status ) { + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + ajaxOptions.error( + xhr, status, ui.tab.closest( "li" ).index(), ui.tab[ 0 ] ); + } + catch ( error ) {} + } + }, this._superApply( arguments ) ); + }, - this.list = this.element.find( "ol,ul" ).eq( 0 ); - this.lis = $( " > li:has(a[href])", this.list ); - this.anchors = this.lis.map(function() { - return $( "a", this )[ 0 ]; - }); - this.panels = $( [] ); - - this.anchors.each(function( i, a ) { - var href = $( a ).attr( "href" ); - // For dynamically created HTML that contains a hash as href IE < 8 expands - // such href to the full page url with hash and then misinterprets tab as ajax. - // Same consideration applies for an added tab with a fragment identifier - // since a[href=#fragment-identifier] does unexpectedly not match. - // Thus normalize href attribute... - var hrefBase = href.split( "#" )[ 0 ], - baseEl; - if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || - ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { - href = a.hash; - a.href = href; + _setOption: function( key, value ) { + // reset cache if switching from cached to not cached + if ( key === "cache" && value === false ) { + this.anchors.removeData( "cache.tabs" ); } + this._super( key, value ); + }, - // inline tab - if ( fragmentId.test( href ) ) { - self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); - // remote tab - // prevent loading the page itself if href is just "#" - } else if ( href && href !== "#" ) { - // required for restore on destroy - $.data( a, "href.tabs", href ); - - // TODO until #3808 is fixed strip fragment identifier from url - // (IE fails to load from such url) - $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); - - var id = self._tabId( a ); - a.href = "#" + id; - var $panel = self.element.find( "#" + id ); - if ( !$panel.length ) { - $panel = $( o.panelTemplate ) - .attr( "id", id ) - .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) - .insertAfter( self.panels[ i - 1 ] || self.list ); - $panel.data( "destroy.tabs", true ); - } - self.panels = self.panels.add( $panel ); - // invalid tab href - } else { - o.disabled.push( i ); + _destroy: function() { + this.anchors.removeData( "cache.tabs" ); + this._super(); + }, + + url: function( index ){ + this.anchors.eq( index ).removeData( "cache.tabs" ); + this._superApply( arguments ); + } + }); + + // abort method + $.widget( "ui.tabs", $.ui.tabs, { + abort: function() { + if ( this.xhr ) { + this.xhr.abort(); } - }); + } + }); - // initialization from scratch - if ( init ) { - // attach necessary classes for styling - this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); - this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); - this.lis.addClass( "ui-state-default ui-corner-top" ); - this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); - - // Selected tab - // use "selected" option or try to retrieve: - // 1. from fragment identifier in url - // 2. from cookie - // 3. from selected class attribute on
        • - if ( o.selected === undefined ) { - if ( location.hash ) { - this.anchors.each(function( i, a ) { - if ( a.hash == location.hash ) { - o.selected = i; - return false; - } + // spinner + $.widget( "ui.tabs", $.ui.tabs, { + options: { + spinner: "Loading…" + }, + _create: function() { + this._super(); + this._on({ + tabsbeforeload: function( event, ui ) { + // Don't react to nested tabs or tabs that don't use a spinner + if ( event.target !== this.element[ 0 ] || + !this.options.spinner ) { + return; + } + + var span = ui.tab.find( "span" ), + html = span.html(); + span.html( this.options.spinner ); + ui.jqXHR.complete(function() { + span.html( html ); }); } - if ( typeof o.selected !== "number" && o.cookie ) { - o.selected = parseInt( self._cookie(), 10 ); - } - if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { - o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + }); + } + }); + + // enable/disable events + $.widget( "ui.tabs", $.ui.tabs, { + options: { + enable: null, + disable: null + }, + + enable: function( index ) { + var options = this.options, + trigger; + + if ( index && options.disabled === true || + ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) !== -1 ) ) { + trigger = true; + } + + this._superApply( arguments ); + + if ( trigger ) { + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + }, + + disable: function( index ) { + var options = this.options, + trigger; + + if ( index && options.disabled === false || + ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) === -1 ) ) { + trigger = true; + } + + this._superApply( arguments ); + + if ( trigger ) { + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + } + }); + + // add/remove methods and events + $.widget( "ui.tabs", $.ui.tabs, { + options: { + add: null, + remove: null, + tabTemplate: "
        • #{label}
        • " + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var doInsertAfter, panel, + options = this.options, + li = $( options.tabTemplate + .replace( /#\{href\}/g, url ) + .replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? + url.replace( "#", "" ) : + this._tabId( li ); + + li.addClass( "ui-state-default ui-corner-top" ).data( "ui-tabs-destroy", true ); + li.attr( "aria-controls", id ); + + doInsertAfter = index >= this.tabs.length; + + // try to find an existing element before creating a new one + panel = this.element.find( "#" + id ); + if ( !panel.length ) { + panel = this._createPanel( id ); + if ( doInsertAfter ) { + if ( index > 0 ) { + panel.insertAfter( this.panels.eq( -1 ) ); + } else { + panel.appendTo( this.element ); + } + } else { + panel.insertBefore( this.panels[ index ] ); } - o.selected = o.selected || ( this.lis.length ? 0 : -1 ); - } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release - o.selected = -1; } + panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ).hide(); - // sanity check - default to first tab... - o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) - ? o.selected - : 0; + if ( doInsertAfter ) { + li.appendTo( this.tablist ); + } else { + li.insertBefore( this.tabs[ index ] ); + } - // Take disabling tabs via class attribute from HTML - // into account and update option properly. - // A selected tab cannot become disabled. - o.disabled = $.unique( o.disabled.concat( - $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { - return self.lis.index( n ); - }) - ) ).sort(); + options.disabled = $.map( options.disabled, function( n ) { + return n >= index ? ++n : n; + }); - if ( $.inArray( o.selected, o.disabled ) != -1 ) { - o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + this.refresh(); + if ( this.tabs.length === 1 && options.active === false ) { + this.option( "active", 0 ); } - // highlight selected tab - this.panels.addClass( "ui-tabs-hide" ); - this.lis.removeClass( "ui-tabs-selected ui-state-active" ); - // check for length avoids error when initializing empty list - if ( o.selected >= 0 && this.anchors.length ) { - self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); - this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, - // seems to be expected behavior that the show callback is fired - self.element.queue( "tabs", function() { - self._trigger( "show", null, - self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); - }); + remove: function( index ) { + index = this._getIndex( index ); + var options = this.options, + tab = this.tabs.eq( index ).remove(), + panel = this._getPanelForTab( tab ).remove(); - this.load( o.selected ); + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + // We check for more than 2 tabs, because if there are only 2, + // then when we remove this tab, there will only be one tab left + // so we don't need to detect which tab to activate. + if ( tab.hasClass( "ui-tabs-active" ) && this.anchors.length > 2 ) { + this._activate( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); } - // clean up to avoid memory leaks in certain versions of IE 6 - // TODO: namespace this event - $( window ).bind( "unload", function() { - self.lis.add( self.anchors ).unbind( ".tabs" ); - self.lis = self.anchors = self.panels = null; - }); - // update selected after add/remove - } else { - o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); - } + options.disabled = $.map( + $.grep( options.disabled, function( n ) { + return n !== index; + }), + function( n ) { + return n >= index ? --n : n; + }); - // update collapsible - // TODO: use .toggleClass() - this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + this.refresh(); - // set or update cookie after init and add/remove respectively - if ( o.cookie ) { - this._cookie( o.selected, o.cookie ); + this._trigger( "remove", null, this._ui( tab.find( "a" )[ 0 ], panel[ 0 ] ) ); + return this; } + }); - // disable tabs - for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { - $( li )[ $.inArray( i, o.disabled ) != -1 && - // TODO: use .toggleClass() - !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + // length method + $.widget( "ui.tabs", $.ui.tabs, { + length: function() { + return this.anchors.length; } + }); - // reset cache if switching from cached to not cached - if ( o.cache === false ) { - this.anchors.removeData( "cache.tabs" ); + // panel ids (idPrefix option + title attribute) + $.widget( "ui.tabs", $.ui.tabs, { + options: { + idPrefix: "ui-tabs-" + }, + + _tabId: function( tab ) { + var a = tab.is( "li" ) ? tab.find( "a[href]" ) : tab; + a = a[0]; + return $( a ).closest( "li" ).attr( "aria-controls" ) || + a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF\-]/g, "" ) || + this.options.idPrefix + getNextTabId(); } + }); - // remove all handlers before, tabify may run on existing tabs after add or option change - this.lis.add( this.anchors ).unbind( ".tabs" ); + // _createPanel method + $.widget( "ui.tabs", $.ui.tabs, { + options: { + panelTemplate: "
          " + }, - if ( o.event !== "mouseover" ) { - var addState = function( state, el ) { - if ( el.is( ":not(.ui-state-disabled)" ) ) { - el.addClass( "ui-state-" + state ); - } - }; - var removeState = function( state, el ) { - el.removeClass( "ui-state-" + state ); - }; - this.lis.bind( "mouseover.tabs" , function() { - addState( "hover", $( this ) ); - }); - this.lis.bind( "mouseout.tabs", function() { - removeState( "hover", $( this ) ); - }); - this.anchors.bind( "focus.tabs", function() { - addState( "focus", $( this ).closest( "li" ) ); - }); - this.anchors.bind( "blur.tabs", function() { - removeState( "focus", $( this ).closest( "li" ) ); - }); + _createPanel: function( id ) { + return $( this.options.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); } + }); - // set up animations - var hideFx, showFx; - if ( o.fx ) { - if ( $.isArray( o.fx ) ) { - hideFx = o.fx[ 0 ]; - showFx = o.fx[ 1 ]; - } else { - hideFx = showFx = o.fx; + // selected option + $.widget( "ui.tabs", $.ui.tabs, { + _create: function() { + var options = this.options; + if ( options.active === null && options.selected !== undefined ) { + options.active = options.selected === -1 ? false : options.selected; } - } - - // Reset certain styles left over from animation - // and prevent IE's ClearType bug... - function resetStyle( $el, fx ) { - $el.css( "display", "" ); - if ( !$.support.opacity && fx.opacity ) { - $el[ 0 ].style.removeAttribute( "filter" ); + this._super(); + options.selected = options.active; + if ( options.selected === false ) { + options.selected = -1; } - } + }, - // Show a tab... - var showTab = showFx - ? function( clicked, $show ) { - $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); - $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way - .animate( showFx, showFx.duration || "normal", function() { - resetStyle( $show, showFx ); - self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); - }); + _setOption: function( key, value ) { + if ( key !== "selected" ) { + return this._super( key, value ); } - : function( clicked, $show ) { - $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); - $show.removeClass( "ui-tabs-hide" ); - self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); - }; - // Hide a tab, $show is optional... - var hideTab = hideFx - ? function( clicked, $hide ) { - $hide.animate( hideFx, hideFx.duration || "normal", function() { - self.lis.removeClass( "ui-tabs-selected ui-state-active" ); - $hide.addClass( "ui-tabs-hide" ); - resetStyle( $hide, hideFx ); - self.element.dequeue( "tabs" ); - }); + var options = this.options; + this._super( "active", value === -1 ? false : value ); + options.selected = options.active; + if ( options.selected === false ) { + options.selected = -1; } - : function( clicked, $hide, $show ) { - self.lis.removeClass( "ui-tabs-selected ui-state-active" ); - $hide.addClass( "ui-tabs-hide" ); - self.element.dequeue( "tabs" ); - }; + }, - // attach tab event handler, unbind to avoid duplicates from former tabifying... - this.anchors.bind( o.event + ".tabs", function() { - var el = this, - $li = $(el).closest( "li" ), - $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), - $show = self.element.find( self._sanitizeSelector( el.hash ) ); - - // If tab is already selected and not collapsible or tab disabled or - // or is already loading or click callback returns false stop here. - // Check if click handler returns false last so that it is not executed - // for a disabled or loading tab! - if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || - $li.hasClass( "ui-state-disabled" ) || - $li.hasClass( "ui-state-processing" ) || - self.panels.filter( ":animated" ).length || - self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { - this.blur(); - return false; + _eventHandler: function() { + this._superApply( arguments ); + this.options.selected = this.options.active; + if ( this.options.selected === false ) { + this.options.selected = -1; } + } + }); - o.selected = self.anchors.index( this ); - - self.abort(); - - // if tab may be closed - if ( o.collapsible ) { - if ( $li.hasClass( "ui-tabs-selected" ) ) { - o.selected = -1; + // show and select event + $.widget( "ui.tabs", $.ui.tabs, { + options: { + show: null, + select: null + }, + _create: function() { + this._super(); + if ( this.options.active !== false ) { + this._trigger( "show", null, this._ui( + this.active.find( ".ui-tabs-anchor" )[ 0 ], + this._getPanelForTab( this.active )[ 0 ] ) ); + } + }, + _trigger: function( type, event, data ) { + var tab, panel, + ret = this._superApply( arguments ); - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } + if ( !ret ) { + return false; + } - self.element.queue( "tabs", function() { - hideTab( el, $hide ); - }).dequeue( "tabs" ); + if ( type === "beforeActivate" ) { + tab = data.newTab.length ? data.newTab : data.oldTab; + panel = data.newPanel.length ? data.newPanel : data.oldPanel; + ret = this._super( "select", event, { + tab: tab.find( ".ui-tabs-anchor" )[ 0], + panel: panel[ 0 ], + index: tab.closest( "li" ).index() + }); + } else if ( type === "activate" && data.newTab.length ) { + ret = this._super( "show", event, { + tab: data.newTab.find( ".ui-tabs-anchor" )[ 0 ], + panel: data.newPanel[ 0 ], + index: data.newTab.closest( "li" ).index() + }); + } + return ret; + } + }); - this.blur(); - return false; - } else if ( !$hide.length ) { - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); - } + // select method + $.widget( "ui.tabs", $.ui.tabs, { + select: function( index ) { + index = this._getIndex( index ); + if ( index === -1 ) { + if ( this.options.collapsible && this.options.selected !== -1 ) { + index = this.options.selected; + } else { + return; + } + } + this.anchors.eq( index ).trigger( this.options.event + this.eventNamespace ); + } + }); - self.element.queue( "tabs", function() { - showTab( el, $show ); - }); + // cookie option + (function() { - // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 - self.load( self.anchors.index( this ) ); + var listId = 0; - this.blur(); - return false; + $.widget( "ui.tabs", $.ui.tabs, { + options: { + cookie: null // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + }, + _create: function() { + var options = this.options, + active; + if ( options.active == null && options.cookie ) { + active = parseInt( this._cookie(), 10 ); + if ( active === -1 ) { + active = false; } + options.active = active; } - - if ( o.cookie ) { - self._cookie( o.selected, o.cookie ); + this._super(); + }, + _cookie: function( active ) { + var cookie = [ this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + (++listId) ) ]; + if ( arguments.length ) { + cookie.push( active === false ? -1 : active ); + cookie.push( this.options.cookie ); + } + return $.cookie.apply( null, cookie ); + }, + _refresh: function() { + this._super(); + if ( this.options.cookie ) { + this._cookie( this.options.active, this.options.cookie ); + } + }, + _eventHandler: function() { + this._superApply( arguments ); + if ( this.options.cookie ) { + this._cookie( this.options.active, this.options.cookie ); + } + }, + _destroy: function() { + this._super(); + if ( this.options.cookie ) { + this._cookie( null, this.options.cookie ); } + } + }); - // show new tab - if ( $show.length ) { - if ( $hide.length ) { - self.element.queue( "tabs", function() { - hideTab( el, $hide ); - }); - } - self.element.queue( "tabs", function() { - showTab( el, $show ); - }); + })(); - self.load( self.anchors.index( this ) ); - } else { - throw "jQuery UI Tabs: Mismatching fragment identifier."; + // load event + $.widget( "ui.tabs", $.ui.tabs, { + _trigger: function( type, event, data ) { + var _data = $.extend( {}, data ); + if ( type === "load" ) { + _data.panel = _data.panel[ 0 ]; + _data.tab = _data.tab.find( ".ui-tabs-anchor" )[ 0 ]; } + return this._super( type, event, _data ); + } + }); - // Prevent IE from keeping other link focussed when using the back button - // and remove dotted border from clicked link. This is controlled via CSS - // in modern browsers; blur() removes focus from address bar in Firefox - // which can become a usability and annoying problem with tabs('rotate'). - if ( $.browser.msie ) { - this.blur(); - } - }); + // fx option + // The new animation options (show, hide) conflict with the old show callback. + // The old fx option wins over show/hide anyway (always favor back-compat). + // If a user wants to use the new animation API, they must give up the old API. + $.widget( "ui.tabs", $.ui.tabs, { + options: { + fx: null // e.g. { height: "toggle", opacity: "toggle", duration: 200 } + }, - // disable click in any case - this.anchors.bind( "click.tabs", function(){ - return false; - }); - }, + _getFx: function() { + var hide, show, + fx = this.options.fx; - _getIndex: function( index ) { - // meta-function to give users option to provide a href string instead of a numerical index. - // also sanitizes numerical indexes to valid values. - if ( typeof index == "string" ) { - index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); - } + if ( fx ) { + if ( $.isArray( fx ) ) { + hide = fx[ 0 ]; + show = fx[ 1 ]; + } else { + hide = show = fx; + } + } - return index; - }, + return fx ? { show: show, hide: hide } : null; + }, - destroy: function() { - var o = this.options; + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel, + fx = this._getFx(); + + if ( !fx ) { + return this._super( event, eventData ); + } - this.abort(); + that.running = true; - this.element - .unbind( ".tabs" ) - .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) - .removeData( "tabs" ); + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } - this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); - this.anchors.each(function() { - var href = $.data( this, "href.tabs" ); - if ( href ) { - this.href = href; + if ( toShow.length && fx.show ) { + toShow + .animate( fx.show, fx.show.duration, function() { + complete(); + }); + } else { + toShow.show(); + complete(); + } } - var $this = $( this ).unbind( ".tabs" ); - $.each( [ "href", "load", "cache" ], function( i, prefix ) { - $this.removeData( prefix + ".tabs" ); - }); - }); - this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { - if ( $.data( this, "destroy.tabs" ) ) { - $( this ).remove(); + // start out by hiding, then showing, then completing + if ( toHide.length && fx.hide ) { + toHide.animate( fx.hide, fx.hide.duration, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); } else { - $( this ).removeClass([ - "ui-state-default", - "ui-corner-top", - "ui-tabs-selected", - "ui-state-active", - "ui-state-hover", - "ui-state-focus", - "ui-state-disabled", - "ui-tabs-panel", - "ui-widget-content", - "ui-corner-bottom", - "ui-tabs-hide" - ].join( " " ) ); + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); } - }); - - if ( o.cookie ) { - this._cookie( null, o.cookie ); } + }); +} - return this; - }, +})( jQuery ); +(function( $ ) { - add: function( url, label, index ) { - if ( index === undefined ) { - index = this.anchors.length; - } +var increments = 0; - var self = this, - o = this.options, - $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), - id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); +function addDescribedBy( elem, id ) { + var describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ); + describedby.push( id ); + elem + .data( "ui-tooltip-id", id ) + .attr( "aria-describedby", $.trim( describedby.join( " " ) ) ); +} - $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); +function removeDescribedBy( elem ) { + var id = elem.data( "ui-tooltip-id" ), + describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ), + index = $.inArray( id, describedby ); + if ( index !== -1 ) { + describedby.splice( index, 1 ); + } - // try to find an existing element before creating a new one - var $panel = self.element.find( "#" + id ); - if ( !$panel.length ) { - $panel = $( o.panelTemplate ) - .attr( "id", id ) - .data( "destroy.tabs", true ); - } - $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + elem.removeData( "ui-tooltip-id" ); + describedby = $.trim( describedby.join( " " ) ); + if ( describedby ) { + elem.attr( "aria-describedby", describedby ); + } else { + elem.removeAttr( "aria-describedby" ); + } +} - if ( index >= this.lis.length ) { - $li.appendTo( this.list ); - $panel.appendTo( this.list[ 0 ].parentNode ); - } else { - $li.insertBefore( this.lis[ index ] ); - $panel.insertBefore( this.panels[ index ] ); - } +$.widget( "ui.tooltip", { + version: "1.9.2", + options: { + content: function() { + return $( this ).attr( "title" ); + }, + hide: true, + // Disabled elements have inconsistent behavior across browsers (#8661) + items: "[title]:not([disabled])", + position: { + my: "left top+15", + at: "left bottom", + collision: "flipfit flip" + }, + show: true, + tooltipClass: null, + track: false, - o.disabled = $.map( o.disabled, function( n, i ) { - return n >= index ? ++n : n; - }); + // callbacks + close: null, + open: null + }, - this._tabify(); + _create: function() { + this._on({ + mouseover: "open", + focusin: "open" + }); - if ( this.anchors.length == 1 ) { - o.selected = 0; - $li.addClass( "ui-tabs-selected ui-state-active" ); - $panel.removeClass( "ui-tabs-hide" ); - this.element.queue( "tabs", function() { - self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); - }); + // IDs of generated tooltips, needed for destroy + this.tooltips = {}; + // IDs of parent tooltips where we removed the title attribute + this.parents = {}; - this.load( 0 ); + if ( this.options.disabled ) { + this._disable(); } - - this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); - return this; }, - remove: function( index ) { - index = this._getIndex( index ); - var o = this.options, - $li = this.lis.eq( index ).remove(), - $panel = this.panels.eq( index ).remove(); - - // If selected tab was removed focus tab to the right or - // in case the last tab was removed the tab to the left. - if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { - this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); - } - - o.disabled = $.map( - $.grep( o.disabled, function(n, i) { - return n != index; - }), - function( n, i ) { - return n >= index ? --n : n; - }); + _setOption: function( key, value ) { + var that = this; - this._tabify(); + if ( key === "disabled" ) { + this[ value ? "_disable" : "_enable" ](); + this.options[ key ] = value; + // disable element style changes + return; + } - this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); - return this; - }, + this._super( key, value ); - enable: function( index ) { - index = this._getIndex( index ); - var o = this.options; - if ( $.inArray( index, o.disabled ) == -1 ) { - return; + if ( key === "content" ) { + $.each( this.tooltips, function( id, element ) { + that._updateContent( element ); + }); } + }, + + _disable: function() { + var that = this; - this.lis.eq( index ).removeClass( "ui-state-disabled" ); - o.disabled = $.grep( o.disabled, function( n, i ) { - return n != index; + // close open tooltips + $.each( this.tooltips, function( id, element ) { + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); }); - this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); - return this; + // remove title attributes to prevent native tooltips + this.element.find( this.options.items ).andSelf().each(function() { + var element = $( this ); + if ( element.is( "[title]" ) ) { + element + .data( "ui-tooltip-title", element.attr( "title" ) ) + .attr( "title", "" ); + } + }); }, - disable: function( index ) { - index = this._getIndex( index ); - var self = this, o = this.options; - // cannot disable already selected tab - if ( index != o.selected ) { - this.lis.eq( index ).addClass( "ui-state-disabled" ); + _enable: function() { + // restore title attributes + this.element.find( this.options.items ).andSelf().each(function() { + var element = $( this ); + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + } + }); + }, - o.disabled.push( index ); - o.disabled.sort(); + open: function( event ) { + var that = this, + target = $( event ? event.target : this.element ) + // we need closest here due to mouseover bubbling, + // but always pointing at the same event target + .closest( this.options.items ); - this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + // No element to show a tooltip for or the tooltip is already open + if ( !target.length || target.data( "ui-tooltip-id" ) ) { + return; } - return this; + if ( target.attr( "title" ) ) { + target.data( "ui-tooltip-title", target.attr( "title" ) ); + } + + target.data( "ui-tooltip-open", true ); + + // kill parent tooltips, custom or native, for hover + if ( event && event.type === "mouseover" ) { + target.parents().each(function() { + var parent = $( this ), + blurEvent; + if ( parent.data( "ui-tooltip-open" ) ) { + blurEvent = $.Event( "blur" ); + blurEvent.target = blurEvent.currentTarget = this; + that.close( blurEvent, true ); + } + if ( parent.attr( "title" ) ) { + parent.uniqueId(); + that.parents[ this.id ] = { + element: this, + title: parent.attr( "title" ) + }; + parent.attr( "title", "" ); + } + }); + } + + this._updateContent( target, event ); }, - select: function( index ) { - index = this._getIndex( index ); - if ( index == -1 ) { - if ( this.options.collapsible && this.options.selected != -1 ) { - index = this.options.selected; - } else { - return this; + _updateContent: function( target, event ) { + var content, + contentOption = this.options.content, + that = this, + eventType = event ? event.type : null; + + if ( typeof contentOption === "string" ) { + return this._open( event, target, contentOption ); + } + + content = contentOption.call( target[0], function( response ) { + // ignore async response if tooltip was closed already + if ( !target.data( "ui-tooltip-open" ) ) { + return; } + // IE may instantly serve a cached response for ajax requests + // delay this call to _open so the other call to _open runs first + that._delay(function() { + // jQuery creates a special event for focusin when it doesn't + // exist natively. To improve performance, the native event + // object is reused and the type is changed. Therefore, we can't + // rely on the type being correct after the event finished + // bubbling, so we set it back to the previous value. (#8740) + if ( event ) { + event.type = eventType; + } + this._open( event, target, response ); + }); + }); + if ( content ) { + this._open( event, target, content ); } - this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); - return this; }, - load: function( index ) { - index = this._getIndex( index ); - var self = this, - o = this.options, - a = this.anchors.eq( index )[ 0 ], - url = $.data( a, "load.tabs" ); + _open: function( event, target, content ) { + var tooltip, events, delayedShow, + positionOption = $.extend( {}, this.options.position ); - this.abort(); - - // not remote or from cache - if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { - this.element.dequeue( "tabs" ); + if ( !content ) { return; } - // load remote from here on - this.lis.eq( index ).addClass( "ui-state-processing" ); - - if ( o.spinner ) { - var span = $( "span", a ); - span.data( "label.tabs", span.html() ).html( o.spinner ); + // Content can be updated multiple times. If the tooltip already + // exists, then just update the content and bail. + tooltip = this._find( target ); + if ( tooltip.length ) { + tooltip.find( ".ui-tooltip-content" ).html( content ); + return; } - this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { - url: url, - success: function( r, s ) { - self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + // if we have a title, clear it to prevent the native tooltip + // we have to check first to avoid defining a title if none exists + // (we don't want to cause an element to start matching [title]) + // + // We use removeAttr only for key events, to allow IE to export the correct + // accessible attributes. For mouse events, set to empty string to avoid + // native tooltip showing up (happens only when removing inside mouseover). + if ( target.is( "[title]" ) ) { + if ( event && event.type === "mouseover" ) { + target.attr( "title", "" ); + } else { + target.removeAttr( "title" ); + } + } - // take care of tab labels - self._cleanup(); + tooltip = this._tooltip( target ); + addDescribedBy( target, tooltip.attr( "id" ) ); + tooltip.find( ".ui-tooltip-content" ).html( content ); - if ( o.cache ) { - $.data( a, "cache.tabs", true ); + function position( event ) { + positionOption.of = event; + if ( tooltip.is( ":hidden" ) ) { + return; + } + tooltip.position( positionOption ); + } + if ( this.options.track && event && /^mouse/.test( event.type ) ) { + this._on( this.document, { + mousemove: position + }); + // trigger once to override element-relative positioning + position( event ); + } else { + tooltip.position( $.extend({ + of: target + }, this.options.position ) ); + } + + tooltip.hide(); + + this._show( tooltip, this.options.show ); + // Handle tracking tooltips that are shown with a delay (#8644). As soon + // as the tooltip is visible, position the tooltip using the most recent + // event. + if ( this.options.show && this.options.show.delay ) { + delayedShow = setInterval(function() { + if ( tooltip.is( ":visible" ) ) { + position( positionOption.of ); + clearInterval( delayedShow ); } + }, $.fx.interval ); + } - self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); - try { - o.ajaxOptions.success( r, s ); - } - catch ( e ) {} - }, - error: function( xhr, s, e ) { - // take care of tab labels - self._cleanup(); + this._trigger( "open", event, { tooltip: tooltip } ); - self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); - try { - // Passing index avoid a race condition when this method is - // called after the user has selected another tab. - // Pass the anchor that initiated this request allows - // loadError to manipulate the tab content panel via $(a.hash) - o.ajaxOptions.error( xhr, s, index, a ); + events = { + keyup: function( event ) { + if ( event.keyCode === $.ui.keyCode.ESCAPE ) { + var fakeEvent = $.Event(event); + fakeEvent.currentTarget = target[0]; + this.close( fakeEvent, true ); } - catch ( e ) {} + }, + remove: function() { + this._removeTooltip( tooltip ); } - } ) ); + }; + if ( !event || event.type === "mouseover" ) { + events.mouseleave = "close"; + } + if ( !event || event.type === "focusin" ) { + events.focusout = "close"; + } + this._on( true, target, events ); + }, - // last, so that load event is fired before show... - self.element.dequeue( "tabs" ); + close: function( event ) { + var that = this, + target = $( event ? event.currentTarget : this.element ), + tooltip = this._find( target ); - return this; - }, + // disabling closes the tooltip, so we need to track when we're closing + // to avoid an infinite loop in case the tooltip becomes disabled on close + if ( this.closing ) { + return; + } - abort: function() { - // stop possibly running animations - this.element.queue( [] ); - this.panels.stop( false, true ); + // only set title if we had one before (see comment in _open()) + if ( target.data( "ui-tooltip-title" ) ) { + target.attr( "title", target.data( "ui-tooltip-title" ) ); + } - // "tabs" queue must not contain more than two elements, - // which are the callbacks for the latest clicked tab... - this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + removeDescribedBy( target ); - // terminate pending requests from other tabs - if ( this.xhr ) { - this.xhr.abort(); - delete this.xhr; + tooltip.stop( true ); + this._hide( tooltip, this.options.hide, function() { + that._removeTooltip( $( this ) ); + }); + + target.removeData( "ui-tooltip-open" ); + this._off( target, "mouseleave focusout keyup" ); + // Remove 'remove' binding only on delegated targets + if ( target[0] !== this.element[0] ) { + this._off( target, "remove" ); } + this._off( this.document, "mousemove" ); - // take care of tab labels - this._cleanup(); - return this; + if ( event && event.type === "mouseleave" ) { + $.each( this.parents, function( id, parent ) { + $( parent.element ).attr( "title", parent.title ); + delete that.parents[ id ]; + }); + } + + this.closing = true; + this._trigger( "close", event, { tooltip: tooltip } ); + this.closing = false; }, - url: function( index, url ) { - this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); - return this; + _tooltip: function( element ) { + var id = "ui-tooltip-" + increments++, + tooltip = $( "
          " ) + .attr({ + id: id, + role: "tooltip" + }) + .addClass( "ui-tooltip ui-widget ui-corner-all ui-widget-content " + + ( this.options.tooltipClass || "" ) ); + $( "
          " ) + .addClass( "ui-tooltip-content" ) + .appendTo( tooltip ); + tooltip.appendTo( this.document[0].body ); + if ( $.fn.bgiframe ) { + tooltip.bgiframe(); + } + this.tooltips[ id ] = element; + return tooltip; }, - length: function() { - return this.anchors.length; - } -}); + _find: function( target ) { + var id = target.data( "ui-tooltip-id" ); + return id ? $( "#" + id ) : $(); + }, -$.extend( $.ui.tabs, { - version: "1.8.16" -}); + _removeTooltip: function( tooltip ) { + tooltip.remove(); + delete this.tooltips[ tooltip.attr( "id" ) ]; + }, -/* - * Tabs Extensions - */ + _destroy: function() { + var that = this; -/* - * Rotate - */ -$.extend( $.ui.tabs.prototype, { - rotation: null, - rotate: function( ms, continuing ) { - var self = this, - o = this.options; + // close open tooltips + $.each( this.tooltips, function( id, element ) { + // Delegate to close method to handle common cleanup + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); - var rotate = self._rotate || ( self._rotate = function( e ) { - clearTimeout( self.rotation ); - self.rotation = setTimeout(function() { - var t = o.selected; - self.select( ++t < self.anchors.length ? t : 0 ); - }, ms ); - - if ( e ) { - e.stopPropagation(); - } - }); + // Remove immediately; destroying an open tooltip doesn't use the + // hide animation + $( "#" + id ).remove(); - var stop = self._unrotate || ( self._unrotate = !continuing - ? function(e) { - if (e.clientX) { // in case of a true click - self.rotate(null); - } + // Restore the title + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + element.removeData( "ui-tooltip-title" ); } - : function( e ) { - t = o.selected; - rotate(); - }); - - // start rotation - if ( ms ) { - this.element.bind( "tabsshow", rotate ); - this.anchors.bind( o.event + ".tabs", stop ); - rotate(); - // stop rotation - } else { - clearTimeout( self.rotation ); - this.element.unbind( "tabsshow", rotate ); - this.anchors.unbind( o.event + ".tabs", stop ); - delete this._rotate; - delete this._unrotate; - } - - return this; + }); } }); -})( jQuery ); +}( jQuery ) ); diff --git a/lib/scripts/jquery/jquery-ui.min.js b/lib/scripts/jquery/jquery-ui.min.js old mode 100644 new mode 100755 index 0202506b5..9b3b84deb --- a/lib/scripts/jquery/jquery-ui.min.js +++ b/lib/scripts/jquery/jquery-ui.min.js @@ -1,414 +1,6 @@ -/*! - * jQuery UI 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(a,d){function c(h,g){var i=h.nodeName.toLowerCase();if("area"===i){g=h.parentNode;i=g.name;if(!h.href||!i||g.nodeName.toLowerCase()!=="map")return false;h=a("img[usemap=#"+i+"]")[0];return!!h&&e(h)}return(/input|select|textarea|button|object/.test(i)?!h.disabled:"a"==i?h.href||g:g)&&e(h)}function e(h){return!a(h).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.ui=a.ui||{};if(!a.ui.version){a.extend(a.ui,{version:"1.8.16", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(h,g){return typeof h==="number"?this.each(function(){var i= -this;setTimeout(function(){a(i).focus();g&&g.call(i)},h)}):this._focus.apply(this,arguments)},scrollParent:function(){var h;h=a.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(a.curCSS(this,"position",1))&&/(auto|scroll)/.test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(a.curCSS(this, -"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!h.length?a(document):h},zIndex:function(h){if(h!==d)return this.css("zIndex",h);if(this.length){h=a(this[0]);for(var g;h.length&&h[0]!==document;){g=h.css("position");if(g==="absolute"||g==="relative"||g==="fixed"){g=parseInt(h.css("zIndex"),10);if(!isNaN(g)&&g!==0)return g}h=h.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart": -"mousedown")+".ui-disableSelection",function(h){h.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(h,g){function i(l,o,n,k){a.each(b,function(){o-=parseFloat(a.curCSS(l,"padding"+this,true))||0;if(n)o-=parseFloat(a.curCSS(l,"border"+this+"Width",true))||0;if(k)o-=parseFloat(a.curCSS(l,"margin"+this,true))||0});return o}var b=g==="Width"?["Left","Right"]:["Top","Bottom"],f=g.toLowerCase(),j={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight, -outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};a.fn["inner"+g]=function(l){if(l===d)return j["inner"+g].call(this);return this.each(function(){a(this).css(f,i(this,l)+"px")})};a.fn["outer"+g]=function(l,o){if(typeof l!=="number")return j["outer"+g].call(this,l);return this.each(function(){a(this).css(f,i(this,l,true,o)+"px")})}});a.extend(a.expr[":"],{data:function(h,g,i){return!!a.data(h,i[3])},focusable:function(h){return c(h,!isNaN(a.attr(h,"tabindex")))},tabbable:function(h){var g=a.attr(h, -"tabindex"),i=isNaN(g);return(i||g>=0)&&c(h,!i)}});a(function(){var h=document.body,g=h.appendChild(g=document.createElement("div"));a.extend(g.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=g.offsetHeight===100;a.support.selectstart="onselectstart"in g;h.removeChild(g).style.display="none"});a.extend(a.ui,{plugin:{add:function(h,g,i){h=a.ui[h].prototype;for(var b in i){h.plugins[b]=h.plugins[b]||[];h.plugins[b].push([g,i[b]])}},call:function(h,g,i){if((g=h.plugins[g])&& -h.element[0].parentNode)for(var b=0;b0)return true;h[g]=1;i=h[g]>0;h[g]=0;return i},isOverAxis:function(h,g,i){return h>g&&h=9)&&!c.button)return this._mouseUp(c);if(this._mouseStarted){this._mouseDrag(c);return c.preventDefault()}if(this._mouseDistanceMet(c)&&this._mouseDelayMet(c))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,c)!==false)?this._mouseDrag(c):this._mouseUp(c);return!this._mouseStarted},_mouseUp:function(c){a(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;c.target==this._mouseDownEvent.target&&a.data(c.target,this.widgetName+".preventClickEvent",true);this._mouseStop(c)}return false},_mouseDistanceMet:function(c){return Math.max(Math.abs(this._mouseDownEvent.pageX-c.pageX),Math.abs(this._mouseDownEvent.pageY-c.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -(function(a){a.widget("ui.draggable",a.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== -"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(d){var c= -this.options;if(this.helper||c.disabled||a(d.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(d);if(!this.handle)return false;if(c.iframeFix)a(c.iframeFix===true?"iframe":c.iframeFix).each(function(){a('
          ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(a(this).offset()).appendTo("body")});return true},_mouseStart:function(d){var c=this.options; -this.helper=this._createHelper(d);this._cacheHelperProportions();if(a.ui.ddmanager)a.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); -this.originalPosition=this.position=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);c.containment&&this._setContainment();if(this._trigger("start",d)===false){this._clear();return false}this._cacheHelperProportions();a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(d,true);a.ui.ddmanager&&a.ui.ddmanager.dragStart(this,d);return true}, -_mouseDrag:function(d,c){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!c){c=this._uiHash();if(this._trigger("drag",d,c)===false){this._mouseUp({});return false}this.position=c.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);return false},_mouseStop:function(d){var c= -false;if(a.ui.ddmanager&&!this.options.dropBehaviour)c=a.ui.ddmanager.drop(this,d);if(this.dropped){c=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!c||this.options.revert=="valid"&&c||this.options.revert===true||a.isFunction(this.options.revert)&&this.options.revert.call(this.element,c)){var e=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, -10),function(){e._trigger("stop",d)!==false&&e._clear()})}else this._trigger("stop",d)!==false&&this._clear();return false},_mouseUp:function(d){this.options.iframeFix===true&&a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});a.ui.ddmanager&&a.ui.ddmanager.dragStop(this,d);return a.ui.mouse.prototype._mouseUp.call(this,d)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(d){var c=!this.options.handle|| -!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==d.target)c=true});return c},_createHelper:function(d){var c=this.options;d=a.isFunction(c.helper)?a(c.helper.apply(this.element[0],[d])):c.helper=="clone"?this.element.clone().removeAttr("id"):this.element;d.parents("body").length||d.appendTo(c.appendTo=="parent"?this.element[0].parentNode:c.appendTo);d[0]!=this.element[0]&&!/(fixed|absolute)/.test(d.css("position"))&& -d.css("position","absolute");return d},_adjustOffsetFromHelper:function(d){if(typeof d=="string")d=d.split(" ");if(a.isArray(d))d={left:+d[0],top:+d[1]||0};if("left"in d)this.offset.click.left=d.left+this.margins.left;if("right"in d)this.offset.click.left=this.helperProportions.width-d.right+this.margins.left;if("top"in d)this.offset.click.top=d.top+this.margins.top;if("bottom"in d)this.offset.click.top=this.helperProportions.height-d.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= -this.helper.offsetParent();var d=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){d.left+=this.scrollParent.scrollLeft();d.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)d={top:0,left:0};return{top:d.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:d.left+(parseInt(this.offsetParent.css("borderLeftWidth"), -10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var d=this.element.position();return{top:d.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:d.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), -10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var d=this.options;if(d.containment=="parent")d.containment=this.helper[0].parentNode;if(d.containment=="document"||d.containment=="window")this.containment=[d.containment=="document"?0:a(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,d.containment=="document"?0:a(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, -(d.containment=="document"?0:a(window).scrollLeft())+a(d.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d.containment=="document"?0:a(window).scrollTop())+(a(d.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(d.containment)&&d.containment.constructor!=Array){d=a(d.containment);var c=d[0];if(c){d.offset();var e=a(c).css("overflow")!= -"hidden";this.containment=[(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0),(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0),(e?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(e?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"), -10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=d}}else if(d.containment.constructor==Array)this.containment=d.containment},_convertPositionTo:function(d,c){if(!c)c=this.position;d=d=="absolute"?1:-1;var e=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName);return{top:c.top+ -this.offset.relative.top*d+this.offset.parent.top*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():h?0:e.scrollTop())*d),left:c.left+this.offset.relative.left*d+this.offset.parent.left*d-(a.browser.safari&&a.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():h?0:e.scrollLeft())*d)}},_generatePosition:function(d){var c=this.options,e=this.cssPosition=="absolute"&& -!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,h=/(html|body)/i.test(e[0].tagName),g=d.pageX,i=d.pageY;if(this.originalPosition){var b;if(this.containment){if(this.relative_container){b=this.relative_container.offset();b=[this.containment[0]+b.left,this.containment[1]+b.top,this.containment[2]+b.left,this.containment[3]+b.top]}else b=this.containment;if(d.pageX-this.offset.click.leftb[2])g=b[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>b[3])i=b[3]+this.offset.click.top}if(c.grid){i=c.grid[1]?this.originalPageY+Math.round((i-this.originalPageY)/c.grid[1])*c.grid[1]:this.originalPageY;i=b?!(i-this.offset.click.topb[3])?i:!(i-this.offset.click.topb[2])?g:!(g-this.offset.click.left=0;l--){var o=e.snapElements[l].left,n=o+e.snapElements[l].width,k=e.snapElements[l].top,m=k+e.snapElements[l].height;if(o-g=l&&i<=o||b>=l&&b<=o||io)&&(h>= -f&&h<=j||g>=f&&g<=j||hj);default:return false}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(d,c){var e=a.ui.ddmanager.droppables[d.options.scope]||[],h=c?c.type:null,g=(d.currentItem||d.element).find(":data(droppable)").andSelf(),i=0;a:for(;i
          ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), -top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= -this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=h.handles||(!a(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", -nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var g=this.handles.split(",");this.handles={};for(var i=0;i
          ');/sw|se|ne|nw/.test(b)&&f.css({zIndex:++h.zIndex});"se"==b&&f.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[b]=".ui-resizable-"+b;this.element.append(f)}}this._renderAxis=function(j){j=j||this.element;for(var l in this.handles){if(this.handles[l].constructor== -String)this.handles[l]=a(this.handles[l],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=a(this.handles[l],this.element),n=0;n=/sw|ne|nw|se|n|s/.test(l)?o.outerHeight():o.outerWidth();o=["padding",/ne|nw|n/.test(l)?"Top":/se|sw|s/.test(l)?"Bottom":/^e$/.test(l)?"Right":"Left"].join("");j.css(o,n);this._proportionallyResize()}a(this.handles[l])}};this._renderAxis(this.element);this._handles=a(".ui-resizable-handle",this.element).disableSelection(); -this._handles.mouseover(function(){if(!e.resizing){if(this.className)var j=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);e.axis=j&&j[1]?j[1]:"se"}});if(h.autoHide){this._handles.hide();a(this.element).addClass("ui-resizable-autohide").hover(function(){if(!h.disabled){a(this).removeClass("ui-resizable-autohide");e._handles.show()}},function(){if(!h.disabled)if(!e.resizing){a(this).addClass("ui-resizable-autohide");e._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); -var e=function(g){a(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var h=this.element;h.after(this.originalElement.css({position:h.css("position"),width:h.outerWidth(),height:h.outerHeight(),top:h.css("top"),left:h.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(e){var h= -false;for(var g in this.handles)if(a(this.handles[g])[0]==e.target)h=true;return!this.options.disabled&&h},_mouseStart:function(e){var h=this.options,g=this.element.position(),i=this.element;this.resizing=true;this.documentScroll={top:a(document).scrollTop(),left:a(document).scrollLeft()};if(i.is(".ui-draggable")||/absolute/.test(i.css("position")))i.css({position:"absolute",top:g.top,left:g.left});a.browser.opera&&/relative/.test(i.css("position"))&&i.css({position:"relative",top:"auto",left:"auto"}); -this._renderProxy();g=d(this.helper.css("left"));var b=d(this.helper.css("top"));if(h.containment){g+=a(h.containment).scrollLeft()||0;b+=a(h.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:g,top:b};this.size=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalSize=this._helper?{width:i.outerWidth(),height:i.outerHeight()}:{width:i.width(),height:i.height()};this.originalPosition={left:g,top:b};this.sizeDiff= -{width:i.outerWidth()-i.width(),height:i.outerHeight()-i.height()};this.originalMousePosition={left:e.pageX,top:e.pageY};this.aspectRatio=typeof h.aspectRatio=="number"?h.aspectRatio:this.originalSize.width/this.originalSize.height||1;h=a(".ui-resizable-"+this.axis).css("cursor");a("body").css("cursor",h=="auto"?this.axis+"-resize":h);i.addClass("ui-resizable-resizing");this._propagate("start",e);return true},_mouseDrag:function(e){var h=this.helper,g=this.originalMousePosition,i=this._change[this.axis]; -if(!i)return false;g=i.apply(this,[e,e.pageX-g.left||0,e.pageY-g.top||0]);this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey)g=this._updateRatio(g,e);g=this._respectSize(g,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(g);this._trigger("resize",e,this.ui());return false}, -_mouseStop:function(e){this.resizing=false;var h=this.options,g=this;if(this._helper){var i=this._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName);i=b&&a.ui.hasScroll(i[0],"left")?0:g.sizeDiff.height;b=b?0:g.sizeDiff.width;b={width:g.helper.width()-b,height:g.helper.height()-i};i=parseInt(g.element.css("left"),10)+(g.position.left-g.originalPosition.left)||null;var f=parseInt(g.element.css("top"),10)+(g.position.top-g.originalPosition.top)||null;h.animate||this.element.css(a.extend(b, -{top:f,left:i}));g.helper.height(g.size.height);g.helper.width(g.size.width);this._helper&&!h.animate&&this._proportionallyResize()}a("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",e);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(e){var h=this.options,g,i,b;h={minWidth:c(h.minWidth)?h.minWidth:0,maxWidth:c(h.maxWidth)?h.maxWidth:Infinity,minHeight:c(h.minHeight)?h.minHeight:0,maxHeight:c(h.maxHeight)?h.maxHeight: -Infinity};if(this._aspectRatio||e){e=h.minHeight*this.aspectRatio;i=h.minWidth/this.aspectRatio;g=h.maxHeight*this.aspectRatio;b=h.maxWidth/this.aspectRatio;if(e>h.minWidth)h.minWidth=e;if(i>h.minHeight)h.minHeight=i;if(ge.width,j=c(e.height)&&h.minHeight&&h.minHeight>e.height;if(f)e.width=h.minWidth;if(j)e.height=h.minHeight;if(i)e.width=h.maxWidth;if(b)e.height=h.maxHeight;var l=this.originalPosition.left+this.originalSize.width,o=this.position.top+this.size.height,n=/sw|nw|w/.test(g);g=/nw|ne|n/.test(g);if(f&&n)e.left=l-h.minWidth;if(i&&n)e.left=l-h.maxWidth;if(j&&g)e.top=o-h.minHeight;if(b&&g)e.top=o-h.maxHeight;if((h=!e.width&&!e.height)&&!e.left&&e.top)e.top=null;else if(h&&!e.top&&e.left)e.left= -null;return e},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var e=this.helper||this.element,h=0;h
          ');var h=a.browser.msie&&a.browser.version<7,g=h?1:0;h=h?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ -h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++e.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(e,h){return{width:this.originalSize.width+h}},w:function(e,h){return{left:this.originalPosition.left+h,width:this.originalSize.width-h}},n:function(e,h,g){return{top:this.originalPosition.top+g,height:this.originalSize.height-g}},s:function(e,h,g){return{height:this.originalSize.height+ -g}},se:function(e,h,g){return a.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[e,h,g]))},sw:function(e,h,g){return a.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[e,h,g]))},ne:function(e,h,g){return a.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[e,h,g]))},nw:function(e,h,g){return a.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[e,h,g]))}},_propagate:function(e,h){a.ui.plugin.call(this,e,[h,this.ui()]); -e!="resize"&&this._trigger(e,h,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});a.extend(a.ui.resizable,{version:"1.8.16"});a.ui.plugin.add("resizable","alsoResize",{start:function(){var e=a(this).data("resizable").options,h=function(g){a(g).each(function(){var i=a(this);i.data("resizable-alsoresize",{width:parseInt(i.width(), -10),height:parseInt(i.height(),10),left:parseInt(i.css("left"),10),top:parseInt(i.css("top"),10),position:i.css("position")})})};if(typeof e.alsoResize=="object"&&!e.alsoResize.parentNode)if(e.alsoResize.length){e.alsoResize=e.alsoResize[0];h(e.alsoResize)}else a.each(e.alsoResize,function(g){h(g)});else h(e.alsoResize)},resize:function(e,h){var g=a(this).data("resizable");e=g.options;var i=g.originalSize,b=g.originalPosition,f={height:g.size.height-i.height||0,width:g.size.width-i.width||0,top:g.position.top- -b.top||0,left:g.position.left-b.left||0},j=function(l,o){a(l).each(function(){var n=a(this),k=a(this).data("resizable-alsoresize"),m={},p=o&&o.length?o:n.parents(h.originalElement[0]).length?["width","height"]:["width","height","top","left"];a.each(p,function(q,s){if((q=(k[s]||0)+(f[s]||0))&&q>=0)m[s]=q||null});if(a.browser.opera&&/relative/.test(n.css("position"))){g._revertToRelativePosition=true;n.css({position:"absolute",top:"auto",left:"auto"})}n.css(m)})};typeof e.alsoResize=="object"&&!e.alsoResize.nodeType? -a.each(e.alsoResize,function(l,o){j(l,o)}):j(e.alsoResize)},stop:function(){var e=a(this).data("resizable"),h=e.options,g=function(i){a(i).each(function(){var b=a(this);b.css({position:b.data("resizable-alsoresize").position})})};if(e._revertToRelativePosition){e._revertToRelativePosition=false;typeof h.alsoResize=="object"&&!h.alsoResize.nodeType?a.each(h.alsoResize,function(i){g(i)}):g(h.alsoResize)}a(this).removeData("resizable-alsoresize")}});a.ui.plugin.add("resizable","animate",{stop:function(e){var h= -a(this).data("resizable"),g=h.options,i=h._proportionallyResizeElements,b=i.length&&/textarea/i.test(i[0].nodeName),f=b&&a.ui.hasScroll(i[0],"left")?0:h.sizeDiff.height;b={width:h.size.width-(b?0:h.sizeDiff.width),height:h.size.height-f};f=parseInt(h.element.css("left"),10)+(h.position.left-h.originalPosition.left)||null;var j=parseInt(h.element.css("top"),10)+(h.position.top-h.originalPosition.top)||null;h.element.animate(a.extend(b,j&&f?{top:j,left:f}:{}),{duration:g.animateDuration,easing:g.animateEasing, -step:function(){var l={width:parseInt(h.element.css("width"),10),height:parseInt(h.element.css("height"),10),top:parseInt(h.element.css("top"),10),left:parseInt(h.element.css("left"),10)};i&&i.length&&a(i[0]).css({width:l.width,height:l.height});h._updateCache(l);h._propagate("resize",e)}})}});a.ui.plugin.add("resizable","containment",{start:function(){var e=a(this).data("resizable"),h=e.element,g=e.options.containment;if(h=g instanceof a?g.get(0):/parent/.test(g)?h.parent().get(0):g){e.containerElement= -a(h);if(/document/.test(g)||g==document){e.containerOffset={left:0,top:0};e.containerPosition={left:0,top:0};e.parentData={element:a(document),left:0,top:0,width:a(document).width(),height:a(document).height()||document.body.parentNode.scrollHeight}}else{var i=a(h),b=[];a(["Top","Right","Left","Bottom"]).each(function(l,o){b[l]=d(i.css("padding"+o))});e.containerOffset=i.offset();e.containerPosition=i.position();e.containerSize={height:i.innerHeight()-b[3],width:i.innerWidth()-b[1]};g=e.containerOffset; -var f=e.containerSize.height,j=e.containerSize.width;j=a.ui.hasScroll(h,"left")?h.scrollWidth:j;f=a.ui.hasScroll(h)?h.scrollHeight:f;e.parentData={element:h,left:g.left,top:g.top,width:j,height:f}}}},resize:function(e){var h=a(this).data("resizable"),g=h.options,i=h.containerOffset,b=h.position;e=h._aspectRatio||e.shiftKey;var f={top:0,left:0},j=h.containerElement;if(j[0]!=document&&/static/.test(j.css("position")))f=i;if(b.left<(h._helper?i.left:0)){h.size.width+=h._helper?h.position.left-i.left: -h.position.left-f.left;if(e)h.size.height=h.size.width/g.aspectRatio;h.position.left=g.helper?i.left:0}if(b.top<(h._helper?i.top:0)){h.size.height+=h._helper?h.position.top-i.top:h.position.top;if(e)h.size.width=h.size.height*g.aspectRatio;h.position.top=h._helper?i.top:0}h.offset.left=h.parentData.left+h.position.left;h.offset.top=h.parentData.top+h.position.top;g=Math.abs((h._helper?h.offset.left-f.left:h.offset.left-f.left)+h.sizeDiff.width);i=Math.abs((h._helper?h.offset.top-f.top:h.offset.top- -i.top)+h.sizeDiff.height);b=h.containerElement.get(0)==h.element.parent().get(0);f=/relative|absolute/.test(h.containerElement.css("position"));if(b&&f)g-=h.parentData.left;if(g+h.size.width>=h.parentData.width){h.size.width=h.parentData.width-g;if(e)h.size.height=h.size.width/h.aspectRatio}if(i+h.size.height>=h.parentData.height){h.size.height=h.parentData.height-i;if(e)h.size.width=h.size.height*h.aspectRatio}},stop:function(){var e=a(this).data("resizable"),h=e.options,g=e.containerOffset,i=e.containerPosition, -b=e.containerElement,f=a(e.helper),j=f.offset(),l=f.outerWidth()-e.sizeDiff.width;f=f.outerHeight()-e.sizeDiff.height;e._helper&&!h.animate&&/relative/.test(b.css("position"))&&a(this).css({left:j.left-i.left-g.left,width:l,height:f});e._helper&&!h.animate&&/static/.test(b.css("position"))&&a(this).css({left:j.left-i.left-g.left,width:l,height:f})}});a.ui.plugin.add("resizable","ghost",{start:function(){var e=a(this).data("resizable"),h=e.options,g=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25, -display:"block",position:"relative",height:g.height,width:g.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof h.ghost=="string"?h.ghost:"");e.ghost.appendTo(e.helper)},resize:function(){var e=a(this).data("resizable");e.ghost&&e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})},stop:function(){var e=a(this).data("resizable");e.ghost&&e.helper&&e.helper.get(0).removeChild(e.ghost.get(0))}});a.ui.plugin.add("resizable","grid",{resize:function(){var e= -a(this).data("resizable"),h=e.options,g=e.size,i=e.originalSize,b=e.originalPosition,f=e.axis;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var j=Math.round((g.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1);h=Math.round((g.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(f)){e.size.width=i.width+j;e.size.height=i.height+h}else if(/^(ne)$/.test(f)){e.size.width=i.width+j;e.size.height=i.height+h;e.position.top=b.top-h}else{if(/^(sw)$/.test(f)){e.size.width=i.width+j;e.size.height= -i.height+h}else{e.size.width=i.width+j;e.size.height=i.height+h;e.position.top=b.top-h}e.position.left=b.left-j}}});var d=function(e){return parseInt(e,10)||0},c=function(e){return!isNaN(parseInt(e,10))}})(jQuery); -(function(a){a.widget("ui.selectable",a.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var d=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(d.options.filter,d.element[0]);c.each(function(){var e=a(this),h=e.offset();a.data(this,"selectable-item",{element:this,$element:e,left:h.left,top:h.top,right:h.left+e.outerWidth(),bottom:h.top+e.outerHeight(),startselected:false,selected:e.hasClass("ui-selected"), -selecting:e.hasClass("ui-selecting"),unselecting:e.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a("
          ")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(d){var c=this;this.opos=[d.pageX, -d.pageY];if(!this.options.disabled){var e=this.options;this.selectees=a(e.filter,this.element[0]);this._trigger("start",d);a(e.appendTo).append(this.helper);this.helper.css({left:d.clientX,top:d.clientY,width:0,height:0});e.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var h=a.data(this,"selectable-item");h.startselected=true;if(!d.metaKey){h.$element.removeClass("ui-selected");h.selected=false;h.$element.addClass("ui-unselecting");h.unselecting=true;c._trigger("unselecting", -d,{unselecting:h.element})}});a(d.target).parents().andSelf().each(function(){var h=a.data(this,"selectable-item");if(h){var g=!d.metaKey||!h.$element.hasClass("ui-selected");h.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");h.unselecting=!g;h.selecting=g;(h.selected=g)?c._trigger("selecting",d,{selecting:h.element}):c._trigger("unselecting",d,{unselecting:h.element});return false}})}},_mouseDrag:function(d){var c=this;this.dragged=true;if(!this.options.disabled){var e= -this.options,h=this.opos[0],g=this.opos[1],i=d.pageX,b=d.pageY;if(h>i){var f=i;i=h;h=f}if(g>b){f=b;b=g;g=f}this.helper.css({left:h,top:g,width:i-h,height:b-g});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!(!j||j.element==c.element[0])){var l=false;if(e.tolerance=="touch")l=!(j.left>i||j.rightb||j.bottomh&&j.rightg&&j.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var d=this.options;this.containerCache={};this.element.addClass("ui-sortable"); -this.refresh();this.floating=this.items.length?d.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var d=this.items.length-1;d>=0;d--)this.items[d].item.removeData("sortable-item");return this},_setOption:function(d,c){if(d=== -"disabled"){this.options[d]=c;this.widget()[c?"addClass":"removeClass"]("ui-sortable-disabled")}else a.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(d,c){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(d);var e=null,h=this;a(d.target).parents().each(function(){if(a.data(this,"sortable-item")==h){e=a(this);return false}});if(a.data(d.target,"sortable-item")==h)e=a(d.target);if(!e)return false;if(this.options.handle&& -!c){var g=false;a(this.options.handle,e).find("*").andSelf().each(function(){if(this==d.target)g=true});if(!g)return false}this.currentItem=e;this._removeCurrentsFromItems();return true},_mouseStart:function(d,c,e){c=this.options;var h=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(d);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, -left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:d.pageX-this.offset.left,top:d.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(d);this.originalPageX=d.pageX;this.originalPageY=d.pageY;c.cursorAt&&this._adjustOffsetFromHelper(c.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; -this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();c.containment&&this._setContainment();if(c.cursor){if(a("body").css("cursor"))this._storedCursor=a("body").css("cursor");a("body").css("cursor",c.cursor)}if(c.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",c.opacity)}if(c.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",c.zIndex)}if(this.scrollParent[0]!= -document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",d,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!e)for(e=this.containers.length-1;e>=0;e--)this.containers[e]._trigger("activate",d,h._uiHash(this));if(a.ui.ddmanager)a.ui.ddmanager.current=this;a.ui.ddmanager&&!c.dropBehaviour&&a.ui.ddmanager.prepareOffsets(this,d);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(d); -return true},_mouseDrag:function(d){this.position=this._generatePosition(d);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var c=this.options,e=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-d.pageY=0;c--){e=this.items[c];var h=e.item[0],g=this._intersectsWithPointer(e);if(g)if(h!=this.currentItem[0]&&this.placeholder[g==1?"next":"prev"]()[0]!=h&&!a.ui.contains(this.placeholder[0],h)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0], -h):true)){this.direction=g==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e))this._rearrange(d,e);else break;this._trigger("change",d,this._uiHash());break}}this._contactContainers(d);a.ui.ddmanager&&a.ui.ddmanager.drag(this,d);this._trigger("sort",d,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(d,c){if(d){a.ui.ddmanager&&!this.options.dropBehaviour&&a.ui.ddmanager.drop(this,d);if(this.options.revert){var e=this;c=e.placeholder.offset(); -e.reverting=true;a(this.helper).animate({left:c.left-this.offset.parent.left-e.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:c.top-this.offset.parent.top-e.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){e._clear(d)})}else this._clear(d,c);return false}},cancel:function(){var d=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): -this.currentItem.show();for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,d._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,d._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();a.extend(this,{helper:null, -dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?a(this.domPosition.prev).after(this.currentItem):a(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(d){var c=this._getItemsAsjQuery(d&&d.connected),e=[];d=d||{};a(c).each(function(){var h=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||/(.+)[-=_](.+)/);if(h)e.push((d.key||h[1]+"[]")+"="+(d.key&&d.expression?h[1]:h[2]))});!e.length&&d.key&&e.push(d.key+"=");return e.join("&")}, -toArray:function(d){var c=this._getItemsAsjQuery(d&&d.connected),e=[];d=d||{};c.each(function(){e.push(a(d.item||this).attr(d.attribute||"id")||"")});return e},_intersectsWith:function(d){var c=this.positionAbs.left,e=c+this.helperProportions.width,h=this.positionAbs.top,g=h+this.helperProportions.height,i=d.left,b=i+d.width,f=d.top,j=f+d.height,l=this.offset.click.top,o=this.offset.click.left;l=h+l>f&&h+li&&c+od[this.floating?"width":"height"]?l:i0?"down":"up")},_getDragHorizontalDirection:function(){var d=this.positionAbs.left-this.lastPositionAbs.left;return d!=0&&(d>0?"right":"left")},refresh:function(d){this._refreshItems(d);this.refreshPositions();return this},_connectWith:function(){var d=this.options;return d.connectWith.constructor==String?[d.connectWith]:d.connectWith},_getItemsAsjQuery:function(d){var c=[],e=[],h=this._connectWith(); -if(h&&d)for(d=h.length-1;d>=0;d--)for(var g=a(h[d]),i=g.length-1;i>=0;i--){var b=a.data(g[i],"sortable");if(b&&b!=this&&!b.options.disabled)e.push([a.isFunction(b.options.items)?b.options.items.call(b.element):a(b.options.items,b.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),b])}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), -this]);for(d=e.length-1;d>=0;d--)e[d][0].each(function(){c.push(this)});return a(c)},_removeCurrentsFromItems:function(){for(var d=this.currentItem.find(":data(sortable-item)"),c=0;c=0;g--)for(var i=a(h[g]),b=i.length-1;b>=0;b--){var f=a.data(i[b],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element[0],d,{item:this.currentItem}):a(f.options.items,f.element),f]);this.containers.push(f)}}for(g=e.length-1;g>=0;g--){d=e[g][1];h=e[g][0];b=0;for(i=h.length;b=0;c--){var e=this.items[c];if(!(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0])){var h=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!d){e.width=h.outerWidth();e.height=h.outerHeight()}h=h.offset();e.left=h.left;e.top=h.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(c= -this.containers.length-1;c>=0;c--){h=this.containers[c].element.offset();this.containers[c].containerCache.left=h.left;this.containers[c].containerCache.top=h.top;this.containers[c].containerCache.width=this.containers[c].element.outerWidth();this.containers[c].containerCache.height=this.containers[c].element.outerHeight()}return this},_createPlaceholder:function(d){var c=d||this,e=c.options;if(!e.placeholder||e.placeholder.constructor==String){var h=e.placeholder;e.placeholder={element:function(){var g= -a(document.createElement(c.currentItem[0].nodeName)).addClass(h||c.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!h)g.style.visibility="hidden";return g},update:function(g,i){if(!(h&&!e.forcePlaceholderSize)){i.height()||i.height(c.currentItem.innerHeight()-parseInt(c.currentItem.css("paddingTop")||0,10)-parseInt(c.currentItem.css("paddingBottom")||0,10));i.width()||i.width(c.currentItem.innerWidth()-parseInt(c.currentItem.css("paddingLeft")||0,10)-parseInt(c.currentItem.css("paddingRight")|| -0,10))}}}}c.placeholder=a(e.placeholder.element.call(c.element,c.currentItem));c.currentItem.after(c.placeholder);e.placeholder.update(c,c.placeholder)},_contactContainers:function(d){for(var c=null,e=null,h=this.containers.length-1;h>=0;h--)if(!a.ui.contains(this.currentItem[0],this.containers[h].element[0]))if(this._intersectsWith(this.containers[h].containerCache)){if(!(c&&a.ui.contains(this.containers[h].element[0],c.element[0]))){c=this.containers[h];e=h}}else if(this.containers[h].containerCache.over){this.containers[h]._trigger("out", -d,this._uiHash(this));this.containers[h].containerCache.over=0}if(c)if(this.containers.length===1){this.containers[e]._trigger("over",d,this._uiHash(this));this.containers[e].containerCache.over=1}else if(this.currentContainer!=this.containers[e]){c=1E4;h=null;for(var g=this.positionAbs[this.containers[e].floating?"left":"top"],i=this.items.length-1;i>=0;i--)if(a.ui.contains(this.containers[e].element[0],this.items[i].item[0])){var b=this.items[i][this.containers[e].floating?"left":"top"];if(Math.abs(b- -g)this.containment[2])g=this.containment[2]+this.offset.click.left;if(d.pageY-this.offset.click.top>this.containment[3])i=this.containment[3]+this.offset.click.top}if(c.grid){i=this.originalPageY+Math.round((i- -this.originalPageY)/c.grid[1])*c.grid[1];i=this.containment?!(i-this.offset.click.topthis.containment[3])?i:!(i-this.offset.click.topthis.containment[2])?g:!(g-this.offset.click.left=0;h--)if(a.ui.contains(this.containers[h].element[0],this.currentItem[0])&&!c){e.push(function(g){return function(i){g._trigger("receive",i,this._uiHash(this))}}.call(this,this.containers[h]));e.push(function(g){return function(i){g._trigger("update",i,this._uiHash(this))}}.call(this,this.containers[h]))}}for(h=this.containers.length-1;h>=0;h--){c||e.push(function(g){return function(i){g._trigger("deactivate",i,this._uiHash(this))}}.call(this, -this.containers[h]));if(this.containers[h].containerCache.over){e.push(function(g){return function(i){g._trigger("out",i,this._uiHash(this))}}.call(this,this.containers[h]));this.containers[h].containerCache.over=0}}this._storedCursor&&a("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!c){this._trigger("beforeStop", -d,this._uiHash());for(h=0;h
        ").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), -p=document.activeElement;n.wrap(m);if(n[0]===p||a.contains(n[0],p))a(p).focus();m=n.parent();if(n.css("position")=="static"){m.css({position:"relative"});n.css({position:"relative"})}else{a.extend(k,{position:n.css("position"),zIndex:n.css("z-index")});a.each(["top","left","bottom","right"],function(q,s){k[s]=n.css(s);if(isNaN(parseInt(k[s],10)))k[s]="auto"});n.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return m.css(k).show()},removeWrapper:function(n){var k,m=document.activeElement; -if(n.parent().is(".ui-effects-wrapper")){k=n.parent().replaceWith(n);if(n[0]===m||a.contains(n[0],m))a(m).focus();return k}return n},setTransition:function(n,k,m,p){p=p||{};a.each(k,function(q,s){unit=n.cssUnit(s);if(unit[0]>0)p[s]=unit[0]*m+unit[1]});return p}});a.fn.extend({effect:function(n){var k=b.apply(this,arguments),m={options:k[1],duration:k[2],callback:k[3]};k=m.options.mode;var p=a.effects[n];if(a.fx.off||!p)return k?this[k](m.duration,m.callback):this.each(function(){m.callback&&m.callback.call(this)}); -return p.call(this,m)},_show:a.fn.show,show:function(n){if(f(n))return this._show.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="show";return this.effect.apply(this,k)}},_hide:a.fn.hide,hide:function(n){if(f(n))return this._hide.apply(this,arguments);else{var k=b.apply(this,arguments);k[1].mode="hide";return this.effect.apply(this,k)}},__toggle:a.fn.toggle,toggle:function(n){if(f(n)||typeof n==="boolean"||a.isFunction(n))return this.__toggle.apply(this,arguments);else{var k=b.apply(this, -arguments);k[1].mode="toggle";return this.effect.apply(this,k)}},cssUnit:function(n){var k=this.css(n),m=[];a.each(["em","px","%","pt"],function(p,q){if(k.indexOf(q)>0)m=[parseFloat(k),q]});return m}});a.easing.jswing=a.easing.swing;a.extend(a.easing,{def:"easeOutQuad",swing:function(n,k,m,p,q){return a.easing[a.easing.def](n,k,m,p,q)},easeInQuad:function(n,k,m,p,q){return p*(k/=q)*k+m},easeOutQuad:function(n,k,m,p,q){return-p*(k/=q)*(k-2)+m},easeInOutQuad:function(n,k,m,p,q){if((k/=q/2)<1)return p/ -2*k*k+m;return-p/2*(--k*(k-2)-1)+m},easeInCubic:function(n,k,m,p,q){return p*(k/=q)*k*k+m},easeOutCubic:function(n,k,m,p,q){return p*((k=k/q-1)*k*k+1)+m},easeInOutCubic:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k+m;return p/2*((k-=2)*k*k+2)+m},easeInQuart:function(n,k,m,p,q){return p*(k/=q)*k*k*k+m},easeOutQuart:function(n,k,m,p,q){return-p*((k=k/q-1)*k*k*k-1)+m},easeInOutQuart:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k+m;return-p/2*((k-=2)*k*k*k-2)+m},easeInQuint:function(n,k,m, -p,q){return p*(k/=q)*k*k*k*k+m},easeOutQuint:function(n,k,m,p,q){return p*((k=k/q-1)*k*k*k*k+1)+m},easeInOutQuint:function(n,k,m,p,q){if((k/=q/2)<1)return p/2*k*k*k*k*k+m;return p/2*((k-=2)*k*k*k*k+2)+m},easeInSine:function(n,k,m,p,q){return-p*Math.cos(k/q*(Math.PI/2))+p+m},easeOutSine:function(n,k,m,p,q){return p*Math.sin(k/q*(Math.PI/2))+m},easeInOutSine:function(n,k,m,p,q){return-p/2*(Math.cos(Math.PI*k/q)-1)+m},easeInExpo:function(n,k,m,p,q){return k==0?m:p*Math.pow(2,10*(k/q-1))+m},easeOutExpo:function(n, -k,m,p,q){return k==q?m+p:p*(-Math.pow(2,-10*k/q)+1)+m},easeInOutExpo:function(n,k,m,p,q){if(k==0)return m;if(k==q)return m+p;if((k/=q/2)<1)return p/2*Math.pow(2,10*(k-1))+m;return p/2*(-Math.pow(2,-10*--k)+2)+m},easeInCirc:function(n,k,m,p,q){return-p*(Math.sqrt(1-(k/=q)*k)-1)+m},easeOutCirc:function(n,k,m,p,q){return p*Math.sqrt(1-(k=k/q-1)*k)+m},easeInOutCirc:function(n,k,m,p,q){if((k/=q/2)<1)return-p/2*(Math.sqrt(1-k*k)-1)+m;return p/2*(Math.sqrt(1-(k-=2)*k)+1)+m},easeInElastic:function(n,k,m, -p,q){n=1.70158;var s=0,r=p;if(k==0)return m;if((k/=q)==1)return m+p;s||(s=q*0.3);if(r
        ").css({position:"absolute",visibility:"visible",left:-j*(i/e),top:-f*(b/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:i/e,height:b/c,left:g.left+j*(i/e)+(d.options.mode=="show"?(j-Math.floor(e/2))*(i/e):0),top:g.top+f*(b/c)+(d.options.mode=="show"?(f-Math.floor(c/2))*(b/c):0),opacity:d.options.mode=="show"?0:1}).animate({left:g.left+j*(i/e)+(d.options.mode=="show"?0:(j-Math.floor(e/2))*(i/e)),top:g.top+ -f*(b/c)+(d.options.mode=="show"?0:(f-Math.floor(c/2))*(b/c)),opacity:d.options.mode=="show"?1:0},d.duration||500);setTimeout(function(){d.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();d.callback&&d.callback.apply(h[0]);h.dequeue();a("div.ui-effects-explode").remove()},d.duration||500)})}})(jQuery); -(function(a){a.effects.fade=function(d){return this.queue(function(){var c=a(this),e=a.effects.setMode(c,d.options.mode||"hide");c.animate({opacity:e},{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -(function(a){a.effects.fold=function(d){return this.queue(function(){var c=a(this),e=["position","top","bottom","left","right"],h=a.effects.setMode(c,d.options.mode||"hide"),g=d.options.size||15,i=!!d.options.horizFirst,b=d.duration?d.duration/2:a.fx.speeds._default/2;a.effects.save(c,e);c.show();var f=a.effects.createWrapper(c).css({overflow:"hidden"}),j=h=="show"!=i,l=j?["width","height"]:["height","width"];j=j?[f.width(),f.height()]:[f.height(),f.width()];var o=/([0-9]+)%/.exec(g);if(o)g=parseInt(o[1], -10)/100*j[h=="hide"?0:1];if(h=="show")f.css(i?{height:0,width:g}:{height:g,width:0});i={};o={};i[l[0]]=h=="show"?j[0]:g;o[l[1]]=h=="show"?j[1]:0;f.animate(i,b,d.options.easing).animate(o,b,d.options.easing,function(){h=="hide"&&c.hide();a.effects.restore(c,e);a.effects.removeWrapper(c);d.callback&&d.callback.apply(c[0],arguments);c.dequeue()})})}})(jQuery); -(function(a){a.effects.highlight=function(d){return this.queue(function(){var c=a(this),e=["backgroundImage","backgroundColor","opacity"],h=a.effects.setMode(c,d.options.mode||"show"),g={backgroundColor:c.css("backgroundColor")};if(h=="hide")g.opacity=0;a.effects.save(c,e);c.show().css({backgroundImage:"none",backgroundColor:d.options.color||"#ffff99"}).animate(g,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){h=="hide"&&c.hide();a.effects.restore(c,e);h=="show"&&!a.support.opacity&& -this.style.removeAttribute("filter");d.callback&&d.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -(function(a){a.effects.pulsate=function(d){return this.queue(function(){var c=a(this),e=a.effects.setMode(c,d.options.mode||"show");times=(d.options.times||5)*2-1;duration=d.duration?d.duration/2:a.fx.speeds._default/2;isVisible=c.is(":visible");animateTo=0;if(!isVisible){c.css("opacity",0).show();animateTo=1}if(e=="hide"&&isVisible||e=="show"&&!isVisible)times--;for(e=0;e
        ').appendTo(document.body).addClass(d.options.className).css({top:h.top,left:h.left,height:c.innerHeight(),width:c.innerWidth(),position:"absolute"}).animate(e,d.duration,d.options.easing,function(){g.remove();d.callback&&d.callback.apply(c[0],arguments); -c.dequeue()})})}})(jQuery); -(function(a){a.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var d=this,c=d.options;d.running=0;d.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");d.headers= -d.element.find(c.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){c.disabled||a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){c.disabled||a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){c.disabled||a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){c.disabled||a(this).removeClass("ui-state-focus")});d.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); -if(c.navigation){var e=d.element.find("a").filter(c.navigationFilter).eq(0);if(e.length){var h=e.closest(".ui-accordion-header");d.active=h.length?h:e.closest(".ui-accordion-content").prev()}}d.active=d._findActive(d.active||c.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");d.active.next().addClass("ui-accordion-content-active");d._createIcons();d.resize();d.element.attr("role","tablist");d.headers.attr("role","tab").bind("keydown.accordion", -function(g){return d._keydown(g)}).next().attr("role","tabpanel");d.headers.not(d.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();d.active.length?d.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):d.headers.eq(0).attr("tabIndex",0);a.browser.safari||d.headers.find("a").attr("tabIndex",-1);c.event&&d.headers.bind(c.event.split(" ").join(".accordion ")+".accordion",function(g){d._clickHandler.call(d,g,this);g.preventDefault()})},_createIcons:function(){var d= -this.options;if(d.icons){a("").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var d=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); -this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var c=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(d.autoHeight||d.fillHeight)c.css("height","");return a.Widget.prototype.destroy.call(this)},_setOption:function(d,c){a.Widget.prototype._setOption.apply(this,arguments);d=="active"&&this.activate(c);if(d=="icons"){this._destroyIcons(); -c&&this._createIcons()}if(d=="disabled")this.headers.add(this.headers.next())[c?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(d){if(!(this.options.disabled||d.altKey||d.ctrlKey)){var c=a.ui.keyCode,e=this.headers.length,h=this.headers.index(d.target),g=false;switch(d.keyCode){case c.RIGHT:case c.DOWN:g=this.headers[(h+1)%e];break;case c.LEFT:case c.UP:g=this.headers[(h-1+e)%e];break;case c.SPACE:case c.ENTER:this._clickHandler({target:d.target},d.target); -d.preventDefault()}if(g){a(d.target).attr("tabIndex",-1);a(g).attr("tabIndex",0);g.focus();return false}return true}},resize:function(){var d=this.options,c;if(d.fillSpace){if(a.browser.msie){var e=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}c=this.element.parent().height();a.browser.msie&&this.element.parent().css("overflow",e);this.headers.each(function(){c-=a(this).outerHeight(true)});this.headers.next().each(function(){a(this).height(Math.max(0,c-a(this).innerHeight()+ -a(this).height()))}).css("overflow","auto")}else if(d.autoHeight){c=0;this.headers.next().each(function(){c=Math.max(c,a(this).height("").height())}).height(c)}return this},activate:function(d){this.options.active=d;d=this._findActive(d)[0];this._clickHandler({target:d},d);return this},_findActive:function(d){return d?typeof d==="number"?this.headers.filter(":eq("+d+")"):this.headers.not(this.headers.not(d)):d===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(d,c){var e=this.options; -if(!e.disabled)if(d.target){d=a(d.currentTarget||c);c=d[0]===this.active[0];e.active=e.collapsible&&c?false:this.headers.index(d);if(!(this.running||!e.collapsible&&c)){var h=this.active;f=d.next();i=this.active.next();b={options:e,newHeader:c&&e.collapsible?a([]):d,oldHeader:this.active,newContent:c&&e.collapsible?a([]):f,oldContent:i};var g=this.headers.index(this.active[0])>this.headers.index(d[0]);this.active=c?a([]):d;this._toggle(f,i,b,c,g);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(e.icons.headerSelected).addClass(e.icons.header); -if(!c){d.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(e.icons.header).addClass(e.icons.headerSelected);d.next().addClass("ui-accordion-content-active")}}}else if(e.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(e.icons.headerSelected).addClass(e.icons.header);this.active.next().addClass("ui-accordion-content-active");var i=this.active.next(), -b={options:e,newHeader:a([]),oldHeader:e.active,newContent:a([]),oldContent:i},f=this.active=a([]);this._toggle(f,i,b)}},_toggle:function(d,c,e,h,g){var i=this,b=i.options;i.toShow=d;i.toHide=c;i.data=e;var f=function(){if(i)return i._completed.apply(i,arguments)};i._trigger("changestart",null,i.data);i.running=c.size()===0?d.size():c.size();if(b.animated){e={};e=b.collapsible&&h?{toShow:a([]),toHide:c,complete:f,down:g,autoHeight:b.autoHeight||b.fillSpace}:{toShow:d,toHide:c,complete:f,down:g,autoHeight:b.autoHeight|| -b.fillSpace};if(!b.proxied)b.proxied=b.animated;if(!b.proxiedDuration)b.proxiedDuration=b.duration;b.animated=a.isFunction(b.proxied)?b.proxied(e):b.proxied;b.duration=a.isFunction(b.proxiedDuration)?b.proxiedDuration(e):b.proxiedDuration;h=a.ui.accordion.animations;var j=b.duration,l=b.animated;if(l&&!h[l]&&!a.easing[l])l="slide";h[l]||(h[l]=function(o){this.slide(o,{easing:l,duration:j||700})});h[l](e)}else{if(b.collapsible&&h)d.toggle();else{c.hide();d.show()}f(true)}c.prev().attr({"aria-expanded":"false", -"aria-selected":"false",tabIndex:-1}).blur();d.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(d){this.running=d?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});a.extend(a.ui.accordion,{version:"1.8.16", -animations:{slide:function(d,c){d=a.extend({easing:"swing",duration:300},d,c);if(d.toHide.size())if(d.toShow.size()){var e=d.toShow.css("overflow"),h=0,g={},i={},b;c=d.toShow;b=c[0].style.width;c.width(parseInt(c.parent().width(),10)-parseInt(c.css("paddingLeft"),10)-parseInt(c.css("paddingRight"),10)-(parseInt(c.css("borderLeftWidth"),10)||0)-(parseInt(c.css("borderRightWidth"),10)||0));a.each(["height","paddingTop","paddingBottom"],function(f,j){i[j]="hide";f=(""+a.css(d.toShow[0],j)).match(/^([\d+-.]+)(.*)$/); -g[j]={value:f[1],unit:f[2]||"px"}});d.toShow.css({height:0,overflow:"hidden"}).show();d.toHide.filter(":hidden").each(d.complete).end().filter(":visible").animate(i,{step:function(f,j){if(j.prop=="height")h=j.end-j.start===0?0:(j.now-j.start)/(j.end-j.start);d.toShow[0].style[j.prop]=h*g[j.prop].value+g[j.prop].unit},duration:d.duration,easing:d.easing,complete:function(){d.autoHeight||d.toShow.css("height","");d.toShow.css({width:b,overflow:e});d.complete()}})}else d.toHide.animate({height:"hide", -paddingTop:"hide",paddingBottom:"hide"},d);else d.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},d)},bounceslide:function(d){this.slide(d,{easing:d.down?"easeOutBounce":"swing",duration:d.down?1E3:200})}}})})(jQuery); -(function(a){var d=0;a.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var c=this,e=this.element[0].ownerDocument,h;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(g){if(!(c.options.disabled||c.element.propAttr("readOnly"))){h= -false;var i=a.ui.keyCode;switch(g.keyCode){case i.PAGE_UP:c._move("previousPage",g);break;case i.PAGE_DOWN:c._move("nextPage",g);break;case i.UP:c._move("previous",g);g.preventDefault();break;case i.DOWN:c._move("next",g);g.preventDefault();break;case i.ENTER:case i.NUMPAD_ENTER:if(c.menu.active){h=true;g.preventDefault()}case i.TAB:if(!c.menu.active)return;c.menu.select(g);break;case i.ESCAPE:c.element.val(c.term);c.close(g);break;default:clearTimeout(c.searching);c.searching=setTimeout(function(){if(c.term!= -c.element.val()){c.selectedItem=null;c.search(null,g)}},c.options.delay);break}}}).bind("keypress.autocomplete",function(g){if(h){h=false;g.preventDefault()}}).bind("focus.autocomplete",function(){if(!c.options.disabled){c.selectedItem=null;c.previous=c.element.val()}}).bind("blur.autocomplete",function(g){if(!c.options.disabled){clearTimeout(c.searching);c.closing=setTimeout(function(){c.close(g);c._change(g)},150)}});this._initSource();this.response=function(){return c._response.apply(c,arguments)}; -this.menu=a("
          ").addClass("ui-autocomplete").appendTo(a(this.options.appendTo||"body",e)[0]).mousedown(function(g){var i=c.menu.element[0];a(g.target).closest(".ui-menu-item").length||setTimeout(function(){a(document).one("mousedown",function(b){b.target!==c.element[0]&&b.target!==i&&!a.ui.contains(i,b.target)&&c.close()})},1);setTimeout(function(){clearTimeout(c.closing)},13)}).menu({focus:function(g,i){i=i.item.data("item.autocomplete");false!==c._trigger("focus",g,{item:i})&&/^key/.test(g.originalEvent.type)&& -c.element.val(i.value)},selected:function(g,i){var b=i.item.data("item.autocomplete"),f=c.previous;if(c.element[0]!==e.activeElement){c.element.focus();c.previous=f;setTimeout(function(){c.previous=f;c.selectedItem=b},1)}false!==c._trigger("select",g,{item:b})&&c.element.val(b.value);c.term=c.element.val();c.close(g);c.selectedItem=b},blur:function(){c.menu.element.is(":visible")&&c.element.val()!==c.term&&c.element.val(c.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); -a.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();a.Widget.prototype.destroy.call(this)},_setOption:function(c,e){a.Widget.prototype._setOption.apply(this,arguments);c==="source"&&this._initSource();if(c==="appendTo")this.menu.element.appendTo(a(e||"body",this.element[0].ownerDocument)[0]);c==="disabled"&& -e&&this.xhr&&this.xhr.abort()},_initSource:function(){var c=this,e,h;if(a.isArray(this.options.source)){e=this.options.source;this.source=function(g,i){i(a.ui.autocomplete.filter(e,g.term))}}else if(typeof this.options.source==="string"){h=this.options.source;this.source=function(g,i){c.xhr&&c.xhr.abort();c.xhr=a.ajax({url:h,data:g,dataType:"json",autocompleteRequest:++d,success:function(b){this.autocompleteRequest===d&&i(b)},error:function(){this.autocompleteRequest===d&&i([])}})}}else this.source= -this.options.source},search:function(c,e){c=c!=null?c:this.element.val();this.term=this.element.val();if(c.length
        • ").data("item.autocomplete",e).append(a("").text(e.label)).appendTo(c)},_move:function(c,e){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(c)||this.menu.last()&&/^next/.test(c)){this.element.val(this.term);this.menu.deactivate()}else this.menu[c](e);else this.search(null,e)},widget:function(){return this.menu.element}});a.extend(a.ui.autocomplete,{escapeRegex:function(c){return c.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, -"\\$&")},filter:function(c,e){var h=new RegExp(a.ui.autocomplete.escapeRegex(e),"i");return a.grep(c,function(g){return h.test(g.label||g.value||g)})}})})(jQuery); -(function(a){a.widget("ui.menu",{_create:function(){var d=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(c){if(a(c.target).closest(".ui-menu-item a").length){c.preventDefault();d.select(c)}});this.refresh()},refresh:function(){var d=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", --1).mouseenter(function(c){d.activate(c,a(this).parent())}).mouseleave(function(){d.deactivate()})},activate:function(d,c){this.deactivate();if(this.hasScroll()){var e=c.offset().top-this.element.offset().top,h=this.element.scrollTop(),g=this.element.height();if(e<0)this.element.scrollTop(h+e);else e>=g&&this.element.scrollTop(h+e-g+c.height())}this.active=c.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",d,{item:c})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); -this._trigger("blur");this.active=null}},next:function(d){this.move("next",".ui-menu-item:first",d)},previous:function(d){this.move("prev",".ui-menu-item:last",d)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(d,c,e){if(this.active){d=this.active[d+"All"](".ui-menu-item").eq(0);d.length?this.activate(e,d):this.activate(e,this.element.children(c))}else this.activate(e, -this.element.children(c))},nextPage:function(d){if(this.hasScroll())if(!this.active||this.last())this.activate(d,this.element.children(".ui-menu-item:first"));else{var c=this.active.offset().top,e=this.element.height(),h=this.element.children(".ui-menu-item").filter(function(){var g=a(this).offset().top-c-e+a(this).height();return g<10&&g>-10});h.length||(h=this.element.children(".ui-menu-item:last"));this.activate(d,h)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active|| -this.last()?":first":":last"))},previousPage:function(d){if(this.hasScroll())if(!this.active||this.first())this.activate(d,this.element.children(".ui-menu-item:last"));else{var c=this.active.offset().top,e=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var h=a(this).offset().top-c+e-a(this).height();return h<10&&h>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(d,result)}else this.activate(d,this.element.children(".ui-menu-item").filter(!this.active|| -this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),j=this.options.icons,l=j.primary&&j.secondary,o=[];if(j.primary||j.secondary){if(this.options.text)o.push("ui-button-text-icon"+(l?"s":j.primary?"-primary":"-secondary"));j.primary&&b.prepend("");j.secondary&&b.append("");if(!this.options.text){o.push(l?"ui-button-icons-only": -"ui-button-icon-only");this.hasTitle||b.attr("title",f)}}else o.push("ui-button-text-only");b.addClass(o.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,f){b==="disabled"&&this.buttons.button("option",b,f);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var b=this.element.css("direction")=== -"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(b?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(b?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); -a.Widget.prototype.destroy.call(this)}})})(jQuery); -(function(a,d){function c(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= -"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", -"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", -minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false,disabled:false};a.extend(this._defaults,this.regional[""]);this.dpDiv=e(a('
          '))}function e(b){return b.bind("mouseout", -function(f){f=a(f.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");f.length&&f.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(f){f=a(f.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(a.datepicker._isDisabledDatepicker(i.inline?b.parent()[0]:i.input[0])||!f.length)){f.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); -f.addClass("ui-state-hover");f.hasClass("ui-datepicker-prev")&&f.addClass("ui-datepicker-prev-hover");f.hasClass("ui-datepicker-next")&&f.addClass("ui-datepicker-next-hover")}})}function h(b,f){a.extend(b,f);for(var j in f)if(f[j]==null||f[j]==d)b[j]=f[j];return b}a.extend(a.ui,{datepicker:{version:"1.8.16"}});var g=(new Date).getTime(),i;a.extend(c.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, -setDefaults:function(b){h(this._defaults,b||{});return this},_attachDatepicker:function(b,f){var j=null;for(var l in this._defaults){var o=b.getAttribute("date:"+l);if(o){j=j||{};try{j[l]=eval(o)}catch(n){j[l]=o}}}l=b.nodeName.toLowerCase();o=l=="div"||l=="span";if(!b.id){this.uuid+=1;b.id="dp"+this.uuid}var k=this._newInst(a(b),o);k.settings=a.extend({},f||{},j||{});if(l=="input")this._connectDatepicker(b,k);else o&&this._inlineDatepicker(b,k)},_newInst:function(b,f){return{id:b[0].id.replace(/([^A-Za-z0-9_-])/g, -"\\\\$1"),input:b,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:f,dpDiv:!f?this.dpDiv:e(a('
          '))}},_connectDatepicker:function(b,f){var j=a(b);f.append=a([]);f.trigger=a([]);if(!j.hasClass(this.markerClassName)){this._attachments(j,f);j.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", -function(l,o,n){f.settings[o]=n}).bind("getData.datepicker",function(l,o){return this._get(f,o)});this._autoSize(f);a.data(b,"datepicker",f);f.settings.disabled&&this._disableDatepicker(b)}},_attachments:function(b,f){var j=this._get(f,"appendText"),l=this._get(f,"isRTL");f.append&&f.append.remove();if(j){f.append=a(''+j+"");b[l?"before":"after"](f.append)}b.unbind("focus",this._showDatepicker);f.trigger&&f.trigger.remove();j=this._get(f,"showOn");if(j== -"focus"||j=="both")b.focus(this._showDatepicker);if(j=="button"||j=="both"){j=this._get(f,"buttonText");var o=this._get(f,"buttonImage");f.trigger=a(this._get(f,"buttonImageOnly")?a("").addClass(this._triggerClass).attr({src:o,alt:j,title:j}):a('').addClass(this._triggerClass).html(o==""?j:a("").attr({src:o,alt:j,title:j})));b[l?"before":"after"](f.trigger);f.trigger.click(function(){a.datepicker._datepickerShowing&&a.datepicker._lastInput==b[0]?a.datepicker._hideDatepicker(): -a.datepicker._showDatepicker(b[0]);return false})}},_autoSize:function(b){if(this._get(b,"autoSize")&&!b.inline){var f=new Date(2009,11,20),j=this._get(b,"dateFormat");if(j.match(/[DM]/)){var l=function(o){for(var n=0,k=0,m=0;mn){n=o[m].length;k=m}return k};f.setMonth(l(this._get(b,j.match(/MM/)?"monthNames":"monthNamesShort")));f.setDate(l(this._get(b,j.match(/DD/)?"dayNames":"dayNamesShort"))+20-f.getDay())}b.input.attr("size",this._formatDate(b,f).length)}},_inlineDatepicker:function(b, -f){var j=a(b);if(!j.hasClass(this.markerClassName)){j.addClass(this.markerClassName).append(f.dpDiv).bind("setData.datepicker",function(l,o,n){f.settings[o]=n}).bind("getData.datepicker",function(l,o){return this._get(f,o)});a.data(b,"datepicker",f);this._setDate(f,this._getDefaultDate(f),true);this._updateDatepicker(f);this._updateAlternate(f);f.settings.disabled&&this._disableDatepicker(b);f.dpDiv.css("display","block")}},_dialogDatepicker:function(b,f,j,l,o){b=this._dialogInst;if(!b){this.uuid+= -1;this._dialogInput=a('');this._dialogInput.keydown(this._doKeyDown);a("body").append(this._dialogInput);b=this._dialogInst=this._newInst(this._dialogInput,false);b.settings={};a.data(this._dialogInput[0],"datepicker",b)}h(b.settings,l||{});f=f&&f.constructor==Date?this._formatDate(b,f):f;this._dialogInput.val(f);this._pos=o?o.length?o:[o.pageX,o.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ -2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");b.settings.onSelect=j;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);a.blockUI&&a.blockUI(this.dpDiv);a.data(this._dialogInput[0],"datepicker",b);return this},_destroyDatepicker:function(b){var f= -a(b),j=a.data(b,"datepicker");if(f.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();a.removeData(b,"datepicker");if(l=="input"){j.append.remove();j.trigger.remove();f.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(l=="div"||l=="span")f.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(b){var f=a(b),j=a.data(b,"datepicker");if(f.hasClass(this.markerClassName)){var l= -b.nodeName.toLowerCase();if(l=="input"){b.disabled=false;j.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(l=="div"||l=="span"){f=f.children("."+this._inlineClass);f.children().removeClass("ui-state-disabled");f.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o==b?null:o})}},_disableDatepicker:function(b){var f=a(b),j=a.data(b, -"datepicker");if(f.hasClass(this.markerClassName)){var l=b.nodeName.toLowerCase();if(l=="input"){b.disabled=true;j.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(l=="div"||l=="span"){f=f.children("."+this._inlineClass);f.children().addClass("ui-state-disabled");f.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=a.map(this._disabledInputs,function(o){return o== -b?null:o});this._disabledInputs[this._disabledInputs.length]=b}},_isDisabledDatepicker:function(b){if(!b)return false;for(var f=0;f-1}},_doKeyUp:function(b){b=a.datepicker._getInst(b.target);if(b.input.val()!=b.lastVal)try{if(a.datepicker.parseDate(a.datepicker._get(b,"dateFormat"),b.input?b.input.val():null,a.datepicker._getFormatConfig(b))){a.datepicker._setDateFromField(b);a.datepicker._updateAlternate(b);a.datepicker._updateDatepicker(b)}}catch(f){a.datepicker.log(f)}return true},_showDatepicker:function(b){b=b.target||b;if(b.nodeName.toLowerCase()!="input")b=a("input", -b.parentNode)[0];if(!(a.datepicker._isDisabledDatepicker(b)||a.datepicker._lastInput==b)){var f=a.datepicker._getInst(b);if(a.datepicker._curInst&&a.datepicker._curInst!=f){a.datepicker._datepickerShowing&&a.datepicker._triggerOnClose(a.datepicker._curInst);a.datepicker._curInst.dpDiv.stop(true,true)}var j=a.datepicker._get(f,"beforeShow");j=j?j.apply(b,[b,f]):{};if(j!==false){h(f.settings,j);f.lastVal=null;a.datepicker._lastInput=b;a.datepicker._setDateFromField(f);if(a.datepicker._inDialog)b.value= -"";if(!a.datepicker._pos){a.datepicker._pos=a.datepicker._findPos(b);a.datepicker._pos[1]+=b.offsetHeight}var l=false;a(b).parents().each(function(){l|=a(this).css("position")=="fixed";return!l});if(l&&a.browser.opera){a.datepicker._pos[0]-=document.documentElement.scrollLeft;a.datepicker._pos[1]-=document.documentElement.scrollTop}j={left:a.datepicker._pos[0],top:a.datepicker._pos[1]};a.datepicker._pos=null;f.dpDiv.empty();f.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});a.datepicker._updateDatepicker(f); -j=a.datepicker._checkOffset(f,j,l);f.dpDiv.css({position:a.datepicker._inDialog&&a.blockUI?"static":l?"fixed":"absolute",display:"none",left:j.left+"px",top:j.top+"px"});if(!f.inline){j=a.datepicker._get(f,"showAnim");var o=a.datepicker._get(f,"duration"),n=function(){var k=f.dpDiv.find("iframe.ui-datepicker-cover");if(k.length){var m=a.datepicker._getBorders(f.dpDiv);k.css({left:-m[0],top:-m[1],width:f.dpDiv.outerWidth(),height:f.dpDiv.outerHeight()})}};f.dpDiv.zIndex(a(b).zIndex()+1);a.datepicker._datepickerShowing= -true;a.effects&&a.effects[j]?f.dpDiv.show(j,a.datepicker._get(f,"showOptions"),o,n):f.dpDiv[j||"show"](j?o:null,n);if(!j||!o)n();f.input.is(":visible")&&!f.input.is(":disabled")&&f.input.focus();a.datepicker._curInst=f}}}},_updateDatepicker:function(b){this.maxRows=4;var f=a.datepicker._getBorders(b.dpDiv);i=b;b.dpDiv.empty().append(this._generateHTML(b));var j=b.dpDiv.find("iframe.ui-datepicker-cover");j.length&&j.css({left:-f[0],top:-f[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()}); -b.dpDiv.find("."+this._dayOverClass+" a").mouseover();f=this._getNumberOfMonths(b);j=f[1];b.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");j>1&&b.dpDiv.addClass("ui-datepicker-multi-"+j).css("width",17*j+"em");b.dpDiv[(f[0]!=1||f[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");b.dpDiv[(this._get(b,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");b==a.datepicker._curInst&&a.datepicker._datepickerShowing&&b.input&&b.input.is(":visible")&& -!b.input.is(":disabled")&&b.input[0]!=document.activeElement&&b.input.focus();if(b.yearshtml){var l=b.yearshtml;setTimeout(function(){l===b.yearshtml&&b.yearshtml&&b.dpDiv.find("select.ui-datepicker-year:first").replaceWith(b.yearshtml);l=b.yearshtml=null},0)}},_getBorders:function(b){var f=function(j){return{thin:1,medium:2,thick:3}[j]||j};return[parseFloat(f(b.css("border-left-width"))),parseFloat(f(b.css("border-top-width")))]},_checkOffset:function(b,f,j){var l=b.dpDiv.outerWidth(),o=b.dpDiv.outerHeight(), -n=b.input?b.input.outerWidth():0,k=b.input?b.input.outerHeight():0,m=document.documentElement.clientWidth+a(document).scrollLeft(),p=document.documentElement.clientHeight+a(document).scrollTop();f.left-=this._get(b,"isRTL")?l-n:0;f.left-=j&&f.left==b.input.offset().left?a(document).scrollLeft():0;f.top-=j&&f.top==b.input.offset().top+k?a(document).scrollTop():0;f.left-=Math.min(f.left,f.left+l>m&&m>l?Math.abs(f.left+l-m):0);f.top-=Math.min(f.top,f.top+o>p&&p>o?Math.abs(o+k):0);return f},_findPos:function(b){for(var f= -this._get(this._getInst(b),"isRTL");b&&(b.type=="hidden"||b.nodeType!=1||a.expr.filters.hidden(b));)b=b[f?"previousSibling":"nextSibling"];b=a(b).offset();return[b.left,b.top]},_triggerOnClose:function(b){var f=this._get(b,"onClose");if(f)f.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b])},_hideDatepicker:function(b){var f=this._curInst;if(!(!f||b&&f!=a.data(b,"datepicker")))if(this._datepickerShowing){b=this._get(f,"showAnim");var j=this._get(f,"duration"),l=function(){a.datepicker._tidyDialog(f); -this._curInst=null};a.effects&&a.effects[b]?f.dpDiv.hide(b,a.datepicker._get(f,"showOptions"),j,l):f.dpDiv[b=="slideDown"?"slideUp":b=="fadeIn"?"fadeOut":"hide"](b?j:null,l);b||l();a.datepicker._triggerOnClose(f);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(a.blockUI){a.unblockUI();a("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(b){b.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, -_checkExternalClick:function(b){if(a.datepicker._curInst){b=a(b.target);b[0].id!=a.datepicker._mainDivId&&b.parents("#"+a.datepicker._mainDivId).length==0&&!b.hasClass(a.datepicker.markerClassName)&&!b.hasClass(a.datepicker._triggerClass)&&a.datepicker._datepickerShowing&&!(a.datepicker._inDialog&&a.blockUI)&&a.datepicker._hideDatepicker()}},_adjustDate:function(b,f,j){b=a(b);var l=this._getInst(b[0]);if(!this._isDisabledDatepicker(b[0])){this._adjustInstDate(l,f+(j=="M"?this._get(l,"showCurrentAtPos"): -0),j);this._updateDatepicker(l)}},_gotoToday:function(b){b=a(b);var f=this._getInst(b[0]);if(this._get(f,"gotoCurrent")&&f.currentDay){f.selectedDay=f.currentDay;f.drawMonth=f.selectedMonth=f.currentMonth;f.drawYear=f.selectedYear=f.currentYear}else{var j=new Date;f.selectedDay=j.getDate();f.drawMonth=f.selectedMonth=j.getMonth();f.drawYear=f.selectedYear=j.getFullYear()}this._notifyChange(f);this._adjustDate(b)},_selectMonthYear:function(b,f,j){b=a(b);var l=this._getInst(b[0]);l["selected"+(j=="M"? -"Month":"Year")]=l["draw"+(j=="M"?"Month":"Year")]=parseInt(f.options[f.selectedIndex].value,10);this._notifyChange(l);this._adjustDate(b)},_selectDay:function(b,f,j,l){var o=a(b);if(!(a(l).hasClass(this._unselectableClass)||this._isDisabledDatepicker(o[0]))){o=this._getInst(o[0]);o.selectedDay=o.currentDay=a("a",l).html();o.selectedMonth=o.currentMonth=f;o.selectedYear=o.currentYear=j;this._selectDate(b,this._formatDate(o,o.currentDay,o.currentMonth,o.currentYear))}},_clearDate:function(b){b=a(b); -this._getInst(b[0]);this._selectDate(b,"")},_selectDate:function(b,f){b=this._getInst(a(b)[0]);f=f!=null?f:this._formatDate(b);b.input&&b.input.val(f);this._updateAlternate(b);var j=this._get(b,"onSelect");if(j)j.apply(b.input?b.input[0]:null,[f,b]);else b.input&&b.input.trigger("change");if(b.inline)this._updateDatepicker(b);else{this._hideDatepicker();this._lastInput=b.input[0];typeof b.input[0]!="object"&&b.input.focus();this._lastInput=null}},_updateAlternate:function(b){var f=this._get(b,"altField"); -if(f){var j=this._get(b,"altFormat")||this._get(b,"dateFormat"),l=this._getDate(b),o=this.formatDate(j,l,this._getFormatConfig(b));a(f).each(function(){a(this).val(o)})}},noWeekends:function(b){b=b.getDay();return[b>0&&b<6,""]},iso8601Week:function(b){b=new Date(b.getTime());b.setDate(b.getDate()+4-(b.getDay()||7));var f=b.getTime();b.setMonth(0);b.setDate(1);return Math.floor(Math.round((f-b)/864E5)/7)+1},parseDate:function(b,f,j){if(b==null||f==null)throw"Invalid arguments";f=typeof f=="object"? -f.toString():f+"";if(f=="")return null;var l=(j?j.shortYearCutoff:null)||this._defaults.shortYearCutoff;l=typeof l!="string"?l:(new Date).getFullYear()%100+parseInt(l,10);for(var o=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,n=(j?j.dayNames:null)||this._defaults.dayNames,k=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort,m=(j?j.monthNames:null)||this._defaults.monthNames,p=j=-1,q=-1,s=-1,r=false,u=function(z){(z=H+1-1){p=1;q=s;do{l=this._getDaysInMonth(j,p-1);if(q<=l)break;p++;q-=l}while(1)}C=this._daylightSavingAdjust(new Date(j,p-1,q));if(C.getFullYear()!=j||C.getMonth()+1!=p||C.getDate()!=q)throw"Invalid date";return C},ATOM:"yy-mm-dd", -COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(b,f,j){if(!f)return"";var l=(j?j.dayNamesShort:null)||this._defaults.dayNamesShort,o=(j?j.dayNames:null)||this._defaults.dayNames,n=(j?j.monthNamesShort:null)||this._defaults.monthNamesShort;j=(j?j.monthNames: -null)||this._defaults.monthNames;var k=function(u){(u=r+1 -12?b.getHours()+2:0);return b},_setDate:function(b,f,j){var l=!f,o=b.selectedMonth,n=b.selectedYear;f=this._restrictMinMax(b,this._determineDate(b,f,new Date));b.selectedDay=b.currentDay=f.getDate();b.drawMonth=b.selectedMonth=b.currentMonth=f.getMonth();b.drawYear=b.selectedYear=b.currentYear=f.getFullYear();if((o!=b.selectedMonth||n!=b.selectedYear)&&!j)this._notifyChange(b);this._adjustInstDate(b);if(b.input)b.input.val(l?"":this._formatDate(b))},_getDate:function(b){return!b.currentYear||b.input&& -b.input.val()==""?null:this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay))},_generateHTML:function(b){var f=new Date;f=this._daylightSavingAdjust(new Date(f.getFullYear(),f.getMonth(),f.getDate()));var j=this._get(b,"isRTL"),l=this._get(b,"showButtonPanel"),o=this._get(b,"hideIfNoPrevNext"),n=this._get(b,"navigationAsDateFormat"),k=this._getNumberOfMonths(b),m=this._get(b,"showCurrentAtPos"),p=this._get(b,"stepMonths"),q=k[0]!=1||k[1]!=1,s=this._daylightSavingAdjust(!b.currentDay? -new Date(9999,9,9):new Date(b.currentYear,b.currentMonth,b.currentDay)),r=this._getMinMaxDate(b,"min"),u=this._getMinMaxDate(b,"max");m=b.drawMonth-m;var v=b.drawYear;if(m<0){m+=12;v--}if(u){var w=this._daylightSavingAdjust(new Date(u.getFullYear(),u.getMonth()-k[0]*k[1]+1,u.getDate()));for(w=r&&ww;){m--;if(m<0){m=11;v--}}}b.drawMonth=m;b.drawYear=v;w=this._get(b,"prevText");w=!n?w:this.formatDate(w,this._daylightSavingAdjust(new Date(v,m-p,1)),this._getFormatConfig(b)); -w=this._canAdjustMonth(b,-1,v,m)?''+w+"":o?"":''+w+"";var x=this._get(b,"nextText");x=!n?x:this.formatDate(x,this._daylightSavingAdjust(new Date(v, -m+p,1)),this._getFormatConfig(b));o=this._canAdjustMonth(b,+1,v,m)?''+x+"":o?"":''+x+"";p=this._get(b,"currentText");x=this._get(b,"gotoCurrent")&& -b.currentDay?s:f;p=!n?p:this.formatDate(p,x,this._getFormatConfig(b));n=!b.inline?'":"";l=l?'
          '+(j?n:"")+(this._isInRange(b,x)?'":"")+(j?"":n)+"
          ":"";n=parseInt(this._get(b,"firstDay"),10);n=isNaN(n)?0:n;p=this._get(b,"showWeek");x=this._get(b,"dayNames");this._get(b,"dayNamesShort");var y=this._get(b,"dayNamesMin"),H=this._get(b,"monthNames"),C=this._get(b,"monthNamesShort"),z=this._get(b,"beforeShowDay"),I=this._get(b,"showOtherMonths"),N=this._get(b,"selectOtherMonths");this._get(b,"calculateWeek");for(var J=this._getDefaultDate(b),D="",E=0;E1)switch(L){case 0:F+=" ui-datepicker-group-first";B=" ui-corner-"+(j?"right":"left");break;case k[1]-1:F+=" ui-datepicker-group-last";B=" ui-corner-"+(j?"left":"right");break;default:F+=" ui-datepicker-group-middle";B="";break}F+='">'}F+='
          '+(/all|left/.test(B)&& -E==0?j?o:w:"")+(/all|right/.test(B)&&E==0?j?w:o:"")+this._generateMonthYearHeader(b,m,v,r,u,E>0||L>0,H,C)+'
          ';var G=p?'":"";for(B=0;B<7;B++){var A=(B+n)%7;G+="=5?' class="ui-datepicker-week-end"':"")+'>'+y[A]+""}F+=G+"";G=this._getDaysInMonth(v,m);if(v==b.selectedYear&&m==b.selectedMonth)b.selectedDay=Math.min(b.selectedDay, -G);B=(this._getFirstDayOfMonth(v,m)-n+7)%7;G=Math.ceil((B+G)/7);this.maxRows=G=q?this.maxRows>G?this.maxRows:G:G;A=this._daylightSavingAdjust(new Date(v,m,1-B));for(var R=0;R";var S=!p?"":'";for(B=0;B<7;B++){var M=z?z.apply(b.input?b.input[0]:null,[A]):[true,""],K=A.getMonth()!=m,O=K&&!N||!M[0]||r&&Au;S+='";A.setDate(A.getDate()+1);A=this._daylightSavingAdjust(A)}F+=S+""}m++;if(m>11){m=0;v++}F+="
          '+this._get(b,"weekHeader")+"
          '+this._get(b,"calculateWeek")(A)+""+(K&&!I?" ":O?''+ -A.getDate()+"":''+A.getDate()+"")+"
          "+(q?"
        "+(k[0]>0&&L==k[1]-1?'
        ':""):"");P+=F}D+=P}D+=l+(a.browser.msie&&parseInt(a.browser.version,10)<7&&!b.inline?'': -"");b._keyEvent=false;return D},_generateMonthYearHeader:function(b,f,j,l,o,n,k,m){var p=this._get(b,"changeMonth"),q=this._get(b,"changeYear"),s=this._get(b,"showMonthAfterYear"),r='
        ',u="";if(n||!p)u+=''+k[f]+"";else{k=l&&l.getFullYear()==j;var v=o&&o.getFullYear()==j;u+='"}s||(r+=u+(n||!(p&&q)?" ":""));if(!b.yearshtml){b.yearshtml="";if(n||!q)r+=''+j+"";else{m=this._get(b,"yearRange").split(":");var x=(new Date).getFullYear();k=function(y){y=y.match(/c[+-].*/)?j+parseInt(y.substring(1),10):y.match(/[+-].*/)?x+parseInt(y,10):parseInt(y,10);return isNaN(y)?x:y};f=k(m[0]);m=Math.max(f,k(m[1]||""));f=l?Math.max(f, -l.getFullYear()):f;m=o?Math.min(m,o.getFullYear()):m;for(b.yearshtml+='";r+=b.yearshtml;b.yearshtml=null}}r+=this._get(b,"yearSuffix");if(s)r+=(n||!(p&&q)?" ":"")+u;r+="
        ";return r},_adjustInstDate:function(b,f,j){var l=b.drawYear+(j=="Y"?f:0),o=b.drawMonth+ -(j=="M"?f:0);f=Math.min(b.selectedDay,this._getDaysInMonth(l,o))+(j=="D"?f:0);l=this._restrictMinMax(b,this._daylightSavingAdjust(new Date(l,o,f)));b.selectedDay=l.getDate();b.drawMonth=b.selectedMonth=l.getMonth();b.drawYear=b.selectedYear=l.getFullYear();if(j=="M"||j=="Y")this._notifyChange(b)},_restrictMinMax:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");f=j&&fb?b:f},_notifyChange:function(b){var f=this._get(b,"onChangeMonthYear");if(f)f.apply(b.input? -b.input[0]:null,[b.selectedYear,b.selectedMonth+1,b])},_getNumberOfMonths:function(b){b=this._get(b,"numberOfMonths");return b==null?[1,1]:typeof b=="number"?[1,b]:b},_getMinMaxDate:function(b,f){return this._determineDate(b,this._get(b,f+"Date"),null)},_getDaysInMonth:function(b,f){return 32-this._daylightSavingAdjust(new Date(b,f,32)).getDate()},_getFirstDayOfMonth:function(b,f){return(new Date(b,f,1)).getDay()},_canAdjustMonth:function(b,f,j,l){var o=this._getNumberOfMonths(b);j=this._daylightSavingAdjust(new Date(j, -l+(f<0?f:o[0]*o[1]),1));f<0&&j.setDate(this._getDaysInMonth(j.getFullYear(),j.getMonth()));return this._isInRange(b,j)},_isInRange:function(b,f){var j=this._getMinMaxDate(b,"min");b=this._getMinMaxDate(b,"max");return(!j||f.getTime()>=j.getTime())&&(!b||f.getTime()<=b.getTime())},_getFormatConfig:function(b){var f=this._get(b,"shortYearCutoff");f=typeof f!="string"?f:(new Date).getFullYear()%100+parseInt(f,10);return{shortYearCutoff:f,dayNamesShort:this._get(b,"dayNamesShort"),dayNames:this._get(b, -"dayNames"),monthNamesShort:this._get(b,"monthNamesShort"),monthNames:this._get(b,"monthNames")}},_formatDate:function(b,f,j,l){if(!f){b.currentDay=b.selectedDay;b.currentMonth=b.selectedMonth;b.currentYear=b.selectedYear}f=f?typeof f=="object"?f:this._daylightSavingAdjust(new Date(l,j,f)):this._daylightSavingAdjust(new Date(b.currentYear,b.currentMonth,b.currentDay));return this.formatDate(this._get(b,"dateFormat"),f,this._getFormatConfig(b))}});a.fn.datepicker=function(b){if(!this.length)return this; -if(!a.datepicker.initialized){a(document).mousedown(a.datepicker._checkExternalClick).find("body").append(a.datepicker.dpDiv);a.datepicker.initialized=true}var f=Array.prototype.slice.call(arguments,1);if(typeof b=="string"&&(b=="isDisabled"||b=="getDate"||b=="widget"))return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(f));if(b=="option"&&arguments.length==2&&typeof arguments[1]=="string")return a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this[0]].concat(f));return this.each(function(){typeof b== -"string"?a.datepicker["_"+b+"Datepicker"].apply(a.datepicker,[this].concat(f)):a.datepicker._attachDatepicker(this,b)})};a.datepicker=new c;a.datepicker.initialized=false;a.datepicker.uuid=(new Date).getTime();a.datepicker.version="1.8.16";window["DP_jQuery_"+g]=a})(jQuery); -(function(a,d){var c={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},e={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},h=a.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};a.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(g){var i=a(this).css(g).offset().top;i<0&&a(this).css("top",g.top-i)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var g=this,i=g.options,b=i.title||" ",f=a.ui.dialog.getTitleId(g.element),j=(g.uiDialog=a("
        ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -i.dialogClass).css({zIndex:i.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){if(i.closeOnEscape&&!n.isDefaultPrevented()&&n.keyCode&&n.keyCode===a.ui.keyCode.ESCAPE){g.close(n);n.preventDefault()}}).attr({role:"dialog","aria-labelledby":f}).mousedown(function(n){g.moveToTop(false,n)});g.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(j);var l=(g.uiDialogTitlebar=a("
        ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(j), -o=a('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){o.addClass("ui-state-hover")},function(){o.removeClass("ui-state-hover")}).focus(function(){o.addClass("ui-state-focus")}).blur(function(){o.removeClass("ui-state-focus")}).click(function(n){g.close(n);return false}).appendTo(l);(g.uiDialogTitlebarCloseText=a("")).addClass("ui-icon ui-icon-closethick").text(i.closeText).appendTo(o);a("").addClass("ui-dialog-title").attr("id", -f).html(b).prependTo(l);if(a.isFunction(i.beforeclose)&&!a.isFunction(i.beforeClose))i.beforeClose=i.beforeclose;l.find("*").add(l).disableSelection();i.draggable&&a.fn.draggable&&g._makeDraggable();i.resizable&&a.fn.resizable&&g._makeResizable();g._createButtons(i.buttons);g._isOpen=false;a.fn.bgiframe&&j.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var g=this;g.overlay&&g.overlay.destroy();g.uiDialog.hide();g.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -g.uiDialog.remove();g.originalTitle&&g.element.attr("title",g.originalTitle);return g},widget:function(){return this.uiDialog},close:function(g){var i=this,b,f;if(false!==i._trigger("beforeClose",g)){i.overlay&&i.overlay.destroy();i.uiDialog.unbind("keypress.ui-dialog");i._isOpen=false;if(i.options.hide)i.uiDialog.hide(i.options.hide,function(){i._trigger("close",g)});else{i.uiDialog.hide();i._trigger("close",g)}a.ui.dialog.overlay.resize();if(i.options.modal){b=0;a(".ui-dialog").each(function(){if(this!== -i.uiDialog[0]){f=a(this).css("z-index");isNaN(f)||(b=Math.max(b,f))}});a.ui.dialog.maxZ=b}return i}},isOpen:function(){return this._isOpen},moveToTop:function(g,i){var b=this,f=b.options;if(f.modal&&!g||!f.stack&&!f.modal)return b._trigger("focus",i);if(f.zIndex>a.ui.dialog.maxZ)a.ui.dialog.maxZ=f.zIndex;if(b.overlay){a.ui.dialog.maxZ+=1;b.overlay.$el.css("z-index",a.ui.dialog.overlay.maxZ=a.ui.dialog.maxZ)}g={scrollTop:b.element.scrollTop(),scrollLeft:b.element.scrollLeft()};a.ui.dialog.maxZ+=1; -b.uiDialog.css("z-index",a.ui.dialog.maxZ);b.element.attr(g);b._trigger("focus",i);return b},open:function(){if(!this._isOpen){var g=this,i=g.options,b=g.uiDialog;g.overlay=i.modal?new a.ui.dialog.overlay(g):null;g._size();g._position(i.position);b.show(i.show);g.moveToTop(true);i.modal&&b.bind("keypress.ui-dialog",function(f){if(f.keyCode===a.ui.keyCode.TAB){var j=a(":tabbable",this),l=j.filter(":first");j=j.filter(":last");if(f.target===j[0]&&!f.shiftKey){l.focus(1);return false}else if(f.target=== -l[0]&&f.shiftKey){j.focus(1);return false}}});a(g.element.find(":tabbable").get().concat(b.find(".ui-dialog-buttonpane :tabbable").get().concat(b.get()))).eq(0).focus();g._isOpen=true;g._trigger("open");return g}},_createButtons:function(g){var i=this,b=false,f=a("
        ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),j=a("
        ").addClass("ui-dialog-buttonset").appendTo(f);i.uiDialog.find(".ui-dialog-buttonpane").remove();typeof g==="object"&&g!==null&&a.each(g, -function(){return!(b=true)});if(b){a.each(g,function(l,o){o=a.isFunction(o)?{click:o,text:l}:o;var n=a('').click(function(){o.click.apply(i.element[0],arguments)}).appendTo(j);a.each(o,function(k,m){if(k!=="click")k in h?n[k](m):n.attr(k,m)});a.fn.button&&n.button()});f.appendTo(i.uiDialog)}},_makeDraggable:function(){function g(l){return{position:l.position,offset:l.offset}}var i=this,b=i.options,f=a(document),j;i.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(l,o){j=b.height==="auto"?"auto":a(this).height();a(this).height(a(this).height()).addClass("ui-dialog-dragging");i._trigger("dragStart",l,g(o))},drag:function(l,o){i._trigger("drag",l,g(o))},stop:function(l,o){b.position=[o.position.left-f.scrollLeft(),o.position.top-f.scrollTop()];a(this).removeClass("ui-dialog-dragging").height(j);i._trigger("dragStop",l,g(o));a.ui.dialog.overlay.resize()}})},_makeResizable:function(g){function i(l){return{originalPosition:l.originalPosition, -originalSize:l.originalSize,position:l.position,size:l.size}}g=g===d?this.options.resizable:g;var b=this,f=b.options,j=b.uiDialog.css("position");g=typeof g==="string"?g:"n,e,s,w,se,sw,ne,nw";b.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:b.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:b._minHeight(),handles:g,start:function(l,o){a(this).addClass("ui-dialog-resizing");b._trigger("resizeStart",l,i(o))},resize:function(l,o){b._trigger("resize", -l,i(o))},stop:function(l,o){a(this).removeClass("ui-dialog-resizing");f.height=a(this).height();f.width=a(this).width();b._trigger("resizeStop",l,i(o));a.ui.dialog.overlay.resize()}}).css("position",j).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var g=this.options;return g.height==="auto"?g.minHeight:Math.min(g.minHeight,g.height)},_position:function(g){var i=[],b=[0,0],f;if(g){if(typeof g==="string"||typeof g==="object"&&"0"in g){i=g.split?g.split(" "): -[g[0],g[1]];if(i.length===1)i[1]=i[0];a.each(["left","top"],function(j,l){if(+i[j]===i[j]){b[j]=i[j];i[j]=l}});g={my:i.join(" "),at:i.join(" "),offset:b.join(" ")}}g=a.extend({},a.ui.dialog.prototype.options.position,g)}else g=a.ui.dialog.prototype.options.position;(f=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(a.extend({of:window},g));f||this.uiDialog.hide()},_setOptions:function(g){var i=this,b={},f=false;a.each(g,function(j,l){i._setOption(j,l); -if(j in c)f=true;if(j in e)b[j]=l});f&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",b)},_setOption:function(g,i){var b=this,f=b.uiDialog;switch(g){case "beforeclose":g="beforeClose";break;case "buttons":b._createButtons(i);break;case "closeText":b.uiDialogTitlebarCloseText.text(""+i);break;case "dialogClass":f.removeClass(b.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+i);break;case "disabled":i?f.addClass("ui-dialog-disabled"): -f.removeClass("ui-dialog-disabled");break;case "draggable":var j=f.is(":data(draggable)");j&&!i&&f.draggable("destroy");!j&&i&&b._makeDraggable();break;case "position":b._position(i);break;case "resizable":(j=f.is(":data(resizable)"))&&!i&&f.resizable("destroy");j&&typeof i==="string"&&f.resizable("option","handles",i);!j&&i!==false&&b._makeResizable(i);break;case "title":a(".ui-dialog-title",b.uiDialogTitlebar).html(""+(i||" "));break}a.Widget.prototype._setOption.apply(b,arguments)},_size:function(){var g= -this.options,i,b,f=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(g.minWidth>g.width)g.width=g.minWidth;i=this.uiDialog.css({height:"auto",width:g.width}).height();b=Math.max(0,g.minHeight-i);if(g.height==="auto")if(a.support.minHeight)this.element.css({minHeight:b,height:"auto"});else{this.uiDialog.show();g=this.element.css("height","auto").height();f||this.uiDialog.hide();this.element.height(Math.max(g,b))}else this.element.height(Math.max(g.height- -i,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});a.extend(a.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(g){g=g.attr("id");if(!g){this.uuid+=1;g=this.uuid}return"ui-dialog-title-"+g},overlay:function(g){this.$el=a.ui.dialog.overlay.create(g)}});a.extend(a.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:a.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(g){return g+".dialog-overlay"}).join(" "), -create:function(g){if(this.instances.length===0){setTimeout(function(){a.ui.dialog.overlay.instances.length&&a(document).bind(a.ui.dialog.overlay.events,function(b){if(a(b.target).zIndex()
      ").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});a.fn.bgiframe&&i.bgiframe();this.instances.push(i);return i},destroy:function(g){var i=a.inArray(g,this.instances);i!=-1&&this.oldInstances.push(this.instances.splice(i,1)[0]);this.instances.length===0&&a([document,window]).unbind(".dialog-overlay");g.remove();var b=0;a.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var g,i;if(a.browser.msie&& -a.browser.version<7){g=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);i=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return g0?g.left-b:Math.max(g.left-i.collisionPosition.left,g.left)},top:function(g,i){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();g.top=b>0?g.top-b:Math.max(g.top-i.collisionPosition.top,g.top)}},flip:{left:function(g,i){if(i.at[0]!=="center"){var b=a(window);b=i.collisionPosition.left+i.collisionWidth-b.width()-b.scrollLeft();var f=i.my[0]==="left"?-i.elemWidth:i.my[0]==="right"?i.elemWidth:0,j=i.at[0]==="left"?i.targetWidth:-i.targetWidth,l=-2*i.offset[0];g.left+= -i.collisionPosition.left<0?f+j+l:b>0?f+j+l:0}},top:function(g,i){if(i.at[1]!=="center"){var b=a(window);b=i.collisionPosition.top+i.collisionHeight-b.height()-b.scrollTop();var f=i.my[1]==="top"?-i.elemHeight:i.my[1]==="bottom"?i.elemHeight:0,j=i.at[1]==="top"?i.targetHeight:-i.targetHeight,l=-2*i.offset[1];g.top+=i.collisionPosition.top<0?f+j+l:b>0?f+j+l:0}}}};if(!a.offset.setOffset){a.offset.setOffset=function(g,i){if(/static/.test(a.curCSS(g,"position")))g.style.position="relative";var b=a(g), -f=b.offset(),j=parseInt(a.curCSS(g,"top",true),10)||0,l=parseInt(a.curCSS(g,"left",true),10)||0;f={top:i.top-f.top+j,left:i.left-f.left+l};"using"in i?i.using.call(g,f):b.css(f)};a.fn.offset=function(g){var i=this[0];if(!i||!i.ownerDocument)return null;if(g)return this.each(function(){a.offset.setOffset(this,g)});return h.call(this)}}})(jQuery); -(function(a,d){a.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=a("
      ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();a.Widget.prototype.destroy.apply(this,arguments)},value:function(c){if(c===d)return this._value();this._setOption("value",c);return this},_setOption:function(c,e){if(c==="value"){this.options.value=e;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}a.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var c=this.options.value;if(typeof c!=="number")c=0;return Math.min(this.options.max,Math.max(this.min,c))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var c=this.value(),e=this._percentage();if(this.oldValue!==c){this.oldValue=c;this._trigger("change")}this.valueDiv.toggle(c>this.min).toggleClass("ui-corner-right",c===this.options.max).width(e.toFixed(0)+"%");this.element.attr("aria-valuenow",c)}});a.extend(a.ui.progressbar,{version:"1.8.16"})})(jQuery); -(function(a){a.widget("ui.slider",a.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var d=this,c=this.options,e=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),h=c.values&&c.values.length||1,g=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ -this.orientation+" ui-widget ui-widget-content ui-corner-all"+(c.disabled?" ui-slider-disabled ui-disabled":""));this.range=a([]);if(c.range){if(c.range===true){if(!c.values)c.values=[this._valueMin(),this._valueMin()];if(c.values.length&&c.values.length!==2)c.values=[c.values[0],c.values[0]]}this.range=a("
      ").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(c.range==="min"||c.range==="max"?" ui-slider-range-"+c.range:""))}for(var i=e.length;i"); -this.handles=e.add(a(g.join("")).appendTo(d.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(b){b.preventDefault()}).hover(function(){c.disabled||a(this).addClass("ui-state-hover")},function(){a(this).removeClass("ui-state-hover")}).focus(function(){if(c.disabled)a(this).blur();else{a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(b){a(this).data("index.ui-slider-handle", -b)});this.handles.keydown(function(b){var f=true,j=a(this).data("index.ui-slider-handle"),l,o,n;if(!d.options.disabled){switch(b.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.PAGE_UP:case a.ui.keyCode.PAGE_DOWN:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!d._keySliding){d._keySliding=true;a(this).addClass("ui-state-active");l=d._start(b,j);if(l===false)return}break}n=d.options.step;l=d.options.values&&d.options.values.length? -(o=d.values(j)):(o=d.value());switch(b.keyCode){case a.ui.keyCode.HOME:o=d._valueMin();break;case a.ui.keyCode.END:o=d._valueMax();break;case a.ui.keyCode.PAGE_UP:o=d._trimAlignValue(l+(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.PAGE_DOWN:o=d._trimAlignValue(l-(d._valueMax()-d._valueMin())/5);break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(l===d._valueMax())return;o=d._trimAlignValue(l+n);break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(l===d._valueMin())return;o=d._trimAlignValue(l- -n);break}d._slide(b,j,o);return f}}).keyup(function(b){var f=a(this).data("index.ui-slider-handle");if(d._keySliding){d._keySliding=false;d._stop(b,f);d._change(b,f);a(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(d){var c=this.options,e,h,g,i,b;if(c.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();e=this._normValueFromMouse({x:d.pageX,y:d.pageY});h=this._valueMax()-this._valueMin()+1;i=this;this.handles.each(function(f){var j=Math.abs(e-i.values(f));if(h>j){h=j;g=a(this);b=f}});if(c.range===true&&this.values(1)===c.min){b+=1;g=a(this.handles[b])}if(this._start(d,b)===false)return false; -this._mouseSliding=true;i._handleIndex=b;g.addClass("ui-state-active").focus();c=g.offset();this._clickOffset=!a(d.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:d.pageX-c.left-g.width()/2,top:d.pageY-c.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(d,b,e);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(d){var c= -this._normValueFromMouse({x:d.pageX,y:d.pageY});this._slide(d,this._handleIndex,c);return false},_mouseStop:function(d){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(d,this._handleIndex);this._change(d,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c;if(this.orientation==="horizontal"){c= -this.elementSize.width;d=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;d=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}c=d/c;if(c>1)c=1;if(c<0)c=0;if(this.orientation==="vertical")c=1-c;d=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+c*d)},_start:function(d,c){var e={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){e.value=this.values(c); -e.values=this.values()}return this._trigger("start",d,e)},_slide:function(d,c,e){var h;if(this.options.values&&this.options.values.length){h=this.values(c?0:1);if(this.options.values.length===2&&this.options.range===true&&(c===0&&e>h||c===1&&e1){this.options.values[d]=this._trimAlignValue(c);this._refreshValue();this._change(null,d)}else if(arguments.length)if(a.isArray(arguments[0])){e=this.options.values;h=arguments[0];for(g=0;g=this._valueMax())return this._valueMax();var c=this.options.step>0?this.options.step:1,e=(d-this._valueMin())%c;d=d-e;if(Math.abs(e)*2>=c)d+=e>0?c:-c;return parseFloat(d.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var d= -this.options.range,c=this.options,e=this,h=!this._animateOff?c.animate:false,g,i={},b,f,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(o){g=(e.values(o)-e._valueMin())/(e._valueMax()-e._valueMin())*100;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";a(this).stop(1,1)[h?"animate":"css"](i,c.animate);if(e.options.range===true)if(e.orientation==="horizontal"){if(o===0)e.range.stop(1,1)[h?"animate":"css"]({left:g+"%"},c.animate);if(o===1)e.range[h?"animate":"css"]({width:g- -b+"%"},{queue:false,duration:c.animate})}else{if(o===0)e.range.stop(1,1)[h?"animate":"css"]({bottom:g+"%"},c.animate);if(o===1)e.range[h?"animate":"css"]({height:g-b+"%"},{queue:false,duration:c.animate})}b=g});else{f=this.value();j=this._valueMin();l=this._valueMax();g=l!==j?(f-j)/(l-j)*100:0;i[e.orientation==="horizontal"?"left":"bottom"]=g+"%";this.handle.stop(1,1)[h?"animate":"css"](i,c.animate);if(d==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[h?"animate":"css"]({width:g+"%"}, -c.animate);if(d==="max"&&this.orientation==="horizontal")this.range[h?"animate":"css"]({width:100-g+"%"},{queue:false,duration:c.animate});if(d==="min"&&this.orientation==="vertical")this.range.stop(1,1)[h?"animate":"css"]({height:g+"%"},c.animate);if(d==="max"&&this.orientation==="vertical")this.range[h?"animate":"css"]({height:100-g+"%"},{queue:false,duration:c.animate})}}});a.extend(a.ui.slider,{version:"1.8.16"})})(jQuery); -(function(a,d){function c(){return++h}function e(){return++g}var h=0,g=0;a.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
      ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
    • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(i,b){if(i=="selected")this.options.collapsible&& -b==this.options.selected||this.select(b);else{this.options[i]=b;this._tabify()}},_tabId:function(i){return i.title&&i.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+c()},_sanitizeSelector:function(i){return i.replace(/:/g,"\\:")},_cookie:function(){var i=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+e());return a.cookie.apply(null,[i].concat(a.makeArray(arguments)))},_ui:function(i,b){return{tab:i,panel:b,index:this.anchors.index(i)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var i= -a(this);i.html(i.data("label.tabs")).removeData("label.tabs")})},_tabify:function(i){function b(r,u){r.css("display","");!a.support.opacity&&u.opacity&&r[0].style.removeAttribute("filter")}var f=this,j=this.options,l=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=a(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);this.anchors.each(function(r,u){var v=a(u).attr("href"),w=v.split("#")[0],x;if(w&&(w===location.toString().split("#")[0]|| -(x=a("base")[0])&&w===x.href)){v=u.hash;u.href=v}if(l.test(v))f.panels=f.panels.add(f.element.find(f._sanitizeSelector(v)));else if(v&&v!=="#"){a.data(u,"href.tabs",v);a.data(u,"load.tabs",v.replace(/#.*$/,""));v=f._tabId(u);u.href="#"+v;u=f.element.find("#"+v);if(!u.length){u=a(j.panelTemplate).attr("id",v).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(f.panels[r-1]||f.list);u.data("destroy.tabs",true)}f.panels=f.panels.add(u)}else j.disabled.push(r)});if(i){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(j.selected===d){location.hash&&this.anchors.each(function(r,u){if(u.hash==location.hash){j.selected=r;return false}});if(typeof j.selected!=="number"&&j.cookie)j.selected=parseInt(f._cookie(),10);if(typeof j.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)j.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));j.selected=j.selected||(this.lis.length?0:-1)}else if(j.selected===null)j.selected=-1;j.selected=j.selected>=0&&this.anchors[j.selected]||j.selected<0?j.selected:0;j.disabled=a.unique(j.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(r){return f.lis.index(r)}))).sort();a.inArray(j.selected,j.disabled)!=-1&&j.disabled.splice(a.inArray(j.selected,j.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(j.selected>=0&&this.anchors.length){f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(j.selected).addClass("ui-tabs-selected ui-state-active");f.element.queue("tabs",function(){f._trigger("show",null,f._ui(f.anchors[j.selected],f.element.find(f._sanitizeSelector(f.anchors[j.selected].hash))[0]))});this.load(j.selected)}a(window).bind("unload",function(){f.lis.add(f.anchors).unbind(".tabs");f.lis=f.anchors=f.panels=null})}else j.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[j.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");j.cookie&&this._cookie(j.selected,j.cookie);i=0;for(var o;o=this.lis[i];i++)a(o)[a.inArray(i,j.disabled)!=-1&&!a(o).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");j.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(j.event!=="mouseover"){var n=function(r,u){u.is(":not(.ui-state-disabled)")&&u.addClass("ui-state-"+r)},k=function(r,u){u.removeClass("ui-state-"+ -r)};this.lis.bind("mouseover.tabs",function(){n("hover",a(this))});this.lis.bind("mouseout.tabs",function(){k("hover",a(this))});this.anchors.bind("focus.tabs",function(){n("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){k("focus",a(this).closest("li"))})}var m,p;if(j.fx)if(a.isArray(j.fx)){m=j.fx[0];p=j.fx[1]}else m=p=j.fx;var q=p?function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.hide().removeClass("ui-tabs-hide").animate(p,p.duration||"normal", -function(){b(u,p);f._trigger("show",null,f._ui(r,u[0]))})}:function(r,u){a(r).closest("li").addClass("ui-tabs-selected ui-state-active");u.removeClass("ui-tabs-hide");f._trigger("show",null,f._ui(r,u[0]))},s=m?function(r,u){u.animate(m,m.duration||"normal",function(){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");b(u,m);f.element.dequeue("tabs")})}:function(r,u){f.lis.removeClass("ui-tabs-selected ui-state-active");u.addClass("ui-tabs-hide");f.element.dequeue("tabs")}; -this.anchors.bind(j.event+".tabs",function(){var r=this,u=a(r).closest("li"),v=f.panels.filter(":not(.ui-tabs-hide)"),w=f.element.find(f._sanitizeSelector(r.hash));if(u.hasClass("ui-tabs-selected")&&!j.collapsible||u.hasClass("ui-state-disabled")||u.hasClass("ui-state-processing")||f.panels.filter(":animated").length||f._trigger("select",null,f._ui(this,w[0]))===false){this.blur();return false}j.selected=f.anchors.index(this);f.abort();if(j.collapsible)if(u.hasClass("ui-tabs-selected")){j.selected= --1;j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){s(r,v)}).dequeue("tabs");this.blur();return false}else if(!v.length){j.cookie&&f._cookie(j.selected,j.cookie);f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this));this.blur();return false}j.cookie&&f._cookie(j.selected,j.cookie);if(w.length){v.length&&f.element.queue("tabs",function(){s(r,v)});f.element.queue("tabs",function(){q(r,w)});f.load(f.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -a.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(i){if(typeof i=="string")i=this.anchors.index(this.anchors.filter("[href$="+i+"]"));return i},destroy:function(){var i=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var b= -a.data(this,"href.tabs");if(b)this.href=b;var f=a(this).unbind(".tabs");a.each(["href","load","cache"],function(j,l){f.removeData(l+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){a.data(this,"destroy.tabs")?a(this).remove():a(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});i.cookie&&this._cookie(null,i.cookie);return this},add:function(i, -b,f){if(f===d)f=this.anchors.length;var j=this,l=this.options;b=a(l.tabTemplate.replace(/#\{href\}/g,i).replace(/#\{label\}/g,b));i=!i.indexOf("#")?i.replace("#",""):this._tabId(a("a",b)[0]);b.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var o=j.element.find("#"+i);o.length||(o=a(l.panelTemplate).attr("id",i).data("destroy.tabs",true));o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(f>=this.lis.length){b.appendTo(this.list);o.appendTo(this.list[0].parentNode)}else{b.insertBefore(this.lis[f]); -o.insertBefore(this.panels[f])}l.disabled=a.map(l.disabled,function(n){return n>=f?++n:n});this._tabify();if(this.anchors.length==1){l.selected=0;b.addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){j._trigger("show",null,j._ui(j.anchors[0],j.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[f],this.panels[f]));return this},remove:function(i){i=this._getIndex(i);var b=this.options,f=this.lis.eq(i).remove(),j=this.panels.eq(i).remove(); -if(f.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(i+(i+1=i?--l:l});this._tabify();this._trigger("remove",null,this._ui(f.find("a")[0],j[0]));return this},enable:function(i){i=this._getIndex(i);var b=this.options;if(a.inArray(i,b.disabled)!=-1){this.lis.eq(i).removeClass("ui-state-disabled");b.disabled=a.grep(b.disabled,function(f){return f!=i});this._trigger("enable",null, -this._ui(this.anchors[i],this.panels[i]));return this}},disable:function(i){i=this._getIndex(i);var b=this.options;if(i!=b.selected){this.lis.eq(i).addClass("ui-state-disabled");b.disabled.push(i);b.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[i],this.panels[i]))}return this},select:function(i){i=this._getIndex(i);if(i==-1)if(this.options.collapsible&&this.options.selected!=-1)i=this.options.selected;else return this;this.anchors.eq(i).trigger(this.options.event+".tabs");return this}, -load:function(i){i=this._getIndex(i);var b=this,f=this.options,j=this.anchors.eq(i)[0],l=a.data(j,"load.tabs");this.abort();if(!l||this.element.queue("tabs").length!==0&&a.data(j,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(i).addClass("ui-state-processing");if(f.spinner){var o=a("span",j);o.data("label.tabs",o.html()).html(f.spinner)}this.xhr=a.ajax(a.extend({},f.ajaxOptions,{url:l,success:function(n,k){b.element.find(b._sanitizeSelector(j.hash)).html(n);b._cleanup();f.cache&&a.data(j, -"cache.tabs",true);b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.success(n,k)}catch(m){}},error:function(n,k){b._cleanup();b._trigger("load",null,b._ui(b.anchors[i],b.panels[i]));try{f.ajaxOptions.error(n,k,i,j)}catch(m){}}}));b.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(i,b){this.anchors.eq(i).removeData("cache.tabs").data("load.tabs",b);return this},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.8.16"});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(i,b){var f=this,j=this.options,l=f._rotate||(f._rotate=function(o){clearTimeout(f.rotation);f.rotation=setTimeout(function(){var n=j.selected;f.select(++n=0)&&i(t,!r)}}),e(function(){var t=document.body,n=t.appendChild(n=document.createElement("div"));n.offsetHeight,e.extend(n.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0}),e.support.minHeight=n.offsetHeight===100,e.support.selectstart="onselectstart"in n,t.removeChild(n).style.display="none"}),e("").outerWidth(1).jquery||e.each(["Width","Height"],function(n,r){function u(t,n,r,s){return e.each(i,function(){n-=parseFloat(e.css(t,"padding"+this))||0,r&&(n-=parseFloat(e.css(t,"border"+this+"Width"))||0),s&&(n-=parseFloat(e.css(t,"margin"+this))||0)}),n}var i=r==="Width"?["Left","Right"]:["Top","Bottom"],s=r.toLowerCase(),o={innerWidth:e.fn.innerWidth,innerHeight:e.fn.innerHeight,outerWidth:e.fn.outerWidth,outerHeight:e.fn.outerHeight};e.fn["inner"+r]=function(n){return n===t?o["inner"+r].call(this):this.each(function(){e(this).css(s,u(this,n)+"px")})},e.fn["outer"+r]=function(t,n){return typeof t!="number"?o["outer"+r].call(this,t):this.each(function(){e(this).css(s,u(this,t,!0,n)+"px")})}}),e("").data("a-b","a").removeData("a-b").data("a-b")&&(e.fn.removeData=function(t){return function(n){return arguments.length?t.call(this,e.camelCase(n)):t.call(this)}}(e.fn.removeData)),function(){var t=/msie ([\w.]+)/.exec(navigator.userAgent.toLowerCase())||[];e.ui.ie=t.length?!0:!1,e.ui.ie6=parseFloat(t[1],10)===6}(),e.fn.extend({disableSelection:function(){return this.bind((e.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}}),e.extend(e.ui,{plugin:{add:function(t,n,r){var i,s=e.ui[t].prototype;for(i in r)s.plugins[i]=s.plugins[i]||[],s.plugins[i].push([n,r[i]])},call:function(e,t,n){var r,i=e.plugins[t];if(!i||!e.element[0].parentNode||e.element[0].parentNode.nodeType===11)return;for(r=0;r0?!0:(t[r]=1,i=t[r]>0,t[r]=0,i)},isOverAxis:function(e,t,n){return e>t&&e",options:{disabled:!1,create:null},_createWidget:function(t,r){r=e(r||this.defaultElement||this)[0],this.element=e(r),this.uuid=n++,this.eventNamespace="."+this.widgetName+this.uuid,this.options=e.widget.extend({},this.options,this._getCreateOptions(),t),this.bindings=e(),this.hoverable=e(),this.focusable=e(),r!==this&&(e.data(r,this.widgetName,this),e.data(r,this.widgetFullName,this),this._on(!0,this.element,{remove:function(e){e.target===r&&this.destroy()}}),this.document=e(r.style?r.ownerDocument:r.document||r),this.window=e(this.document[0].defaultView||this.document[0].parentWindow)),this._create(),this._trigger("create",null,this._getCreateEventData()),this._init()},_getCreateOptions:e.noop,_getCreateEventData:e.noop,_create:e.noop,_init:e.noop,destroy:function(){this._destroy(),this.element.unbind(this.eventNamespace).removeData(this.widgetName).removeData(this.widgetFullName).removeData(e.camelCase(this.widgetFullName)),this.widget().unbind(this.eventNamespace).removeAttr("aria-disabled").removeClass(this.widgetFullName+"-disabled "+"ui-state-disabled"),this.bindings.unbind(this.eventNamespace),this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus")},_destroy:e.noop,widget:function(){return this.element},option:function(n,r){var i=n,s,o,u;if(arguments.length===0)return e.widget.extend({},this.options);if(typeof n=="string"){i={},s=n.split("."),n=s.shift();if(s.length){o=i[n]=e.widget.extend({},this.options[n]);for(u=0;u=9||!!t.button?this._mouseStarted?(this._mouseDrag(t),t.preventDefault()):(this._mouseDistanceMet(t)&&this._mouseDelayMet(t)&&(this._mouseStarted=this._mouseStart(this._mouseDownEvent,t)!==!1,this._mouseStarted?this._mouseDrag(t):this._mouseUp(t)),!this._mouseStarted):this._mouseUp(t)},_mouseUp:function(t){return e(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,t.target===this._mouseDownEvent.target&&e.data(t.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(t)),!1},_mouseDistanceMet:function(e){return Math.max(Math.abs(this._mouseDownEvent.pageX-e.pageX),Math.abs(this._mouseDownEvent.pageY-e.pageY))>=this.options.distance},_mouseDelayMet:function(e){return this.mouseDelayMet},_mouseStart:function(e){},_mouseDrag:function(e){},_mouseStop:function(e){},_mouseCapture:function(e){return!0}})})(jQuery);(function(e,t){function h(e,t,n){return[parseInt(e[0],10)*(l.test(e[0])?t/100:1),parseInt(e[1],10)*(l.test(e[1])?n/100:1)]}function p(t,n){return parseInt(e.css(t,n),10)||0}e.ui=e.ui||{};var n,r=Math.max,i=Math.abs,s=Math.round,o=/left|center|right/,u=/top|center|bottom/,a=/[\+\-]\d+%?/,f=/^\w+/,l=/%$/,c=e.fn.position;e.position={scrollbarWidth:function(){if(n!==t)return n;var r,i,s=e("
      "),o=s.children()[0];return e("body").append(s),r=o.offsetWidth,s.css("overflow","scroll"),i=o.offsetWidth,r===i&&(i=s[0].clientWidth),s.remove(),n=r-i},getScrollInfo:function(t){var n=t.isWindow?"":t.element.css("overflow-x"),r=t.isWindow?"":t.element.css("overflow-y"),i=n==="scroll"||n==="auto"&&t.width0?"right":"center",vertical:u<0?"top":o>0?"bottom":"middle"};lr(i(o),i(u))?h.important="horizontal":h.important="vertical",t.using.call(this,e,h)}),a.offset(e.extend(C,{using:u}))})},e.ui.position={fit:{left:function(e,t){var n=t.within,i=n.isWindow?n.scrollLeft:n.offset.left,s=n.width,o=e.left-t.collisionPosition.marginLeft,u=i-o,a=o+t.collisionWidth-s-i,f;t.collisionWidth>s?u>0&&a<=0?(f=e.left+u+t.collisionWidth-s-i,e.left+=u-f):a>0&&u<=0?e.left=i:u>a?e.left=i+s-t.collisionWidth:e.left=i:u>0?e.left+=u:a>0?e.left-=a:e.left=r(e.left-o,e.left)},top:function(e,t){var n=t.within,i=n.isWindow?n.scrollTop:n.offset.top,s=t.within.height,o=e.top-t.collisionPosition.marginTop,u=i-o,a=o+t.collisionHeight-s-i,f;t.collisionHeight>s?u>0&&a<=0?(f=e.top+u+t.collisionHeight-s-i,e.top+=u-f):a>0&&u<=0?e.top=i:u>a?e.top=i+s-t.collisionHeight:e.top=i:u>0?e.top+=u:a>0?e.top-=a:e.top=r(e.top-o,e.top)}},flip:{left:function(e,t){var n=t.within,r=n.offset.left+n.scrollLeft,s=n.width,o=n.isWindow?n.scrollLeft:n.offset.left,u=e.left-t.collisionPosition.marginLeft,a=u-o,f=u+t.collisionWidth-s-o,l=t.my[0]==="left"?-t.elemWidth:t.my[0]==="right"?t.elemWidth:0,c=t.at[0]==="left"?t.targetWidth:t.at[0]==="right"?-t.targetWidth:0,h=-2*t.offset[0],p,d;if(a<0){p=e.left+l+c+h+t.collisionWidth-s-r;if(p<0||p0){d=e.left-t.collisionPosition.marginLeft+l+c+h-o;if(d>0||i(d)a&&(v<0||v0&&(d=e.top-t.collisionPosition.marginTop+c+h+p-o,e.top+c+h+p>f&&(d>0||i(d)10&&i<11,t.innerHTML="",n.removeChild(t)}(),e.uiBackCompat!==!1&&function(e){var n=e.fn.position;e.fn.position=function(r){if(!r||!r.offset)return n.call(this,r);var i=r.offset.split(" "),s=r.at.split(" ");return i.length===1&&(i[1]=i[0]),/^\d/.test(i[0])&&(i[0]="+"+i[0]),/^\d/.test(i[1])&&(i[1]="+"+i[1]),s.length===1&&(/left|center|right/.test(s[0])?s[1]="center":(s[1]=s[0],s[0]="center")),n.call(this,e.extend(r,{at:s[0]+i[0]+" "+s[1]+i[1],offset:t}))}}(jQuery)})(jQuery);(function(e,t){var n=0,r={},i={};r.height=r.paddingTop=r.paddingBottom=r.borderTopWidth=r.borderBottomWidth="hide",i.height=i.paddingTop=i.paddingBottom=i.borderTopWidth=i.borderBottomWidth="show",e.widget("ui.accordion",{version:"1.9.2",options:{active:0,animate:{},collapsible:!1,event:"click",header:"> li > :first-child,> :not(li):even",heightStyle:"auto",icons:{activeHeader:"ui-icon-triangle-1-s",header:"ui-icon-triangle-1-e"},activate:null,beforeActivate:null},_create:function(){var t=this.accordionId="ui-accordion-"+(this.element.attr("id")||++n),r=this.options;this.prevShow=this.prevHide=e(),this.element.addClass("ui-accordion ui-widget ui-helper-reset"),this.headers=this.element.find(r.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all"),this._hoverable(this.headers),this._focusable(this.headers),this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom").hide(),!r.collapsible&&(r.active===!1||r.active==null)&&(r.active=0),r.active<0&&(r.active+=this.headers.length),this.active=this._findActive(r.active).addClass("ui-accordion-header-active ui-state-active").toggleClass("ui-corner-all ui-corner-top"),this.active.next().addClass("ui-accordion-content-active").show(),this._createIcons(),this.refresh(),this.element.attr("role","tablist"),this.headers.attr("role","tab").each(function(n){var r=e(this),i=r.attr("id"),s=r.next(),o=s.attr("id");i||(i=t+"-header-"+n,r.attr("id",i)),o||(o=t+"-panel-"+n,s.attr("id",o)),r.attr("aria-controls",o),s.attr("aria-labelledby",i)}).next().attr("role","tabpanel"),this.headers.not(this.active).attr({"aria-selected":"false",tabIndex:-1}).next().attr({"aria-expanded":"false","aria-hidden":"true"}).hide(),this.active.length?this.active.attr({"aria-selected":"true",tabIndex:0}).next().attr({"aria-expanded":"true","aria-hidden":"false"}):this.headers.eq(0).attr("tabIndex",0),this._on(this.headers,{keydown:"_keydown"}),this._on(this.headers.next(),{keydown:"_panelKeyDown"}),this._setupEvents(r.event)},_getCreateEventData:function(){return{header:this.active,content:this.active.length?this.active.next():e()}},_createIcons:function(){var t=this.options.icons;t&&(e("").addClass("ui-accordion-header-icon ui-icon "+t.header).prependTo(this.headers),this.active.children(".ui-accordion-header-icon").removeClass(t.header).addClass(t.activeHeader),this.headers.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.removeClass("ui-accordion-icons").children(".ui-accordion-header-icon").remove()},_destroy:function(){var e;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.removeClass("ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-selected").removeAttr("aria-controls").removeAttr("tabIndex").each(function(){/^ui-accordion/.test(this.id)&&this.removeAttribute("id")}),this._destroyIcons(),e=this.headers.next().css("display","").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled").each(function(){/^ui-accordion/.test(this.id)&&this.removeAttribute("id")}),this.options.heightStyle!=="content"&&e.css("height","")},_setOption:function(e,t){if(e==="active"){this._activate(t);return}e==="event"&&(this.options.event&&this._off(this.headers,this.options.event),this._setupEvents(t)),this._super(e,t),e==="collapsible"&&!t&&this.options.active===!1&&this._activate(0),e==="icons"&&(this._destroyIcons(),t&&this._createIcons()),e==="disabled"&&this.headers.add(this.headers.next()).toggleClass("ui-state-disabled",!!t)},_keydown:function(t){if(t.altKey||t.ctrlKey)return;var n=e.ui.keyCode,r=this.headers.length,i=this.headers.index(t.target),s=!1;switch(t.keyCode){case n.RIGHT:case n.DOWN:s=this.headers[(i+1)%r];break;case n.LEFT:case n.UP:s=this.headers[(i-1+r)%r];break;case n.SPACE:case n.ENTER:this._eventHandler(t);break;case n.HOME:s=this.headers[0];break;case n.END:s=this.headers[r-1]}s&&(e(t.target).attr("tabIndex",-1),e(s).attr("tabIndex",0),s.focus(),t.preventDefault())},_panelKeyDown:function(t){t.keyCode===e.ui.keyCode.UP&&t.ctrlKey&&e(t.currentTarget).prev().focus()},refresh:function(){var t,n,r=this.options.heightStyle,i=this.element.parent();r==="fill"?(e.support.minHeight||(n=i.css("overflow"),i.css("overflow","hidden")),t=i.height(),this.element.siblings(":visible").each(function(){var n=e(this),r=n.css("position");if(r==="absolute"||r==="fixed")return;t-=n.outerHeight(!0)}),n&&i.css("overflow",n),this.headers.each(function(){t-=e(this).outerHeight(!0)}),this.headers.next().each(function(){e(this).height(Math.max(0,t-e(this).innerHeight()+e(this).height()))}).css("overflow","auto")):r==="auto"&&(t=0,this.headers.next().each(function(){t=Math.max(t,e(this).css("height","").height())}).height(t))},_activate:function(t){var n=this._findActive(t)[0];if(n===this.active[0])return;n=n||this.active[0],this._eventHandler({target:n,currentTarget:n,preventDefault:e.noop})},_findActive:function(t){return typeof t=="number"?this.headers.eq(t):e()},_setupEvents:function(t){var n={};if(!t)return;e.each(t.split(" "),function(e,t){n[t]="_eventHandler"}),this._on(this.headers,n)},_eventHandler:function(t){var n=this.options,r=this.active,i=e(t.currentTarget),s=i[0]===r[0],o=s&&n.collapsible,u=o?e():i.next(),a=r.next(),f={oldHeader:r,oldPanel:a,newHeader:o?e():i,newPanel:u};t.preventDefault();if(s&&!n.collapsible||this._trigger("beforeActivate",t,f)===!1)return;n.active=o?!1:this.headers.index(i),this.active=s?e():i,this._toggle(f),r.removeClass("ui-accordion-header-active ui-state-active"),n.icons&&r.children(".ui-accordion-header-icon").removeClass(n.icons.activeHeader).addClass(n.icons.header),s||(i.removeClass("ui-corner-all").addClass("ui-accordion-header-active ui-state-active ui-corner-top"),n.icons&&i.children(".ui-accordion-header-icon").removeClass(n.icons.header).addClass(n.icons.activeHeader),i.next().addClass("ui-accordion-content-active"))},_toggle:function(t){var n=t.newPanel,r=this.prevShow.length?this.prevShow:t.oldPanel;this.prevShow.add(this.prevHide).stop(!0,!0),this.prevShow=n,this.prevHide=r,this.options.animate?this._animate(n,r,t):(r.hide(),n.show(),this._toggleComplete(t)),r.attr({"aria-expanded":"false","aria-hidden":"true"}),r.prev().attr("aria-selected","false"),n.length&&r.length?r.prev().attr("tabIndex",-1):n.length&&this.headers.filter(function(){return e(this).attr("tabIndex")===0}).attr("tabIndex",-1),n.attr({"aria-expanded":"true","aria-hidden":"false"}).prev().attr({"aria-selected":"true",tabIndex:0})},_animate:function(e,t,n){var s,o,u,a=this,f=0,l=e.length&&(!t.length||e.index()",options:{appendTo:"body",autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null,change:null,close:null,focus:null,open:null,response:null,search:null,select:null},pending:0,_create:function(){var t,n,r;this.isMultiLine=this._isMultiLine(),this.valueMethod=this.element[this.element.is("input,textarea")?"val":"text"],this.isNewMenu=!0,this.element.addClass("ui-autocomplete-input").attr("autocomplete","off"),this._on(this.element,{keydown:function(i){if(this.element.prop("readOnly")){t=!0,r=!0,n=!0;return}t=!1,r=!1,n=!1;var s=e.ui.keyCode;switch(i.keyCode){case s.PAGE_UP:t=!0,this._move("previousPage",i);break;case s.PAGE_DOWN:t=!0,this._move("nextPage",i);break;case s.UP:t=!0,this._keyEvent("previous",i);break;case s.DOWN:t=!0,this._keyEvent("next",i);break;case s.ENTER:case s.NUMPAD_ENTER:this.menu.active&&(t=!0,i.preventDefault(),this.menu.select(i));break;case s.TAB:this.menu.active&&this.menu.select(i);break;case s.ESCAPE:this.menu.element.is(":visible")&&(this._value(this.term),this.close(i),i.preventDefault());break;default:n=!0,this._searchTimeout(i)}},keypress:function(r){if(t){t=!1,r.preventDefault();return}if(n)return;var i=e.ui.keyCode;switch(r.keyCode){case i.PAGE_UP:this._move("previousPage",r);break;case i.PAGE_DOWN:this._move("nextPage",r);break;case i.UP:this._keyEvent("previous",r);break;case i.DOWN:this._keyEvent("next",r)}},input:function(e){if(r){r=!1,e.preventDefault();return}this._searchTimeout(e)},focus:function(){this.selectedItem=null,this.previous=this._value()},blur:function(e){if(this.cancelBlur){delete this.cancelBlur;return}clearTimeout(this.searching),this.close(e),this._change(e)}}),this._initSource(),this.menu=e("
      "+(o[0]>0&&I==o[1]-1?'
      ':""):""),F+=U}B+=F}return B+=x+($.ui.ie6&&!e.inline?'':""),e._keyEvent=!1,B},_generateMonthYearHeader:function(e,t,n,r,i,s,o,u){var a=this._get(e,"changeMonth"),f=this._get(e,"changeYear"),l=this._get(e,"showMonthAfterYear"),c='
      ',h="";if(s||!a)h+=''+o[t]+"";else{var p=r&&r.getFullYear()==n,d=i&&i.getFullYear()==n;h+='"}l||(c+=h+(s||!a||!f?" ":""));if(!e.yearshtml){e.yearshtml="";if(s||!f)c+=''+n+"";else{var m=this._get(e,"yearRange").split(":"),g=(new Date).getFullYear(),y=function(e){var t=e.match(/c[+-].*/)?n+parseInt(e.substring(1),10):e.match(/[+-].*/)?g+parseInt(e,10):parseInt(e,10);return isNaN(t)?g:t},b=y(m[0]),w=Math.max(b,y(m[1]||""));b=r?Math.max(b,r.getFullYear()):b,w=i?Math.min(w,i.getFullYear()):w,e.yearshtml+='",c+=e.yearshtml,e.yearshtml=null}}return c+=this._get(e,"yearSuffix"),l&&(c+=(s||!a||!f?" ":"")+h),c+="
      ",c},_adjustInstDate:function(e,t,n){var r=e.drawYear+(n=="Y"?t:0),i=e.drawMonth+(n=="M"?t:0),s=Math.min(e.selectedDay,this._getDaysInMonth(r,i))+(n=="D"?t:0),o=this._restrictMinMax(e,this._daylightSavingAdjust(new Date(r,i,s)));e.selectedDay=o.getDate(),e.drawMonth=e.selectedMonth=o.getMonth(),e.drawYear=e.selectedYear=o.getFullYear(),(n=="M"||n=="Y")&&this._notifyChange(e)},_restrictMinMax:function(e,t){var n=this._getMinMaxDate(e,"min"),r=this._getMinMaxDate(e,"max"),i=n&&tr?r:i,i},_notifyChange:function(e){var t=this._get(e,"onChangeMonthYear");t&&t.apply(e.input?e.input[0]:null,[e.selectedYear,e.selectedMonth+1,e])},_getNumberOfMonths:function(e){var t=this._get(e,"numberOfMonths");return t==null?[1,1]:typeof t=="number"?[1,t]:t},_getMinMaxDate:function(e,t){return this._determineDate(e,this._get(e,t+"Date"),null)},_getDaysInMonth:function(e,t){return 32-this._daylightSavingAdjust(new Date(e,t,32)).getDate()},_getFirstDayOfMonth:function(e,t){return(new Date(e,t,1)).getDay()},_canAdjustMonth:function(e,t,n,r){var i=this._getNumberOfMonths(e),s=this._daylightSavingAdjust(new Date(n,r+(t<0?t:i[0]*i[1]),1));return t<0&&s.setDate(this._getDaysInMonth(s.getFullYear(),s.getMonth())),this._isInRange(e,s)},_isInRange:function(e,t){var n=this._getMinMaxDate(e,"min"),r=this._getMinMaxDate(e,"max");return(!n||t.getTime()>=n.getTime())&&(!r||t.getTime()<=r.getTime())},_getFormatConfig:function(e){var t=this._get(e,"shortYearCutoff");return t=typeof t!="string"?t:(new Date).getFullYear()%100+parseInt(t,10),{shortYearCutoff:t,dayNamesShort:this._get(e,"dayNamesShort"),dayNames:this._get(e,"dayNames"),monthNamesShort:this._get(e,"monthNamesShort"),monthNames:this._get(e,"monthNames")}},_formatDate:function(e,t,n,r){t||(e.currentDay=e.selectedDay,e.currentMonth=e.selectedMonth,e.currentYear=e.selectedYear);var i=t?typeof t=="object"?t:this._daylightSavingAdjust(new Date(r,n,t)):this._daylightSavingAdjust(new Date(e.currentYear,e.currentMonth,e.currentDay));return this.formatDate(this._get(e,"dateFormat"),i,this._getFormatConfig(e))}}),$.fn.datepicker=function(e){if(!this.length)return this;$.datepicker.initialized||($(document).mousedown($.datepicker._checkExternalClick).find(document.body).append($.datepicker.dpDiv),$.datepicker.initialized=!0);var t=Array.prototype.slice.call(arguments,1);return typeof e!="string"||e!="isDisabled"&&e!="getDate"&&e!="widget"?e=="option"&&arguments.length==2&&typeof arguments[1]=="string"?$.datepicker["_"+e+"Datepicker"].apply($.datepicker,[this[0]].concat(t)):this.each(function(){typeof e=="string"?$.datepicker["_"+e+"Datepicker"].apply($.datepicker,[this].concat(t)):$.datepicker._attachDatepicker(this,e)}):$.datepicker["_"+e+"Datepicker"].apply($.datepicker,[this[0]].concat(t))},$.datepicker=new Datepicker,$.datepicker.initialized=!1,$.datepicker.uuid=(new Date).getTime(),$.datepicker.version="1.9.2",window["DP_jQuery_"+dpuuid]=$})(jQuery);(function(e,t){var n="ui-dialog ui-widget ui-widget-content ui-corner-all ",r={buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},i={maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0};e.widget("ui.dialog",{version:"1.9.2",options:{autoOpen:!0,buttons:{},closeOnEscape:!0,closeText:"close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:!1,maxWidth:!1,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",of:window,collision:"fit",using:function(t){var n=e(this).css(t).offset().top;n<0&&e(this).css("top",t.top-n)}},resizable:!0,show:null,stack:!0,title:"",width:300,zIndex:1e3},_create:function(){this.originalTitle=this.element.attr("title"),typeof this.originalTitle!="string"&&(this.originalTitle=""),this.oldPosition={parent:this.element.parent(),index:this.element.parent().children().index(this.element)},this.options.title=this.options.title||this.originalTitle;var t=this,r=this.options,i=r.title||" ",s,o,u,a,f;s=(this.uiDialog=e("
      ")).addClass(n+r.dialogClass).css({display:"none",outline:0,zIndex:r.zIndex}).attr("tabIndex",-1).keydown(function(n){r.closeOnEscape&&!n.isDefaultPrevented()&&n.keyCode&&n.keyCode===e.ui.keyCode.ESCAPE&&(t.close(n),n.preventDefault())}).mousedown(function(e){t.moveToTop(!1,e)}).appendTo("body"),this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(s),o=(this.uiDialogTitlebar=e("
      ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").bind("mousedown",function(){s.focus()}).prependTo(s),u=e("").addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").click(function(e){e.preventDefault(),t.close(e)}).appendTo(o),(this.uiDialogTitlebarCloseText=e("")).addClass("ui-icon ui-icon-closethick").text(r.closeText).appendTo(u),a=e("").uniqueId().addClass("ui-dialog-title").html(i).prependTo(o),f=(this.uiDialogButtonPane=e("
      ")).addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),(this.uiButtonSet=e("
      ")).addClass("ui-dialog-buttonset").appendTo(f),s.attr({role:"dialog","aria-labelledby":a.attr("id")}),o.find("*").add(o).disableSelection(),this._hoverable(u),this._focusable(u),r.draggable&&e.fn.draggable&&this._makeDraggable(),r.resizable&&e.fn.resizable&&this._makeResizable(),this._createButtons(r.buttons),this._isOpen=!1,e.fn.bgiframe&&s.bgiframe(),this._on(s,{keydown:function(t){if(!r.modal||t.keyCode!==e.ui.keyCode.TAB)return;var n=e(":tabbable",s),i=n.filter(":first"),o=n.filter(":last");if(t.target===o[0]&&!t.shiftKey)return i.focus(1),!1;if(t.target===i[0]&&t.shiftKey)return o.focus(1),!1}})},_init:function(){this.options.autoOpen&&this.open()},_destroy:function(){var e,t=this.oldPosition;this.overlay&&this.overlay.destroy(),this.uiDialog.hide(),this.element.removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"),this.uiDialog.remove(),this.originalTitle&&this.element.attr("title",this.originalTitle),e=t.parent.children().eq(t.index),e.length&&e[0]!==this.element[0]?e.before(this.element):t.parent.append(this.element)},widget:function(){return this.uiDialog},close:function(t){var n=this,r,i;if(!this._isOpen)return;if(!1===this._trigger("beforeClose",t))return;return this._isOpen=!1,this.overlay&&this.overlay.destroy(),this.options.hide?this._hide(this.uiDialog,this.options.hide,function(){n._trigger("close",t)}):(this.uiDialog.hide(),this._trigger("close",t)),e.ui.dialog.overlay.resize(),this.options.modal&&(r=0,e(".ui-dialog").each(function(){this!==n.uiDialog[0]&&(i=e(this).css("z-index"),isNaN(i)||(r=Math.max(r,i)))}),e.ui.dialog.maxZ=r),this},isOpen:function(){return this._isOpen},moveToTop:function(t,n){var r=this.options,i;return r.modal&&!t||!r.stack&&!r.modal?this._trigger("focus",n):(r.zIndex>e.ui.dialog.maxZ&&(e.ui.dialog.maxZ=r.zIndex),this.overlay&&(e.ui.dialog.maxZ+=1,e.ui.dialog.overlay.maxZ=e.ui.dialog.maxZ,this.overlay.$el.css("z-index",e.ui.dialog.overlay.maxZ)),i={scrollTop:this.element.scrollTop(),scrollLeft:this.element.scrollLeft()},e.ui.dialog.maxZ+=1,this.uiDialog.css("z-index",e.ui.dialog.maxZ),this.element.attr(i),this._trigger("focus",n),this)},open:function(){if(this._isOpen)return;var t,n=this.options,r=this.uiDialog;return this._size(),this._position(n.position),r.show(n.show),this.overlay=n.modal?new e.ui.dialog.overlay(this):null,this.moveToTop(!0),t=this.element.find(":tabbable"),t.length||(t=this.uiDialogButtonPane.find(":tabbable"),t.length||(t=r)),t.eq(0).focus(),this._isOpen=!0,this._trigger("open"),this},_createButtons:function(t){var n=this,r=!1;this.uiDialogButtonPane.remove(),this.uiButtonSet.empty(),typeof t=="object"&&t!==null&&e.each(t,function(){return!(r=!0)}),r?(e.each(t,function(t,r){var i,s;r=e.isFunction(r)?{click:r,text:t}:r,r=e.extend({type:"button"},r),s=r.click,r.click=function(){s.apply(n.element[0],arguments)},i=e("",r).appendTo(n.uiButtonSet),e.fn.button&&i.button()}),this.uiDialog.addClass("ui-dialog-buttons"),this.uiDialogButtonPane.appendTo(this.uiDialog)):this.uiDialog.removeClass("ui-dialog-buttons")},_makeDraggable:function(){function r(e){return{position:e.position,offset:e.offset}}var t=this,n=this.options;this.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(n,i){e(this).addClass("ui-dialog-dragging"),t._trigger("dragStart",n,r(i))},drag:function(e,n){t._trigger("drag",e,r(n))},stop:function(i,s){n.position=[s.position.left-t.document.scrollLeft(),s.position.top-t.document.scrollTop()],e(this).removeClass("ui-dialog-dragging"),t._trigger("dragStop",i,r(s)),e.ui.dialog.overlay.resize()}})},_makeResizable:function(n){function u(e){return{originalPosition:e.originalPosition,originalSize:e.originalSize,position:e.position,size:e.size}}n=n===t?this.options.resizable:n;var r=this,i=this.options,s=this.uiDialog.css("position"),o=typeof n=="string"?n:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:this.element,maxWidth:i.maxWidth,maxHeight:i.maxHeight,minWidth:i.minWidth,minHeight:this._minHeight(),handles:o,start:function(t,n){e(this).addClass("ui-dialog-resizing"),r._trigger("resizeStart",t,u(n))},resize:function(e,t){r._trigger("resize",e,u(t))},stop:function(t,n){e(this).removeClass("ui-dialog-resizing"),i.height=e(this).height(),i.width=e(this).width(),r._trigger("resizeStop",t,u(n)),e.ui.dialog.overlay.resize()}}).css("position",s).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var e=this.options;return e.height==="auto"?e.minHeight:Math.min(e.minHeight,e.height)},_position:function(t){var n=[],r=[0,0],i;if(t){if(typeof t=="string"||typeof t=="object"&&"0"in t)n=t.split?t.split(" "):[t[0],t[1]],n.length===1&&(n[1]=n[0]),e.each(["left","top"],function(e,t){+n[e]===n[e]&&(r[e]=n[e],n[e]=t)}),t={my:n[0]+(r[0]<0?r[0]:"+"+r[0])+" "+n[1]+(r[1]<0?r[1]:"+"+r[1]),at:n.join(" ")};t=e.extend({},e.ui.dialog.prototype.options.position,t)}else t=e.ui.dialog.prototype.options.position;i=this.uiDialog.is(":visible"),i||this.uiDialog.show(),this.uiDialog.position(t),i||this.uiDialog.hide()},_setOptions:function(t){var n=this,s={},o=!1;e.each(t,function(e,t){n._setOption(e,t),e in r&&(o=!0),e in i&&(s[e]=t)}),o&&this._size(),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",s)},_setOption:function(t,r){var i,s,o=this.uiDialog;switch(t){case"buttons":this._createButtons(r);break;case"closeText":this.uiDialogTitlebarCloseText.text(""+r);break;case"dialogClass":o.removeClass(this.options.dialogClass).addClass(n+r);break;case"disabled":r?o.addClass("ui-dialog-disabled"):o.removeClass("ui-dialog-disabled");break;case"draggable":i=o.is(":data(draggable)"),i&&!r&&o.draggable("destroy"),!i&&r&&this._makeDraggable();break;case"position":this._position(r);break;case"resizable":s=o.is(":data(resizable)"),s&&!r&&o.resizable("destroy"),s&&typeof r=="string"&&o.resizable("option","handles",r),!s&&r!==!1&&this._makeResizable(r);break;case"title":e(".ui-dialog-title",this.uiDialogTitlebar).html(""+(r||" "))}this._super(t,r)},_size:function(){var t,n,r,i=this.options,s=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0}),i.minWidth>i.width&&(i.width=i.minWidth),t=this.uiDialog.css({height:"auto",width:i.width}).outerHeight(),n=Math.max(0,i.minHeight-t),i.height==="auto"?e.support.minHeight?this.element.css({minHeight:n,height:"auto"}):(this.uiDialog.show(),r=this.element.css("height","auto").height(),s||this.uiDialog.hide(),this.element.height(Math.max(r,n))):this.element.height(Math.max(i.height-t,0)),this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}}),e.extend(e.ui.dialog,{uuid:0,maxZ:0,getTitleId:function(e){var t=e.attr("id");return t||(this.uuid+=1,t=this.uuid),"ui-dialog-title-"+t},overlay:function(t){this.$el=e.ui.dialog.overlay.create(t)}}),e.extend(e.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:e.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(e){return e+".dialog-overlay"}).join(" "),create:function(t){this.instances.length===0&&(setTimeout(function(){e.ui.dialog.overlay.instances.length&&e(document).bind(e.ui.dialog.overlay.events,function(t){if(e(t.target).zIndex()").addClass("ui-widget-overlay");return e(document).bind("keydown.dialog-overlay",function(r){var i=e.ui.dialog.overlay.instances;i.length!==0&&i[i.length-1]===n&&t.options.closeOnEscape&&!r.isDefaultPrevented()&&r.keyCode&&r.keyCode===e.ui.keyCode.ESCAPE&&(t.close(r),r.preventDefault())}),n.appendTo(document.body).css({width:this.width(),height:this.height()}),e.fn.bgiframe&&n.bgiframe(),this.instances.push(n),n},destroy:function(t){var n=e.inArray(t,this.instances),r=0;n!==-1&&this.oldInstances.push(this.instances.splice(n,1)[0]),this.instances.length===0&&e([document,window]).unbind(".dialog-overlay"),t.height(0).width(0).remove(),e.each(this.instances,function(){r=Math.max(r,this.css("z-index"))}),this.maxZ=r},height:function(){var t,n;return e.ui.ie?(t=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight),n=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight),t
      ').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1e3}).css(e(this).offset()).appendTo("body")}),!0):!1)},_mouseStart:function(t){var n=this.options;return this.helper=this._createHelper(t),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),e.ui.ddmanager&&(e.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(),this.offset=this.positionAbs=this.element.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},e.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.originalPosition=this.position=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,n.cursorAt&&this._adjustOffsetFromHelper(n.cursorAt),n.containment&&this._setContainment(),this._trigger("start",t)===!1?(this._clear(),!1):(this._cacheHelperProportions(),e.ui.ddmanager&&!n.dropBehaviour&&e.ui.ddmanager.prepareOffsets(this,t),this._mouseDrag(t,!0),e.ui.ddmanager&&e.ui.ddmanager.dragStart(this,t),!0)},_mouseDrag:function(t,n){this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute");if(!n){var r=this._uiHash();if(this._trigger("drag",t,r)===!1)return this._mouseUp({}),!1;this.position=r.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";return e.ui.ddmanager&&e.ui.ddmanager.drag(this,t),!1},_mouseStop:function(t){var n=!1;e.ui.ddmanager&&!this.options.dropBehaviour&&(n=e.ui.ddmanager.drop(this,t)),this.dropped&&(n=this.dropped,this.dropped=!1);var r=this.element[0],i=!1;while(r&&(r=r.parentNode))r==document&&(i=!0);if(!i&&this.options.helper==="original")return!1;if(this.options.revert=="invalid"&&!n||this.options.revert=="valid"&&n||this.options.revert===!0||e.isFunction(this.options.revert)&&this.options.revert.call(this.element,n)){var s=this;e(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){s._trigger("stop",t)!==!1&&s._clear()})}else this._trigger("stop",t)!==!1&&this._clear();return!1},_mouseUp:function(t){return e("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)}),e.ui.ddmanager&&e.ui.ddmanager.dragStop(this,t),e.ui.mouse.prototype._mouseUp.call(this,t)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(t){var n=!this.options.handle||!e(this.options.handle,this.element).length?!0:!1;return e(this.options.handle,this.element).find("*").andSelf().each(function(){this==t.target&&(n=!0)}),n},_createHelper:function(t){var n=this.options,r=e.isFunction(n.helper)?e(n.helper.apply(this.element[0],[t])):n.helper=="clone"?this.element.clone().removeAttr("id"):this.element;return r.parents("body").length||r.appendTo(n.appendTo=="parent"?this.element[0].parentNode:n.appendTo),r[0]!=this.element[0]&&!/(fixed|absolute)/.test(r.css("position"))&&r.css("position","absolute"),r},_adjustOffsetFromHelper:function(t){typeof t=="string"&&(t=t.split(" ")),e.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var t=this.offsetParent.offset();this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&e.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop());if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&e.ui.ie)t={top:0,left:0};return{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var e=this.element.position();return{top:e.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:e.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t=this.options;t.containment=="parent"&&(t.containment=this.helper[0].parentNode);if(t.containment=="document"||t.containment=="window")this.containment=[t.containment=="document"?0:e(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,t.containment=="document"?0:e(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,(t.containment=="document"?0:e(window).scrollLeft())+e(t.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(t.containment=="document"?0:e(window).scrollTop())+(e(t.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(t.containment)&&t.containment.constructor!=Array){var n=e(t.containment),r=n[0];if(!r)return;var i=n.offset(),s=e(r).css("overflow")!="hidden";this.containment=[(parseInt(e(r).css("borderLeftWidth"),10)||0)+(parseInt(e(r).css("paddingLeft"),10)||0),(parseInt(e(r).css("borderTopWidth"),10)||0)+(parseInt(e(r).css("paddingTop"),10)||0),(s?Math.max(r.scrollWidth,r.offsetWidth):r.offsetWidth)-(parseInt(e(r).css("borderLeftWidth"),10)||0)-(parseInt(e(r).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(s?Math.max(r.scrollHeight,r.offsetHeight):r.offsetHeight)-(parseInt(e(r).css("borderTopWidth"),10)||0)-(parseInt(e(r).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relative_container=n}else t.containment.constructor==Array&&(this.containment=t.containment)},_convertPositionTo:function(t,n){n||(n=this.position);var r=t=="absolute"?1:-1,i=this.options,s=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,o=/(html|body)/i.test(s[0].tagName);return{top:n.top+this.offset.relative.top*r+this.offset.parent.top*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():o?0:s.scrollTop())*r,left:n.left+this.offset.relative.left*r+this.offset.parent.left*r-(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():o?0:s.scrollLeft())*r}},_generatePosition:function(t){var n=this.options,r=this.cssPosition!="absolute"||this.scrollParent[0]!=document&&!!e.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,i=/(html|body)/i.test(r[0].tagName),s=t.pageX,o=t.pageY;if(this.originalPosition){var u;if(this.containment){if(this.relative_container){var a=this.relative_container.offset();u=[this.containment[0]+a.left,this.containment[1]+a.top,this.containment[2]+a.left,this.containment[3]+a.top]}else u=this.containment;t.pageX-this.offset.click.leftu[2]&&(s=u[2]+this.offset.click.left),t.pageY-this.offset.click.top>u[3]&&(o=u[3]+this.offset.click.top)}if(n.grid){var f=n.grid[1]?this.originalPageY+Math.round((o-this.originalPageY)/n.grid[1])*n.grid[1]:this.originalPageY;o=u?f-this.offset.click.topu[3]?f-this.offset.click.topu[2]?l-this.offset.click.left=0;l--){var c=r.snapElements[l].left,h=c+r.snapElements[l].width,p=r.snapElements[l].top,d=p+r.snapElements[l].height;if(!(c-s=l&&o<=c||u>=l&&u<=c||oc)&&(i>=a&&i<=f||s>=a&&s<=f||if);default:return!1}},e.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(t,n){var r=e.ui.ddmanager.droppables[t.options.scope]||[],i=n?n.type:null,s=(t.currentItem||t.element).find(":data(droppable)").andSelf();e:for(var o=0;oe?0:r.max")[0],c,h=t.each;l.style.cssText="background-color:rgba(1,1,1,.5)",f.rgba=l.style.backgroundColor.indexOf("rgba")>-1,h(u,function(e,t){t.cache="_"+e,t.props.alpha={idx:3,type:"percent",def:1}}),o.fn=t.extend(o.prototype,{parse:function(r,i,s,a){if(r===n)return this._rgba=[null,null,null,null],this;if(r.jquery||r.nodeType)r=t(r).css(i),i=n;var f=this,l=t.type(r),v=this._rgba=[];i!==n&&(r=[r,i,s,a],l="array");if(l==="string")return this.parse(d(r)||c._default);if(l==="array")return h(u.rgba.props,function(e,t){v[t.idx]=p(r[t.idx],t)}),this;if(l==="object")return r instanceof o?h(u,function(e,t){r[t.cache]&&(f[t.cache]=r[t.cache].slice())}):h(u,function(t,n){var i=n.cache;h(n.props,function(e,t){if(!f[i]&&n.to){if(e==="alpha"||r[e]==null)return;f[i]=n.to(f._rgba)}f[i][t.idx]=p(r[e],t,!0)}),f[i]&&e.inArray(null,f[i].slice(0,3))<0&&(f[i][3]=1,n.from&&(f._rgba=n.from(f[i])))}),this},is:function(e){var t=o(e),n=!0,r=this;return h(u,function(e,i){var s,o=t[i.cache];return o&&(s=r[i.cache]||i.to&&i.to(r._rgba)||[],h(i.props,function(e,t){if(o[t.idx]!=null)return n=o[t.idx]===s[t.idx],n})),n}),n},_space:function(){var e=[],t=this;return h(u,function(n,r){t[r.cache]&&e.push(n)}),e.pop()},transition:function(e,t){var n=o(e),r=n._space(),i=u[r],s=this.alpha()===0?o("transparent"):this,f=s[i.cache]||i.to(s._rgba),l=f.slice();return n=n[i.cache],h(i.props,function(e,r){var i=r.idx,s=f[i],o=n[i],u=a[r.type]||{};if(o===null)return;s===null?l[i]=o:(u.mod&&(o-s>u.mod/2?s+=u.mod:s-o>u.mod/2&&(s-=u.mod)),l[i]=p((o-s)*t+s,r))}),this[r](l)},blend:function(e){if(this._rgba[3]===1)return this;var n=this._rgba.slice(),r=n.pop(),i=o(e)._rgba;return o(t.map(n,function(e,t){return(1-r)*i[t]+r*e}))},toRgbaString:function(){var e="rgba(",n=t.map(this._rgba,function(e,t){return e==null?t>2?1:0:e});return n[3]===1&&(n.pop(),e="rgb("),e+n.join()+")"},toHslaString:function(){var e="hsla(",n=t.map(this.hsla(),function(e,t){return e==null&&(e=t>2?1:0),t&&t<3&&(e=Math.round(e*100)+"%"),e});return n[3]===1&&(n.pop(),e="hsl("),e+n.join()+")"},toHexString:function(e){var n=this._rgba.slice(),r=n.pop();return e&&n.push(~~(r*255)),"#"+t.map(n,function(e){return e=(e||0).toString(16),e.length===1?"0"+e:e}).join("")},toString:function(){return this._rgba[3]===0?"transparent":this.toRgbaString()}}),o.fn.parse.prototype=o.fn,u.hsla.to=function(e){if(e[0]==null||e[1]==null||e[2]==null)return[null,null,null,e[3]];var t=e[0]/255,n=e[1]/255,r=e[2]/255,i=e[3],s=Math.max(t,n,r),o=Math.min(t,n,r),u=s-o,a=s+o,f=a*.5,l,c;return o===s?l=0:t===s?l=60*(n-r)/u+360:n===s?l=60*(r-t)/u+120:l=60*(t-n)/u+240,f===0||f===1?c=f:f<=.5?c=u/a:c=u/(2-a),[Math.round(l)%360,c,f,i==null?1:i]},u.hsla.from=function(e){if(e[0]==null||e[1]==null||e[2]==null)return[null,null,null,e[3]];var t=e[0]/360,n=e[1],r=e[2],i=e[3],s=r<=.5?r*(1+n):r+n-r*n,o=2*r-s;return[Math.round(v(o,s,t+1/3)*255),Math.round(v(o,s,t)*255),Math.round(v(o,s,t-1/3)*255),i]},h(u,function(e,r){var s=r.props,u=r.cache,a=r.to,f=r.from;o.fn[e]=function(e){a&&!this[u]&&(this[u]=a(this._rgba));if(e===n)return this[u].slice();var r,i=t.type(e),l=i==="array"||i==="object"?e:arguments,c=this[u].slice();return h(s,function(e,t){var n=l[i==="object"?e:t.idx];n==null&&(n=c[t.idx]),c[t.idx]=p(n,t)}),f?(r=o(f(c)),r[u]=c,r):o(c)},h(s,function(n,r){if(o.fn[n])return;o.fn[n]=function(s){var o=t.type(s),u=n==="alpha"?this._hsla?"hsla":"rgba":e,a=this[u](),f=a[r.idx],l;return o==="undefined"?f:(o==="function"&&(s=s.call(this,f),o=t.type(s)),s==null&&r.empty?this:(o==="string"&&(l=i.exec(s),l&&(s=f+parseFloat(l[2])*(l[1]==="+"?1:-1))),a[r.idx]=s,this[u](a)))}})}),h(r,function(e,n){t.cssHooks[n]={set:function(e,r){var i,s,u="";if(t.type(r)!=="string"||(i=d(r))){r=o(i||r);if(!f.rgba&&r._rgba[3]!==1){s=n==="backgroundColor"?e.parentNode:e;while((u===""||u==="transparent")&&s&&s.style)try{u=t.css(s,"backgroundColor"),s=s.parentNode}catch(a){}r=r.blend(u&&u!=="transparent"?u:"_default")}r=r.toRgbaString()}try{e.style[n]=r}catch(l){}}},t.fx.step[n]=function(e){e.colorInit||(e.start=o(e.elem,n),e.end=o(e.end),e.colorInit=!0),t.cssHooks[n].set(e.elem,e.start.transition(e.end,e.pos))}}),t.cssHooks.borderColor={expand:function(e){var t={};return h(["Top","Right","Bottom","Left"],function(n,r){t["border"+r+"Color"]=e}),t}},c=t.Color.names={aqua:"#00ffff",black:"#000000",blue:"#0000ff",fuchsia:"#ff00ff",gray:"#808080",green:"#008000",lime:"#00ff00",maroon:"#800000",navy:"#000080",olive:"#808000",purple:"#800080",red:"#ff0000",silver:"#c0c0c0",teal:"#008080",white:"#ffffff",yellow:"#ffff00",transparent:[null,null,null,0],_default:"#ffffff"}}(jQuery),function(){function i(){var t=this.ownerDocument.defaultView?this.ownerDocument.defaultView.getComputedStyle(this,null):this.currentStyle,n={},r,i;if(t&&t.length&&t[0]&&t[t[0]]){i=t.length;while(i--)r=t[i],typeof t[r]=="string"&&(n[e.camelCase(r)]=t[r])}else for(r in t)typeof t[r]=="string"&&(n[r]=t[r]);return n}function s(t,n){var i={},s,o;for(s in n)o=n[s],t[s]!==o&&!r[s]&&(e.fx.step[s]||!isNaN(parseFloat(o)))&&(i[s]=o);return i}var n=["add","remove","toggle"],r={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};e.each(["borderLeftStyle","borderRightStyle","borderBottomStyle","borderTopStyle"],function(t,n){e.fx.step[n]=function(e){if(e.end!=="none"&&!e.setAttr||e.pos===1&&!e.setAttr)jQuery.style(e.elem,n,e.end),e.setAttr=!0}}),e.effects.animateClass=function(t,r,o,u){var a=e.speed(r,o,u);return this.queue(function(){var r=e(this),o=r.attr("class")||"",u,f=a.children?r.find("*").andSelf():r;f=f.map(function(){var t=e(this);return{el:t,start:i.call(this)}}),u=function(){e.each(n,function(e,n){t[n]&&r[n+"Class"](t[n])})},u(),f=f.map(function(){return this.end=i.call(this.el[0]),this.diff=s(this.start,this.end),this}),r.attr("class",o),f=f.map(function(){var t=this,n=e.Deferred(),r=jQuery.extend({},a,{queue:!1,complete:function(){n.resolve(t)}});return this.el.animate(this.diff,r),n.promise()}),e.when.apply(e,f.get()).done(function(){u(),e.each(arguments,function(){var t=this.el;e.each(this.diff,function(e){t.css(e,"")})}),a.complete.call(r[0])})})},e.fn.extend({_addClass:e.fn.addClass,addClass:function(t,n,r,i){return n?e.effects.animateClass.call(this,{add:t},n,r,i):this._addClass(t)},_removeClass:e.fn.removeClass,removeClass:function(t,n,r,i){return n?e.effects.animateClass.call(this,{remove:t},n,r,i):this._removeClass(t)},_toggleClass:e.fn.toggleClass,toggleClass:function(n,r,i,s,o){return typeof r=="boolean"||r===t?i?e.effects.animateClass.call(this,r?{add:n}:{remove:n},i,s,o):this._toggleClass(n,r):e.effects.animateClass.call(this,{toggle:n},r,i,s)},switchClass:function(t,n,r,i,s){return e.effects.animateClass.call(this,{add:n,remove:t},r,i,s)}})}(),function(){function i(t,n,r,i){e.isPlainObject(t)&&(n=t,t=t.effect),t={effect:t},n==null&&(n={}),e.isFunction(n)&&(i=n,r=null,n={});if(typeof n=="number"||e.fx.speeds[n])i=r,r=n,n={};return e.isFunction(r)&&(i=r,r=null),n&&e.extend(t,n),r=r||n.duration,t.duration=e.fx.off?0:typeof r=="number"?r:r in e.fx.speeds?e.fx.speeds[r]:e.fx.speeds._default,t.complete=i||n.complete,t}function s(t){return!t||typeof t=="number"||e.fx.speeds[t]?!0:typeof t=="string"&&!e.effects.effect[t]?n&&e.effects[t]?!1:!0:!1}e.extend(e.effects,{version:"1.9.2",save:function(e,t){for(var n=0;n
      ").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),i={width:t.width(),height:t.height()},s=document.activeElement;try{s.id}catch(o){s=document.body}return t.wrap(r),(t[0]===s||e.contains(t[0],s))&&e(s).focus(),r=t.parent(),t.css("position")==="static"?(r.css({position:"relative"}),t.css({position:"relative"})):(e.extend(n,{position:t.css("position"),zIndex:t.css("z-index")}),e.each(["top","left","bottom","right"],function(e,r){n[r]=t.css(r),isNaN(parseInt(n[r],10))&&(n[r]="auto")}),t.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),t.css(i),r.css(n).show()},removeWrapper:function(t){var n=document.activeElement;return t.parent().is(".ui-effects-wrapper")&&(t.parent().replaceWith(t),(t[0]===n||e.contains(t[0],n))&&e(n).focus()),t},setTransition:function(t,n,r,i){return i=i||{},e.each(n,function(e,n){var s=t.cssUnit(n);s[0]>0&&(i[n]=s[0]*r+s[1])}),i}}),e.fn.extend({effect:function(){function a(n){function u(){e.isFunction(i)&&i.call(r[0]),e.isFunction(n)&&n()}var r=e(this),i=t.complete,s=t.mode;(r.is(":hidden")?s==="hide":s==="show")?u():o.call(r[0],t,u)}var t=i.apply(this,arguments),r=t.mode,s=t.queue,o=e.effects.effect[t.effect],u=!o&&n&&e.effects[t.effect];return e.fx.off||!o&&!u?r?this[r](t.duration,t.complete):this.each(function(){t.complete&&t.complete.call(this)}):o?s===!1?this.each(a):this.queue(s||"fx",a):u.call(this,{options:t,duration:t.duration,callback:t.complete,mode:t.mode})},_show:e.fn.show,show:function(e){if(s(e))return this._show.apply(this,arguments);var t=i.apply(this,arguments);return t.mode="show",this.effect.call(this,t)},_hide:e.fn.hide,hide:function(e){if(s(e))return this._hide.apply(this,arguments);var t=i.apply(this,arguments);return t.mode="hide",this.effect.call(this,t)},__toggle:e.fn.toggle,toggle:function(t){if(s(t)||typeof t=="boolean"||e.isFunction(t))return this.__toggle.apply(this,arguments);var n=i.apply(this,arguments);return n.mode="toggle",this.effect.call(this,n)},cssUnit:function(t){var n=this.css(t),r=[];return e.each(["em","px","%","pt"],function(e,t){n.indexOf(t)>0&&(r=[parseFloat(n),t])}),r}})}(),function(){var t={};e.each(["Quad","Cubic","Quart","Quint","Expo"],function(e,n){t[n]=function(t){return Math.pow(t,e+2)}}),e.extend(t,{Sine:function(e){return 1-Math.cos(e*Math.PI/2)},Circ:function(e){return 1-Math.sqrt(1-e*e)},Elastic:function(e){return e===0||e===1?e:-Math.pow(2,8*(e-1))*Math.sin(((e-1)*80-7.5)*Math.PI/15)},Back:function(e){return e*e*(3*e-2)},Bounce:function(e){var t,n=4;while(e<((t=Math.pow(2,--n))-1)/11);return 1/Math.pow(4,3-n)-7.5625*Math.pow((t*3-2)/22-e,2)}}),e.each(t,function(t,n){e.easing["easeIn"+t]=n,e.easing["easeOut"+t]=function(e){return 1-n(1-e)},e.easing["easeInOut"+t]=function(e){return e<.5?n(e*2)/2:1-n(e*-2+2)/2}})}()}(jQuery);(function(e,t){var n=/up|down|vertical/,r=/up|left|vertical|horizontal/;e.effects.effect.blind=function(t,i){var s=e(this),o=["position","top","bottom","left","right","height","width"],u=e.effects.setMode(s,t.mode||"hide"),a=t.direction||"up",f=n.test(a),l=f?"height":"width",c=f?"top":"left",h=r.test(a),p={},d=u==="show",v,m,g;s.parent().is(".ui-effects-wrapper")?e.effects.save(s.parent(),o):e.effects.save(s,o),s.show(),v=e.effects.createWrapper(s).css({overflow:"hidden"}),m=v[l](),g=parseFloat(v.css(c))||0,p[l]=d?m:0,h||(s.css(f?"bottom":"right",0).css(f?"top":"left","auto").css({position:"absolute"}),p[c]=d?g:m+g),d&&(v.css(l,0),h||v.css(c,g+m)),v.animate(p,{duration:t.duration,easing:t.easing,queue:!1,complete:function(){u==="hide"&&s.hide(),e.effects.restore(s,o),e.effects.removeWrapper(s),i()}})}})(jQuery);(function(e,t){e.effects.effect.bounce=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"effect"),o=s==="hide",u=s==="show",a=t.direction||"up",f=t.distance,l=t.times||5,c=l*2+(u||o?1:0),h=t.duration/c,p=t.easing,d=a==="up"||a==="down"?"top":"left",v=a==="up"||a==="left",m,g,y,b=r.queue(),w=b.length;(u||o)&&i.push("opacity"),e.effects.save(r,i),r.show(),e.effects.createWrapper(r),f||(f=r[d==="top"?"outerHeight":"outerWidth"]()/3),u&&(y={opacity:1},y[d]=0,r.css("opacity",0).css(d,v?-f*2:f*2).animate(y,h,p)),o&&(f/=Math.pow(2,l-1)),y={},y[d]=0;for(m=0;m1&&b.splice.apply(b,[1,0].concat(b.splice(w,c+1))),r.dequeue()}})(jQuery);(function(e,t){e.effects.effect.clip=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"hide"),o=s==="show",u=t.direction||"vertical",a=u==="vertical",f=a?"height":"width",l=a?"top":"left",c={},h,p,d;e.effects.save(r,i),r.show(),h=e.effects.createWrapper(r).css({overflow:"hidden"}),p=r[0].tagName==="IMG"?h:r,d=p[f](),o&&(p.css(f,0),p.css(l,d/2)),c[f]=o?d:0,c[l]=o?0:d/2,p.animate(c,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){o||r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}})}})(jQuery);(function(e,t){e.effects.effect.drop=function(t,n){var r=e(this),i=["position","top","bottom","left","right","opacity","height","width"],s=e.effects.setMode(r,t.mode||"hide"),o=s==="show",u=t.direction||"left",a=u==="up"||u==="down"?"top":"left",f=u==="up"||u==="left"?"pos":"neg",l={opacity:o?1:0},c;e.effects.save(r,i),r.show(),e.effects.createWrapper(r),c=t.distance||r[a==="top"?"outerHeight":"outerWidth"](!0)/2,o&&r.css("opacity",0).css(a,f==="pos"?-c:c),l[a]=(o?f==="pos"?"+=":"-=":f==="pos"?"-=":"+=")+c,r.animate(l,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){s==="hide"&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}})}})(jQuery);(function(e,t){e.effects.effect.explode=function(t,n){function y(){c.push(this),c.length===r*i&&b()}function b(){s.css({visibility:"visible"}),e(c).remove(),u||s.hide(),n()}var r=t.pieces?Math.round(Math.sqrt(t.pieces)):3,i=r,s=e(this),o=e.effects.setMode(s,t.mode||"hide"),u=o==="show",a=s.show().css("visibility","hidden").offset(),f=Math.ceil(s.outerWidth()/i),l=Math.ceil(s.outerHeight()/r),c=[],h,p,d,v,m,g;for(h=0;h
      ").css({position:"absolute",visibility:"visible",left:-p*f,top:-h*l}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:f,height:l,left:d+(u?m*f:0),top:v+(u?g*l:0),opacity:u?0:1}).animate({left:d+(u?0:m*f),top:v+(u?0:g*l),opacity:u?1:0},t.duration||500,t.easing,y)}}})(jQuery);(function(e,t){e.effects.effect.fade=function(t,n){var r=e(this),i=e.effects.setMode(r,t.mode||"toggle");r.animate({opacity:i},{queue:!1,duration:t.duration,easing:t.easing,complete:n})}})(jQuery);(function(e,t){e.effects.effect.fold=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"hide"),o=s==="show",u=s==="hide",a=t.size||15,f=/([0-9]+)%/.exec(a),l=!!t.horizFirst,c=o!==l,h=c?["width","height"]:["height","width"],p=t.duration/2,d,v,m={},g={};e.effects.save(r,i),r.show(),d=e.effects.createWrapper(r).css({overflow:"hidden"}),v=c?[d.width(),d.height()]:[d.height(),d.width()],f&&(a=parseInt(f[1],10)/100*v[u?0:1]),o&&d.css(l?{height:0,width:a}:{height:a,width:0}),m[h[0]]=o?v[0]:a,g[h[1]]=o?v[1]:0,d.animate(m,p,t.easing).animate(g,p,t.easing,function(){u&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()})}})(jQuery);(function(e,t){e.effects.effect.highlight=function(t,n){var r=e(this),i=["backgroundImage","backgroundColor","opacity"],s=e.effects.setMode(r,t.mode||"show"),o={backgroundColor:r.css("backgroundColor")};s==="hide"&&(o.opacity=0),e.effects.save(r,i),r.show().css({backgroundImage:"none",backgroundColor:t.color||"#ffff99"}).animate(o,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){s==="hide"&&r.hide(),e.effects.restore(r,i),n()}})}})(jQuery);(function(e,t){e.effects.effect.pulsate=function(t,n){var r=e(this),i=e.effects.setMode(r,t.mode||"show"),s=i==="show",o=i==="hide",u=s||i==="hide",a=(t.times||5)*2+(u?1:0),f=t.duration/a,l=0,c=r.queue(),h=c.length,p;if(s||!r.is(":visible"))r.css("opacity",0).show(),l=1;for(p=1;p1&&c.splice.apply(c,[1,0].concat(c.splice(h,a+1))),r.dequeue()}})(jQuery);(function(e,t){e.effects.effect.puff=function(t,n){var r=e(this),i=e.effects.setMode(r,t.mode||"hide"),s=i==="hide",o=parseInt(t.percent,10)||150,u=o/100,a={height:r.height(),width:r.width(),outerHeight:r.outerHeight(),outerWidth:r.outerWidth()};e.extend(t,{effect:"scale",queue:!1,fade:!0,mode:i,complete:n,percent:s?o:100,from:s?a:{height:a.height*u,width:a.width*u,outerHeight:a.outerHeight*u,outerWidth:a.outerWidth*u}}),r.effect(t)},e.effects.effect.scale=function(t,n){var r=e(this),i=e.extend(!0,{},t),s=e.effects.setMode(r,t.mode||"effect"),o=parseInt(t.percent,10)||(parseInt(t.percent,10)===0?0:s==="hide"?0:100),u=t.direction||"both",a=t.origin,f={height:r.height(),width:r.width(),outerHeight:r.outerHeight(),outerWidth:r.outerWidth()},l={y:u!=="horizontal"?o/100:1,x:u!=="vertical"?o/100:1};i.effect="size",i.queue=!1,i.complete=n,s!=="effect"&&(i.origin=a||["middle","center"],i.restore=!0),i.from=t.from||(s==="show"?{height:0,width:0,outerHeight:0,outerWidth:0}:f),i.to={height:f.height*l.y,width:f.width*l.x,outerHeight:f.outerHeight*l.y,outerWidth:f.outerWidth*l.x},i.fade&&(s==="show"&&(i.from.opacity=0,i.to.opacity=1),s==="hide"&&(i.from.opacity=1,i.to.opacity=0)),r.effect(i)},e.effects.effect.size=function(t,n){var r,i,s,o=e(this),u=["position","top","bottom","left","right","width","height","overflow","opacity"],a=["position","top","bottom","left","right","overflow","opacity"],f=["width","height","overflow"],l=["fontSize"],c=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],h=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],p=e.effects.setMode(o,t.mode||"effect"),d=t.restore||p!=="effect",v=t.scale||"both",m=t.origin||["middle","center"],g=o.css("position"),y=d?u:a,b={height:0,width:0,outerHeight:0,outerWidth:0};p==="show"&&o.show(),r={height:o.height(),width:o.width(),outerHeight:o.outerHeight(),outerWidth:o.outerWidth()},t.mode==="toggle"&&p==="show"?(o.from=t.to||b,o.to=t.from||r):(o.from=t.from||(p==="show"?b:r),o.to=t.to||(p==="hide"?b:r)),s={from:{y:o.from.height/r.height,x:o.from.width/r.width},to:{y:o.to.height/r.height,x:o.to.width/r.width}};if(v==="box"||v==="both")s.from.y!==s.to.y&&(y=y.concat(c),o.from=e.effects.setTransition(o,c,s.from.y,o.from),o.to=e.effects.setTransition(o,c,s.to.y,o.to)),s.from.x!==s.to.x&&(y=y.concat(h),o.from=e.effects.setTransition(o,h,s.from.x,o.from),o.to=e.effects.setTransition(o,h,s.to.x,o.to));(v==="content"||v==="both")&&s.from.y!==s.to.y&&(y=y.concat(l).concat(f),o.from=e.effects.setTransition(o,l,s.from.y,o.from),o.to=e.effects.setTransition(o,l,s.to.y,o.to)),e.effects.save(o,y),o.show(),e.effects.createWrapper(o),o.css("overflow","hidden").css(o.from),m&&(i=e.effects.getBaseline(m,r),o.from.top=(r.outerHeight-o.outerHeight())*i.y,o.from.left=(r.outerWidth-o.outerWidth())*i.x,o.to.top=(r.outerHeight-o.to.outerHeight)*i.y,o.to.left=(r.outerWidth-o.to.outerWidth)*i.x),o.css(o.from);if(v==="content"||v==="both")c=c.concat(["marginTop","marginBottom"]).concat(l),h=h.concat(["marginLeft","marginRight"]),f=u.concat(c).concat(h),o.find("*[width]").each(function(){var n=e(this),r={height:n.height(),width:n.width(),outerHeight:n.outerHeight(),outerWidth:n.outerWidth()};d&&e.effects.save(n,f),n.from={height:r.height*s.from.y,width:r.width*s.from.x,outerHeight:r.outerHeight*s.from.y,outerWidth:r.outerWidth*s.from.x},n.to={height:r.height*s.to.y,width:r.width*s.to.x,outerHeight:r.height*s.to.y,outerWidth:r.width*s.to.x},s.from.y!==s.to.y&&(n.from=e.effects.setTransition(n,c,s.from.y,n.from),n.to=e.effects.setTransition(n,c,s.to.y,n.to)),s.from.x!==s.to.x&&(n.from=e.effects.setTransition(n,h,s.from.x,n.from),n.to=e.effects.setTransition(n,h,s.to.x,n.to)),n.css(n.from),n.animate(n.to,t.duration,t.easing,function(){d&&e.effects.restore(n,f)})});o.animate(o.to,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){o.to.opacity===0&&o.css("opacity",o.from.opacity),p==="hide"&&o.hide(),e.effects.restore(o,y),d||(g==="static"?o.css({position:"relative",top:o.to.top,left:o.to.left}):e.each(["top","left"],function(e,t){o.css(t,function(t,n){var r=parseInt(n,10),i=e?o.to.left:o.to.top;return n==="auto"?i+"px":r+i+"px"})})),e.effects.removeWrapper(o),n()}})}})(jQuery);(function(e,t){e.effects.effect.shake=function(t,n){var r=e(this),i=["position","top","bottom","left","right","height","width"],s=e.effects.setMode(r,t.mode||"effect"),o=t.direction||"left",u=t.distance||20,a=t.times||3,f=a*2+1,l=Math.round(t.duration/f),c=o==="up"||o==="down"?"top":"left",h=o==="up"||o==="left",p={},d={},v={},m,g=r.queue(),y=g.length;e.effects.save(r,i),r.show(),e.effects.createWrapper(r),p[c]=(h?"-=":"+=")+u,d[c]=(h?"+=":"-=")+u*2,v[c]=(h?"-=":"+=")+u*2,r.animate(p,l,t.easing);for(m=1;m1&&g.splice.apply(g,[1,0].concat(g.splice(y,f+1))),r.dequeue()}})(jQuery);(function(e,t){e.effects.effect.slide=function(t,n){var r=e(this),i=["position","top","bottom","left","right","width","height"],s=e.effects.setMode(r,t.mode||"show"),o=s==="show",u=t.direction||"left",a=u==="up"||u==="down"?"top":"left",f=u==="up"||u==="left",l,c={};e.effects.save(r,i),r.show(),l=t.distance||r[a==="top"?"outerHeight":"outerWidth"](!0),e.effects.createWrapper(r).css({overflow:"hidden"}),o&&r.css(a,f?isNaN(l)?"-"+l:-l:l),c[a]=(o?f?"+=":"-=":f?"-=":"+=")+l,r.animate(c,{queue:!1,duration:t.duration,easing:t.easing,complete:function(){s==="hide"&&r.hide(),e.effects.restore(r,i),e.effects.removeWrapper(r),n()}})}})(jQuery);(function(e,t){e.effects.effect.transfer=function(t,n){var r=e(this),i=e(t.to),s=i.css("position")==="fixed",o=e("body"),u=s?o.scrollTop():0,a=s?o.scrollLeft():0,f=i.offset(),l={top:f.top-u,left:f.left-a,height:i.innerHeight(),width:i.innerWidth()},c=r.offset(),h=e('
      ').appendTo(document.body).addClass(t.className).css({top:c.top-u,left:c.left-a,height:r.innerHeight(),width:r.innerWidth(),position:s?"fixed":"absolute"}).animate(l,t.duration,t.easing,function(){h.remove(),n()})}})(jQuery);(function(e,t){var n=!1;e.widget("ui.menu",{version:"1.9.2",defaultElement:"
        ",delay:300,options:{icons:{submenu:"ui-icon-carat-1-e"},menus:"ul",position:{my:"left top",at:"right top"},role:"menu",blur:null,focus:null,select:null},_create:function(){this.activeMenu=this.element,this.element.uniqueId().addClass("ui-menu ui-widget ui-widget-content ui-corner-all").toggleClass("ui-menu-icons",!!this.element.find(".ui-icon").length).attr({role:this.options.role,tabIndex:0}).bind("click"+this.eventNamespace,e.proxy(function(e){this.options.disabled&&e.preventDefault()},this)),this.options.disabled&&this.element.addClass("ui-state-disabled").attr("aria-disabled","true"),this._on({"mousedown .ui-menu-item > a":function(e){e.preventDefault()},"click .ui-state-disabled > a":function(e){e.preventDefault()},"click .ui-menu-item:has(a)":function(t){var r=e(t.target).closest(".ui-menu-item");!n&&r.not(".ui-state-disabled").length&&(n=!0,this.select(t),r.has(".ui-menu").length?this.expand(t):this.element.is(":focus")||(this.element.trigger("focus",[!0]),this.active&&this.active.parents(".ui-menu").length===1&&clearTimeout(this.timer)))},"mouseenter .ui-menu-item":function(t){var n=e(t.currentTarget);n.siblings().children(".ui-state-active").removeClass("ui-state-active"),this.focus(t,n)},mouseleave:"collapseAll","mouseleave .ui-menu":"collapseAll",focus:function(e,t){var n=this.active||this.element.children(".ui-menu-item").eq(0);t||this.focus(e,n)},blur:function(t){this._delay(function(){e.contains(this.element[0],this.document[0].activeElement)||this.collapseAll(t)})},keydown:"_keydown"}),this.refresh(),this._on(this.document,{click:function(t){e(t.target).closest(".ui-menu").length||this.collapseAll(t),n=!1}})},_destroy:function(){this.element.removeAttr("aria-activedescendant").find(".ui-menu").andSelf().removeClass("ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons").removeAttr("role").removeAttr("tabIndex").removeAttr("aria-labelledby").removeAttr("aria-expanded").removeAttr("aria-hidden").removeAttr("aria-disabled").removeUniqueId().show(),this.element.find(".ui-menu-item").removeClass("ui-menu-item").removeAttr("role").removeAttr("aria-disabled").children("a").removeUniqueId().removeClass("ui-corner-all ui-state-hover").removeAttr("tabIndex").removeAttr("role").removeAttr("aria-haspopup").children().each(function(){var t=e(this);t.data("ui-menu-submenu-carat")&&t.remove()}),this.element.find(".ui-menu-divider").removeClass("ui-menu-divider ui-widget-content")},_keydown:function(t){function a(e){return e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&")}var n,r,i,s,o,u=!0;switch(t.keyCode){case e.ui.keyCode.PAGE_UP:this.previousPage(t);break;case e.ui.keyCode.PAGE_DOWN:this.nextPage(t);break;case e.ui.keyCode.HOME:this._move("first","first",t);break;case e.ui.keyCode.END:this._move("last","last",t);break;case e.ui.keyCode.UP:this.previous(t);break;case e.ui.keyCode.DOWN:this.next(t);break;case e.ui.keyCode.LEFT:this.collapse(t);break;case e.ui.keyCode.RIGHT:this.active&&!this.active.is(".ui-state-disabled")&&this.expand(t);break;case e.ui.keyCode.ENTER:case e.ui.keyCode.SPACE:this._activate(t);break;case e.ui.keyCode.ESCAPE:this.collapse(t);break;default:u=!1,r=this.previousFilter||"",i=String.fromCharCode(t.keyCode),s=!1,clearTimeout(this.filterTimer),i===r?s=!0:i=r+i,o=new RegExp("^"+a(i),"i"),n=this.activeMenu.children(".ui-menu-item").filter(function(){return o.test(e(this).children("a").text())}),n=s&&n.index(this.active.next())!==-1?this.active.nextAll(".ui-menu-item"):n,n.length||(i=String.fromCharCode(t.keyCode),o=new RegExp("^"+a(i),"i"),n=this.activeMenu.children(".ui-menu-item").filter(function(){return o.test(e(this).children("a").text())})),n.length?(this.focus(t,n),n.length>1?(this.previousFilter=i,this.filterTimer=this._delay(function(){delete this.previousFilter},1e3)):delete this.previousFilter):delete this.previousFilter}u&&t.preventDefault()},_activate:function(e){this.active.is(".ui-state-disabled")||(this.active.children("a[aria-haspopup='true']").length?this.expand(e):this.select(e))},refresh:function(){var t,n=this.options.icons.submenu,r=this.element.find(this.options.menus);r.filter(":not(.ui-menu)").addClass("ui-menu ui-widget ui-widget-content ui-corner-all").hide().attr({role:this.options.role,"aria-hidden":"true","aria-expanded":"false"}).each(function(){var t=e(this),r=t.prev("a"),i=e("").addClass("ui-menu-icon ui-icon "+n).data("ui-menu-submenu-carat",!0);r.attr("aria-haspopup","true").prepend(i),t.attr("aria-labelledby",r.attr("id"))}),t=r.add(this.element),t.children(":not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","presentation").children("a").uniqueId().addClass("ui-corner-all").attr({tabIndex:-1,role:this._itemRole()}),t.children(":not(.ui-menu-item)").each(function(){var t=e(this);/[^\-—–\s]/.test(t.text())||t.addClass("ui-widget-content ui-menu-divider")}),t.children(".ui-state-disabled").attr("aria-disabled","true"),this.active&&!e.contains(this.element[0],this.active[0])&&this.blur()},_itemRole:function(){return{menu:"menuitem",listbox:"option"}[this.options.role]},focus:function(e,t){var n,r;this.blur(e,e&&e.type==="focus"),this._scrollIntoView(t),this.active=t.first(),r=this.active.children("a").addClass("ui-state-focus"),this.options.role&&this.element.attr("aria-activedescendant",r.attr("id")),this.active.parent().closest(".ui-menu-item").children("a:first").addClass("ui-state-active"),e&&e.type==="keydown"?this._close():this.timer=this._delay(function(){this._close()},this.delay),n=t.children(".ui-menu"),n.length&&/^mouse/.test(e.type)&&this._startOpening(n),this.activeMenu=t.parent(),this._trigger("focus",e,{item:t})},_scrollIntoView:function(t){var n,r,i,s,o,u;this._hasScroll()&&(n=parseFloat(e.css(this.activeMenu[0],"borderTopWidth"))||0,r=parseFloat(e.css(this.activeMenu[0],"paddingTop"))||0,i=t.offset().top-this.activeMenu.offset().top-n-r,s=this.activeMenu.scrollTop(),o=this.activeMenu.height(),u=t.height(),i<0?this.activeMenu.scrollTop(s+i):i+u>o&&this.activeMenu.scrollTop(s+i-o+u))},blur:function(e,t){t||clearTimeout(this.timer);if(!this.active)return;this.active.children("a").removeClass("ui-state-focus"),this.active=null,this._trigger("blur",e,{item:this.active})},_startOpening:function(e){clearTimeout(this.timer);if(e.attr("aria-hidden")!=="true")return;this.timer=this._delay(function(){this._close(),this._open(e)},this.delay)},_open:function(t){var n=e.extend({of:this.active},this.options.position);clearTimeout(this.timer),this.element.find(".ui-menu").not(t.parents(".ui-menu")).hide().attr("aria-hidden","true"),t.show().removeAttr("aria-hidden").attr("aria-expanded","true").position(n)},collapseAll:function(t,n){clearTimeout(this.timer),this.timer=this._delay(function(){var r=n?this.element:e(t&&t.target).closest(this.element.find(".ui-menu"));r.length||(r=this.element),this._close(r),this.blur(t),this.activeMenu=r},this.delay)},_close:function(e){e||(e=this.active?this.active.parent():this.element),e.find(".ui-menu").hide().attr("aria-hidden","true").attr("aria-expanded","false").end().find("a.ui-state-active").removeClass("ui-state-active")},collapse:function(e){var t=this.active&&this.active.parent().closest(".ui-menu-item",this.element);t&&t.length&&(this._close(),this.focus(e,t))},expand:function(e){var t=this.active&&this.active.children(".ui-menu ").children(".ui-menu-item").first();t&&t.length&&(this._open(t.parent()),this._delay(function(){this.focus(e,t)}))},next:function(e){this._move("next","first",e)},previous:function(e){this._move("prev","last",e)},isFirstItem:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},isLastItem:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},_move:function(e,t,n){var r;this.active&&(e==="first"||e==="last"?r=this.active[e==="first"?"prevAll":"nextAll"](".ui-menu-item").eq(-1):r=this.active[e+"All"](".ui-menu-item").eq(0));if(!r||!r.length||!this.active)r=this.activeMenu.children(".ui-menu-item")[t]();this.focus(n,r)},nextPage:function(t){var n,r,i;if(!this.active){this.next(t);return}if(this.isLastItem())return;this._hasScroll()?(r=this.active.offset().top,i=this.element.height(),this.active.nextAll(".ui-menu-item").each(function(){return n=e(this),n.offset().top-r-i<0}),this.focus(t,n)):this.focus(t,this.activeMenu.children(".ui-menu-item")[this.active?"last":"first"]())},previousPage:function(t){var n,r,i;if(!this.active){this.next(t);return}if(this.isFirstItem())return;this._hasScroll()?(r=this.active.offset().top,i=this.element.height(),this.active.prevAll(".ui-menu-item").each(function(){return n=e(this),n.offset().top-r+i>0}),this.focus(t,n)):this.focus(t,this.activeMenu.children(".ui-menu-item").first())},_hasScroll:function(){return this.element.outerHeight()
      ").appendTo(this.element),this.oldValue=this._value(),this._refreshValue()},_destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove()},value:function(e){return e===t?this._value():(this._setOption("value",e),this)},_setOption:function(e,t){e==="value"&&(this.options.value=t,this._refreshValue(),this._value()===this.options.max&&this._trigger("complete")),this._super(e,t)},_value:function(){var e=this.options.value;return typeof e!="number"&&(e=0),Math.min(this.options.max,Math.max(this.min,e))},_percentage:function(){return 100*this._value()/this.options.max},_refreshValue:function(){var e=this.value(),t=this._percentage();this.oldValue!==e&&(this.oldValue=e,this._trigger("change")),this.valueDiv.toggle(e>this.min).toggleClass("ui-corner-right",e===this.options.max).width(t.toFixed(0)+"%"),this.element.attr("aria-valuenow",e)}})})(jQuery);(function(e,t){e.widget("ui.resizable",e.ui.mouse,{version:"1.9.2",widgetEventPrefix:"resize",options:{alsoResize:!1,animate:!1,animateDuration:"slow",animateEasing:"swing",aspectRatio:!1,autoHide:!1,containment:!1,ghost:!1,grid:!1,handles:"e,s,se",helper:!1,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1e3},_create:function(){var t=this,n=this.options;this.element.addClass("ui-resizable"),e.extend(this,{_aspectRatio:!!n.aspectRatio,aspectRatio:n.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:n.helper||n.ghost||n.animate?n.helper||"ui-resizable-helper":null}),this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)&&(this.element.wrap(e('
      ').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("resizable",this.element.data("resizable")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=n.handles||(e(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se");if(this.handles.constructor==String){this.handles=="all"&&(this.handles="n,e,s,w,se,sw,ne,nw");var r=this.handles.split(",");this.handles={};for(var i=0;i
      ');u.css({zIndex:n.zIndex}),"se"==s&&u.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[s]=".ui-resizable-"+s,this.element.append(u)}}this._renderAxis=function(t){t=t||this.element;for(var n in this.handles){this.handles[n].constructor==String&&(this.handles[n]=e(this.handles[n],this.element).show());if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var r=e(this.handles[n],this.element),i=0;i=/sw|ne|nw|se|n|s/.test(n)?r.outerHeight():r.outerWidth();var s=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");t.css(s,i),this._proportionallyResize()}if(!e(this.handles[n]).length)continue}},this._renderAxis(this.element),this._handles=e(".ui-resizable-handle",this.element).disableSelection(),this._handles.mouseover(function(){if(!t.resizing){if(this.className)var e=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);t.axis=e&&e[1]?e[1]:"se"}}),n.autoHide&&(this._handles.hide(),e(this.element).addClass("ui-resizable-autohide").mouseenter(function(){if(n.disabled)return;e(this).removeClass("ui-resizable-autohide"),t._handles.show()}).mouseleave(function(){if(n.disabled)return;t.resizing||(e(this).addClass("ui-resizable-autohide"),t._handles.hide())})),this._mouseInit()},_destroy:function(){this._mouseDestroy();var t=function(t){e(t).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){t(this.element);var n=this.element;this.originalElement.css({position:n.css("position"),width:n.outerWidth(),height:n.outerHeight(),top:n.css("top"),left:n.css("left")}).insertAfter(n),n.remove()}return this.originalElement.css("resize",this.originalResizeStyle),t(this.originalElement),this},_mouseCapture:function(t){var n=!1;for(var r in this.handles)e(this.handles[r])[0]==t.target&&(n=!0);return!this.options.disabled&&n},_mouseStart:function(t){var r=this.options,i=this.element.position(),s=this.element;this.resizing=!0,this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()},(s.is(".ui-draggable")||/absolute/.test(s.css("position")))&&s.css({position:"absolute",top:i.top,left:i.left}),this._renderProxy();var o=n(this.helper.css("left")),u=n(this.helper.css("top"));r.containment&&(o+=e(r.containment).scrollLeft()||0,u+=e(r.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:o,top:u},this.size=this._helper?{width:s.outerWidth(),height:s.outerHeight()}:{width:s.width(),height:s.height()},this.originalSize=this._helper?{width:s.outerWidth(),height:s.outerHeight()}:{width:s.width(),height:s.height()},this.originalPosition={left:o,top:u},this.sizeDiff={width:s.outerWidth()-s.width(),height:s.outerHeight()-s.height()},this.originalMousePosition={left:t.pageX,top:t.pageY},this.aspectRatio=typeof r.aspectRatio=="number"?r.aspectRatio:this.originalSize.width/this.originalSize.height||1;var a=e(".ui-resizable-"+this.axis).css("cursor");return e("body").css("cursor",a=="auto"?this.axis+"-resize":a),s.addClass("ui-resizable-resizing"),this._propagate("start",t),!0},_mouseDrag:function(e){var t=this.helper,n=this.options,r={},i=this,s=this.originalMousePosition,o=this.axis,u=e.pageX-s.left||0,a=e.pageY-s.top||0,f=this._change[o];if(!f)return!1;var l=f.apply(this,[e,u,a]);this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey)l=this._updateRatio(l,e);return l=this._respectSize(l,e),this._propagate("resize",e),t.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"}),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),this._updateCache(l),this._trigger("resize",e,this.ui()),!1},_mouseStop:function(t){this.resizing=!1;var n=this.options,r=this;if(this._helper){var i=this._proportionallyResizeElements,s=i.length&&/textarea/i.test(i[0].nodeName),o=s&&e.ui.hasScroll(i[0],"left")?0:r.sizeDiff.height,u=s?0:r.sizeDiff.width,a={width:r.helper.width()-u,height:r.helper.height()-o},f=parseInt(r.element.css("left"),10)+(r.position.left-r.originalPosition.left)||null,l=parseInt(r.element.css("top"),10)+(r.position.top-r.originalPosition.top)||null;n.animate||this.element.css(e.extend(a,{top:l,left:f})),r.helper.height(r.size.height),r.helper.width(r.size.width),this._helper&&!n.animate&&this._proportionallyResize()}return e("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",t),this._helper&&this.helper.remove(),!1},_updateVirtualBoundaries:function(e){var t=this.options,n,i,s,o,u;u={minWidth:r(t.minWidth)?t.minWidth:0,maxWidth:r(t.maxWidth)?t.maxWidth:Infinity,minHeight:r(t.minHeight)?t.minHeight:0,maxHeight:r(t.maxHeight)?t.maxHeight:Infinity};if(this._aspectRatio||e)n=u.minHeight*this.aspectRatio,s=u.minWidth/this.aspectRatio,i=u.maxHeight*this.aspectRatio,o=u.maxWidth/this.aspectRatio,n>u.minWidth&&(u.minWidth=n),s>u.minHeight&&(u.minHeight=s),ie.width,l=r(e.height)&&i.minHeight&&i.minHeight>e.height;f&&(e.width=i.minWidth),l&&(e.height=i.minHeight),u&&(e.width=i.maxWidth),a&&(e.height=i.maxHeight);var c=this.originalPosition.left+this.originalSize.width,h=this.position.top+this.size.height,p=/sw|nw|w/.test(o),d=/nw|ne|n/.test(o);f&&p&&(e.left=c-i.minWidth),u&&p&&(e.left=c-i.maxWidth),l&&d&&(e.top=h-i.minHeight),a&&d&&(e.top=h-i.maxHeight);var v=!e.width&&!e.height;return v&&!e.left&&e.top?e.top=null:v&&!e.top&&e.left&&(e.left=null),e},_proportionallyResize:function(){var t=this.options;if(!this._proportionallyResizeElements.length)return;var n=this.helper||this.element;for(var r=0;r');var r=e.ui.ie6?1:0,i=e.ui.ie6?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+i,height:this.element.outerHeight()+i,position:"absolute",left:this.elementOffset.left-r+"px",top:this.elementOffset.top-r+"px",zIndex:++n.zIndex}),this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(e,t,n){return{width:this.originalSize.width+t}},w:function(e,t,n){var r=this.options,i=this.originalSize,s=this.originalPosition;return{left:s.left+t,width:i.width-t}},n:function(e,t,n){var r=this.options,i=this.originalSize,s=this.originalPosition;return{top:s.top+n,height:i.height-n}},s:function(e,t,n){return{height:this.originalSize.height+n}},se:function(t,n,r){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[t,n,r]))},sw:function(t,n,r){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[t,n,r]))},ne:function(t,n,r){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[t,n,r]))},nw:function(t,n,r){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[t,n,r]))}},_propagate:function(t,n){e.ui.plugin.call(this,t,[n,this.ui()]),t!="resize"&&this._trigger(t,n,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),e.ui.plugin.add("resizable","alsoResize",{start:function(t,n){var r=e(this).data("resizable"),i=r.options,s=function(t){e(t).each(function(){var t=e(this);t.data("resizable-alsoresize",{width:parseInt(t.width(),10),height:parseInt(t.height(),10),left:parseInt(t.css("left"),10),top:parseInt(t.css("top"),10)})})};typeof i.alsoResize=="object"&&!i.alsoResize.parentNode?i.alsoResize.length?(i.alsoResize=i.alsoResize[0],s(i.alsoResize)):e.each(i.alsoResize,function(e){s(e)}):s(i.alsoResize)},resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.originalSize,o=r.originalPosition,u={height:r.size.height-s.height||0,width:r.size.width-s.width||0,top:r.position.top-o.top||0,left:r.position.left-o.left||0},a=function(t,r){e(t).each(function(){var t=e(this),i=e(this).data("resizable-alsoresize"),s={},o=r&&r.length?r:t.parents(n.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(o,function(e,t){var n=(i[t]||0)+(u[t]||0);n&&n>=0&&(s[t]=n||null)}),t.css(s)})};typeof i.alsoResize=="object"&&!i.alsoResize.nodeType?e.each(i.alsoResize,function(e,t){a(e,t)}):a(i.alsoResize)},stop:function(t,n){e(this).removeData("resizable-alsoresize")}}),e.ui.plugin.add("resizable","animate",{stop:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r._proportionallyResizeElements,o=s.length&&/textarea/i.test(s[0].nodeName),u=o&&e.ui.hasScroll(s[0],"left")?0:r.sizeDiff.height,a=o?0:r.sizeDiff.width,f={width:r.size.width-a,height:r.size.height-u},l=parseInt(r.element.css("left"),10)+(r.position.left-r.originalPosition.left)||null,c=parseInt(r.element.css("top"),10)+(r.position.top-r.originalPosition.top)||null;r.element.animate(e.extend(f,c&&l?{top:c,left:l}:{}),{duration:i.animateDuration,easing:i.animateEasing,step:function(){var n={width:parseInt(r.element.css("width"),10),height:parseInt(r.element.css("height"),10),top:parseInt(r.element.css("top"),10),left:parseInt(r.element.css("left"),10)};s&&s.length&&e(s[0]).css({width:n.width,height:n.height}),r._updateCache(n),r._propagate("resize",t)}})}}),e.ui.plugin.add("resizable","containment",{start:function(t,r){var i=e(this).data("resizable"),s=i.options,o=i.element,u=s.containment,a=u instanceof e?u.get(0):/parent/.test(u)?o.parent().get(0):u;if(!a)return;i.containerElement=e(a);if(/document/.test(u)||u==document)i.containerOffset={left:0,top:0},i.containerPosition={left:0,top:0},i.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight};else{var f=e(a),l=[];e(["Top","Right","Left","Bottom"]).each(function(e,t){l[e]=n(f.css("padding"+t))}),i.containerOffset=f.offset(),i.containerPosition=f.position(),i.containerSize={height:f.innerHeight()-l[3],width:f.innerWidth()-l[1]};var c=i.containerOffset,h=i.containerSize.height,p=i.containerSize.width,d=e.ui.hasScroll(a,"left")?a.scrollWidth:p,v=e.ui.hasScroll(a)?a.scrollHeight:h;i.parentData={element:a,left:c.left,top:c.top,width:d,height:v}}},resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.containerSize,o=r.containerOffset,u=r.size,a=r.position,f=r._aspectRatio||t.shiftKey,l={top:0,left:0},c=r.containerElement;c[0]!=document&&/static/.test(c.css("position"))&&(l=o),a.left<(r._helper?o.left:0)&&(r.size.width=r.size.width+(r._helper?r.position.left-o.left:r.position.left-l.left),f&&(r.size.height=r.size.width/r.aspectRatio),r.position.left=i.helper?o.left:0),a.top<(r._helper?o.top:0)&&(r.size.height=r.size.height+(r._helper?r.position.top-o.top:r.position.top),f&&(r.size.width=r.size.height*r.aspectRatio),r.position.top=r._helper?o.top:0),r.offset.left=r.parentData.left+r.position.left,r.offset.top=r.parentData.top+r.position.top;var h=Math.abs((r._helper?r.offset.left-l.left:r.offset.left-l.left)+r.sizeDiff.width),p=Math.abs((r._helper?r.offset.top-l.top:r.offset.top-o.top)+r.sizeDiff.height),d=r.containerElement.get(0)==r.element.parent().get(0),v=/relative|absolute/.test(r.containerElement.css("position"));d&&v&&(h-=r.parentData.left),h+r.size.width>=r.parentData.width&&(r.size.width=r.parentData.width-h,f&&(r.size.height=r.size.width/r.aspectRatio)),p+r.size.height>=r.parentData.height&&(r.size.height=r.parentData.height-p,f&&(r.size.width=r.size.height*r.aspectRatio))},stop:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.position,o=r.containerOffset,u=r.containerPosition,a=r.containerElement,f=e(r.helper),l=f.offset(),c=f.outerWidth()-r.sizeDiff.width,h=f.outerHeight()-r.sizeDiff.height;r._helper&&!i.animate&&/relative/.test(a.css("position"))&&e(this).css({left:l.left-u.left-o.left,width:c,height:h}),r._helper&&!i.animate&&/static/.test(a.css("position"))&&e(this).css({left:l.left-u.left-o.left,width:c,height:h})}}),e.ui.plugin.add("resizable","ghost",{start:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.size;r.ghost=r.originalElement.clone(),r.ghost.css({opacity:.25,display:"block",position:"relative",height:s.height,width:s.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:""),r.ghost.appendTo(r.helper)},resize:function(t,n){var r=e(this).data("resizable"),i=r.options;r.ghost&&r.ghost.css({position:"relative",height:r.size.height,width:r.size.width})},stop:function(t,n){var r=e(this).data("resizable"),i=r.options;r.ghost&&r.helper&&r.helper.get(0).removeChild(r.ghost.get(0))}}),e.ui.plugin.add("resizable","grid",{resize:function(t,n){var r=e(this).data("resizable"),i=r.options,s=r.size,o=r.originalSize,u=r.originalPosition,a=r.axis,f=i._aspectRatio||t.shiftKey;i.grid=typeof i.grid=="number"?[i.grid,i.grid]:i.grid;var l=Math.round((s.width-o.width)/(i.grid[0]||1))*(i.grid[0]||1),c=Math.round((s.height-o.height)/(i.grid[1]||1))*(i.grid[1]||1);/^(se|s|e)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c):/^(ne)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c,r.position.top=u.top-c):/^(sw)$/.test(a)?(r.size.width=o.width+l,r.size.height=o.height+c,r.position.left=u.left-l):(r.size.width=o.width+l,r.size.height=o.height+c,r.position.top=u.top-c,r.position.left=u.left-l)}});var n=function(e){return parseInt(e,10)||0},r=function(e){return!isNaN(parseInt(e,10))}})(jQuery);(function(e,t){e.widget("ui.selectable",e.ui.mouse,{version:"1.9.2",options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch"},_create:function(){var t=this;this.element.addClass("ui-selectable"),this.dragged=!1;var n;this.refresh=function(){n=e(t.options.filter,t.element[0]),n.addClass("ui-selectee"),n.each(function(){var t=e(this),n=t.offset();e.data(this,"selectable-item",{element:this,$element:t,left:n.left,top:n.top,right:n.left+t.outerWidth(),bottom:n.top+t.outerHeight(),startselected:!1,selected:t.hasClass("ui-selected"),selecting:t.hasClass("ui-selecting"),unselecting:t.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=n.addClass("ui-selectee"),this._mouseInit(),this.helper=e("
      ")},_destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled"),this._mouseDestroy()},_mouseStart:function(t){var n=this;this.opos=[t.pageX,t.pageY];if(this.options.disabled)return;var r=this.options;this.selectees=e(r.filter,this.element[0]),this._trigger("start",t),e(r.appendTo).append(this.helper),this.helper.css({left:t.clientX,top:t.clientY,width:0,height:0}),r.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var r=e.data(this,"selectable-item");r.startselected=!0,!t.metaKey&&!t.ctrlKey&&(r.$element.removeClass("ui-selected"),r.selected=!1,r.$element.addClass("ui-unselecting"),r.unselecting=!0,n._trigger("unselecting",t,{unselecting:r.element}))}),e(t.target).parents().andSelf().each(function(){var r=e.data(this,"selectable-item");if(r){var i=!t.metaKey&&!t.ctrlKey||!r.$element.hasClass("ui-selected");return r.$element.removeClass(i?"ui-unselecting":"ui-selected").addClass(i?"ui-selecting":"ui-unselecting"),r.unselecting=!i,r.selecting=i,r.selected=i,i?n._trigger("selecting",t,{selecting:r.element}):n._trigger("unselecting",t,{unselecting:r.element}),!1}})},_mouseDrag:function(t){var n=this;this.dragged=!0;if(this.options.disabled)return;var r=this.options,i=this.opos[0],s=this.opos[1],o=t.pageX,u=t.pageY;if(i>o){var a=o;o=i,i=a}if(s>u){var a=u;u=s,s=a}return this.helper.css({left:i,top:s,width:o-i,height:u-s}),this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!a||a.element==n.element[0])return;var f=!1;r.tolerance=="touch"?f=!(a.left>o||a.rightu||a.bottomi&&a.rights&&a.bottom").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(i.range==="min"||i.range==="max"?" ui-slider-range-"+i.range:""))),r=i.values&&i.values.length||1;for(t=s.length;tn&&(i=n,s=e(this),o=t)}),c.range===!0&&this.values(1)===c.min&&(o+=1,s=e(this.handles[o])),u=this._start(t,o),u===!1?!1:(this._mouseSliding=!0,this._handleIndex=o,s.addClass("ui-state-active").focus(),a=s.offset(),f=!e(t.target).parents().andSelf().is(".ui-slider-handle"),this._clickOffset=f?{left:0,top:0}:{left:t.pageX-a.left-s.width()/2,top:t.pageY-a.top-s.height()/2-(parseInt(s.css("borderTopWidth"),10)||0)-(parseInt(s.css("borderBottomWidth"),10)||0)+(parseInt(s.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(t,o,r),this._animateOff=!0,!0))},_mouseStart:function(){return!0},_mouseDrag:function(e){var t={x:e.pageX,y:e.pageY},n=this._normValueFromMouse(t);return this._slide(e,this._handleIndex,n),!1},_mouseStop:function(e){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(e,this._handleIndex),this._change(e,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1,!1},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(e){var t,n,r,i,s;return this.orientation==="horizontal"?(t=this.elementSize.width,n=e.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(t=this.elementSize.height,n=e.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)),r=n/t,r>1&&(r=1),r<0&&(r=0),this.orientation==="vertical"&&(r=1-r),i=this._valueMax()-this._valueMin(),s=this._valueMin()+r*i,this._trimAlignValue(s)},_start:function(e,t){var n={handle:this.handles[t],value:this.value()};return this.options.values&&this.options.values.length&&(n.value=this.values(t),n.values=this.values()),this._trigger("start",e,n)},_slide:function(e,t,n){var r,i,s;this.options.values&&this.options.values.length?(r=this.values(t?0:1),this.options.values.length===2&&this.options.range===!0&&(t===0&&n>r||t===1&&n1){this.options.values[t]=this._trimAlignValue(n),this._refreshValue(),this._change(null,t);return}if(!arguments.length)return this._values();if(!e.isArray(arguments[0]))return this.options.values&&this.options.values.length?this._values(t):this.value();r=this.options.values,i=arguments[0];for(s=0;s=this._valueMax())return this._valueMax();var t=this.options.step>0?this.options.step:1,n=(e-this._valueMin())%t,r=e-n;return Math.abs(n)*2>=t&&(r+=n>0?t:-t),parseFloat(r.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var t,n,r,i,s,o=this.options.range,u=this.options,a=this,f=this._animateOff?!1:u.animate,l={};this.options.values&&this.options.values.length?this.handles.each(function(r){n=(a.values(r)-a._valueMin())/(a._valueMax()-a._valueMin())*100,l[a.orientation==="horizontal"?"left":"bottom"]=n+"%",e(this).stop(1,1)[f?"animate":"css"](l,u.animate),a.options.range===!0&&(a.orientation==="horizontal"?(r===0&&a.range.stop(1,1)[f?"animate":"css"]({left:n+"%"},u.animate),r===1&&a.range[f?"animate":"css"]({width:n-t+"%"},{queue:!1,duration:u.animate})):(r===0&&a.range.stop(1,1)[f?"animate":"css"]({bottom:n+"%"},u.animate),r===1&&a.range[f?"animate":"css"]({height:n-t+"%"},{queue:!1,duration:u.animate}))),t=n}):(r=this.value(),i=this._valueMin(),s=this._valueMax(),n=s!==i?(r-i)/(s-i)*100:0,l[this.orientation==="horizontal"?"left":"bottom"]=n+"%",this.handle.stop(1,1)[f?"animate":"css"](l,u.animate),o==="min"&&this.orientation==="horizontal"&&this.range.stop(1,1)[f?"animate":"css"]({width:n+"%"},u.animate),o==="max"&&this.orientation==="horizontal"&&this.range[f?"animate":"css"]({width:100-n+"%"},{queue:!1,duration:u.animate}),o==="min"&&this.orientation==="vertical"&&this.range.stop(1,1)[f?"animate":"css"]({height:n+"%"},u.animate),o==="max"&&this.orientation==="vertical"&&this.range[f?"animate":"css"]({height:100-n+"%"},{queue:!1,duration:u.animate}))}})})(jQuery);(function(e,t){e.widget("ui.sortable",e.ui.mouse,{version:"1.9.2",widgetEventPrefix:"sort",ready:!1,options:{appendTo:"parent",axis:!1,connectWith:!1,containment:!1,cursor:"auto",cursorAt:!1,dropOnEmpty:!0,forcePlaceholderSize:!1,forceHelperSize:!1,grid:!1,handle:!1,helper:"original",items:"> *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3},_create:function(){var e=this.options;this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.floating=this.items.length?e.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):!1,this.offset=this.element.offset(),this._mouseInit(),this.ready=!0},_destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled"),this._mouseDestroy();for(var e=this.items.length-1;e>=0;e--)this.items[e].item.removeData(this.widgetName+"-item");return this},_setOption:function(t,n){t==="disabled"?(this.options[t]=n,this.widget().toggleClass("ui-sortable-disabled",!!n)):e.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(t,n){var r=this;if(this.reverting)return!1;if(this.options.disabled||this.options.type=="static")return!1;this._refreshItems(t);var i=null,s=e(t.target).parents().each(function(){if(e.data(this,r.widgetName+"-item")==r)return i=e(this),!1});e.data(t.target,r.widgetName+"-item")==r&&(i=e(t.target));if(!i)return!1;if(this.options.handle&&!n){var o=!1;e(this.options.handle,i).find("*").andSelf().each(function(){this==t.target&&(o=!0)});if(!o)return!1}return this.currentItem=i,this._removeCurrentsFromItems(),!0},_mouseStart:function(t,n,r){var i=this.options;this.currentContainer=this,this.refreshPositions(),this.helper=this._createHelper(t),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},e.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,i.cursorAt&&this._adjustOffsetFromHelper(i.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!=this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),i.containment&&this._setContainment(),i.cursor&&(e("body").css("cursor")&&(this._storedCursor=e("body").css("cursor")),e("body").css("cursor",i.cursor)),i.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",i.opacity)),i.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",i.zIndex)),this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",t,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions();if(!r)for(var s=this.containers.length-1;s>=0;s--)this.containers[s]._trigger("activate",t,this._uiHash(this));return e.ui.ddmanager&&(e.ui.ddmanager.current=this),e.ui.ddmanager&&!i.dropBehaviour&&e.ui.ddmanager.prepareOffsets(this,t),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(t),!0},_mouseDrag:function(t){this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs);if(this.options.scroll){var n=this.options,r=!1;this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-t.pageY=0;i--){var s=this.items[i],o=s.item[0],u=this._intersectsWithPointer(s);if(!u)continue;if(s.instance!==this.currentContainer)continue;if(o!=this.currentItem[0]&&this.placeholder[u==1?"next":"prev"]()[0]!=o&&!e.contains(this.placeholder[0],o)&&(this.options.type=="semi-dynamic"?!e.contains(this.element[0],o):!0)){this.direction=u==1?"down":"up";if(this.options.tolerance!="pointer"&&!this._intersectsWithSides(s))break;this._rearrange(t,s),this._trigger("change",t,this._uiHash());break}}return this._contactContainers(t),e.ui.ddmanager&&e.ui.ddmanager.drag(this,t),this._trigger("sort",t,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(t,n){if(!t)return;e.ui.ddmanager&&!this.options.dropBehaviour&&e.ui.ddmanager.drop(this,t);if(this.options.revert){var r=this,i=this.placeholder.offset();this.reverting=!0,e(this.helper).animate({left:i.left-this.offset.parent.left-this.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:i.top-this.offset.parent.top-this.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){r._clear(t)})}else this._clear(t,n);return!1},cancel:function(){if(this.dragging){this._mouseUp({target:null}),this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var t=this.containers.length-1;t>=0;t--)this.containers[t]._trigger("deactivate",null,this._uiHash(this)),this.containers[t].containerCache.over&&(this.containers[t]._trigger("out",null,this._uiHash(this)),this.containers[t].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),e.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?e(this.domPosition.prev).after(this.currentItem):e(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(t){var n=this._getItemsAsjQuery(t&&t.connected),r=[];return t=t||{},e(n).each(function(){var n=(e(t.item||this).attr(t.attribute||"id")||"").match(t.expression||/(.+)[-=_](.+)/);n&&r.push((t.key||n[1]+"[]")+"="+(t.key&&t.expression?n[1]:n[2]))}),!r.length&&t.key&&r.push(t.key+"="),r.join("&")},toArray:function(t){var n=this._getItemsAsjQuery(t&&t.connected),r=[];return t=t||{},n.each(function(){r.push(e(t.item||this).attr(t.attribute||"id")||"")}),r},_intersectsWith:function(e){var t=this.positionAbs.left,n=t+this.helperProportions.width,r=this.positionAbs.top,i=r+this.helperProportions.height,s=e.left,o=s+e.width,u=e.top,a=u+e.height,f=this.offset.click.top,l=this.offset.click.left,c=r+f>u&&r+fs&&t+le[this.floating?"width":"height"]?c:s0?"down":"up")},_getDragHorizontalDirection:function(){var e=this.positionAbs.left-this.lastPositionAbs.left;return e!=0&&(e>0?"right":"left")},refresh:function(e){return this._refreshItems(e),this.refreshPositions(),this},_connectWith:function(){var e=this.options;return e.connectWith.constructor==String?[e.connectWith]:e.connectWith},_getItemsAsjQuery:function(t){var n=[],r=[],i=this._connectWith();if(i&&t)for(var s=i.length-1;s>=0;s--){var o=e(i[s]);for(var u=o.length-1;u>=0;u--){var a=e.data(o[u],this.widgetName);a&&a!=this&&!a.options.disabled&&r.push([e.isFunction(a.options.items)?a.options.items.call(a.element):e(a.options.items,a.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),a])}}r.push([e.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):e(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(var s=r.length-1;s>=0;s--)r[s][0].each(function(){n.push(this)});return e(n)},_removeCurrentsFromItems:function(){var t=this.currentItem.find(":data("+this.widgetName+"-item)");this.items=e.grep(this.items,function(e){for(var n=0;n=0;s--){var o=e(i[s]);for(var u=o.length-1;u>=0;u--){var a=e.data(o[u],this.widgetName);a&&a!=this&&!a.options.disabled&&(r.push([e.isFunction(a.options.items)?a.options.items.call(a.element[0],t,{item:this.currentItem}):e(a.options.items,a.element),a]),this.containers.push(a))}}for(var s=r.length-1;s>=0;s--){var f=r[s][1],l=r[s][0];for(var u=0,c=l.length;u=0;n--){var r=this.items[n];if(r.instance!=this.currentContainer&&this.currentContainer&&r.item[0]!=this.currentItem[0])continue;var i=this.options.toleranceElement?e(this.options.toleranceElement,r.item):r.item;t||(r.width=i.outerWidth(),r.height=i.outerHeight());var s=i.offset();r.left=s.left,r.top=s.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(var n=this.containers.length-1;n>=0;n--){var s=this.containers[n].element.offset();this.containers[n].containerCache.left=s.left,this.containers[n].containerCache.top=s.top,this.containers[n].containerCache.width=this.containers[n].element.outerWidth(),this.containers[n].containerCache.height=this.containers[n].element.outerHeight()}return this},_createPlaceholder:function(t){t=t||this;var n=t.options;if(!n.placeholder||n.placeholder.constructor==String){var r=n.placeholder;n.placeholder={element:function(){var n=e(document.createElement(t.currentItem[0].nodeName)).addClass(r||t.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];return r||(n.style.visibility="hidden"),n},update:function(e,i){if(r&&!n.forcePlaceholderSize)return;i.height()||i.height(t.currentItem.innerHeight()-parseInt(t.currentItem.css("paddingTop")||0,10)-parseInt(t.currentItem.css("paddingBottom")||0,10)),i.width()||i.width(t.currentItem.innerWidth()-parseInt(t.currentItem.css("paddingLeft")||0,10)-parseInt(t.currentItem.css("paddingRight")||0,10))}}}t.placeholder=e(n.placeholder.element.call(t.element,t.currentItem)),t.currentItem.after(t.placeholder),n.placeholder.update(t,t.placeholder)},_contactContainers:function(t){var n=null,r=null;for(var i=this.containers.length-1;i>=0;i--){if(e.contains(this.currentItem[0],this.containers[i].element[0]))continue;if(this._intersectsWith(this.containers[i].containerCache)){if(n&&e.contains(this.containers[i].element[0],n.element[0]))continue;n=this.containers[i],r=i}else this.containers[i].containerCache.over&&(this.containers[i]._trigger("out",t,this._uiHash(this)),this.containers[i].containerCache.over=0)}if(!n)return;if(this.containers.length===1)this.containers[r]._trigger("over",t,this._uiHash(this)),this.containers[r].containerCache.over=1;else{var s=1e4,o=null,u=this.containers[r].floating?"left":"top",a=this.containers[r].floating?"width":"height",f=this.positionAbs[u]+this.offset.click[u];for(var l=this.items.length-1;l>=0;l--){if(!e.contains(this.containers[r].element[0],this.items[l].item[0]))continue;if(this.items[l].item[0]==this.currentItem[0])continue;var c=this.items[l].item.offset()[u],h=!1;Math.abs(c-f)>Math.abs(c+this.items[l][a]-f)&&(h=!0,c+=this.items[l][a]),Math.abs(c-f)this.containment[2]&&(s=this.containment[2]+this.offset.click.left),t.pageY-this.offset.click.top>this.containment[3]&&(o=this.containment[3]+this.offset.click.top));if(n.grid){var u=this.originalPageY+Math.round((o-this.originalPageY)/n.grid[1])*n.grid[1];o=this.containment?u-this.offset.click.topthis.containment[3]?u-this.offset.click.topthis.containment[2]?a-this.offset.click.left=0;i--)n||r.push(function(e){return function(t){e._trigger("deactivate",t,this._uiHash(this))}}.call(this,this.containers[i])),this.containers[i].containerCache.over&&(r.push(function(e){return function(t){e._trigger("out",t,this._uiHash(this))}}.call(this,this.containers[i])),this.containers[i].containerCache.over=0);this._storedCursor&&e("body").css("cursor",this._storedCursor),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex),this.dragging=!1;if(this.cancelHelperRemoval){if(!n){this._trigger("beforeStop",t,this._uiHash());for(var i=0;i",widgetEventPrefix:"spin",options:{culture:null,icons:{down:"ui-icon-triangle-1-s",up:"ui-icon-triangle-1-n"},incremental:!0,max:null,min:null,numberFormat:null,page:10,step:1,change:null,spin:null,start:null,stop:null},_create:function(){this._setOption("max",this.options.max),this._setOption("min",this.options.min),this._setOption("step",this.options.step),this._value(this.element.val(),!0),this._draw(),this._on(this._events),this._refresh(),this._on(this.window,{beforeunload:function(){this.element.removeAttr("autocomplete")}})},_getCreateOptions:function(){var t={},n=this.element;return e.each(["min","max","step"],function(e,r){var i=n.attr(r);i!==undefined&&i.length&&(t[r]=i)}),t},_events:{keydown:function(e){this._start(e)&&this._keydown(e)&&e.preventDefault()},keyup:"_stop",focus:function(){this.previous=this.element.val()},blur:function(e){if(this.cancelBlur){delete this.cancelBlur;return}this._refresh(),this.previous!==this.element.val()&&this._trigger("change",e)},mousewheel:function(e,t){if(!t)return;if(!this.spinning&&!this._start(e))return!1;this._spin((t>0?1:-1)*this.options.step,e),clearTimeout(this.mousewheelTimer),this.mousewheelTimer=this._delay(function(){this.spinning&&this._stop(e)},100),e.preventDefault()},"mousedown .ui-spinner-button":function(t){function r(){var e=this.element[0]===this.document[0].activeElement;e||(this.element.focus(),this.previous=n,this._delay(function(){this.previous=n}))}var n;n=this.element[0]===this.document[0].activeElement?this.previous:this.element.val(),t.preventDefault(),r.call(this),this.cancelBlur=!0,this._delay(function(){delete this.cancelBlur,r.call(this)});if(this._start(t)===!1)return;this._repeat(null,e(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseup .ui-spinner-button":"_stop","mouseenter .ui-spinner-button":function(t){if(!e(t.currentTarget).hasClass("ui-state-active"))return;if(this._start(t)===!1)return!1;this._repeat(null,e(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseleave .ui-spinner-button":"_stop"},_draw:function(){var e=this.uiSpinner=this.element.addClass("ui-spinner-input").attr("autocomplete","off").wrap(this._uiSpinnerHtml()).parent().append(this._buttonHtml());this.element.attr("role","spinbutton"),this.buttons=e.find(".ui-spinner-button").attr("tabIndex",-1).button().removeClass("ui-corner-all"),this.buttons.height()>Math.ceil(e.height()*.5)&&e.height()>0&&e.height(e.height()),this.options.disabled&&this.disable()},_keydown:function(t){var n=this.options,r=e.ui.keyCode;switch(t.keyCode){case r.UP:return this._repeat(null,1,t),!0;case r.DOWN:return this._repeat(null,-1,t),!0;case r.PAGE_UP:return this._repeat(null,n.page,t),!0;case r.PAGE_DOWN:return this._repeat(null,-n.page,t),!0}return!1},_uiSpinnerHtml:function(){return""},_buttonHtml:function(){return""+""+""+""+""},_start:function(e){return!this.spinning&&this._trigger("start",e)===!1?!1:(this.counter||(this.counter=1),this.spinning=!0,!0)},_repeat:function(e,t,n){e=e||500,clearTimeout(this.timer),this.timer=this._delay(function(){this._repeat(40,t,n)},e),this._spin(t*this.options.step,n)},_spin:function(e,t){var n=this.value()||0;this.counter||(this.counter=1),n=this._adjustValue(n+e*this._increment(this.counter));if(!this.spinning||this._trigger("spin",t,{value:n})!==!1)this._value(n),this.counter++},_increment:function(t){var n=this.options.incremental;return n?e.isFunction(n)?n(t):Math.floor(t*t*t/5e4-t*t/500+17*t/200+1):1},_precision:function(){var e=this._precisionOf(this.options.step);return this.options.min!==null&&(e=Math.max(e,this._precisionOf(this.options.min))),e},_precisionOf:function(e){var t=e.toString(),n=t.indexOf(".");return n===-1?0:t.length-n-1},_adjustValue:function(e){var t,n,r=this.options;return t=r.min!==null?r.min:0,n=e-t,n=Math.round(n/r.step)*r.step,e=t+n,e=parseFloat(e.toFixed(this._precision())),r.max!==null&&e>r.max?r.max:r.min!==null&&e1&&e.href.replace(r,"")===location.href.replace(r,"").replace(/\s/g,"%20")}var n=0,r=/#.*$/;e.widget("ui.tabs",{version:"1.9.2",delay:300,options:{active:null,collapsible:!1,event:"click",heightStyle:"content",hide:null,show:null,activate:null,beforeActivate:null,beforeLoad:null,load:null},_create:function(){var t=this,n=this.options,r=n.active,i=location.hash.substring(1);this.running=!1,this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all").toggleClass("ui-tabs-collapsible",n.collapsible).delegate(".ui-tabs-nav > li","mousedown"+this.eventNamespace,function(t){e(this).is(".ui-state-disabled")&&t.preventDefault()}).delegate(".ui-tabs-anchor","focus"+this.eventNamespace,function(){e(this).closest("li").is(".ui-state-disabled")&&this.blur()}),this._processTabs();if(r===null){i&&this.tabs.each(function(t,n){if(e(n).attr("aria-controls")===i)return r=t,!1}),r===null&&(r=this.tabs.index(this.tabs.filter(".ui-tabs-active")));if(r===null||r===-1)r=this.tabs.length?0:!1}r!==!1&&(r=this.tabs.index(this.tabs.eq(r)),r===-1&&(r=n.collapsible?!1:0)),n.active=r,!n.collapsible&&n.active===!1&&this.anchors.length&&(n.active=0),e.isArray(n.disabled)&&(n.disabled=e.unique(n.disabled.concat(e.map(this.tabs.filter(".ui-state-disabled"),function(e){return t.tabs.index(e)}))).sort()),this.options.active!==!1&&this.anchors.length?this.active=this._findActive(this.options.active):this.active=e(),this._refresh(),this.active.length&&this.load(n.active)},_getCreateEventData:function(){return{tab:this.active,panel:this.active.length?this._getPanelForTab(this.active):e()}},_tabKeydown:function(t){var n=e(this.document[0].activeElement).closest("li"),r=this.tabs.index(n),i=!0;if(this._handlePageNav(t))return;switch(t.keyCode){case e.ui.keyCode.RIGHT:case e.ui.keyCode.DOWN:r++;break;case e.ui.keyCode.UP:case e.ui.keyCode.LEFT:i=!1,r--;break;case e.ui.keyCode.END:r=this.anchors.length-1;break;case e.ui.keyCode.HOME:r=0;break;case e.ui.keyCode.SPACE:t.preventDefault(),clearTimeout(this.activating),this._activate(r);return;case e.ui.keyCode.ENTER:t.preventDefault(),clearTimeout(this.activating),this._activate(r===this.options.active?!1:r);return;default:return}t.preventDefault(),clearTimeout(this.activating),r=this._focusNextTab(r,i),t.ctrlKey||(n.attr("aria-selected","false"),this.tabs.eq(r).attr("aria-selected","true"),this.activating=this._delay(function(){this.option("active",r)},this.delay))},_panelKeydown:function(t){if(this._handlePageNav(t))return;t.ctrlKey&&t.keyCode===e.ui.keyCode.UP&&(t.preventDefault(),this.active.focus())},_handlePageNav:function(t){if(t.altKey&&t.keyCode===e.ui.keyCode.PAGE_UP)return this._activate(this._focusNextTab(this.options.active-1,!1)),!0;if(t.altKey&&t.keyCode===e.ui.keyCode.PAGE_DOWN)return this._activate(this._focusNextTab(this.options.active+1,!0)),!0},_findNextTab:function(t,n){function i(){return t>r&&(t=0),t<0&&(t=r),t}var r=this.tabs.length-1;while(e.inArray(i(),this.options.disabled)!==-1)t=n?t+1:t-1;return t},_focusNextTab:function(e,t){return e=this._findNextTab(e,t),this.tabs.eq(e).focus(),e},_setOption:function(e,t){if(e==="active"){this._activate(t);return}if(e==="disabled"){this._setupDisabled(t);return}this._super(e,t),e==="collapsible"&&(this.element.toggleClass("ui-tabs-collapsible",t),!t&&this.options.active===!1&&this._activate(0)),e==="event"&&this._setupEvents(t),e==="heightStyle"&&this._setupHeightStyle(t)},_tabId:function(e){return e.attr("aria-controls")||"ui-tabs-"+i()},_sanitizeSelector:function(e){return e?e.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g,"\\$&"):""},refresh:function(){var t=this.options,n=this.tablist.children(":has(a[href])");t.disabled=e.map(n.filter(".ui-state-disabled"),function(e){return n.index(e)}),this._processTabs(),t.active===!1||!this.anchors.length?(t.active=!1,this.active=e()):this.active.length&&!e.contains(this.tablist[0],this.active[0])?this.tabs.length===t.disabled.length?(t.active=!1,this.active=e()):this._activate(this._findNextTab(Math.max(0,t.active-1),!1)):t.active=this.tabs.index(this.active),this._refresh()},_refresh:function(){this._setupDisabled(this.options.disabled),this._setupEvents(this.options.event),this._setupHeightStyle(this.options.heightStyle),this.tabs.not(this.active).attr({"aria-selected":"false",tabIndex:-1}),this.panels.not(this._getPanelForTab(this.active)).hide().attr({"aria-expanded":"false","aria-hidden":"true"}),this.active.length?(this.active.addClass("ui-tabs-active ui-state-active").attr({"aria-selected":"true",tabIndex:0}),this._getPanelForTab(this.active).show().attr({"aria-expanded":"true","aria-hidden":"false"})):this.tabs.eq(0).attr("tabIndex",0)},_processTabs:function(){var t=this;this.tablist=this._getList().addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").attr("role","tablist"),this.tabs=this.tablist.find("> li:has(a[href])").addClass("ui-state-default ui-corner-top").attr({role:"tab",tabIndex:-1}),this.anchors=this.tabs.map(function(){return e("a",this)[0]}).addClass("ui-tabs-anchor").attr({role:"presentation",tabIndex:-1}),this.panels=e(),this.anchors.each(function(n,r){var i,o,u,a=e(r).uniqueId().attr("id"),f=e(r).closest("li"),l=f.attr("aria-controls");s(r)?(i=r.hash,o=t.element.find(t._sanitizeSelector(i))):(u=t._tabId(f),i="#"+u,o=t.element.find(i),o.length||(o=t._createPanel(u),o.insertAfter(t.panels[n-1]||t.tablist)),o.attr("aria-live","polite")),o.length&&(t.panels=t.panels.add(o)),l&&f.data("ui-tabs-aria-controls",l),f.attr({"aria-controls":i.substring(1),"aria-labelledby":a}),o.attr("aria-labelledby",a)}),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").attr("role","tabpanel")},_getList:function(){return this.element.find("ol,ul").eq(0)},_createPanel:function(t){return e("
      ").attr("id",t).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").data("ui-tabs-destroy",!0)},_setupDisabled:function(t){e.isArray(t)&&(t.length?t.length===this.anchors.length&&(t=!0):t=!1);for(var n=0,r;r=this.tabs[n];n++)t===!0||e.inArray(n,t)!==-1?e(r).addClass("ui-state-disabled").attr("aria-disabled","true"):e(r).removeClass("ui-state-disabled").removeAttr("aria-disabled");this.options.disabled=t},_setupEvents:function(t){var n={click:function(e){e.preventDefault()}};t&&e.each(t.split(" "),function(e,t){n[t]="_eventHandler"}),this._off(this.anchors.add(this.tabs).add(this.panels)),this._on(this.anchors,n),this._on(this.tabs,{keydown:"_tabKeydown"}),this._on(this.panels,{keydown:"_panelKeydown"}),this._focusable(this.tabs),this._hoverable(this.tabs)},_setupHeightStyle:function(t){var n,r,i=this.element.parent();t==="fill"?(e.support.minHeight||(r=i.css("overflow"),i.css("overflow","hidden")),n=i.height(),this.element.siblings(":visible").each(function(){var t=e(this),r=t.css("position");if(r==="absolute"||r==="fixed")return;n-=t.outerHeight(!0)}),r&&i.css("overflow",r),this.element.children().not(this.panels).each(function(){n-=e(this).outerHeight(!0)}),this.panels.each(function(){e(this).height(Math.max(0,n-e(this).innerHeight()+e(this).height()))}).css("overflow","auto")):t==="auto"&&(n=0,this.panels.each(function(){n=Math.max(n,e(this).height("").height())}).height(n))},_eventHandler:function(t){var n=this.options,r=this.active,i=e(t.currentTarget),s=i.closest("li"),o=s[0]===r[0],u=o&&n.collapsible,a=u?e():this._getPanelForTab(s),f=r.length?this._getPanelForTab(r):e(),l={oldTab:r,oldPanel:f,newTab:u?e():s,newPanel:a};t.preventDefault();if(s.hasClass("ui-state-disabled")||s.hasClass("ui-tabs-loading")||this.running||o&&!n.collapsible||this._trigger("beforeActivate",t,l)===!1)return;n.active=u?!1:this.tabs.index(s),this.active=o?e():s,this.xhr&&this.xhr.abort(),!f.length&&!a.length&&e.error("jQuery UI Tabs: Mismatching fragment identifier."),a.length&&this.load(this.tabs.index(s),t),this._toggle(t,l)},_toggle:function(t,n){function o(){r.running=!1,r._trigger("activate",t,n)}function u(){n.newTab.closest("li").addClass("ui-tabs-active ui-state-active"),i.length&&r.options.show?r._show(i,r.options.show,o):(i.show(),o())}var r=this,i=n.newPanel,s=n.oldPanel;this.running=!0,s.length&&this.options.hide?this._hide(s,this.options.hide,function(){n.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),u()}):(n.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),s.hide(),u()),s.attr({"aria-expanded":"false","aria-hidden":"true"}),n.oldTab.attr("aria-selected","false"),i.length&&s.length?n.oldTab.attr("tabIndex",-1):i.length&&this.tabs.filter(function(){return e(this).attr("tabIndex")===0}).attr("tabIndex",-1),i.attr({"aria-expanded":"true","aria-hidden":"false"}),n.newTab.attr({"aria-selected":"true",tabIndex:0})},_activate:function(t){var n,r=this._findActive(t);if(r[0]===this.active[0])return;r.length||(r=this.active),n=r.find(".ui-tabs-anchor")[0],this._eventHandler({target:n,currentTarget:n,preventDefault:e.noop})},_findActive:function(t){return t===!1?e():this.tabs.eq(t)},_getIndex:function(e){return typeof e=="string"&&(e=this.anchors.index(this.anchors.filter("[href$='"+e+"']"))),e},_destroy:function(){this.xhr&&this.xhr.abort(),this.element.removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible"),this.tablist.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").removeAttr("role"),this.anchors.removeClass("ui-tabs-anchor").removeAttr("role").removeAttr("tabIndex").removeData("href.tabs").removeData("load.tabs").removeUniqueId(),this.tabs.add(this.panels).each(function(){e.data(this,"ui-tabs-destroy")?e(this).remove():e(this).removeClass("ui-state-default ui-state-active ui-state-disabled ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel").removeAttr("tabIndex").removeAttr("aria-live").removeAttr("aria-busy").removeAttr("aria-selected").removeAttr("aria-labelledby").removeAttr("aria-hidden").removeAttr("aria-expanded").removeAttr("role")}),this.tabs.each(function(){var t=e(this),n=t.data("ui-tabs-aria-controls");n?t.attr("aria-controls",n):t.removeAttr("aria-controls")}),this.panels.show(),this.options.heightStyle!=="content"&&this.panels.css("height","")},enable:function(n){var r=this.options.disabled;if(r===!1)return;n===t?r=!1:(n=this._getIndex(n),e.isArray(r)?r=e.map(r,function(e){return e!==n?e:null}):r=e.map(this.tabs,function(e,t){return t!==n?t:null})),this._setupDisabled(r)},disable:function(n){var r=this.options.disabled;if(r===!0)return;if(n===t)r=!0;else{n=this._getIndex(n);if(e.inArray(n,r)!==-1)return;e.isArray(r)?r=e.merge([n],r).sort():r=[n]}this._setupDisabled(r)},load:function(t,n){t=this._getIndex(t);var r=this,i=this.tabs.eq(t),o=i.find(".ui-tabs-anchor"),u=this._getPanelForTab(i),a={tab:i,panel:u};if(s(o[0]))return;this.xhr=e.ajax(this._ajaxSettings(o,n,a)),this.xhr&&this.xhr.statusText!=="canceled"&&(i.addClass("ui-tabs-loading"),u.attr("aria-busy","true"),this.xhr.success(function(e){setTimeout(function(){u.html(e),r._trigger("load",n,a)},1)}).complete(function(e,t){setTimeout(function(){t==="abort"&&r.panels.stop(!1,!0),i.removeClass("ui-tabs-loading"),u.removeAttr("aria-busy"),e===r.xhr&&delete r.xhr},1)}))},_ajaxSettings:function(t,n,r){var i=this;return{url:t.attr("href"),beforeSend:function(t,s){return i._trigger("beforeLoad",n,e.extend({jqXHR:t,ajaxSettings:s},r))}}},_getPanelForTab:function(t){var n=e(t).attr("aria-controls");return this.element.find(this._sanitizeSelector("#"+n))}}),e.uiBackCompat!==!1&&(e.ui.tabs.prototype._ui=function(e,t){return{tab:e,panel:t,index:this.anchors.index(e)}},e.widget("ui.tabs",e.ui.tabs,{url:function(e,t){this.anchors.eq(e).attr("href",t)}}),e.widget("ui.tabs",e.ui.tabs,{options:{ajaxOptions:null,cache:!1},_create:function(){this._super();var t=this;this._on({tabsbeforeload:function(n,r){if(e.data(r.tab[0],"cache.tabs")){n.preventDefault();return}r.jqXHR.success(function(){t.options.cache&&e.data(r.tab[0],"cache.tabs",!0)})}})},_ajaxSettings:function(t,n,r){var i=this.options.ajaxOptions;return e.extend({},i,{error:function(e,t){try{i.error(e,t,r.tab.closest("li").index(),r.tab[0])}catch(n){}}},this._superApply(arguments))},_setOption:function(e,t){e==="cache"&&t===!1&&this.anchors.removeData("cache.tabs"),this._super(e,t)},_destroy:function(){this.anchors.removeData("cache.tabs"),this._super()},url:function(e){this.anchors.eq(e).removeData("cache.tabs"),this._superApply(arguments)}}),e.widget("ui.tabs",e.ui.tabs,{abort:function(){this.xhr&&this.xhr.abort()}}),e.widget("ui.tabs",e.ui.tabs,{options:{spinner:"Loading…"},_create:function(){this._super(),this._on({tabsbeforeload:function(e,t){if(e.target!==this.element[0]||!this.options.spinner)return;var n=t.tab.find("span"),r=n.html();n.html(this.options.spinner),t.jqXHR.complete(function(){n.html(r)})}})}}),e.widget("ui.tabs",e.ui.tabs,{options:{enable:null,disable:null},enable:function(t){var n=this.options,r;if(t&&n.disabled===!0||e.isArray(n.disabled)&&e.inArray(t,n.disabled)!==-1)r=!0;this._superApply(arguments),r&&this._trigger("enable",null,this._ui(this.anchors[t],this.panels[t]))},disable:function(t){var n=this.options,r;if(t&&n.disabled===!1||e.isArray(n.disabled)&&e.inArray(t,n.disabled)===-1)r=!0;this._superApply(arguments),r&&this._trigger("disable",null,this._ui(this.anchors[t],this.panels[t]))}}),e.widget("ui.tabs",e.ui.tabs,{options:{add:null,remove:null,tabTemplate:"
    • #{label}
    • "},add:function(n,r,i){i===t&&(i=this.anchors.length);var s,o,u=this.options,a=e(u.tabTemplate.replace(/#\{href\}/g,n).replace(/#\{label\}/g,r)),f=n.indexOf("#")?this._tabId(a):n.replace("#","");return a.addClass("ui-state-default ui-corner-top").data("ui-tabs-destroy",!0),a.attr("aria-controls",f),s=i>=this.tabs.length,o=this.element.find("#"+f),o.length||(o=this._createPanel(f),s?i>0?o.insertAfter(this.panels.eq(-1)):o.appendTo(this.element):o.insertBefore(this.panels[i])),o.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").hide(),s?a.appendTo(this.tablist):a.insertBefore(this.tabs[i]),u.disabled=e.map(u.disabled,function(e){return e>=i?++e:e}),this.refresh(),this.tabs.length===1&&u.active===!1&&this.option("active",0),this._trigger("add",null,this._ui(this.anchors[i],this.panels[i])),this},remove:function(t){t=this._getIndex(t);var n=this.options,r=this.tabs.eq(t).remove(),i=this._getPanelForTab(r).remove();return r.hasClass("ui-tabs-active")&&this.anchors.length>2&&this._activate(t+(t+1=t?--e:e}),this.refresh(),this._trigger("remove",null,this._ui(r.find("a")[0],i[0])),this}}),e.widget("ui.tabs",e.ui.tabs,{length:function(){return this.anchors.length}}),e.widget("ui.tabs",e.ui.tabs,{options:{idPrefix:"ui-tabs-"},_tabId:function(t){var n=t.is("li")?t.find("a[href]"):t;return n=n[0],e(n).closest("li").attr("aria-controls")||n.title&&n.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF\-]/g,"")||this.options.idPrefix+i()}}),e.widget("ui.tabs",e.ui.tabs,{options:{panelTemplate:"
      "},_createPanel:function(t){return e(this.options.panelTemplate).attr("id",t).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").data("ui-tabs-destroy",!0)}}),e.widget("ui.tabs",e.ui.tabs,{_create:function(){var e=this.options;e.active===null&&e.selected!==t&&(e.active=e.selected===-1?!1:e.selected),this._super(),e.selected=e.active,e.selected===!1&&(e.selected=-1)},_setOption:function(e,t){if(e!=="selected")return this._super(e,t);var n=this.options;this._super("active",t===-1?!1:t),n.selected=n.active,n.selected===!1&&(n.selected=-1)},_eventHandler:function(){this._superApply(arguments),this.options.selected=this.options.active,this.options.selected===!1&&(this.options.selected=-1)}}),e.widget("ui.tabs",e.ui.tabs,{options:{show:null,select:null},_create:function(){this._super(),this.options.active!==!1&&this._trigger("show",null,this._ui(this.active.find(".ui-tabs-anchor")[0],this._getPanelForTab(this.active)[0]))},_trigger:function(e,t,n){var r,i,s=this._superApply(arguments);return s?(e==="beforeActivate"?(r=n.newTab.length?n.newTab:n.oldTab,i=n.newPanel.length?n.newPanel:n.oldPanel,s=this._super("select",t,{tab:r.find(".ui-tabs-anchor")[0],panel:i[0],index:r.closest("li").index()})):e==="activate"&&n.newTab.length&&(s=this._super("show",t,{tab:n.newTab.find(".ui-tabs-anchor")[0],panel:n.newPanel[0],index:n.newTab.closest("li").index()})),s):!1}}),e.widget("ui.tabs",e.ui.tabs,{select:function(e){e=this._getIndex(e);if(e===-1){if(!this.options.collapsible||this.options.selected===-1)return;e=this.options.selected}this.anchors.eq(e).trigger(this.options.event+this.eventNamespace)}}),function(){var t=0;e.widget("ui.tabs",e.ui.tabs,{options:{cookie:null},_create:function(){var e=this.options,t;e.active==null&&e.cookie&&(t=parseInt(this._cookie(),10),t===-1&&(t=!1),e.active=t),this._super()},_cookie:function(n){var r=[this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+ ++t)];return arguments.length&&(r.push(n===!1?-1:n),r.push(this.options.cookie)),e.cookie.apply(null,r)},_refresh:function(){this._super(),this.options.cookie&&this._cookie(this.options.active,this.options.cookie)},_eventHandler:function(){this._superApply(arguments),this.options.cookie&&this._cookie(this.options.active,this.options.cookie)},_destroy:function(){this._super(),this.options.cookie&&this._cookie(null,this.options.cookie)}})}(),e.widget("ui.tabs",e.ui.tabs,{_trigger:function(t,n,r){var i=e.extend({},r);return t==="load"&&(i.panel=i.panel[0],i.tab=i.tab.find(".ui-tabs-anchor")[0]),this._super(t,n,i)}}),e.widget("ui.tabs",e.ui.tabs,{options:{fx:null},_getFx:function(){var t,n,r=this.options.fx;return r&&(e.isArray(r)?(t=r[0],n=r[1]):t=n=r),r?{show:n,hide:t}:null},_toggle:function(e,t){function o(){n.running=!1,n._trigger("activate",e,t)}function u(){t.newTab.closest("li").addClass("ui-tabs-active ui-state-active"),r.length&&s.show?r.animate(s.show,s.show.duration,function(){o()}):(r.show(),o())}var n=this,r=t.newPanel,i=t.oldPanel,s=this._getFx();if(!s)return this._super(e,t);n.running=!0,i.length&&s.hide?i.animate(s.hide,s.hide.duration,function(){t.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),u()}):(t.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),i.hide(),u())}}))})(jQuery);(function(e){function n(t,n){var r=(t.attr("aria-describedby")||"").split(/\s+/);r.push(n),t.data("ui-tooltip-id",n).attr("aria-describedby",e.trim(r.join(" ")))}function r(t){var n=t.data("ui-tooltip-id"),r=(t.attr("aria-describedby")||"").split(/\s+/),i=e.inArray(n,r);i!==-1&&r.splice(i,1),t.removeData("ui-tooltip-id"),r=e.trim(r.join(" ")),r?t.attr("aria-describedby",r):t.removeAttr("aria-describedby")}var t=0;e.widget("ui.tooltip",{version:"1.9.2",options:{content:function(){return e(this).attr("title")},hide:!0,items:"[title]:not([disabled])",position:{my:"left top+15",at:"left bottom",collision:"flipfit flip"},show:!0,tooltipClass:null,track:!1,close:null,open:null},_create:function(){this._on({mouseover:"open",focusin:"open"}),this.tooltips={},this.parents={},this.options.disabled&&this._disable()},_setOption:function(t,n){var r=this;if(t==="disabled"){this[n?"_disable":"_enable"](),this.options[t]=n;return}this._super(t,n),t==="content"&&e.each(this.tooltips,function(e,t){r._updateContent(t)})},_disable:function(){var t=this;e.each(this.tooltips,function(n,r){var i=e.Event("blur");i.target=i.currentTarget=r[0],t.close(i,!0)}),this.element.find(this.options.items).andSelf().each(function(){var t=e(this);t.is("[title]")&&t.data("ui-tooltip-title",t.attr("title")).attr("title","")})},_enable:function(){this.element.find(this.options.items).andSelf().each(function(){var t=e(this);t.data("ui-tooltip-title")&&t.attr("title",t.data("ui-tooltip-title"))})},open:function(t){var n=this,r=e(t?t.target:this.element).closest(this.options.items);if(!r.length||r.data("ui-tooltip-id"))return;r.attr("title")&&r.data("ui-tooltip-title",r.attr("title")),r.data("ui-tooltip-open",!0),t&&t.type==="mouseover"&&r.parents().each(function(){var t=e(this),r;t.data("ui-tooltip-open")&&(r=e.Event("blur"),r.target=r.currentTarget=this,n.close(r,!0)),t.attr("title")&&(t.uniqueId(),n.parents[this.id]={element:this,title:t.attr("title")},t.attr("title",""))}),this._updateContent(r,t)},_updateContent:function(e,t){var n,r=this.options.content,i=this,s=t?t.type:null;if(typeof r=="string")return this._open(t,e,r);n=r.call(e[0],function(n){if(!e.data("ui-tooltip-open"))return;i._delay(function(){t&&(t.type=s),this._open(t,e,n)})}),n&&this._open(t,e,n)},_open:function(t,r,i){function f(e){a.of=e;if(s.is(":hidden"))return;s.position(a)}var s,o,u,a=e.extend({},this.options.position);if(!i)return;s=this._find(r);if(s.length){s.find(".ui-tooltip-content").html(i);return}r.is("[title]")&&(t&&t.type==="mouseover"?r.attr("title",""):r.removeAttr("title")),s=this._tooltip(r),n(r,s.attr("id")),s.find(".ui-tooltip-content").html(i),this.options.track&&t&&/^mouse/.test(t.type)?(this._on(this.document,{mousemove:f}),f(t)):s.position(e.extend({of:r},this.options.position)),s.hide(),this._show(s,this.options.show),this.options.show&&this.options.show.delay&&(u=setInterval(function(){s.is(":visible")&&(f(a.of),clearInterval(u))},e.fx.interval)),this._trigger("open",t,{tooltip:s}),o={keyup:function(t){if(t.keyCode===e.ui.keyCode.ESCAPE){var n=e.Event(t);n.currentTarget=r[0],this.close(n,!0)}},remove:function(){this._removeTooltip(s)}};if(!t||t.type==="mouseover")o.mouseleave="close";if(!t||t.type==="focusin")o.focusout="close";this._on(!0,r,o)},close:function(t){var n=this,i=e(t?t.currentTarget:this.element),s=this._find(i);if(this.closing)return;i.data("ui-tooltip-title")&&i.attr("title",i.data("ui-tooltip-title")),r(i),s.stop(!0),this._hide(s,this.options.hide,function(){n._removeTooltip(e(this))}),i.removeData("ui-tooltip-open"),this._off(i,"mouseleave focusout keyup"),i[0]!==this.element[0]&&this._off(i,"remove"),this._off(this.document,"mousemove"),t&&t.type==="mouseleave"&&e.each(this.parents,function(t,r){e(r.element).attr("title",r.title),delete n.parents[t]}),this.closing=!0,this._trigger("close",t,{tooltip:s}),this.closing=!1},_tooltip:function(n){var r="ui-tooltip-"+t++,i=e("
      ").attr({id:r,role:"tooltip"}).addClass("ui-tooltip ui-widget ui-corner-all ui-widget-content "+(this.options.tooltipClass||""));return e("
      ").addClass("ui-tooltip-content").appendTo(i),i.appendTo(this.document[0].body),e.fn.bgiframe&&i.bgiframe(),this.tooltips[r]=n,i},_find:function(t){var n=t.data("ui-tooltip-id");return n?e("#"+n):e()},_removeTooltip:function(e){e.remove(),delete this.tooltips[e.attr("id")]},_destroy:function(){var t=this;e.each(this.tooltips,function(n,r){var i=e.Event("blur");i.target=i.currentTarget=r[0],t.close(i,!0),e("#"+n).remove(),r.data("ui-tooltip-title")&&(r.attr("title",r.data("ui-tooltip-title")),r.removeData("ui-tooltip-title"))})}})})(jQuery); \ No newline at end of file diff --git a/lib/scripts/jquery/jquery.cookie.js b/lib/scripts/jquery/jquery.cookie.js index 6a3e394b4..2d4c05a84 100644 --- a/lib/scripts/jquery/jquery.cookie.js +++ b/lib/scripts/jquery/jquery.cookie.js @@ -1,41 +1,72 @@ -/** - * jQuery Cookie plugin +/*! + * jQuery Cookie Plugin v1.3 + * https://github.com/carhartl/jquery-cookie * - * Copyright (c) 2010 Klaus Hartl (stilbuero.de) - * Dual licensed under the MIT and GPL licenses: + * Copyright 2011, Klaus Hartl + * Dual licensed under the MIT or GPL Version 2 licenses. * http://www.opensource.org/licenses/mit-license.php - * http://www.gnu.org/licenses/gpl.html - * + * http://www.opensource.org/licenses/GPL-2.0 */ -jQuery.cookie = function (key, value, options) { - - // key and at least value given, set cookie... - if (arguments.length > 1 && String(value) !== "[object Object]") { - options = jQuery.extend({}, options); - - if (value === null || value === undefined) { - options.expires = -1; - } - - if (typeof options.expires === 'number') { - var days = options.expires, t = options.expires = new Date(); - t.setDate(t.getDate() + days); - } - - value = String(value); - - return (document.cookie = [ - encodeURIComponent(key), '=', - options.raw ? value : encodeURIComponent(value), - options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE - options.path ? '; path=' + options.path : '', - options.domain ? '; domain=' + options.domain : '', - options.secure ? '; secure' : '' - ].join('')); - } - - // key and possibly options given, get cookie... - options = value || {}; - var result, decode = options.raw ? function (s) { return s; } : decodeURIComponent; - return (result = new RegExp('(?:^|; )' + encodeURIComponent(key) + '=([^;]*)').exec(document.cookie)) ? decode(result[1]) : null; -}; +(function ($, document, undefined) { + + var pluses = /\+/g; + + function raw(s) { + return s; + } + + function decoded(s) { + return decodeURIComponent(s.replace(pluses, ' ')); + } + + var config = $.cookie = function (key, value, options) { + + // write + if (value !== undefined) { + options = $.extend({}, config.defaults, options); + + if (value === null) { + options.expires = -1; + } + + if (typeof options.expires === 'number') { + var days = options.expires, t = options.expires = new Date(); + t.setDate(t.getDate() + days); + } + + value = config.json ? JSON.stringify(value) : String(value); + + return (document.cookie = [ + encodeURIComponent(key), '=', config.raw ? value : encodeURIComponent(value), + options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE + options.path ? '; path=' + options.path : '', + options.domain ? '; domain=' + options.domain : '', + options.secure ? '; secure' : '' + ].join('')); + } + + // read + var decode = config.raw ? raw : decoded; + var cookies = document.cookie.split('; '); + for (var i = 0, l = cookies.length; i < l; i++) { + var parts = cookies[i].split('='); + if (decode(parts.shift()) === key) { + var cookie = decode(parts.join('=')); + return config.json ? JSON.parse(cookie) : cookie; + } + } + + return null; + }; + + config.defaults = {}; + + $.removeCookie = function (key, options) { + if ($.cookie(key) !== null) { + $.cookie(key, null, options); + return true; + } + return false; + }; + +})(jQuery, document); diff --git a/lib/scripts/jquery/jquery.js b/lib/scripts/jquery/jquery.js deleted file mode 100644 index 719e1d4ec..000000000 --- a/lib/scripts/jquery/jquery.js +++ /dev/null @@ -1,9046 +0,0 @@ -/*! - * jQuery JavaScript Library v1.6.4 - * http://jquery.com/ - * - * Copyright 2011, John Resig - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * Includes Sizzle.js - * http://sizzlejs.com/ - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * - * Date: Mon Sep 12 18:54:48 2011 -0400 - */ -(function( window, undefined ) { - -// Use the correct document accordingly with window argument (sandbox) -var document = window.document, - navigator = window.navigator, - location = window.location; -var jQuery = (function() { - -// Define a local copy of jQuery -var jQuery = function( selector, context ) { - // The jQuery object is actually just the init constructor 'enhanced' - return new jQuery.fn.init( selector, context, rootjQuery ); - }, - - // Map over jQuery in case of overwrite - _jQuery = window.jQuery, - - // Map over the $ in case of overwrite - _$ = window.$, - - // A central reference to the root jQuery(document) - rootjQuery, - - // A simple way to check for HTML strings or ID strings - // Prioritize #id over to avoid XSS via location.hash (#9521) - quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, - - // Check if a string has a non-whitespace character in it - rnotwhite = /\S/, - - // Used for trimming whitespace - trimLeft = /^\s+/, - trimRight = /\s+$/, - - // Check for digits - rdigit = /\d/, - - // Match a standalone tag - rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, - - // JSON RegExp - rvalidchars = /^[\],:{}\s]*$/, - rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, - rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, - rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, - - // Useragent RegExp - rwebkit = /(webkit)[ \/]([\w.]+)/, - ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, - rmsie = /(msie) ([\w.]+)/, - rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, - - // Matches dashed string for camelizing - rdashAlpha = /-([a-z]|[0-9])/ig, - rmsPrefix = /^-ms-/, - - // Used by jQuery.camelCase as callback to replace() - fcamelCase = function( all, letter ) { - return ( letter + "" ).toUpperCase(); - }, - - // Keep a UserAgent string for use with jQuery.browser - userAgent = navigator.userAgent, - - // For matching the engine and version of the browser - browserMatch, - - // The deferred used on DOM ready - readyList, - - // The ready event handler - DOMContentLoaded, - - // Save a reference to some core methods - toString = Object.prototype.toString, - hasOwn = Object.prototype.hasOwnProperty, - push = Array.prototype.push, - slice = Array.prototype.slice, - trim = String.prototype.trim, - indexOf = Array.prototype.indexOf, - - // [[Class]] -> type pairs - class2type = {}; - -jQuery.fn = jQuery.prototype = { - constructor: jQuery, - init: function( selector, context, rootjQuery ) { - var match, elem, ret, doc; - - // Handle $(""), $(null), or $(undefined) - if ( !selector ) { - return this; - } - - // Handle $(DOMElement) - if ( selector.nodeType ) { - this.context = this[0] = selector; - this.length = 1; - return this; - } - - // The body element only exists once, optimize finding it - if ( selector === "body" && !context && document.body ) { - this.context = document; - this[0] = document.body; - this.selector = selector; - this.length = 1; - return this; - } - - // Handle HTML strings - if ( typeof selector === "string" ) { - // Are we dealing with HTML string or an ID? - if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { - // Assume that strings that start and end with <> are HTML and skip the regex check - match = [ null, selector, null ]; - - } else { - match = quickExpr.exec( selector ); - } - - // Verify a match, and that no context was specified for #id - if ( match && (match[1] || !context) ) { - - // HANDLE: $(html) -> $(array) - if ( match[1] ) { - context = context instanceof jQuery ? context[0] : context; - doc = (context ? context.ownerDocument || context : document); - - // If a single string is passed in and it's a single tag - // just do a createElement and skip the rest - ret = rsingleTag.exec( selector ); - - if ( ret ) { - if ( jQuery.isPlainObject( context ) ) { - selector = [ document.createElement( ret[1] ) ]; - jQuery.fn.attr.call( selector, context, true ); - - } else { - selector = [ doc.createElement( ret[1] ) ]; - } - - } else { - ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); - selector = (ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment).childNodes; - } - - return jQuery.merge( this, selector ); - - // HANDLE: $("#id") - } else { - elem = document.getElementById( match[2] ); - - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - if ( elem && elem.parentNode ) { - // Handle the case where IE and Opera return items - // by name instead of ID - if ( elem.id !== match[2] ) { - return rootjQuery.find( selector ); - } - - // Otherwise, we inject the element directly into the jQuery object - this.length = 1; - this[0] = elem; - } - - this.context = document; - this.selector = selector; - return this; - } - - // HANDLE: $(expr, $(...)) - } else if ( !context || context.jquery ) { - return (context || rootjQuery).find( selector ); - - // HANDLE: $(expr, context) - // (which is just equivalent to: $(context).find(expr) - } else { - return this.constructor( context ).find( selector ); - } - - // HANDLE: $(function) - // Shortcut for document ready - } else if ( jQuery.isFunction( selector ) ) { - return rootjQuery.ready( selector ); - } - - if (selector.selector !== undefined) { - this.selector = selector.selector; - this.context = selector.context; - } - - return jQuery.makeArray( selector, this ); - }, - - // Start with an empty selector - selector: "", - - // The current version of jQuery being used - jquery: "1.6.4", - - // The default length of a jQuery object is 0 - length: 0, - - // The number of elements contained in the matched element set - size: function() { - return this.length; - }, - - toArray: function() { - return slice.call( this, 0 ); - }, - - // Get the Nth element in the matched element set OR - // Get the whole matched element set as a clean array - get: function( num ) { - return num == null ? - - // Return a 'clean' array - this.toArray() : - - // Return just the object - ( num < 0 ? this[ this.length + num ] : this[ num ] ); - }, - - // Take an array of elements and push it onto the stack - // (returning the new matched element set) - pushStack: function( elems, name, selector ) { - // Build a new jQuery matched element set - var ret = this.constructor(); - - if ( jQuery.isArray( elems ) ) { - push.apply( ret, elems ); - - } else { - jQuery.merge( ret, elems ); - } - - // Add the old object onto the stack (as a reference) - ret.prevObject = this; - - ret.context = this.context; - - if ( name === "find" ) { - ret.selector = this.selector + (this.selector ? " " : "") + selector; - } else if ( name ) { - ret.selector = this.selector + "." + name + "(" + selector + ")"; - } - - // Return the newly-formed element set - return ret; - }, - - // Execute a callback for every element in the matched set. - // (You can seed the arguments with an array of args, but this is - // only used internally.) - each: function( callback, args ) { - return jQuery.each( this, callback, args ); - }, - - ready: function( fn ) { - // Attach the listeners - jQuery.bindReady(); - - // Add the callback - readyList.done( fn ); - - return this; - }, - - eq: function( i ) { - return i === -1 ? - this.slice( i ) : - this.slice( i, +i + 1 ); - }, - - first: function() { - return this.eq( 0 ); - }, - - last: function() { - return this.eq( -1 ); - }, - - slice: function() { - return this.pushStack( slice.apply( this, arguments ), - "slice", slice.call(arguments).join(",") ); - }, - - map: function( callback ) { - return this.pushStack( jQuery.map(this, function( elem, i ) { - return callback.call( elem, i, elem ); - })); - }, - - end: function() { - return this.prevObject || this.constructor(null); - }, - - // For internal use only. - // Behaves like an Array's method, not like a jQuery method. - push: push, - sort: [].sort, - splice: [].splice -}; - -// Give the init function the jQuery prototype for later instantiation -jQuery.fn.init.prototype = jQuery.fn; - -jQuery.extend = jQuery.fn.extend = function() { - var options, name, src, copy, copyIsArray, clone, - target = arguments[0] || {}, - i = 1, - length = arguments.length, - deep = false; - - // Handle a deep copy situation - if ( typeof target === "boolean" ) { - deep = target; - target = arguments[1] || {}; - // skip the boolean and the target - i = 2; - } - - // Handle case when target is a string or something (possible in deep copy) - if ( typeof target !== "object" && !jQuery.isFunction(target) ) { - target = {}; - } - - // extend jQuery itself if only one argument is passed - if ( length === i ) { - target = this; - --i; - } - - for ( ; i < length; i++ ) { - // Only deal with non-null/undefined values - if ( (options = arguments[ i ]) != null ) { - // Extend the base object - for ( name in options ) { - src = target[ name ]; - copy = options[ name ]; - - // Prevent never-ending loop - if ( target === copy ) { - continue; - } - - // Recurse if we're merging plain objects or arrays - if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { - if ( copyIsArray ) { - copyIsArray = false; - clone = src && jQuery.isArray(src) ? src : []; - - } else { - clone = src && jQuery.isPlainObject(src) ? src : {}; - } - - // Never move original objects, clone them - target[ name ] = jQuery.extend( deep, clone, copy ); - - // Don't bring in undefined values - } else if ( copy !== undefined ) { - target[ name ] = copy; - } - } - } - } - - // Return the modified object - return target; -}; - -jQuery.extend({ - noConflict: function( deep ) { - if ( window.$ === jQuery ) { - window.$ = _$; - } - - if ( deep && window.jQuery === jQuery ) { - window.jQuery = _jQuery; - } - - return jQuery; - }, - - // Is the DOM ready to be used? Set to true once it occurs. - isReady: false, - - // A counter to track how many items to wait for before - // the ready event fires. See #6781 - readyWait: 1, - - // Hold (or release) the ready event - holdReady: function( hold ) { - if ( hold ) { - jQuery.readyWait++; - } else { - jQuery.ready( true ); - } - }, - - // Handle when the DOM is ready - ready: function( wait ) { - // Either a released hold or an DOMready/load event and not yet ready - if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { - // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). - if ( !document.body ) { - return setTimeout( jQuery.ready, 1 ); - } - - // Remember that the DOM is ready - jQuery.isReady = true; - - // If a normal DOM Ready event fired, decrement, and wait if need be - if ( wait !== true && --jQuery.readyWait > 0 ) { - return; - } - - // If there are functions bound, to execute - readyList.resolveWith( document, [ jQuery ] ); - - // Trigger any bound ready events - if ( jQuery.fn.trigger ) { - jQuery( document ).trigger( "ready" ).unbind( "ready" ); - } - } - }, - - bindReady: function() { - if ( readyList ) { - return; - } - - readyList = jQuery._Deferred(); - - // Catch cases where $(document).ready() is called after the - // browser event has already occurred. - if ( document.readyState === "complete" ) { - // Handle it asynchronously to allow scripts the opportunity to delay ready - return setTimeout( jQuery.ready, 1 ); - } - - // Mozilla, Opera and webkit nightlies currently support this event - if ( document.addEventListener ) { - // Use the handy event callback - document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); - - // A fallback to window.onload, that will always work - window.addEventListener( "load", jQuery.ready, false ); - - // If IE event model is used - } else if ( document.attachEvent ) { - // ensure firing before onload, - // maybe late but safe also for iframes - document.attachEvent( "onreadystatechange", DOMContentLoaded ); - - // A fallback to window.onload, that will always work - window.attachEvent( "onload", jQuery.ready ); - - // If IE and not a frame - // continually check to see if the document is ready - var toplevel = false; - - try { - toplevel = window.frameElement == null; - } catch(e) {} - - if ( document.documentElement.doScroll && toplevel ) { - doScrollCheck(); - } - } - }, - - // See test/unit/core.js for details concerning isFunction. - // Since version 1.3, DOM methods and functions like alert - // aren't supported. They return false on IE (#2968). - isFunction: function( obj ) { - return jQuery.type(obj) === "function"; - }, - - isArray: Array.isArray || function( obj ) { - return jQuery.type(obj) === "array"; - }, - - // A crude way of determining if an object is a window - isWindow: function( obj ) { - return obj && typeof obj === "object" && "setInterval" in obj; - }, - - isNaN: function( obj ) { - return obj == null || !rdigit.test( obj ) || isNaN( obj ); - }, - - type: function( obj ) { - return obj == null ? - String( obj ) : - class2type[ toString.call(obj) ] || "object"; - }, - - isPlainObject: function( obj ) { - // Must be an Object. - // Because of IE, we also have to check the presence of the constructor property. - // Make sure that DOM nodes and window objects don't pass through, as well - if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { - return false; - } - - try { - // Not own constructor property must be Object - if ( obj.constructor && - !hasOwn.call(obj, "constructor") && - !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { - return false; - } - } catch ( e ) { - // IE8,9 Will throw exceptions on certain host objects #9897 - return false; - } - - // Own properties are enumerated firstly, so to speed up, - // if last one is own, then all properties are own. - - var key; - for ( key in obj ) {} - - return key === undefined || hasOwn.call( obj, key ); - }, - - isEmptyObject: function( obj ) { - for ( var name in obj ) { - return false; - } - return true; - }, - - error: function( msg ) { - throw msg; - }, - - parseJSON: function( data ) { - if ( typeof data !== "string" || !data ) { - return null; - } - - // Make sure leading/trailing whitespace is removed (IE can't handle it) - data = jQuery.trim( data ); - - // Attempt to parse using the native JSON parser first - if ( window.JSON && window.JSON.parse ) { - return window.JSON.parse( data ); - } - - // Make sure the incoming data is actual JSON - // Logic borrowed from http://json.org/json2.js - if ( rvalidchars.test( data.replace( rvalidescape, "@" ) - .replace( rvalidtokens, "]" ) - .replace( rvalidbraces, "")) ) { - - return (new Function( "return " + data ))(); - - } - jQuery.error( "Invalid JSON: " + data ); - }, - - // Cross-browser xml parsing - parseXML: function( data ) { - var xml, tmp; - try { - if ( window.DOMParser ) { // Standard - tmp = new DOMParser(); - xml = tmp.parseFromString( data , "text/xml" ); - } else { // IE - xml = new ActiveXObject( "Microsoft.XMLDOM" ); - xml.async = "false"; - xml.loadXML( data ); - } - } catch( e ) { - xml = undefined; - } - if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { - jQuery.error( "Invalid XML: " + data ); - } - return xml; - }, - - noop: function() {}, - - // Evaluates a script in a global context - // Workarounds based on findings by Jim Driscoll - // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context - globalEval: function( data ) { - if ( data && rnotwhite.test( data ) ) { - // We use execScript on Internet Explorer - // We use an anonymous function so that context is window - // rather than jQuery in Firefox - ( window.execScript || function( data ) { - window[ "eval" ].call( window, data ); - } )( data ); - } - }, - - // Convert dashed to camelCase; used by the css and data modules - // Microsoft forgot to hump their vendor prefix (#9572) - camelCase: function( string ) { - return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); - }, - - nodeName: function( elem, name ) { - return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); - }, - - // args is for internal usage only - each: function( object, callback, args ) { - var name, i = 0, - length = object.length, - isObj = length === undefined || jQuery.isFunction( object ); - - if ( args ) { - if ( isObj ) { - for ( name in object ) { - if ( callback.apply( object[ name ], args ) === false ) { - break; - } - } - } else { - for ( ; i < length; ) { - if ( callback.apply( object[ i++ ], args ) === false ) { - break; - } - } - } - - // A special, fast, case for the most common use of each - } else { - if ( isObj ) { - for ( name in object ) { - if ( callback.call( object[ name ], name, object[ name ] ) === false ) { - break; - } - } - } else { - for ( ; i < length; ) { - if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { - break; - } - } - } - } - - return object; - }, - - // Use native String.trim function wherever possible - trim: trim ? - function( text ) { - return text == null ? - "" : - trim.call( text ); - } : - - // Otherwise use our own trimming functionality - function( text ) { - return text == null ? - "" : - text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); - }, - - // results is for internal usage only - makeArray: function( array, results ) { - var ret = results || []; - - if ( array != null ) { - // The window, strings (and functions) also have 'length' - // The extra typeof function check is to prevent crashes - // in Safari 2 (See: #3039) - // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 - var type = jQuery.type( array ); - - if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { - push.call( ret, array ); - } else { - jQuery.merge( ret, array ); - } - } - - return ret; - }, - - inArray: function( elem, array ) { - if ( !array ) { - return -1; - } - - if ( indexOf ) { - return indexOf.call( array, elem ); - } - - for ( var i = 0, length = array.length; i < length; i++ ) { - if ( array[ i ] === elem ) { - return i; - } - } - - return -1; - }, - - merge: function( first, second ) { - var i = first.length, - j = 0; - - if ( typeof second.length === "number" ) { - for ( var l = second.length; j < l; j++ ) { - first[ i++ ] = second[ j ]; - } - - } else { - while ( second[j] !== undefined ) { - first[ i++ ] = second[ j++ ]; - } - } - - first.length = i; - - return first; - }, - - grep: function( elems, callback, inv ) { - var ret = [], retVal; - inv = !!inv; - - // Go through the array, only saving the items - // that pass the validator function - for ( var i = 0, length = elems.length; i < length; i++ ) { - retVal = !!callback( elems[ i ], i ); - if ( inv !== retVal ) { - ret.push( elems[ i ] ); - } - } - - return ret; - }, - - // arg is for internal usage only - map: function( elems, callback, arg ) { - var value, key, ret = [], - i = 0, - length = elems.length, - // jquery objects are treated as arrays - isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; - - // Go through the array, translating each of the items to their - if ( isArray ) { - for ( ; i < length; i++ ) { - value = callback( elems[ i ], i, arg ); - - if ( value != null ) { - ret[ ret.length ] = value; - } - } - - // Go through every key on the object, - } else { - for ( key in elems ) { - value = callback( elems[ key ], key, arg ); - - if ( value != null ) { - ret[ ret.length ] = value; - } - } - } - - // Flatten any nested arrays - return ret.concat.apply( [], ret ); - }, - - // A global GUID counter for objects - guid: 1, - - // Bind a function to a context, optionally partially applying any - // arguments. - proxy: function( fn, context ) { - if ( typeof context === "string" ) { - var tmp = fn[ context ]; - context = fn; - fn = tmp; - } - - // Quick check to determine if target is callable, in the spec - // this throws a TypeError, but we will just return undefined. - if ( !jQuery.isFunction( fn ) ) { - return undefined; - } - - // Simulated bind - var args = slice.call( arguments, 2 ), - proxy = function() { - return fn.apply( context, args.concat( slice.call( arguments ) ) ); - }; - - // Set the guid of unique handler to the same of original handler, so it can be removed - proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; - - return proxy; - }, - - // Mutifunctional method to get and set values to a collection - // The value/s can optionally be executed if it's a function - access: function( elems, key, value, exec, fn, pass ) { - var length = elems.length; - - // Setting many attributes - if ( typeof key === "object" ) { - for ( var k in key ) { - jQuery.access( elems, k, key[k], exec, fn, value ); - } - return elems; - } - - // Setting one attribute - if ( value !== undefined ) { - // Optionally, function values get executed if exec is true - exec = !pass && exec && jQuery.isFunction(value); - - for ( var i = 0; i < length; i++ ) { - fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); - } - - return elems; - } - - // Getting an attribute - return length ? fn( elems[0], key ) : undefined; - }, - - now: function() { - return (new Date()).getTime(); - }, - - // Use of jQuery.browser is frowned upon. - // More details: http://docs.jquery.com/Utilities/jQuery.browser - uaMatch: function( ua ) { - ua = ua.toLowerCase(); - - var match = rwebkit.exec( ua ) || - ropera.exec( ua ) || - rmsie.exec( ua ) || - ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || - []; - - return { browser: match[1] || "", version: match[2] || "0" }; - }, - - sub: function() { - function jQuerySub( selector, context ) { - return new jQuerySub.fn.init( selector, context ); - } - jQuery.extend( true, jQuerySub, this ); - jQuerySub.superclass = this; - jQuerySub.fn = jQuerySub.prototype = this(); - jQuerySub.fn.constructor = jQuerySub; - jQuerySub.sub = this.sub; - jQuerySub.fn.init = function init( selector, context ) { - if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { - context = jQuerySub( context ); - } - - return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); - }; - jQuerySub.fn.init.prototype = jQuerySub.fn; - var rootjQuerySub = jQuerySub(document); - return jQuerySub; - }, - - browser: {} -}); - -// Populate the class2type map -jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { - class2type[ "[object " + name + "]" ] = name.toLowerCase(); -}); - -browserMatch = jQuery.uaMatch( userAgent ); -if ( browserMatch.browser ) { - jQuery.browser[ browserMatch.browser ] = true; - jQuery.browser.version = browserMatch.version; -} - -// Deprecated, use jQuery.browser.webkit instead -if ( jQuery.browser.webkit ) { - jQuery.browser.safari = true; -} - -// IE doesn't match non-breaking spaces with \s -if ( rnotwhite.test( "\xA0" ) ) { - trimLeft = /^[\s\xA0]+/; - trimRight = /[\s\xA0]+$/; -} - -// All jQuery objects should point back to these -rootjQuery = jQuery(document); - -// Cleanup functions for the document ready method -if ( document.addEventListener ) { - DOMContentLoaded = function() { - document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); - jQuery.ready(); - }; - -} else if ( document.attachEvent ) { - DOMContentLoaded = function() { - // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). - if ( document.readyState === "complete" ) { - document.detachEvent( "onreadystatechange", DOMContentLoaded ); - jQuery.ready(); - } - }; -} - -// The DOM ready check for Internet Explorer -function doScrollCheck() { - if ( jQuery.isReady ) { - return; - } - - try { - // If IE is used, use the trick by Diego Perini - // http://javascript.nwbox.com/IEContentLoaded/ - document.documentElement.doScroll("left"); - } catch(e) { - setTimeout( doScrollCheck, 1 ); - return; - } - - // and execute any waiting functions - jQuery.ready(); -} - -return jQuery; - -})(); - - -var // Promise methods - promiseMethods = "done fail isResolved isRejected promise then always pipe".split( " " ), - // Static reference to slice - sliceDeferred = [].slice; - -jQuery.extend({ - // Create a simple deferred (one callbacks list) - _Deferred: function() { - var // callbacks list - callbacks = [], - // stored [ context , args ] - fired, - // to avoid firing when already doing so - firing, - // flag to know if the deferred has been cancelled - cancelled, - // the deferred itself - deferred = { - - // done( f1, f2, ...) - done: function() { - if ( !cancelled ) { - var args = arguments, - i, - length, - elem, - type, - _fired; - if ( fired ) { - _fired = fired; - fired = 0; - } - for ( i = 0, length = args.length; i < length; i++ ) { - elem = args[ i ]; - type = jQuery.type( elem ); - if ( type === "array" ) { - deferred.done.apply( deferred, elem ); - } else if ( type === "function" ) { - callbacks.push( elem ); - } - } - if ( _fired ) { - deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] ); - } - } - return this; - }, - - // resolve with given context and args - resolveWith: function( context, args ) { - if ( !cancelled && !fired && !firing ) { - // make sure args are available (#8421) - args = args || []; - firing = 1; - try { - while( callbacks[ 0 ] ) { - callbacks.shift().apply( context, args ); - } - } - finally { - fired = [ context, args ]; - firing = 0; - } - } - return this; - }, - - // resolve with this as context and given arguments - resolve: function() { - deferred.resolveWith( this, arguments ); - return this; - }, - - // Has this deferred been resolved? - isResolved: function() { - return !!( firing || fired ); - }, - - // Cancel - cancel: function() { - cancelled = 1; - callbacks = []; - return this; - } - }; - - return deferred; - }, - - // Full fledged deferred (two callbacks list) - Deferred: function( func ) { - var deferred = jQuery._Deferred(), - failDeferred = jQuery._Deferred(), - promise; - // Add errorDeferred methods, then and promise - jQuery.extend( deferred, { - then: function( doneCallbacks, failCallbacks ) { - deferred.done( doneCallbacks ).fail( failCallbacks ); - return this; - }, - always: function() { - return deferred.done.apply( deferred, arguments ).fail.apply( this, arguments ); - }, - fail: failDeferred.done, - rejectWith: failDeferred.resolveWith, - reject: failDeferred.resolve, - isRejected: failDeferred.isResolved, - pipe: function( fnDone, fnFail ) { - return jQuery.Deferred(function( newDefer ) { - jQuery.each( { - done: [ fnDone, "resolve" ], - fail: [ fnFail, "reject" ] - }, function( handler, data ) { - var fn = data[ 0 ], - action = data[ 1 ], - returned; - if ( jQuery.isFunction( fn ) ) { - deferred[ handler ](function() { - returned = fn.apply( this, arguments ); - if ( returned && jQuery.isFunction( returned.promise ) ) { - returned.promise().then( newDefer.resolve, newDefer.reject ); - } else { - newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); - } - }); - } else { - deferred[ handler ]( newDefer[ action ] ); - } - }); - }).promise(); - }, - // Get a promise for this deferred - // If obj is provided, the promise aspect is added to the object - promise: function( obj ) { - if ( obj == null ) { - if ( promise ) { - return promise; - } - promise = obj = {}; - } - var i = promiseMethods.length; - while( i-- ) { - obj[ promiseMethods[i] ] = deferred[ promiseMethods[i] ]; - } - return obj; - } - }); - // Make sure only one callback list will be used - deferred.done( failDeferred.cancel ).fail( deferred.cancel ); - // Unexpose cancel - delete deferred.cancel; - // Call given func if any - if ( func ) { - func.call( deferred, deferred ); - } - return deferred; - }, - - // Deferred helper - when: function( firstParam ) { - var args = arguments, - i = 0, - length = args.length, - count = length, - deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? - firstParam : - jQuery.Deferred(); - function resolveFunc( i ) { - return function( value ) { - args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; - if ( !( --count ) ) { - // Strange bug in FF4: - // Values changed onto the arguments object sometimes end up as undefined values - // outside the $.when method. Cloning the object into a fresh array solves the issue - deferred.resolveWith( deferred, sliceDeferred.call( args, 0 ) ); - } - }; - } - if ( length > 1 ) { - for( ; i < length; i++ ) { - if ( args[ i ] && jQuery.isFunction( args[ i ].promise ) ) { - args[ i ].promise().then( resolveFunc(i), deferred.reject ); - } else { - --count; - } - } - if ( !count ) { - deferred.resolveWith( deferred, args ); - } - } else if ( deferred !== firstParam ) { - deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); - } - return deferred.promise(); - } -}); - - - -jQuery.support = (function() { - - var div = document.createElement( "div" ), - documentElement = document.documentElement, - all, - a, - select, - opt, - input, - marginDiv, - support, - fragment, - body, - testElementParent, - testElement, - testElementStyle, - tds, - events, - eventName, - i, - isSupported; - - // Preliminary tests - div.setAttribute("className", "t"); - div.innerHTML = "
      a"; - - - all = div.getElementsByTagName( "*" ); - a = div.getElementsByTagName( "a" )[ 0 ]; - - // Can't get basic test support - if ( !all || !all.length || !a ) { - return {}; - } - - // First batch of supports tests - select = document.createElement( "select" ); - opt = select.appendChild( document.createElement("option") ); - input = div.getElementsByTagName( "input" )[ 0 ]; - - support = { - // IE strips leading whitespace when .innerHTML is used - leadingWhitespace: ( div.firstChild.nodeType === 3 ), - - // Make sure that tbody elements aren't automatically inserted - // IE will insert them into empty tables - tbody: !div.getElementsByTagName( "tbody" ).length, - - // Make sure that link elements get serialized correctly by innerHTML - // This requires a wrapper element in IE - htmlSerialize: !!div.getElementsByTagName( "link" ).length, - - // Get the style information from getAttribute - // (IE uses .cssText instead) - style: /top/.test( a.getAttribute("style") ), - - // Make sure that URLs aren't manipulated - // (IE normalizes it by default) - hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), - - // Make sure that element opacity exists - // (IE uses filter instead) - // Use a regex to work around a WebKit issue. See #5145 - opacity: /^0.55$/.test( a.style.opacity ), - - // Verify style float existence - // (IE uses styleFloat instead of cssFloat) - cssFloat: !!a.style.cssFloat, - - // Make sure that if no value is specified for a checkbox - // that it defaults to "on". - // (WebKit defaults to "" instead) - checkOn: ( input.value === "on" ), - - // Make sure that a selected-by-default option has a working selected property. - // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) - optSelected: opt.selected, - - // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) - getSetAttribute: div.className !== "t", - - // Will be defined later - submitBubbles: true, - changeBubbles: true, - focusinBubbles: false, - deleteExpando: true, - noCloneEvent: true, - inlineBlockNeedsLayout: false, - shrinkWrapBlocks: false, - reliableMarginRight: true - }; - - // Make sure checked status is properly cloned - input.checked = true; - support.noCloneChecked = input.cloneNode( true ).checked; - - // Make sure that the options inside disabled selects aren't marked as disabled - // (WebKit marks them as disabled) - select.disabled = true; - support.optDisabled = !opt.disabled; - - // Test to see if it's possible to delete an expando from an element - // Fails in Internet Explorer - try { - delete div.test; - } catch( e ) { - support.deleteExpando = false; - } - - if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { - div.attachEvent( "onclick", function() { - // Cloning a node shouldn't copy over any - // bound event handlers (IE does this) - support.noCloneEvent = false; - }); - div.cloneNode( true ).fireEvent( "onclick" ); - } - - // Check if a radio maintains it's value - // after being appended to the DOM - input = document.createElement("input"); - input.value = "t"; - input.setAttribute("type", "radio"); - support.radioValue = input.value === "t"; - - input.setAttribute("checked", "checked"); - div.appendChild( input ); - fragment = document.createDocumentFragment(); - fragment.appendChild( div.firstChild ); - - // WebKit doesn't clone checked state correctly in fragments - support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; - - div.innerHTML = ""; - - // Figure out if the W3C box model works as expected - div.style.width = div.style.paddingLeft = "1px"; - - body = document.getElementsByTagName( "body" )[ 0 ]; - // We use our own, invisible, body unless the body is already present - // in which case we use a div (#9239) - testElement = document.createElement( body ? "div" : "body" ); - testElementStyle = { - visibility: "hidden", - width: 0, - height: 0, - border: 0, - margin: 0, - background: "none" - }; - if ( body ) { - jQuery.extend( testElementStyle, { - position: "absolute", - left: "-1000px", - top: "-1000px" - }); - } - for ( i in testElementStyle ) { - testElement.style[ i ] = testElementStyle[ i ]; - } - testElement.appendChild( div ); - testElementParent = body || documentElement; - testElementParent.insertBefore( testElement, testElementParent.firstChild ); - - // Check if a disconnected checkbox will retain its checked - // value of true after appended to the DOM (IE6/7) - support.appendChecked = input.checked; - - support.boxModel = div.offsetWidth === 2; - - if ( "zoom" in div.style ) { - // Check if natively block-level elements act like inline-block - // elements when setting their display to 'inline' and giving - // them layout - // (IE < 8 does this) - div.style.display = "inline"; - div.style.zoom = 1; - support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); - - // Check if elements with layout shrink-wrap their children - // (IE 6 does this) - div.style.display = ""; - div.innerHTML = "
      "; - support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); - } - - div.innerHTML = "
      t
      "; - tds = div.getElementsByTagName( "td" ); - - // Check if table cells still have offsetWidth/Height when they are set - // to display:none and there are still other visible table cells in a - // table row; if so, offsetWidth/Height are not reliable for use when - // determining if an element has been hidden directly using - // display:none (it is still safe to use offsets if a parent element is - // hidden; don safety goggles and see bug #4512 for more information). - // (only IE 8 fails this test) - isSupported = ( tds[ 0 ].offsetHeight === 0 ); - - tds[ 0 ].style.display = ""; - tds[ 1 ].style.display = "none"; - - // Check if empty table cells still have offsetWidth/Height - // (IE < 8 fail this test) - support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); - div.innerHTML = ""; - - // Check if div with explicit width and no margin-right incorrectly - // gets computed margin-right based on width of container. For more - // info see bug #3333 - // Fails in WebKit before Feb 2011 nightlies - // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right - if ( document.defaultView && document.defaultView.getComputedStyle ) { - marginDiv = document.createElement( "div" ); - marginDiv.style.width = "0"; - marginDiv.style.marginRight = "0"; - div.appendChild( marginDiv ); - support.reliableMarginRight = - ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; - } - - // Remove the body element we added - testElement.innerHTML = ""; - testElementParent.removeChild( testElement ); - - // Technique from Juriy Zaytsev - // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/ - // We only care about the case where non-standard event systems - // are used, namely in IE. Short-circuiting here helps us to - // avoid an eval call (in setAttribute) which can cause CSP - // to go haywire. See: https://developer.mozilla.org/en/Security/CSP - if ( div.attachEvent ) { - for( i in { - submit: 1, - change: 1, - focusin: 1 - } ) { - eventName = "on" + i; - isSupported = ( eventName in div ); - if ( !isSupported ) { - div.setAttribute( eventName, "return;" ); - isSupported = ( typeof div[ eventName ] === "function" ); - } - support[ i + "Bubbles" ] = isSupported; - } - } - - // Null connected elements to avoid leaks in IE - testElement = fragment = select = opt = body = marginDiv = div = input = null; - - return support; -})(); - -// Keep track of boxModel -jQuery.boxModel = jQuery.support.boxModel; - - - - -var rbrace = /^(?:\{.*\}|\[.*\])$/, - rmultiDash = /([A-Z])/g; - -jQuery.extend({ - cache: {}, - - // Please use with caution - uuid: 0, - - // Unique for each copy of jQuery on the page - // Non-digits removed to match rinlinejQuery - expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), - - // The following elements throw uncatchable exceptions if you - // attempt to add expando properties to them. - noData: { - "embed": true, - // Ban all objects except for Flash (which handle expandos) - "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", - "applet": true - }, - - hasData: function( elem ) { - elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; - - return !!elem && !isEmptyDataObject( elem ); - }, - - data: function( elem, name, data, pvt /* Internal Use Only */ ) { - if ( !jQuery.acceptData( elem ) ) { - return; - } - - var thisCache, ret, - internalKey = jQuery.expando, - getByName = typeof name === "string", - - // We have to handle DOM nodes and JS objects differently because IE6-7 - // can't GC object references properly across the DOM-JS boundary - isNode = elem.nodeType, - - // Only DOM nodes need the global jQuery cache; JS object data is - // attached directly to the object so GC can occur automatically - cache = isNode ? jQuery.cache : elem, - - // Only defining an ID for JS objects if its cache already exists allows - // the code to shortcut on the same path as a DOM node with no cache - id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando; - - // Avoid doing any more work than we need to when trying to get data on an - // object that has no data at all - if ( (!id || (pvt && id && (cache[ id ] && !cache[ id ][ internalKey ]))) && getByName && data === undefined ) { - return; - } - - if ( !id ) { - // Only DOM nodes need a new unique ID for each element since their data - // ends up in the global cache - if ( isNode ) { - elem[ jQuery.expando ] = id = ++jQuery.uuid; - } else { - id = jQuery.expando; - } - } - - if ( !cache[ id ] ) { - cache[ id ] = {}; - - // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery - // metadata on plain JS objects when the object is serialized using - // JSON.stringify - if ( !isNode ) { - cache[ id ].toJSON = jQuery.noop; - } - } - - // An object can be passed to jQuery.data instead of a key/value pair; this gets - // shallow copied over onto the existing cache - if ( typeof name === "object" || typeof name === "function" ) { - if ( pvt ) { - cache[ id ][ internalKey ] = jQuery.extend(cache[ id ][ internalKey ], name); - } else { - cache[ id ] = jQuery.extend(cache[ id ], name); - } - } - - thisCache = cache[ id ]; - - // Internal jQuery data is stored in a separate object inside the object's data - // cache in order to avoid key collisions between internal data and user-defined - // data - if ( pvt ) { - if ( !thisCache[ internalKey ] ) { - thisCache[ internalKey ] = {}; - } - - thisCache = thisCache[ internalKey ]; - } - - if ( data !== undefined ) { - thisCache[ jQuery.camelCase( name ) ] = data; - } - - // TODO: This is a hack for 1.5 ONLY. It will be removed in 1.6. Users should - // not attempt to inspect the internal events object using jQuery.data, as this - // internal data object is undocumented and subject to change. - if ( name === "events" && !thisCache[name] ) { - return thisCache[ internalKey ] && thisCache[ internalKey ].events; - } - - // Check for both converted-to-camel and non-converted data property names - // If a data property was specified - if ( getByName ) { - - // First Try to find as-is property data - ret = thisCache[ name ]; - - // Test for null|undefined property data - if ( ret == null ) { - - // Try to find the camelCased property - ret = thisCache[ jQuery.camelCase( name ) ]; - } - } else { - ret = thisCache; - } - - return ret; - }, - - removeData: function( elem, name, pvt /* Internal Use Only */ ) { - if ( !jQuery.acceptData( elem ) ) { - return; - } - - var thisCache, - - // Reference to internal data cache key - internalKey = jQuery.expando, - - isNode = elem.nodeType, - - // See jQuery.data for more information - cache = isNode ? jQuery.cache : elem, - - // See jQuery.data for more information - id = isNode ? elem[ jQuery.expando ] : jQuery.expando; - - // If there is already no cache entry for this object, there is no - // purpose in continuing - if ( !cache[ id ] ) { - return; - } - - if ( name ) { - - thisCache = pvt ? cache[ id ][ internalKey ] : cache[ id ]; - - if ( thisCache ) { - - // Support interoperable removal of hyphenated or camelcased keys - if ( !thisCache[ name ] ) { - name = jQuery.camelCase( name ); - } - - delete thisCache[ name ]; - - // If there is no data left in the cache, we want to continue - // and let the cache object itself get destroyed - if ( !isEmptyDataObject(thisCache) ) { - return; - } - } - } - - // See jQuery.data for more information - if ( pvt ) { - delete cache[ id ][ internalKey ]; - - // Don't destroy the parent cache unless the internal data object - // had been the only thing left in it - if ( !isEmptyDataObject(cache[ id ]) ) { - return; - } - } - - var internalCache = cache[ id ][ internalKey ]; - - // Browsers that fail expando deletion also refuse to delete expandos on - // the window, but it will allow it on all other JS objects; other browsers - // don't care - // Ensure that `cache` is not a window object #10080 - if ( jQuery.support.deleteExpando || !cache.setInterval ) { - delete cache[ id ]; - } else { - cache[ id ] = null; - } - - // We destroyed the entire user cache at once because it's faster than - // iterating through each key, but we need to continue to persist internal - // data if it existed - if ( internalCache ) { - cache[ id ] = {}; - // TODO: This is a hack for 1.5 ONLY. Avoids exposing jQuery - // metadata on plain JS objects when the object is serialized using - // JSON.stringify - if ( !isNode ) { - cache[ id ].toJSON = jQuery.noop; - } - - cache[ id ][ internalKey ] = internalCache; - - // Otherwise, we need to eliminate the expando on the node to avoid - // false lookups in the cache for entries that no longer exist - } else if ( isNode ) { - // IE does not allow us to delete expando properties from nodes, - // nor does it have a removeAttribute function on Document nodes; - // we must handle all of these cases - if ( jQuery.support.deleteExpando ) { - delete elem[ jQuery.expando ]; - } else if ( elem.removeAttribute ) { - elem.removeAttribute( jQuery.expando ); - } else { - elem[ jQuery.expando ] = null; - } - } - }, - - // For internal use only. - _data: function( elem, name, data ) { - return jQuery.data( elem, name, data, true ); - }, - - // A method for determining if a DOM node can handle the data expando - acceptData: function( elem ) { - if ( elem.nodeName ) { - var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; - - if ( match ) { - return !(match === true || elem.getAttribute("classid") !== match); - } - } - - return true; - } -}); - -jQuery.fn.extend({ - data: function( key, value ) { - var data = null; - - if ( typeof key === "undefined" ) { - if ( this.length ) { - data = jQuery.data( this[0] ); - - if ( this[0].nodeType === 1 ) { - var attr = this[0].attributes, name; - for ( var i = 0, l = attr.length; i < l; i++ ) { - name = attr[i].name; - - if ( name.indexOf( "data-" ) === 0 ) { - name = jQuery.camelCase( name.substring(5) ); - - dataAttr( this[0], name, data[ name ] ); - } - } - } - } - - return data; - - } else if ( typeof key === "object" ) { - return this.each(function() { - jQuery.data( this, key ); - }); - } - - var parts = key.split("."); - parts[1] = parts[1] ? "." + parts[1] : ""; - - if ( value === undefined ) { - data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); - - // Try to fetch any internally stored data first - if ( data === undefined && this.length ) { - data = jQuery.data( this[0], key ); - data = dataAttr( this[0], key, data ); - } - - return data === undefined && parts[1] ? - this.data( parts[0] ) : - data; - - } else { - return this.each(function() { - var $this = jQuery( this ), - args = [ parts[0], value ]; - - $this.triggerHandler( "setData" + parts[1] + "!", args ); - jQuery.data( this, key, value ); - $this.triggerHandler( "changeData" + parts[1] + "!", args ); - }); - } - }, - - removeData: function( key ) { - return this.each(function() { - jQuery.removeData( this, key ); - }); - } -}); - -function dataAttr( elem, key, data ) { - // If nothing was found internally, try to fetch any - // data from the HTML5 data-* attribute - if ( data === undefined && elem.nodeType === 1 ) { - - var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); - - data = elem.getAttribute( name ); - - if ( typeof data === "string" ) { - try { - data = data === "true" ? true : - data === "false" ? false : - data === "null" ? null : - !jQuery.isNaN( data ) ? parseFloat( data ) : - rbrace.test( data ) ? jQuery.parseJSON( data ) : - data; - } catch( e ) {} - - // Make sure we set the data so it isn't changed later - jQuery.data( elem, key, data ); - - } else { - data = undefined; - } - } - - return data; -} - -// TODO: This is a hack for 1.5 ONLY to allow objects with a single toJSON -// property to be considered empty objects; this property always exists in -// order to make sure JSON.stringify does not expose internal metadata -function isEmptyDataObject( obj ) { - for ( var name in obj ) { - if ( name !== "toJSON" ) { - return false; - } - } - - return true; -} - - - - -function handleQueueMarkDefer( elem, type, src ) { - var deferDataKey = type + "defer", - queueDataKey = type + "queue", - markDataKey = type + "mark", - defer = jQuery.data( elem, deferDataKey, undefined, true ); - if ( defer && - ( src === "queue" || !jQuery.data( elem, queueDataKey, undefined, true ) ) && - ( src === "mark" || !jQuery.data( elem, markDataKey, undefined, true ) ) ) { - // Give room for hard-coded callbacks to fire first - // and eventually mark/queue something else on the element - setTimeout( function() { - if ( !jQuery.data( elem, queueDataKey, undefined, true ) && - !jQuery.data( elem, markDataKey, undefined, true ) ) { - jQuery.removeData( elem, deferDataKey, true ); - defer.resolve(); - } - }, 0 ); - } -} - -jQuery.extend({ - - _mark: function( elem, type ) { - if ( elem ) { - type = (type || "fx") + "mark"; - jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); - } - }, - - _unmark: function( force, elem, type ) { - if ( force !== true ) { - type = elem; - elem = force; - force = false; - } - if ( elem ) { - type = type || "fx"; - var key = type + "mark", - count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); - if ( count ) { - jQuery.data( elem, key, count, true ); - } else { - jQuery.removeData( elem, key, true ); - handleQueueMarkDefer( elem, type, "mark" ); - } - } - }, - - queue: function( elem, type, data ) { - if ( elem ) { - type = (type || "fx") + "queue"; - var q = jQuery.data( elem, type, undefined, true ); - // Speed up dequeue by getting out quickly if this is just a lookup - if ( data ) { - if ( !q || jQuery.isArray(data) ) { - q = jQuery.data( elem, type, jQuery.makeArray(data), true ); - } else { - q.push( data ); - } - } - return q || []; - } - }, - - dequeue: function( elem, type ) { - type = type || "fx"; - - var queue = jQuery.queue( elem, type ), - fn = queue.shift(), - defer; - - // If the fx queue is dequeued, always remove the progress sentinel - if ( fn === "inprogress" ) { - fn = queue.shift(); - } - - if ( fn ) { - // Add a progress sentinel to prevent the fx queue from being - // automatically dequeued - if ( type === "fx" ) { - queue.unshift("inprogress"); - } - - fn.call(elem, function() { - jQuery.dequeue(elem, type); - }); - } - - if ( !queue.length ) { - jQuery.removeData( elem, type + "queue", true ); - handleQueueMarkDefer( elem, type, "queue" ); - } - } -}); - -jQuery.fn.extend({ - queue: function( type, data ) { - if ( typeof type !== "string" ) { - data = type; - type = "fx"; - } - - if ( data === undefined ) { - return jQuery.queue( this[0], type ); - } - return this.each(function() { - var queue = jQuery.queue( this, type, data ); - - if ( type === "fx" && queue[0] !== "inprogress" ) { - jQuery.dequeue( this, type ); - } - }); - }, - dequeue: function( type ) { - return this.each(function() { - jQuery.dequeue( this, type ); - }); - }, - // Based off of the plugin by Clint Helfers, with permission. - // http://blindsignals.com/index.php/2009/07/jquery-delay/ - delay: function( time, type ) { - time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; - type = type || "fx"; - - return this.queue( type, function() { - var elem = this; - setTimeout(function() { - jQuery.dequeue( elem, type ); - }, time ); - }); - }, - clearQueue: function( type ) { - return this.queue( type || "fx", [] ); - }, - // Get a promise resolved when queues of a certain type - // are emptied (fx is the type by default) - promise: function( type, object ) { - if ( typeof type !== "string" ) { - object = type; - type = undefined; - } - type = type || "fx"; - var defer = jQuery.Deferred(), - elements = this, - i = elements.length, - count = 1, - deferDataKey = type + "defer", - queueDataKey = type + "queue", - markDataKey = type + "mark", - tmp; - function resolve() { - if ( !( --count ) ) { - defer.resolveWith( elements, [ elements ] ); - } - } - while( i-- ) { - if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || - ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || - jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && - jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { - count++; - tmp.done( resolve ); - } - } - resolve(); - return defer.promise(); - } -}); - - - - -var rclass = /[\n\t\r]/g, - rspace = /\s+/, - rreturn = /\r/g, - rtype = /^(?:button|input)$/i, - rfocusable = /^(?:button|input|object|select|textarea)$/i, - rclickable = /^a(?:rea)?$/i, - rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, - nodeHook, boolHook; - -jQuery.fn.extend({ - attr: function( name, value ) { - return jQuery.access( this, name, value, true, jQuery.attr ); - }, - - removeAttr: function( name ) { - return this.each(function() { - jQuery.removeAttr( this, name ); - }); - }, - - prop: function( name, value ) { - return jQuery.access( this, name, value, true, jQuery.prop ); - }, - - removeProp: function( name ) { - name = jQuery.propFix[ name ] || name; - return this.each(function() { - // try/catch handles cases where IE balks (such as removing a property on window) - try { - this[ name ] = undefined; - delete this[ name ]; - } catch( e ) {} - }); - }, - - addClass: function( value ) { - var classNames, i, l, elem, - setClass, c, cl; - - if ( jQuery.isFunction( value ) ) { - return this.each(function( j ) { - jQuery( this ).addClass( value.call(this, j, this.className) ); - }); - } - - if ( value && typeof value === "string" ) { - classNames = value.split( rspace ); - - for ( i = 0, l = this.length; i < l; i++ ) { - elem = this[ i ]; - - if ( elem.nodeType === 1 ) { - if ( !elem.className && classNames.length === 1 ) { - elem.className = value; - - } else { - setClass = " " + elem.className + " "; - - for ( c = 0, cl = classNames.length; c < cl; c++ ) { - if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { - setClass += classNames[ c ] + " "; - } - } - elem.className = jQuery.trim( setClass ); - } - } - } - } - - return this; - }, - - removeClass: function( value ) { - var classNames, i, l, elem, className, c, cl; - - if ( jQuery.isFunction( value ) ) { - return this.each(function( j ) { - jQuery( this ).removeClass( value.call(this, j, this.className) ); - }); - } - - if ( (value && typeof value === "string") || value === undefined ) { - classNames = (value || "").split( rspace ); - - for ( i = 0, l = this.length; i < l; i++ ) { - elem = this[ i ]; - - if ( elem.nodeType === 1 && elem.className ) { - if ( value ) { - className = (" " + elem.className + " ").replace( rclass, " " ); - for ( c = 0, cl = classNames.length; c < cl; c++ ) { - className = className.replace(" " + classNames[ c ] + " ", " "); - } - elem.className = jQuery.trim( className ); - - } else { - elem.className = ""; - } - } - } - } - - return this; - }, - - toggleClass: function( value, stateVal ) { - var type = typeof value, - isBool = typeof stateVal === "boolean"; - - if ( jQuery.isFunction( value ) ) { - return this.each(function( i ) { - jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); - }); - } - - return this.each(function() { - if ( type === "string" ) { - // toggle individual class names - var className, - i = 0, - self = jQuery( this ), - state = stateVal, - classNames = value.split( rspace ); - - while ( (className = classNames[ i++ ]) ) { - // check each className given, space seperated list - state = isBool ? state : !self.hasClass( className ); - self[ state ? "addClass" : "removeClass" ]( className ); - } - - } else if ( type === "undefined" || type === "boolean" ) { - if ( this.className ) { - // store className if set - jQuery._data( this, "__className__", this.className ); - } - - // toggle whole className - this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; - } - }); - }, - - hasClass: function( selector ) { - var className = " " + selector + " "; - for ( var i = 0, l = this.length; i < l; i++ ) { - if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { - return true; - } - } - - return false; - }, - - val: function( value ) { - var hooks, ret, - elem = this[0]; - - if ( !arguments.length ) { - if ( elem ) { - hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; - - if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { - return ret; - } - - ret = elem.value; - - return typeof ret === "string" ? - // handle most common string cases - ret.replace(rreturn, "") : - // handle cases where value is null/undef or number - ret == null ? "" : ret; - } - - return undefined; - } - - var isFunction = jQuery.isFunction( value ); - - return this.each(function( i ) { - var self = jQuery(this), val; - - if ( this.nodeType !== 1 ) { - return; - } - - if ( isFunction ) { - val = value.call( this, i, self.val() ); - } else { - val = value; - } - - // Treat null/undefined as ""; convert numbers to string - if ( val == null ) { - val = ""; - } else if ( typeof val === "number" ) { - val += ""; - } else if ( jQuery.isArray( val ) ) { - val = jQuery.map(val, function ( value ) { - return value == null ? "" : value + ""; - }); - } - - hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; - - // If set returns undefined, fall back to normal setting - if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { - this.value = val; - } - }); - } -}); - -jQuery.extend({ - valHooks: { - option: { - get: function( elem ) { - // attributes.value is undefined in Blackberry 4.7 but - // uses .value. See #6932 - var val = elem.attributes.value; - return !val || val.specified ? elem.value : elem.text; - } - }, - select: { - get: function( elem ) { - var value, - index = elem.selectedIndex, - values = [], - options = elem.options, - one = elem.type === "select-one"; - - // Nothing was selected - if ( index < 0 ) { - return null; - } - - // Loop through all the selected options - for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { - var option = options[ i ]; - - // Don't return options that are disabled or in a disabled optgroup - if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && - (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { - - // Get the specific value for the option - value = jQuery( option ).val(); - - // We don't need an array for one selects - if ( one ) { - return value; - } - - // Multi-Selects return an array - values.push( value ); - } - } - - // Fixes Bug #2551 -- select.val() broken in IE after form.reset() - if ( one && !values.length && options.length ) { - return jQuery( options[ index ] ).val(); - } - - return values; - }, - - set: function( elem, value ) { - var values = jQuery.makeArray( value ); - - jQuery(elem).find("option").each(function() { - this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; - }); - - if ( !values.length ) { - elem.selectedIndex = -1; - } - return values; - } - } - }, - - attrFn: { - val: true, - css: true, - html: true, - text: true, - data: true, - width: true, - height: true, - offset: true - }, - - attrFix: { - // Always normalize to ensure hook usage - tabindex: "tabIndex" - }, - - attr: function( elem, name, value, pass ) { - var nType = elem.nodeType; - - // don't get/set attributes on text, comment and attribute nodes - if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { - return undefined; - } - - if ( pass && name in jQuery.attrFn ) { - return jQuery( elem )[ name ]( value ); - } - - // Fallback to prop when attributes are not supported - if ( !("getAttribute" in elem) ) { - return jQuery.prop( elem, name, value ); - } - - var ret, hooks, - notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); - - // Normalize the name if needed - if ( notxml ) { - name = jQuery.attrFix[ name ] || name; - - hooks = jQuery.attrHooks[ name ]; - - if ( !hooks ) { - // Use boolHook for boolean attributes - if ( rboolean.test( name ) ) { - hooks = boolHook; - - // Use nodeHook if available( IE6/7 ) - } else if ( nodeHook ) { - hooks = nodeHook; - } - } - } - - if ( value !== undefined ) { - - if ( value === null ) { - jQuery.removeAttr( elem, name ); - return undefined; - - } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { - return ret; - - } else { - elem.setAttribute( name, "" + value ); - return value; - } - - } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { - return ret; - - } else { - - ret = elem.getAttribute( name ); - - // Non-existent attributes return null, we normalize to undefined - return ret === null ? - undefined : - ret; - } - }, - - removeAttr: function( elem, name ) { - var propName; - if ( elem.nodeType === 1 ) { - name = jQuery.attrFix[ name ] || name; - - jQuery.attr( elem, name, "" ); - elem.removeAttribute( name ); - - // Set corresponding property to false for boolean attributes - if ( rboolean.test( name ) && (propName = jQuery.propFix[ name ] || name) in elem ) { - elem[ propName ] = false; - } - } - }, - - attrHooks: { - type: { - set: function( elem, value ) { - // We can't allow the type property to be changed (since it causes problems in IE) - if ( rtype.test( elem.nodeName ) && elem.parentNode ) { - jQuery.error( "type property can't be changed" ); - } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { - // Setting the type on a radio button after the value resets the value in IE6-9 - // Reset value to it's default in case type is set after value - // This is for element creation - var val = elem.value; - elem.setAttribute( "type", value ); - if ( val ) { - elem.value = val; - } - return value; - } - } - }, - // Use the value property for back compat - // Use the nodeHook for button elements in IE6/7 (#1954) - value: { - get: function( elem, name ) { - if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { - return nodeHook.get( elem, name ); - } - return name in elem ? - elem.value : - null; - }, - set: function( elem, value, name ) { - if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { - return nodeHook.set( elem, value, name ); - } - // Does not return so that setAttribute is also used - elem.value = value; - } - } - }, - - propFix: { - tabindex: "tabIndex", - readonly: "readOnly", - "for": "htmlFor", - "class": "className", - maxlength: "maxLength", - cellspacing: "cellSpacing", - cellpadding: "cellPadding", - rowspan: "rowSpan", - colspan: "colSpan", - usemap: "useMap", - frameborder: "frameBorder", - contenteditable: "contentEditable" - }, - - prop: function( elem, name, value ) { - var nType = elem.nodeType; - - // don't get/set properties on text, comment and attribute nodes - if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { - return undefined; - } - - var ret, hooks, - notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); - - if ( notxml ) { - // Fix name and attach hooks - name = jQuery.propFix[ name ] || name; - hooks = jQuery.propHooks[ name ]; - } - - if ( value !== undefined ) { - if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { - return ret; - - } else { - return (elem[ name ] = value); - } - - } else { - if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { - return ret; - - } else { - return elem[ name ]; - } - } - }, - - propHooks: { - tabIndex: { - get: function( elem ) { - // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set - // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ - var attributeNode = elem.getAttributeNode("tabindex"); - - return attributeNode && attributeNode.specified ? - parseInt( attributeNode.value, 10 ) : - rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? - 0 : - undefined; - } - } - } -}); - -// Add the tabindex propHook to attrHooks for back-compat -jQuery.attrHooks.tabIndex = jQuery.propHooks.tabIndex; - -// Hook for boolean attributes -boolHook = { - get: function( elem, name ) { - // Align boolean attributes with corresponding properties - // Fall back to attribute presence where some booleans are not supported - var attrNode; - return jQuery.prop( elem, name ) === true || ( attrNode = elem.getAttributeNode( name ) ) && attrNode.nodeValue !== false ? - name.toLowerCase() : - undefined; - }, - set: function( elem, value, name ) { - var propName; - if ( value === false ) { - // Remove boolean attributes when set to false - jQuery.removeAttr( elem, name ); - } else { - // value is true since we know at this point it's type boolean and not false - // Set boolean attributes to the same name and set the DOM property - propName = jQuery.propFix[ name ] || name; - if ( propName in elem ) { - // Only set the IDL specifically if it already exists on the element - elem[ propName ] = true; - } - - elem.setAttribute( name, name.toLowerCase() ); - } - return name; - } -}; - -// IE6/7 do not support getting/setting some attributes with get/setAttribute -if ( !jQuery.support.getSetAttribute ) { - - // Use this for any attribute in IE6/7 - // This fixes almost every IE6/7 issue - nodeHook = jQuery.valHooks.button = { - get: function( elem, name ) { - var ret; - ret = elem.getAttributeNode( name ); - // Return undefined if nodeValue is empty string - return ret && ret.nodeValue !== "" ? - ret.nodeValue : - undefined; - }, - set: function( elem, value, name ) { - // Set the existing or create a new attribute node - var ret = elem.getAttributeNode( name ); - if ( !ret ) { - ret = document.createAttribute( name ); - elem.setAttributeNode( ret ); - } - return (ret.nodeValue = value + ""); - } - }; - - // Set width and height to auto instead of 0 on empty string( Bug #8150 ) - // This is for removals - jQuery.each([ "width", "height" ], function( i, name ) { - jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { - set: function( elem, value ) { - if ( value === "" ) { - elem.setAttribute( name, "auto" ); - return value; - } - } - }); - }); -} - - -// Some attributes require a special call on IE -if ( !jQuery.support.hrefNormalized ) { - jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { - jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { - get: function( elem ) { - var ret = elem.getAttribute( name, 2 ); - return ret === null ? undefined : ret; - } - }); - }); -} - -if ( !jQuery.support.style ) { - jQuery.attrHooks.style = { - get: function( elem ) { - // Return undefined in the case of empty string - // Normalize to lowercase since IE uppercases css property names - return elem.style.cssText.toLowerCase() || undefined; - }, - set: function( elem, value ) { - return (elem.style.cssText = "" + value); - } - }; -} - -// Safari mis-reports the default selected property of an option -// Accessing the parent's selectedIndex property fixes it -if ( !jQuery.support.optSelected ) { - jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { - get: function( elem ) { - var parent = elem.parentNode; - - if ( parent ) { - parent.selectedIndex; - - // Make sure that it also works with optgroups, see #5701 - if ( parent.parentNode ) { - parent.parentNode.selectedIndex; - } - } - return null; - } - }); -} - -// Radios and checkboxes getter/setter -if ( !jQuery.support.checkOn ) { - jQuery.each([ "radio", "checkbox" ], function() { - jQuery.valHooks[ this ] = { - get: function( elem ) { - // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified - return elem.getAttribute("value") === null ? "on" : elem.value; - } - }; - }); -} -jQuery.each([ "radio", "checkbox" ], function() { - jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { - set: function( elem, value ) { - if ( jQuery.isArray( value ) ) { - return (elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0); - } - } - }); -}); - - - - -var rnamespaces = /\.(.*)$/, - rformElems = /^(?:textarea|input|select)$/i, - rperiod = /\./g, - rspaces = / /g, - rescape = /[^\w\s.|`]/g, - fcleanup = function( nm ) { - return nm.replace(rescape, "\\$&"); - }; - -/* - * A number of helper functions used for managing events. - * Many of the ideas behind this code originated from - * Dean Edwards' addEvent library. - */ -jQuery.event = { - - // Bind an event to an element - // Original by Dean Edwards - add: function( elem, types, handler, data ) { - if ( elem.nodeType === 3 || elem.nodeType === 8 ) { - return; - } - - if ( handler === false ) { - handler = returnFalse; - } else if ( !handler ) { - // Fixes bug #7229. Fix recommended by jdalton - return; - } - - var handleObjIn, handleObj; - - if ( handler.handler ) { - handleObjIn = handler; - handler = handleObjIn.handler; - } - - // Make sure that the function being executed has a unique ID - if ( !handler.guid ) { - handler.guid = jQuery.guid++; - } - - // Init the element's event structure - var elemData = jQuery._data( elem ); - - // If no elemData is found then we must be trying to bind to one of the - // banned noData elements - if ( !elemData ) { - return; - } - - var events = elemData.events, - eventHandle = elemData.handle; - - if ( !events ) { - elemData.events = events = {}; - } - - if ( !eventHandle ) { - elemData.handle = eventHandle = function( e ) { - // Discard the second event of a jQuery.event.trigger() and - // when an event is called after a page has unloaded - return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? - jQuery.event.handle.apply( eventHandle.elem, arguments ) : - undefined; - }; - } - - // Add elem as a property of the handle function - // This is to prevent a memory leak with non-native events in IE. - eventHandle.elem = elem; - - // Handle multiple events separated by a space - // jQuery(...).bind("mouseover mouseout", fn); - types = types.split(" "); - - var type, i = 0, namespaces; - - while ( (type = types[ i++ ]) ) { - handleObj = handleObjIn ? - jQuery.extend({}, handleObjIn) : - { handler: handler, data: data }; - - // Namespaced event handlers - if ( type.indexOf(".") > -1 ) { - namespaces = type.split("."); - type = namespaces.shift(); - handleObj.namespace = namespaces.slice(0).sort().join("."); - - } else { - namespaces = []; - handleObj.namespace = ""; - } - - handleObj.type = type; - if ( !handleObj.guid ) { - handleObj.guid = handler.guid; - } - - // Get the current list of functions bound to this event - var handlers = events[ type ], - special = jQuery.event.special[ type ] || {}; - - // Init the event handler queue - if ( !handlers ) { - handlers = events[ type ] = []; - - // Check for a special event handler - // Only use addEventListener/attachEvent if the special - // events handler returns false - if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { - // Bind the global event handler to the element - if ( elem.addEventListener ) { - elem.addEventListener( type, eventHandle, false ); - - } else if ( elem.attachEvent ) { - elem.attachEvent( "on" + type, eventHandle ); - } - } - } - - if ( special.add ) { - special.add.call( elem, handleObj ); - - if ( !handleObj.handler.guid ) { - handleObj.handler.guid = handler.guid; - } - } - - // Add the function to the element's handler list - handlers.push( handleObj ); - - // Keep track of which events have been used, for event optimization - jQuery.event.global[ type ] = true; - } - - // Nullify elem to prevent memory leaks in IE - elem = null; - }, - - global: {}, - - // Detach an event or set of events from an element - remove: function( elem, types, handler, pos ) { - // don't do events on text and comment nodes - if ( elem.nodeType === 3 || elem.nodeType === 8 ) { - return; - } - - if ( handler === false ) { - handler = returnFalse; - } - - var ret, type, fn, j, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType, - elemData = jQuery.hasData( elem ) && jQuery._data( elem ), - events = elemData && elemData.events; - - if ( !elemData || !events ) { - return; - } - - // types is actually an event object here - if ( types && types.type ) { - handler = types.handler; - types = types.type; - } - - // Unbind all events for the element - if ( !types || typeof types === "string" && types.charAt(0) === "." ) { - types = types || ""; - - for ( type in events ) { - jQuery.event.remove( elem, type + types ); - } - - return; - } - - // Handle multiple events separated by a space - // jQuery(...).unbind("mouseover mouseout", fn); - types = types.split(" "); - - while ( (type = types[ i++ ]) ) { - origType = type; - handleObj = null; - all = type.indexOf(".") < 0; - namespaces = []; - - if ( !all ) { - // Namespaced event handlers - namespaces = type.split("."); - type = namespaces.shift(); - - namespace = new RegExp("(^|\\.)" + - jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)"); - } - - eventType = events[ type ]; - - if ( !eventType ) { - continue; - } - - if ( !handler ) { - for ( j = 0; j < eventType.length; j++ ) { - handleObj = eventType[ j ]; - - if ( all || namespace.test( handleObj.namespace ) ) { - jQuery.event.remove( elem, origType, handleObj.handler, j ); - eventType.splice( j--, 1 ); - } - } - - continue; - } - - special = jQuery.event.special[ type ] || {}; - - for ( j = pos || 0; j < eventType.length; j++ ) { - handleObj = eventType[ j ]; - - if ( handler.guid === handleObj.guid ) { - // remove the given handler for the given type - if ( all || namespace.test( handleObj.namespace ) ) { - if ( pos == null ) { - eventType.splice( j--, 1 ); - } - - if ( special.remove ) { - special.remove.call( elem, handleObj ); - } - } - - if ( pos != null ) { - break; - } - } - } - - // remove generic event handler if no more handlers exist - if ( eventType.length === 0 || pos != null && eventType.length === 1 ) { - if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { - jQuery.removeEvent( elem, type, elemData.handle ); - } - - ret = null; - delete events[ type ]; - } - } - - // Remove the expando if it's no longer used - if ( jQuery.isEmptyObject( events ) ) { - var handle = elemData.handle; - if ( handle ) { - handle.elem = null; - } - - delete elemData.events; - delete elemData.handle; - - if ( jQuery.isEmptyObject( elemData ) ) { - jQuery.removeData( elem, undefined, true ); - } - } - }, - - // Events that are safe to short-circuit if no handlers are attached. - // Native DOM events should not be added, they may have inline handlers. - customEvent: { - "getData": true, - "setData": true, - "changeData": true - }, - - trigger: function( event, data, elem, onlyHandlers ) { - // Event object or event type - var type = event.type || event, - namespaces = [], - exclusive; - - if ( type.indexOf("!") >= 0 ) { - // Exclusive events trigger only for the exact event (no namespaces) - type = type.slice(0, -1); - exclusive = true; - } - - if ( type.indexOf(".") >= 0 ) { - // Namespaced trigger; create a regexp to match event type in handle() - namespaces = type.split("."); - type = namespaces.shift(); - namespaces.sort(); - } - - if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { - // No jQuery handlers for this event type, and it can't have inline handlers - return; - } - - // Caller can pass in an Event, Object, or just an event type string - event = typeof event === "object" ? - // jQuery.Event object - event[ jQuery.expando ] ? event : - // Object literal - new jQuery.Event( type, event ) : - // Just the event type (string) - new jQuery.Event( type ); - - event.type = type; - event.exclusive = exclusive; - event.namespace = namespaces.join("."); - event.namespace_re = new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)"); - - // triggerHandler() and global events don't bubble or run the default action - if ( onlyHandlers || !elem ) { - event.preventDefault(); - event.stopPropagation(); - } - - // Handle a global trigger - if ( !elem ) { - // TODO: Stop taunting the data cache; remove global events and always attach to document - jQuery.each( jQuery.cache, function() { - // internalKey variable is just used to make it easier to find - // and potentially change this stuff later; currently it just - // points to jQuery.expando - var internalKey = jQuery.expando, - internalCache = this[ internalKey ]; - if ( internalCache && internalCache.events && internalCache.events[ type ] ) { - jQuery.event.trigger( event, data, internalCache.handle.elem ); - } - }); - return; - } - - // Don't do events on text and comment nodes - if ( elem.nodeType === 3 || elem.nodeType === 8 ) { - return; - } - - // Clean up the event in case it is being reused - event.result = undefined; - event.target = elem; - - // Clone any incoming data and prepend the event, creating the handler arg list - data = data != null ? jQuery.makeArray( data ) : []; - data.unshift( event ); - - var cur = elem, - // IE doesn't like method names with a colon (#3533, #8272) - ontype = type.indexOf(":") < 0 ? "on" + type : ""; - - // Fire event on the current element, then bubble up the DOM tree - do { - var handle = jQuery._data( cur, "handle" ); - - event.currentTarget = cur; - if ( handle ) { - handle.apply( cur, data ); - } - - // Trigger an inline bound script - if ( ontype && jQuery.acceptData( cur ) && cur[ ontype ] && cur[ ontype ].apply( cur, data ) === false ) { - event.result = false; - event.preventDefault(); - } - - // Bubble up to document, then to window - cur = cur.parentNode || cur.ownerDocument || cur === event.target.ownerDocument && window; - } while ( cur && !event.isPropagationStopped() ); - - // If nobody prevented the default action, do it now - if ( !event.isDefaultPrevented() ) { - var old, - special = jQuery.event.special[ type ] || {}; - - if ( (!special._default || special._default.call( elem.ownerDocument, event ) === false) && - !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { - - // Call a native DOM method on the target with the same name name as the event. - // Can't use an .isFunction)() check here because IE6/7 fails that test. - // IE<9 dies on focus to hidden element (#1486), may want to revisit a try/catch. - try { - if ( ontype && elem[ type ] ) { - // Don't re-trigger an onFOO event when we call its FOO() method - old = elem[ ontype ]; - - if ( old ) { - elem[ ontype ] = null; - } - - jQuery.event.triggered = type; - elem[ type ](); - } - } catch ( ieError ) {} - - if ( old ) { - elem[ ontype ] = old; - } - - jQuery.event.triggered = undefined; - } - } - - return event.result; - }, - - handle: function( event ) { - event = jQuery.event.fix( event || window.event ); - // Snapshot the handlers list since a called handler may add/remove events. - var handlers = ((jQuery._data( this, "events" ) || {})[ event.type ] || []).slice(0), - run_all = !event.exclusive && !event.namespace, - args = Array.prototype.slice.call( arguments, 0 ); - - // Use the fix-ed Event rather than the (read-only) native event - args[0] = event; - event.currentTarget = this; - - for ( var j = 0, l = handlers.length; j < l; j++ ) { - var handleObj = handlers[ j ]; - - // Triggered event must 1) be non-exclusive and have no namespace, or - // 2) have namespace(s) a subset or equal to those in the bound event. - if ( run_all || event.namespace_re.test( handleObj.namespace ) ) { - // Pass in a reference to the handler function itself - // So that we can later remove it - event.handler = handleObj.handler; - event.data = handleObj.data; - event.handleObj = handleObj; - - var ret = handleObj.handler.apply( this, args ); - - if ( ret !== undefined ) { - event.result = ret; - if ( ret === false ) { - event.preventDefault(); - event.stopPropagation(); - } - } - - if ( event.isImmediatePropagationStopped() ) { - break; - } - } - } - return event.result; - }, - - props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), - - fix: function( event ) { - if ( event[ jQuery.expando ] ) { - return event; - } - - // store a copy of the original event object - // and "clone" to set read-only properties - var originalEvent = event; - event = jQuery.Event( originalEvent ); - - for ( var i = this.props.length, prop; i; ) { - prop = this.props[ --i ]; - event[ prop ] = originalEvent[ prop ]; - } - - // Fix target property, if necessary - if ( !event.target ) { - // Fixes #1925 where srcElement might not be defined either - event.target = event.srcElement || document; - } - - // check if target is a textnode (safari) - if ( event.target.nodeType === 3 ) { - event.target = event.target.parentNode; - } - - // Add relatedTarget, if necessary - if ( !event.relatedTarget && event.fromElement ) { - event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement; - } - - // Calculate pageX/Y if missing and clientX/Y available - if ( event.pageX == null && event.clientX != null ) { - var eventDocument = event.target.ownerDocument || document, - doc = eventDocument.documentElement, - body = eventDocument.body; - - event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0); - event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0); - } - - // Add which for key events - if ( event.which == null && (event.charCode != null || event.keyCode != null) ) { - event.which = event.charCode != null ? event.charCode : event.keyCode; - } - - // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) - if ( !event.metaKey && event.ctrlKey ) { - event.metaKey = event.ctrlKey; - } - - // Add which for click: 1 === left; 2 === middle; 3 === right - // Note: button is not normalized, so don't use it - if ( !event.which && event.button !== undefined ) { - event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); - } - - return event; - }, - - // Deprecated, use jQuery.guid instead - guid: 1E8, - - // Deprecated, use jQuery.proxy instead - proxy: jQuery.proxy, - - special: { - ready: { - // Make sure the ready event is setup - setup: jQuery.bindReady, - teardown: jQuery.noop - }, - - live: { - add: function( handleObj ) { - jQuery.event.add( this, - liveConvert( handleObj.origType, handleObj.selector ), - jQuery.extend({}, handleObj, {handler: liveHandler, guid: handleObj.handler.guid}) ); - }, - - remove: function( handleObj ) { - jQuery.event.remove( this, liveConvert( handleObj.origType, handleObj.selector ), handleObj ); - } - }, - - beforeunload: { - setup: function( data, namespaces, eventHandle ) { - // We only want to do this special case on windows - if ( jQuery.isWindow( this ) ) { - this.onbeforeunload = eventHandle; - } - }, - - teardown: function( namespaces, eventHandle ) { - if ( this.onbeforeunload === eventHandle ) { - this.onbeforeunload = null; - } - } - } - } -}; - -jQuery.removeEvent = document.removeEventListener ? - function( elem, type, handle ) { - if ( elem.removeEventListener ) { - elem.removeEventListener( type, handle, false ); - } - } : - function( elem, type, handle ) { - if ( elem.detachEvent ) { - elem.detachEvent( "on" + type, handle ); - } - }; - -jQuery.Event = function( src, props ) { - // Allow instantiation without the 'new' keyword - if ( !this.preventDefault ) { - return new jQuery.Event( src, props ); - } - - // Event object - if ( src && src.type ) { - this.originalEvent = src; - this.type = src.type; - - // Events bubbling up the document may have been marked as prevented - // by a handler lower down the tree; reflect the correct value. - this.isDefaultPrevented = (src.defaultPrevented || src.returnValue === false || - src.getPreventDefault && src.getPreventDefault()) ? returnTrue : returnFalse; - - // Event type - } else { - this.type = src; - } - - // Put explicitly provided properties onto the event object - if ( props ) { - jQuery.extend( this, props ); - } - - // timeStamp is buggy for some events on Firefox(#3843) - // So we won't rely on the native value - this.timeStamp = jQuery.now(); - - // Mark it as fixed - this[ jQuery.expando ] = true; -}; - -function returnFalse() { - return false; -} -function returnTrue() { - return true; -} - -// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding -// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html -jQuery.Event.prototype = { - preventDefault: function() { - this.isDefaultPrevented = returnTrue; - - var e = this.originalEvent; - if ( !e ) { - return; - } - - // if preventDefault exists run it on the original event - if ( e.preventDefault ) { - e.preventDefault(); - - // otherwise set the returnValue property of the original event to false (IE) - } else { - e.returnValue = false; - } - }, - stopPropagation: function() { - this.isPropagationStopped = returnTrue; - - var e = this.originalEvent; - if ( !e ) { - return; - } - // if stopPropagation exists run it on the original event - if ( e.stopPropagation ) { - e.stopPropagation(); - } - // otherwise set the cancelBubble property of the original event to true (IE) - e.cancelBubble = true; - }, - stopImmediatePropagation: function() { - this.isImmediatePropagationStopped = returnTrue; - this.stopPropagation(); - }, - isDefaultPrevented: returnFalse, - isPropagationStopped: returnFalse, - isImmediatePropagationStopped: returnFalse -}; - -// Checks if an event happened on an element within another element -// Used in jQuery.event.special.mouseenter and mouseleave handlers -var withinElement = function( event ) { - - // Check if mouse(over|out) are still within the same parent element - var related = event.relatedTarget, - inside = false, - eventType = event.type; - - event.type = event.data; - - if ( related !== this ) { - - if ( related ) { - inside = jQuery.contains( this, related ); - } - - if ( !inside ) { - - jQuery.event.handle.apply( this, arguments ); - - event.type = eventType; - } - } -}, - -// In case of event delegation, we only need to rename the event.type, -// liveHandler will take care of the rest. -delegate = function( event ) { - event.type = event.data; - jQuery.event.handle.apply( this, arguments ); -}; - -// Create mouseenter and mouseleave events -jQuery.each({ - mouseenter: "mouseover", - mouseleave: "mouseout" -}, function( orig, fix ) { - jQuery.event.special[ orig ] = { - setup: function( data ) { - jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig ); - }, - teardown: function( data ) { - jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement ); - } - }; -}); - -// submit delegation -if ( !jQuery.support.submitBubbles ) { - - jQuery.event.special.submit = { - setup: function( data, namespaces ) { - if ( !jQuery.nodeName( this, "form" ) ) { - jQuery.event.add(this, "click.specialSubmit", function( e ) { - // Avoid triggering error on non-existent type attribute in IE VML (#7071) - var elem = e.target, - type = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.type : ""; - - if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) { - trigger( "submit", this, arguments ); - } - }); - - jQuery.event.add(this, "keypress.specialSubmit", function( e ) { - var elem = e.target, - type = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.type : ""; - - if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) { - trigger( "submit", this, arguments ); - } - }); - - } else { - return false; - } - }, - - teardown: function( namespaces ) { - jQuery.event.remove( this, ".specialSubmit" ); - } - }; - -} - -// change delegation, happens here so we have bind. -if ( !jQuery.support.changeBubbles ) { - - var changeFilters, - - getVal = function( elem ) { - var type = jQuery.nodeName( elem, "input" ) ? elem.type : "", - val = elem.value; - - if ( type === "radio" || type === "checkbox" ) { - val = elem.checked; - - } else if ( type === "select-multiple" ) { - val = elem.selectedIndex > -1 ? - jQuery.map( elem.options, function( elem ) { - return elem.selected; - }).join("-") : - ""; - - } else if ( jQuery.nodeName( elem, "select" ) ) { - val = elem.selectedIndex; - } - - return val; - }, - - testChange = function testChange( e ) { - var elem = e.target, data, val; - - if ( !rformElems.test( elem.nodeName ) || elem.readOnly ) { - return; - } - - data = jQuery._data( elem, "_change_data" ); - val = getVal(elem); - - // the current data will be also retrieved by beforeactivate - if ( e.type !== "focusout" || elem.type !== "radio" ) { - jQuery._data( elem, "_change_data", val ); - } - - if ( data === undefined || val === data ) { - return; - } - - if ( data != null || val ) { - e.type = "change"; - e.liveFired = undefined; - jQuery.event.trigger( e, arguments[1], elem ); - } - }; - - jQuery.event.special.change = { - filters: { - focusout: testChange, - - beforedeactivate: testChange, - - click: function( e ) { - var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; - - if ( type === "radio" || type === "checkbox" || jQuery.nodeName( elem, "select" ) ) { - testChange.call( this, e ); - } - }, - - // Change has to be called before submit - // Keydown will be called before keypress, which is used in submit-event delegation - keydown: function( e ) { - var elem = e.target, type = jQuery.nodeName( elem, "input" ) ? elem.type : ""; - - if ( (e.keyCode === 13 && !jQuery.nodeName( elem, "textarea" ) ) || - (e.keyCode === 32 && (type === "checkbox" || type === "radio")) || - type === "select-multiple" ) { - testChange.call( this, e ); - } - }, - - // Beforeactivate happens also before the previous element is blurred - // with this event you can't trigger a change event, but you can store - // information - beforeactivate: function( e ) { - var elem = e.target; - jQuery._data( elem, "_change_data", getVal(elem) ); - } - }, - - setup: function( data, namespaces ) { - if ( this.type === "file" ) { - return false; - } - - for ( var type in changeFilters ) { - jQuery.event.add( this, type + ".specialChange", changeFilters[type] ); - } - - return rformElems.test( this.nodeName ); - }, - - teardown: function( namespaces ) { - jQuery.event.remove( this, ".specialChange" ); - - return rformElems.test( this.nodeName ); - } - }; - - changeFilters = jQuery.event.special.change.filters; - - // Handle when the input is .focus()'d - changeFilters.focus = changeFilters.beforeactivate; -} - -function trigger( type, elem, args ) { - // Piggyback on a donor event to simulate a different one. - // Fake originalEvent to avoid donor's stopPropagation, but if the - // simulated event prevents default then we do the same on the donor. - // Don't pass args or remember liveFired; they apply to the donor event. - var event = jQuery.extend( {}, args[ 0 ] ); - event.type = type; - event.originalEvent = {}; - event.liveFired = undefined; - jQuery.event.handle.call( elem, event ); - if ( event.isDefaultPrevented() ) { - args[ 0 ].preventDefault(); - } -} - -// Create "bubbling" focus and blur events -if ( !jQuery.support.focusinBubbles ) { - jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { - - // Attach a single capturing handler while someone wants focusin/focusout - var attaches = 0; - - jQuery.event.special[ fix ] = { - setup: function() { - if ( attaches++ === 0 ) { - document.addEventListener( orig, handler, true ); - } - }, - teardown: function() { - if ( --attaches === 0 ) { - document.removeEventListener( orig, handler, true ); - } - } - }; - - function handler( donor ) { - // Donor event is always a native one; fix it and switch its type. - // Let focusin/out handler cancel the donor focus/blur event. - var e = jQuery.event.fix( donor ); - e.type = fix; - e.originalEvent = {}; - jQuery.event.trigger( e, null, e.target ); - if ( e.isDefaultPrevented() ) { - donor.preventDefault(); - } - } - }); -} - -jQuery.each(["bind", "one"], function( i, name ) { - jQuery.fn[ name ] = function( type, data, fn ) { - var handler; - - // Handle object literals - if ( typeof type === "object" ) { - for ( var key in type ) { - this[ name ](key, data, type[key], fn); - } - return this; - } - - if ( arguments.length === 2 || data === false ) { - fn = data; - data = undefined; - } - - if ( name === "one" ) { - handler = function( event ) { - jQuery( this ).unbind( event, handler ); - return fn.apply( this, arguments ); - }; - handler.guid = fn.guid || jQuery.guid++; - } else { - handler = fn; - } - - if ( type === "unload" && name !== "one" ) { - this.one( type, data, fn ); - - } else { - for ( var i = 0, l = this.length; i < l; i++ ) { - jQuery.event.add( this[i], type, handler, data ); - } - } - - return this; - }; -}); - -jQuery.fn.extend({ - unbind: function( type, fn ) { - // Handle object literals - if ( typeof type === "object" && !type.preventDefault ) { - for ( var key in type ) { - this.unbind(key, type[key]); - } - - } else { - for ( var i = 0, l = this.length; i < l; i++ ) { - jQuery.event.remove( this[i], type, fn ); - } - } - - return this; - }, - - delegate: function( selector, types, data, fn ) { - return this.live( types, data, fn, selector ); - }, - - undelegate: function( selector, types, fn ) { - if ( arguments.length === 0 ) { - return this.unbind( "live" ); - - } else { - return this.die( types, null, fn, selector ); - } - }, - - trigger: function( type, data ) { - return this.each(function() { - jQuery.event.trigger( type, data, this ); - }); - }, - - triggerHandler: function( type, data ) { - if ( this[0] ) { - return jQuery.event.trigger( type, data, this[0], true ); - } - }, - - toggle: function( fn ) { - // Save reference to arguments for access in closure - var args = arguments, - guid = fn.guid || jQuery.guid++, - i = 0, - toggler = function( event ) { - // Figure out which function to execute - var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i; - jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 ); - - // Make sure that clicks stop - event.preventDefault(); - - // and execute the function - return args[ lastToggle ].apply( this, arguments ) || false; - }; - - // link all the functions, so any of them can unbind this click handler - toggler.guid = guid; - while ( i < args.length ) { - args[ i++ ].guid = guid; - } - - return this.click( toggler ); - }, - - hover: function( fnOver, fnOut ) { - return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); - } -}); - -var liveMap = { - focus: "focusin", - blur: "focusout", - mouseenter: "mouseover", - mouseleave: "mouseout" -}; - -jQuery.each(["live", "die"], function( i, name ) { - jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) { - var type, i = 0, match, namespaces, preType, - selector = origSelector || this.selector, - context = origSelector ? this : jQuery( this.context ); - - if ( typeof types === "object" && !types.preventDefault ) { - for ( var key in types ) { - context[ name ]( key, data, types[key], selector ); - } - - return this; - } - - if ( name === "die" && !types && - origSelector && origSelector.charAt(0) === "." ) { - - context.unbind( origSelector ); - - return this; - } - - if ( data === false || jQuery.isFunction( data ) ) { - fn = data || returnFalse; - data = undefined; - } - - types = (types || "").split(" "); - - while ( (type = types[ i++ ]) != null ) { - match = rnamespaces.exec( type ); - namespaces = ""; - - if ( match ) { - namespaces = match[0]; - type = type.replace( rnamespaces, "" ); - } - - if ( type === "hover" ) { - types.push( "mouseenter" + namespaces, "mouseleave" + namespaces ); - continue; - } - - preType = type; - - if ( liveMap[ type ] ) { - types.push( liveMap[ type ] + namespaces ); - type = type + namespaces; - - } else { - type = (liveMap[ type ] || type) + namespaces; - } - - if ( name === "live" ) { - // bind live handler - for ( var j = 0, l = context.length; j < l; j++ ) { - jQuery.event.add( context[j], "live." + liveConvert( type, selector ), - { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } ); - } - - } else { - // unbind live handler - context.unbind( "live." + liveConvert( type, selector ), fn ); - } - } - - return this; - }; -}); - -function liveHandler( event ) { - var stop, maxLevel, related, match, handleObj, elem, j, i, l, data, close, namespace, ret, - elems = [], - selectors = [], - events = jQuery._data( this, "events" ); - - // Make sure we avoid non-left-click bubbling in Firefox (#3861) and disabled elements in IE (#6911) - if ( event.liveFired === this || !events || !events.live || event.target.disabled || event.button && event.type === "click" ) { - return; - } - - if ( event.namespace ) { - namespace = new RegExp("(^|\\.)" + event.namespace.split(".").join("\\.(?:.*\\.)?") + "(\\.|$)"); - } - - event.liveFired = this; - - var live = events.live.slice(0); - - for ( j = 0; j < live.length; j++ ) { - handleObj = live[j]; - - if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) { - selectors.push( handleObj.selector ); - - } else { - live.splice( j--, 1 ); - } - } - - match = jQuery( event.target ).closest( selectors, event.currentTarget ); - - for ( i = 0, l = match.length; i < l; i++ ) { - close = match[i]; - - for ( j = 0; j < live.length; j++ ) { - handleObj = live[j]; - - if ( close.selector === handleObj.selector && (!namespace || namespace.test( handleObj.namespace )) && !close.elem.disabled ) { - elem = close.elem; - related = null; - - // Those two events require additional checking - if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) { - event.type = handleObj.preType; - related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0]; - - // Make sure not to accidentally match a child element with the same selector - if ( related && jQuery.contains( elem, related ) ) { - related = elem; - } - } - - if ( !related || related !== elem ) { - elems.push({ elem: elem, handleObj: handleObj, level: close.level }); - } - } - } - } - - for ( i = 0, l = elems.length; i < l; i++ ) { - match = elems[i]; - - if ( maxLevel && match.level > maxLevel ) { - break; - } - - event.currentTarget = match.elem; - event.data = match.handleObj.data; - event.handleObj = match.handleObj; - - ret = match.handleObj.origHandler.apply( match.elem, arguments ); - - if ( ret === false || event.isPropagationStopped() ) { - maxLevel = match.level; - - if ( ret === false ) { - stop = false; - } - if ( event.isImmediatePropagationStopped() ) { - break; - } - } - } - - return stop; -} - -function liveConvert( type, selector ) { - return (type && type !== "*" ? type + "." : "") + selector.replace(rperiod, "`").replace(rspaces, "&"); -} - -jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + - "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + - "change select submit keydown keypress keyup error").split(" "), function( i, name ) { - - // Handle event binding - jQuery.fn[ name ] = function( data, fn ) { - if ( fn == null ) { - fn = data; - data = null; - } - - return arguments.length > 0 ? - this.bind( name, data, fn ) : - this.trigger( name ); - }; - - if ( jQuery.attrFn ) { - jQuery.attrFn[ name ] = true; - } -}); - - - -/*! - * Sizzle CSS Selector Engine - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * More information: http://sizzlejs.com/ - */ -(function(){ - -var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, - done = 0, - toString = Object.prototype.toString, - hasDuplicate = false, - baseHasDuplicate = true, - rBackslash = /\\/g, - rNonWord = /\W/; - -// Here we check if the JavaScript engine is using some sort of -// optimization where it does not always call our comparision -// function. If that is the case, discard the hasDuplicate value. -// Thus far that includes Google Chrome. -[0, 0].sort(function() { - baseHasDuplicate = false; - return 0; -}); - -var Sizzle = function( selector, context, results, seed ) { - results = results || []; - context = context || document; - - var origContext = context; - - if ( context.nodeType !== 1 && context.nodeType !== 9 ) { - return []; - } - - if ( !selector || typeof selector !== "string" ) { - return results; - } - - var m, set, checkSet, extra, ret, cur, pop, i, - prune = true, - contextXML = Sizzle.isXML( context ), - parts = [], - soFar = selector; - - // Reset the position of the chunker regexp (start from head) - do { - chunker.exec( "" ); - m = chunker.exec( soFar ); - - if ( m ) { - soFar = m[3]; - - parts.push( m[1] ); - - if ( m[2] ) { - extra = m[3]; - break; - } - } - } while ( m ); - - if ( parts.length > 1 && origPOS.exec( selector ) ) { - - if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { - set = posProcess( parts[0] + parts[1], context ); - - } else { - set = Expr.relative[ parts[0] ] ? - [ context ] : - Sizzle( parts.shift(), context ); - - while ( parts.length ) { - selector = parts.shift(); - - if ( Expr.relative[ selector ] ) { - selector += parts.shift(); - } - - set = posProcess( selector, set ); - } - } - - } else { - // Take a shortcut and set the context if the root selector is an ID - // (but not if it'll be faster if the inner selector is an ID) - if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && - Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { - - ret = Sizzle.find( parts.shift(), context, contextXML ); - context = ret.expr ? - Sizzle.filter( ret.expr, ret.set )[0] : - ret.set[0]; - } - - if ( context ) { - ret = seed ? - { expr: parts.pop(), set: makeArray(seed) } : - Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); - - set = ret.expr ? - Sizzle.filter( ret.expr, ret.set ) : - ret.set; - - if ( parts.length > 0 ) { - checkSet = makeArray( set ); - - } else { - prune = false; - } - - while ( parts.length ) { - cur = parts.pop(); - pop = cur; - - if ( !Expr.relative[ cur ] ) { - cur = ""; - } else { - pop = parts.pop(); - } - - if ( pop == null ) { - pop = context; - } - - Expr.relative[ cur ]( checkSet, pop, contextXML ); - } - - } else { - checkSet = parts = []; - } - } - - if ( !checkSet ) { - checkSet = set; - } - - if ( !checkSet ) { - Sizzle.error( cur || selector ); - } - - if ( toString.call(checkSet) === "[object Array]" ) { - if ( !prune ) { - results.push.apply( results, checkSet ); - - } else if ( context && context.nodeType === 1 ) { - for ( i = 0; checkSet[i] != null; i++ ) { - if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { - results.push( set[i] ); - } - } - - } else { - for ( i = 0; checkSet[i] != null; i++ ) { - if ( checkSet[i] && checkSet[i].nodeType === 1 ) { - results.push( set[i] ); - } - } - } - - } else { - makeArray( checkSet, results ); - } - - if ( extra ) { - Sizzle( extra, origContext, results, seed ); - Sizzle.uniqueSort( results ); - } - - return results; -}; - -Sizzle.uniqueSort = function( results ) { - if ( sortOrder ) { - hasDuplicate = baseHasDuplicate; - results.sort( sortOrder ); - - if ( hasDuplicate ) { - for ( var i = 1; i < results.length; i++ ) { - if ( results[i] === results[ i - 1 ] ) { - results.splice( i--, 1 ); - } - } - } - } - - return results; -}; - -Sizzle.matches = function( expr, set ) { - return Sizzle( expr, null, null, set ); -}; - -Sizzle.matchesSelector = function( node, expr ) { - return Sizzle( expr, null, null, [node] ).length > 0; -}; - -Sizzle.find = function( expr, context, isXML ) { - var set; - - if ( !expr ) { - return []; - } - - for ( var i = 0, l = Expr.order.length; i < l; i++ ) { - var match, - type = Expr.order[i]; - - if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { - var left = match[1]; - match.splice( 1, 1 ); - - if ( left.substr( left.length - 1 ) !== "\\" ) { - match[1] = (match[1] || "").replace( rBackslash, "" ); - set = Expr.find[ type ]( match, context, isXML ); - - if ( set != null ) { - expr = expr.replace( Expr.match[ type ], "" ); - break; - } - } - } - } - - if ( !set ) { - set = typeof context.getElementsByTagName !== "undefined" ? - context.getElementsByTagName( "*" ) : - []; - } - - return { set: set, expr: expr }; -}; - -Sizzle.filter = function( expr, set, inplace, not ) { - var match, anyFound, - old = expr, - result = [], - curLoop = set, - isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); - - while ( expr && set.length ) { - for ( var type in Expr.filter ) { - if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { - var found, item, - filter = Expr.filter[ type ], - left = match[1]; - - anyFound = false; - - match.splice(1,1); - - if ( left.substr( left.length - 1 ) === "\\" ) { - continue; - } - - if ( curLoop === result ) { - result = []; - } - - if ( Expr.preFilter[ type ] ) { - match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); - - if ( !match ) { - anyFound = found = true; - - } else if ( match === true ) { - continue; - } - } - - if ( match ) { - for ( var i = 0; (item = curLoop[i]) != null; i++ ) { - if ( item ) { - found = filter( item, match, i, curLoop ); - var pass = not ^ !!found; - - if ( inplace && found != null ) { - if ( pass ) { - anyFound = true; - - } else { - curLoop[i] = false; - } - - } else if ( pass ) { - result.push( item ); - anyFound = true; - } - } - } - } - - if ( found !== undefined ) { - if ( !inplace ) { - curLoop = result; - } - - expr = expr.replace( Expr.match[ type ], "" ); - - if ( !anyFound ) { - return []; - } - - break; - } - } - } - - // Improper expression - if ( expr === old ) { - if ( anyFound == null ) { - Sizzle.error( expr ); - - } else { - break; - } - } - - old = expr; - } - - return curLoop; -}; - -Sizzle.error = function( msg ) { - throw "Syntax error, unrecognized expression: " + msg; -}; - -var Expr = Sizzle.selectors = { - order: [ "ID", "NAME", "TAG" ], - - match: { - ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, - CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, - NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, - ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, - TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, - CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, - POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, - PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ - }, - - leftMatch: {}, - - attrMap: { - "class": "className", - "for": "htmlFor" - }, - - attrHandle: { - href: function( elem ) { - return elem.getAttribute( "href" ); - }, - type: function( elem ) { - return elem.getAttribute( "type" ); - } - }, - - relative: { - "+": function(checkSet, part){ - var isPartStr = typeof part === "string", - isTag = isPartStr && !rNonWord.test( part ), - isPartStrNotTag = isPartStr && !isTag; - - if ( isTag ) { - part = part.toLowerCase(); - } - - for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { - if ( (elem = checkSet[i]) ) { - while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} - - checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? - elem || false : - elem === part; - } - } - - if ( isPartStrNotTag ) { - Sizzle.filter( part, checkSet, true ); - } - }, - - ">": function( checkSet, part ) { - var elem, - isPartStr = typeof part === "string", - i = 0, - l = checkSet.length; - - if ( isPartStr && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - - for ( ; i < l; i++ ) { - elem = checkSet[i]; - - if ( elem ) { - var parent = elem.parentNode; - checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; - } - } - - } else { - for ( ; i < l; i++ ) { - elem = checkSet[i]; - - if ( elem ) { - checkSet[i] = isPartStr ? - elem.parentNode : - elem.parentNode === part; - } - } - - if ( isPartStr ) { - Sizzle.filter( part, checkSet, true ); - } - } - }, - - "": function(checkSet, part, isXML){ - var nodeCheck, - doneName = done++, - checkFn = dirCheck; - - if ( typeof part === "string" && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - nodeCheck = part; - checkFn = dirNodeCheck; - } - - checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); - }, - - "~": function( checkSet, part, isXML ) { - var nodeCheck, - doneName = done++, - checkFn = dirCheck; - - if ( typeof part === "string" && !rNonWord.test( part ) ) { - part = part.toLowerCase(); - nodeCheck = part; - checkFn = dirNodeCheck; - } - - checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); - } - }, - - find: { - ID: function( match, context, isXML ) { - if ( typeof context.getElementById !== "undefined" && !isXML ) { - var m = context.getElementById(match[1]); - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - return m && m.parentNode ? [m] : []; - } - }, - - NAME: function( match, context ) { - if ( typeof context.getElementsByName !== "undefined" ) { - var ret = [], - results = context.getElementsByName( match[1] ); - - for ( var i = 0, l = results.length; i < l; i++ ) { - if ( results[i].getAttribute("name") === match[1] ) { - ret.push( results[i] ); - } - } - - return ret.length === 0 ? null : ret; - } - }, - - TAG: function( match, context ) { - if ( typeof context.getElementsByTagName !== "undefined" ) { - return context.getElementsByTagName( match[1] ); - } - } - }, - preFilter: { - CLASS: function( match, curLoop, inplace, result, not, isXML ) { - match = " " + match[1].replace( rBackslash, "" ) + " "; - - if ( isXML ) { - return match; - } - - for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { - if ( elem ) { - if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { - if ( !inplace ) { - result.push( elem ); - } - - } else if ( inplace ) { - curLoop[i] = false; - } - } - } - - return false; - }, - - ID: function( match ) { - return match[1].replace( rBackslash, "" ); - }, - - TAG: function( match, curLoop ) { - return match[1].replace( rBackslash, "" ).toLowerCase(); - }, - - CHILD: function( match ) { - if ( match[1] === "nth" ) { - if ( !match[2] ) { - Sizzle.error( match[0] ); - } - - match[2] = match[2].replace(/^\+|\s*/g, ''); - - // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' - var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( - match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || - !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); - - // calculate the numbers (first)n+(last) including if they are negative - match[2] = (test[1] + (test[2] || 1)) - 0; - match[3] = test[3] - 0; - } - else if ( match[2] ) { - Sizzle.error( match[0] ); - } - - // TODO: Move to normal caching system - match[0] = done++; - - return match; - }, - - ATTR: function( match, curLoop, inplace, result, not, isXML ) { - var name = match[1] = match[1].replace( rBackslash, "" ); - - if ( !isXML && Expr.attrMap[name] ) { - match[1] = Expr.attrMap[name]; - } - - // Handle if an un-quoted value was used - match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); - - if ( match[2] === "~=" ) { - match[4] = " " + match[4] + " "; - } - - return match; - }, - - PSEUDO: function( match, curLoop, inplace, result, not ) { - if ( match[1] === "not" ) { - // If we're dealing with a complex expression, or a simple one - if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { - match[3] = Sizzle(match[3], null, null, curLoop); - - } else { - var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); - - if ( !inplace ) { - result.push.apply( result, ret ); - } - - return false; - } - - } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { - return true; - } - - return match; - }, - - POS: function( match ) { - match.unshift( true ); - - return match; - } - }, - - filters: { - enabled: function( elem ) { - return elem.disabled === false && elem.type !== "hidden"; - }, - - disabled: function( elem ) { - return elem.disabled === true; - }, - - checked: function( elem ) { - return elem.checked === true; - }, - - selected: function( elem ) { - // Accessing this property makes selected-by-default - // options in Safari work properly - if ( elem.parentNode ) { - elem.parentNode.selectedIndex; - } - - return elem.selected === true; - }, - - parent: function( elem ) { - return !!elem.firstChild; - }, - - empty: function( elem ) { - return !elem.firstChild; - }, - - has: function( elem, i, match ) { - return !!Sizzle( match[3], elem ).length; - }, - - header: function( elem ) { - return (/h\d/i).test( elem.nodeName ); - }, - - text: function( elem ) { - var attr = elem.getAttribute( "type" ), type = elem.type; - // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) - // use getAttribute instead to test this case - return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); - }, - - radio: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; - }, - - checkbox: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; - }, - - file: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; - }, - - password: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; - }, - - submit: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return (name === "input" || name === "button") && "submit" === elem.type; - }, - - image: function( elem ) { - return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; - }, - - reset: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return (name === "input" || name === "button") && "reset" === elem.type; - }, - - button: function( elem ) { - var name = elem.nodeName.toLowerCase(); - return name === "input" && "button" === elem.type || name === "button"; - }, - - input: function( elem ) { - return (/input|select|textarea|button/i).test( elem.nodeName ); - }, - - focus: function( elem ) { - return elem === elem.ownerDocument.activeElement; - } - }, - setFilters: { - first: function( elem, i ) { - return i === 0; - }, - - last: function( elem, i, match, array ) { - return i === array.length - 1; - }, - - even: function( elem, i ) { - return i % 2 === 0; - }, - - odd: function( elem, i ) { - return i % 2 === 1; - }, - - lt: function( elem, i, match ) { - return i < match[3] - 0; - }, - - gt: function( elem, i, match ) { - return i > match[3] - 0; - }, - - nth: function( elem, i, match ) { - return match[3] - 0 === i; - }, - - eq: function( elem, i, match ) { - return match[3] - 0 === i; - } - }, - filter: { - PSEUDO: function( elem, match, i, array ) { - var name = match[1], - filter = Expr.filters[ name ]; - - if ( filter ) { - return filter( elem, i, match, array ); - - } else if ( name === "contains" ) { - return (elem.textContent || elem.innerText || Sizzle.getText([ elem ]) || "").indexOf(match[3]) >= 0; - - } else if ( name === "not" ) { - var not = match[3]; - - for ( var j = 0, l = not.length; j < l; j++ ) { - if ( not[j] === elem ) { - return false; - } - } - - return true; - - } else { - Sizzle.error( name ); - } - }, - - CHILD: function( elem, match ) { - var type = match[1], - node = elem; - - switch ( type ) { - case "only": - case "first": - while ( (node = node.previousSibling) ) { - if ( node.nodeType === 1 ) { - return false; - } - } - - if ( type === "first" ) { - return true; - } - - node = elem; - - case "last": - while ( (node = node.nextSibling) ) { - if ( node.nodeType === 1 ) { - return false; - } - } - - return true; - - case "nth": - var first = match[2], - last = match[3]; - - if ( first === 1 && last === 0 ) { - return true; - } - - var doneName = match[0], - parent = elem.parentNode; - - if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { - var count = 0; - - for ( node = parent.firstChild; node; node = node.nextSibling ) { - if ( node.nodeType === 1 ) { - node.nodeIndex = ++count; - } - } - - parent.sizcache = doneName; - } - - var diff = elem.nodeIndex - last; - - if ( first === 0 ) { - return diff === 0; - - } else { - return ( diff % first === 0 && diff / first >= 0 ); - } - } - }, - - ID: function( elem, match ) { - return elem.nodeType === 1 && elem.getAttribute("id") === match; - }, - - TAG: function( elem, match ) { - return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match; - }, - - CLASS: function( elem, match ) { - return (" " + (elem.className || elem.getAttribute("class")) + " ") - .indexOf( match ) > -1; - }, - - ATTR: function( elem, match ) { - var name = match[1], - result = Expr.attrHandle[ name ] ? - Expr.attrHandle[ name ]( elem ) : - elem[ name ] != null ? - elem[ name ] : - elem.getAttribute( name ), - value = result + "", - type = match[2], - check = match[4]; - - return result == null ? - type === "!=" : - type === "=" ? - value === check : - type === "*=" ? - value.indexOf(check) >= 0 : - type === "~=" ? - (" " + value + " ").indexOf(check) >= 0 : - !check ? - value && result !== false : - type === "!=" ? - value !== check : - type === "^=" ? - value.indexOf(check) === 0 : - type === "$=" ? - value.substr(value.length - check.length) === check : - type === "|=" ? - value === check || value.substr(0, check.length + 1) === check + "-" : - false; - }, - - POS: function( elem, match, i, array ) { - var name = match[2], - filter = Expr.setFilters[ name ]; - - if ( filter ) { - return filter( elem, i, match, array ); - } - } - } -}; - -var origPOS = Expr.match.POS, - fescape = function(all, num){ - return "\\" + (num - 0 + 1); - }; - -for ( var type in Expr.match ) { - Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); - Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); -} - -var makeArray = function( array, results ) { - array = Array.prototype.slice.call( array, 0 ); - - if ( results ) { - results.push.apply( results, array ); - return results; - } - - return array; -}; - -// Perform a simple check to determine if the browser is capable of -// converting a NodeList to an array using builtin methods. -// Also verifies that the returned array holds DOM nodes -// (which is not the case in the Blackberry browser) -try { - Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; - -// Provide a fallback method if it does not work -} catch( e ) { - makeArray = function( array, results ) { - var i = 0, - ret = results || []; - - if ( toString.call(array) === "[object Array]" ) { - Array.prototype.push.apply( ret, array ); - - } else { - if ( typeof array.length === "number" ) { - for ( var l = array.length; i < l; i++ ) { - ret.push( array[i] ); - } - - } else { - for ( ; array[i]; i++ ) { - ret.push( array[i] ); - } - } - } - - return ret; - }; -} - -var sortOrder, siblingCheck; - -if ( document.documentElement.compareDocumentPosition ) { - sortOrder = function( a, b ) { - if ( a === b ) { - hasDuplicate = true; - return 0; - } - - if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { - return a.compareDocumentPosition ? -1 : 1; - } - - return a.compareDocumentPosition(b) & 4 ? -1 : 1; - }; - -} else { - sortOrder = function( a, b ) { - // The nodes are identical, we can exit early - if ( a === b ) { - hasDuplicate = true; - return 0; - - // Fallback to using sourceIndex (in IE) if it's available on both nodes - } else if ( a.sourceIndex && b.sourceIndex ) { - return a.sourceIndex - b.sourceIndex; - } - - var al, bl, - ap = [], - bp = [], - aup = a.parentNode, - bup = b.parentNode, - cur = aup; - - // If the nodes are siblings (or identical) we can do a quick check - if ( aup === bup ) { - return siblingCheck( a, b ); - - // If no parents were found then the nodes are disconnected - } else if ( !aup ) { - return -1; - - } else if ( !bup ) { - return 1; - } - - // Otherwise they're somewhere else in the tree so we need - // to build up a full list of the parentNodes for comparison - while ( cur ) { - ap.unshift( cur ); - cur = cur.parentNode; - } - - cur = bup; - - while ( cur ) { - bp.unshift( cur ); - cur = cur.parentNode; - } - - al = ap.length; - bl = bp.length; - - // Start walking down the tree looking for a discrepancy - for ( var i = 0; i < al && i < bl; i++ ) { - if ( ap[i] !== bp[i] ) { - return siblingCheck( ap[i], bp[i] ); - } - } - - // We ended someplace up the tree so do a sibling check - return i === al ? - siblingCheck( a, bp[i], -1 ) : - siblingCheck( ap[i], b, 1 ); - }; - - siblingCheck = function( a, b, ret ) { - if ( a === b ) { - return ret; - } - - var cur = a.nextSibling; - - while ( cur ) { - if ( cur === b ) { - return -1; - } - - cur = cur.nextSibling; - } - - return 1; - }; -} - -// Utility function for retreiving the text value of an array of DOM nodes -Sizzle.getText = function( elems ) { - var ret = "", elem; - - for ( var i = 0; elems[i]; i++ ) { - elem = elems[i]; - - // Get the text from text nodes and CDATA nodes - if ( elem.nodeType === 3 || elem.nodeType === 4 ) { - ret += elem.nodeValue; - - // Traverse everything else, except comment nodes - } else if ( elem.nodeType !== 8 ) { - ret += Sizzle.getText( elem.childNodes ); - } - } - - return ret; -}; - -// Check to see if the browser returns elements by name when -// querying by getElementById (and provide a workaround) -(function(){ - // We're going to inject a fake input element with a specified name - var form = document.createElement("div"), - id = "script" + (new Date()).getTime(), - root = document.documentElement; - - form.innerHTML = ""; - - // Inject it into the root element, check its status, and remove it quickly - root.insertBefore( form, root.firstChild ); - - // The workaround has to do additional checks after a getElementById - // Which slows things down for other browsers (hence the branching) - if ( document.getElementById( id ) ) { - Expr.find.ID = function( match, context, isXML ) { - if ( typeof context.getElementById !== "undefined" && !isXML ) { - var m = context.getElementById(match[1]); - - return m ? - m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? - [m] : - undefined : - []; - } - }; - - Expr.filter.ID = function( elem, match ) { - var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); - - return elem.nodeType === 1 && node && node.nodeValue === match; - }; - } - - root.removeChild( form ); - - // release memory in IE - root = form = null; -})(); - -(function(){ - // Check to see if the browser returns only elements - // when doing getElementsByTagName("*") - - // Create a fake element - var div = document.createElement("div"); - div.appendChild( document.createComment("") ); - - // Make sure no comments are found - if ( div.getElementsByTagName("*").length > 0 ) { - Expr.find.TAG = function( match, context ) { - var results = context.getElementsByTagName( match[1] ); - - // Filter out possible comments - if ( match[1] === "*" ) { - var tmp = []; - - for ( var i = 0; results[i]; i++ ) { - if ( results[i].nodeType === 1 ) { - tmp.push( results[i] ); - } - } - - results = tmp; - } - - return results; - }; - } - - // Check to see if an attribute returns normalized href attributes - div.innerHTML = ""; - - if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && - div.firstChild.getAttribute("href") !== "#" ) { - - Expr.attrHandle.href = function( elem ) { - return elem.getAttribute( "href", 2 ); - }; - } - - // release memory in IE - div = null; -})(); - -if ( document.querySelectorAll ) { - (function(){ - var oldSizzle = Sizzle, - div = document.createElement("div"), - id = "__sizzle__"; - - div.innerHTML = "

      "; - - // Safari can't handle uppercase or unicode characters when - // in quirks mode. - if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { - return; - } - - Sizzle = function( query, context, extra, seed ) { - context = context || document; - - // Only use querySelectorAll on non-XML documents - // (ID selectors don't work in non-HTML documents) - if ( !seed && !Sizzle.isXML(context) ) { - // See if we find a selector to speed up - var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); - - if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { - // Speed-up: Sizzle("TAG") - if ( match[1] ) { - return makeArray( context.getElementsByTagName( query ), extra ); - - // Speed-up: Sizzle(".CLASS") - } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { - return makeArray( context.getElementsByClassName( match[2] ), extra ); - } - } - - if ( context.nodeType === 9 ) { - // Speed-up: Sizzle("body") - // The body element only exists once, optimize finding it - if ( query === "body" && context.body ) { - return makeArray( [ context.body ], extra ); - - // Speed-up: Sizzle("#ID") - } else if ( match && match[3] ) { - var elem = context.getElementById( match[3] ); - - // Check parentNode to catch when Blackberry 4.6 returns - // nodes that are no longer in the document #6963 - if ( elem && elem.parentNode ) { - // Handle the case where IE and Opera return items - // by name instead of ID - if ( elem.id === match[3] ) { - return makeArray( [ elem ], extra ); - } - - } else { - return makeArray( [], extra ); - } - } - - try { - return makeArray( context.querySelectorAll(query), extra ); - } catch(qsaError) {} - - // qSA works strangely on Element-rooted queries - // We can work around this by specifying an extra ID on the root - // and working up from there (Thanks to Andrew Dupont for the technique) - // IE 8 doesn't work on object elements - } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { - var oldContext = context, - old = context.getAttribute( "id" ), - nid = old || id, - hasParent = context.parentNode, - relativeHierarchySelector = /^\s*[+~]/.test( query ); - - if ( !old ) { - context.setAttribute( "id", nid ); - } else { - nid = nid.replace( /'/g, "\\$&" ); - } - if ( relativeHierarchySelector && hasParent ) { - context = context.parentNode; - } - - try { - if ( !relativeHierarchySelector || hasParent ) { - return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); - } - - } catch(pseudoError) { - } finally { - if ( !old ) { - oldContext.removeAttribute( "id" ); - } - } - } - } - - return oldSizzle(query, context, extra, seed); - }; - - for ( var prop in oldSizzle ) { - Sizzle[ prop ] = oldSizzle[ prop ]; - } - - // release memory in IE - div = null; - })(); -} - -(function(){ - var html = document.documentElement, - matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; - - if ( matches ) { - // Check to see if it's possible to do matchesSelector - // on a disconnected node (IE 9 fails this) - var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), - pseudoWorks = false; - - try { - // This should fail with an exception - // Gecko does not error, returns false instead - matches.call( document.documentElement, "[test!='']:sizzle" ); - - } catch( pseudoError ) { - pseudoWorks = true; - } - - Sizzle.matchesSelector = function( node, expr ) { - // Make sure that attribute selectors are quoted - expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); - - if ( !Sizzle.isXML( node ) ) { - try { - if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { - var ret = matches.call( node, expr ); - - // IE 9's matchesSelector returns false on disconnected nodes - if ( ret || !disconnectedMatch || - // As well, disconnected nodes are said to be in a document - // fragment in IE 9, so check for that - node.document && node.document.nodeType !== 11 ) { - return ret; - } - } - } catch(e) {} - } - - return Sizzle(expr, null, null, [node]).length > 0; - }; - } -})(); - -(function(){ - var div = document.createElement("div"); - - div.innerHTML = "
      "; - - // Opera can't find a second classname (in 9.6) - // Also, make sure that getElementsByClassName actually exists - if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { - return; - } - - // Safari caches class attributes, doesn't catch changes (in 3.2) - div.lastChild.className = "e"; - - if ( div.getElementsByClassName("e").length === 1 ) { - return; - } - - Expr.order.splice(1, 0, "CLASS"); - Expr.find.CLASS = function( match, context, isXML ) { - if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { - return context.getElementsByClassName(match[1]); - } - }; - - // release memory in IE - div = null; -})(); - -function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { - for ( var i = 0, l = checkSet.length; i < l; i++ ) { - var elem = checkSet[i]; - - if ( elem ) { - var match = false; - - elem = elem[dir]; - - while ( elem ) { - if ( elem.sizcache === doneName ) { - match = checkSet[elem.sizset]; - break; - } - - if ( elem.nodeType === 1 && !isXML ){ - elem.sizcache = doneName; - elem.sizset = i; - } - - if ( elem.nodeName.toLowerCase() === cur ) { - match = elem; - break; - } - - elem = elem[dir]; - } - - checkSet[i] = match; - } - } -} - -function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { - for ( var i = 0, l = checkSet.length; i < l; i++ ) { - var elem = checkSet[i]; - - if ( elem ) { - var match = false; - - elem = elem[dir]; - - while ( elem ) { - if ( elem.sizcache === doneName ) { - match = checkSet[elem.sizset]; - break; - } - - if ( elem.nodeType === 1 ) { - if ( !isXML ) { - elem.sizcache = doneName; - elem.sizset = i; - } - - if ( typeof cur !== "string" ) { - if ( elem === cur ) { - match = true; - break; - } - - } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { - match = elem; - break; - } - } - - elem = elem[dir]; - } - - checkSet[i] = match; - } - } -} - -if ( document.documentElement.contains ) { - Sizzle.contains = function( a, b ) { - return a !== b && (a.contains ? a.contains(b) : true); - }; - -} else if ( document.documentElement.compareDocumentPosition ) { - Sizzle.contains = function( a, b ) { - return !!(a.compareDocumentPosition(b) & 16); - }; - -} else { - Sizzle.contains = function() { - return false; - }; -} - -Sizzle.isXML = function( elem ) { - // documentElement is verified for cases where it doesn't yet exist - // (such as loading iframes in IE - #4833) - var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; - - return documentElement ? documentElement.nodeName !== "HTML" : false; -}; - -var posProcess = function( selector, context ) { - var match, - tmpSet = [], - later = "", - root = context.nodeType ? [context] : context; - - // Position selectors must be done after the filter - // And so must :not(positional) so we move all PSEUDOs to the end - while ( (match = Expr.match.PSEUDO.exec( selector )) ) { - later += match[0]; - selector = selector.replace( Expr.match.PSEUDO, "" ); - } - - selector = Expr.relative[selector] ? selector + "*" : selector; - - for ( var i = 0, l = root.length; i < l; i++ ) { - Sizzle( selector, root[i], tmpSet ); - } - - return Sizzle.filter( later, tmpSet ); -}; - -// EXPOSE -jQuery.find = Sizzle; -jQuery.expr = Sizzle.selectors; -jQuery.expr[":"] = jQuery.expr.filters; -jQuery.unique = Sizzle.uniqueSort; -jQuery.text = Sizzle.getText; -jQuery.isXMLDoc = Sizzle.isXML; -jQuery.contains = Sizzle.contains; - - -})(); - - -var runtil = /Until$/, - rparentsprev = /^(?:parents|prevUntil|prevAll)/, - // Note: This RegExp should be improved, or likely pulled from Sizzle - rmultiselector = /,/, - isSimple = /^.[^:#\[\.,]*$/, - slice = Array.prototype.slice, - POS = jQuery.expr.match.POS, - // methods guaranteed to produce a unique set when starting from a unique set - guaranteedUnique = { - children: true, - contents: true, - next: true, - prev: true - }; - -jQuery.fn.extend({ - find: function( selector ) { - var self = this, - i, l; - - if ( typeof selector !== "string" ) { - return jQuery( selector ).filter(function() { - for ( i = 0, l = self.length; i < l; i++ ) { - if ( jQuery.contains( self[ i ], this ) ) { - return true; - } - } - }); - } - - var ret = this.pushStack( "", "find", selector ), - length, n, r; - - for ( i = 0, l = this.length; i < l; i++ ) { - length = ret.length; - jQuery.find( selector, this[i], ret ); - - if ( i > 0 ) { - // Make sure that the results are unique - for ( n = length; n < ret.length; n++ ) { - for ( r = 0; r < length; r++ ) { - if ( ret[r] === ret[n] ) { - ret.splice(n--, 1); - break; - } - } - } - } - } - - return ret; - }, - - has: function( target ) { - var targets = jQuery( target ); - return this.filter(function() { - for ( var i = 0, l = targets.length; i < l; i++ ) { - if ( jQuery.contains( this, targets[i] ) ) { - return true; - } - } - }); - }, - - not: function( selector ) { - return this.pushStack( winnow(this, selector, false), "not", selector); - }, - - filter: function( selector ) { - return this.pushStack( winnow(this, selector, true), "filter", selector ); - }, - - is: function( selector ) { - return !!selector && ( typeof selector === "string" ? - jQuery.filter( selector, this ).length > 0 : - this.filter( selector ).length > 0 ); - }, - - closest: function( selectors, context ) { - var ret = [], i, l, cur = this[0]; - - // Array - if ( jQuery.isArray( selectors ) ) { - var match, selector, - matches = {}, - level = 1; - - if ( cur && selectors.length ) { - for ( i = 0, l = selectors.length; i < l; i++ ) { - selector = selectors[i]; - - if ( !matches[ selector ] ) { - matches[ selector ] = POS.test( selector ) ? - jQuery( selector, context || this.context ) : - selector; - } - } - - while ( cur && cur.ownerDocument && cur !== context ) { - for ( selector in matches ) { - match = matches[ selector ]; - - if ( match.jquery ? match.index( cur ) > -1 : jQuery( cur ).is( match ) ) { - ret.push({ selector: selector, elem: cur, level: level }); - } - } - - cur = cur.parentNode; - level++; - } - } - - return ret; - } - - // String - var pos = POS.test( selectors ) || typeof selectors !== "string" ? - jQuery( selectors, context || this.context ) : - 0; - - for ( i = 0, l = this.length; i < l; i++ ) { - cur = this[i]; - - while ( cur ) { - if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { - ret.push( cur ); - break; - - } else { - cur = cur.parentNode; - if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { - break; - } - } - } - } - - ret = ret.length > 1 ? jQuery.unique( ret ) : ret; - - return this.pushStack( ret, "closest", selectors ); - }, - - // Determine the position of an element within - // the matched set of elements - index: function( elem ) { - - // No argument, return index in parent - if ( !elem ) { - return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; - } - - // index in selector - if ( typeof elem === "string" ) { - return jQuery.inArray( this[0], jQuery( elem ) ); - } - - // Locate the position of the desired element - return jQuery.inArray( - // If it receives a jQuery object, the first element is used - elem.jquery ? elem[0] : elem, this ); - }, - - add: function( selector, context ) { - var set = typeof selector === "string" ? - jQuery( selector, context ) : - jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), - all = jQuery.merge( this.get(), set ); - - return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? - all : - jQuery.unique( all ) ); - }, - - andSelf: function() { - return this.add( this.prevObject ); - } -}); - -// A painfully simple check to see if an element is disconnected -// from a document (should be improved, where feasible). -function isDisconnected( node ) { - return !node || !node.parentNode || node.parentNode.nodeType === 11; -} - -jQuery.each({ - parent: function( elem ) { - var parent = elem.parentNode; - return parent && parent.nodeType !== 11 ? parent : null; - }, - parents: function( elem ) { - return jQuery.dir( elem, "parentNode" ); - }, - parentsUntil: function( elem, i, until ) { - return jQuery.dir( elem, "parentNode", until ); - }, - next: function( elem ) { - return jQuery.nth( elem, 2, "nextSibling" ); - }, - prev: function( elem ) { - return jQuery.nth( elem, 2, "previousSibling" ); - }, - nextAll: function( elem ) { - return jQuery.dir( elem, "nextSibling" ); - }, - prevAll: function( elem ) { - return jQuery.dir( elem, "previousSibling" ); - }, - nextUntil: function( elem, i, until ) { - return jQuery.dir( elem, "nextSibling", until ); - }, - prevUntil: function( elem, i, until ) { - return jQuery.dir( elem, "previousSibling", until ); - }, - siblings: function( elem ) { - return jQuery.sibling( elem.parentNode.firstChild, elem ); - }, - children: function( elem ) { - return jQuery.sibling( elem.firstChild ); - }, - contents: function( elem ) { - return jQuery.nodeName( elem, "iframe" ) ? - elem.contentDocument || elem.contentWindow.document : - jQuery.makeArray( elem.childNodes ); - } -}, function( name, fn ) { - jQuery.fn[ name ] = function( until, selector ) { - var ret = jQuery.map( this, fn, until ), - // The variable 'args' was introduced in - // https://github.com/jquery/jquery/commit/52a0238 - // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. - // http://code.google.com/p/v8/issues/detail?id=1050 - args = slice.call(arguments); - - if ( !runtil.test( name ) ) { - selector = until; - } - - if ( selector && typeof selector === "string" ) { - ret = jQuery.filter( selector, ret ); - } - - ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; - - if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { - ret = ret.reverse(); - } - - return this.pushStack( ret, name, args.join(",") ); - }; -}); - -jQuery.extend({ - filter: function( expr, elems, not ) { - if ( not ) { - expr = ":not(" + expr + ")"; - } - - return elems.length === 1 ? - jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : - jQuery.find.matches(expr, elems); - }, - - dir: function( elem, dir, until ) { - var matched = [], - cur = elem[ dir ]; - - while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { - if ( cur.nodeType === 1 ) { - matched.push( cur ); - } - cur = cur[dir]; - } - return matched; - }, - - nth: function( cur, result, dir, elem ) { - result = result || 1; - var num = 0; - - for ( ; cur; cur = cur[dir] ) { - if ( cur.nodeType === 1 && ++num === result ) { - break; - } - } - - return cur; - }, - - sibling: function( n, elem ) { - var r = []; - - for ( ; n; n = n.nextSibling ) { - if ( n.nodeType === 1 && n !== elem ) { - r.push( n ); - } - } - - return r; - } -}); - -// Implement the identical functionality for filter and not -function winnow( elements, qualifier, keep ) { - - // Can't pass null or undefined to indexOf in Firefox 4 - // Set to 0 to skip string check - qualifier = qualifier || 0; - - if ( jQuery.isFunction( qualifier ) ) { - return jQuery.grep(elements, function( elem, i ) { - var retVal = !!qualifier.call( elem, i, elem ); - return retVal === keep; - }); - - } else if ( qualifier.nodeType ) { - return jQuery.grep(elements, function( elem, i ) { - return (elem === qualifier) === keep; - }); - - } else if ( typeof qualifier === "string" ) { - var filtered = jQuery.grep(elements, function( elem ) { - return elem.nodeType === 1; - }); - - if ( isSimple.test( qualifier ) ) { - return jQuery.filter(qualifier, filtered, !keep); - } else { - qualifier = jQuery.filter( qualifier, filtered ); - } - } - - return jQuery.grep(elements, function( elem, i ) { - return (jQuery.inArray( elem, qualifier ) >= 0) === keep; - }); -} - - - - -var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, - rleadingWhitespace = /^\s+/, - rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, - rtagName = /<([\w:]+)/, - rtbody = /", "" ], - legend: [ 1, "
      ", "
      " ], - thead: [ 1, "", "
      " ], - tr: [ 2, "", "
      " ], - td: [ 3, "", "
      " ], - col: [ 2, "", "
      " ], - area: [ 1, "", "" ], - _default: [ 0, "", "" ] - }; - -wrapMap.optgroup = wrapMap.option; -wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; -wrapMap.th = wrapMap.td; - -// IE can't serialize and